summaryrefslogtreecommitdiff
path: root/tools
diff options
context:
space:
mode:
Diffstat (limited to 'tools')
-rw-r--r--tools/arch/arm64/include/asm/cputype.h6
-rw-r--r--tools/arch/arm64/include/uapi/asm/unistd.h1
-rw-r--r--tools/arch/loongarch/include/uapi/asm/unistd.h1
-rw-r--r--tools/arch/x86/include/asm/msr-index.h9
-rw-r--r--tools/arch/x86/include/uapi/asm/kvm.h22
-rw-r--r--tools/arch/x86/kcpuid/Makefile4
-rw-r--r--tools/bpf/bpftool/Documentation/bpftool-btf.rst6
-rw-r--r--tools/bpf/bpftool/Makefile3
-rw-r--r--tools/bpf/bpftool/bash-completion/bpftool3
-rw-r--r--tools/bpf/bpftool/btf.c193
-rw-r--r--tools/bpf/bpftool/cgroup.c40
-rw-r--r--tools/bpf/bpftool/common.c2
-rw-r--r--tools/bpf/bpftool/gen.c94
-rw-r--r--tools/bpf/bpftool/prog.c4
-rw-r--r--tools/bpf/bpftool/skeleton/pid_iter.bpf.c7
-rw-r--r--tools/bpf/bpftool/skeleton/profiler.bpf.c14
-rw-r--r--tools/bpf/resolve_btfids/main.c10
-rwxr-xr-xtools/gpio/gpio-sloppy-logic-analyzer.sh246
-rw-r--r--tools/hv/Makefile1
-rw-r--r--tools/include/nolibc/stdint.h19
-rw-r--r--tools/include/nolibc/stdio.h10
-rw-r--r--tools/include/nolibc/stdlib.h109
-rw-r--r--tools/include/uapi/asm-generic/unistd.h9
-rw-r--r--tools/include/uapi/drm/i915_drm.h31
-rw-r--r--tools/include/uapi/linux/bpf.h17
-rw-r--r--tools/include/uapi/linux/kvm.h4
-rw-r--r--tools/include/uapi/linux/netdev.h1
-rw-r--r--tools/include/uapi/linux/stat.h4
-rw-r--r--tools/lib/bpf/Build2
-rw-r--r--tools/lib/bpf/btf.c696
-rw-r--r--tools/lib/bpf/btf.h36
-rw-r--r--tools/lib/bpf/btf_iter.c177
-rw-r--r--tools/lib/bpf/btf_relocate.c519
-rw-r--r--tools/lib/bpf/features.c32
-rw-r--r--tools/lib/bpf/libbpf.c136
-rw-r--r--tools/lib/bpf/libbpf.h23
-rw-r--r--tools/lib/bpf/libbpf.map4
-rw-r--r--tools/lib/bpf/libbpf_internal.h39
-rw-r--r--tools/lib/bpf/linker.c69
-rw-r--r--tools/memory-model/Documentation/README4
-rw-r--r--tools/memory-model/Documentation/access-marking.txt34
-rw-r--r--tools/memory-model/lock.cat62
-rw-r--r--tools/net/ynl/Makefile6
-rw-r--r--tools/net/ynl/Makefile.deps4
-rw-r--r--tools/net/ynl/lib/Makefile4
-rw-r--r--tools/net/ynl/lib/ynl-priv.h30
-rw-r--r--tools/net/ynl/lib/ynl.c10
-rw-r--r--tools/net/ynl/lib/ynl.h2
-rw-r--r--tools/net/ynl/lib/ynl.py2
-rwxr-xr-xtools/net/ynl/ynl-gen-c.py58
-rwxr-xr-xtools/net/ynl/ynl-gen-rst.py13
-rw-r--r--tools/objtool/Documentation/objtool.txt19
-rw-r--r--tools/objtool/arch/x86/decode.c8
-rw-r--r--tools/objtool/arch/x86/special.c23
-rw-r--r--tools/objtool/builtin-check.c4
-rw-r--r--tools/objtool/noreturns.h4
-rw-r--r--tools/objtool/special.c16
-rw-r--r--tools/perf/Makefile.perf1
-rw-r--r--tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl1
-rw-r--r--tools/perf/arch/powerpc/entry/syscalls/syscall.tbl1
-rw-r--r--tools/perf/arch/s390/entry/syscalls/syscall.tbl1
-rw-r--r--tools/perf/arch/x86/entry/syscalls/syscall_64.tbl3
-rw-r--r--tools/perf/builtin-record.c6
-rw-r--r--tools/perf/builtin-trace.c2
-rw-r--r--tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h8
-rw-r--r--tools/perf/trace/beauty/include/linux/socket.h3
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/fcntl.h14
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/prctl.h22
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/stat.h4
-rw-r--r--tools/perf/util/comm.c29
-rw-r--r--tools/perf/util/dsos.c26
-rw-r--r--tools/power/cpupower/Makefile47
-rw-r--r--tools/power/cpupower/README160
-rw-r--r--tools/power/cpupower/bench/Makefile5
-rw-r--r--tools/power/cpupower/man/cpupower-monitor.113
-rw-r--r--tools/power/cpupower/utils/helpers/amd.c26
-rw-r--r--tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c2
-rwxr-xr-xtools/power/pm-graph/bootgraph.py16
-rwxr-xr-xtools/power/pm-graph/sleepgraph.py1098
-rw-r--r--tools/power/x86/intel-speed-select/isst-config.c2
-rw-r--r--tools/power/x86/intel-speed-select/isst-core.c6
-rw-r--r--tools/power/x86/turbostat/Makefile6
-rw-r--r--tools/power/x86/turbostat/turbostat.c20
-rwxr-xr-xtools/rcu/rcu-updaters.sh52
-rw-r--r--tools/testing/cxl/test/cxl.c4
-rw-r--r--tools/testing/cxl/test/mem.c1
-rw-r--r--tools/testing/selftests/Makefile1
-rw-r--r--tools/testing/selftests/alsa/Makefile2
-rw-r--r--tools/testing/selftests/arm64/abi/ptrace.c2
-rw-r--r--tools/testing/selftests/arm64/fp/.gitignore1
-rw-r--r--tools/testing/selftests/arm64/fp/Makefile1
-rw-r--r--tools/testing/selftests/arm64/fp/fp-stress.c26
-rw-r--r--tools/testing/selftests/arm64/fp/kernel-test.c324
-rw-r--r--tools/testing/selftests/arm64/tags/Makefile1
-rwxr-xr-xtools/testing/selftests/arm64/tags/run_tags_test.sh12
-rw-r--r--tools/testing/selftests/arm64/tags/tags_test.c10
-rw-r--r--tools/testing/selftests/bpf/DENYLIST.aarch641
-rw-r--r--tools/testing/selftests/bpf/DENYLIST.s390x4
-rw-r--r--tools/testing/selftests/bpf/Makefile2
-rw-r--r--tools/testing/selftests/bpf/bpf_arena_common.h2
-rw-r--r--tools/testing/selftests/bpf/bpf_experimental.h32
-rw-r--r--tools/testing/selftests/bpf/bpf_kfuncs.h2
-rw-r--r--tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c4
-rw-r--r--tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c77
-rw-r--r--tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h10
-rw-r--r--tools/testing/selftests/bpf/config17
-rw-r--r--tools/testing/selftests/bpf/network_helpers.c130
-rw-r--r--tools/testing/selftests/bpf/network_helpers.h24
-rw-r--r--tools/testing/selftests/bpf/prog_tests/arena_atomics.c18
-rw-r--r--tools/testing/selftests/bpf/prog_tests/bpf_cookie.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/bpf_nf.c7
-rw-r--r--tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c247
-rw-r--r--tools/testing/selftests/bpf/prog_tests/bpf_verif_scale.c6
-rw-r--r--tools/testing/selftests/bpf/prog_tests/btf_distill.c552
-rw-r--r--tools/testing/selftests/bpf/prog_tests/btf_field_iter.c161
-rw-r--r--tools/testing/selftests/bpf/prog_tests/cgroup_v1v2.c4
-rw-r--r--tools/testing/selftests/bpf/prog_tests/cpumask.c5
-rw-r--r--tools/testing/selftests/bpf/prog_tests/ctx_rewrite.c10
-rw-r--r--tools/testing/selftests/bpf/prog_tests/fexit_stress.c4
-rw-r--r--tools/testing/selftests/bpf/prog_tests/find_vma.c4
-rw-r--r--tools/testing/selftests/bpf/prog_tests/ip_check_defrag.c14
-rw-r--r--tools/testing/selftests/bpf/prog_tests/kfunc_call.c1
-rw-r--r--tools/testing/selftests/bpf/prog_tests/kfunc_param_nullable.c11
-rw-r--r--tools/testing/selftests/bpf/prog_tests/linked_list.c12
-rw-r--r--tools/testing/selftests/bpf/prog_tests/mptcp.c7
-rw-r--r--tools/testing/selftests/bpf/prog_tests/rbtree.c47
-rw-r--r--tools/testing/selftests/bpf/prog_tests/ringbuf.c56
-rw-r--r--tools/testing/selftests/bpf/prog_tests/send_signal.c3
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sk_lookup.c82
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockopt_inherit.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_links.c61
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_netkit.c94
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_redirect.c3
-rw-r--r--tools/testing/selftests/bpf/prog_tests/test_skb_pkt_end.c1
-rw-r--r--tools/testing/selftests/bpf/prog_tests/test_struct_ops_module.c57
-rw-r--r--tools/testing/selftests/bpf/prog_tests/timer_lockup.c91
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tracing_struct.c44
-rw-r--r--tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c134
-rw-r--r--tools/testing/selftests/bpf/prog_tests/verifier.c6
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c168
-rw-r--r--tools/testing/selftests/bpf/progs/arena_atomics.c143
-rw-r--r--tools/testing/selftests/bpf/progs/arena_htab.c17
-rw-r--r--tools/testing/selftests/bpf/progs/arena_list.c1
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_dctcp.c36
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_iter_bpf_array_map.c6
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_iter_bpf_percpu_array_map.c6
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_misc.h15
-rw-r--r--tools/testing/selftests/bpf/progs/cpumask_success.c171
-rw-r--r--tools/testing/selftests/bpf/progs/crypto_bench.c10
-rw-r--r--tools/testing/selftests/bpf/progs/crypto_sanity.c16
-rw-r--r--tools/testing/selftests/bpf/progs/dynptr_fail.c30
-rw-r--r--tools/testing/selftests/bpf/progs/get_func_ip_test.c7
-rw-r--r--tools/testing/selftests/bpf/progs/ip_check_defrag.c10
-rw-r--r--tools/testing/selftests/bpf/progs/iters.c2
-rw-r--r--tools/testing/selftests/bpf/progs/kfunc_call_test.c37
-rw-r--r--tools/testing/selftests/bpf/progs/kprobe_multi_session.c3
-rw-r--r--tools/testing/selftests/bpf/progs/kprobe_multi_session_cookie.c2
-rw-r--r--tools/testing/selftests/bpf/progs/linked_list.c47
-rw-r--r--tools/testing/selftests/bpf/progs/map_percpu_stats.c2
-rw-r--r--tools/testing/selftests/bpf/progs/nested_trust_common.h2
-rw-r--r--tools/testing/selftests/bpf/progs/nested_trust_failure.c8
-rw-r--r--tools/testing/selftests/bpf/progs/nested_trust_success.c8
-rw-r--r--tools/testing/selftests/bpf/progs/netif_receive_skb.c5
-rw-r--r--tools/testing/selftests/bpf/progs/profiler.inc.h5
-rw-r--r--tools/testing/selftests/bpf/progs/rbtree.c77
-rw-r--r--tools/testing/selftests/bpf/progs/rbtree_fail.c2
-rw-r--r--tools/testing/selftests/bpf/progs/refcounted_kptr_fail.c4
-rw-r--r--tools/testing/selftests/bpf/progs/setget_sockopt.c5
-rw-r--r--tools/testing/selftests/bpf/progs/skb_pkt_end.c11
-rw-r--r--tools/testing/selftests/bpf/progs/struct_ops_detach.c10
-rw-r--r--tools/testing/selftests/bpf/progs/test_bpf_ma.c4
-rw-r--r--tools/testing/selftests/bpf/progs/test_bpf_nf.c109
-rw-r--r--tools/testing/selftests/bpf/progs/test_bpf_nf_fail.c1
-rw-r--r--tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c43
-rw-r--r--tools/testing/selftests/bpf/progs/test_ringbuf_write.c46
-rw-r--r--tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_sockmap_kern.h20
-rw-r--r--tools/testing/selftests/bpf/progs/test_sysctl_loop1.c5
-rw-r--r--tools/testing/selftests/bpf/progs/test_sysctl_loop2.c5
-rw-r--r--tools/testing/selftests/bpf/progs/test_sysctl_prog.c5
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_dtime.c39
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_link.c35
-rw-r--r--tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.c1
-rw-r--r--tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.h2
-rw-r--r--tools/testing/selftests/bpf/progs/timer_lockup.c87
-rw-r--r--tools/testing/selftests/bpf/progs/tracing_struct.c54
-rw-r--r--tools/testing/selftests/bpf/progs/tracing_struct_many_args.c95
-rw-r--r--tools/testing/selftests/bpf/progs/uprobe_multi.c50
-rw-r--r--tools/testing/selftests/bpf/progs/user_ringbuf_fail.c22
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_arena.c1
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_arena_large.c1
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_bits_iter.c153
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c382
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_movsx.c63
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_netfilter_ctx.c6
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c41
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c187
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_subprog_precision.c2
-rw-r--r--tools/testing/selftests/bpf/progs/wq.c19
-rw-r--r--tools/testing/selftests/bpf/progs/wq_failures.c4
-rw-r--r--tools/testing/selftests/bpf/progs/xdp_flowtable.c148
-rw-r--r--tools/testing/selftests/bpf/progs/xdp_synproxy_kern.c1
-rw-r--r--tools/testing/selftests/bpf/progs/xfrm_info.c1
-rw-r--r--tools/testing/selftests/bpf/test_loader.c115
-rw-r--r--tools/testing/selftests/bpf/test_progs.h9
-rw-r--r--tools/testing/selftests/bpf/test_sockmap.c137
-rw-r--r--tools/testing/selftests/bpf/test_tcp_check_syncookie_user.c33
-rw-r--r--tools/testing/selftests/bpf/test_verifier.c5
-rw-r--r--tools/testing/selftests/bpf/trace_helpers.c13
-rw-r--r--tools/testing/selftests/bpf/verifier/calls.c15
-rw-r--r--tools/testing/selftests/bpf/verifier/precise.c22
-rw-r--r--tools/testing/selftests/bpf/xskxceiver.c40
-rw-r--r--tools/testing/selftests/bpf/xskxceiver.h2
-rw-r--r--tools/testing/selftests/breakpoints/step_after_suspend_test.c1
-rw-r--r--tools/testing/selftests/cachestat/test_cachestat.c1
-rw-r--r--tools/testing/selftests/cgroup/.gitignore11
-rw-r--r--tools/testing/selftests/cgroup/Makefile25
-rwxr-xr-xtools/testing/selftests/cgroup/test_cpuset_prs.sh75
-rw-r--r--tools/testing/selftests/cgroup/test_pids.c178
-rw-r--r--tools/testing/selftests/dma/dma_map_benchmark.c1
-rw-r--r--tools/testing/selftests/drivers/net/hw/Makefile1
-rwxr-xr-xtools/testing/selftests/drivers/net/hw/rss_ctx.py522
-rw-r--r--tools/testing/selftests/drivers/net/lib/py/env.py19
-rw-r--r--tools/testing/selftests/drivers/net/lib/py/load.py37
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/mirror_gre.sh71
-rw-r--r--tools/testing/selftests/drivers/net/mlxsw/mirror_gre_scale.sh18
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh55
-rw-r--r--tools/testing/selftests/drivers/net/virtio_net/config8
-rw-r--r--tools/testing/selftests/drivers/platform/x86/intel/ifs/Makefile6
-rwxr-xr-xtools/testing/selftests/drivers/platform/x86/intel/ifs/test_ifs.sh494
-rw-r--r--tools/testing/selftests/exec/Makefile19
-rw-r--r--tools/testing/selftests/exec/load_address.c67
-rw-r--r--tools/testing/selftests/fchmodat2/Makefile11
-rw-r--r--tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c1
-rw-r--r--tools/testing/selftests/filesystems/statmount/Makefile2
-rw-r--r--tools/testing/selftests/filesystems/statmount/statmount.h46
-rw-r--r--tools/testing/selftests/filesystems/statmount/statmount_test.c156
-rw-r--r--tools/testing/selftests/filesystems/statmount/statmount_test_ns.c364
-rw-r--r--tools/testing/selftests/ftrace/config26
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc2
-rw-r--r--tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc20
-rw-r--r--tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc3
-rw-r--r--tools/testing/selftests/futex/Makefile2
-rw-r--r--tools/testing/selftests/futex/functional/Makefile2
-rw-r--r--tools/testing/selftests/futex/functional/futex_requeue_pi.c2
-rw-r--r--tools/testing/selftests/hid/hid_bpf.c426
-rw-r--r--tools/testing/selftests/hid/progs/hid.c392
-rw-r--r--tools/testing/selftests/hid/progs/hid_bpf_helpers.h46
-rw-r--r--tools/testing/selftests/kselftest.h8
-rw-r--r--tools/testing/selftests/kselftest_harness.h43
-rw-r--r--tools/testing/selftests/kvm/Makefile1
-rw-r--r--tools/testing/selftests/kvm/include/x86_64/processor.h1
-rw-r--r--tools/testing/selftests/kvm/lib/riscv/ucall.c1
-rw-r--r--tools/testing/selftests/kvm/lib/x86_64/processor.c15
-rw-r--r--tools/testing/selftests/kvm/riscv/ebreak_test.c1
-rw-r--r--tools/testing/selftests/kvm/riscv/sbi_pmu_test.c1
-rw-r--r--tools/testing/selftests/kvm/s390x/shared_zeropage_test.c111
-rw-r--r--tools/testing/selftests/kvm/x86_64/sev_init2_tests.c4
-rw-r--r--tools/testing/selftests/landlock/fs_test.c45
-rw-r--r--tools/testing/selftests/lib.mk8
-rw-r--r--tools/testing/selftests/lkdtm/tests.txt1
-rw-r--r--tools/testing/selftests/mm/ksm_functional_tests.c38
-rw-r--r--tools/testing/selftests/mm/map_fixed_noreplace.c24
-rw-r--r--tools/testing/selftests/net/.gitignore1
-rw-r--r--tools/testing/selftests/net/Makefile3
-rw-r--r--tools/testing/selftests/net/af_unix/Makefile2
-rw-r--r--tools/testing/selftests/net/af_unix/config3
-rw-r--r--tools/testing/selftests/net/af_unix/msg_oob.c734
-rw-r--r--tools/testing/selftests/net/af_unix/scm_rights.c25
-rw-r--r--tools/testing/selftests/net/af_unix/test_unix_oob.c436
-rwxr-xr-xtools/testing/selftests/net/amt.sh2
-rw-r--r--tools/testing/selftests/net/config8
-rw-r--r--tools/testing/selftests/net/forwarding/Makefile2
-rw-r--r--tools/testing/selftests/net/forwarding/devlink_lib.sh2
-rw-r--r--tools/testing/selftests/net/forwarding/lib.sh92
-rwxr-xr-xtools/testing/selftests/net/forwarding/min_max_mtu.sh283
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre.sh45
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bound.sh23
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1d.sh21
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1d_vlan.sh21
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1q.sh21
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh29
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_changes.sh73
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_flower.sh43
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh65
-rw-r--r--tools/testing/selftests/net/forwarding/mirror_gre_lib.sh90
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_neigh.sh39
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_nh.sh35
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_vlan.sh21
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_vlan_bridge_1q.sh69
-rw-r--r--tools/testing/selftests/net/forwarding/mirror_lib.sh79
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_vlan.sh43
-rwxr-xr-xtools/testing/selftests/net/forwarding/router_mpath_seed.sh333
-rwxr-xr-xtools/testing/selftests/net/forwarding/vxlan_bridge_1d.sh8
-rw-r--r--tools/testing/selftests/net/hsr/config1
-rwxr-xr-xtools/testing/selftests/net/hsr/hsr_ping.sh11
-rwxr-xr-xtools/testing/selftests/net/hsr/hsr_redbox.sh15
-rw-r--r--tools/testing/selftests/net/lib.sh71
-rw-r--r--tools/testing/selftests/net/lib/py/ksft.py65
-rw-r--r--tools/testing/selftests/net/lib/py/utils.py61
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_join.sh15
-rw-r--r--tools/testing/selftests/net/mptcp/mptcp_lib.sh63
-rwxr-xr-xtools/testing/selftests/net/mptcp/simult_flows.sh6
-rwxr-xr-xtools/testing/selftests/net/mptcp/userspace_pm.sh46
-rw-r--r--tools/testing/selftests/net/msg_zerocopy.c14
-rwxr-xr-xtools/testing/selftests/net/netfilter/nft_queue.sh37
-rwxr-xr-xtools/testing/selftests/net/netns-sysctl.sh40
-rwxr-xr-xtools/testing/selftests/net/openvswitch/openvswitch.sh171
-rw-r--r--tools/testing/selftests/net/openvswitch/ovs-dpctl.py643
-rw-r--r--tools/testing/selftests/net/openvswitch/settings1
-rwxr-xr-xtools/testing/selftests/net/pmtu.sh145
-rwxr-xr-xtools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh335
-rwxr-xr-xtools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh340
-rw-r--r--tools/testing/selftests/net/tcp_ao/self-connect.c18
-rw-r--r--tools/testing/selftests/net/udpgso.c15
-rwxr-xr-xtools/testing/selftests/net/udpgso.sh43
-rwxr-xr-xtools/testing/selftests/net/vrf_route_leaking.sh93
-rw-r--r--tools/testing/selftests/net/ynl.mk21
-rw-r--r--tools/testing/selftests/nolibc/Makefile2
-rw-r--r--tools/testing/selftests/nolibc/nolibc-test.c109
-rwxr-xr-xtools/testing/selftests/nolibc/run-tests.sh9
-rw-r--r--tools/testing/selftests/openat2/Makefile14
-rw-r--r--tools/testing/selftests/openat2/openat2_test.c1
-rw-r--r--tools/testing/selftests/powerpc/flags.mk5
-rw-r--r--tools/testing/selftests/resctrl/cache.c10
-rw-r--r--tools/testing/selftests/resctrl/cat_test.c37
-rw-r--r--tools/testing/selftests/resctrl/cmt_test.c22
-rw-r--r--tools/testing/selftests/resctrl/mba_test.c26
-rw-r--r--tools/testing/selftests/resctrl/mbm_test.c26
-rw-r--r--tools/testing/selftests/resctrl/resctrl.h49
-rw-r--r--tools/testing/selftests/resctrl/resctrl_val.c371
-rw-r--r--tools/testing/selftests/resctrl/resctrlfs.c67
-rw-r--r--tools/testing/selftests/riscv/sigreturn/sigreturn.c2
-rw-r--r--tools/testing/selftests/sched/cs_prctl_test.c10
-rw-r--r--tools/testing/selftests/seccomp/seccomp_benchmark.c6
-rw-r--r--tools/testing/selftests/seccomp/seccomp_bpf.c131
-rw-r--r--tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json44
-rw-r--r--tools/testing/selftests/timens/exec.c6
-rw-r--r--tools/testing/selftests/timens/timer.c2
-rw-r--r--tools/testing/selftests/timens/timerfd.c2
-rw-r--r--tools/testing/selftests/timens/vfork_exec.c4
-rw-r--r--tools/testing/selftests/timers/rtcpie.c3
-rw-r--r--tools/testing/selftests/vDSO/Makefile29
-rw-r--r--tools/testing/selftests/vDSO/parse_vdso.c16
-rw-r--r--tools/testing/selftests/vDSO/vdso_standalone_test_x86.c18
-rw-r--r--tools/testing/selftests/wireguard/qemu/Makefile8
-rw-r--r--tools/testing/selftests/x86/Makefile31
-rw-r--r--tools/testing/selftests/x86/amx.c16
-rw-r--r--tools/testing/selftests/x86/clang_helpers_32.S11
-rw-r--r--tools/testing/selftests/x86/clang_helpers_64.S28
-rw-r--r--tools/testing/selftests/x86/fsgsbase.c6
-rw-r--r--tools/testing/selftests/x86/fsgsbase_restore.c11
-rw-r--r--tools/testing/selftests/x86/sigreturn.c2
-rw-r--r--tools/testing/selftests/x86/syscall_arg_fault.c1
-rw-r--r--tools/testing/selftests/x86/sysret_rip.c20
-rw-r--r--tools/testing/selftests/x86/test_FISTTP.c8
-rw-r--r--tools/testing/selftests/x86/test_vsyscall.c15
-rw-r--r--tools/testing/selftests/x86/vdso_restorer.c2
-rw-r--r--tools/testing/vsock/Makefile13
361 files changed, 15715 insertions, 3622 deletions
diff --git a/tools/arch/arm64/include/asm/cputype.h b/tools/arch/arm64/include/asm/cputype.h
index 52f076afeb96..7b32b99023a2 100644
--- a/tools/arch/arm64/include/asm/cputype.h
+++ b/tools/arch/arm64/include/asm/cputype.h
@@ -86,6 +86,9 @@
#define ARM_CPU_PART_CORTEX_X2 0xD48
#define ARM_CPU_PART_NEOVERSE_N2 0xD49
#define ARM_CPU_PART_CORTEX_A78C 0xD4B
+#define ARM_CPU_PART_NEOVERSE_V2 0xD4F
+#define ARM_CPU_PART_CORTEX_X4 0xD82
+#define ARM_CPU_PART_NEOVERSE_V3 0xD84
#define APM_CPU_PART_XGENE 0x000
#define APM_CPU_VAR_POTENZA 0x00
@@ -159,6 +162,9 @@
#define MIDR_CORTEX_X2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X2)
#define MIDR_NEOVERSE_N2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_N2)
#define MIDR_CORTEX_A78C MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_A78C)
+#define MIDR_NEOVERSE_V2 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V2)
+#define MIDR_CORTEX_X4 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_CORTEX_X4)
+#define MIDR_NEOVERSE_V3 MIDR_CPU_MODEL(ARM_CPU_IMP_ARM, ARM_CPU_PART_NEOVERSE_V3)
#define MIDR_THUNDERX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX)
#define MIDR_THUNDERX_81XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_81XX)
#define MIDR_THUNDERX_83XX MIDR_CPU_MODEL(ARM_CPU_IMP_CAVIUM, CAVIUM_CPU_PART_THUNDERX_83XX)
diff --git a/tools/arch/arm64/include/uapi/asm/unistd.h b/tools/arch/arm64/include/uapi/asm/unistd.h
index ce2ee8f1e361..9306726337fe 100644
--- a/tools/arch/arm64/include/uapi/asm/unistd.h
+++ b/tools/arch/arm64/include/uapi/asm/unistd.h
@@ -19,7 +19,6 @@
#define __ARCH_WANT_NEW_STAT
#define __ARCH_WANT_SET_GET_RLIMIT
#define __ARCH_WANT_TIME32_SYSCALLS
-#define __ARCH_WANT_SYS_CLONE3
#define __ARCH_WANT_MEMFD_SECRET
#include <asm-generic/unistd.h>
diff --git a/tools/arch/loongarch/include/uapi/asm/unistd.h b/tools/arch/loongarch/include/uapi/asm/unistd.h
index 0c743344e92d..8eeaac0087c3 100644
--- a/tools/arch/loongarch/include/uapi/asm/unistd.h
+++ b/tools/arch/loongarch/include/uapi/asm/unistd.h
@@ -4,6 +4,5 @@
*/
#define __ARCH_WANT_SYS_CLONE
-#define __ARCH_WANT_SYS_CLONE3
#include <asm-generic/unistd.h>
diff --git a/tools/arch/x86/include/asm/msr-index.h b/tools/arch/x86/include/asm/msr-index.h
index e72c2b872957..e022e6eb766c 100644
--- a/tools/arch/x86/include/asm/msr-index.h
+++ b/tools/arch/x86/include/asm/msr-index.h
@@ -170,6 +170,10 @@
* CPU is not affected by Branch
* History Injection.
*/
+#define ARCH_CAP_XAPIC_DISABLE BIT(21) /*
+ * IA32_XAPIC_DISABLE_STATUS MSR
+ * supported
+ */
#define ARCH_CAP_PBRSB_NO BIT(24) /*
* Not susceptible to Post-Barrier
* Return Stack Buffer Predictions.
@@ -192,11 +196,6 @@
* File.
*/
-#define ARCH_CAP_XAPIC_DISABLE BIT(21) /*
- * IA32_XAPIC_DISABLE_STATUS MSR
- * supported
- */
-
#define MSR_IA32_FLUSH_CMD 0x0000010b
#define L1D_FLUSH BIT(0) /*
* Writeback and invalidate the
diff --git a/tools/arch/x86/include/uapi/asm/kvm.h b/tools/arch/x86/include/uapi/asm/kvm.h
index ef11aa4cab42..9fae1b73b529 100644
--- a/tools/arch/x86/include/uapi/asm/kvm.h
+++ b/tools/arch/x86/include/uapi/asm/kvm.h
@@ -457,8 +457,13 @@ struct kvm_sync_regs {
#define KVM_STATE_VMX_PREEMPTION_TIMER_DEADLINE 0x00000001
-/* attributes for system fd (group 0) */
-#define KVM_X86_XCOMP_GUEST_SUPP 0
+/* vendor-independent attributes for system fd (group 0) */
+#define KVM_X86_GRP_SYSTEM 0
+# define KVM_X86_XCOMP_GUEST_SUPP 0
+
+/* vendor-specific groups and attributes for system fd */
+#define KVM_X86_GRP_SEV 1
+# define KVM_X86_SEV_VMSA_FEATURES 0
struct kvm_vmx_nested_state_data {
__u8 vmcs12[KVM_STATE_NESTED_VMX_VMCS_SIZE];
@@ -689,6 +694,9 @@ enum sev_cmd_id {
/* Guest Migration Extension */
KVM_SEV_SEND_CANCEL,
+ /* Second time is the charm; improved versions of the above ioctls. */
+ KVM_SEV_INIT2,
+
KVM_SEV_NR_MAX,
};
@@ -700,6 +708,14 @@ struct kvm_sev_cmd {
__u32 sev_fd;
};
+struct kvm_sev_init {
+ __u64 vmsa_features;
+ __u32 flags;
+ __u16 ghcb_version;
+ __u16 pad1;
+ __u32 pad2[8];
+};
+
struct kvm_sev_launch_start {
__u32 handle;
__u32 policy;
@@ -856,5 +872,7 @@ struct kvm_hyperv_eventfd {
#define KVM_X86_DEFAULT_VM 0
#define KVM_X86_SW_PROTECTED_VM 1
+#define KVM_X86_SEV_VM 2
+#define KVM_X86_SEV_ES_VM 3
#endif /* _ASM_X86_KVM_H */
diff --git a/tools/arch/x86/kcpuid/Makefile b/tools/arch/x86/kcpuid/Makefile
index 87b554fab14b..d0b4b0ed10ff 100644
--- a/tools/arch/x86/kcpuid/Makefile
+++ b/tools/arch/x86/kcpuid/Makefile
@@ -19,6 +19,6 @@ clean :
@rm -f kcpuid
install : kcpuid
- install -d $(DESTDIR)$(BINDIR)
+ install -d $(DESTDIR)$(BINDIR) $(DESTDIR)$(HWDATADIR)
install -m 755 -p kcpuid $(DESTDIR)$(BINDIR)/kcpuid
- install -m 444 -p cpuid.csv $(HWDATADIR)/cpuid.csv
+ install -m 444 -p cpuid.csv $(DESTDIR)$(HWDATADIR)/cpuid.csv
diff --git a/tools/bpf/bpftool/Documentation/bpftool-btf.rst b/tools/bpf/bpftool/Documentation/bpftool-btf.rst
index eaba24320fb2..3f6bca03ad2e 100644
--- a/tools/bpf/bpftool/Documentation/bpftool-btf.rst
+++ b/tools/bpf/bpftool/Documentation/bpftool-btf.rst
@@ -28,7 +28,7 @@ BTF COMMANDS
| **bpftool** **btf help**
|
| *BTF_SRC* := { **id** *BTF_ID* | **prog** *PROG* | **map** *MAP* [{**key** | **value** | **kv** | **all**}] | **file** *FILE* }
-| *FORMAT* := { **raw** | **c** }
+| *FORMAT* := { **raw** | **c** [**unsorted**] }
| *MAP* := { **id** *MAP_ID* | **pinned** *FILE* }
| *PROG* := { **id** *PROG_ID* | **pinned** *FILE* | **tag** *PROG_TAG* | **name** *PROG_NAME* }
@@ -63,7 +63,9 @@ bpftool btf dump *BTF_SRC*
pahole.
**format** option can be used to override default (raw) output format. Raw
- (**raw**) or C-syntax (**c**) output formats are supported.
+ (**raw**) or C-syntax (**c**) output formats are supported. With C-style
+ formatting, the output is sorted by default. Use the **unsorted** option
+ to avoid sorting the output.
bpftool btf help
Print short help message.
diff --git a/tools/bpf/bpftool/Makefile b/tools/bpf/bpftool/Makefile
index dfa4f1bebbb3..ba927379eb20 100644
--- a/tools/bpf/bpftool/Makefile
+++ b/tools/bpf/bpftool/Makefile
@@ -204,10 +204,11 @@ ifeq ($(feature-clang-bpf-co-re),1)
BUILD_BPF_SKELS := 1
-$(OUTPUT)vmlinux.h: $(VMLINUX_BTF) $(BPFTOOL_BOOTSTRAP)
ifeq ($(VMLINUX_H),)
+$(OUTPUT)vmlinux.h: $(VMLINUX_BTF) $(BPFTOOL_BOOTSTRAP)
$(QUIET_GEN)$(BPFTOOL_BOOTSTRAP) btf dump file $< format c > $@
else
+$(OUTPUT)vmlinux.h: $(VMLINUX_H)
$(Q)cp "$(VMLINUX_H)" $@
endif
diff --git a/tools/bpf/bpftool/bash-completion/bpftool b/tools/bpf/bpftool/bash-completion/bpftool
index 04afe2ac2228..be99d49b8714 100644
--- a/tools/bpf/bpftool/bash-completion/bpftool
+++ b/tools/bpf/bpftool/bash-completion/bpftool
@@ -930,6 +930,9 @@ _bpftool()
format)
COMPREPLY=( $( compgen -W "c raw" -- "$cur" ) )
;;
+ c)
+ COMPREPLY=( $( compgen -W "unsorted" -- "$cur" ) )
+ ;;
*)
# emit extra options
case ${words[3]} in
diff --git a/tools/bpf/bpftool/btf.c b/tools/bpf/bpftool/btf.c
index 91fcb75babe3..6789c7a4d5ca 100644
--- a/tools/bpf/bpftool/btf.c
+++ b/tools/bpf/bpftool/btf.c
@@ -20,6 +20,8 @@
#include "json_writer.h"
#include "main.h"
+#define KFUNC_DECL_TAG "bpf_kfunc"
+
static const char * const btf_kind_str[NR_BTF_KINDS] = {
[BTF_KIND_UNKN] = "UNKNOWN",
[BTF_KIND_INT] = "INT",
@@ -43,6 +45,13 @@ static const char * const btf_kind_str[NR_BTF_KINDS] = {
[BTF_KIND_ENUM64] = "ENUM64",
};
+struct sort_datum {
+ int index;
+ int type_rank;
+ const char *sort_name;
+ const char *own_name;
+};
+
static const char *btf_int_enc_str(__u8 encoding)
{
switch (encoding) {
@@ -454,15 +463,171 @@ static int dump_btf_raw(const struct btf *btf,
return 0;
}
+static int dump_btf_kfuncs(struct btf_dump *d, const struct btf *btf)
+{
+ LIBBPF_OPTS(btf_dump_emit_type_decl_opts, opts);
+ int cnt = btf__type_cnt(btf);
+ int i;
+
+ printf("\n/* BPF kfuncs */\n");
+ printf("#ifndef BPF_NO_KFUNC_PROTOTYPES\n");
+
+ for (i = 1; i < cnt; i++) {
+ const struct btf_type *t = btf__type_by_id(btf, i);
+ const char *name;
+ int err;
+
+ if (!btf_is_decl_tag(t))
+ continue;
+
+ if (btf_decl_tag(t)->component_idx != -1)
+ continue;
+
+ name = btf__name_by_offset(btf, t->name_off);
+ if (strncmp(name, KFUNC_DECL_TAG, sizeof(KFUNC_DECL_TAG)))
+ continue;
+
+ t = btf__type_by_id(btf, t->type);
+ if (!btf_is_func(t))
+ continue;
+
+ printf("extern ");
+
+ opts.field_name = btf__name_by_offset(btf, t->name_off);
+ err = btf_dump__emit_type_decl(d, t->type, &opts);
+ if (err)
+ return err;
+
+ printf(" __weak __ksym;\n");
+ }
+
+ printf("#endif\n\n");
+
+ return 0;
+}
+
static void __printf(2, 0) btf_dump_printf(void *ctx,
const char *fmt, va_list args)
{
vfprintf(stdout, fmt, args);
}
+static int btf_type_rank(const struct btf *btf, __u32 index, bool has_name)
+{
+ const struct btf_type *t = btf__type_by_id(btf, index);
+ const int kind = btf_kind(t);
+ const int max_rank = 10;
+
+ if (t->name_off)
+ has_name = true;
+
+ switch (kind) {
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64:
+ return has_name ? 1 : 0;
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ return 2;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ return has_name ? 3 : max_rank;
+ case BTF_KIND_FUNC_PROTO:
+ return has_name ? 4 : max_rank;
+ case BTF_KIND_ARRAY:
+ if (has_name)
+ return btf_type_rank(btf, btf_array(t)->type, has_name);
+ return max_rank;
+ case BTF_KIND_TYPE_TAG:
+ case BTF_KIND_CONST:
+ case BTF_KIND_PTR:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_DECL_TAG:
+ if (has_name)
+ return btf_type_rank(btf, t->type, has_name);
+ return max_rank;
+ default:
+ return max_rank;
+ }
+}
+
+static const char *btf_type_sort_name(const struct btf *btf, __u32 index, bool from_ref)
+{
+ const struct btf_type *t = btf__type_by_id(btf, index);
+
+ switch (btf_kind(t)) {
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64: {
+ int name_off = t->name_off;
+
+ /* Use name of the first element for anonymous enums if allowed */
+ if (!from_ref && !t->name_off && btf_vlen(t))
+ name_off = btf_enum(t)->name_off;
+
+ return btf__name_by_offset(btf, name_off);
+ }
+ case BTF_KIND_ARRAY:
+ return btf_type_sort_name(btf, btf_array(t)->type, true);
+ case BTF_KIND_TYPE_TAG:
+ case BTF_KIND_CONST:
+ case BTF_KIND_PTR:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_DECL_TAG:
+ return btf_type_sort_name(btf, t->type, true);
+ default:
+ return btf__name_by_offset(btf, t->name_off);
+ }
+ return NULL;
+}
+
+static int btf_type_compare(const void *left, const void *right)
+{
+ const struct sort_datum *d1 = (const struct sort_datum *)left;
+ const struct sort_datum *d2 = (const struct sort_datum *)right;
+ int r;
+
+ if (d1->type_rank != d2->type_rank)
+ return d1->type_rank < d2->type_rank ? -1 : 1;
+
+ r = strcmp(d1->sort_name, d2->sort_name);
+ if (r)
+ return r;
+
+ return strcmp(d1->own_name, d2->own_name);
+}
+
+static struct sort_datum *sort_btf_c(const struct btf *btf)
+{
+ struct sort_datum *datums;
+ int n;
+
+ n = btf__type_cnt(btf);
+ datums = malloc(sizeof(struct sort_datum) * n);
+ if (!datums)
+ return NULL;
+
+ for (int i = 0; i < n; ++i) {
+ struct sort_datum *d = datums + i;
+ const struct btf_type *t = btf__type_by_id(btf, i);
+
+ d->index = i;
+ d->type_rank = btf_type_rank(btf, i, false);
+ d->sort_name = btf_type_sort_name(btf, i, false);
+ d->own_name = btf__name_by_offset(btf, t->name_off);
+ }
+
+ qsort(datums, n, sizeof(struct sort_datum), btf_type_compare);
+
+ return datums;
+}
+
static int dump_btf_c(const struct btf *btf,
- __u32 *root_type_ids, int root_type_cnt)
+ __u32 *root_type_ids, int root_type_cnt, bool sort_dump)
{
+ struct sort_datum *datums = NULL;
struct btf_dump *d;
int err = 0, i;
@@ -476,6 +641,12 @@ static int dump_btf_c(const struct btf *btf,
printf("#ifndef BPF_NO_PRESERVE_ACCESS_INDEX\n");
printf("#pragma clang attribute push (__attribute__((preserve_access_index)), apply_to = record)\n");
printf("#endif\n\n");
+ printf("#ifndef __ksym\n");
+ printf("#define __ksym __attribute__((section(\".ksyms\")))\n");
+ printf("#endif\n\n");
+ printf("#ifndef __weak\n");
+ printf("#define __weak __attribute__((weak))\n");
+ printf("#endif\n\n");
if (root_type_cnt) {
for (i = 0; i < root_type_cnt; i++) {
@@ -486,11 +657,19 @@ static int dump_btf_c(const struct btf *btf,
} else {
int cnt = btf__type_cnt(btf);
+ if (sort_dump)
+ datums = sort_btf_c(btf);
for (i = 1; i < cnt; i++) {
- err = btf_dump__dump_type(d, i);
+ int idx = datums ? datums[i].index : i;
+
+ err = btf_dump__dump_type(d, idx);
if (err)
goto done;
}
+
+ err = dump_btf_kfuncs(d, btf);
+ if (err)
+ goto done;
}
printf("#ifndef BPF_NO_PRESERVE_ACCESS_INDEX\n");
@@ -500,6 +679,7 @@ static int dump_btf_c(const struct btf *btf,
printf("#endif /* __VMLINUX_H__ */\n");
done:
+ free(datums);
btf_dump__free(d);
return err;
}
@@ -549,10 +729,10 @@ static bool btf_is_kernel_module(__u32 btf_id)
static int do_dump(int argc, char **argv)
{
+ bool dump_c = false, sort_dump_c = true;
struct btf *btf = NULL, *base = NULL;
__u32 root_type_ids[2];
int root_type_cnt = 0;
- bool dump_c = false;
__u32 btf_id = -1;
const char *src;
int fd = -1;
@@ -663,6 +843,9 @@ static int do_dump(int argc, char **argv)
goto done;
}
NEXT_ARG();
+ } else if (is_prefix(*argv, "unsorted")) {
+ sort_dump_c = false;
+ NEXT_ARG();
} else {
p_err("unrecognized option: '%s'", *argv);
err = -EINVAL;
@@ -691,7 +874,7 @@ static int do_dump(int argc, char **argv)
err = -ENOTSUP;
goto done;
}
- err = dump_btf_c(btf, root_type_ids, root_type_cnt);
+ err = dump_btf_c(btf, root_type_ids, root_type_cnt, sort_dump_c);
} else {
err = dump_btf_raw(btf, root_type_ids, root_type_cnt);
}
@@ -1063,7 +1246,7 @@ static int do_help(int argc, char **argv)
" %1$s %2$s help\n"
"\n"
" BTF_SRC := { id BTF_ID | prog PROG | map MAP [{key | value | kv | all}] | file FILE }\n"
- " FORMAT := { raw | c }\n"
+ " FORMAT := { raw | c [unsorted] }\n"
" " HELP_SPEC_MAP "\n"
" " HELP_SPEC_PROGRAM "\n"
" " HELP_SPEC_OPTIONS " |\n"
diff --git a/tools/bpf/bpftool/cgroup.c b/tools/bpf/bpftool/cgroup.c
index af6898c0f388..9af426d43299 100644
--- a/tools/bpf/bpftool/cgroup.c
+++ b/tools/bpf/bpftool/cgroup.c
@@ -19,6 +19,38 @@
#include "main.h"
+static const int cgroup_attach_types[] = {
+ BPF_CGROUP_INET_INGRESS,
+ BPF_CGROUP_INET_EGRESS,
+ BPF_CGROUP_INET_SOCK_CREATE,
+ BPF_CGROUP_INET_SOCK_RELEASE,
+ BPF_CGROUP_INET4_BIND,
+ BPF_CGROUP_INET6_BIND,
+ BPF_CGROUP_INET4_POST_BIND,
+ BPF_CGROUP_INET6_POST_BIND,
+ BPF_CGROUP_INET4_CONNECT,
+ BPF_CGROUP_INET6_CONNECT,
+ BPF_CGROUP_UNIX_CONNECT,
+ BPF_CGROUP_INET4_GETPEERNAME,
+ BPF_CGROUP_INET6_GETPEERNAME,
+ BPF_CGROUP_UNIX_GETPEERNAME,
+ BPF_CGROUP_INET4_GETSOCKNAME,
+ BPF_CGROUP_INET6_GETSOCKNAME,
+ BPF_CGROUP_UNIX_GETSOCKNAME,
+ BPF_CGROUP_UDP4_SENDMSG,
+ BPF_CGROUP_UDP6_SENDMSG,
+ BPF_CGROUP_UNIX_SENDMSG,
+ BPF_CGROUP_UDP4_RECVMSG,
+ BPF_CGROUP_UDP6_RECVMSG,
+ BPF_CGROUP_UNIX_RECVMSG,
+ BPF_CGROUP_SOCK_OPS,
+ BPF_CGROUP_DEVICE,
+ BPF_CGROUP_SYSCTL,
+ BPF_CGROUP_GETSOCKOPT,
+ BPF_CGROUP_SETSOCKOPT,
+ BPF_LSM_CGROUP
+};
+
#define HELP_SPEC_ATTACH_FLAGS \
"ATTACH_FLAGS := { multi | override }"
@@ -183,13 +215,13 @@ static int count_attached_bpf_progs(int cgroup_fd, enum bpf_attach_type type)
static int cgroup_has_attached_progs(int cgroup_fd)
{
- enum bpf_attach_type type;
+ unsigned int i = 0;
bool no_prog = true;
- for (type = 0; type < __MAX_BPF_ATTACH_TYPE; type++) {
- int count = count_attached_bpf_progs(cgroup_fd, type);
+ for (i = 0; i < ARRAY_SIZE(cgroup_attach_types); i++) {
+ int count = count_attached_bpf_progs(cgroup_fd, cgroup_attach_types[i]);
- if (count < 0 && errno != EINVAL)
+ if (count < 0)
return -1;
if (count > 0) {
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index 958e92acca8e..9b75639434b8 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -410,7 +410,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
{
const char *prog_name = prog_info->name;
const struct btf_type *func_type;
- const struct bpf_func_info finfo = {};
+ struct bpf_func_info finfo = {};
struct bpf_prog_info info = {};
__u32 info_len = sizeof(info);
struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/gen.c b/tools/bpf/bpftool/gen.c
index b3979ddc0189..5a4d3240689e 100644
--- a/tools/bpf/bpftool/gen.c
+++ b/tools/bpf/bpftool/gen.c
@@ -848,28 +848,45 @@ out:
}
static void
-codegen_maps_skeleton(struct bpf_object *obj, size_t map_cnt, bool mmaped)
+codegen_maps_skeleton(struct bpf_object *obj, size_t map_cnt, bool mmaped, bool populate_links)
{
struct bpf_map *map;
char ident[256];
- size_t i;
+ size_t i, map_sz;
if (!map_cnt)
return;
+ /* for backward compatibility with old libbpf versions that don't
+ * handle new BPF skeleton with new struct bpf_map_skeleton definition
+ * that includes link field, avoid specifying new increased size,
+ * unless we absolutely have to (i.e., if there are struct_ops maps
+ * present)
+ */
+ map_sz = offsetof(struct bpf_map_skeleton, link);
+ if (populate_links) {
+ bpf_object__for_each_map(map, obj) {
+ if (bpf_map__type(map) == BPF_MAP_TYPE_STRUCT_OPS) {
+ map_sz = sizeof(struct bpf_map_skeleton);
+ break;
+ }
+ }
+ }
+
codegen("\
\n\
- \n\
+ \n\
/* maps */ \n\
s->map_cnt = %zu; \n\
- s->map_skel_sz = sizeof(*s->maps); \n\
- s->maps = (struct bpf_map_skeleton *)calloc(s->map_cnt, s->map_skel_sz);\n\
+ s->map_skel_sz = %zu; \n\
+ s->maps = (struct bpf_map_skeleton *)calloc(s->map_cnt,\n\
+ sizeof(*s->maps) > %zu ? sizeof(*s->maps) : %zu);\n\
if (!s->maps) { \n\
err = -ENOMEM; \n\
goto err; \n\
} \n\
",
- map_cnt
+ map_cnt, map_sz, map_sz, map_sz
);
i = 0;
bpf_object__for_each_map(map, obj) {
@@ -878,15 +895,22 @@ codegen_maps_skeleton(struct bpf_object *obj, size_t map_cnt, bool mmaped)
codegen("\
\n\
- \n\
- s->maps[%zu].name = \"%s\"; \n\
- s->maps[%zu].map = &obj->maps.%s; \n\
+ \n\
+ map = (struct bpf_map_skeleton *)((char *)s->maps + %zu * s->map_skel_sz);\n\
+ map->name = \"%s\"; \n\
+ map->map = &obj->maps.%s; \n\
",
- i, bpf_map__name(map), i, ident);
+ i, bpf_map__name(map), ident);
/* memory-mapped internal maps */
if (mmaped && is_mmapable_map(map, ident, sizeof(ident))) {
- printf("\ts->maps[%zu].mmaped = (void **)&obj->%s;\n",
- i, ident);
+ printf("\tmap->mmaped = (void **)&obj->%s;\n", ident);
+ }
+
+ if (populate_links && bpf_map__type(map) == BPF_MAP_TYPE_STRUCT_OPS) {
+ codegen("\
+ \n\
+ map->link = &obj->links.%s; \n\
+ ", ident);
}
i++;
}
@@ -1141,7 +1165,7 @@ static void gen_st_ops_shadow_init(struct btf *btf, struct bpf_object *obj)
static int do_skeleton(int argc, char **argv)
{
char header_guard[MAX_OBJ_NAME_LEN + sizeof("__SKEL_H__")];
- size_t map_cnt = 0, prog_cnt = 0, file_sz, mmap_sz;
+ size_t map_cnt = 0, prog_cnt = 0, attach_map_cnt = 0, file_sz, mmap_sz;
DECLARE_LIBBPF_OPTS(bpf_object_open_opts, opts);
char obj_name[MAX_OBJ_NAME_LEN] = "", *obj_data;
struct bpf_object *obj = NULL;
@@ -1225,6 +1249,10 @@ static int do_skeleton(int argc, char **argv)
bpf_map__name(map));
continue;
}
+
+ if (bpf_map__type(map) == BPF_MAP_TYPE_STRUCT_OPS)
+ attach_map_cnt++;
+
map_cnt++;
}
bpf_object__for_each_program(prog, obj) {
@@ -1260,6 +1288,8 @@ static int do_skeleton(int argc, char **argv)
#include <stdlib.h> \n\
#include <bpf/libbpf.h> \n\
\n\
+ #define BPF_SKEL_SUPPORTS_MAP_AUTO_ATTACH 1 \n\
+ \n\
struct %1$s { \n\
struct bpf_object_skeleton *skeleton; \n\
struct bpf_object *obj; \n\
@@ -1297,6 +1327,9 @@ static int do_skeleton(int argc, char **argv)
bpf_program__name(prog));
}
printf("\t} progs;\n");
+ }
+
+ if (prog_cnt + attach_map_cnt) {
printf("\tstruct {\n");
bpf_object__for_each_program(prog, obj) {
if (use_loader)
@@ -1306,6 +1339,19 @@ static int do_skeleton(int argc, char **argv)
printf("\t\tstruct bpf_link *%s;\n",
bpf_program__name(prog));
}
+
+ bpf_object__for_each_map(map, obj) {
+ if (!get_map_ident(map, ident, sizeof(ident)))
+ continue;
+ if (bpf_map__type(map) != BPF_MAP_TYPE_STRUCT_OPS)
+ continue;
+
+ if (use_loader)
+ printf("t\tint %s_fd;\n", ident);
+ else
+ printf("\t\tstruct bpf_link *%s;\n", ident);
+ }
+
printf("\t} links;\n");
}
@@ -1433,6 +1479,7 @@ static int do_skeleton(int argc, char **argv)
%1$s__create_skeleton(struct %1$s *obj) \n\
{ \n\
struct bpf_object_skeleton *s; \n\
+ struct bpf_map_skeleton *map __attribute__((unused));\n\
int err; \n\
\n\
s = (struct bpf_object_skeleton *)calloc(1, sizeof(*s));\n\
@@ -1448,7 +1495,7 @@ static int do_skeleton(int argc, char **argv)
obj_name
);
- codegen_maps_skeleton(obj, map_cnt, true /*mmaped*/);
+ codegen_maps_skeleton(obj, map_cnt, true /*mmaped*/, true /*links*/);
codegen_progs_skeleton(obj, prog_cnt, true /*populate_links*/);
codegen("\
@@ -1723,6 +1770,7 @@ static int do_subskeleton(int argc, char **argv)
{ \n\
struct %1$s *obj; \n\
struct bpf_object_subskeleton *s; \n\
+ struct bpf_map_skeleton *map __attribute__((unused));\n\
int err; \n\
\n\
obj = (struct %1$s *)calloc(1, sizeof(*obj)); \n\
@@ -1786,7 +1834,7 @@ static int do_subskeleton(int argc, char **argv)
}
}
- codegen_maps_skeleton(obj, map_cnt, false /*mmaped*/);
+ codegen_maps_skeleton(obj, map_cnt, false /*mmaped*/, false /*links*/);
codegen_progs_skeleton(obj, prog_cnt, false /*links*/);
codegen("\
@@ -2379,15 +2427,6 @@ out:
return err;
}
-static int btfgen_remap_id(__u32 *type_id, void *ctx)
-{
- unsigned int *ids = ctx;
-
- *type_id = ids[*type_id];
-
- return 0;
-}
-
/* Generate BTF from relocation information previously recorded */
static struct btf *btfgen_get_btf(struct btfgen_info *info)
{
@@ -2467,10 +2506,15 @@ static struct btf *btfgen_get_btf(struct btfgen_info *info)
/* second pass: fix up type ids */
for (i = 1; i < btf__type_cnt(btf_new); i++) {
struct btf_type *btf_type = (struct btf_type *) btf__type_by_id(btf_new, i);
+ struct btf_field_iter it;
+ __u32 *type_id;
- err = btf_type_visit_type_ids(btf_type, btfgen_remap_id, ids);
+ err = btf_field_iter_init(&it, btf_type, BTF_FIELD_ITER_IDS);
if (err)
goto err_out;
+
+ while ((type_id = btf_field_iter_next(&it)))
+ *type_id = ids[*type_id];
}
free(ids);
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 1a501cf09e78..40ea743d139f 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1813,6 +1813,10 @@ offload_dev:
}
if (pinmaps) {
+ err = create_and_mount_bpffs_dir(pinmaps);
+ if (err)
+ goto err_unpin;
+
err = bpf_object__pin_maps(obj, pinmaps);
if (err) {
p_err("failed to pin all maps");
diff --git a/tools/bpf/bpftool/skeleton/pid_iter.bpf.c b/tools/bpf/bpftool/skeleton/pid_iter.bpf.c
index 7bdbcac3cf62..948dde25034e 100644
--- a/tools/bpf/bpftool/skeleton/pid_iter.bpf.c
+++ b/tools/bpf/bpftool/skeleton/pid_iter.bpf.c
@@ -29,6 +29,7 @@ enum bpf_link_type___local {
};
extern const void bpf_link_fops __ksym;
+extern const void bpf_link_fops_poll __ksym __weak;
extern const void bpf_map_fops __ksym;
extern const void bpf_prog_fops __ksym;
extern const void btf_fops __ksym;
@@ -84,7 +85,11 @@ int iter(struct bpf_iter__task_file *ctx)
fops = &btf_fops;
break;
case BPF_OBJ_LINK:
- fops = &bpf_link_fops;
+ if (&bpf_link_fops_poll &&
+ file->f_op == &bpf_link_fops_poll)
+ fops = &bpf_link_fops_poll;
+ else
+ fops = &bpf_link_fops;
break;
default:
return 0;
diff --git a/tools/bpf/bpftool/skeleton/profiler.bpf.c b/tools/bpf/bpftool/skeleton/profiler.bpf.c
index 2f80edc682f1..f48c783cb9f7 100644
--- a/tools/bpf/bpftool/skeleton/profiler.bpf.c
+++ b/tools/bpf/bpftool/skeleton/profiler.bpf.c
@@ -40,17 +40,17 @@ struct {
const volatile __u32 num_cpu = 1;
const volatile __u32 num_metric = 1;
-#define MAX_NUM_MATRICS 4
+#define MAX_NUM_METRICS 4
SEC("fentry/XXX")
int BPF_PROG(fentry_XXX)
{
- struct bpf_perf_event_value___local *ptrs[MAX_NUM_MATRICS];
+ struct bpf_perf_event_value___local *ptrs[MAX_NUM_METRICS];
u32 key = bpf_get_smp_processor_id();
u32 i;
/* look up before reading, to reduce error */
- for (i = 0; i < num_metric && i < MAX_NUM_MATRICS; i++) {
+ for (i = 0; i < num_metric && i < MAX_NUM_METRICS; i++) {
u32 flag = i;
ptrs[i] = bpf_map_lookup_elem(&fentry_readings, &flag);
@@ -58,7 +58,7 @@ int BPF_PROG(fentry_XXX)
return 0;
}
- for (i = 0; i < num_metric && i < MAX_NUM_MATRICS; i++) {
+ for (i = 0; i < num_metric && i < MAX_NUM_METRICS; i++) {
struct bpf_perf_event_value___local reading;
int err;
@@ -99,14 +99,14 @@ fexit_update_maps(u32 id, struct bpf_perf_event_value___local *after)
SEC("fexit/XXX")
int BPF_PROG(fexit_XXX)
{
- struct bpf_perf_event_value___local readings[MAX_NUM_MATRICS];
+ struct bpf_perf_event_value___local readings[MAX_NUM_METRICS];
u32 cpu = bpf_get_smp_processor_id();
u32 i, zero = 0;
int err;
u64 *count;
/* read all events before updating the maps, to reduce error */
- for (i = 0; i < num_metric && i < MAX_NUM_MATRICS; i++) {
+ for (i = 0; i < num_metric && i < MAX_NUM_METRICS; i++) {
err = bpf_perf_event_read_value(&events, cpu + i * num_cpu,
(void *)(readings + i),
sizeof(*readings));
@@ -116,7 +116,7 @@ int BPF_PROG(fexit_XXX)
count = bpf_map_lookup_elem(&counts, &zero);
if (count) {
*count += 1;
- for (i = 0; i < num_metric && i < MAX_NUM_MATRICS; i++)
+ for (i = 0; i < num_metric && i < MAX_NUM_METRICS; i++)
fexit_update_maps(i, &readings[i]);
}
return 0;
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index d9520cb826b3..936ef95c3d32 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -409,6 +409,14 @@ static int elf_collect(struct object *obj)
obj->efile.idlist = data;
obj->efile.idlist_shndx = idx;
obj->efile.idlist_addr = sh.sh_addr;
+ } else if (!strcmp(name, BTF_BASE_ELF_SEC)) {
+ /* If a .BTF.base section is found, do not resolve
+ * BTF ids relative to vmlinux; resolve relative
+ * to the .BTF.base section instead. btf__parse_split()
+ * will take care of this once the base BTF it is
+ * passed is NULL.
+ */
+ obj->base_btf_path = NULL;
}
if (compressed_section_fix(elf, scn, &sh))
@@ -728,7 +736,7 @@ static int sets_patch(struct object *obj)
static int symbols_patch(struct object *obj)
{
- int err;
+ off_t err;
if (__symbols_patch(obj, &obj->structs) ||
__symbols_patch(obj, &obj->unions) ||
diff --git a/tools/gpio/gpio-sloppy-logic-analyzer.sh b/tools/gpio/gpio-sloppy-logic-analyzer.sh
new file mode 100755
index 000000000000..ed21a110df5e
--- /dev/null
+++ b/tools/gpio/gpio-sloppy-logic-analyzer.sh
@@ -0,0 +1,246 @@
+#!/bin/sh -eu
+# SPDX-License-Identifier: GPL-2.0
+#
+# Helper script for the Linux Kernel GPIO sloppy logic analyzer
+#
+# Copyright (C) Wolfram Sang <wsa@sang-engineering.com>
+# Copyright (C) Renesas Electronics Corporation
+
+samplefreq=1000000
+numsamples=250000
+cpusetdefaultdir='/sys/fs/cgroup'
+cpusetprefix='cpuset.'
+debugdir='/sys/kernel/debug'
+ladirname='gpio-sloppy-logic-analyzer'
+outputdir="$PWD"
+neededcmds='taskset zip'
+max_chans=8
+duration=
+initcpu=
+listinstances=0
+lainstance=
+lasysfsdir=
+triggerdat=
+trigger_bindat=
+progname="${0##*/}"
+print_help()
+{
+ cat << EOF
+$progname - helper script for the Linux Kernel Sloppy GPIO Logic Analyzer
+Available options:
+ -c|--cpu <n>: which CPU to isolate for sampling. Only needed once. Default <1>.
+ Remember that a more powerful CPU gives you higher sampling speeds.
+ Also CPU0 is not recommended as it usually does extra bookkeeping.
+ -d|--duration-us <SI-n>: number of microseconds to sample. Overrides -n, no default value.
+ -h|--help: print this help
+ -i|--instance <str>: name of the logic analyzer in case you have multiple instances. Default
+ to first instance found
+ -k|--kernel-debug-dir <str>: path to the kernel debugfs mountpoint. Default: <$debugdir>
+ -l|--list-instances: list all available instances
+ -n|--num_samples <SI-n>: number of samples to acquire. Default <$numsamples>
+ -o|--output-dir <str>: directory to put the result files. Default: current dir
+ -s|--sample_freq <SI-n>: desired sampling frequency. Might be capped if too large.
+ Default: <1000000>
+ -t|--trigger <str>: pattern to use as trigger. <str> consists of two-char pairs. First
+ char is channel number starting at "1". Second char is trigger level:
+ "L" - low; "H" - high; "R" - rising; "F" - falling
+ These pairs can be combined with "+", so "1H+2F" triggers when probe 1
+ is high while probe 2 has a falling edge. You can have multiple triggers
+ combined with ",". So, "1H+2F,1H+2R" is like the example before but it
+ waits for a rising edge on probe 2 while probe 1 is still high after the
+ first trigger has been met.
+ Trigger data will only be used for the next capture and then be erased.
+
+<SI-n> is an integer value where SI units "T", "G", "M", "K" are recognized, e.g. '1M500K' is 1500000.
+
+Examples:
+Samples $numsamples values at 1MHz with an already prepared CPU or automatically prepares CPU1 if needed,
+use the first logic analyzer instance found:
+ '$progname'
+Samples 50us at 2MHz waiting for a falling edge on channel 2. CPU and instance as above:
+ '$progname -d 50 -s 2M -t "2F"'
+
+Note that the process exits after checking all parameters but a sub-process still works in
+the background. The result is only available once the sub-process finishes.
+
+Result is a .sr file to be consumed with PulseView from the free Sigrok project. It is
+a zip file which also contains the binary sample data which may be consumed by others.
+The filename is the logic analyzer instance name plus a since-epoch timestamp.
+EOF
+}
+
+fail()
+{
+ echo "$1"
+ exit 1
+}
+
+parse_si()
+{
+ conv_si="$(printf $1 | sed 's/[tT]+\?/*1000G+/g; s/[gG]+\?/*1000M+/g; s/[mM]+\?/*1000K+/g; s/[kK]+\?/*1000+/g; s/+$//')"
+ si_val="$((conv_si))"
+}
+set_newmask()
+{
+ for f in $(find "$1" -iname "$2"); do echo "$newmask" > "$f" 2>/dev/null || true; done
+}
+
+init_cpu()
+{
+ isol_cpu="$1"
+
+ [ -d "$lacpusetdir" ] || mkdir "$lacpusetdir"
+
+ cur_cpu=$(cat "${lacpusetfile}cpus")
+ [ "$cur_cpu" = "$isol_cpu" ] && return
+ [ -z "$cur_cpu" ] || fail "CPU$isol_cpu requested but CPU$cur_cpu already isolated"
+
+ echo "$isol_cpu" > "${lacpusetfile}cpus" || fail "Could not isolate CPU$isol_cpu. Does it exist?"
+ echo 1 > "${lacpusetfile}cpu_exclusive"
+ echo 0 > "${lacpusetfile}mems"
+
+ oldmask=$(cat /proc/irq/default_smp_affinity)
+ newmask=$(printf "%x" $((0x$oldmask & ~(1 << isol_cpu))))
+
+ set_newmask '/proc/irq' '*smp_affinity'
+ set_newmask '/sys/devices/virtual/workqueue/' 'cpumask'
+
+ # Move tasks away from isolated CPU
+ for p in $(ps -o pid | tail -n +2); do
+ mask=$(taskset -p "$p") || continue
+ # Ignore tasks with a custom mask, i.e. not equal $oldmask
+ [ "${mask##*: }" = "$oldmask" ] || continue
+ taskset -p "$newmask" "$p" || continue
+ done 2>/dev/null >/dev/null
+
+ # Big hammer! Working with 'rcu_momentary_dyntick_idle()' for a more fine-grained solution
+ # still printed warnings. Same for re-enabling the stall detector after sampling.
+ echo 1 > /sys/module/rcupdate/parameters/rcu_cpu_stall_suppress
+
+ cpufreqgov="/sys/devices/system/cpu/cpu$isol_cpu/cpufreq/scaling_governor"
+ [ -w "$cpufreqgov" ] && echo 'performance' > "$cpufreqgov" || true
+}
+
+parse_triggerdat()
+{
+ oldifs="$IFS"
+ IFS=','; for trig in $1; do
+ mask=0; val1=0; val2=0
+ IFS='+'; for elem in $trig; do
+ chan=${elem%[lhfrLHFR]}
+ mode=${elem#$chan}
+ # Check if we could parse something and the channel number fits
+ [ "$chan" != "$elem" ] && [ "$chan" -le $max_chans ] || fail "Trigger syntax error: $elem"
+ bit=$((1 << (chan - 1)))
+ mask=$((mask | bit))
+ case $mode in
+ [hH]) val1=$((val1 | bit)); val2=$((val2 | bit));;
+ [fF]) val1=$((val1 | bit));;
+ [rR]) val2=$((val2 | bit));;
+ esac
+ done
+ trigger_bindat="$trigger_bindat$(printf '\\%o\\%o' $mask $val1)"
+ [ $val1 -ne $val2 ] && trigger_bindat="$trigger_bindat$(printf '\\%o\\%o' $mask $val2)"
+ done
+ IFS="$oldifs"
+}
+
+do_capture()
+{
+ taskset "$1" echo 1 > "$lasysfsdir"/capture || fail "Capture error! Check kernel log"
+
+ srtmp=$(mktemp -d)
+ echo 1 > "$srtmp"/version
+ cp "$lasysfsdir"/sample_data "$srtmp"/logic-1-1
+ cat > "$srtmp"/metadata << EOF
+[global]
+sigrok version=0.2.0
+
+[device 1]
+capturefile=logic-1
+total probes=$(wc -l < "$lasysfsdir"/meta_data)
+samplerate=${samplefreq}Hz
+unitsize=1
+EOF
+ cat "$lasysfsdir"/meta_data >> "$srtmp"/metadata
+
+ zipname="$outputdir/${lasysfsdir##*/}-$(date +%s).sr"
+ zip -jq "$zipname" "$srtmp"/*
+ rm -rf "$srtmp"
+ delay_ack=$(cat "$lasysfsdir"/delay_ns_acquisition)
+ [ "$delay_ack" -eq 0 ] && delay_ack=1
+ echo "Logic analyzer done. Saved '$zipname'"
+ echo "Max sample frequency this time: $((1000000000 / delay_ack))Hz."
+}
+
+rep=$(getopt -a -l cpu:,duration-us:,help,instance:,list-instances,kernel-debug-dir:,num_samples:,output-dir:,sample_freq:,trigger: -o c:d:hi:k:ln:o:s:t: -- "$@") || exit 1
+eval set -- "$rep"
+while true; do
+ case "$1" in
+ -c|--cpu) initcpu="$2"; shift;;
+ -d|--duration-us) parse_si $2; duration=$si_val; shift;;
+ -h|--help) print_help; exit 0;;
+ -i|--instance) lainstance="$2"; shift;;
+ -k|--kernel-debug-dir) debugdir="$2"; shift;;
+ -l|--list-instances) listinstances=1;;
+ -n|--num_samples) parse_si $2; numsamples=$si_val; shift;;
+ -o|--output-dir) outputdir="$2"; shift;;
+ -s|--sample_freq) parse_si $2; samplefreq=$si_val; shift;;
+ -t|--trigger) triggerdat="$2"; shift;;
+ --) break;;
+ *) fail "error parsing command line: $*";;
+ esac
+ shift
+done
+
+for f in $neededcmds; do
+ command -v "$f" >/dev/null || fail "Command '$f' not found"
+done
+
+# print cpuset mountpoint if any, errorcode > 0 if noprefix option was found
+cpusetdir=$(awk '$3 == "cgroup" && $4 ~ /cpuset/ { print $2; exit (match($4, /noprefix/) > 0) }' /proc/self/mounts) || cpusetprefix=''
+if [ -z "$cpusetdir" ]; then
+ cpusetdir="$cpusetdefaultdir"
+ [ -d $cpusetdir ] || mkdir $cpusetdir
+ mount -t cgroup -o cpuset none $cpusetdir || fail "Couldn't mount cpusets. Not in kernel or already in use?"
+fi
+
+lacpusetdir="$cpusetdir/$ladirname"
+lacpusetfile="$lacpusetdir/$cpusetprefix"
+sysfsdir="$debugdir/$ladirname"
+
+[ "$samplefreq" -ne 0 ] || fail "Invalid sample frequency"
+
+[ -d "$sysfsdir" ] || fail "Could not find logic analyzer root dir '$sysfsdir'. Module loaded?"
+[ -x "$sysfsdir" ] || fail "Could not access logic analyzer root dir '$sysfsdir'. Need root?"
+
+[ $listinstances -gt 0 ] && find "$sysfsdir" -mindepth 1 -type d | sed 's|.*/||' && exit 0
+
+if [ -n "$lainstance" ]; then
+ lasysfsdir="$sysfsdir/$lainstance"
+else
+ lasysfsdir=$(find "$sysfsdir" -mindepth 1 -type d -print -quit)
+fi
+[ -d "$lasysfsdir" ] || fail "Logic analyzer directory '$lasysfsdir' not found!"
+[ -d "$outputdir" ] || fail "Output directory '$outputdir' not found!"
+
+[ -n "$initcpu" ] && init_cpu "$initcpu"
+[ -d "$lacpusetdir" ] || { echo "Auto-Isolating CPU1"; init_cpu 1; }
+
+ndelay=$((1000000000 / samplefreq))
+echo "$ndelay" > "$lasysfsdir"/delay_ns
+
+[ -n "$duration" ] && numsamples=$((samplefreq * duration / 1000000))
+echo $numsamples > "$lasysfsdir"/buf_size
+
+if [ -n "$triggerdat" ]; then
+ parse_triggerdat "$triggerdat"
+ printf "$trigger_bindat" > "$lasysfsdir"/trigger 2>/dev/null || fail "Trigger data '$triggerdat' rejected"
+fi
+
+workcpu=$(cat "${lacpusetfile}effective_cpus")
+[ -n "$workcpu" ] || fail "No isolated CPU found"
+cpumask=$(printf '%x' $((1 << workcpu)))
+instance=${lasysfsdir##*/}
+echo "Setting up '$instance': $numsamples samples at ${samplefreq}Hz with ${triggerdat:-no} trigger using CPU$workcpu"
+do_capture "$cpumask" &
diff --git a/tools/hv/Makefile b/tools/hv/Makefile
index bb52871da341..2e60e2c212cd 100644
--- a/tools/hv/Makefile
+++ b/tools/hv/Makefile
@@ -17,6 +17,7 @@ endif
MAKEFLAGS += -r
override CFLAGS += -O2 -Wall -g -D_GNU_SOURCE -I$(OUTPUT)include
+override CFLAGS += -Wno-address-of-packed-member
ALL_TARGETS := hv_kvp_daemon hv_vss_daemon
ifneq ($(ARCH), aarch64)
diff --git a/tools/include/nolibc/stdint.h b/tools/include/nolibc/stdint.h
index 6665e272e213..cd79ddd6170e 100644
--- a/tools/include/nolibc/stdint.h
+++ b/tools/include/nolibc/stdint.h
@@ -96,6 +96,10 @@ typedef uint64_t uintmax_t;
#define UINT_FAST32_MAX SIZE_MAX
#define UINT_FAST64_MAX UINT64_MAX
+#define INTMAX_MIN INT64_MIN
+#define INTMAX_MAX INT64_MAX
+#define UINTMAX_MAX UINT64_MAX
+
#ifndef INT_MIN
#define INT_MIN (-__INT_MAX__ - 1)
#endif
@@ -110,4 +114,19 @@ typedef uint64_t uintmax_t;
#define LONG_MAX __LONG_MAX__
#endif
+#ifndef ULONG_MAX
+#define ULONG_MAX ((unsigned long)(__LONG_MAX__) * 2 + 1)
+#endif
+
+#ifndef LLONG_MIN
+#define LLONG_MIN (-__LONG_LONG_MAX__ - 1)
+#endif
+#ifndef LLONG_MAX
+#define LLONG_MAX __LONG_LONG_MAX__
+#endif
+
+#ifndef ULLONG_MAX
+#define ULLONG_MAX ((unsigned long long)(__LONG_LONG_MAX__) * 2 + 1)
+#endif
+
#endif /* _NOLIBC_STDINT_H */
diff --git a/tools/include/nolibc/stdio.h b/tools/include/nolibc/stdio.h
index 16cd4d807251..c968dbbc4ef8 100644
--- a/tools/include/nolibc/stdio.h
+++ b/tools/include/nolibc/stdio.h
@@ -376,6 +376,16 @@ int setvbuf(FILE *stream __attribute__((unused)),
return 0;
}
+static __attribute__((unused))
+const char *strerror(int errno)
+{
+ static char buf[18] = "errno=";
+
+ i64toa_r(errno, &buf[6]);
+
+ return buf;
+}
+
/* make sure to include all global symbols */
#include "nolibc.h"
diff --git a/tools/include/nolibc/stdlib.h b/tools/include/nolibc/stdlib.h
index 5be9d3c7435a..75aa273c23a6 100644
--- a/tools/include/nolibc/stdlib.h
+++ b/tools/include/nolibc/stdlib.h
@@ -438,6 +438,115 @@ char *u64toa(uint64_t in)
return itoa_buffer;
}
+static __attribute__((unused))
+uintmax_t __strtox(const char *nptr, char **endptr, int base, intmax_t lower_limit, uintmax_t upper_limit)
+{
+ const char signed_ = lower_limit != 0;
+ unsigned char neg = 0, overflow = 0;
+ uintmax_t val = 0, limit, old_val;
+ char c;
+
+ if (base < 0 || base > 36) {
+ SET_ERRNO(EINVAL);
+ goto out;
+ }
+
+ while (isspace(*nptr))
+ nptr++;
+
+ if (*nptr == '+') {
+ nptr++;
+ } else if (*nptr == '-') {
+ neg = 1;
+ nptr++;
+ }
+
+ if (signed_ && neg)
+ limit = -(uintmax_t)lower_limit;
+ else
+ limit = upper_limit;
+
+ if ((base == 0 || base == 16) &&
+ (strncmp(nptr, "0x", 2) == 0 || strncmp(nptr, "0X", 2) == 0)) {
+ base = 16;
+ nptr += 2;
+ } else if (base == 0 && strncmp(nptr, "0", 1) == 0) {
+ base = 8;
+ nptr += 1;
+ } else if (base == 0) {
+ base = 10;
+ }
+
+ while (*nptr) {
+ c = *nptr;
+
+ if (c >= '0' && c <= '9')
+ c -= '0';
+ else if (c >= 'a' && c <= 'z')
+ c = c - 'a' + 10;
+ else if (c >= 'A' && c <= 'Z')
+ c = c - 'A' + 10;
+ else
+ goto out;
+
+ if (c >= base)
+ goto out;
+
+ nptr++;
+ old_val = val;
+ val *= base;
+ val += c;
+
+ if (val > limit || val < old_val)
+ overflow = 1;
+ }
+
+out:
+ if (overflow) {
+ SET_ERRNO(ERANGE);
+ val = limit;
+ }
+ if (endptr)
+ *endptr = (char *)nptr;
+ return neg ? -val : val;
+}
+
+static __attribute__((unused))
+long strtol(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, LONG_MIN, LONG_MAX);
+}
+
+static __attribute__((unused))
+unsigned long strtoul(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, 0, ULONG_MAX);
+}
+
+static __attribute__((unused))
+long long strtoll(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, LLONG_MIN, LLONG_MAX);
+}
+
+static __attribute__((unused))
+unsigned long long strtoull(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, 0, ULLONG_MAX);
+}
+
+static __attribute__((unused))
+intmax_t strtoimax(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, INTMAX_MIN, INTMAX_MAX);
+}
+
+static __attribute__((unused))
+uintmax_t strtoumax(const char *nptr, char **endptr, int base)
+{
+ return __strtox(nptr, endptr, base, 0, UINTMAX_MAX);
+}
+
/* make sure to include all global symbols */
#include "nolibc.h"
diff --git a/tools/include/uapi/asm-generic/unistd.h b/tools/include/uapi/asm-generic/unistd.h
index 75f00965ab15..a00d53d02723 100644
--- a/tools/include/uapi/asm-generic/unistd.h
+++ b/tools/include/uapi/asm-generic/unistd.h
@@ -776,12 +776,8 @@ __SYSCALL(__NR_fsmount, sys_fsmount)
__SYSCALL(__NR_fspick, sys_fspick)
#define __NR_pidfd_open 434
__SYSCALL(__NR_pidfd_open, sys_pidfd_open)
-
-#ifdef __ARCH_WANT_SYS_CLONE3
#define __NR_clone3 435
__SYSCALL(__NR_clone3, sys_clone3)
-#endif
-
#define __NR_close_range 436
__SYSCALL(__NR_close_range, sys_close_range)
#define __NR_openat2 437
@@ -842,8 +838,11 @@ __SYSCALL(__NR_lsm_set_self_attr, sys_lsm_set_self_attr)
#define __NR_lsm_list_modules 461
__SYSCALL(__NR_lsm_list_modules, sys_lsm_list_modules)
+#define __NR_mseal 462
+__SYSCALL(__NR_mseal, sys_mseal)
+
#undef __NR_syscalls
-#define __NR_syscalls 462
+#define __NR_syscalls 463
/*
* 32 bit systems traditionally used different
diff --git a/tools/include/uapi/drm/i915_drm.h b/tools/include/uapi/drm/i915_drm.h
index 2ee338860b7e..d4d86e566e07 100644
--- a/tools/include/uapi/drm/i915_drm.h
+++ b/tools/include/uapi/drm/i915_drm.h
@@ -806,6 +806,12 @@ typedef struct drm_i915_irq_wait {
*/
#define I915_PARAM_PXP_STATUS 58
+/*
+ * Query if kernel allows marking a context to send a Freq hint to SLPC. This
+ * will enable use of the strategies allowed by the SLPC algorithm.
+ */
+#define I915_PARAM_HAS_CONTEXT_FREQ_HINT 59
+
/* Must be kept compact -- no holes and well documented */
/**
@@ -2148,6 +2154,15 @@ struct drm_i915_gem_context_param {
* -EIO: The firmware did not succeed in creating the protected context.
*/
#define I915_CONTEXT_PARAM_PROTECTED_CONTENT 0xd
+
+/*
+ * I915_CONTEXT_PARAM_LOW_LATENCY:
+ *
+ * Mark this context as a low latency workload which requires aggressive GT
+ * frequency scaling. Use I915_PARAM_HAS_CONTEXT_FREQ_HINT to check if the kernel
+ * supports this per context flag.
+ */
+#define I915_CONTEXT_PARAM_LOW_LATENCY 0xe
/* Must be kept compact -- no holes and well documented */
/** @value: Context parameter value to be set or queried */
@@ -2623,19 +2638,29 @@ struct drm_i915_reg_read {
*
*/
+/*
+ * struct drm_i915_reset_stats - Return global reset and other context stats
+ *
+ * Driver keeps few stats for each contexts and also global reset count.
+ * This struct can be used to query those stats.
+ */
struct drm_i915_reset_stats {
+ /** @ctx_id: ID of the requested context */
__u32 ctx_id;
+
+ /** @flags: MBZ */
__u32 flags;
- /* All resets since boot/module reload, for all contexts */
+ /** @reset_count: All resets since boot/module reload, for all contexts */
__u32 reset_count;
- /* Number of batches lost when active in GPU, for this context */
+ /** @batch_active: Number of batches lost when active in GPU, for this context */
__u32 batch_active;
- /* Number of batches lost pending for execution, for this context */
+ /** @batch_pending: Number of batches lost pending for execution, for this context */
__u32 batch_pending;
+ /** @pad: MBZ */
__u32 pad;
};
diff --git a/tools/include/uapi/linux/bpf.h b/tools/include/uapi/linux/bpf.h
index 90706a47f6ff..35bcf52dbc65 100644
--- a/tools/include/uapi/linux/bpf.h
+++ b/tools/include/uapi/linux/bpf.h
@@ -1425,6 +1425,8 @@ enum {
#define BPF_F_TEST_RUN_ON_CPU (1U << 0)
/* If set, XDP frames will be transmitted after processing */
#define BPF_F_TEST_XDP_LIVE_FRAMES (1U << 1)
+/* If set, apply CHECKSUM_COMPLETE to skb and validate the checksum */
+#define BPF_F_TEST_SKB_CHECKSUM_COMPLETE (1U << 2)
/* type for BPF_ENABLE_STATS */
enum bpf_stats_type {
@@ -6207,12 +6209,17 @@ union { \
__u64 :64; \
} __attribute__((aligned(8)))
+/* The enum used in skb->tstamp_type. It specifies the clock type
+ * of the time stored in the skb->tstamp.
+ */
enum {
- BPF_SKB_TSTAMP_UNSPEC,
- BPF_SKB_TSTAMP_DELIVERY_MONO, /* tstamp has mono delivery time */
- /* For any BPF_SKB_TSTAMP_* that the bpf prog cannot handle,
- * the bpf prog should handle it like BPF_SKB_TSTAMP_UNSPEC
- * and try to deduce it by ingress, egress or skb->sk->sk_clockid.
+ BPF_SKB_TSTAMP_UNSPEC = 0, /* DEPRECATED */
+ BPF_SKB_TSTAMP_DELIVERY_MONO = 1, /* DEPRECATED */
+ BPF_SKB_CLOCK_REALTIME = 0,
+ BPF_SKB_CLOCK_MONOTONIC = 1,
+ BPF_SKB_CLOCK_TAI = 2,
+ /* For any future BPF_SKB_CLOCK_* that the bpf prog cannot handle,
+ * the bpf prog can try to deduce it by ingress/egress/skb->sk->sk_clockid.
*/
};
diff --git a/tools/include/uapi/linux/kvm.h b/tools/include/uapi/linux/kvm.h
index ea32b101b999..d03842abae57 100644
--- a/tools/include/uapi/linux/kvm.h
+++ b/tools/include/uapi/linux/kvm.h
@@ -1221,9 +1221,9 @@ struct kvm_vfio_spapr_tce {
/* Available with KVM_CAP_SPAPR_RESIZE_HPT */
#define KVM_PPC_RESIZE_HPT_PREPARE _IOR(KVMIO, 0xad, struct kvm_ppc_resize_hpt)
#define KVM_PPC_RESIZE_HPT_COMMIT _IOR(KVMIO, 0xae, struct kvm_ppc_resize_hpt)
-/* Available with KVM_CAP_PPC_RADIX_MMU or KVM_CAP_PPC_MMU_HASH_V3 */
+/* Available with KVM_CAP_PPC_MMU_RADIX or KVM_CAP_PPC_MMU_HASH_V3 */
#define KVM_PPC_CONFIGURE_V3_MMU _IOW(KVMIO, 0xaf, struct kvm_ppc_mmuv3_cfg)
-/* Available with KVM_CAP_PPC_RADIX_MMU */
+/* Available with KVM_CAP_PPC_MMU_RADIX */
#define KVM_PPC_GET_RMMU_INFO _IOW(KVMIO, 0xb0, struct kvm_ppc_rmmu_info)
/* Available with KVM_CAP_PPC_GET_CPU_CHAR */
#define KVM_PPC_GET_CPU_CHAR _IOR(KVMIO, 0xb1, struct kvm_ppc_cpu_char)
diff --git a/tools/include/uapi/linux/netdev.h b/tools/include/uapi/linux/netdev.h
index a8188202413e..43742ac5b00d 100644
--- a/tools/include/uapi/linux/netdev.h
+++ b/tools/include/uapi/linux/netdev.h
@@ -148,6 +148,7 @@ enum {
NETDEV_A_QSTATS_RX_ALLOC_FAIL,
NETDEV_A_QSTATS_RX_HW_DROPS,
NETDEV_A_QSTATS_RX_HW_DROP_OVERRUNS,
+ NETDEV_A_QSTATS_RX_CSUM_COMPLETE,
NETDEV_A_QSTATS_RX_CSUM_UNNECESSARY,
NETDEV_A_QSTATS_RX_CSUM_NONE,
NETDEV_A_QSTATS_RX_CSUM_BAD,
diff --git a/tools/include/uapi/linux/stat.h b/tools/include/uapi/linux/stat.h
index 2f2ee82d5517..67626d535316 100644
--- a/tools/include/uapi/linux/stat.h
+++ b/tools/include/uapi/linux/stat.h
@@ -126,8 +126,9 @@ struct statx {
__u64 stx_mnt_id;
__u32 stx_dio_mem_align; /* Memory buffer alignment for direct I/O */
__u32 stx_dio_offset_align; /* File offset alignment for direct I/O */
+ __u64 stx_subvol; /* Subvolume identifier */
/* 0xa0 */
- __u64 __spare3[12]; /* Spare space for future expansion */
+ __u64 __spare3[11]; /* Spare space for future expansion */
/* 0x100 */
};
@@ -155,6 +156,7 @@ struct statx {
#define STATX_MNT_ID 0x00001000U /* Got stx_mnt_id */
#define STATX_DIOALIGN 0x00002000U /* Want/got direct I/O alignment info */
#define STATX_MNT_ID_UNIQUE 0x00004000U /* Want/got extended stx_mount_id */
+#define STATX_SUBVOL 0x00008000U /* Want/got stx_subvol */
#define STATX__RESERVED 0x80000000U /* Reserved for future struct statx expansion */
diff --git a/tools/lib/bpf/Build b/tools/lib/bpf/Build
index b6619199a706..e2cd558ca0b4 100644
--- a/tools/lib/bpf/Build
+++ b/tools/lib/bpf/Build
@@ -1,4 +1,4 @@
libbpf-y := libbpf.o bpf.o nlattr.o btf.o libbpf_errno.o str_error.o \
netlink.o bpf_prog_linfo.o libbpf_probes.o hashmap.o \
btf_dump.o ringbuf.o strset.o linker.o gen_loader.o relo_core.o \
- usdt.o zip.o elf.o features.o
+ usdt.o zip.o elf.o features.o btf_iter.o btf_relocate.o
diff --git a/tools/lib/bpf/btf.c b/tools/lib/bpf/btf.c
index 2d0840ef599a..32c00db3b91b 100644
--- a/tools/lib/bpf/btf.c
+++ b/tools/lib/bpf/btf.c
@@ -116,6 +116,9 @@ struct btf {
/* whether strings are already deduplicated */
bool strs_deduped;
+ /* whether base_btf should be freed in btf_free for this instance */
+ bool owns_base;
+
/* BTF object FD, if loaded into kernel */
int fd;
@@ -598,7 +601,7 @@ static int btf_sanity_check(const struct btf *btf)
__u32 i, n = btf__type_cnt(btf);
int err;
- for (i = 1; i < n; i++) {
+ for (i = btf->start_id; i < n; i++) {
t = btf_type_by_id(btf, i);
err = btf_validate_type(btf, t, i);
if (err)
@@ -969,6 +972,8 @@ void btf__free(struct btf *btf)
free(btf->raw_data);
free(btf->raw_data_swapped);
free(btf->type_offs);
+ if (btf->owns_base)
+ btf__free(btf->base_btf);
free(btf);
}
@@ -1084,53 +1089,38 @@ struct btf *btf__new_split(const void *data, __u32 size, struct btf *base_btf)
return libbpf_ptr(btf_new(data, size, base_btf));
}
-static struct btf *btf_parse_elf(const char *path, struct btf *base_btf,
- struct btf_ext **btf_ext)
+struct btf_elf_secs {
+ Elf_Data *btf_data;
+ Elf_Data *btf_ext_data;
+ Elf_Data *btf_base_data;
+};
+
+static int btf_find_elf_sections(Elf *elf, const char *path, struct btf_elf_secs *secs)
{
- Elf_Data *btf_data = NULL, *btf_ext_data = NULL;
- int err = 0, fd = -1, idx = 0;
- struct btf *btf = NULL;
Elf_Scn *scn = NULL;
- Elf *elf = NULL;
+ Elf_Data *data;
GElf_Ehdr ehdr;
size_t shstrndx;
+ int idx = 0;
- if (elf_version(EV_CURRENT) == EV_NONE) {
- pr_warn("failed to init libelf for %s\n", path);
- return ERR_PTR(-LIBBPF_ERRNO__LIBELF);
- }
-
- fd = open(path, O_RDONLY | O_CLOEXEC);
- if (fd < 0) {
- err = -errno;
- pr_warn("failed to open %s: %s\n", path, strerror(errno));
- return ERR_PTR(err);
- }
-
- err = -LIBBPF_ERRNO__FORMAT;
-
- elf = elf_begin(fd, ELF_C_READ, NULL);
- if (!elf) {
- pr_warn("failed to open %s as ELF file\n", path);
- goto done;
- }
if (!gelf_getehdr(elf, &ehdr)) {
pr_warn("failed to get EHDR from %s\n", path);
- goto done;
+ goto err;
}
if (elf_getshdrstrndx(elf, &shstrndx)) {
pr_warn("failed to get section names section index for %s\n",
path);
- goto done;
+ goto err;
}
if (!elf_rawdata(elf_getscn(elf, shstrndx), NULL)) {
pr_warn("failed to get e_shstrndx from %s\n", path);
- goto done;
+ goto err;
}
while ((scn = elf_nextscn(elf, scn)) != NULL) {
+ Elf_Data **field;
GElf_Shdr sh;
char *name;
@@ -1138,42 +1128,102 @@ static struct btf *btf_parse_elf(const char *path, struct btf *base_btf,
if (gelf_getshdr(scn, &sh) != &sh) {
pr_warn("failed to get section(%d) header from %s\n",
idx, path);
- goto done;
+ goto err;
}
name = elf_strptr(elf, shstrndx, sh.sh_name);
if (!name) {
pr_warn("failed to get section(%d) name from %s\n",
idx, path);
- goto done;
+ goto err;
}
- if (strcmp(name, BTF_ELF_SEC) == 0) {
- btf_data = elf_getdata(scn, 0);
- if (!btf_data) {
- pr_warn("failed to get section(%d, %s) data from %s\n",
- idx, name, path);
- goto done;
- }
- continue;
- } else if (btf_ext && strcmp(name, BTF_EXT_ELF_SEC) == 0) {
- btf_ext_data = elf_getdata(scn, 0);
- if (!btf_ext_data) {
- pr_warn("failed to get section(%d, %s) data from %s\n",
- idx, name, path);
- goto done;
- }
+
+ if (strcmp(name, BTF_ELF_SEC) == 0)
+ field = &secs->btf_data;
+ else if (strcmp(name, BTF_EXT_ELF_SEC) == 0)
+ field = &secs->btf_ext_data;
+ else if (strcmp(name, BTF_BASE_ELF_SEC) == 0)
+ field = &secs->btf_base_data;
+ else
continue;
+
+ data = elf_getdata(scn, 0);
+ if (!data) {
+ pr_warn("failed to get section(%d, %s) data from %s\n",
+ idx, name, path);
+ goto err;
}
+ *field = data;
}
- if (!btf_data) {
+ return 0;
+
+err:
+ return -LIBBPF_ERRNO__FORMAT;
+}
+
+static struct btf *btf_parse_elf(const char *path, struct btf *base_btf,
+ struct btf_ext **btf_ext)
+{
+ struct btf_elf_secs secs = {};
+ struct btf *dist_base_btf = NULL;
+ struct btf *btf = NULL;
+ int err = 0, fd = -1;
+ Elf *elf = NULL;
+
+ if (elf_version(EV_CURRENT) == EV_NONE) {
+ pr_warn("failed to init libelf for %s\n", path);
+ return ERR_PTR(-LIBBPF_ERRNO__LIBELF);
+ }
+
+ fd = open(path, O_RDONLY | O_CLOEXEC);
+ if (fd < 0) {
+ err = -errno;
+ pr_warn("failed to open %s: %s\n", path, strerror(errno));
+ return ERR_PTR(err);
+ }
+
+ elf = elf_begin(fd, ELF_C_READ, NULL);
+ if (!elf) {
+ pr_warn("failed to open %s as ELF file\n", path);
+ goto done;
+ }
+
+ err = btf_find_elf_sections(elf, path, &secs);
+ if (err)
+ goto done;
+
+ if (!secs.btf_data) {
pr_warn("failed to find '%s' ELF section in %s\n", BTF_ELF_SEC, path);
err = -ENODATA;
goto done;
}
- btf = btf_new(btf_data->d_buf, btf_data->d_size, base_btf);
- err = libbpf_get_error(btf);
- if (err)
+
+ if (secs.btf_base_data) {
+ dist_base_btf = btf_new(secs.btf_base_data->d_buf, secs.btf_base_data->d_size,
+ NULL);
+ if (IS_ERR(dist_base_btf)) {
+ err = PTR_ERR(dist_base_btf);
+ dist_base_btf = NULL;
+ goto done;
+ }
+ }
+
+ btf = btf_new(secs.btf_data->d_buf, secs.btf_data->d_size,
+ dist_base_btf ?: base_btf);
+ if (IS_ERR(btf)) {
+ err = PTR_ERR(btf);
goto done;
+ }
+ if (dist_base_btf && base_btf) {
+ err = btf__relocate(btf, base_btf);
+ if (err)
+ goto done;
+ btf__free(dist_base_btf);
+ dist_base_btf = NULL;
+ }
+
+ if (dist_base_btf)
+ btf->owns_base = true;
switch (gelf_getclass(elf)) {
case ELFCLASS32:
@@ -1187,11 +1237,12 @@ static struct btf *btf_parse_elf(const char *path, struct btf *base_btf,
break;
}
- if (btf_ext && btf_ext_data) {
- *btf_ext = btf_ext__new(btf_ext_data->d_buf, btf_ext_data->d_size);
- err = libbpf_get_error(*btf_ext);
- if (err)
+ if (btf_ext && secs.btf_ext_data) {
+ *btf_ext = btf_ext__new(secs.btf_ext_data->d_buf, secs.btf_ext_data->d_size);
+ if (IS_ERR(*btf_ext)) {
+ err = PTR_ERR(*btf_ext);
goto done;
+ }
} else if (btf_ext) {
*btf_ext = NULL;
}
@@ -1205,6 +1256,7 @@ done:
if (btf_ext)
btf_ext__free(*btf_ext);
+ btf__free(dist_base_btf);
btf__free(btf);
return ERR_PTR(err);
@@ -1739,9 +1791,8 @@ struct btf_pipe {
struct hashmap *str_off_map; /* map string offsets from src to dst */
};
-static int btf_rewrite_str(__u32 *str_off, void *ctx)
+static int btf_rewrite_str(struct btf_pipe *p, __u32 *str_off)
{
- struct btf_pipe *p = ctx;
long mapped_off;
int off, err;
@@ -1771,10 +1822,11 @@ static int btf_rewrite_str(__u32 *str_off, void *ctx)
return 0;
}
-int btf__add_type(struct btf *btf, const struct btf *src_btf, const struct btf_type *src_type)
+static int btf_add_type(struct btf_pipe *p, const struct btf_type *src_type)
{
- struct btf_pipe p = { .src = src_btf, .dst = btf };
+ struct btf_field_iter it;
struct btf_type *t;
+ __u32 *str_off;
int sz, err;
sz = btf_type_size(src_type);
@@ -1782,35 +1834,33 @@ int btf__add_type(struct btf *btf, const struct btf *src_btf, const struct btf_t
return libbpf_err(sz);
/* deconstruct BTF, if necessary, and invalidate raw_data */
- if (btf_ensure_modifiable(btf))
+ if (btf_ensure_modifiable(p->dst))
return libbpf_err(-ENOMEM);
- t = btf_add_type_mem(btf, sz);
+ t = btf_add_type_mem(p->dst, sz);
if (!t)
return libbpf_err(-ENOMEM);
memcpy(t, src_type, sz);
- err = btf_type_visit_str_offs(t, btf_rewrite_str, &p);
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_STRS);
if (err)
return libbpf_err(err);
- return btf_commit_type(btf, sz);
+ while ((str_off = btf_field_iter_next(&it))) {
+ err = btf_rewrite_str(p, str_off);
+ if (err)
+ return libbpf_err(err);
+ }
+
+ return btf_commit_type(p->dst, sz);
}
-static int btf_rewrite_type_ids(__u32 *type_id, void *ctx)
+int btf__add_type(struct btf *btf, const struct btf *src_btf, const struct btf_type *src_type)
{
- struct btf *btf = ctx;
-
- if (!*type_id) /* nothing to do for VOID references */
- return 0;
+ struct btf_pipe p = { .src = src_btf, .dst = btf };
- /* we haven't updated btf's type count yet, so
- * btf->start_id + btf->nr_types - 1 is the type ID offset we should
- * add to all newly added BTF types
- */
- *type_id += btf->start_id + btf->nr_types - 1;
- return 0;
+ return btf_add_type(&p, src_type);
}
static size_t btf_dedup_identity_hash_fn(long key, void *ctx);
@@ -1858,6 +1908,9 @@ int btf__add_btf(struct btf *btf, const struct btf *src_btf)
memcpy(t, src_btf->types_data, data_sz);
for (i = 0; i < cnt; i++) {
+ struct btf_field_iter it;
+ __u32 *type_id, *str_off;
+
sz = btf_type_size(t);
if (sz < 0) {
/* unlikely, has to be corrupted src_btf */
@@ -1869,15 +1922,31 @@ int btf__add_btf(struct btf *btf, const struct btf *src_btf)
*off = t - btf->types_data;
/* add, dedup, and remap strings referenced by this BTF type */
- err = btf_type_visit_str_offs(t, btf_rewrite_str, &p);
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_STRS);
if (err)
goto err_out;
+ while ((str_off = btf_field_iter_next(&it))) {
+ err = btf_rewrite_str(&p, str_off);
+ if (err)
+ goto err_out;
+ }
/* remap all type IDs referenced from this BTF type */
- err = btf_type_visit_type_ids(t, btf_rewrite_type_ids, btf);
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
if (err)
goto err_out;
+ while ((type_id = btf_field_iter_next(&it))) {
+ if (!*type_id) /* nothing to do for VOID references */
+ continue;
+
+ /* we haven't updated btf's type count yet, so
+ * btf->start_id + btf->nr_types - 1 is the type ID offset we should
+ * add to all newly added BTF types
+ */
+ *type_id += btf->start_id + btf->nr_types - 1;
+ }
+
/* go to next type data and type offset index entry */
t += sz;
off++;
@@ -3453,11 +3522,19 @@ static int btf_for_each_str_off(struct btf_dedup *d, str_off_visit_fn fn, void *
int i, r;
for (i = 0; i < d->btf->nr_types; i++) {
+ struct btf_field_iter it;
struct btf_type *t = btf_type_by_id(d->btf, d->btf->start_id + i);
+ __u32 *str_off;
- r = btf_type_visit_str_offs(t, fn, ctx);
+ r = btf_field_iter_init(&it, t, BTF_FIELD_ITER_STRS);
if (r)
return r;
+
+ while ((str_off = btf_field_iter_next(&it))) {
+ r = fn(str_off, ctx);
+ if (r)
+ return r;
+ }
}
if (!d->btf_ext)
@@ -4919,10 +4996,23 @@ static int btf_dedup_remap_types(struct btf_dedup *d)
for (i = 0; i < d->btf->nr_types; i++) {
struct btf_type *t = btf_type_by_id(d->btf, d->btf->start_id + i);
+ struct btf_field_iter it;
+ __u32 *type_id;
- r = btf_type_visit_type_ids(t, btf_dedup_remap_type_id, d);
+ r = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
if (r)
return r;
+
+ while ((type_id = btf_field_iter_next(&it))) {
+ __u32 resolved_id, new_id;
+
+ resolved_id = resolve_type_id(d, *type_id);
+ new_id = d->hypot_map[resolved_id];
+ if (new_id > BTF_MAX_NR_TYPES)
+ return -EINVAL;
+
+ *type_id = new_id;
+ }
}
if (!d->btf_ext)
@@ -5003,136 +5093,6 @@ struct btf *btf__load_module_btf(const char *module_name, struct btf *vmlinux_bt
return btf__parse_split(path, vmlinux_btf);
}
-int btf_type_visit_type_ids(struct btf_type *t, type_id_visit_fn visit, void *ctx)
-{
- int i, n, err;
-
- switch (btf_kind(t)) {
- case BTF_KIND_INT:
- case BTF_KIND_FLOAT:
- case BTF_KIND_ENUM:
- case BTF_KIND_ENUM64:
- return 0;
-
- case BTF_KIND_FWD:
- case BTF_KIND_CONST:
- case BTF_KIND_VOLATILE:
- case BTF_KIND_RESTRICT:
- case BTF_KIND_PTR:
- case BTF_KIND_TYPEDEF:
- case BTF_KIND_FUNC:
- case BTF_KIND_VAR:
- case BTF_KIND_DECL_TAG:
- case BTF_KIND_TYPE_TAG:
- return visit(&t->type, ctx);
-
- case BTF_KIND_ARRAY: {
- struct btf_array *a = btf_array(t);
-
- err = visit(&a->type, ctx);
- err = err ?: visit(&a->index_type, ctx);
- return err;
- }
-
- case BTF_KIND_STRUCT:
- case BTF_KIND_UNION: {
- struct btf_member *m = btf_members(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->type, ctx);
- if (err)
- return err;
- }
- return 0;
- }
-
- case BTF_KIND_FUNC_PROTO: {
- struct btf_param *m = btf_params(t);
-
- err = visit(&t->type, ctx);
- if (err)
- return err;
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->type, ctx);
- if (err)
- return err;
- }
- return 0;
- }
-
- case BTF_KIND_DATASEC: {
- struct btf_var_secinfo *m = btf_var_secinfos(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->type, ctx);
- if (err)
- return err;
- }
- return 0;
- }
-
- default:
- return -EINVAL;
- }
-}
-
-int btf_type_visit_str_offs(struct btf_type *t, str_off_visit_fn visit, void *ctx)
-{
- int i, n, err;
-
- err = visit(&t->name_off, ctx);
- if (err)
- return err;
-
- switch (btf_kind(t)) {
- case BTF_KIND_STRUCT:
- case BTF_KIND_UNION: {
- struct btf_member *m = btf_members(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->name_off, ctx);
- if (err)
- return err;
- }
- break;
- }
- case BTF_KIND_ENUM: {
- struct btf_enum *m = btf_enum(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->name_off, ctx);
- if (err)
- return err;
- }
- break;
- }
- case BTF_KIND_ENUM64: {
- struct btf_enum64 *m = btf_enum64(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->name_off, ctx);
- if (err)
- return err;
- }
- break;
- }
- case BTF_KIND_FUNC_PROTO: {
- struct btf_param *m = btf_params(t);
-
- for (i = 0, n = btf_vlen(t); i < n; i++, m++) {
- err = visit(&m->name_off, ctx);
- if (err)
- return err;
- }
- break;
- }
- default:
- break;
- }
-
- return 0;
-}
-
int btf_ext_visit_type_ids(struct btf_ext *btf_ext, type_id_visit_fn visit, void *ctx)
{
const struct btf_ext_info *seg;
@@ -5212,3 +5172,325 @@ int btf_ext_visit_str_offs(struct btf_ext *btf_ext, str_off_visit_fn visit, void
return 0;
}
+
+struct btf_distill {
+ struct btf_pipe pipe;
+ int *id_map;
+ unsigned int split_start_id;
+ unsigned int split_start_str;
+ int diff_id;
+};
+
+static int btf_add_distilled_type_ids(struct btf_distill *dist, __u32 i)
+{
+ struct btf_type *split_t = btf_type_by_id(dist->pipe.src, i);
+ struct btf_field_iter it;
+ __u32 *id;
+ int err;
+
+ err = btf_field_iter_init(&it, split_t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+ while ((id = btf_field_iter_next(&it))) {
+ struct btf_type *base_t;
+
+ if (!*id)
+ continue;
+ /* split BTF id, not needed */
+ if (*id >= dist->split_start_id)
+ continue;
+ /* already added ? */
+ if (dist->id_map[*id] > 0)
+ continue;
+
+ /* only a subset of base BTF types should be referenced from
+ * split BTF; ensure nothing unexpected is referenced.
+ */
+ base_t = btf_type_by_id(dist->pipe.src, *id);
+ switch (btf_kind(base_t)) {
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_FWD:
+ case BTF_KIND_ARRAY:
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64:
+ case BTF_KIND_PTR:
+ case BTF_KIND_CONST:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_FUNC_PROTO:
+ case BTF_KIND_TYPE_TAG:
+ dist->id_map[*id] = *id;
+ break;
+ default:
+ pr_warn("unexpected reference to base type[%u] of kind [%u] when creating distilled base BTF.\n",
+ *id, btf_kind(base_t));
+ return -EINVAL;
+ }
+ /* If a base type is used, ensure types it refers to are
+ * marked as used also; so for example if we find a PTR to INT
+ * we need both the PTR and INT.
+ *
+ * The only exception is named struct/unions, since distilled
+ * base BTF composite types have no members.
+ */
+ if (btf_is_composite(base_t) && base_t->name_off)
+ continue;
+ err = btf_add_distilled_type_ids(dist, *id);
+ if (err)
+ return err;
+ }
+ return 0;
+}
+
+static int btf_add_distilled_types(struct btf_distill *dist)
+{
+ bool adding_to_base = dist->pipe.dst->start_id == 1;
+ int id = btf__type_cnt(dist->pipe.dst);
+ struct btf_type *t;
+ int i, err = 0;
+
+
+ /* Add types for each of the required references to either distilled
+ * base or split BTF, depending on type characteristics.
+ */
+ for (i = 1; i < dist->split_start_id; i++) {
+ const char *name;
+ int kind;
+
+ if (!dist->id_map[i])
+ continue;
+ t = btf_type_by_id(dist->pipe.src, i);
+ kind = btf_kind(t);
+ name = btf__name_by_offset(dist->pipe.src, t->name_off);
+
+ switch (kind) {
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_FWD:
+ /* Named int, float, fwd are added to base. */
+ if (!adding_to_base)
+ continue;
+ err = btf_add_type(&dist->pipe, t);
+ break;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ /* Named struct/union are added to base as 0-vlen
+ * struct/union of same size. Anonymous struct/unions
+ * are added to split BTF as-is.
+ */
+ if (adding_to_base) {
+ if (!t->name_off)
+ continue;
+ err = btf_add_composite(dist->pipe.dst, kind, name, t->size);
+ } else {
+ if (t->name_off)
+ continue;
+ err = btf_add_type(&dist->pipe, t);
+ }
+ break;
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64:
+ /* Named enum[64]s are added to base as a sized
+ * enum; relocation will match with appropriately-named
+ * and sized enum or enum64.
+ *
+ * Anonymous enums are added to split BTF as-is.
+ */
+ if (adding_to_base) {
+ if (!t->name_off)
+ continue;
+ err = btf__add_enum(dist->pipe.dst, name, t->size);
+ } else {
+ if (t->name_off)
+ continue;
+ err = btf_add_type(&dist->pipe, t);
+ }
+ break;
+ case BTF_KIND_ARRAY:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_PTR:
+ case BTF_KIND_CONST:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_FUNC_PROTO:
+ case BTF_KIND_TYPE_TAG:
+ /* All other types are added to split BTF. */
+ if (adding_to_base)
+ continue;
+ err = btf_add_type(&dist->pipe, t);
+ break;
+ default:
+ pr_warn("unexpected kind when adding base type '%s'[%u] of kind [%u] to distilled base BTF.\n",
+ name, i, kind);
+ return -EINVAL;
+
+ }
+ if (err < 0)
+ break;
+ dist->id_map[i] = id++;
+ }
+ return err;
+}
+
+/* Split BTF ids without a mapping will be shifted downwards since distilled
+ * base BTF is smaller than the original base BTF. For those that have a
+ * mapping (either to base or updated split BTF), update the id based on
+ * that mapping.
+ */
+static int btf_update_distilled_type_ids(struct btf_distill *dist, __u32 i)
+{
+ struct btf_type *t = btf_type_by_id(dist->pipe.dst, i);
+ struct btf_field_iter it;
+ __u32 *id;
+ int err;
+
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+ while ((id = btf_field_iter_next(&it))) {
+ if (dist->id_map[*id])
+ *id = dist->id_map[*id];
+ else if (*id >= dist->split_start_id)
+ *id -= dist->diff_id;
+ }
+ return 0;
+}
+
+/* Create updated split BTF with distilled base BTF; distilled base BTF
+ * consists of BTF information required to clarify the types that split
+ * BTF refers to, omitting unneeded details. Specifically it will contain
+ * base types and memberless definitions of named structs, unions and enumerated
+ * types. Associated reference types like pointers, arrays and anonymous
+ * structs, unions and enumerated types will be added to split BTF.
+ * Size is recorded for named struct/unions to help guide matching to the
+ * target base BTF during later relocation.
+ *
+ * The only case where structs, unions or enumerated types are fully represented
+ * is when they are anonymous; in such cases, the anonymous type is added to
+ * split BTF in full.
+ *
+ * We return newly-created split BTF where the split BTF refers to a newly-created
+ * distilled base BTF. Both must be freed separately by the caller.
+ */
+int btf__distill_base(const struct btf *src_btf, struct btf **new_base_btf,
+ struct btf **new_split_btf)
+{
+ struct btf *new_base = NULL, *new_split = NULL;
+ const struct btf *old_base;
+ unsigned int n = btf__type_cnt(src_btf);
+ struct btf_distill dist = {};
+ struct btf_type *t;
+ int i, err = 0;
+
+ /* src BTF must be split BTF. */
+ old_base = btf__base_btf(src_btf);
+ if (!new_base_btf || !new_split_btf || !old_base)
+ return libbpf_err(-EINVAL);
+
+ new_base = btf__new_empty();
+ if (!new_base)
+ return libbpf_err(-ENOMEM);
+ dist.id_map = calloc(n, sizeof(*dist.id_map));
+ if (!dist.id_map) {
+ err = -ENOMEM;
+ goto done;
+ }
+ dist.pipe.src = src_btf;
+ dist.pipe.dst = new_base;
+ dist.pipe.str_off_map = hashmap__new(btf_dedup_identity_hash_fn, btf_dedup_equal_fn, NULL);
+ if (IS_ERR(dist.pipe.str_off_map)) {
+ err = -ENOMEM;
+ goto done;
+ }
+ dist.split_start_id = btf__type_cnt(old_base);
+ dist.split_start_str = old_base->hdr->str_len;
+
+ /* Pass over src split BTF; generate the list of base BTF type ids it
+ * references; these will constitute our distilled BTF set to be
+ * distributed over base and split BTF as appropriate.
+ */
+ for (i = src_btf->start_id; i < n; i++) {
+ err = btf_add_distilled_type_ids(&dist, i);
+ if (err < 0)
+ goto done;
+ }
+ /* Next add types for each of the required references to base BTF and split BTF
+ * in turn.
+ */
+ err = btf_add_distilled_types(&dist);
+ if (err < 0)
+ goto done;
+
+ /* Create new split BTF with distilled base BTF as its base; the final
+ * state is split BTF with distilled base BTF that represents enough
+ * about its base references to allow it to be relocated with the base
+ * BTF available.
+ */
+ new_split = btf__new_empty_split(new_base);
+ if (!new_split) {
+ err = -errno;
+ goto done;
+ }
+ dist.pipe.dst = new_split;
+ /* First add all split types */
+ for (i = src_btf->start_id; i < n; i++) {
+ t = btf_type_by_id(src_btf, i);
+ err = btf_add_type(&dist.pipe, t);
+ if (err < 0)
+ goto done;
+ }
+ /* Now add distilled types to split BTF that are not added to base. */
+ err = btf_add_distilled_types(&dist);
+ if (err < 0)
+ goto done;
+
+ /* All split BTF ids will be shifted downwards since there are less base
+ * BTF ids in distilled base BTF.
+ */
+ dist.diff_id = dist.split_start_id - btf__type_cnt(new_base);
+
+ n = btf__type_cnt(new_split);
+ /* Now update base/split BTF ids. */
+ for (i = 1; i < n; i++) {
+ err = btf_update_distilled_type_ids(&dist, i);
+ if (err < 0)
+ break;
+ }
+done:
+ free(dist.id_map);
+ hashmap__free(dist.pipe.str_off_map);
+ if (err) {
+ btf__free(new_split);
+ btf__free(new_base);
+ return libbpf_err(err);
+ }
+ *new_base_btf = new_base;
+ *new_split_btf = new_split;
+
+ return 0;
+}
+
+const struct btf_header *btf_header(const struct btf *btf)
+{
+ return btf->hdr;
+}
+
+void btf_set_base_btf(struct btf *btf, const struct btf *base_btf)
+{
+ btf->base_btf = (struct btf *)base_btf;
+ btf->start_id = btf__type_cnt(base_btf);
+ btf->start_str_off = base_btf->hdr->str_len;
+}
+
+int btf__relocate(struct btf *btf, const struct btf *base_btf)
+{
+ int err = btf_relocate(btf, base_btf, NULL);
+
+ if (!err)
+ btf->owns_base = false;
+ return libbpf_err(err);
+}
diff --git a/tools/lib/bpf/btf.h b/tools/lib/bpf/btf.h
index 8e6880d91c84..b68d216837a9 100644
--- a/tools/lib/bpf/btf.h
+++ b/tools/lib/bpf/btf.h
@@ -18,6 +18,7 @@ extern "C" {
#define BTF_ELF_SEC ".BTF"
#define BTF_EXT_ELF_SEC ".BTF.ext"
+#define BTF_BASE_ELF_SEC ".BTF.base"
#define MAPS_ELF_SEC ".maps"
struct btf;
@@ -107,6 +108,27 @@ LIBBPF_API struct btf *btf__new_empty(void);
*/
LIBBPF_API struct btf *btf__new_empty_split(struct btf *base_btf);
+/**
+ * @brief **btf__distill_base()** creates new versions of the split BTF
+ * *src_btf* and its base BTF. The new base BTF will only contain the types
+ * needed to improve robustness of the split BTF to small changes in base BTF.
+ * When that split BTF is loaded against a (possibly changed) base, this
+ * distilled base BTF will help update references to that (possibly changed)
+ * base BTF.
+ *
+ * Both the new split and its associated new base BTF must be freed by
+ * the caller.
+ *
+ * If successful, 0 is returned and **new_base_btf** and **new_split_btf**
+ * will point at new base/split BTF. Both the new split and its associated
+ * new base BTF must be freed by the caller.
+ *
+ * A negative value is returned on error and the thread-local `errno` variable
+ * is set to the error code as well.
+ */
+LIBBPF_API int btf__distill_base(const struct btf *src_btf, struct btf **new_base_btf,
+ struct btf **new_split_btf);
+
LIBBPF_API struct btf *btf__parse(const char *path, struct btf_ext **btf_ext);
LIBBPF_API struct btf *btf__parse_split(const char *path, struct btf *base_btf);
LIBBPF_API struct btf *btf__parse_elf(const char *path, struct btf_ext **btf_ext);
@@ -231,6 +253,20 @@ struct btf_dedup_opts {
LIBBPF_API int btf__dedup(struct btf *btf, const struct btf_dedup_opts *opts);
+/**
+ * @brief **btf__relocate()** will check the split BTF *btf* for references
+ * to base BTF kinds, and verify those references are compatible with
+ * *base_btf*; if they are, *btf* is adjusted such that is re-parented to
+ * *base_btf* and type ids and strings are adjusted to accommodate this.
+ *
+ * If successful, 0 is returned and **btf** now has **base_btf** as its
+ * base.
+ *
+ * A negative value is returned on error and the thread-local `errno` variable
+ * is set to the error code as well.
+ */
+LIBBPF_API int btf__relocate(struct btf *btf, const struct btf *base_btf);
+
struct btf_dump;
struct btf_dump_opts {
diff --git a/tools/lib/bpf/btf_iter.c b/tools/lib/bpf/btf_iter.c
new file mode 100644
index 000000000000..9a6c822c2294
--- /dev/null
+++ b/tools/lib/bpf/btf_iter.c
@@ -0,0 +1,177 @@
+// SPDX-License-Identifier: (LGPL-2.1 OR BSD-2-Clause)
+/* Copyright (c) 2021 Facebook */
+/* Copyright (c) 2024, Oracle and/or its affiliates. */
+
+#ifdef __KERNEL__
+#include <linux/bpf.h>
+#include <linux/btf.h>
+
+#define btf_var_secinfos(t) (struct btf_var_secinfo *)btf_type_var_secinfo(t)
+
+#else
+#include "btf.h"
+#include "libbpf_internal.h"
+#endif
+
+int btf_field_iter_init(struct btf_field_iter *it, struct btf_type *t,
+ enum btf_field_iter_kind iter_kind)
+{
+ it->p = NULL;
+ it->m_idx = -1;
+ it->off_idx = 0;
+ it->vlen = 0;
+
+ switch (iter_kind) {
+ case BTF_FIELD_ITER_IDS:
+ switch (btf_kind(t)) {
+ case BTF_KIND_UNKN:
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64:
+ it->desc = (struct btf_field_desc) {};
+ break;
+ case BTF_KIND_FWD:
+ case BTF_KIND_CONST:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_PTR:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_FUNC:
+ case BTF_KIND_VAR:
+ case BTF_KIND_DECL_TAG:
+ case BTF_KIND_TYPE_TAG:
+ it->desc = (struct btf_field_desc) { 1, {offsetof(struct btf_type, type)} };
+ break;
+ case BTF_KIND_ARRAY:
+ it->desc = (struct btf_field_desc) {
+ 2, {sizeof(struct btf_type) + offsetof(struct btf_array, type),
+ sizeof(struct btf_type) + offsetof(struct btf_array, index_type)}
+ };
+ break;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ it->desc = (struct btf_field_desc) {
+ 0, {},
+ sizeof(struct btf_member),
+ 1, {offsetof(struct btf_member, type)}
+ };
+ break;
+ case BTF_KIND_FUNC_PROTO:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, type)},
+ sizeof(struct btf_param),
+ 1, {offsetof(struct btf_param, type)}
+ };
+ break;
+ case BTF_KIND_DATASEC:
+ it->desc = (struct btf_field_desc) {
+ 0, {},
+ sizeof(struct btf_var_secinfo),
+ 1, {offsetof(struct btf_var_secinfo, type)}
+ };
+ break;
+ default:
+ return -EINVAL;
+ }
+ break;
+ case BTF_FIELD_ITER_STRS:
+ switch (btf_kind(t)) {
+ case BTF_KIND_UNKN:
+ it->desc = (struct btf_field_desc) {};
+ break;
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_FWD:
+ case BTF_KIND_ARRAY:
+ case BTF_KIND_CONST:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_PTR:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_FUNC:
+ case BTF_KIND_VAR:
+ case BTF_KIND_DECL_TAG:
+ case BTF_KIND_TYPE_TAG:
+ case BTF_KIND_DATASEC:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, name_off)}
+ };
+ break;
+ case BTF_KIND_ENUM:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, name_off)},
+ sizeof(struct btf_enum),
+ 1, {offsetof(struct btf_enum, name_off)}
+ };
+ break;
+ case BTF_KIND_ENUM64:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, name_off)},
+ sizeof(struct btf_enum64),
+ 1, {offsetof(struct btf_enum64, name_off)}
+ };
+ break;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, name_off)},
+ sizeof(struct btf_member),
+ 1, {offsetof(struct btf_member, name_off)}
+ };
+ break;
+ case BTF_KIND_FUNC_PROTO:
+ it->desc = (struct btf_field_desc) {
+ 1, {offsetof(struct btf_type, name_off)},
+ sizeof(struct btf_param),
+ 1, {offsetof(struct btf_param, name_off)}
+ };
+ break;
+ default:
+ return -EINVAL;
+ }
+ break;
+ default:
+ return -EINVAL;
+ }
+
+ if (it->desc.m_sz)
+ it->vlen = btf_vlen(t);
+
+ it->p = t;
+ return 0;
+}
+
+__u32 *btf_field_iter_next(struct btf_field_iter *it)
+{
+ if (!it->p)
+ return NULL;
+
+ if (it->m_idx < 0) {
+ if (it->off_idx < it->desc.t_off_cnt)
+ return it->p + it->desc.t_offs[it->off_idx++];
+ /* move to per-member iteration */
+ it->m_idx = 0;
+ it->p += sizeof(struct btf_type);
+ it->off_idx = 0;
+ }
+
+ /* if type doesn't have members, stop */
+ if (it->desc.m_sz == 0) {
+ it->p = NULL;
+ return NULL;
+ }
+
+ if (it->off_idx >= it->desc.m_off_cnt) {
+ /* exhausted this member's fields, go to the next member */
+ it->m_idx++;
+ it->p += it->desc.m_sz;
+ it->off_idx = 0;
+ }
+
+ if (it->m_idx < it->vlen)
+ return it->p + it->desc.m_offs[it->off_idx++];
+
+ it->p = NULL;
+ return NULL;
+}
diff --git a/tools/lib/bpf/btf_relocate.c b/tools/lib/bpf/btf_relocate.c
new file mode 100644
index 000000000000..17f8b32f94a0
--- /dev/null
+++ b/tools/lib/bpf/btf_relocate.c
@@ -0,0 +1,519 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024, Oracle and/or its affiliates. */
+
+#ifndef _GNU_SOURCE
+#define _GNU_SOURCE
+#endif
+
+#ifdef __KERNEL__
+#include <linux/bpf.h>
+#include <linux/bsearch.h>
+#include <linux/btf.h>
+#include <linux/sort.h>
+#include <linux/string.h>
+#include <linux/bpf_verifier.h>
+
+#define btf_type_by_id (struct btf_type *)btf_type_by_id
+#define btf__type_cnt btf_nr_types
+#define btf__base_btf btf_base_btf
+#define btf__name_by_offset btf_name_by_offset
+#define btf__str_by_offset btf_str_by_offset
+#define btf_kflag btf_type_kflag
+
+#define calloc(nmemb, sz) kvcalloc(nmemb, sz, GFP_KERNEL | __GFP_NOWARN)
+#define free(ptr) kvfree(ptr)
+#define qsort(base, num, sz, cmp) sort(base, num, sz, cmp, NULL)
+
+#else
+
+#include "btf.h"
+#include "bpf.h"
+#include "libbpf.h"
+#include "libbpf_internal.h"
+
+#endif /* __KERNEL__ */
+
+struct btf;
+
+struct btf_relocate {
+ struct btf *btf;
+ const struct btf *base_btf;
+ const struct btf *dist_base_btf;
+ unsigned int nr_base_types;
+ unsigned int nr_split_types;
+ unsigned int nr_dist_base_types;
+ int dist_str_len;
+ int base_str_len;
+ __u32 *id_map;
+ __u32 *str_map;
+};
+
+/* Set temporarily in relocation id_map if distilled base struct/union is
+ * embedded in a split BTF struct/union; in such a case, size information must
+ * match between distilled base BTF and base BTF representation of type.
+ */
+#define BTF_IS_EMBEDDED ((__u32)-1)
+
+/* <name, size, id> triple used in sorting/searching distilled base BTF. */
+struct btf_name_info {
+ const char *name;
+ /* set when search requires a size match */
+ bool needs_size: 1;
+ unsigned int size: 31;
+ __u32 id;
+};
+
+static int btf_relocate_rewrite_type_id(struct btf_relocate *r, __u32 i)
+{
+ struct btf_type *t = btf_type_by_id(r->btf, i);
+ struct btf_field_iter it;
+ __u32 *id;
+ int err;
+
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+
+ while ((id = btf_field_iter_next(&it)))
+ *id = r->id_map[*id];
+ return 0;
+}
+
+/* Simple string comparison used for sorting within BTF, since all distilled
+ * types are named. If strings match, and size is non-zero for both elements
+ * fall back to using size for ordering.
+ */
+static int cmp_btf_name_size(const void *n1, const void *n2)
+{
+ const struct btf_name_info *ni1 = n1;
+ const struct btf_name_info *ni2 = n2;
+ int name_diff = strcmp(ni1->name, ni2->name);
+
+ if (!name_diff && ni1->needs_size && ni2->needs_size)
+ return ni2->size - ni1->size;
+ return name_diff;
+}
+
+/* Binary search with a small twist; find leftmost element that matches
+ * so that we can then iterate through all exact matches. So for example
+ * searching { "a", "bb", "bb", "c" } we would always match on the
+ * leftmost "bb".
+ */
+static struct btf_name_info *search_btf_name_size(struct btf_name_info *key,
+ struct btf_name_info *vals,
+ int nelems)
+{
+ struct btf_name_info *ret = NULL;
+ int high = nelems - 1;
+ int low = 0;
+
+ while (low <= high) {
+ int mid = (low + high)/2;
+ struct btf_name_info *val = &vals[mid];
+ int diff = cmp_btf_name_size(key, val);
+
+ if (diff == 0)
+ ret = val;
+ /* even if found, keep searching for leftmost match */
+ if (diff <= 0)
+ high = mid - 1;
+ else
+ low = mid + 1;
+ }
+ return ret;
+}
+
+/* If a member of a split BTF struct/union refers to a base BTF
+ * struct/union, mark that struct/union id temporarily in the id_map
+ * with BTF_IS_EMBEDDED. Members can be const/restrict/volatile/typedef
+ * reference types, but if a pointer is encountered, the type is no longer
+ * considered embedded.
+ */
+static int btf_mark_embedded_composite_type_ids(struct btf_relocate *r, __u32 i)
+{
+ struct btf_type *t = btf_type_by_id(r->btf, i);
+ struct btf_field_iter it;
+ __u32 *id;
+ int err;
+
+ if (!btf_is_composite(t))
+ return 0;
+
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+
+ while ((id = btf_field_iter_next(&it))) {
+ __u32 next_id = *id;
+
+ while (next_id) {
+ t = btf_type_by_id(r->btf, next_id);
+ switch (btf_kind(t)) {
+ case BTF_KIND_CONST:
+ case BTF_KIND_RESTRICT:
+ case BTF_KIND_VOLATILE:
+ case BTF_KIND_TYPEDEF:
+ case BTF_KIND_TYPE_TAG:
+ next_id = t->type;
+ break;
+ case BTF_KIND_ARRAY: {
+ struct btf_array *a = btf_array(t);
+
+ next_id = a->type;
+ break;
+ }
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ if (next_id < r->nr_dist_base_types)
+ r->id_map[next_id] = BTF_IS_EMBEDDED;
+ next_id = 0;
+ break;
+ default:
+ next_id = 0;
+ break;
+ }
+ }
+ }
+
+ return 0;
+}
+
+/* Build a map from distilled base BTF ids to base BTF ids. To do so, iterate
+ * through base BTF looking up distilled type (using binary search) equivalents.
+ */
+static int btf_relocate_map_distilled_base(struct btf_relocate *r)
+{
+ struct btf_name_info *info, *info_end;
+ struct btf_type *base_t, *dist_t;
+ __u8 *base_name_cnt = NULL;
+ int err = 0;
+ __u32 id;
+
+ /* generate a sort index array of name/type ids sorted by name for
+ * distilled base BTF to speed name-based lookups.
+ */
+ info = calloc(r->nr_dist_base_types, sizeof(*info));
+ if (!info) {
+ err = -ENOMEM;
+ goto done;
+ }
+ info_end = info + r->nr_dist_base_types;
+ for (id = 0; id < r->nr_dist_base_types; id++) {
+ dist_t = btf_type_by_id(r->dist_base_btf, id);
+ info[id].name = btf__name_by_offset(r->dist_base_btf, dist_t->name_off);
+ info[id].id = id;
+ info[id].size = dist_t->size;
+ info[id].needs_size = true;
+ }
+ qsort(info, r->nr_dist_base_types, sizeof(*info), cmp_btf_name_size);
+
+ /* Mark distilled base struct/union members of split BTF structs/unions
+ * in id_map with BTF_IS_EMBEDDED; this signals that these types
+ * need to match both name and size, otherwise embedding the base
+ * struct/union in the split type is invalid.
+ */
+ for (id = r->nr_dist_base_types; id < r->nr_split_types; id++) {
+ err = btf_mark_embedded_composite_type_ids(r, id);
+ if (err)
+ goto done;
+ }
+
+ /* Collect name counts for composite types in base BTF. If multiple
+ * instances of a struct/union of the same name exist, we need to use
+ * size to determine which to map to since name alone is ambiguous.
+ */
+ base_name_cnt = calloc(r->base_str_len, sizeof(*base_name_cnt));
+ if (!base_name_cnt) {
+ err = -ENOMEM;
+ goto done;
+ }
+ for (id = 1; id < r->nr_base_types; id++) {
+ base_t = btf_type_by_id(r->base_btf, id);
+ if (!btf_is_composite(base_t) || !base_t->name_off)
+ continue;
+ if (base_name_cnt[base_t->name_off] < 255)
+ base_name_cnt[base_t->name_off]++;
+ }
+
+ /* Now search base BTF for matching distilled base BTF types. */
+ for (id = 1; id < r->nr_base_types; id++) {
+ struct btf_name_info *dist_info, base_info = {};
+ int dist_kind, base_kind;
+
+ base_t = btf_type_by_id(r->base_btf, id);
+ /* distilled base consists of named types only. */
+ if (!base_t->name_off)
+ continue;
+ base_kind = btf_kind(base_t);
+ base_info.id = id;
+ base_info.name = btf__name_by_offset(r->base_btf, base_t->name_off);
+ switch (base_kind) {
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_ENUM:
+ case BTF_KIND_ENUM64:
+ /* These types should match both name and size */
+ base_info.needs_size = true;
+ base_info.size = base_t->size;
+ break;
+ case BTF_KIND_FWD:
+ /* No size considerations for fwds. */
+ break;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ /* Size only needs to be used for struct/union if there
+ * are multiple types in base BTF with the same name.
+ * If there are multiple _distilled_ types with the same
+ * name (a very unlikely scenario), that doesn't matter
+ * unless corresponding _base_ types to match them are
+ * missing.
+ */
+ base_info.needs_size = base_name_cnt[base_t->name_off] > 1;
+ base_info.size = base_t->size;
+ break;
+ default:
+ continue;
+ }
+ /* iterate over all matching distilled base types */
+ for (dist_info = search_btf_name_size(&base_info, info, r->nr_dist_base_types);
+ dist_info != NULL && dist_info < info_end &&
+ cmp_btf_name_size(&base_info, dist_info) == 0;
+ dist_info++) {
+ if (!dist_info->id || dist_info->id >= r->nr_dist_base_types) {
+ pr_warn("base BTF id [%d] maps to invalid distilled base BTF id [%d]\n",
+ id, dist_info->id);
+ err = -EINVAL;
+ goto done;
+ }
+ dist_t = btf_type_by_id(r->dist_base_btf, dist_info->id);
+ dist_kind = btf_kind(dist_t);
+
+ /* Validate that the found distilled type is compatible.
+ * Do not error out on mismatch as another match may
+ * occur for an identically-named type.
+ */
+ switch (dist_kind) {
+ case BTF_KIND_FWD:
+ switch (base_kind) {
+ case BTF_KIND_FWD:
+ if (btf_kflag(dist_t) != btf_kflag(base_t))
+ continue;
+ break;
+ case BTF_KIND_STRUCT:
+ if (btf_kflag(base_t))
+ continue;
+ break;
+ case BTF_KIND_UNION:
+ if (!btf_kflag(base_t))
+ continue;
+ break;
+ default:
+ continue;
+ }
+ break;
+ case BTF_KIND_INT:
+ if (dist_kind != base_kind ||
+ btf_int_encoding(base_t) != btf_int_encoding(dist_t))
+ continue;
+ break;
+ case BTF_KIND_FLOAT:
+ if (dist_kind != base_kind)
+ continue;
+ break;
+ case BTF_KIND_ENUM:
+ /* ENUM and ENUM64 are encoded as sized ENUM in
+ * distilled base BTF.
+ */
+ if (base_kind != dist_kind && base_kind != BTF_KIND_ENUM64)
+ continue;
+ break;
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ /* size verification is required for embedded
+ * struct/unions.
+ */
+ if (r->id_map[dist_info->id] == BTF_IS_EMBEDDED &&
+ base_t->size != dist_t->size)
+ continue;
+ break;
+ default:
+ continue;
+ }
+ if (r->id_map[dist_info->id] &&
+ r->id_map[dist_info->id] != BTF_IS_EMBEDDED) {
+ /* we already have a match; this tells us that
+ * multiple base types of the same name
+ * have the same size, since for cases where
+ * multiple types have the same name we match
+ * on name and size. In this case, we have
+ * no way of determining which to relocate
+ * to in base BTF, so error out.
+ */
+ pr_warn("distilled base BTF type '%s' [%u], size %u has multiple candidates of the same size (ids [%u, %u]) in base BTF\n",
+ base_info.name, dist_info->id,
+ base_t->size, id, r->id_map[dist_info->id]);
+ err = -EINVAL;
+ goto done;
+ }
+ /* map id and name */
+ r->id_map[dist_info->id] = id;
+ r->str_map[dist_t->name_off] = base_t->name_off;
+ }
+ }
+ /* ensure all distilled BTF ids now have a mapping... */
+ for (id = 1; id < r->nr_dist_base_types; id++) {
+ const char *name;
+
+ if (r->id_map[id] && r->id_map[id] != BTF_IS_EMBEDDED)
+ continue;
+ dist_t = btf_type_by_id(r->dist_base_btf, id);
+ name = btf__name_by_offset(r->dist_base_btf, dist_t->name_off);
+ pr_warn("distilled base BTF type '%s' [%d] is not mapped to base BTF id\n",
+ name, id);
+ err = -EINVAL;
+ break;
+ }
+done:
+ free(base_name_cnt);
+ free(info);
+ return err;
+}
+
+/* distilled base should only have named int/float/enum/fwd/struct/union types. */
+static int btf_relocate_validate_distilled_base(struct btf_relocate *r)
+{
+ unsigned int i;
+
+ for (i = 1; i < r->nr_dist_base_types; i++) {
+ struct btf_type *t = btf_type_by_id(r->dist_base_btf, i);
+ int kind = btf_kind(t);
+
+ switch (kind) {
+ case BTF_KIND_INT:
+ case BTF_KIND_FLOAT:
+ case BTF_KIND_ENUM:
+ case BTF_KIND_STRUCT:
+ case BTF_KIND_UNION:
+ case BTF_KIND_FWD:
+ if (t->name_off)
+ break;
+ pr_warn("type [%d], kind [%d] is invalid for distilled base BTF; it is anonymous\n",
+ i, kind);
+ return -EINVAL;
+ default:
+ pr_warn("type [%d] in distilled based BTF has unexpected kind [%d]\n",
+ i, kind);
+ return -EINVAL;
+ }
+ }
+ return 0;
+}
+
+static int btf_relocate_rewrite_strs(struct btf_relocate *r, __u32 i)
+{
+ struct btf_type *t = btf_type_by_id(r->btf, i);
+ struct btf_field_iter it;
+ __u32 *str_off;
+ int off, err;
+
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_STRS);
+ if (err)
+ return err;
+
+ while ((str_off = btf_field_iter_next(&it))) {
+ if (!*str_off)
+ continue;
+ if (*str_off >= r->dist_str_len) {
+ *str_off += r->base_str_len - r->dist_str_len;
+ } else {
+ off = r->str_map[*str_off];
+ if (!off) {
+ pr_warn("string '%s' [offset %u] is not mapped to base BTF",
+ btf__str_by_offset(r->btf, off), *str_off);
+ return -ENOENT;
+ }
+ *str_off = off;
+ }
+ }
+ return 0;
+}
+
+/* If successful, output of relocation is updated BTF with base BTF pointing
+ * at base_btf, and type ids, strings adjusted accordingly.
+ */
+int btf_relocate(struct btf *btf, const struct btf *base_btf, __u32 **id_map)
+{
+ unsigned int nr_types = btf__type_cnt(btf);
+ const struct btf_header *dist_base_hdr;
+ const struct btf_header *base_hdr;
+ struct btf_relocate r = {};
+ int err = 0;
+ __u32 id, i;
+
+ r.dist_base_btf = btf__base_btf(btf);
+ if (!base_btf || r.dist_base_btf == base_btf)
+ return -EINVAL;
+
+ r.nr_dist_base_types = btf__type_cnt(r.dist_base_btf);
+ r.nr_base_types = btf__type_cnt(base_btf);
+ r.nr_split_types = nr_types - r.nr_dist_base_types;
+ r.btf = btf;
+ r.base_btf = base_btf;
+
+ r.id_map = calloc(nr_types, sizeof(*r.id_map));
+ r.str_map = calloc(btf_header(r.dist_base_btf)->str_len, sizeof(*r.str_map));
+ dist_base_hdr = btf_header(r.dist_base_btf);
+ base_hdr = btf_header(r.base_btf);
+ r.dist_str_len = dist_base_hdr->str_len;
+ r.base_str_len = base_hdr->str_len;
+ if (!r.id_map || !r.str_map) {
+ err = -ENOMEM;
+ goto err_out;
+ }
+
+ err = btf_relocate_validate_distilled_base(&r);
+ if (err)
+ goto err_out;
+
+ /* Split BTF ids need to be adjusted as base and distilled base
+ * have different numbers of types, changing the start id of split
+ * BTF.
+ */
+ for (id = r.nr_dist_base_types; id < nr_types; id++)
+ r.id_map[id] = id + r.nr_base_types - r.nr_dist_base_types;
+
+ /* Build a map from distilled base ids to actual base BTF ids; it is used
+ * to update split BTF id references. Also build a str_map mapping from
+ * distilled base BTF names to base BTF names.
+ */
+ err = btf_relocate_map_distilled_base(&r);
+ if (err)
+ goto err_out;
+
+ /* Next, rewrite type ids in split BTF, replacing split ids with updated
+ * ids based on number of types in base BTF, and base ids with
+ * relocated ids from base_btf.
+ */
+ for (i = 0, id = r.nr_dist_base_types; i < r.nr_split_types; i++, id++) {
+ err = btf_relocate_rewrite_type_id(&r, id);
+ if (err)
+ goto err_out;
+ }
+ /* String offsets now need to be updated using the str_map. */
+ for (i = 0; i < r.nr_split_types; i++) {
+ err = btf_relocate_rewrite_strs(&r, i + r.nr_dist_base_types);
+ if (err)
+ goto err_out;
+ }
+ /* Finally reset base BTF to be base_btf */
+ btf_set_base_btf(btf, base_btf);
+
+ if (id_map) {
+ *id_map = r.id_map;
+ r.id_map = NULL;
+ }
+err_out:
+ free(r.id_map);
+ free(r.str_map);
+ return err;
+}
diff --git a/tools/lib/bpf/features.c b/tools/lib/bpf/features.c
index a336786a22a3..50befe125ddc 100644
--- a/tools/lib/bpf/features.c
+++ b/tools/lib/bpf/features.c
@@ -392,11 +392,41 @@ static int probe_uprobe_multi_link(int token_fd)
link_fd = bpf_link_create(prog_fd, -1, BPF_TRACE_UPROBE_MULTI, &link_opts);
err = -errno; /* close() can clobber errno */
+ if (link_fd >= 0 || err != -EBADF) {
+ if (link_fd >= 0)
+ close(link_fd);
+ close(prog_fd);
+ return 0;
+ }
+
+ /* Initial multi-uprobe support in kernel didn't handle PID filtering
+ * correctly (it was doing thread filtering, not process filtering).
+ * So now we'll detect if PID filtering logic was fixed, and, if not,
+ * we'll pretend multi-uprobes are not supported, if not.
+ * Multi-uprobes are used in USDT attachment logic, and we need to be
+ * conservative here, because multi-uprobe selection happens early at
+ * load time, while the use of PID filtering is known late at
+ * attachment time, at which point it's too late to undo multi-uprobe
+ * selection.
+ *
+ * Creating uprobe with pid == -1 for (invalid) '/' binary will fail
+ * early with -EINVAL on kernels with fixed PID filtering logic;
+ * otherwise -ESRCH would be returned if passed correct binary path
+ * (but we'll just get -BADF, of course).
+ */
+ link_opts.uprobe_multi.pid = -1; /* invalid PID */
+ link_opts.uprobe_multi.path = "/"; /* invalid path */
+ link_opts.uprobe_multi.offsets = &offset;
+ link_opts.uprobe_multi.cnt = 1;
+
+ link_fd = bpf_link_create(prog_fd, -1, BPF_TRACE_UPROBE_MULTI, &link_opts);
+ err = -errno; /* close() can clobber errno */
+
if (link_fd >= 0)
close(link_fd);
close(prog_fd);
- return link_fd < 0 && err == -EBADF;
+ return link_fd < 0 && err == -EINVAL;
}
static int probe_kern_bpf_cookie(int token_fd)
diff --git a/tools/lib/bpf/libbpf.c b/tools/lib/bpf/libbpf.c
index 5401f2df463d..a3be6f8fac09 100644
--- a/tools/lib/bpf/libbpf.c
+++ b/tools/lib/bpf/libbpf.c
@@ -229,7 +229,30 @@ static const char * const prog_type_name[] = {
static int __base_pr(enum libbpf_print_level level, const char *format,
va_list args)
{
- if (level == LIBBPF_DEBUG)
+ const char *env_var = "LIBBPF_LOG_LEVEL";
+ static enum libbpf_print_level min_level = LIBBPF_INFO;
+ static bool initialized;
+
+ if (!initialized) {
+ char *verbosity;
+
+ initialized = true;
+ verbosity = getenv(env_var);
+ if (verbosity) {
+ if (strcasecmp(verbosity, "warn") == 0)
+ min_level = LIBBPF_WARN;
+ else if (strcasecmp(verbosity, "debug") == 0)
+ min_level = LIBBPF_DEBUG;
+ else if (strcasecmp(verbosity, "info") == 0)
+ min_level = LIBBPF_INFO;
+ else
+ fprintf(stderr, "libbpf: unrecognized '%s' envvar value: '%s', should be one of 'warn', 'debug', or 'info'.\n",
+ env_var, verbosity);
+ }
+ }
+
+ /* if too verbose, skip logging */
+ if (level > min_level)
return 0;
return vfprintf(stderr, format, args);
@@ -549,6 +572,7 @@ struct bpf_map {
bool pinned;
bool reused;
bool autocreate;
+ bool autoattach;
__u64 map_extra;
};
@@ -1377,6 +1401,7 @@ static int init_struct_ops_maps(struct bpf_object *obj, const char *sec_name,
map->def.value_size = type->size;
map->def.max_entries = 1;
map->def.map_flags = strcmp(sec_name, STRUCT_OPS_LINK_SEC) == 0 ? BPF_F_LINK : 0;
+ map->autoattach = true;
map->st_ops = calloc(1, sizeof(*map->st_ops));
if (!map->st_ops)
@@ -4796,6 +4821,20 @@ int bpf_map__set_autocreate(struct bpf_map *map, bool autocreate)
return 0;
}
+int bpf_map__set_autoattach(struct bpf_map *map, bool autoattach)
+{
+ if (!bpf_map__is_struct_ops(map))
+ return libbpf_err(-EINVAL);
+
+ map->autoattach = autoattach;
+ return 0;
+}
+
+bool bpf_map__autoattach(const struct bpf_map *map)
+{
+ return map->autoattach;
+}
+
int bpf_map__reuse_fd(struct bpf_map *map, int fd)
{
struct bpf_map_info info;
@@ -10336,7 +10375,7 @@ __bpf_map__iter(const struct bpf_map *m, const struct bpf_object *obj, int i)
struct bpf_map *
bpf_object__next_map(const struct bpf_object *obj, const struct bpf_map *prev)
{
- if (prev == NULL)
+ if (prev == NULL && obj != NULL)
return obj->maps;
return __bpf_map__iter(prev, obj, 1);
@@ -10345,7 +10384,7 @@ bpf_object__next_map(const struct bpf_object *obj, const struct bpf_map *prev)
struct bpf_map *
bpf_object__prev_map(const struct bpf_object *obj, const struct bpf_map *next)
{
- if (next == NULL) {
+ if (next == NULL && obj != NULL) {
if (!obj->nr_maps)
return NULL;
return obj->maps + obj->nr_maps - 1;
@@ -12877,8 +12916,10 @@ struct bpf_link *bpf_map__attach_struct_ops(const struct bpf_map *map)
__u32 zero = 0;
int err, fd;
- if (!bpf_map__is_struct_ops(map))
+ if (!bpf_map__is_struct_ops(map)) {
+ pr_warn("map '%s': can't attach non-struct_ops map\n", map->name);
return libbpf_err_ptr(-EINVAL);
+ }
if (map->fd < 0) {
pr_warn("map '%s': can't attach BPF map without FD (was it created?)\n", map->name);
@@ -13671,14 +13712,15 @@ int libbpf_num_possible_cpus(void)
static int populate_skeleton_maps(const struct bpf_object *obj,
struct bpf_map_skeleton *maps,
- size_t map_cnt)
+ size_t map_cnt, size_t map_skel_sz)
{
int i;
for (i = 0; i < map_cnt; i++) {
- struct bpf_map **map = maps[i].map;
- const char *name = maps[i].name;
- void **mmaped = maps[i].mmaped;
+ struct bpf_map_skeleton *map_skel = (void *)maps + i * map_skel_sz;
+ struct bpf_map **map = map_skel->map;
+ const char *name = map_skel->name;
+ void **mmaped = map_skel->mmaped;
*map = bpf_object__find_map_by_name(obj, name);
if (!*map) {
@@ -13695,13 +13737,14 @@ static int populate_skeleton_maps(const struct bpf_object *obj,
static int populate_skeleton_progs(const struct bpf_object *obj,
struct bpf_prog_skeleton *progs,
- size_t prog_cnt)
+ size_t prog_cnt, size_t prog_skel_sz)
{
int i;
for (i = 0; i < prog_cnt; i++) {
- struct bpf_program **prog = progs[i].prog;
- const char *name = progs[i].name;
+ struct bpf_prog_skeleton *prog_skel = (void *)progs + i * prog_skel_sz;
+ struct bpf_program **prog = prog_skel->prog;
+ const char *name = prog_skel->name;
*prog = bpf_object__find_program_by_name(obj, name);
if (!*prog) {
@@ -13742,13 +13785,13 @@ int bpf_object__open_skeleton(struct bpf_object_skeleton *s,
}
*s->obj = obj;
- err = populate_skeleton_maps(obj, s->maps, s->map_cnt);
+ err = populate_skeleton_maps(obj, s->maps, s->map_cnt, s->map_skel_sz);
if (err) {
pr_warn("failed to populate skeleton maps for '%s': %d\n", s->name, err);
return libbpf_err(err);
}
- err = populate_skeleton_progs(obj, s->progs, s->prog_cnt);
+ err = populate_skeleton_progs(obj, s->progs, s->prog_cnt, s->prog_skel_sz);
if (err) {
pr_warn("failed to populate skeleton progs for '%s': %d\n", s->name, err);
return libbpf_err(err);
@@ -13778,20 +13821,20 @@ int bpf_object__open_subskeleton(struct bpf_object_subskeleton *s)
return libbpf_err(-errno);
}
- err = populate_skeleton_maps(s->obj, s->maps, s->map_cnt);
+ err = populate_skeleton_maps(s->obj, s->maps, s->map_cnt, s->map_skel_sz);
if (err) {
pr_warn("failed to populate subskeleton maps: %d\n", err);
return libbpf_err(err);
}
- err = populate_skeleton_progs(s->obj, s->progs, s->prog_cnt);
+ err = populate_skeleton_progs(s->obj, s->progs, s->prog_cnt, s->prog_skel_sz);
if (err) {
pr_warn("failed to populate subskeleton maps: %d\n", err);
return libbpf_err(err);
}
for (var_idx = 0; var_idx < s->var_cnt; var_idx++) {
- var_skel = &s->vars[var_idx];
+ var_skel = (void *)s->vars + var_idx * s->var_skel_sz;
map = *var_skel->map;
map_type_id = bpf_map__btf_value_type_id(map);
map_type = btf__type_by_id(btf, map_type_id);
@@ -13838,10 +13881,11 @@ int bpf_object__load_skeleton(struct bpf_object_skeleton *s)
}
for (i = 0; i < s->map_cnt; i++) {
- struct bpf_map *map = *s->maps[i].map;
+ struct bpf_map_skeleton *map_skel = (void *)s->maps + i * s->map_skel_sz;
+ struct bpf_map *map = *map_skel->map;
size_t mmap_sz = bpf_map_mmap_sz(map);
int prot, map_fd = map->fd;
- void **mmaped = s->maps[i].mmaped;
+ void **mmaped = map_skel->mmaped;
if (!mmaped)
continue;
@@ -13889,8 +13933,9 @@ int bpf_object__attach_skeleton(struct bpf_object_skeleton *s)
int i, err;
for (i = 0; i < s->prog_cnt; i++) {
- struct bpf_program *prog = *s->progs[i].prog;
- struct bpf_link **link = s->progs[i].link;
+ struct bpf_prog_skeleton *prog_skel = (void *)s->progs + i * s->prog_skel_sz;
+ struct bpf_program *prog = *prog_skel->prog;
+ struct bpf_link **link = prog_skel->link;
if (!prog->autoload || !prog->autoattach)
continue;
@@ -13922,6 +13967,38 @@ int bpf_object__attach_skeleton(struct bpf_object_skeleton *s)
*/
}
+
+ for (i = 0; i < s->map_cnt; i++) {
+ struct bpf_map_skeleton *map_skel = (void *)s->maps + i * s->map_skel_sz;
+ struct bpf_map *map = *map_skel->map;
+ struct bpf_link **link;
+
+ if (!map->autocreate || !map->autoattach)
+ continue;
+
+ /* only struct_ops maps can be attached */
+ if (!bpf_map__is_struct_ops(map))
+ continue;
+
+ /* skeleton is created with earlier version of bpftool, notify user */
+ if (s->map_skel_sz < offsetofend(struct bpf_map_skeleton, link)) {
+ pr_warn("map '%s': BPF skeleton version is old, skipping map auto-attachment...\n",
+ bpf_map__name(map));
+ continue;
+ }
+
+ link = map_skel->link;
+ if (*link)
+ continue;
+
+ *link = bpf_map__attach_struct_ops(map);
+ if (!*link) {
+ err = -errno;
+ pr_warn("map '%s': failed to auto-attach: %d\n", bpf_map__name(map), err);
+ return libbpf_err(err);
+ }
+ }
+
return 0;
}
@@ -13930,11 +14007,25 @@ void bpf_object__detach_skeleton(struct bpf_object_skeleton *s)
int i;
for (i = 0; i < s->prog_cnt; i++) {
- struct bpf_link **link = s->progs[i].link;
+ struct bpf_prog_skeleton *prog_skel = (void *)s->progs + i * s->prog_skel_sz;
+ struct bpf_link **link = prog_skel->link;
bpf_link__destroy(*link);
*link = NULL;
}
+
+ if (s->map_skel_sz < sizeof(struct bpf_map_skeleton))
+ return;
+
+ for (i = 0; i < s->map_cnt; i++) {
+ struct bpf_map_skeleton *map_skel = (void *)s->maps + i * s->map_skel_sz;
+ struct bpf_link **link = map_skel->link;
+
+ if (link) {
+ bpf_link__destroy(*link);
+ *link = NULL;
+ }
+ }
}
void bpf_object__destroy_skeleton(struct bpf_object_skeleton *s)
@@ -13942,8 +14033,7 @@ void bpf_object__destroy_skeleton(struct bpf_object_skeleton *s)
if (!s)
return;
- if (s->progs)
- bpf_object__detach_skeleton(s);
+ bpf_object__detach_skeleton(s);
if (s->obj)
bpf_object__close(*s->obj);
free(s->maps);
diff --git a/tools/lib/bpf/libbpf.h b/tools/lib/bpf/libbpf.h
index c3f77d9260fe..64a6a3d323e3 100644
--- a/tools/lib/bpf/libbpf.h
+++ b/tools/lib/bpf/libbpf.h
@@ -98,7 +98,10 @@ typedef int (*libbpf_print_fn_t)(enum libbpf_print_level level,
/**
* @brief **libbpf_set_print()** sets user-provided log callback function to
- * be used for libbpf warnings and informational messages.
+ * be used for libbpf warnings and informational messages. If the user callback
+ * is not set, messages are logged to stderr by default. The verbosity of these
+ * messages can be controlled by setting the environment variable
+ * LIBBPF_LOG_LEVEL to either warn, info, or debug.
* @param fn The log print function. If NULL, libbpf won't print anything.
* @return Pointer to old print function.
*
@@ -976,6 +979,23 @@ LIBBPF_API int bpf_map__set_autocreate(struct bpf_map *map, bool autocreate);
LIBBPF_API bool bpf_map__autocreate(const struct bpf_map *map);
/**
+ * @brief **bpf_map__set_autoattach()** sets whether libbpf has to auto-attach
+ * map during BPF skeleton attach phase.
+ * @param map the BPF map instance
+ * @param autoattach whether to attach map during BPF skeleton attach phase
+ * @return 0 on success; negative error code, otherwise
+ */
+LIBBPF_API int bpf_map__set_autoattach(struct bpf_map *map, bool autoattach);
+
+/**
+ * @brief **bpf_map__autoattach()** returns whether BPF map is configured to
+ * auto-attach during BPF skeleton attach phase.
+ * @param map the BPF map instance
+ * @return true if map is set to auto-attach during skeleton attach phase; false, otherwise
+ */
+LIBBPF_API bool bpf_map__autoattach(const struct bpf_map *map);
+
+/**
* @brief **bpf_map__fd()** gets the file descriptor of the passed
* BPF map
* @param map the BPF map instance
@@ -1669,6 +1689,7 @@ struct bpf_map_skeleton {
const char *name;
struct bpf_map **map;
void **mmaped;
+ struct bpf_link **link;
};
struct bpf_prog_skeleton {
diff --git a/tools/lib/bpf/libbpf.map b/tools/lib/bpf/libbpf.map
index c1ce8aa3520b..8f0d9ea3b1b4 100644
--- a/tools/lib/bpf/libbpf.map
+++ b/tools/lib/bpf/libbpf.map
@@ -419,6 +419,10 @@ LIBBPF_1.4.0 {
LIBBPF_1.5.0 {
global:
+ btf__distill_base;
+ btf__relocate;
+ bpf_map__autoattach;
+ bpf_map__set_autoattach;
bpf_program__attach_sockmap;
ring__consume_n;
ring_buffer__consume_n;
diff --git a/tools/lib/bpf/libbpf_internal.h b/tools/lib/bpf/libbpf_internal.h
index a0dcfb82e455..408df59e0771 100644
--- a/tools/lib/bpf/libbpf_internal.h
+++ b/tools/lib/bpf/libbpf_internal.h
@@ -234,6 +234,9 @@ struct btf_type;
struct btf_type *btf_type_by_id(const struct btf *btf, __u32 type_id);
const char *btf_kind_str(const struct btf_type *t);
const struct btf_type *skip_mods_and_typedefs(const struct btf *btf, __u32 id, __u32 *res_id);
+const struct btf_header *btf_header(const struct btf *btf);
+void btf_set_base_btf(struct btf *btf, const struct btf *base_btf);
+int btf_relocate(struct btf *btf, const struct btf *base_btf, __u32 **id_map);
static inline enum btf_func_linkage btf_func_linkage(const struct btf_type *t)
{
@@ -508,11 +511,33 @@ struct bpf_line_info_min {
__u32 line_col;
};
+enum btf_field_iter_kind {
+ BTF_FIELD_ITER_IDS,
+ BTF_FIELD_ITER_STRS,
+};
+
+struct btf_field_desc {
+ /* once-per-type offsets */
+ int t_off_cnt, t_offs[2];
+ /* member struct size, or zero, if no members */
+ int m_sz;
+ /* repeated per-member offsets */
+ int m_off_cnt, m_offs[1];
+};
+
+struct btf_field_iter {
+ struct btf_field_desc desc;
+ void *p;
+ int m_idx;
+ int off_idx;
+ int vlen;
+};
+
+int btf_field_iter_init(struct btf_field_iter *it, struct btf_type *t, enum btf_field_iter_kind iter_kind);
+__u32 *btf_field_iter_next(struct btf_field_iter *it);
typedef int (*type_id_visit_fn)(__u32 *type_id, void *ctx);
typedef int (*str_off_visit_fn)(__u32 *str_off, void *ctx);
-int btf_type_visit_type_ids(struct btf_type *t, type_id_visit_fn visit, void *ctx);
-int btf_type_visit_str_offs(struct btf_type *t, str_off_visit_fn visit, void *ctx);
int btf_ext_visit_type_ids(struct btf_ext *btf_ext, type_id_visit_fn visit, void *ctx);
int btf_ext_visit_str_offs(struct btf_ext *btf_ext, str_off_visit_fn visit, void *ctx);
__s32 btf__find_by_name_kind_own(const struct btf *btf, const char *type_name,
@@ -597,13 +622,9 @@ static inline int ensure_good_fd(int fd)
return fd;
}
-static inline int sys_dup2(int oldfd, int newfd)
+static inline int sys_dup3(int oldfd, int newfd, int flags)
{
-#ifdef __NR_dup2
- return syscall(__NR_dup2, oldfd, newfd);
-#else
- return syscall(__NR_dup3, oldfd, newfd, 0);
-#endif
+ return syscall(__NR_dup3, oldfd, newfd, flags);
}
/* Point *fixed_fd* to the same file that *tmp_fd* points to.
@@ -614,7 +635,7 @@ static inline int reuse_fd(int fixed_fd, int tmp_fd)
{
int err;
- err = sys_dup2(tmp_fd, fixed_fd);
+ err = sys_dup3(tmp_fd, fixed_fd, O_CLOEXEC);
err = err < 0 ? -errno : 0;
close(tmp_fd); /* clean up temporary FD */
return err;
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 0d4be829551b..9cd3d4109788 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -957,19 +957,33 @@ static int check_btf_str_off(__u32 *str_off, void *ctx)
static int linker_sanity_check_btf(struct src_obj *obj)
{
struct btf_type *t;
- int i, n, err = 0;
+ int i, n, err;
if (!obj->btf)
return 0;
n = btf__type_cnt(obj->btf);
for (i = 1; i < n; i++) {
+ struct btf_field_iter it;
+ __u32 *type_id, *str_off;
+
t = btf_type_by_id(obj->btf, i);
- err = err ?: btf_type_visit_type_ids(t, check_btf_type_id, obj->btf);
- err = err ?: btf_type_visit_str_offs(t, check_btf_str_off, obj->btf);
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+ while ((type_id = btf_field_iter_next(&it))) {
+ if (*type_id >= n)
+ return -EINVAL;
+ }
+
+ err = btf_field_iter_init(&it, t, BTF_FIELD_ITER_STRS);
if (err)
return err;
+ while ((str_off = btf_field_iter_next(&it))) {
+ if (!btf__str_by_offset(obj->btf, *str_off))
+ return -EINVAL;
+ }
}
return 0;
@@ -2213,10 +2227,17 @@ static int linker_fixup_btf(struct src_obj *obj)
vi = btf_var_secinfos(t);
for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
- const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
- int var_linkage = btf_var(vt)->linkage;
+ const char *var_name;
+ int var_linkage;
Elf64_Sym *sym;
+ /* could be a variable or function */
+ if (!btf_is_var(vt))
+ continue;
+
+ var_name = btf__str_by_offset(obj->btf, vt->name_off);
+ var_linkage = btf_var(vt)->linkage;
+
/* no need to patch up static or extern vars */
if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
continue;
@@ -2234,26 +2255,10 @@ static int linker_fixup_btf(struct src_obj *obj)
return 0;
}
-static int remap_type_id(__u32 *type_id, void *ctx)
-{
- int *id_map = ctx;
- int new_id = id_map[*type_id];
-
- /* Error out if the type wasn't remapped. Ignore VOID which stays VOID. */
- if (new_id == 0 && *type_id != 0) {
- pr_warn("failed to find new ID mapping for original BTF type ID %u\n", *type_id);
- return -EINVAL;
- }
-
- *type_id = id_map[*type_id];
-
- return 0;
-}
-
static int linker_append_btf(struct bpf_linker *linker, struct src_obj *obj)
{
const struct btf_type *t;
- int i, j, n, start_id, id;
+ int i, j, n, start_id, id, err;
const char *name;
if (!obj->btf)
@@ -2324,9 +2329,25 @@ static int linker_append_btf(struct bpf_linker *linker, struct src_obj *obj)
n = btf__type_cnt(linker->btf);
for (i = start_id; i < n; i++) {
struct btf_type *dst_t = btf_type_by_id(linker->btf, i);
+ struct btf_field_iter it;
+ __u32 *type_id;
- if (btf_type_visit_type_ids(dst_t, remap_type_id, obj->btf_type_map))
- return -EINVAL;
+ err = btf_field_iter_init(&it, dst_t, BTF_FIELD_ITER_IDS);
+ if (err)
+ return err;
+
+ while ((type_id = btf_field_iter_next(&it))) {
+ int new_id = obj->btf_type_map[*type_id];
+
+ /* Error out if the type wasn't remapped. Ignore VOID which stays VOID. */
+ if (new_id == 0 && *type_id != 0) {
+ pr_warn("failed to find new ID mapping for original BTF type ID %u\n",
+ *type_id);
+ return -EINVAL;
+ }
+
+ *type_id = obj->btf_type_map[*type_id];
+ }
}
/* Rewrite VAR/FUNC underlying types (i.e., FUNC's FUNC_PROTO and VAR's
diff --git a/tools/memory-model/Documentation/README b/tools/memory-model/Documentation/README
index db90a26dbdf4..304162743a5b 100644
--- a/tools/memory-model/Documentation/README
+++ b/tools/memory-model/Documentation/README
@@ -47,6 +47,10 @@ DESCRIPTION OF FILES
README
This file.
+access-marking.txt
+ Guidelines for marking intentionally concurrent accesses to
+ shared memory.
+
cheatsheet.txt
Quick-reference guide to the Linux-kernel memory model.
diff --git a/tools/memory-model/Documentation/access-marking.txt b/tools/memory-model/Documentation/access-marking.txt
index 65778222183e..3fbe77fd564a 100644
--- a/tools/memory-model/Documentation/access-marking.txt
+++ b/tools/memory-model/Documentation/access-marking.txt
@@ -6,7 +6,8 @@ normal accesses to shared memory, that is "normal" as in accesses that do
not use read-modify-write atomic operations. It also describes how to
document these accesses, both with comments and with special assertions
processed by the Kernel Concurrency Sanitizer (KCSAN). This discussion
-builds on an earlier LWN article [1].
+builds on an earlier LWN article [1] and Linux Foundation mentorship
+session [2].
ACCESS-MARKING OPTIONS
@@ -24,6 +25,11 @@ The Linux kernel provides the following access-marking options:
4. WRITE_ONCE(), for example, "WRITE_ONCE(a, b);"
The various forms of atomic_set() also fit in here.
+5. __data_racy, for example "int __data_racy a;"
+
+6. KCSAN's negative-marking assertions, ASSERT_EXCLUSIVE_ACCESS()
+ and ASSERT_EXCLUSIVE_WRITER(), are described in the
+ "ACCESS-DOCUMENTATION OPTIONS" section below.
These may be used in combination, as shown in this admittedly improbable
example:
@@ -31,7 +37,7 @@ example:
WRITE_ONCE(a, b + data_race(c + d) + READ_ONCE(e));
Neither plain C-language accesses nor data_race() (#1 and #2 above) place
-any sort of constraint on the compiler's choice of optimizations [2].
+any sort of constraint on the compiler's choice of optimizations [3].
In contrast, READ_ONCE() and WRITE_ONCE() (#3 and #4 above) restrict the
compiler's use of code-motion and common-subexpression optimizations.
Therefore, if a given access is involved in an intentional data race,
@@ -205,6 +211,23 @@ because doing otherwise prevents KCSAN from detecting violations of your
code's synchronization rules.
+Use of __data_racy
+------------------
+
+Adding the __data_racy type qualifier to the declaration of a variable
+causes KCSAN to treat all accesses to that variable as if they were
+enclosed by data_race(). However, __data_racy does not affect the
+compiler, though one could imagine hardened kernel builds treating the
+__data_racy type qualifier as if it was the volatile keyword.
+
+Note well that __data_racy is subject to the same pointer-declaration
+rules as are other type qualifiers such as const and volatile.
+For example:
+
+ int __data_racy *p; // Pointer to data-racy data.
+ int *__data_racy p; // Data-racy pointer to non-data-racy data.
+
+
ACCESS-DOCUMENTATION OPTIONS
============================
@@ -342,7 +365,7 @@ as follows:
Because foo is read locklessly, all accesses are marked. The purpose
of the ASSERT_EXCLUSIVE_WRITER() is to allow KCSAN to check for a buggy
-concurrent lockless write.
+concurrent write, whether marked or not.
Lock-Protected Writes With Heuristic Lockless Reads
@@ -594,5 +617,8 @@ REFERENCES
[1] "Concurrency bugs should fear the big bad data-race detector (part 2)"
https://lwn.net/Articles/816854/
-[2] "Who's afraid of a big bad optimizing compiler?"
+[2] "The Kernel Concurrency Sanitizer"
+ https://www.linuxfoundation.org/webinars/the-kernel-concurrency-sanitizer
+
+[3] "Who's afraid of a big bad optimizing compiler?"
https://lwn.net/Articles/793253/
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 53b5a492739d..03c12efed66a 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -54,6 +54,12 @@ flag ~empty LKR \ domain(lk-rmw) as unpaired-LKR
*)
empty ([LKW] ; po-loc ; [LKR]) \ (po-loc ; [UL] ; po-loc) as lock-nest
+(*
+ * In the same way, spin_is_locked() inside a critical section must always
+ * return True (no RU events can be in a critical section for the same lock).
+ *)
+empty ([LKW] ; po-loc ; [RU]) \ (po-loc ; [UL] ; po-loc) as nested-is-locked
+
(* The final value of a spinlock should not be tested *)
flag ~empty [FW] ; loc ; [ALL-LOCKS] as lock-final
@@ -79,42 +85,50 @@ empty ([UNMATCHED-LKW] ; loc ; [UNMATCHED-LKW]) \ id as unmatched-locks
(* rfi for LF events: link each LKW to the LF events in its critical section *)
let rfi-lf = ([LKW] ; po-loc ; [LF]) \ ([LKW] ; po-loc ; [UL] ; po-loc)
-(* rfe for LF events *)
+(* Utility macro to convert a single pair to a single-edge relation *)
+let pair-to-relation p = p ++ 0
+
+(*
+ * If a given LF event e is outside a critical section, it cannot read
+ * internally but it may read from an LKW event in another thread.
+ * Compute the relation containing these possible edges.
+ *)
+let possible-rfe-noncrit-lf e = (LKW * {e}) & loc & ext
+
+(* Compute set of sets of possible rfe edges for LF events *)
let all-possible-rfe-lf =
(*
- * Given an LF event r, compute the possible rfe edges for that event
- * (all those starting from LKW events in other threads),
- * and then convert that relation to a set of single-edge relations.
+ * Convert the possible-rfe-noncrit-lf relation for e
+ * to a set of single edges
*)
- let possible-rfe-lf r =
- let pair-to-relation p = p ++ 0
- in map pair-to-relation ((LKW * {r}) & loc & ext)
- (* Do this for each LF event r that isn't in rfi-lf *)
- in map possible-rfe-lf (LF \ range(rfi-lf))
+ let set-of-singleton-rfe-lf e =
+ map pair-to-relation (possible-rfe-noncrit-lf e)
+ (* Do this for each LF event e that isn't in rfi-lf *)
+ in map set-of-singleton-rfe-lf (LF \ range(rfi-lf))
(* Generate all rf relations for LF events *)
with rfe-lf from cross(all-possible-rfe-lf)
let rf-lf = rfe-lf | rfi-lf
(*
- * RU, i.e., spin_is_locked() returning False, is slightly different.
- * We rely on the memory model to rule out cases where spin_is_locked()
- * within one of the lock's critical sections returns False.
+ * A given RU event e may read internally from the last po-previous UL,
+ * or it may read from a UL event in another thread or the initial write.
+ * Compute the relation containing these possible edges.
*)
-
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
- let possible-rfe-ru r =
- let pair-to-relation p = p ++ 0
- in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
- in map possible-rfe-ru RU
+let possible-rf-ru e = (((UL * {e}) & po-loc) \
+ ([UL] ; po-loc ; [UL] ; po-loc)) |
+ (((UL | IW) * {e}) & loc & ext)
+
+(* Compute set of sets of possible rf edges for RU events *)
+let all-possible-rf-ru =
+ (* Convert the possible-rf-ru relation for e to a set of single edges *)
+ let set-of-singleton-rf-ru e =
+ map pair-to-relation (possible-rf-ru e)
+ (* Do this for each RU event e *)
+ in map set-of-singleton-rf-ru RU
(* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
(* Final rf relation *)
let rf = rf | rf-lf | rf-ru
diff --git a/tools/net/ynl/Makefile b/tools/net/ynl/Makefile
index 8e9e09d84e26..d1cdf2a8f826 100644
--- a/tools/net/ynl/Makefile
+++ b/tools/net/ynl/Makefile
@@ -2,9 +2,12 @@
SUBDIRS = lib generated samples
-all: $(SUBDIRS)
+all: $(SUBDIRS) libynl.a
samples: | lib generated
+libynl.a: | lib generated
+ @echo -e "\tAR $@"
+ @ar rcs $@ lib/ynl.o generated/*-user.o
$(SUBDIRS):
@if [ -f "$@/Makefile" ] ; then \
@@ -17,5 +20,6 @@ clean distclean:
$(MAKE) -C $$dir $@; \
fi \
done
+ rm -f libynl.a
.PHONY: all clean distclean $(SUBDIRS)
diff --git a/tools/net/ynl/Makefile.deps b/tools/net/ynl/Makefile.deps
index f4e8eb79c1b8..0712b5e82eb7 100644
--- a/tools/net/ynl/Makefile.deps
+++ b/tools/net/ynl/Makefile.deps
@@ -16,7 +16,8 @@ get_hdr_inc=-D$(1) -include $(UAPI_PATH)/linux/$(2)
CFLAGS_devlink:=$(call get_hdr_inc,_LINUX_DEVLINK_H_,devlink.h)
CFLAGS_dpll:=$(call get_hdr_inc,_LINUX_DPLL_H,dpll.h)
-CFLAGS_ethtool:=$(call get_hdr_inc,_LINUX_ETHTOOL_NETLINK_H_,ethtool_netlink.h)
+CFLAGS_ethtool:=$(call get_hdr_inc,_LINUX_ETHTOOL_H,ethtool.h) \
+ $(call get_hdr_inc,_LINUX_ETHTOOL_NETLINK_H_,ethtool_netlink.h)
CFLAGS_handshake:=$(call get_hdr_inc,_LINUX_HANDSHAKE_H,handshake.h)
CFLAGS_mptcp_pm:=$(call get_hdr_inc,_LINUX_MPTCP_PM_H,mptcp_pm.h)
CFLAGS_netdev:=$(call get_hdr_inc,_LINUX_NETDEV_H,netdev.h)
@@ -25,3 +26,4 @@ CFLAGS_nfsd:=$(call get_hdr_inc,_LINUX_NFSD_NETLINK_H,nfsd_netlink.h)
CFLAGS_ovs_datapath:=$(call get_hdr_inc,__LINUX_OPENVSWITCH_H,openvswitch.h)
CFLAGS_ovs_flow:=$(call get_hdr_inc,__LINUX_OPENVSWITCH_H,openvswitch.h)
CFLAGS_ovs_vport:=$(call get_hdr_inc,__LINUX_OPENVSWITCH_H,openvswitch.h)
+CFLAGS_tcp_metrics:=$(call get_hdr_inc,_LINUX_TCP_METRICS_H,tcp_metrics.h)
diff --git a/tools/net/ynl/lib/Makefile b/tools/net/ynl/lib/Makefile
index dfff3ecd1cba..2887cc5de530 100644
--- a/tools/net/ynl/lib/Makefile
+++ b/tools/net/ynl/lib/Makefile
@@ -14,7 +14,9 @@ include $(wildcard *.d)
all: ynl.a
ynl.a: $(OBJS)
- ar rcs $@ $(OBJS)
+ @echo -e "\tAR $@"
+ @ar rcs $@ $(OBJS)
+
clean:
rm -f *.o *.d *~
rm -rf __pycache__
diff --git a/tools/net/ynl/lib/ynl-priv.h b/tools/net/ynl/lib/ynl-priv.h
index 6cf890080dc0..3c09a7bbfba5 100644
--- a/tools/net/ynl/lib/ynl-priv.h
+++ b/tools/net/ynl/lib/ynl-priv.h
@@ -45,17 +45,17 @@ struct ynl_policy_attr {
enum ynl_policy_type type;
unsigned int len;
const char *name;
- struct ynl_policy_nest *nest;
+ const struct ynl_policy_nest *nest;
};
struct ynl_policy_nest {
unsigned int max_attr;
- struct ynl_policy_attr *table;
+ const struct ynl_policy_attr *table;
};
struct ynl_parse_arg {
struct ynl_sock *ys;
- struct ynl_policy_nest *rsp_policy;
+ const struct ynl_policy_nest *rsp_policy;
void *data;
};
@@ -79,7 +79,7 @@ static inline void *ynl_dump_obj_next(void *obj)
struct ynl_dump_list_type *list;
uptr -= offsetof(struct ynl_dump_list_type, data);
- list = (void *)uptr;
+ list = (struct ynl_dump_list_type *)uptr;
uptr = (unsigned long)list->next;
uptr += offsetof(struct ynl_dump_list_type, data);
@@ -119,7 +119,7 @@ struct ynl_dump_state {
};
struct ynl_ntf_info {
- struct ynl_policy_nest *policy;
+ const struct ynl_policy_nest *policy;
ynl_parse_cb_t cb;
size_t alloc_sz;
void (*free)(struct ynl_ntf_base_type *ntf);
@@ -139,7 +139,7 @@ int ynl_error_parse(struct ynl_parse_arg *yarg, const char *msg);
static inline struct nlmsghdr *ynl_nlmsg_put_header(void *buf)
{
- struct nlmsghdr *nlh = buf;
+ struct nlmsghdr *nlh = (struct nlmsghdr *)buf;
memset(nlh, 0, sizeof(*nlh));
nlh->nlmsg_len = NLMSG_HDRLEN;
@@ -196,7 +196,7 @@ static inline void *ynl_attr_data(const struct nlattr *attr)
static inline void *ynl_attr_data_end(const struct nlattr *attr)
{
- return ynl_attr_data(attr) + ynl_attr_data_len(attr);
+ return (char *)ynl_attr_data(attr) + ynl_attr_data_len(attr);
}
#define ynl_attr_for_each(attr, nlh, fixed_hdr_sz) \
@@ -228,7 +228,7 @@ ynl_attr_next(const void *end, const struct nlattr *prev)
{
struct nlattr *attr;
- attr = (void *)((char *)prev + NLA_ALIGN(prev->nla_len));
+ attr = (struct nlattr *)((char *)prev + NLA_ALIGN(prev->nla_len));
return ynl_attr_if_good(end, attr);
}
@@ -237,8 +237,8 @@ ynl_attr_first(const void *start, size_t len, size_t skip)
{
struct nlattr *attr;
- attr = (void *)((char *)start + NLMSG_ALIGN(skip));
- return ynl_attr_if_good(start + len, attr);
+ attr = (struct nlattr *)((char *)start + NLMSG_ALIGN(skip));
+ return ynl_attr_if_good((char *)start + len, attr);
}
static inline bool
@@ -262,9 +262,9 @@ ynl_attr_nest_start(struct nlmsghdr *nlh, unsigned int attr_type)
struct nlattr *attr;
if (__ynl_attr_put_overflow(nlh, 0))
- return ynl_nlmsg_end_addr(nlh) - NLA_HDRLEN;
+ return (struct nlattr *)ynl_nlmsg_end_addr(nlh) - 1;
- attr = ynl_nlmsg_end_addr(nlh);
+ attr = (struct nlattr *)ynl_nlmsg_end_addr(nlh);
attr->nla_type = attr_type | NLA_F_NESTED;
nlh->nlmsg_len += NLA_HDRLEN;
@@ -286,7 +286,7 @@ ynl_attr_put(struct nlmsghdr *nlh, unsigned int attr_type,
if (__ynl_attr_put_overflow(nlh, size))
return;
- attr = ynl_nlmsg_end_addr(nlh);
+ attr = (struct nlattr *)ynl_nlmsg_end_addr(nlh);
attr->nla_type = attr_type;
attr->nla_len = NLA_HDRLEN + size;
@@ -305,10 +305,10 @@ ynl_attr_put_str(struct nlmsghdr *nlh, unsigned int attr_type, const char *str)
if (__ynl_attr_put_overflow(nlh, len))
return;
- attr = ynl_nlmsg_end_addr(nlh);
+ attr = (struct nlattr *)ynl_nlmsg_end_addr(nlh);
attr->nla_type = attr_type;
- strcpy(ynl_attr_data(attr), str);
+ strcpy((char *)ynl_attr_data(attr), str);
attr->nla_len = NLA_HDRLEN + NLA_ALIGN(len);
nlh->nlmsg_len += NLMSG_ALIGN(attr->nla_len);
diff --git a/tools/net/ynl/lib/ynl.c b/tools/net/ynl/lib/ynl.c
index 4b9c091fc86b..fcb18a5a6d70 100644
--- a/tools/net/ynl/lib/ynl.c
+++ b/tools/net/ynl/lib/ynl.c
@@ -46,7 +46,7 @@
/* -- Netlink boiler plate */
static int
-ynl_err_walk_report_one(struct ynl_policy_nest *policy, unsigned int type,
+ynl_err_walk_report_one(const struct ynl_policy_nest *policy, unsigned int type,
char *str, int str_sz, int *n)
{
if (!policy) {
@@ -75,8 +75,8 @@ ynl_err_walk_report_one(struct ynl_policy_nest *policy, unsigned int type,
static int
ynl_err_walk(struct ynl_sock *ys, void *start, void *end, unsigned int off,
- struct ynl_policy_nest *policy, char *str, int str_sz,
- struct ynl_policy_nest **nest_pol)
+ const struct ynl_policy_nest *policy, char *str, int str_sz,
+ const struct ynl_policy_nest **nest_pol)
{
unsigned int astart_off, aend_off;
const struct nlattr *attr;
@@ -206,7 +206,7 @@ ynl_ext_ack_check(struct ynl_sock *ys, const struct nlmsghdr *nlh,
bad_attr[n] = '\0';
}
if (tb[NLMSGERR_ATTR_MISS_TYPE]) {
- struct ynl_policy_nest *nest_pol = NULL;
+ const struct ynl_policy_nest *nest_pol = NULL;
unsigned int n, off, type;
void *start, *end;
int n2;
@@ -296,7 +296,7 @@ static int ynl_cb_done(const struct nlmsghdr *nlh, struct ynl_parse_arg *yarg)
int ynl_attr_validate(struct ynl_parse_arg *yarg, const struct nlattr *attr)
{
- struct ynl_policy_attr *policy;
+ const struct ynl_policy_attr *policy;
unsigned int type, len;
unsigned char *data;
diff --git a/tools/net/ynl/lib/ynl.h b/tools/net/ynl/lib/ynl.h
index eef7c6324ed4..6cd570b283ea 100644
--- a/tools/net/ynl/lib/ynl.h
+++ b/tools/net/ynl/lib/ynl.h
@@ -76,7 +76,7 @@ struct ynl_sock {
struct ynl_ntf_base_type **ntf_last_next;
struct nlmsghdr *nlh;
- struct ynl_policy_nest *req_policy;
+ const struct ynl_policy_nest *req_policy;
unsigned char *tx_buf;
unsigned char *rx_buf;
unsigned char raw_buf[];
diff --git a/tools/net/ynl/lib/ynl.py b/tools/net/ynl/lib/ynl.py
index 35e666928119..d42c1d605969 100644
--- a/tools/net/ynl/lib/ynl.py
+++ b/tools/net/ynl/lib/ynl.py
@@ -743,6 +743,8 @@ class YnlFamily(SpecFamily):
decoded = attr.as_scalar(attr_spec['type'], attr_spec.byte_order)
if 'enum' in attr_spec:
decoded = self._decode_enum(decoded, attr_spec)
+ elif attr_spec.display_hint:
+ decoded = self._formatted_string(decoded, attr_spec.display_hint)
elif attr_spec["type"] == 'indexed-array':
decoded = self._decode_array_attr(attr, attr_spec)
elif attr_spec["type"] == 'bitfield32':
diff --git a/tools/net/ynl/ynl-gen-c.py b/tools/net/ynl/ynl-gen-c.py
index a42d62b23ee0..51529fabd517 100755
--- a/tools/net/ynl/ynl-gen-c.py
+++ b/tools/net/ynl/ynl-gen-c.py
@@ -59,9 +59,9 @@ class Type(SpecAttr):
if 'nested-attributes' in attr:
self.nested_attrs = attr['nested-attributes']
if self.nested_attrs == family.name:
- self.nested_render_name = c_lower(f"{family.name}")
+ self.nested_render_name = c_lower(f"{family.ident_name}")
else:
- self.nested_render_name = c_lower(f"{family.name}_{self.nested_attrs}")
+ self.nested_render_name = c_lower(f"{family.ident_name}_{self.nested_attrs}")
if self.nested_attrs in self.family.consts:
self.nested_struct_type = 'struct ' + self.nested_render_name + '_'
@@ -693,9 +693,9 @@ class Struct:
self.nested = type_list is None
if family.name == c_lower(space_name):
- self.render_name = c_lower(family.name)
+ self.render_name = c_lower(family.ident_name)
else:
- self.render_name = c_lower(family.name + '-' + space_name)
+ self.render_name = c_lower(family.ident_name + '-' + space_name)
self.struct_name = 'struct ' + self.render_name
if self.nested and space_name in family.consts:
self.struct_name += '_'
@@ -761,7 +761,7 @@ class EnumEntry(SpecEnumEntry):
class EnumSet(SpecEnumSet):
def __init__(self, family, yaml):
- self.render_name = c_lower(family.name + '-' + yaml['name'])
+ self.render_name = c_lower(family.ident_name + '-' + yaml['name'])
if 'enum-name' in yaml:
if yaml['enum-name']:
@@ -777,7 +777,7 @@ class EnumSet(SpecEnumSet):
else:
self.user_type = 'int'
- self.value_pfx = yaml.get('name-prefix', f"{family.name}-{yaml['name']}-")
+ self.value_pfx = yaml.get('name-prefix', f"{family.ident_name}-{yaml['name']}-")
super().__init__(family, yaml)
@@ -802,9 +802,9 @@ class AttrSet(SpecAttrSet):
if 'name-prefix' in yaml:
pfx = yaml['name-prefix']
elif self.name == family.name:
- pfx = family.name + '-a-'
+ pfx = family.ident_name + '-a-'
else:
- pfx = f"{family.name}-a-{self.name}-"
+ pfx = f"{family.ident_name}-a-{self.name}-"
self.name_prefix = c_upper(pfx)
self.max_name = c_upper(self.yaml.get('attr-max-name', f"{self.name_prefix}max"))
self.cnt_name = c_upper(self.yaml.get('attr-cnt-name', f"__{self.name_prefix}max"))
@@ -861,7 +861,7 @@ class Operation(SpecOperation):
def __init__(self, family, yaml, req_value, rsp_value):
super().__init__(family, yaml, req_value, rsp_value)
- self.render_name = c_lower(family.name + '_' + self.name)
+ self.render_name = c_lower(family.ident_name + '_' + self.name)
self.dual_policy = ('do' in yaml and 'request' in yaml['do']) and \
('dump' in yaml and 'request' in yaml['dump'])
@@ -911,11 +911,11 @@ class Family(SpecFamily):
if 'uapi-header' in self.yaml:
self.uapi_header = self.yaml['uapi-header']
else:
- self.uapi_header = f"linux/{self.name}.h"
+ self.uapi_header = f"linux/{self.ident_name}.h"
if self.uapi_header.startswith("linux/") and self.uapi_header.endswith('.h'):
self.uapi_header_name = self.uapi_header[6:-2]
else:
- self.uapi_header_name = self.name
+ self.uapi_header_name = self.ident_name
def resolve(self):
self.resolve_up(super())
@@ -923,7 +923,7 @@ class Family(SpecFamily):
if self.yaml.get('protocol', 'genetlink') not in {'genetlink', 'genetlink-c', 'genetlink-legacy'}:
raise Exception("Codegen only supported for genetlink")
- self.c_name = c_lower(self.name)
+ self.c_name = c_lower(self.ident_name)
if 'name-prefix' in self.yaml['operations']:
self.op_prefix = c_upper(self.yaml['operations']['name-prefix'])
else:
@@ -1507,12 +1507,12 @@ def print_dump_prototype(ri):
def put_typol_fwd(cw, struct):
- cw.p(f'extern struct ynl_policy_nest {struct.render_name}_nest;')
+ cw.p(f'extern const struct ynl_policy_nest {struct.render_name}_nest;')
def put_typol(cw, struct):
type_max = struct.attr_set.max_name
- cw.block_start(line=f'struct ynl_policy_attr {struct.render_name}_policy[{type_max} + 1] =')
+ cw.block_start(line=f'const struct ynl_policy_attr {struct.render_name}_policy[{type_max} + 1] =')
for _, arg in struct.member_list():
arg.attr_typol(cw)
@@ -1520,7 +1520,7 @@ def put_typol(cw, struct):
cw.block_end(line=';')
cw.nl()
- cw.block_start(line=f'struct ynl_policy_nest {struct.render_name}_nest =')
+ cw.block_start(line=f'const struct ynl_policy_nest {struct.render_name}_nest =')
cw.p(f'.max_attr = {type_max},')
cw.p(f'.table = {struct.render_name}_policy,')
cw.block_end(line=';')
@@ -2173,7 +2173,7 @@ def print_kernel_op_table_fwd(family, cw, terminate):
exported = not kernel_can_gen_family_struct(family)
if not terminate or exported:
- cw.p(f"/* Ops table for {family.name} */")
+ cw.p(f"/* Ops table for {family.ident_name} */")
pol_to_struct = {'global': 'genl_small_ops',
'per-op': 'genl_ops',
@@ -2225,12 +2225,12 @@ def print_kernel_op_table_fwd(family, cw, terminate):
continue
if 'do' in op:
- name = c_lower(f"{family.name}-nl-{op_name}-doit")
+ name = c_lower(f"{family.ident_name}-nl-{op_name}-doit")
cw.write_func_prot('int', name,
['struct sk_buff *skb', 'struct genl_info *info'], suffix=';')
if 'dump' in op:
- name = c_lower(f"{family.name}-nl-{op_name}-dumpit")
+ name = c_lower(f"{family.ident_name}-nl-{op_name}-dumpit")
cw.write_func_prot('int', name,
['struct sk_buff *skb', 'struct netlink_callback *cb'], suffix=';')
cw.nl()
@@ -2256,13 +2256,13 @@ def print_kernel_op_table(family, cw):
for x in op['dont-validate']])), )
for op_mode in ['do', 'dump']:
if op_mode in op:
- name = c_lower(f"{family.name}-nl-{op_name}-{op_mode}it")
+ name = c_lower(f"{family.ident_name}-nl-{op_name}-{op_mode}it")
members.append((op_mode + 'it', name))
if family.kernel_policy == 'per-op':
struct = Struct(family, op['attribute-set'],
type_list=op['do']['request']['attributes'])
- name = c_lower(f"{family.name}-{op_name}-nl-policy")
+ name = c_lower(f"{family.ident_name}-{op_name}-nl-policy")
members.append(('policy', name))
members.append(('maxattr', struct.attr_max_val.enum_name))
if 'flags' in op:
@@ -2294,7 +2294,7 @@ def print_kernel_op_table(family, cw):
members.append(('validate',
' | '.join([c_upper('genl-dont-validate-' + x)
for x in dont_validate])), )
- name = c_lower(f"{family.name}-nl-{op_name}-{op_mode}it")
+ name = c_lower(f"{family.ident_name}-nl-{op_name}-{op_mode}it")
if 'pre' in op[op_mode]:
members.append((cb_names[op_mode]['pre'], c_lower(op[op_mode]['pre'])))
members.append((op_mode + 'it', name))
@@ -2305,9 +2305,9 @@ def print_kernel_op_table(family, cw):
type_list=op[op_mode]['request']['attributes'])
if op.dual_policy:
- name = c_lower(f"{family.name}-{op_name}-{op_mode}-nl-policy")
+ name = c_lower(f"{family.ident_name}-{op_name}-{op_mode}-nl-policy")
else:
- name = c_lower(f"{family.name}-{op_name}-nl-policy")
+ name = c_lower(f"{family.ident_name}-{op_name}-nl-policy")
members.append(('policy', name))
members.append(('maxattr', struct.attr_max_val.enum_name))
flags = (op['flags'] if 'flags' in op else []) + ['cmd-cap-' + op_mode]
@@ -2326,7 +2326,7 @@ def print_kernel_mcgrp_hdr(family, cw):
cw.block_start('enum')
for grp in family.mcgrps['list']:
- grp_id = c_upper(f"{family.name}-nlgrp-{grp['name']},")
+ grp_id = c_upper(f"{family.ident_name}-nlgrp-{grp['name']},")
cw.p(grp_id)
cw.block_end(';')
cw.nl()
@@ -2339,7 +2339,7 @@ def print_kernel_mcgrp_src(family, cw):
cw.block_start('static const struct genl_multicast_group ' + family.c_name + '_nl_mcgrps[] =')
for grp in family.mcgrps['list']:
name = grp['name']
- grp_id = c_upper(f"{family.name}-nlgrp-{name}")
+ grp_id = c_upper(f"{family.ident_name}-nlgrp-{name}")
cw.p('[' + grp_id + '] = { "' + name + '", },')
cw.block_end(';')
cw.nl()
@@ -2361,7 +2361,7 @@ def print_kernel_family_struct_src(family, cw):
if not kernel_can_gen_family_struct(family):
return
- cw.block_start(f"struct genl_family {family.name}_nl_family __ro_after_init =")
+ cw.block_start(f"struct genl_family {family.ident_name}_nl_family __ro_after_init =")
cw.p('.name\t\t= ' + family.fam_key + ',')
cw.p('.version\t= ' + family.ver_key + ',')
cw.p('.netnsok\t= true,')
@@ -2429,7 +2429,7 @@ def render_uapi(family, cw):
cw.p(' */')
uapi_enum_start(family, cw, const, 'name')
- name_pfx = const.get('name-prefix', f"{family.name}-{const['name']}-")
+ name_pfx = const.get('name-prefix', f"{family.ident_name}-{const['name']}-")
for entry in enum.entries.values():
suffix = ','
if entry.value_change:
@@ -2451,7 +2451,7 @@ def render_uapi(family, cw):
cw.nl()
elif const['type'] == 'const':
defines.append([c_upper(family.get('c-define-name',
- f"{family.name}-{const['name']}")),
+ f"{family.ident_name}-{const['name']}")),
const['value']])
if defines:
@@ -2529,7 +2529,7 @@ def render_uapi(family, cw):
defines = []
for grp in family.mcgrps['list']:
name = grp['name']
- defines.append([c_upper(grp.get('c-define-name', f"{family.name}-mcgrp-{name}")),
+ defines.append([c_upper(grp.get('c-define-name', f"{family.ident_name}-mcgrp-{name}")),
f'{name}'])
cw.nl()
if defines:
diff --git a/tools/net/ynl/ynl-gen-rst.py b/tools/net/ynl/ynl-gen-rst.py
index 657e881d2ea4..6c56d0d726b4 100755
--- a/tools/net/ynl/ynl-gen-rst.py
+++ b/tools/net/ynl/ynl-gen-rst.py
@@ -49,7 +49,7 @@ def inline(text: str) -> str:
def sanitize(text: str) -> str:
"""Remove newlines and multiple spaces"""
# This is useful for some fields that are spread across multiple lines
- return str(text).replace("\n", "").strip()
+ return str(text).replace("\n", " ").strip()
def rst_fields(key: str, value: str, level: int = 0) -> str:
@@ -156,7 +156,10 @@ def parse_do(do_dict: Dict[str, Any], level: int = 0) -> str:
lines = []
for key in do_dict.keys():
lines.append(rst_paragraph(bold(key), level + 1))
- lines.append(parse_do_attributes(do_dict[key], level + 1) + "\n")
+ if key in ['request', 'reply']:
+ lines.append(parse_do_attributes(do_dict[key], level + 1) + "\n")
+ else:
+ lines.append(headroom(level + 2) + do_dict[key] + "\n")
return "\n".join(lines)
@@ -172,13 +175,13 @@ def parse_do_attributes(attrs: Dict[str, Any], level: int = 0) -> str:
def parse_operations(operations: List[Dict[str, Any]], namespace: str) -> str:
"""Parse operations block"""
- preprocessed = ["name", "doc", "title", "do", "dump"]
+ preprocessed = ["name", "doc", "title", "do", "dump", "flags"]
linkable = ["fixed-header", "attribute-set"]
lines = []
for operation in operations:
lines.append(rst_section(namespace, 'operation', operation["name"]))
- lines.append(rst_paragraph(sanitize(operation["doc"])) + "\n")
+ lines.append(rst_paragraph(operation["doc"]) + "\n")
for key in operation.keys():
if key in preprocessed:
@@ -188,6 +191,8 @@ def parse_operations(operations: List[Dict[str, Any]], namespace: str) -> str:
if key in linkable:
value = rst_ref(namespace, key, value)
lines.append(rst_fields(key, value, 0))
+ if 'flags' in operation:
+ lines.append(rst_fields('flags', rst_list_inline(operation['flags'])))
if "do" in operation:
lines.append(rst_paragraph(":do:", 0))
diff --git a/tools/objtool/Documentation/objtool.txt b/tools/objtool/Documentation/objtool.txt
index fe39c2a8ef0d..7c3ee959b63c 100644
--- a/tools/objtool/Documentation/objtool.txt
+++ b/tools/objtool/Documentation/objtool.txt
@@ -284,6 +284,25 @@ the objtool maintainers.
Otherwise the stack frame may not get created before the call.
+ objtool can help with pinpointing the exact function where it happens:
+
+ $ OBJTOOL_ARGS="--verbose" make arch/x86/kvm/
+
+ arch/x86/kvm/kvm.o: warning: objtool: .altinstr_replacement+0xc5: call without frame pointer save/setup
+ arch/x86/kvm/kvm.o: warning: objtool: em_loop.part.0+0x29: (alt)
+ arch/x86/kvm/kvm.o: warning: objtool: em_loop.part.0+0x0: <=== (sym)
+ LD [M] arch/x86/kvm/kvm-intel.o
+ 0000 0000000000028220 <em_loop.part.0>:
+ 0000 28220: 0f b6 47 61 movzbl 0x61(%rdi),%eax
+ 0004 28224: 3c e2 cmp $0xe2,%al
+ 0006 28226: 74 2c je 28254 <em_loop.part.0+0x34>
+ 0008 28228: 48 8b 57 10 mov 0x10(%rdi),%rdx
+ 000c 2822c: 83 f0 05 xor $0x5,%eax
+ 000f 2822f: 48 c1 e0 04 shl $0x4,%rax
+ 0013 28233: 25 f0 00 00 00 and $0xf0,%eax
+ 0018 28238: 81 e2 d5 08 00 00 and $0x8d5,%edx
+ 001e 2823e: 80 ce 02 or $0x2,%dh
+ ...
2. file.o: warning: objtool: .text+0x53: unreachable instruction
diff --git a/tools/objtool/arch/x86/decode.c b/tools/objtool/arch/x86/decode.c
index 3a1d80a7878d..ed6bff0e01dc 100644
--- a/tools/objtool/arch/x86/decode.c
+++ b/tools/objtool/arch/x86/decode.c
@@ -125,8 +125,14 @@ bool arch_pc_relative_reloc(struct reloc *reloc)
#define is_RIP() ((modrm_rm & 7) == CFI_BP && modrm_mod == 0)
#define have_SIB() ((modrm_rm & 7) == CFI_SP && mod_is_mem())
+/*
+ * Check the ModRM register. If there is a SIB byte then check with
+ * the SIB base register. But if the SIB base is 5 (i.e. CFI_BP) and
+ * ModRM mod is 0 then there is no base register.
+ */
#define rm_is(reg) (have_SIB() ? \
- sib_base == (reg) && sib_index == CFI_SP : \
+ sib_base == (reg) && sib_index == CFI_SP && \
+ (sib_base != CFI_BP || modrm_mod != 0) : \
modrm_rm == (reg))
#define rm_is_mem(reg) (mod_is_mem() && !is_RIP() && rm_is(reg))
diff --git a/tools/objtool/arch/x86/special.c b/tools/objtool/arch/x86/special.c
index 4134d27c696b..4ea0f9815fda 100644
--- a/tools/objtool/arch/x86/special.c
+++ b/tools/objtool/arch/x86/special.c
@@ -9,6 +9,29 @@
void arch_handle_alternative(unsigned short feature, struct special_alt *alt)
{
+ static struct special_alt *group, *prev;
+
+ /*
+ * Recompute orig_len for nested ALTERNATIVE()s.
+ */
+ if (group && group->orig_sec == alt->orig_sec &&
+ group->orig_off == alt->orig_off) {
+
+ struct special_alt *iter = group;
+ for (;;) {
+ unsigned int len = max(iter->orig_len, alt->orig_len);
+ iter->orig_len = alt->orig_len = len;
+
+ if (iter == prev)
+ break;
+
+ iter = list_next_entry(iter, list);
+ }
+
+ } else group = alt;
+
+ prev = alt;
+
switch (feature) {
case X86_FEATURE_SMAP:
/*
diff --git a/tools/objtool/builtin-check.c b/tools/objtool/builtin-check.c
index 5e21cfb7661d..387d56a7f5fb 100644
--- a/tools/objtool/builtin-check.c
+++ b/tools/objtool/builtin-check.c
@@ -144,7 +144,7 @@ static bool opts_valid(void)
opts.static_call ||
opts.uaccess) {
if (opts.dump_orc) {
- ERROR("--dump can't be combined with other options");
+ ERROR("--dump can't be combined with other actions");
return false;
}
@@ -159,7 +159,7 @@ static bool opts_valid(void)
if (opts.dump_orc)
return true;
- ERROR("At least one command required");
+ ERROR("At least one action required");
return false;
}
diff --git a/tools/objtool/noreturns.h b/tools/objtool/noreturns.h
index 7ebf29c91184..1e8141ef1b15 100644
--- a/tools/objtool/noreturns.h
+++ b/tools/objtool/noreturns.h
@@ -7,12 +7,16 @@
* Yes, this is unfortunate. A better solution is in the works.
*/
NORETURN(__fortify_panic)
+NORETURN(__ia32_sys_exit)
+NORETURN(__ia32_sys_exit_group)
NORETURN(__kunit_abort)
NORETURN(__module_put_and_kthread_exit)
NORETURN(__reiserfs_panic)
NORETURN(__stack_chk_fail)
NORETURN(__tdx_hypercall_failed)
NORETURN(__ubsan_handle_builtin_unreachable)
+NORETURN(__x64_sys_exit)
+NORETURN(__x64_sys_exit_group)
NORETURN(arch_cpu_idle_dead)
NORETURN(bch2_trans_in_restart_error)
NORETURN(bch2_trans_restart_error)
diff --git a/tools/objtool/special.c b/tools/objtool/special.c
index 91b1950f5bd8..097a69db82a0 100644
--- a/tools/objtool/special.c
+++ b/tools/objtool/special.c
@@ -84,6 +84,14 @@ static int get_alt_entry(struct elf *elf, const struct special_entry *entry,
entry->new_len);
}
+ orig_reloc = find_reloc_by_dest(elf, sec, offset + entry->orig);
+ if (!orig_reloc) {
+ WARN_FUNC("can't find orig reloc", sec, offset + entry->orig);
+ return -1;
+ }
+
+ reloc_to_sec_off(orig_reloc, &alt->orig_sec, &alt->orig_off);
+
if (entry->feature) {
unsigned short feature;
@@ -94,14 +102,6 @@ static int get_alt_entry(struct elf *elf, const struct special_entry *entry,
arch_handle_alternative(feature, alt);
}
- orig_reloc = find_reloc_by_dest(elf, sec, offset + entry->orig);
- if (!orig_reloc) {
- WARN_FUNC("can't find orig reloc", sec, offset + entry->orig);
- return -1;
- }
-
- reloc_to_sec_off(orig_reloc, &alt->orig_sec, &alt->orig_off);
-
if (!entry->group || alt->new_len) {
new_reloc = find_reloc_by_dest(elf, sec, offset + entry->new);
if (!new_reloc) {
diff --git a/tools/perf/Makefile.perf b/tools/perf/Makefile.perf
index 5c35c0d89306..e6d56b555369 100644
--- a/tools/perf/Makefile.perf
+++ b/tools/perf/Makefile.perf
@@ -214,6 +214,7 @@ NON_CONFIG_TARGETS := clean python-clean TAGS tags cscope help
ifdef MAKECMDGOALS
ifeq ($(filter-out $(NON_CONFIG_TARGETS),$(MAKECMDGOALS)),)
+ VMLINUX_H=$(src-perf)/util/bpf_skel/vmlinux/vmlinux.h
config := 0
endif
endif
diff --git a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
index 532b855df589..1464c6be6eb3 100644
--- a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
+++ b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
@@ -376,3 +376,4 @@
459 n64 lsm_get_self_attr sys_lsm_get_self_attr
460 n64 lsm_set_self_attr sys_lsm_set_self_attr
461 n64 lsm_list_modules sys_lsm_list_modules
+462 n64 mseal sys_mseal
diff --git a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
index 17173b82ca21..3656f1ca7a21 100644
--- a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
@@ -548,3 +548,4 @@
459 common lsm_get_self_attr sys_lsm_get_self_attr
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
diff --git a/tools/perf/arch/s390/entry/syscalls/syscall.tbl b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
index 095bb86339a7..bd0fee24ad10 100644
--- a/tools/perf/arch/s390/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
@@ -464,3 +464,4 @@
459 common lsm_get_self_attr sys_lsm_get_self_attr sys_lsm_get_self_attr
460 common lsm_set_self_attr sys_lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal sys_mseal
diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
index 7e8d46f4147f..a396f6e6ab5b 100644
--- a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
+++ b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
@@ -374,7 +374,7 @@
450 common set_mempolicy_home_node sys_set_mempolicy_home_node
451 common cachestat sys_cachestat
452 common fchmodat2 sys_fchmodat2
-453 64 map_shadow_stack sys_map_shadow_stack
+453 common map_shadow_stack sys_map_shadow_stack
454 common futex_wake sys_futex_wake
455 common futex_wait sys_futex_wait
456 common futex_requeue sys_futex_requeue
@@ -383,6 +383,7 @@
459 common lsm_get_self_attr sys_lsm_get_self_attr
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
+462 common mseal sys_mseal
#
# Due to a historical design error, certain syscalls are numbered differently
diff --git a/tools/perf/builtin-record.c b/tools/perf/builtin-record.c
index 66a3de8ac661..0a8ba1323d64 100644
--- a/tools/perf/builtin-record.c
+++ b/tools/perf/builtin-record.c
@@ -1956,8 +1956,7 @@ static void record__read_lost_samples(struct record *rec)
if (count.lost) {
if (!lost) {
- lost = zalloc(sizeof(*lost) +
- session->machines.host.id_hdr_size);
+ lost = zalloc(PERF_SAMPLE_MAX_SIZE);
if (!lost) {
pr_debug("Memory allocation failed\n");
return;
@@ -1973,8 +1972,7 @@ static void record__read_lost_samples(struct record *rec)
lost_count = perf_bpf_filter__lost_count(evsel);
if (lost_count) {
if (!lost) {
- lost = zalloc(sizeof(*lost) +
- session->machines.host.id_hdr_size);
+ lost = zalloc(PERF_SAMPLE_MAX_SIZE);
if (!lost) {
pr_debug("Memory allocation failed\n");
return;
diff --git a/tools/perf/builtin-trace.c b/tools/perf/builtin-trace.c
index 51eca671c797..08a3a6effac1 100644
--- a/tools/perf/builtin-trace.c
+++ b/tools/perf/builtin-trace.c
@@ -765,7 +765,7 @@ static const char *fcntl_cmds[] = {
static DEFINE_STRARRAY(fcntl_cmds, "F_");
static const char *fcntl_linux_specific_cmds[] = {
- "SETLEASE", "GETLEASE", "NOTIFY", [5] = "CANCELLK", "DUPFD_CLOEXEC",
+ "SETLEASE", "GETLEASE", "NOTIFY", "DUPFD_QUERY", [5] = "CANCELLK", "DUPFD_CLOEXEC",
"SETPIPE_SZ", "GETPIPE_SZ", "ADD_SEALS", "GET_SEALS",
"GET_RW_HINT", "SET_RW_HINT", "GET_FILE_RW_HINT", "SET_FILE_RW_HINT",
};
diff --git a/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h b/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h
index d18bfb238f66..13aea8fc3d45 100644
--- a/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h
+++ b/tools/perf/trace/beauty/arch/x86/include/asm/irq_vectors.h
@@ -97,10 +97,16 @@
#define LOCAL_TIMER_VECTOR 0xec
+/*
+ * Posted interrupt notification vector for all device MSIs delivered to
+ * the host kernel.
+ */
+#define POSTED_MSI_NOTIFICATION_VECTOR 0xeb
+
#define NR_VECTORS 256
#ifdef CONFIG_X86_LOCAL_APIC
-#define FIRST_SYSTEM_VECTOR LOCAL_TIMER_VECTOR
+#define FIRST_SYSTEM_VECTOR POSTED_MSI_NOTIFICATION_VECTOR
#else
#define FIRST_SYSTEM_VECTOR NR_VECTORS
#endif
diff --git a/tools/perf/trace/beauty/include/linux/socket.h b/tools/perf/trace/beauty/include/linux/socket.h
index 139c330ccf2c..89d16b90370b 100644
--- a/tools/perf/trace/beauty/include/linux/socket.h
+++ b/tools/perf/trace/beauty/include/linux/socket.h
@@ -16,6 +16,7 @@ struct cred;
struct socket;
struct sock;
struct sk_buff;
+struct proto_accept_arg;
#define __sockaddr_check_size(size) \
BUILD_BUG_ON(((size) > sizeof(struct __kernel_sockaddr_storage)))
@@ -433,7 +434,7 @@ extern int __sys_recvfrom(int fd, void __user *ubuf, size_t size,
extern int __sys_sendto(int fd, void __user *buff, size_t len,
unsigned int flags, struct sockaddr __user *addr,
int addr_len);
-extern struct file *do_accept(struct file *file, unsigned file_flags,
+extern struct file *do_accept(struct file *file, struct proto_accept_arg *arg,
struct sockaddr __user *upeer_sockaddr,
int __user *upeer_addrlen, int flags);
extern int __sys_accept4(int fd, struct sockaddr __user *upeer_sockaddr,
diff --git a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
index 282e90aeb163..c0bcc185fa48 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
@@ -9,6 +9,14 @@
#define F_GETLEASE (F_LINUX_SPECIFIC_BASE + 1)
/*
+ * Request nofications on a directory.
+ * See below for events that may be notified.
+ */
+#define F_NOTIFY (F_LINUX_SPECIFIC_BASE + 2)
+
+#define F_DUPFD_QUERY (F_LINUX_SPECIFIC_BASE + 3)
+
+/*
* Cancel a blocking posix lock; internal use only until we expose an
* asynchronous lock api to userspace:
*/
@@ -18,12 +26,6 @@
#define F_DUPFD_CLOEXEC (F_LINUX_SPECIFIC_BASE + 6)
/*
- * Request nofications on a directory.
- * See below for events that may be notified.
- */
-#define F_NOTIFY (F_LINUX_SPECIFIC_BASE+2)
-
-/*
* Set and get of pipe page size array
*/
#define F_SETPIPE_SZ (F_LINUX_SPECIFIC_BASE + 7)
diff --git a/tools/perf/trace/beauty/include/uapi/linux/prctl.h b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
index 370ed14b1ae0..35791791a879 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/prctl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
@@ -306,4 +306,26 @@ struct prctl_mm_map {
# define PR_RISCV_V_VSTATE_CTRL_NEXT_MASK 0xc
# define PR_RISCV_V_VSTATE_CTRL_MASK 0x1f
+#define PR_RISCV_SET_ICACHE_FLUSH_CTX 71
+# define PR_RISCV_CTX_SW_FENCEI_ON 0
+# define PR_RISCV_CTX_SW_FENCEI_OFF 1
+# define PR_RISCV_SCOPE_PER_PROCESS 0
+# define PR_RISCV_SCOPE_PER_THREAD 1
+
+/* PowerPC Dynamic Execution Control Register (DEXCR) controls */
+#define PR_PPC_GET_DEXCR 72
+#define PR_PPC_SET_DEXCR 73
+/* DEXCR aspect to act on */
+# define PR_PPC_DEXCR_SBHE 0 /* Speculative branch hint enable */
+# define PR_PPC_DEXCR_IBRTPD 1 /* Indirect branch recurrent target prediction disable */
+# define PR_PPC_DEXCR_SRAPD 2 /* Subroutine return address prediction disable */
+# define PR_PPC_DEXCR_NPHIE 3 /* Non-privileged hash instruction enable */
+/* Action to apply / return */
+# define PR_PPC_DEXCR_CTRL_EDITABLE 0x1 /* Aspect can be modified with PR_PPC_SET_DEXCR */
+# define PR_PPC_DEXCR_CTRL_SET 0x2 /* Set the aspect for this process */
+# define PR_PPC_DEXCR_CTRL_CLEAR 0x4 /* Clear the aspect for this process */
+# define PR_PPC_DEXCR_CTRL_SET_ONEXEC 0x8 /* Set the aspect on exec */
+# define PR_PPC_DEXCR_CTRL_CLEAR_ONEXEC 0x10 /* Clear the aspect on exec */
+# define PR_PPC_DEXCR_CTRL_MASK 0x1f
+
#endif /* _LINUX_PRCTL_H */
diff --git a/tools/perf/trace/beauty/include/uapi/linux/stat.h b/tools/perf/trace/beauty/include/uapi/linux/stat.h
index 2f2ee82d5517..67626d535316 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/stat.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/stat.h
@@ -126,8 +126,9 @@ struct statx {
__u64 stx_mnt_id;
__u32 stx_dio_mem_align; /* Memory buffer alignment for direct I/O */
__u32 stx_dio_offset_align; /* File offset alignment for direct I/O */
+ __u64 stx_subvol; /* Subvolume identifier */
/* 0xa0 */
- __u64 __spare3[12]; /* Spare space for future expansion */
+ __u64 __spare3[11]; /* Spare space for future expansion */
/* 0x100 */
};
@@ -155,6 +156,7 @@ struct statx {
#define STATX_MNT_ID 0x00001000U /* Got stx_mnt_id */
#define STATX_DIOALIGN 0x00002000U /* Want/got direct I/O alignment info */
#define STATX_MNT_ID_UNIQUE 0x00004000U /* Want/got extended stx_mount_id */
+#define STATX_SUBVOL 0x00008000U /* Want/got stx_subvol */
#define STATX__RESERVED 0x80000000U /* Reserved for future struct statx expansion */
diff --git a/tools/perf/util/comm.c b/tools/perf/util/comm.c
index 233f2b6edf52..49b79cf0c5cc 100644
--- a/tools/perf/util/comm.c
+++ b/tools/perf/util/comm.c
@@ -86,14 +86,6 @@ static struct comm_str *comm_str__new(const char *str)
return result;
}
-static int comm_str__cmp(const void *_lhs, const void *_rhs)
-{
- const struct comm_str *lhs = *(const struct comm_str * const *)_lhs;
- const struct comm_str *rhs = *(const struct comm_str * const *)_rhs;
-
- return strcmp(comm_str__str(lhs), comm_str__str(rhs));
-}
-
static int comm_str__search(const void *_key, const void *_member)
{
const char *key = _key;
@@ -169,9 +161,24 @@ static struct comm_str *comm_strs__findnew(const char *str)
}
result = comm_str__new(str);
if (result) {
- comm_strs->strs[comm_strs->num_strs++] = result;
- qsort(comm_strs->strs, comm_strs->num_strs, sizeof(struct comm_str *),
- comm_str__cmp);
+ int low = 0, high = comm_strs->num_strs - 1;
+ int insert = comm_strs->num_strs; /* Default to inserting at the end. */
+
+ while (low <= high) {
+ int mid = low + (high - low) / 2;
+ int cmp = strcmp(comm_str__str(comm_strs->strs[mid]), str);
+
+ if (cmp < 0) {
+ low = mid + 1;
+ } else {
+ high = mid - 1;
+ insert = mid;
+ }
+ }
+ memmove(&comm_strs->strs[insert + 1], &comm_strs->strs[insert],
+ (comm_strs->num_strs - insert) * sizeof(struct comm_str *));
+ comm_strs->num_strs++;
+ comm_strs->strs[insert] = result;
}
}
up_write(&comm_strs->lock);
diff --git a/tools/perf/util/dsos.c b/tools/perf/util/dsos.c
index ab3d0c01dd63..a69a9c661200 100644
--- a/tools/perf/util/dsos.c
+++ b/tools/perf/util/dsos.c
@@ -203,11 +203,27 @@ int __dsos__add(struct dsos *dsos, struct dso *dso)
dsos->dsos = temp;
dsos->allocated = to_allocate;
}
- dsos->dsos[dsos->cnt++] = dso__get(dso);
- if (dsos->cnt >= 2 && dsos->sorted) {
- dsos->sorted = dsos__cmp_long_name_id_short_name(&dsos->dsos[dsos->cnt - 2],
- &dsos->dsos[dsos->cnt - 1])
- <= 0;
+ if (!dsos->sorted) {
+ dsos->dsos[dsos->cnt++] = dso__get(dso);
+ } else {
+ int low = 0, high = dsos->cnt - 1;
+ int insert = dsos->cnt; /* Default to inserting at the end. */
+
+ while (low <= high) {
+ int mid = low + (high - low) / 2;
+ int cmp = dsos__cmp_long_name_id_short_name(&dsos->dsos[mid], &dso);
+
+ if (cmp < 0) {
+ low = mid + 1;
+ } else {
+ high = mid - 1;
+ insert = mid;
+ }
+ }
+ memmove(&dsos->dsos[insert + 1], &dsos->dsos[insert],
+ (dsos->cnt - insert) * sizeof(struct dso *));
+ dsos->cnt++;
+ dsos->dsos[insert] = dso__get(dso);
}
dso__set_dsos(dso, dsos);
return 0;
diff --git a/tools/power/cpupower/Makefile b/tools/power/cpupower/Makefile
index b53753dee02f..6c02f401069e 100644
--- a/tools/power/cpupower/Makefile
+++ b/tools/power/cpupower/Makefile
@@ -67,6 +67,7 @@ LANGUAGES = de fr it cs pt ka
bindir ?= /usr/bin
sbindir ?= /usr/sbin
mandir ?= /usr/man
+libdir ?= /usr/lib
includedir ?= /usr/include
localedir ?= /usr/share/locale
docdir ?= /usr/share/doc/packages/cpupower
@@ -94,15 +95,6 @@ RANLIB = $(CROSS)ranlib
HOSTCC = gcc
MKDIR = mkdir
-# 64bit library detection
-include ../../scripts/Makefile.arch
-
-ifeq ($(IS_64_BIT), 1)
-libdir ?= /usr/lib64
-else
-libdir ?= /usr/lib
-endif
-
# Now we set up the build system
#
@@ -332,4 +324,39 @@ uninstall:
rm -f $(DESTDIR)${localedir}/$$HLANG/LC_MESSAGES/cpupower.mo; \
done;
-.PHONY: all utils libcpupower update-po create-gmo install-lib install-tools install-man install-gmo install uninstall clean
+help:
+ @echo 'Building targets:'
+ @echo ' all - Default target. Could be omitted. Put build artifacts'
+ @echo ' to "O" cmdline option dir (default: current dir)'
+ @echo ' install - Install previously built project files from the output'
+ @echo ' dir defined by "O" cmdline option (default: current dir)'
+ @echo ' to the install dir defined by "DESTDIR" cmdline or'
+ @echo ' Makefile config block option (default: "")'
+ @echo ' install-lib - Install previously built library binary from the output'
+ @echo ' dir defined by "O" cmdline option (default: current dir)'
+ @echo ' and library headers from "lib/" for userspace to the install'
+ @echo ' dir defined by "DESTDIR" cmdline (default: "")'
+ @echo ' install-tools - Install previously built "cpupower" util from the output'
+ @echo ' dir defined by "O" cmdline option (default: current dir) and'
+ @echo ' "cpupower-completion.sh" script from the src dir to the'
+ @echo ' install dir defined by "DESTDIR" cmdline or Makefile'
+ @echo ' config block option (default: "")'
+ @echo ' install-man - Install man pages from the "man" src subdir to the'
+ @echo ' install dir defined by "DESTDIR" cmdline or Makefile'
+ @echo ' config block option (default: "")'
+ @echo ' install-gmo - Install previously built language files from the output'
+ @echo ' dir defined by "O" cmdline option (default: current dir)'
+ @echo ' to the install dir defined by "DESTDIR" cmdline or Makefile'
+ @echo ' config block option (default: "")'
+ @echo ' install-bench - Install previously built "cpufreq-bench" util files from the'
+ @echo ' output dir defined by "O" cmdline option (default: current dir)'
+ @echo ' to the install dir defined by "DESTDIR" cmdline or Makefile'
+ @echo ' config block option (default: "")'
+ @echo ''
+ @echo 'Cleaning targets:'
+ @echo ' clean - Clean build artifacts from the dir defined by "O" cmdline'
+ @echo ' option (default: current dir)'
+ @echo ' uninstall - Remove previously installed files from the dir defined by "DESTDIR"'
+ @echo ' cmdline or Makefile config block option (default: "")'
+
+.PHONY: all utils libcpupower update-po create-gmo install-lib install-tools install-man install-gmo install uninstall clean help
diff --git a/tools/power/cpupower/README b/tools/power/cpupower/README
index 1c68f47663b2..2678ed81d311 100644
--- a/tools/power/cpupower/README
+++ b/tools/power/cpupower/README
@@ -22,16 +22,156 @@ interfaces [depending on configuration, see below].
compilation and installation
----------------------------
-make
-su
-make install
-
-should suffice on most systems. It builds libcpupower to put in
-/usr/lib; cpupower, cpufreq-bench_plot.sh to put in /usr/bin; and
-cpufreq-bench to put in /usr/sbin. If you want to set up the paths
-differently and/or want to configure the package to your specific
-needs, you need to open "Makefile" with an editor of your choice and
-edit the block marked CONFIGURATION.
+There are 2 output directories - one for the build output and another for
+the installation of the build results, that is the utility, library,
+man pages, etc...
+
+default directory
+-----------------
+
+In the case of default directory, build and install process requires no
+additional parameters:
+
+build
+-----
+
+$ make
+
+The output directory for the 'make' command is the current directory and
+its subdirs in the kernel tree:
+tools/power/cpupower
+
+install
+-------
+
+$ sudo make install
+
+'make install' command puts targets to default system dirs:
+
+-----------------------------------------------------------------------
+| Installing file | System dir |
+-----------------------------------------------------------------------
+| libcpupower | /usr/lib |
+-----------------------------------------------------------------------
+| cpupower | /usr/bin |
+-----------------------------------------------------------------------
+| cpufreq-bench_plot.sh | /usr/bin |
+-----------------------------------------------------------------------
+| man pages | /usr/man |
+-----------------------------------------------------------------------
+
+To put it in other words it makes build results available system-wide,
+enabling any user to simply start using it without any additional steps
+
+custom directory
+----------------
+
+There are 2 make's command-line variables 'O' and 'DESTDIR' that setup
+appropriate dirs:
+'O' - build directory
+'DESTDIR' - installation directory. This variable could also be setup in
+the 'CONFIGURATION' block of the "Makefile"
+
+build
+-----
+
+$ make O=<your_custom_build_catalog>
+
+Example:
+$ make O=/home/hedin/prj/cpupower/build
+
+install
+-------
+
+$ make O=<your_custom_build_catalog> DESTDIR=<your_custom_install_catalog>
+
+Example:
+$ make O=/home/hedin/prj/cpupower/build DESTDIR=/home/hedin/prj/cpupower \
+> install
+
+Notice that both variables 'O' and 'DESTDIR' have been provided. The reason
+is that the build results are saved in the custom output dir defined by 'O'
+variable. So, this dir is the source for the installation step. If only
+'DESTDIR' were provided then the 'install' target would assume that the
+build directory is the current one, build everything there and install
+from the current dir.
+
+The files will be installed to the following dirs:
+
+-----------------------------------------------------------------------
+| Installing file | System dir |
+-----------------------------------------------------------------------
+| libcpupower | ${DESTDIR}/usr/lib |
+-----------------------------------------------------------------------
+| cpupower | ${DESTDIR}/usr/bin |
+-----------------------------------------------------------------------
+| cpufreq-bench_plot.sh | ${DESTDIR}/usr/bin |
+-----------------------------------------------------------------------
+| man pages | ${DESTDIR}/usr/man |
+-----------------------------------------------------------------------
+
+If you look at the table for the default 'make' output dirs you will
+notice that the only difference with the non-default case is the
+${DESTDIR} prefix. So, the structure of the output dirs remains the same
+regardles of the root output directory.
+
+
+clean and uninstall
+-------------------
+
+'clean' target is intended for cleanup the build catalog from build results
+'uninstall' target is intended for removing installed files from the
+installation directory
+
+default directory
+-----------------
+
+This case is a straightforward one:
+$ make clean
+$ make uninstall
+
+custom directory
+----------------
+
+Use 'O' command line variable to remove previously built files from the
+build dir:
+$ make O=<your_custom_build_catalog> clean
+
+Example:
+$ make O=/home/hedin/prj/cpupower/build clean
+
+Use 'DESTDIR' command line variable to uninstall previously installed files
+from the given dir:
+$ make DESTDIR=<your_custom_install_catalog>
+
+Example:
+make DESTDIR=/home/hedin/prj/cpupower uninstall
+
+
+running the tool
+----------------
+
+default directory
+-----------------
+
+$ sudo cpupower
+
+custom directory
+----------------
+
+When it comes to run the utility from the custom build catalog things
+become a little bit complicated as 'just run' approach doesn't work.
+Assuming that the current dir is '<your_custom_install_catalog>/usr',
+issuing the following command:
+
+$ sudo ./bin/cpupower
+will produce the following error output:
+./bin/cpupower: error while loading shared libraries: libcpupower.so.1:
+cannot open shared object file: No such file or directory
+
+The issue is that binary cannot find the 'libcpupower' library. So, we
+shall point to the lib dir:
+sudo LD_LIBRARY_PATH=lib64/ ./bin/cpupower
THANKS
diff --git a/tools/power/cpupower/bench/Makefile b/tools/power/cpupower/bench/Makefile
index a4b902f9e1c4..34e5894476eb 100644
--- a/tools/power/cpupower/bench/Makefile
+++ b/tools/power/cpupower/bench/Makefile
@@ -1,4 +1,9 @@
# SPDX-License-Identifier: GPL-2.0
+ifeq ($(MAKELEVEL),0)
+$(error This Makefile is not intended to be run standalone, but only as a part \
+of the main one in the parent dir)
+endif
+
OUTPUT := ./
ifeq ("$(origin O)", "command line")
ifneq ($(O),)
diff --git a/tools/power/cpupower/man/cpupower-monitor.1 b/tools/power/cpupower/man/cpupower-monitor.1
index 8ee737eefa5c..89af019f8dc4 100644
--- a/tools/power/cpupower/man/cpupower-monitor.1
+++ b/tools/power/cpupower/man/cpupower-monitor.1
@@ -81,11 +81,6 @@ Measure idle and frequency characteristics of an arbitrary command/workload.
The executable \fBcommand\fP is forked and upon its exit, statistics gathered since it was
forked are displayed.
.RE
-.PP
-\-v
-.RS 4
-Increase verbosity if the binary was compiled with the DEBUG option set.
-.RE
.SH MONITOR DESCRIPTIONS
.SS "Idle_Stats"
@@ -172,9 +167,11 @@ displayed.
"BIOS and Kernel Developer’s Guide (BKDG) for AMD Family 14h Processors"
https://support.amd.com/us/Processor_TechDocs/43170.pdf
-"Intel® Turbo Boost Technology
-in Intel® Core™ Microarchitecture (Nehalem) Based Processors"
-http://download.intel.com/design/processor/applnots/320354.pdf
+"What Is Intel® Turbo Boost Technology?"
+https://www.intel.com/content/www/us/en/gaming/resources/turbo-boost.html
+
+"Power Management - Technology Overview"
+https://cdrdv2.intel.com/v1/dl/getContent/637748
"Intel® 64 and IA-32 Architectures Software Developer's Manual
Volume 3B: System Programming Guide"
diff --git a/tools/power/cpupower/utils/helpers/amd.c b/tools/power/cpupower/utils/helpers/amd.c
index c519cc89c97f..0a56e22240fc 100644
--- a/tools/power/cpupower/utils/helpers/amd.c
+++ b/tools/power/cpupower/utils/helpers/amd.c
@@ -41,6 +41,16 @@ union core_pstate {
unsigned res1:31;
unsigned en:1;
} pstatedef;
+ /* since fam 1Ah: */
+ struct {
+ unsigned fid:12;
+ unsigned res1:2;
+ unsigned vid:8;
+ unsigned iddval:8;
+ unsigned idddiv:2;
+ unsigned res2:31;
+ unsigned en:1;
+ } pstatedef2;
unsigned long long val;
};
@@ -48,6 +58,10 @@ static int get_did(union core_pstate pstate)
{
int t;
+ /* Fam 1Ah onward do not use did */
+ if (cpupower_cpu_info.family >= 0x1A)
+ return 0;
+
if (cpupower_cpu_info.caps & CPUPOWER_CAP_AMD_PSTATEDEF)
t = pstate.pstatedef.did;
else if (cpupower_cpu_info.family == 0x12)
@@ -61,12 +75,18 @@ static int get_did(union core_pstate pstate)
static int get_cof(union core_pstate pstate)
{
int t;
- int fid, did, cof;
+ int fid, did, cof = 0;
did = get_did(pstate);
if (cpupower_cpu_info.caps & CPUPOWER_CAP_AMD_PSTATEDEF) {
- fid = pstate.pstatedef.fid;
- cof = 200 * fid / did;
+ if (cpupower_cpu_info.family >= 0x1A) {
+ fid = pstate.pstatedef2.fid;
+ if (fid > 0x0f)
+ cof = (fid * 5);
+ } else {
+ fid = pstate.pstatedef.fid;
+ cof = 200 * fid / did;
+ }
} else {
t = 0x10;
fid = pstate.pstate.fid;
diff --git a/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c b/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c
index 075e766ff1f3..f746099b5dac 100644
--- a/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c
+++ b/tools/power/cpupower/utils/idle_monitor/cpupower-monitor.c
@@ -35,7 +35,7 @@ static unsigned int avail_monitors;
static char *progname;
enum operation_mode_e { list = 1, show, show_all };
-static int mode;
+static enum operation_mode_e mode;
static int interval = 1;
static char *show_monitors_param;
static struct cpupower_topology cpu_top;
diff --git a/tools/power/pm-graph/bootgraph.py b/tools/power/pm-graph/bootgraph.py
index f96f50e0c336..8a3ef94fe88f 100755
--- a/tools/power/pm-graph/bootgraph.py
+++ b/tools/power/pm-graph/bootgraph.py
@@ -77,12 +77,12 @@ class SystemValues(aslib.SystemValues):
fp.close()
self.testdir = datetime.now().strftime('boot-%y%m%d-%H%M%S')
def kernelVersion(self, msg):
- m = re.match('^[Ll]inux *[Vv]ersion *(?P<v>\S*) .*', msg)
+ m = re.match(r'^[Ll]inux *[Vv]ersion *(?P<v>\S*) .*', msg)
if m:
return m.group('v')
return 'unknown'
def checkFtraceKernelVersion(self):
- m = re.match('^(?P<x>[0-9]*)\.(?P<y>[0-9]*)\.(?P<z>[0-9]*).*', self.kernel)
+ m = re.match(r'^(?P<x>[0-9]*)\.(?P<y>[0-9]*)\.(?P<z>[0-9]*).*', self.kernel)
if m:
val = tuple(map(int, m.groups()))
if val >= (4, 10, 0):
@@ -324,7 +324,7 @@ def parseKernelLog():
idx = line.find('[')
if idx > 1:
line = line[idx:]
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if(not m):
continue
ktime = float(m.group('ktime'))
@@ -332,24 +332,24 @@ def parseKernelLog():
break
msg = m.group('msg')
data.dmesgtext.append(line)
- if(ktime == 0.0 and re.match('^Linux version .*', msg)):
+ if(ktime == 0.0 and re.match(r'^Linux version .*', msg)):
if(not sysvals.stamp['kernel']):
sysvals.stamp['kernel'] = sysvals.kernelVersion(msg)
continue
- m = re.match('.* setting system clock to (?P<d>[0-9\-]*)[ A-Z](?P<t>[0-9:]*) UTC.*', msg)
+ m = re.match(r'.* setting system clock to (?P<d>[0-9\-]*)[ A-Z](?P<t>[0-9:]*) UTC.*', msg)
if(m):
bt = datetime.strptime(m.group('d')+' '+m.group('t'), '%Y-%m-%d %H:%M:%S')
bt = bt - timedelta(seconds=int(ktime))
data.boottime = bt.strftime('%Y-%m-%d_%H:%M:%S')
sysvals.stamp['time'] = bt.strftime('%B %d %Y, %I:%M:%S %p')
continue
- m = re.match('^calling *(?P<f>.*)\+.* @ (?P<p>[0-9]*)', msg)
+ m = re.match(r'^calling *(?P<f>.*)\+.* @ (?P<p>[0-9]*)', msg)
if(m):
func = m.group('f')
pid = int(m.group('p'))
devtemp[func] = (ktime, pid)
continue
- m = re.match('^initcall *(?P<f>.*)\+.* returned (?P<r>.*) after (?P<t>.*) usecs', msg)
+ m = re.match(r'^initcall *(?P<f>.*)\+.* returned (?P<r>.*) after (?P<t>.*) usecs', msg)
if(m):
data.valid = True
data.end = ktime
@@ -359,7 +359,7 @@ def parseKernelLog():
data.newAction(phase, f, pid, start, ktime, int(r), int(t))
del devtemp[f]
continue
- if(re.match('^Freeing unused kernel .*', msg)):
+ if(re.match(r'^Freeing unused kernel .*', msg)):
data.tUserMode = ktime
data.dmesg['kernel']['end'] = ktime
data.dmesg['user']['start'] = ktime
diff --git a/tools/power/pm-graph/sleepgraph.py b/tools/power/pm-graph/sleepgraph.py
index 40ad221e8881..ef87e63c05c7 100755
--- a/tools/power/pm-graph/sleepgraph.py
+++ b/tools/power/pm-graph/sleepgraph.py
@@ -86,7 +86,7 @@ def ascii(text):
# store system values and test parameters
class SystemValues:
title = 'SleepGraph'
- version = '5.11'
+ version = '5.12'
ansi = False
rs = 0
display = ''
@@ -420,11 +420,11 @@ class SystemValues:
return value.format(**args)
def setOutputFile(self):
if self.dmesgfile != '':
- m = re.match('(?P<name>.*)_dmesg\.txt.*', self.dmesgfile)
+ m = re.match(r'(?P<name>.*)_dmesg\.txt.*', self.dmesgfile)
if(m):
self.htmlfile = m.group('name')+'.html'
if self.ftracefile != '':
- m = re.match('(?P<name>.*)_ftrace\.txt.*', self.ftracefile)
+ m = re.match(r'(?P<name>.*)_ftrace\.txt.*', self.ftracefile)
if(m):
self.htmlfile = m.group('name')+'.html'
def systemInfo(self, info):
@@ -464,15 +464,15 @@ class SystemValues:
if os.path.exists('/proc/cpuinfo'):
with open('/proc/cpuinfo', 'r') as fp:
for line in fp:
- if re.match('^processor[ \t]*:[ \t]*[0-9]*', line):
+ if re.match(r'^processor[ \t]*:[ \t]*[0-9]*', line):
self.cpucount += 1
if os.path.exists('/proc/meminfo'):
with open('/proc/meminfo', 'r') as fp:
for line in fp:
- m = re.match('^MemTotal:[ \t]*(?P<sz>[0-9]*) *kB', line)
+ m = re.match(r'^MemTotal:[ \t]*(?P<sz>[0-9]*) *kB', line)
if m:
self.memtotal = int(m.group('sz'))
- m = re.match('^MemFree:[ \t]*(?P<sz>[0-9]*) *kB', line)
+ m = re.match(r'^MemFree:[ \t]*(?P<sz>[0-9]*) *kB', line)
if m:
self.memfree = int(m.group('sz'))
if os.path.exists('/etc/os-release'):
@@ -539,7 +539,7 @@ class SystemValues:
idx = line.find('[')
if idx > 1:
line = line[idx:]
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if(m):
ktime = m.group('ktime')
break
@@ -553,7 +553,7 @@ class SystemValues:
idx = line.find('[')
if idx > 1:
line = line[idx:]
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if(not m):
continue
ktime = float(m.group('ktime'))
@@ -636,11 +636,11 @@ class SystemValues:
# now process the args
for arg in sorted(args):
arglist[arg] = ''
- m = re.match('.* '+arg+'=(?P<arg>.*) ', data);
+ m = re.match(r'.* '+arg+'=(?P<arg>.*) ', data);
if m:
arglist[arg] = m.group('arg')
else:
- m = re.match('.* '+arg+'=(?P<arg>.*)', data);
+ m = re.match(r'.* '+arg+'=(?P<arg>.*)', data);
if m:
arglist[arg] = m.group('arg')
out = fmt.format(**arglist)
@@ -989,7 +989,7 @@ class SystemValues:
m = re.match(tp.ftrace_line_fmt, line)
if(not m or 'device_pm_callback_start' not in line):
continue
- m = re.match('.*: (?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*', m.group('msg'));
+ m = re.match(r'.*: (?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*', m.group('msg'));
if(not m):
continue
dev = m.group('d')
@@ -999,7 +999,7 @@ class SystemValues:
# now get the syspath for each target device
for dirname, dirnames, filenames in os.walk('/sys/devices'):
- if(re.match('.*/power', dirname) and 'async' in filenames):
+ if(re.match(r'.*/power', dirname) and 'async' in filenames):
dev = dirname.split('/')[-2]
if dev in props and (not props[dev].syspath or len(dirname) < len(props[dev].syspath)):
props[dev].syspath = dirname[:-6]
@@ -1143,12 +1143,12 @@ class SystemValues:
elif value and os.path.exists(file):
fp = open(file, 'r+')
if fmt == 'radio':
- m = re.match('.*\[(?P<v>.*)\].*', fp.read())
+ m = re.match(r'.*\[(?P<v>.*)\].*', fp.read())
if m:
self.cfgdef[file] = m.group('v')
elif fmt == 'acpi':
line = fp.read().strip().split('\n')[-1]
- m = re.match('.* (?P<v>[0-9A-Fx]*) .*', line)
+ m = re.match(r'.* (?P<v>[0-9A-Fx]*) .*', line)
if m:
self.cfgdef[file] = m.group('v')
else:
@@ -1173,7 +1173,7 @@ class SystemValues:
fp = Popen([cmd, '-v'], stdout=PIPE, stderr=PIPE).stderr
out = ascii(fp.read()).strip()
fp.close()
- if re.match('turbostat version .*', out):
+ if re.match(r'turbostat version .*', out):
self.vprint(out)
return True
return False
@@ -1181,33 +1181,33 @@ class SystemValues:
cmd = self.getExec('turbostat')
rawout = keyline = valline = ''
fullcmd = '%s -q -S echo freeze > %s' % (cmd, self.powerfile)
- fp = Popen(['sh', '-c', fullcmd], stdout=PIPE, stderr=PIPE).stderr
- for line in fp:
+ fp = Popen(['sh', '-c', fullcmd], stdout=PIPE, stderr=PIPE)
+ for line in fp.stderr:
line = ascii(line)
rawout += line
if keyline and valline:
continue
- if re.match('(?i)Avg_MHz.*', line):
+ if re.match(r'(?i)Avg_MHz.*', line):
keyline = line.strip().split()
elif keyline:
valline = line.strip().split()
- fp.close()
+ fp.wait()
if not keyline or not valline or len(keyline) != len(valline):
errmsg = 'unrecognized turbostat output:\n'+rawout.strip()
self.vprint(errmsg)
if not self.verbose:
pprint(errmsg)
- return ''
+ return (fp.returncode, '')
if self.verbose:
pprint(rawout.strip())
out = []
for key in keyline:
idx = keyline.index(key)
val = valline[idx]
- if key == 'SYS%LPI' and not s0ixready and re.match('^[0\.]*$', val):
+ if key == 'SYS%LPI' and not s0ixready and re.match(r'^[0\.]*$', val):
continue
out.append('%s=%s' % (key, val))
- return '|'.join(out)
+ return (fp.returncode, '|'.join(out))
def netfixon(self, net='both'):
cmd = self.getExec('netfix')
if not cmd:
@@ -1232,7 +1232,7 @@ class SystemValues:
except:
return ''
for line in reversed(w.split('\n')):
- m = re.match(' *(?P<dev>.*): (?P<stat>[0-9a-f]*) .*', line)
+ m = re.match(r' *(?P<dev>.*): (?P<stat>[0-9a-f]*) .*', line)
if not m or (dev and dev != m.group('dev')):
continue
return m.group('dev')
@@ -1261,14 +1261,14 @@ class SystemValues:
return
arr = msg.split()
for j in range(len(arr)):
- if re.match('^[0-9,\-\.]*$', arr[j]):
- arr[j] = '[0-9,\-\.]*'
+ if re.match(r'^[0-9,\-\.]*$', arr[j]):
+ arr[j] = r'[0-9,\-\.]*'
else:
arr[j] = arr[j]\
- .replace('\\', '\\\\').replace(']', '\]').replace('[', '\[')\
- .replace('.', '\.').replace('+', '\+').replace('*', '\*')\
- .replace('(', '\(').replace(')', '\)').replace('}', '\}')\
- .replace('{', '\{')
+ .replace('\\', r'\\\\').replace(']', r'\]').replace('[', r'\[')\
+ .replace('.', r'\.').replace('+', r'\+').replace('*', r'\*')\
+ .replace('(', r'\(').replace(')', r'\)').replace('}', r'\}')\
+ .replace('{', r'\{')
mstr = ' *'.join(arr)
entry = {
'line': msg,
@@ -1340,7 +1340,7 @@ class SystemValues:
fp = Popen(xset.format('q').split(' '), stdout=PIPE).stdout
ret = 'unknown'
for line in fp:
- m = re.match('[\s]*Monitor is (?P<m>.*)', ascii(line))
+ m = re.match(r'[\s]*Monitor is (?P<m>.*)', ascii(line))
if(m and len(m.group('m')) >= 2):
out = m.group('m').lower()
ret = out[3:] if out[0:2] == 'in' else out
@@ -1566,7 +1566,7 @@ class Data:
i += 1
if tp.stampInfo(line, sysvals):
continue
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if not m:
continue
t = float(m.group('ktime'))
@@ -1574,7 +1574,7 @@ class Data:
continue
dir = 'suspend' if t < self.tSuspended else 'resume'
msg = m.group('msg')
- if re.match('capability: warning: .*', msg):
+ if re.match(r'capability: warning: .*', msg):
continue
for err in self.errlist:
if re.match(self.errlist[err], msg):
@@ -1679,8 +1679,8 @@ class Data:
ubiquitous = False
if kprobename in dtf and 'ub' in dtf[kprobename]:
ubiquitous = True
- mc = re.match('\(.*\) *(?P<args>.*)', cdata)
- mr = re.match('\((?P<caller>\S*).* arg1=(?P<ret>.*)', rdata)
+ mc = re.match(r'\(.*\) *(?P<args>.*)', cdata)
+ mr = re.match(r'\((?P<caller>\S*).* arg1=(?P<ret>.*)', rdata)
if mc and mr:
c = mr.group('caller').split('+')[0]
a = mc.group('args').strip()
@@ -1997,7 +1997,7 @@ class Data:
list = self.dmesg[phase]['list']
mydev = ''
for devname in sorted(list):
- if name == devname or re.match('^%s\[(?P<num>[0-9]*)\]$' % name, devname):
+ if name == devname or re.match(r'^%s\[(?P<num>[0-9]*)\]$' % name, devname):
mydev = devname
if mydev:
return list[mydev]
@@ -2099,7 +2099,7 @@ class Data:
for dev in sorted(list):
pdev = list[dev]['par']
pid = list[dev]['pid']
- if(pid < 0 or re.match('[0-9]*-[0-9]*\.[0-9]*[\.0-9]*\:[\.0-9]*$', pdev)):
+ if(pid < 0 or re.match(r'[0-9]*-[0-9]*\.[0-9]*[\.0-9]*\:[\.0-9]*$', pdev)):
continue
if pdev and pdev not in real and pdev not in rootlist:
rootlist.append(pdev)
@@ -2190,26 +2190,26 @@ class Data:
if 'resume_complete' in dm:
dm['resume_complete']['end'] = time
def initcall_debug_call(self, line, quick=False):
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
- 'PM: *calling .* @ (?P<n>.*), parent: (?P<p>.*)', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
+ r'PM: *calling .* @ (?P<n>.*), parent: (?P<p>.*)', line)
if not m:
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
- 'calling .* @ (?P<n>.*), parent: (?P<p>.*)', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
+ r'calling .* @ (?P<n>.*), parent: (?P<p>.*)', line)
if not m:
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) calling '+\
- '(?P<f>.*)\+ @ (?P<n>.*), parent: (?P<p>.*)', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) calling '+\
+ r'(?P<f>.*)\+ @ (?P<n>.*), parent: (?P<p>.*)', line)
if m:
return True if quick else m.group('t', 'f', 'n', 'p')
return False if quick else ('', '', '', '')
def initcall_debug_return(self, line, quick=False):
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: PM: '+\
- '.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: PM: '+\
+ r'.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line)
if not m:
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
- '.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) .* (?P<f>.*)\: '+\
+ r'.* returned (?P<r>[0-9]*) after (?P<dt>[0-9]*) usecs', line)
if not m:
- m = re.match('.*(\[ *)(?P<t>[0-9\.]*)(\]) call '+\
- '(?P<f>.*)\+ returned .* after (?P<dt>.*) usecs', line)
+ m = re.match(r'.*(\[ *)(?P<t>[0-9\.]*)(\]) call '+\
+ r'(?P<f>.*)\+ returned .* after (?P<dt>.*) usecs', line)
if m:
return True if quick else m.group('t', 'f', 'dt')
return False if quick else ('', '', '')
@@ -2294,28 +2294,28 @@ class FTraceLine:
if not m and not d:
return
# is this a trace event
- if(d == 'traceevent' or re.match('^ *\/\* *(?P<msg>.*) \*\/ *$', m)):
+ if(d == 'traceevent' or re.match(r'^ *\/\* *(?P<msg>.*) \*\/ *$', m)):
if(d == 'traceevent'):
# nop format trace event
msg = m
else:
# function_graph format trace event
- em = re.match('^ *\/\* *(?P<msg>.*) \*\/ *$', m)
+ em = re.match(r'^ *\/\* *(?P<msg>.*) \*\/ *$', m)
msg = em.group('msg')
- emm = re.match('^(?P<call>.*?): (?P<msg>.*)', msg)
+ emm = re.match(r'^(?P<call>.*?): (?P<msg>.*)', msg)
if(emm):
self.name = emm.group('msg')
self.type = emm.group('call')
else:
self.name = msg
- km = re.match('^(?P<n>.*)_cal$', self.type)
+ km = re.match(r'^(?P<n>.*)_cal$', self.type)
if km:
self.fcall = True
self.fkprobe = True
self.type = km.group('n')
return
- km = re.match('^(?P<n>.*)_ret$', self.type)
+ km = re.match(r'^(?P<n>.*)_ret$', self.type)
if km:
self.freturn = True
self.fkprobe = True
@@ -2327,7 +2327,7 @@ class FTraceLine:
if(d):
self.length = float(d)/1000000
# the indentation determines the depth
- match = re.match('^(?P<d> *)(?P<o>.*)$', m)
+ match = re.match(r'^(?P<d> *)(?P<o>.*)$', m)
if(not match):
return
self.depth = self.getDepth(match.group('d'))
@@ -2337,7 +2337,7 @@ class FTraceLine:
self.freturn = True
if(len(m) > 1):
# includes comment with function name
- match = re.match('^} *\/\* *(?P<n>.*) *\*\/$', m)
+ match = re.match(r'^} *\/\* *(?P<n>.*) *\*\/$', m)
if(match):
self.name = match.group('n').strip()
# function call
@@ -2345,13 +2345,13 @@ class FTraceLine:
self.fcall = True
# function call with children
if(m[-1] == '{'):
- match = re.match('^(?P<n>.*) *\(.*', m)
+ match = re.match(r'^(?P<n>.*) *\(.*', m)
if(match):
self.name = match.group('n').strip()
# function call with no children (leaf)
elif(m[-1] == ';'):
self.freturn = True
- match = re.match('^(?P<n>.*) *\(.*', m)
+ match = re.match(r'^(?P<n>.*) *\(.*', m)
if(match):
self.name = match.group('n').strip()
# something else (possibly a trace marker)
@@ -2385,7 +2385,7 @@ class FTraceLine:
return False
else:
if(self.type == 'suspend_resume' and
- re.match('suspend_enter\[.*\] begin', self.name)):
+ re.match(r'suspend_enter\[.*\] begin', self.name)):
return True
return False
def endMarker(self):
@@ -2398,7 +2398,7 @@ class FTraceLine:
return False
else:
if(self.type == 'suspend_resume' and
- re.match('thaw_processes\[.*\] end', self.name)):
+ re.match(r'thaw_processes\[.*\] end', self.name)):
return True
return False
@@ -2976,30 +2976,30 @@ class Timeline:
# Description:
# A list of values describing the properties of these test runs
class TestProps:
- stampfmt = '# [a-z]*-(?P<m>[0-9]{2})(?P<d>[0-9]{2})(?P<y>[0-9]{2})-'+\
- '(?P<H>[0-9]{2})(?P<M>[0-9]{2})(?P<S>[0-9]{2})'+\
- ' (?P<host>.*) (?P<mode>.*) (?P<kernel>.*)$'
- wififmt = '^# wifi *(?P<d>\S*) *(?P<s>\S*) *(?P<t>[0-9\.]+).*'
- tstatfmt = '^# turbostat (?P<t>\S*)'
- testerrfmt = '^# enter_sleep_error (?P<e>.*)'
- sysinfofmt = '^# sysinfo .*'
- cmdlinefmt = '^# command \| (?P<cmd>.*)'
- kparamsfmt = '^# kparams \| (?P<kp>.*)'
- devpropfmt = '# Device Properties: .*'
- pinfofmt = '# platform-(?P<val>[a-z,A-Z,0-9,_]*): (?P<info>.*)'
- tracertypefmt = '# tracer: (?P<t>.*)'
- firmwarefmt = '# fwsuspend (?P<s>[0-9]*) fwresume (?P<r>[0-9]*)$'
- procexecfmt = 'ps - (?P<ps>.*)$'
- procmultifmt = '@(?P<n>[0-9]*)\|(?P<ps>.*)$'
+ stampfmt = r'# [a-z]*-(?P<m>[0-9]{2})(?P<d>[0-9]{2})(?P<y>[0-9]{2})-'+\
+ r'(?P<H>[0-9]{2})(?P<M>[0-9]{2})(?P<S>[0-9]{2})'+\
+ r' (?P<host>.*) (?P<mode>.*) (?P<kernel>.*)$'
+ wififmt = r'^# wifi *(?P<d>\S*) *(?P<s>\S*) *(?P<t>[0-9\.]+).*'
+ tstatfmt = r'^# turbostat (?P<t>\S*)'
+ testerrfmt = r'^# enter_sleep_error (?P<e>.*)'
+ sysinfofmt = r'^# sysinfo .*'
+ cmdlinefmt = r'^# command \| (?P<cmd>.*)'
+ kparamsfmt = r'^# kparams \| (?P<kp>.*)'
+ devpropfmt = r'# Device Properties: .*'
+ pinfofmt = r'# platform-(?P<val>[a-z,A-Z,0-9,_]*): (?P<info>.*)'
+ tracertypefmt = r'# tracer: (?P<t>.*)'
+ firmwarefmt = r'# fwsuspend (?P<s>[0-9]*) fwresume (?P<r>[0-9]*)$'
+ procexecfmt = r'ps - (?P<ps>.*)$'
+ procmultifmt = r'@(?P<n>[0-9]*)\|(?P<ps>.*)$'
ftrace_line_fmt_fg = \
- '^ *(?P<time>[0-9\.]*) *\| *(?P<cpu>[0-9]*)\)'+\
- ' *(?P<proc>.*)-(?P<pid>[0-9]*) *\|'+\
- '[ +!#\*@$]*(?P<dur>[0-9\.]*) .*\| (?P<msg>.*)'
+ r'^ *(?P<time>[0-9\.]*) *\| *(?P<cpu>[0-9]*)\)'+\
+ r' *(?P<proc>.*)-(?P<pid>[0-9]*) *\|'+\
+ r'[ +!#\*@$]*(?P<dur>[0-9\.]*) .*\| (?P<msg>.*)'
ftrace_line_fmt_nop = \
- ' *(?P<proc>.*)-(?P<pid>[0-9]*) *\[(?P<cpu>[0-9]*)\] *'+\
- '(?P<flags>\S*) *(?P<time>[0-9\.]*): *'+\
- '(?P<msg>.*)'
- machinesuspend = 'machine_suspend\[.*'
+ r' *(?P<proc>.*)-(?P<pid>[0-9]*) *\[(?P<cpu>[0-9]*)\] *'+\
+ r'(?P<flags>\S*) *(?P<time>[0-9\.]*): *'+\
+ r'(?P<msg>.*)'
+ machinesuspend = r'machine_suspend\[.*'
multiproclist = dict()
multiproctime = 0.0
multiproccnt = 0
@@ -3081,14 +3081,14 @@ class TestProps:
sv.hostname = data.stamp['host']
sv.suspendmode = data.stamp['mode']
if sv.suspendmode == 'freeze':
- self.machinesuspend = 'timekeeping_freeze\[.*'
+ self.machinesuspend = r'timekeeping_freeze\[.*'
else:
- self.machinesuspend = 'machine_suspend\[.*'
+ self.machinesuspend = r'machine_suspend\[.*'
if sv.suspendmode == 'command' and sv.ftracefile != '':
modes = ['on', 'freeze', 'standby', 'mem', 'disk']
fp = sv.openlog(sv.ftracefile, 'r')
for line in fp:
- m = re.match('.* machine_suspend\[(?P<mode>.*)\]', line)
+ m = re.match(r'.* machine_suspend\[(?P<mode>.*)\]', line)
if m and m.group('mode') in ['1', '2', '3', '4']:
sv.suspendmode = modes[int(m.group('mode'))]
data.stamp['mode'] = sv.suspendmode
@@ -3401,9 +3401,9 @@ def loadTraceLog():
for i in range(len(blk)):
if 'SUSPEND START' in blk[i][3]:
first.append(i)
- elif re.match('.* timekeeping_freeze.*begin', blk[i][3]):
+ elif re.match(r'.* timekeeping_freeze.*begin', blk[i][3]):
last.append(i)
- elif re.match('.* timekeeping_freeze.*end', blk[i][3]):
+ elif re.match(r'.* timekeeping_freeze.*end', blk[i][3]):
first.append(i)
elif 'RESUME COMPLETE' in blk[i][3]:
last.append(i)
@@ -3514,28 +3514,28 @@ def parseTraceLog(live=False):
if(t.fevent):
if(t.type == 'suspend_resume'):
# suspend_resume trace events have two types, begin and end
- if(re.match('(?P<name>.*) begin$', t.name)):
+ if(re.match(r'(?P<name>.*) begin$', t.name)):
isbegin = True
- elif(re.match('(?P<name>.*) end$', t.name)):
+ elif(re.match(r'(?P<name>.*) end$', t.name)):
isbegin = False
else:
continue
if '[' in t.name:
- m = re.match('(?P<name>.*)\[.*', t.name)
+ m = re.match(r'(?P<name>.*)\[.*', t.name)
else:
- m = re.match('(?P<name>.*) .*', t.name)
+ m = re.match(r'(?P<name>.*) .*', t.name)
name = m.group('name')
# ignore these events
if(name.split('[')[0] in tracewatch):
continue
# -- phase changes --
# start of kernel suspend
- if(re.match('suspend_enter\[.*', t.name)):
+ if(re.match(r'suspend_enter\[.*', t.name)):
if(isbegin and data.tKernSus == 0):
data.tKernSus = t.time
continue
# suspend_prepare start
- elif(re.match('dpm_prepare\[.*', t.name)):
+ elif(re.match(r'dpm_prepare\[.*', t.name)):
if isbegin and data.first_suspend_prepare:
data.first_suspend_prepare = False
if data.tKernSus == 0:
@@ -3544,15 +3544,15 @@ def parseTraceLog(live=False):
phase = data.setPhase('suspend_prepare', t.time, isbegin)
continue
# suspend start
- elif(re.match('dpm_suspend\[.*', t.name)):
+ elif(re.match(r'dpm_suspend\[.*', t.name)):
phase = data.setPhase('suspend', t.time, isbegin)
continue
# suspend_late start
- elif(re.match('dpm_suspend_late\[.*', t.name)):
+ elif(re.match(r'dpm_suspend_late\[.*', t.name)):
phase = data.setPhase('suspend_late', t.time, isbegin)
continue
# suspend_noirq start
- elif(re.match('dpm_suspend_noirq\[.*', t.name)):
+ elif(re.match(r'dpm_suspend_noirq\[.*', t.name)):
phase = data.setPhase('suspend_noirq', t.time, isbegin)
continue
# suspend_machine/resume_machine
@@ -3589,19 +3589,19 @@ def parseTraceLog(live=False):
data.tResumed = t.time
continue
# resume_noirq start
- elif(re.match('dpm_resume_noirq\[.*', t.name)):
+ elif(re.match(r'dpm_resume_noirq\[.*', t.name)):
phase = data.setPhase('resume_noirq', t.time, isbegin)
continue
# resume_early start
- elif(re.match('dpm_resume_early\[.*', t.name)):
+ elif(re.match(r'dpm_resume_early\[.*', t.name)):
phase = data.setPhase('resume_early', t.time, isbegin)
continue
# resume start
- elif(re.match('dpm_resume\[.*', t.name)):
+ elif(re.match(r'dpm_resume\[.*', t.name)):
phase = data.setPhase('resume', t.time, isbegin)
continue
# resume complete start
- elif(re.match('dpm_complete\[.*', t.name)):
+ elif(re.match(r'dpm_complete\[.*', t.name)):
phase = data.setPhase('resume_complete', t.time, isbegin)
continue
# skip trace events inside devices calls
@@ -3635,7 +3635,7 @@ def parseTraceLog(live=False):
elif(t.type == 'device_pm_callback_start'):
if phase not in data.dmesg:
continue
- m = re.match('(?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*',\
+ m = re.match(r'(?P<drv>.*) (?P<d>.*), parent: *(?P<p>.*), .*',\
t.name);
if(not m):
continue
@@ -3650,7 +3650,7 @@ def parseTraceLog(live=False):
elif(t.type == 'device_pm_callback_end'):
if phase not in data.dmesg:
continue
- m = re.match('(?P<drv>.*) (?P<d>.*), err.*', t.name);
+ m = re.match(r'(?P<drv>.*) (?P<d>.*), err.*', t.name);
if(not m):
continue
n = m.group('d')
@@ -3904,24 +3904,24 @@ def loadKernelLog():
line = line[idx:]
if tp.stampInfo(line, sysvals):
continue
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if(not m):
continue
msg = m.group("msg")
- if re.match('PM: Syncing filesystems.*', msg) or \
- re.match('PM: suspend entry.*', msg):
+ if re.match(r'PM: Syncing filesystems.*', msg) or \
+ re.match(r'PM: suspend entry.*', msg):
if(data):
testruns.append(data)
data = Data(len(testruns))
tp.parseStamp(data, sysvals)
if(not data):
continue
- m = re.match('.* *(?P<k>[0-9]\.[0-9]{2}\.[0-9]-.*) .*', msg)
+ m = re.match(r'.* *(?P<k>[0-9]\.[0-9]{2}\.[0-9]-.*) .*', msg)
if(m):
sysvals.stamp['kernel'] = m.group('k')
- m = re.match('PM: Preparing system for (?P<m>.*) sleep', msg)
+ m = re.match(r'PM: Preparing system for (?P<m>.*) sleep', msg)
if not m:
- m = re.match('PM: Preparing system for sleep \((?P<m>.*)\)', msg)
+ m = re.match(r'PM: Preparing system for sleep \((?P<m>.*)\)', msg)
if m:
sysvals.stamp['mode'] = sysvals.suspendmode = m.group('m')
data.dmesgtext.append(line)
@@ -3984,7 +3984,7 @@ def parseKernelLog(data):
'resume_machine': ['[PM: ]*Timekeeping suspended for.*',
'ACPI: Low-level resume complete.*',
'ACPI: resume from mwait',
- 'Suspended for [0-9\.]* seconds'],
+ r'Suspended for [0-9\.]* seconds'],
'resume_noirq': ['PM: resume from suspend-to-idle',
'ACPI: Waking up from system sleep state.*'],
'resume_early': ['PM: noirq resume of devices complete after.*',
@@ -3993,7 +3993,7 @@ def parseKernelLog(data):
'PM: early restore of devices complete after.*'],
'resume_complete': ['PM: resume of devices complete after.*',
'PM: restore of devices complete after.*'],
- 'post_resume': ['.*Restarting tasks \.\.\..*'],
+ 'post_resume': [r'.*Restarting tasks \.\.\..*'],
}
# action table (expected events that occur and show up in dmesg)
@@ -4021,7 +4021,7 @@ def parseKernelLog(data):
actions = dict()
for line in data.dmesgtext:
# parse each dmesg line into the time and message
- m = re.match('[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
+ m = re.match(r'[ \t]*(\[ *)(?P<ktime>[0-9\.]*)(\]) (?P<msg>.*)', line)
if(m):
val = m.group('ktime')
try:
@@ -4145,26 +4145,26 @@ def parseKernelLog(data):
if(a in actions and actions[a][-1]['begin'] == actions[a][-1]['end']):
actions[a][-1]['end'] = ktime
# now look for CPU on/off events
- if(re.match('Disabling non-boot CPUs .*', msg)):
+ if(re.match(r'Disabling non-boot CPUs .*', msg)):
# start of first cpu suspend
cpu_start = ktime
- elif(re.match('Enabling non-boot CPUs .*', msg)):
+ elif(re.match(r'Enabling non-boot CPUs .*', msg)):
# start of first cpu resume
cpu_start = ktime
- elif(re.match('smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) \
- or re.match('psci: CPU(?P<cpu>[0-9]*) killed.*', msg)):
+ elif(re.match(r'smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg) \
+ or re.match(r'psci: CPU(?P<cpu>[0-9]*) killed.*', msg)):
# end of a cpu suspend, start of the next
- m = re.match('smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg)
+ m = re.match(r'smpboot: CPU (?P<cpu>[0-9]*) is now offline', msg)
if(not m):
- m = re.match('psci: CPU(?P<cpu>[0-9]*) killed.*', msg)
+ m = re.match(r'psci: CPU(?P<cpu>[0-9]*) killed.*', msg)
cpu = 'CPU'+m.group('cpu')
if(cpu not in actions):
actions[cpu] = []
actions[cpu].append({'begin': cpu_start, 'end': ktime})
cpu_start = ktime
- elif(re.match('CPU(?P<cpu>[0-9]*) is up', msg)):
+ elif(re.match(r'CPU(?P<cpu>[0-9]*) is up', msg)):
# end of a cpu resume, start of the next
- m = re.match('CPU(?P<cpu>[0-9]*) is up', msg)
+ m = re.match(r'CPU(?P<cpu>[0-9]*) is up', msg)
cpu = 'CPU'+m.group('cpu')
if(cpu not in actions):
actions[cpu] = []
@@ -4343,7 +4343,8 @@ def createHTMLSummarySimple(testruns, htmlfile, title):
list[mode]['data'].append([data['host'], data['kernel'],
data['time'], tVal[0], tVal[1], data['url'], res,
data['issues'], data['sus_worst'], data['sus_worsttime'],
- data['res_worst'], data['res_worsttime'], pkgpc10, syslpi, wifi])
+ data['res_worst'], data['res_worsttime'], pkgpc10, syslpi, wifi,
+ (data['fullmode'] if 'fullmode' in data else mode)])
idx = len(list[mode]['data']) - 1
if res.startswith('fail in'):
res = 'fail'
@@ -4449,7 +4450,7 @@ def createHTMLSummarySimple(testruns, htmlfile, title):
elif idx == iMed[i]:
tHigh[i] = ' id="%smed" class=medval title="Median"' % tag
html += td.format("%d" % (list[mode]['data'].index(d) + 1)) # row
- html += td.format(mode) # mode
+ html += td.format(d[15]) # mode
html += td.format(d[0]) # host
html += td.format(d[1]) # kernel
html += td.format(d[2]) # time
@@ -5061,6 +5062,7 @@ def addCSS(hf, sv, testcount=1, kerror=False, extra=''):
def addScriptCode(hf, testruns):
t0 = testruns[0].start * 1000
tMax = testruns[-1].end * 1000
+ hf.write('<script type="text/javascript">\n');
# create an array in javascript memory with the device details
detail = ' var devtable = [];\n'
for data in testruns:
@@ -5068,384 +5070,383 @@ def addScriptCode(hf, testruns):
detail += ' devtable[%d] = "%s";\n' % (data.testnumber, topo)
detail += ' var bounds = [%f,%f];\n' % (t0, tMax)
# add the code which will manipulate the data in the browser
- script_code = \
- '<script type="text/javascript">\n'+detail+\
- ' var resolution = -1;\n'\
- ' var dragval = [0, 0];\n'\
- ' function redrawTimescale(t0, tMax, tS) {\n'\
- ' var rline = \'<div class="t" style="left:0;border-left:1px solid black;border-right:0;">\';\n'\
- ' var tTotal = tMax - t0;\n'\
- ' var list = document.getElementsByClassName("tblock");\n'\
- ' for (var i = 0; i < list.length; i++) {\n'\
- ' var timescale = list[i].getElementsByClassName("timescale")[0];\n'\
- ' var m0 = t0 + (tTotal*parseFloat(list[i].style.left)/100);\n'\
- ' var mTotal = tTotal*parseFloat(list[i].style.width)/100;\n'\
- ' var mMax = m0 + mTotal;\n'\
- ' var html = "";\n'\
- ' var divTotal = Math.floor(mTotal/tS) + 1;\n'\
- ' if(divTotal > 1000) continue;\n'\
- ' var divEdge = (mTotal - tS*(divTotal-1))*100/mTotal;\n'\
- ' var pos = 0.0, val = 0.0;\n'\
- ' for (var j = 0; j < divTotal; j++) {\n'\
- ' var htmlline = "";\n'\
- ' var mode = list[i].id[5];\n'\
- ' if(mode == "s") {\n'\
- ' pos = 100 - (((j)*tS*100)/mTotal) - divEdge;\n'\
- ' val = (j-divTotal+1)*tS;\n'\
- ' if(j == divTotal - 1)\n'\
- ' htmlline = \'<div class="t" style="right:\'+pos+\'%"><cS>S&rarr;</cS></div>\';\n'\
- ' else\n'\
- ' htmlline = \'<div class="t" style="right:\'+pos+\'%">\'+val+\'ms</div>\';\n'\
- ' } else {\n'\
- ' pos = 100 - (((j)*tS*100)/mTotal);\n'\
- ' val = (j)*tS;\n'\
- ' htmlline = \'<div class="t" style="right:\'+pos+\'%">\'+val+\'ms</div>\';\n'\
- ' if(j == 0)\n'\
- ' if(mode == "r")\n'\
- ' htmlline = rline+"<cS>&larr;R</cS></div>";\n'\
- ' else\n'\
- ' htmlline = rline+"<cS>0ms</div>";\n'\
- ' }\n'\
- ' html += htmlline;\n'\
- ' }\n'\
- ' timescale.innerHTML = html;\n'\
- ' }\n'\
- ' }\n'\
- ' function zoomTimeline() {\n'\
- ' var dmesg = document.getElementById("dmesg");\n'\
- ' var zoombox = document.getElementById("dmesgzoombox");\n'\
- ' var left = zoombox.scrollLeft;\n'\
- ' var val = parseFloat(dmesg.style.width);\n'\
- ' var newval = 100;\n'\
- ' var sh = window.outerWidth / 2;\n'\
- ' if(this.id == "zoomin") {\n'\
- ' newval = val * 1.2;\n'\
- ' if(newval > 910034) newval = 910034;\n'\
- ' dmesg.style.width = newval+"%";\n'\
- ' zoombox.scrollLeft = ((left + sh) * newval / val) - sh;\n'\
- ' } else if (this.id == "zoomout") {\n'\
- ' newval = val / 1.2;\n'\
- ' if(newval < 100) newval = 100;\n'\
- ' dmesg.style.width = newval+"%";\n'\
- ' zoombox.scrollLeft = ((left + sh) * newval / val) - sh;\n'\
- ' } else {\n'\
- ' zoombox.scrollLeft = 0;\n'\
- ' dmesg.style.width = "100%";\n'\
- ' }\n'\
- ' var tS = [10000, 5000, 2000, 1000, 500, 200, 100, 50, 20, 10, 5, 2, 1];\n'\
- ' var t0 = bounds[0];\n'\
- ' var tMax = bounds[1];\n'\
- ' var tTotal = tMax - t0;\n'\
- ' var wTotal = tTotal * 100.0 / newval;\n'\
- ' var idx = 7*window.innerWidth/1100;\n'\
- ' for(var i = 0; (i < tS.length)&&((wTotal / tS[i]) < idx); i++);\n'\
- ' if(i >= tS.length) i = tS.length - 1;\n'\
- ' if(tS[i] == resolution) return;\n'\
- ' resolution = tS[i];\n'\
- ' redrawTimescale(t0, tMax, tS[i]);\n'\
- ' }\n'\
- ' function deviceName(title) {\n'\
- ' var name = title.slice(0, title.indexOf(" ("));\n'\
- ' return name;\n'\
- ' }\n'\
- ' function deviceHover() {\n'\
- ' var name = deviceName(this.title);\n'\
- ' var dmesg = document.getElementById("dmesg");\n'\
- ' var dev = dmesg.getElementsByClassName("thread");\n'\
- ' var cpu = -1;\n'\
- ' if(name.match("CPU_ON\[[0-9]*\]"))\n'\
- ' cpu = parseInt(name.slice(7));\n'\
- ' else if(name.match("CPU_OFF\[[0-9]*\]"))\n'\
- ' cpu = parseInt(name.slice(8));\n'\
- ' for (var i = 0; i < dev.length; i++) {\n'\
- ' dname = deviceName(dev[i].title);\n'\
- ' var cname = dev[i].className.slice(dev[i].className.indexOf("thread"));\n'\
- ' if((cpu >= 0 && dname.match("CPU_O[NF]*\\\[*"+cpu+"\\\]")) ||\n'\
- ' (name == dname))\n'\
- ' {\n'\
- ' dev[i].className = "hover "+cname;\n'\
- ' } else {\n'\
- ' dev[i].className = cname;\n'\
- ' }\n'\
- ' }\n'\
- ' }\n'\
- ' function deviceUnhover() {\n'\
- ' var dmesg = document.getElementById("dmesg");\n'\
- ' var dev = dmesg.getElementsByClassName("thread");\n'\
- ' for (var i = 0; i < dev.length; i++) {\n'\
- ' dev[i].className = dev[i].className.slice(dev[i].className.indexOf("thread"));\n'\
- ' }\n'\
- ' }\n'\
- ' function deviceTitle(title, total, cpu) {\n'\
- ' var prefix = "Total";\n'\
- ' if(total.length > 3) {\n'\
- ' prefix = "Average";\n'\
- ' total[1] = (total[1]+total[3])/2;\n'\
- ' total[2] = (total[2]+total[4])/2;\n'\
- ' }\n'\
- ' var devtitle = document.getElementById("devicedetailtitle");\n'\
- ' var name = deviceName(title);\n'\
- ' if(cpu >= 0) name = "CPU"+cpu;\n'\
- ' var driver = "";\n'\
- ' var tS = "<t2>(</t2>";\n'\
- ' var tR = "<t2>)</t2>";\n'\
- ' if(total[1] > 0)\n'\
- ' tS = "<t2>("+prefix+" Suspend:</t2><t0> "+total[1].toFixed(3)+" ms</t0> ";\n'\
- ' if(total[2] > 0)\n'\
- ' tR = " <t2>"+prefix+" Resume:</t2><t0> "+total[2].toFixed(3)+" ms<t2>)</t2></t0>";\n'\
- ' var s = title.indexOf("{");\n'\
- ' var e = title.indexOf("}");\n'\
- ' if((s >= 0) && (e >= 0))\n'\
- ' driver = title.slice(s+1, e) + " <t1>@</t1> ";\n'\
- ' if(total[1] > 0 && total[2] > 0)\n'\
- ' devtitle.innerHTML = "<t0>"+driver+name+"</t0> "+tS+tR;\n'\
- ' else\n'\
- ' devtitle.innerHTML = "<t0>"+title+"</t0>";\n'\
- ' return name;\n'\
- ' }\n'\
- ' function deviceDetail() {\n'\
- ' var devinfo = document.getElementById("devicedetail");\n'\
- ' devinfo.style.display = "block";\n'\
- ' var name = deviceName(this.title);\n'\
- ' var cpu = -1;\n'\
- ' if(name.match("CPU_ON\[[0-9]*\]"))\n'\
- ' cpu = parseInt(name.slice(7));\n'\
- ' else if(name.match("CPU_OFF\[[0-9]*\]"))\n'\
- ' cpu = parseInt(name.slice(8));\n'\
- ' var dmesg = document.getElementById("dmesg");\n'\
- ' var dev = dmesg.getElementsByClassName("thread");\n'\
- ' var idlist = [];\n'\
- ' var pdata = [[]];\n'\
- ' if(document.getElementById("devicedetail1"))\n'\
- ' pdata = [[], []];\n'\
- ' var pd = pdata[0];\n'\
- ' var total = [0.0, 0.0, 0.0];\n'\
- ' for (var i = 0; i < dev.length; i++) {\n'\
- ' dname = deviceName(dev[i].title);\n'\
- ' if((cpu >= 0 && dname.match("CPU_O[NF]*\\\[*"+cpu+"\\\]")) ||\n'\
- ' (name == dname))\n'\
- ' {\n'\
- ' idlist[idlist.length] = dev[i].id;\n'\
- ' var tidx = 1;\n'\
- ' if(dev[i].id[0] == "a") {\n'\
- ' pd = pdata[0];\n'\
- ' } else {\n'\
- ' if(pdata.length == 1) pdata[1] = [];\n'\
- ' if(total.length == 3) total[3]=total[4]=0.0;\n'\
- ' pd = pdata[1];\n'\
- ' tidx = 3;\n'\
- ' }\n'\
- ' var info = dev[i].title.split(" ");\n'\
- ' var pname = info[info.length-1];\n'\
- ' pd[pname] = parseFloat(info[info.length-3].slice(1));\n'\
- ' total[0] += pd[pname];\n'\
- ' if(pname.indexOf("suspend") >= 0)\n'\
- ' total[tidx] += pd[pname];\n'\
- ' else\n'\
- ' total[tidx+1] += pd[pname];\n'\
- ' }\n'\
- ' }\n'\
- ' var devname = deviceTitle(this.title, total, cpu);\n'\
- ' var left = 0.0;\n'\
- ' for (var t = 0; t < pdata.length; t++) {\n'\
- ' pd = pdata[t];\n'\
- ' devinfo = document.getElementById("devicedetail"+t);\n'\
- ' var phases = devinfo.getElementsByClassName("phaselet");\n'\
- ' for (var i = 0; i < phases.length; i++) {\n'\
- ' if(phases[i].id in pd) {\n'\
- ' var w = 100.0*pd[phases[i].id]/total[0];\n'\
- ' var fs = 32;\n'\
- ' if(w < 8) fs = 4*w | 0;\n'\
- ' var fs2 = fs*3/4;\n'\
- ' phases[i].style.width = w+"%";\n'\
- ' phases[i].style.left = left+"%";\n'\
- ' phases[i].title = phases[i].id+" "+pd[phases[i].id]+" ms";\n'\
- ' left += w;\n'\
- ' var time = "<t4 style=\\"font-size:"+fs+"px\\">"+pd[phases[i].id]+" ms<br></t4>";\n'\
- ' var pname = "<t3 style=\\"font-size:"+fs2+"px\\">"+phases[i].id.replace(new RegExp("_", "g"), " ")+"</t3>";\n'\
- ' phases[i].innerHTML = time+pname;\n'\
- ' } else {\n'\
- ' phases[i].style.width = "0%";\n'\
- ' phases[i].style.left = left+"%";\n'\
- ' }\n'\
- ' }\n'\
- ' }\n'\
- ' if(typeof devstats !== \'undefined\')\n'\
- ' callDetail(this.id, this.title);\n'\
- ' var cglist = document.getElementById("callgraphs");\n'\
- ' if(!cglist) return;\n'\
- ' var cg = cglist.getElementsByClassName("atop");\n'\
- ' if(cg.length < 10) return;\n'\
- ' for (var i = 0; i < cg.length; i++) {\n'\
- ' cgid = cg[i].id.split("x")[0]\n'\
- ' if(idlist.indexOf(cgid) >= 0) {\n'\
- ' cg[i].style.display = "block";\n'\
- ' } else {\n'\
- ' cg[i].style.display = "none";\n'\
- ' }\n'\
- ' }\n'\
- ' }\n'\
- ' function callDetail(devid, devtitle) {\n'\
- ' if(!(devid in devstats) || devstats[devid].length < 1)\n'\
- ' return;\n'\
- ' var list = devstats[devid];\n'\
- ' var tmp = devtitle.split(" ");\n'\
- ' var name = tmp[0], phase = tmp[tmp.length-1];\n'\
- ' var dd = document.getElementById(phase);\n'\
- ' var total = parseFloat(tmp[1].slice(1));\n'\
- ' var mlist = [];\n'\
- ' var maxlen = 0;\n'\
- ' var info = []\n'\
- ' for(var i in list) {\n'\
- ' if(list[i][0] == "@") {\n'\
- ' info = list[i].split("|");\n'\
- ' continue;\n'\
- ' }\n'\
- ' var tmp = list[i].split("|");\n'\
- ' var t = parseFloat(tmp[0]), f = tmp[1], c = parseInt(tmp[2]);\n'\
- ' var p = (t*100.0/total).toFixed(2);\n'\
- ' mlist[mlist.length] = [f, c, t.toFixed(2), p+"%"];\n'\
- ' if(f.length > maxlen)\n'\
- ' maxlen = f.length;\n'\
- ' }\n'\
- ' var pad = 5;\n'\
- ' if(mlist.length == 0) pad = 30;\n'\
- ' var html = \'<div style="padding-top:\'+pad+\'px"><t3> <b>\'+name+\':</b>\';\n'\
- ' if(info.length > 2)\n'\
- ' html += " start=<b>"+info[1]+"</b>, end=<b>"+info[2]+"</b>";\n'\
- ' if(info.length > 3)\n'\
- ' html += ", length<i>(w/o overhead)</i>=<b>"+info[3]+" ms</b>";\n'\
- ' if(info.length > 4)\n'\
- ' html += ", return=<b>"+info[4]+"</b>";\n'\
- ' html += "</t3></div>";\n'\
- ' if(mlist.length > 0) {\n'\
- ' html += \'<table class=fstat style="padding-top:\'+(maxlen*5)+\'px;"><tr><th>Function</th>\';\n'\
- ' for(var i in mlist)\n'\
- ' html += "<td class=vt>"+mlist[i][0]+"</td>";\n'\
- ' html += "</tr><tr><th>Calls</th>";\n'\
- ' for(var i in mlist)\n'\
- ' html += "<td>"+mlist[i][1]+"</td>";\n'\
- ' html += "</tr><tr><th>Time(ms)</th>";\n'\
- ' for(var i in mlist)\n'\
- ' html += "<td>"+mlist[i][2]+"</td>";\n'\
- ' html += "</tr><tr><th>Percent</th>";\n'\
- ' for(var i in mlist)\n'\
- ' html += "<td>"+mlist[i][3]+"</td>";\n'\
- ' html += "</tr></table>";\n'\
- ' }\n'\
- ' dd.innerHTML = html;\n'\
- ' var height = (maxlen*5)+100;\n'\
- ' dd.style.height = height+"px";\n'\
- ' document.getElementById("devicedetail").style.height = height+"px";\n'\
- ' }\n'\
- ' function callSelect() {\n'\
- ' var cglist = document.getElementById("callgraphs");\n'\
- ' if(!cglist) return;\n'\
- ' var cg = cglist.getElementsByClassName("atop");\n'\
- ' for (var i = 0; i < cg.length; i++) {\n'\
- ' if(this.id == cg[i].id) {\n'\
- ' cg[i].style.display = "block";\n'\
- ' } else {\n'\
- ' cg[i].style.display = "none";\n'\
- ' }\n'\
- ' }\n'\
- ' }\n'\
- ' function devListWindow(e) {\n'\
- ' var win = window.open();\n'\
- ' var html = "<title>"+e.target.innerHTML+"</title>"+\n'\
- ' "<style type=\\"text/css\\">"+\n'\
- ' " ul {list-style-type:circle;padding-left:10px;margin-left:10px;}"+\n'\
- ' "</style>"\n'\
- ' var dt = devtable[0];\n'\
- ' if(e.target.id != "devlist1")\n'\
- ' dt = devtable[1];\n'\
- ' win.document.write(html+dt);\n'\
- ' }\n'\
- ' function errWindow() {\n'\
- ' var range = this.id.split("_");\n'\
- ' var idx1 = parseInt(range[0]);\n'\
- ' var idx2 = parseInt(range[1]);\n'\
- ' var win = window.open();\n'\
- ' var log = document.getElementById("dmesglog");\n'\
- ' var title = "<title>dmesg log</title>";\n'\
- ' var text = log.innerHTML.split("\\n");\n'\
- ' var html = "";\n'\
- ' for(var i = 0; i < text.length; i++) {\n'\
- ' if(i == idx1) {\n'\
- ' html += "<e id=target>"+text[i]+"</e>\\n";\n'\
- ' } else if(i > idx1 && i <= idx2) {\n'\
- ' html += "<e>"+text[i]+"</e>\\n";\n'\
- ' } else {\n'\
- ' html += text[i]+"\\n";\n'\
- ' }\n'\
- ' }\n'\
- ' win.document.write("<style>e{color:red}</style>"+title+"<pre>"+html+"</pre>");\n'\
- ' win.location.hash = "#target";\n'\
- ' win.document.close();\n'\
- ' }\n'\
- ' function logWindow(e) {\n'\
- ' var name = e.target.id.slice(4);\n'\
- ' var win = window.open();\n'\
- ' var log = document.getElementById(name+"log");\n'\
- ' var title = "<title>"+document.title.split(" ")[0]+" "+name+" log</title>";\n'\
- ' win.document.write(title+"<pre>"+log.innerHTML+"</pre>");\n'\
- ' win.document.close();\n'\
- ' }\n'\
- ' function onMouseDown(e) {\n'\
- ' dragval[0] = e.clientX;\n'\
- ' dragval[1] = document.getElementById("dmesgzoombox").scrollLeft;\n'\
- ' document.onmousemove = onMouseMove;\n'\
- ' }\n'\
- ' function onMouseMove(e) {\n'\
- ' var zoombox = document.getElementById("dmesgzoombox");\n'\
- ' zoombox.scrollLeft = dragval[1] + dragval[0] - e.clientX;\n'\
- ' }\n'\
- ' function onMouseUp(e) {\n'\
- ' document.onmousemove = null;\n'\
- ' }\n'\
- ' function onKeyPress(e) {\n'\
- ' var c = e.charCode;\n'\
- ' if(c != 42 && c != 43 && c != 45) return;\n'\
- ' var click = document.createEvent("Events");\n'\
- ' click.initEvent("click", true, false);\n'\
- ' if(c == 43) \n'\
- ' document.getElementById("zoomin").dispatchEvent(click);\n'\
- ' else if(c == 45)\n'\
- ' document.getElementById("zoomout").dispatchEvent(click);\n'\
- ' else if(c == 42)\n'\
- ' document.getElementById("zoomdef").dispatchEvent(click);\n'\
- ' }\n'\
- ' window.addEventListener("resize", function () {zoomTimeline();});\n'\
- ' window.addEventListener("load", function () {\n'\
- ' var dmesg = document.getElementById("dmesg");\n'\
- ' dmesg.style.width = "100%"\n'\
- ' dmesg.onmousedown = onMouseDown;\n'\
- ' document.onmouseup = onMouseUp;\n'\
- ' document.onkeypress = onKeyPress;\n'\
- ' document.getElementById("zoomin").onclick = zoomTimeline;\n'\
- ' document.getElementById("zoomout").onclick = zoomTimeline;\n'\
- ' document.getElementById("zoomdef").onclick = zoomTimeline;\n'\
- ' var list = document.getElementsByClassName("err");\n'\
- ' for (var i = 0; i < list.length; i++)\n'\
- ' list[i].onclick = errWindow;\n'\
- ' var list = document.getElementsByClassName("logbtn");\n'\
- ' for (var i = 0; i < list.length; i++)\n'\
- ' list[i].onclick = logWindow;\n'\
- ' list = document.getElementsByClassName("devlist");\n'\
- ' for (var i = 0; i < list.length; i++)\n'\
- ' list[i].onclick = devListWindow;\n'\
- ' var dev = dmesg.getElementsByClassName("thread");\n'\
- ' for (var i = 0; i < dev.length; i++) {\n'\
- ' dev[i].onclick = deviceDetail;\n'\
- ' dev[i].onmouseover = deviceHover;\n'\
- ' dev[i].onmouseout = deviceUnhover;\n'\
- ' }\n'\
- ' var dev = dmesg.getElementsByClassName("srccall");\n'\
- ' for (var i = 0; i < dev.length; i++)\n'\
- ' dev[i].onclick = callSelect;\n'\
- ' zoomTimeline();\n'\
- ' });\n'\
- '</script>\n'
+ hf.write(detail);
+ script_code = r""" var resolution = -1;
+ var dragval = [0, 0];
+ function redrawTimescale(t0, tMax, tS) {
+ var rline = '<div class="t" style="left:0;border-left:1px solid black;border-right:0;">';
+ var tTotal = tMax - t0;
+ var list = document.getElementsByClassName("tblock");
+ for (var i = 0; i < list.length; i++) {
+ var timescale = list[i].getElementsByClassName("timescale")[0];
+ var m0 = t0 + (tTotal*parseFloat(list[i].style.left)/100);
+ var mTotal = tTotal*parseFloat(list[i].style.width)/100;
+ var mMax = m0 + mTotal;
+ var html = "";
+ var divTotal = Math.floor(mTotal/tS) + 1;
+ if(divTotal > 1000) continue;
+ var divEdge = (mTotal - tS*(divTotal-1))*100/mTotal;
+ var pos = 0.0, val = 0.0;
+ for (var j = 0; j < divTotal; j++) {
+ var htmlline = "";
+ var mode = list[i].id[5];
+ if(mode == "s") {
+ pos = 100 - (((j)*tS*100)/mTotal) - divEdge;
+ val = (j-divTotal+1)*tS;
+ if(j == divTotal - 1)
+ htmlline = '<div class="t" style="right:'+pos+'%"><cS>S&rarr;</cS></div>';
+ else
+ htmlline = '<div class="t" style="right:'+pos+'%">'+val+'ms</div>';
+ } else {
+ pos = 100 - (((j)*tS*100)/mTotal);
+ val = (j)*tS;
+ htmlline = '<div class="t" style="right:'+pos+'%">'+val+'ms</div>';
+ if(j == 0)
+ if(mode == "r")
+ htmlline = rline+"<cS>&larr;R</cS></div>";
+ else
+ htmlline = rline+"<cS>0ms</div>";
+ }
+ html += htmlline;
+ }
+ timescale.innerHTML = html;
+ }
+ }
+ function zoomTimeline() {
+ var dmesg = document.getElementById("dmesg");
+ var zoombox = document.getElementById("dmesgzoombox");
+ var left = zoombox.scrollLeft;
+ var val = parseFloat(dmesg.style.width);
+ var newval = 100;
+ var sh = window.outerWidth / 2;
+ if(this.id == "zoomin") {
+ newval = val * 1.2;
+ if(newval > 910034) newval = 910034;
+ dmesg.style.width = newval+"%";
+ zoombox.scrollLeft = ((left + sh) * newval / val) - sh;
+ } else if (this.id == "zoomout") {
+ newval = val / 1.2;
+ if(newval < 100) newval = 100;
+ dmesg.style.width = newval+"%";
+ zoombox.scrollLeft = ((left + sh) * newval / val) - sh;
+ } else {
+ zoombox.scrollLeft = 0;
+ dmesg.style.width = "100%";
+ }
+ var tS = [10000, 5000, 2000, 1000, 500, 200, 100, 50, 20, 10, 5, 2, 1];
+ var t0 = bounds[0];
+ var tMax = bounds[1];
+ var tTotal = tMax - t0;
+ var wTotal = tTotal * 100.0 / newval;
+ var idx = 7*window.innerWidth/1100;
+ for(var i = 0; (i < tS.length)&&((wTotal / tS[i]) < idx); i++);
+ if(i >= tS.length) i = tS.length - 1;
+ if(tS[i] == resolution) return;
+ resolution = tS[i];
+ redrawTimescale(t0, tMax, tS[i]);
+ }
+ function deviceName(title) {
+ var name = title.slice(0, title.indexOf(" ("));
+ return name;
+ }
+ function deviceHover() {
+ var name = deviceName(this.title);
+ var dmesg = document.getElementById("dmesg");
+ var dev = dmesg.getElementsByClassName("thread");
+ var cpu = -1;
+ if(name.match("CPU_ON\[[0-9]*\]"))
+ cpu = parseInt(name.slice(7));
+ else if(name.match("CPU_OFF\[[0-9]*\]"))
+ cpu = parseInt(name.slice(8));
+ for (var i = 0; i < dev.length; i++) {
+ dname = deviceName(dev[i].title);
+ var cname = dev[i].className.slice(dev[i].className.indexOf("thread"));
+ if((cpu >= 0 && dname.match("CPU_O[NF]*\\[*"+cpu+"\\]")) ||
+ (name == dname))
+ {
+ dev[i].className = "hover "+cname;
+ } else {
+ dev[i].className = cname;
+ }
+ }
+ }
+ function deviceUnhover() {
+ var dmesg = document.getElementById("dmesg");
+ var dev = dmesg.getElementsByClassName("thread");
+ for (var i = 0; i < dev.length; i++) {
+ dev[i].className = dev[i].className.slice(dev[i].className.indexOf("thread"));
+ }
+ }
+ function deviceTitle(title, total, cpu) {
+ var prefix = "Total";
+ if(total.length > 3) {
+ prefix = "Average";
+ total[1] = (total[1]+total[3])/2;
+ total[2] = (total[2]+total[4])/2;
+ }
+ var devtitle = document.getElementById("devicedetailtitle");
+ var name = deviceName(title);
+ if(cpu >= 0) name = "CPU"+cpu;
+ var driver = "";
+ var tS = "<t2>(</t2>";
+ var tR = "<t2>)</t2>";
+ if(total[1] > 0)
+ tS = "<t2>("+prefix+" Suspend:</t2><t0> "+total[1].toFixed(3)+" ms</t0> ";
+ if(total[2] > 0)
+ tR = " <t2>"+prefix+" Resume:</t2><t0> "+total[2].toFixed(3)+" ms<t2>)</t2></t0>";
+ var s = title.indexOf("{");
+ var e = title.indexOf("}");
+ if((s >= 0) && (e >= 0))
+ driver = title.slice(s+1, e) + " <t1>@</t1> ";
+ if(total[1] > 0 && total[2] > 0)
+ devtitle.innerHTML = "<t0>"+driver+name+"</t0> "+tS+tR;
+ else
+ devtitle.innerHTML = "<t0>"+title+"</t0>";
+ return name;
+ }
+ function deviceDetail() {
+ var devinfo = document.getElementById("devicedetail");
+ devinfo.style.display = "block";
+ var name = deviceName(this.title);
+ var cpu = -1;
+ if(name.match("CPU_ON\[[0-9]*\]"))
+ cpu = parseInt(name.slice(7));
+ else if(name.match("CPU_OFF\[[0-9]*\]"))
+ cpu = parseInt(name.slice(8));
+ var dmesg = document.getElementById("dmesg");
+ var dev = dmesg.getElementsByClassName("thread");
+ var idlist = [];
+ var pdata = [[]];
+ if(document.getElementById("devicedetail1"))
+ pdata = [[], []];
+ var pd = pdata[0];
+ var total = [0.0, 0.0, 0.0];
+ for (var i = 0; i < dev.length; i++) {
+ dname = deviceName(dev[i].title);
+ if((cpu >= 0 && dname.match("CPU_O[NF]*\\[*"+cpu+"\\]")) ||
+ (name == dname))
+ {
+ idlist[idlist.length] = dev[i].id;
+ var tidx = 1;
+ if(dev[i].id[0] == "a") {
+ pd = pdata[0];
+ } else {
+ if(pdata.length == 1) pdata[1] = [];
+ if(total.length == 3) total[3]=total[4]=0.0;
+ pd = pdata[1];
+ tidx = 3;
+ }
+ var info = dev[i].title.split(" ");
+ var pname = info[info.length-1];
+ pd[pname] = parseFloat(info[info.length-3].slice(1));
+ total[0] += pd[pname];
+ if(pname.indexOf("suspend") >= 0)
+ total[tidx] += pd[pname];
+ else
+ total[tidx+1] += pd[pname];
+ }
+ }
+ var devname = deviceTitle(this.title, total, cpu);
+ var left = 0.0;
+ for (var t = 0; t < pdata.length; t++) {
+ pd = pdata[t];
+ devinfo = document.getElementById("devicedetail"+t);
+ var phases = devinfo.getElementsByClassName("phaselet");
+ for (var i = 0; i < phases.length; i++) {
+ if(phases[i].id in pd) {
+ var w = 100.0*pd[phases[i].id]/total[0];
+ var fs = 32;
+ if(w < 8) fs = 4*w | 0;
+ var fs2 = fs*3/4;
+ phases[i].style.width = w+"%";
+ phases[i].style.left = left+"%";
+ phases[i].title = phases[i].id+" "+pd[phases[i].id]+" ms";
+ left += w;
+ var time = "<t4 style=\"font-size:"+fs+"px\">"+pd[phases[i].id]+" ms<br></t4>";
+ var pname = "<t3 style=\"font-size:"+fs2+"px\">"+phases[i].id.replace(new RegExp("_", "g"), " ")+"</t3>";
+ phases[i].innerHTML = time+pname;
+ } else {
+ phases[i].style.width = "0%";
+ phases[i].style.left = left+"%";
+ }
+ }
+ }
+ if(typeof devstats !== 'undefined')
+ callDetail(this.id, this.title);
+ var cglist = document.getElementById("callgraphs");
+ if(!cglist) return;
+ var cg = cglist.getElementsByClassName("atop");
+ if(cg.length < 10) return;
+ for (var i = 0; i < cg.length; i++) {
+ cgid = cg[i].id.split("x")[0]
+ if(idlist.indexOf(cgid) >= 0) {
+ cg[i].style.display = "block";
+ } else {
+ cg[i].style.display = "none";
+ }
+ }
+ }
+ function callDetail(devid, devtitle) {
+ if(!(devid in devstats) || devstats[devid].length < 1)
+ return;
+ var list = devstats[devid];
+ var tmp = devtitle.split(" ");
+ var name = tmp[0], phase = tmp[tmp.length-1];
+ var dd = document.getElementById(phase);
+ var total = parseFloat(tmp[1].slice(1));
+ var mlist = [];
+ var maxlen = 0;
+ var info = []
+ for(var i in list) {
+ if(list[i][0] == "@") {
+ info = list[i].split("|");
+ continue;
+ }
+ var tmp = list[i].split("|");
+ var t = parseFloat(tmp[0]), f = tmp[1], c = parseInt(tmp[2]);
+ var p = (t*100.0/total).toFixed(2);
+ mlist[mlist.length] = [f, c, t.toFixed(2), p+"%"];
+ if(f.length > maxlen)
+ maxlen = f.length;
+ }
+ var pad = 5;
+ if(mlist.length == 0) pad = 30;
+ var html = '<div style="padding-top:'+pad+'px"><t3> <b>'+name+':</b>';
+ if(info.length > 2)
+ html += " start=<b>"+info[1]+"</b>, end=<b>"+info[2]+"</b>";
+ if(info.length > 3)
+ html += ", length<i>(w/o overhead)</i>=<b>"+info[3]+" ms</b>";
+ if(info.length > 4)
+ html += ", return=<b>"+info[4]+"</b>";
+ html += "</t3></div>";
+ if(mlist.length > 0) {
+ html += '<table class=fstat style="padding-top:'+(maxlen*5)+'px;"><tr><th>Function</th>';
+ for(var i in mlist)
+ html += "<td class=vt>"+mlist[i][0]+"</td>";
+ html += "</tr><tr><th>Calls</th>";
+ for(var i in mlist)
+ html += "<td>"+mlist[i][1]+"</td>";
+ html += "</tr><tr><th>Time(ms)</th>";
+ for(var i in mlist)
+ html += "<td>"+mlist[i][2]+"</td>";
+ html += "</tr><tr><th>Percent</th>";
+ for(var i in mlist)
+ html += "<td>"+mlist[i][3]+"</td>";
+ html += "</tr></table>";
+ }
+ dd.innerHTML = html;
+ var height = (maxlen*5)+100;
+ dd.style.height = height+"px";
+ document.getElementById("devicedetail").style.height = height+"px";
+ }
+ function callSelect() {
+ var cglist = document.getElementById("callgraphs");
+ if(!cglist) return;
+ var cg = cglist.getElementsByClassName("atop");
+ for (var i = 0; i < cg.length; i++) {
+ if(this.id == cg[i].id) {
+ cg[i].style.display = "block";
+ } else {
+ cg[i].style.display = "none";
+ }
+ }
+ }
+ function devListWindow(e) {
+ var win = window.open();
+ var html = "<title>"+e.target.innerHTML+"</title>"+
+ "<style type=\"text/css\">"+
+ " ul {list-style-type:circle;padding-left:10px;margin-left:10px;}"+
+ "</style>"
+ var dt = devtable[0];
+ if(e.target.id != "devlist1")
+ dt = devtable[1];
+ win.document.write(html+dt);
+ }
+ function errWindow() {
+ var range = this.id.split("_");
+ var idx1 = parseInt(range[0]);
+ var idx2 = parseInt(range[1]);
+ var win = window.open();
+ var log = document.getElementById("dmesglog");
+ var title = "<title>dmesg log</title>";
+ var text = log.innerHTML.split("\n");
+ var html = "";
+ for(var i = 0; i < text.length; i++) {
+ if(i == idx1) {
+ html += "<e id=target>"+text[i]+"</e>\n";
+ } else if(i > idx1 && i <= idx2) {
+ html += "<e>"+text[i]+"</e>\n";
+ } else {
+ html += text[i]+"\n";
+ }
+ }
+ win.document.write("<style>e{color:red}</style>"+title+"<pre>"+html+"</pre>");
+ win.location.hash = "#target";
+ win.document.close();
+ }
+ function logWindow(e) {
+ var name = e.target.id.slice(4);
+ var win = window.open();
+ var log = document.getElementById(name+"log");
+ var title = "<title>"+document.title.split(" ")[0]+" "+name+" log</title>";
+ win.document.write(title+"<pre>"+log.innerHTML+"</pre>");
+ win.document.close();
+ }
+ function onMouseDown(e) {
+ dragval[0] = e.clientX;
+ dragval[1] = document.getElementById("dmesgzoombox").scrollLeft;
+ document.onmousemove = onMouseMove;
+ }
+ function onMouseMove(e) {
+ var zoombox = document.getElementById("dmesgzoombox");
+ zoombox.scrollLeft = dragval[1] + dragval[0] - e.clientX;
+ }
+ function onMouseUp(e) {
+ document.onmousemove = null;
+ }
+ function onKeyPress(e) {
+ var c = e.charCode;
+ if(c != 42 && c != 43 && c != 45) return;
+ var click = document.createEvent("Events");
+ click.initEvent("click", true, false);
+ if(c == 43)
+ document.getElementById("zoomin").dispatchEvent(click);
+ else if(c == 45)
+ document.getElementById("zoomout").dispatchEvent(click);
+ else if(c == 42)
+ document.getElementById("zoomdef").dispatchEvent(click);
+ }
+ window.addEventListener("resize", function () {zoomTimeline();});
+ window.addEventListener("load", function () {
+ var dmesg = document.getElementById("dmesg");
+ dmesg.style.width = "100%"
+ dmesg.onmousedown = onMouseDown;
+ document.onmouseup = onMouseUp;
+ document.onkeypress = onKeyPress;
+ document.getElementById("zoomin").onclick = zoomTimeline;
+ document.getElementById("zoomout").onclick = zoomTimeline;
+ document.getElementById("zoomdef").onclick = zoomTimeline;
+ var list = document.getElementsByClassName("err");
+ for (var i = 0; i < list.length; i++)
+ list[i].onclick = errWindow;
+ var list = document.getElementsByClassName("logbtn");
+ for (var i = 0; i < list.length; i++)
+ list[i].onclick = logWindow;
+ list = document.getElementsByClassName("devlist");
+ for (var i = 0; i < list.length; i++)
+ list[i].onclick = devListWindow;
+ var dev = dmesg.getElementsByClassName("thread");
+ for (var i = 0; i < dev.length; i++) {
+ dev[i].onclick = deviceDetail;
+ dev[i].onmouseover = deviceHover;
+ dev[i].onmouseout = deviceUnhover;
+ }
+ var dev = dmesg.getElementsByClassName("srccall");
+ for (var i = 0; i < dev.length; i++)
+ dev[i].onclick = callSelect;
+ zoomTimeline();
+ });
+</script> """
hf.write(script_code);
# Function: executeSuspend
@@ -5524,7 +5525,9 @@ def executeSuspend(quiet=False):
if ((mode == 'freeze') or (sv.memmode == 's2idle')) \
and sv.haveTurbostat():
# execution will pause here
- turbo = sv.turbostat(s0ixready)
+ retval, turbo = sv.turbostat(s0ixready)
+ if retval != 0:
+ tdata['error'] ='turbostat returned %d' % retval
if turbo:
tdata['turbo'] = turbo
else:
@@ -5532,6 +5535,7 @@ def executeSuspend(quiet=False):
pf.write(mode)
# execution will pause here
try:
+ pf.flush()
pf.close()
except Exception as e:
tdata['error'] = str(e)
@@ -5633,7 +5637,7 @@ def deviceInfo(output=''):
tgtval = 'runtime_status'
lines = dict()
for dirname, dirnames, filenames in os.walk('/sys/devices'):
- if(not re.match('.*/power', dirname) or
+ if(not re.match(r'.*/power', dirname) or
'control' not in filenames or
tgtval not in filenames):
continue
@@ -5702,6 +5706,40 @@ def getModes():
fp.close()
return modes
+def dmidecode_backup(out, fatal=False):
+ cpath, spath, info = '/proc/cpuinfo', '/sys/class/dmi/id', {
+ 'bios-vendor': 'bios_vendor',
+ 'bios-version': 'bios_version',
+ 'bios-release-date': 'bios_date',
+ 'system-manufacturer': 'sys_vendor',
+ 'system-product-name': 'product_name',
+ 'system-version': 'product_version',
+ 'system-serial-number': 'product_serial',
+ 'baseboard-manufacturer': 'board_vendor',
+ 'baseboard-product-name': 'board_name',
+ 'baseboard-version': 'board_version',
+ 'baseboard-serial-number': 'board_serial',
+ 'chassis-manufacturer': 'chassis_vendor',
+ 'chassis-version': 'chassis_version',
+ 'chassis-serial-number': 'chassis_serial',
+ }
+ for key in info:
+ if key not in out:
+ val = sysvals.getVal(os.path.join(spath, info[key])).strip()
+ if val and val.lower() != 'to be filled by o.e.m.':
+ out[key] = val
+ if 'processor-version' not in out and os.path.exists(cpath):
+ with open(cpath, 'r') as fp:
+ for line in fp:
+ m = re.match(r'^model\s*name\s*\:\s*(?P<c>.*)', line)
+ if m:
+ out['processor-version'] = m.group('c').strip()
+ break
+ if fatal and len(out) < 1:
+ doError('dmidecode failed to get info from %s or %s' % \
+ (sysvals.mempath, spath))
+ return out
+
# Function: dmidecode
# Description:
# Read the bios tables and pull out system info
@@ -5712,6 +5750,8 @@ def getModes():
# A dict object with all available key/values
def dmidecode(mempath, fatal=False):
out = dict()
+ if(not (os.path.exists(mempath) and os.access(mempath, os.R_OK))):
+ return dmidecode_backup(out, fatal)
# the list of values to retrieve, with hardcoded (type, idx)
info = {
@@ -5727,24 +5767,14 @@ def dmidecode(mempath, fatal=False):
'baseboard-version': (2, 6),
'baseboard-serial-number': (2, 7),
'chassis-manufacturer': (3, 4),
- 'chassis-type': (3, 5),
'chassis-version': (3, 6),
'chassis-serial-number': (3, 7),
'processor-manufacturer': (4, 7),
'processor-version': (4, 16),
}
- if(not os.path.exists(mempath)):
- if(fatal):
- doError('file does not exist: %s' % mempath)
- return out
- if(not os.access(mempath, os.R_OK)):
- if(fatal):
- doError('file is not readable: %s' % mempath)
- return out
# by default use legacy scan, but try to use EFI first
- memaddr = 0xf0000
- memsize = 0x10000
+ memaddr, memsize = 0xf0000, 0x10000
for ep in ['/sys/firmware/efi/systab', '/proc/efi/systab']:
if not os.path.exists(ep) or not os.access(ep, os.R_OK):
continue
@@ -5765,11 +5795,7 @@ def dmidecode(mempath, fatal=False):
fp.seek(memaddr)
buf = fp.read(memsize)
except:
- if(fatal):
- doError('DMI table is unreachable, sorry')
- else:
- pprint('WARNING: /dev/mem is not readable, ignoring DMI data')
- return out
+ return dmidecode_backup(out, fatal)
fp.close()
# search for either an SM table or DMI table
@@ -5785,10 +5811,7 @@ def dmidecode(mempath, fatal=False):
break
i += 16
if base == 0 and length == 0 and num == 0:
- if(fatal):
- doError('Neither SMBIOS nor DMI were found')
- else:
- return out
+ return dmidecode_backup(out, fatal)
# read in the SM or DMI table
try:
@@ -5796,11 +5819,7 @@ def dmidecode(mempath, fatal=False):
fp.seek(base)
buf = fp.read(length)
except:
- if(fatal):
- doError('DMI table is unreachable, sorry')
- else:
- pprint('WARNING: /dev/mem is not readable, ignoring DMI data')
- return out
+ return dmidecode_backup(out, fatal)
fp.close()
# scan the table for the values we want
@@ -6272,7 +6291,10 @@ def find_in_html(html, start, end, firstonly=True):
return out
def data_from_html(file, outpath, issues, fulldetail=False):
- html = open(file, 'r').read()
+ try:
+ html = open(file, 'r').read()
+ except:
+ html = ascii(open(file, 'rb').read())
sysvals.htmlfile = os.path.relpath(file, outpath)
# extract general info
suspend = find_in_html(html, 'Kernel Suspend', 'ms')
@@ -6290,7 +6312,7 @@ def data_from_html(file, outpath, issues, fulldetail=False):
tstr = dt.strftime('%Y/%m/%d %H:%M:%S')
error = find_in_html(html, '<table class="testfail"><tr><td>', '</td>')
if error:
- m = re.match('[a-z0-9]* failed in (?P<p>\S*).*', error)
+ m = re.match(r'[a-z0-9]* failed in (?P<p>\S*).*', error)
if m:
result = 'fail in %s' % m.group('p')
else:
@@ -6307,8 +6329,9 @@ def data_from_html(file, outpath, issues, fulldetail=False):
d.end = 999999999
d.dmesgtext = log.split('\n')
tp = d.extractErrorInfo()
- for msg in tp.msglist:
- sysvals.errorSummary(issues, msg)
+ if len(issues) < 100:
+ for msg in tp.msglist:
+ sysvals.errorSummary(issues, msg)
if stmp[2] == 'freeze':
extra = d.turbostatInfo()
elist = dict()
@@ -6325,6 +6348,11 @@ def data_from_html(file, outpath, issues, fulldetail=False):
line = find_in_html(log, '# netfix ', '\n')
if line:
extra['netfix'] = line
+ line = find_in_html(log, '# command ', '\n')
+ if line:
+ m = re.match(r'.* -m (?P<m>\S*).*', line)
+ if m:
+ extra['fullmode'] = m.group('m')
low = find_in_html(html, 'freeze time: <b>', ' ms</b>')
for lowstr in ['waking', '+']:
if not low:
@@ -6334,7 +6362,7 @@ def data_from_html(file, outpath, issues, fulldetail=False):
if lowstr == '+':
issue = 'S2LOOPx%d' % len(low.split('+'))
else:
- m = re.match('.*waking *(?P<n>[0-9]*) *times.*', low)
+ m = re.match(r'.*waking *(?P<n>[0-9]*) *times.*', low)
issue = 'S2WAKEx%s' % m.group('n') if m else 'S2WAKExNaN'
match = [i for i in issues if i['match'] == issue]
if len(match) > 0:
@@ -6352,10 +6380,10 @@ def data_from_html(file, outpath, issues, fulldetail=False):
# extract device info
devices = dict()
for line in html.split('\n'):
- m = re.match(' *<div id=\"[a,0-9]*\" *title=\"(?P<title>.*)\" class=\"thread.*', line)
+ m = re.match(r' *<div id=\"[a,0-9]*\" *title=\"(?P<title>.*)\" class=\"thread.*', line)
if not m or 'thread kth' in line or 'thread sec' in line:
continue
- m = re.match('(?P<n>.*) \((?P<t>[0-9,\.]*) ms\) (?P<p>.*)', m.group('title'))
+ m = re.match(r'(?P<n>.*) \((?P<t>[0-9,\.]*) ms\) (?P<p>.*)', m.group('title'))
if not m:
continue
name, time, phase = m.group('n'), m.group('t'), m.group('p')
@@ -6416,9 +6444,9 @@ def genHtml(subdir, force=False):
for filename in filenames:
file = os.path.join(dirname, filename)
if sysvals.usable(file):
- if(re.match('.*_dmesg.txt', filename)):
+ if(re.match(r'.*_dmesg.txt', filename)):
sysvals.dmesgfile = file
- elif(re.match('.*_ftrace.txt', filename)):
+ elif(re.match(r'.*_ftrace.txt', filename)):
sysvals.ftracefile = file
sysvals.setOutputFile()
if (sysvals.dmesgfile or sysvals.ftracefile) and sysvals.htmlfile and \
@@ -6441,7 +6469,7 @@ def runSummary(subdir, local=True, genhtml=False):
desc = {'host':[],'mode':[],'kernel':[]}
for dirname, dirnames, filenames in os.walk(subdir):
for filename in filenames:
- if(not re.match('.*.html', filename)):
+ if(not re.match(r'.*.html', filename)):
continue
data = data_from_html(os.path.join(dirname, filename), outpath, issues)
if(not data):
diff --git a/tools/power/x86/intel-speed-select/isst-config.c b/tools/power/x86/intel-speed-select/isst-config.c
index 5899c27c2e2e..5127be34869e 100644
--- a/tools/power/x86/intel-speed-select/isst-config.c
+++ b/tools/power/x86/intel-speed-select/isst-config.c
@@ -16,7 +16,7 @@ struct process_cmd_struct {
int arg;
};
-static const char *version_str = "v1.19";
+static const char *version_str = "v1.20";
static const int supported_api_ver = 3;
static struct isst_if_platform_info isst_platform_info;
diff --git a/tools/power/x86/intel-speed-select/isst-core.c b/tools/power/x86/intel-speed-select/isst-core.c
index 05efffbca3b7..e05561d00458 100644
--- a/tools/power/x86/intel-speed-select/isst-core.c
+++ b/tools/power/x86/intel-speed-select/isst-core.c
@@ -283,6 +283,8 @@ int isst_set_trl(struct isst_id *id, unsigned long long trl)
return 0;
}
+#define MSR_TRL_FREQ_MULTIPLIER 100
+
int isst_set_trl_from_current_tdp(struct isst_id *id, unsigned long long trl)
{
unsigned long long msr_trl;
@@ -310,6 +312,10 @@ int isst_set_trl_from_current_tdp(struct isst_id *id, unsigned long long trl)
for (i = 0; i < 8; ++i) {
unsigned long long _trl = trl[i];
+ /* MSR is always in 100 MHz unit */
+ if (isst_get_disp_freq_multiplier() == 1)
+ _trl /= MSR_TRL_FREQ_MULTIPLIER;
+
msr_trl |= (_trl << (i * 8));
}
}
diff --git a/tools/power/x86/turbostat/Makefile b/tools/power/x86/turbostat/Makefile
index 2d6dce2c8f77..b1e6817f1e54 100644
--- a/tools/power/x86/turbostat/Makefile
+++ b/tools/power/x86/turbostat/Makefile
@@ -14,6 +14,7 @@ turbostat : turbostat.c
override CFLAGS += -O2 -Wall -Wextra -I../../../include
override CFLAGS += -DMSRHEADER='"../../../../arch/x86/include/asm/msr-index.h"'
override CFLAGS += -DINTEL_FAMILY_HEADER='"../../../../arch/x86/include/asm/intel-family.h"'
+override CFLAGS += -DBUILD_BUG_HEADER='"../../../../include/linux/build_bug.h"'
override CFLAGS += -D_FILE_OFFSET_BITS=64
override CFLAGS += -D_FORTIFY_SOURCE=2
@@ -44,10 +45,13 @@ snapshot: turbostat
@echo "#define GENMASK(h, l) (((~0UL) << (l)) & (~0UL >> (sizeof(long) * 8 - 1 - (h))))" >> $(SNAPSHOT)/bits.h
@echo "#define GENMASK_ULL(h, l) (((~0ULL) << (l)) & (~0ULL >> (sizeof(long long) * 8 - 1 - (h))))" >> $(SNAPSHOT)/bits.h
+ @echo '#define BUILD_BUG_ON(cond) do { enum { compile_time_check ## __COUNTER__ = 1/(!(cond)) }; } while (0)' > $(SNAPSHOT)/build_bug.h
+
@echo PWD=. > $(SNAPSHOT)/Makefile
@echo "CFLAGS += -DMSRHEADER='\"msr-index.h\"'" >> $(SNAPSHOT)/Makefile
@echo "CFLAGS += -DINTEL_FAMILY_HEADER='\"intel-family.h\"'" >> $(SNAPSHOT)/Makefile
- @sed -e's/.*MSRHEADER.*//' -e's/.*INTEL_FAMILY_HEADER.*//' Makefile >> $(SNAPSHOT)/Makefile
+ @echo "CFLAGS += -DBUILD_BUG_HEADER='\"build_bug.h\"'" >> $(SNAPSHOT)/Makefile
+ @sed -e's/.*MSRHEADER.*//' -e's/.*INTEL_FAMILY_HEADER.*//' -e's/.*BUILD_BUG_HEADER.*//' Makefile >> $(SNAPSHOT)/Makefile
@rm -f $(SNAPSHOT).tar.gz
tar cvzf $(SNAPSHOT).tar.gz $(SNAPSHOT)
diff --git a/tools/power/x86/turbostat/turbostat.c b/tools/power/x86/turbostat/turbostat.c
index 8cdf41906e98..9f5d053d4bc6 100644
--- a/tools/power/x86/turbostat/turbostat.c
+++ b/tools/power/x86/turbostat/turbostat.c
@@ -10,6 +10,7 @@
#define _GNU_SOURCE
#include MSRHEADER
#include INTEL_FAMILY_HEADER
+#include BUILD_BUG_HEADER
#include <stdarg.h>
#include <stdio.h>
#include <err.h>
@@ -38,7 +39,6 @@
#include <stdbool.h>
#include <assert.h>
#include <linux/kernel.h>
-#include <linux/build_bug.h>
#define UNUSED(x) (void)(x)
@@ -5695,9 +5695,6 @@ static void probe_intel_uncore_frequency_cluster(void)
if (access("/sys/devices/system/cpu/intel_uncore_frequency/uncore00/current_freq_khz", R_OK))
return;
- if (quiet)
- return;
-
for (uncore_max_id = 0;; ++uncore_max_id) {
sprintf(path_base, "/sys/devices/system/cpu/intel_uncore_frequency/uncore%02d", uncore_max_id);
@@ -5727,6 +5724,14 @@ static void probe_intel_uncore_frequency_cluster(void)
sprintf(path, "%s/fabric_cluster_id", path_base);
cluster_id = read_sysfs_int(path);
+ sprintf(path, "%s/current_freq_khz", path_base);
+ sprintf(name_buf, "UMHz%d.%d", domain_id, cluster_id);
+
+ add_counter(0, path, name_buf, 0, SCOPE_PACKAGE, COUNTER_K2M, FORMAT_AVERAGE, 0, package_id);
+
+ if (quiet)
+ continue;
+
sprintf(path, "%s/min_freq_khz", path_base);
k = read_sysfs_int(path);
sprintf(path, "%s/max_freq_khz", path_base);
@@ -5743,11 +5748,6 @@ static void probe_intel_uncore_frequency_cluster(void)
sprintf(path, "%s/current_freq_khz", path_base);
k = read_sysfs_int(path);
fprintf(outf, " %d MHz\n", k / 1000);
-
- sprintf(path, "%s/current_freq_khz", path_base);
- sprintf(name_buf, "UMHz%d.%d", domain_id, cluster_id);
-
- add_counter(0, path, name_buf, 0, SCOPE_PACKAGE, COUNTER_K2M, FORMAT_AVERAGE, 0, package_id);
}
}
@@ -8424,7 +8424,7 @@ void cmdline(int argc, char **argv)
* Parse some options early, because they may make other options invalid,
* like adding the MSR counter with --add and at the same time using --no-msr.
*/
- while ((opt = getopt_long_only(argc, argv, "MP", long_options, &option_index)) != -1) {
+ while ((opt = getopt_long_only(argc, argv, "MPn:", long_options, &option_index)) != -1) {
switch (opt) {
case 'M':
no_msr = 1;
diff --git a/tools/rcu/rcu-updaters.sh b/tools/rcu/rcu-updaters.sh
new file mode 100755
index 000000000000..4ef1397927bb
--- /dev/null
+++ b/tools/rcu/rcu-updaters.sh
@@ -0,0 +1,52 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0+
+#
+# Run bpftrace to obtain a histogram of the types of primitives used to
+# initiate RCU grace periods. The count associated with rcu_gp_init()
+# is the number of normal (non-expedited) grace periods.
+#
+# Usage: rcu-updaters.sh [ duration-in-seconds ]
+#
+# Note that not all kernel builds have all of these functions. In those
+# that do not, this script will issue a diagnostic for each that is not
+# found, but continue normally for the rest of the functions.
+
+duration=${1}
+if test -n "${duration}"
+then
+ exitclause='interval:s:'"${duration}"' { exit(); }'
+else
+ echo 'Hit control-C to end sample and print results.'
+fi
+bpftrace -e 'kprobe:kvfree_call_rcu,
+ kprobe:call_rcu,
+ kprobe:call_rcu_tasks,
+ kprobe:call_rcu_tasks_rude,
+ kprobe:call_rcu_tasks_trace,
+ kprobe:call_srcu,
+ kprobe:rcu_barrier,
+ kprobe:rcu_barrier_tasks,
+ kprobe:rcu_barrier_tasks_rude,
+ kprobe:rcu_barrier_tasks_trace,
+ kprobe:srcu_barrier,
+ kprobe:synchronize_rcu,
+ kprobe:synchronize_rcu_expedited,
+ kprobe:synchronize_rcu_tasks,
+ kprobe:synchronize_rcu_tasks_rude,
+ kprobe:synchronize_rcu_tasks_trace,
+ kprobe:synchronize_srcu,
+ kprobe:synchronize_srcu_expedited,
+ kprobe:get_state_synchronize_rcu,
+ kprobe:get_state_synchronize_rcu_full,
+ kprobe:start_poll_synchronize_rcu,
+ kprobe:start_poll_synchronize_rcu_expedited,
+ kprobe:start_poll_synchronize_rcu_full,
+ kprobe:start_poll_synchronize_rcu_expedited_full,
+ kprobe:poll_state_synchronize_rcu,
+ kprobe:poll_state_synchronize_rcu_full,
+ kprobe:cond_synchronize_rcu,
+ kprobe:cond_synchronize_rcu_full,
+ kprobe:start_poll_synchronize_srcu,
+ kprobe:poll_state_synchronize_srcu,
+ kprobe:rcu_gp_init
+ { @counts[func] = count(); } '"${exitclause}"
diff --git a/tools/testing/cxl/test/cxl.c b/tools/testing/cxl/test/cxl.c
index 3482248aa344..90d5afd52dd0 100644
--- a/tools/testing/cxl/test/cxl.c
+++ b/tools/testing/cxl/test/cxl.c
@@ -630,11 +630,15 @@ static struct cxl_hdm *mock_cxl_setup_hdm(struct cxl_port *port,
struct cxl_endpoint_dvsec_info *info)
{
struct cxl_hdm *cxlhdm = devm_kzalloc(&port->dev, sizeof(*cxlhdm), GFP_KERNEL);
+ struct device *dev = &port->dev;
if (!cxlhdm)
return ERR_PTR(-ENOMEM);
cxlhdm->port = port;
+ cxlhdm->interleave_mask = ~0U;
+ cxlhdm->iw_cap_mask = ~0UL;
+ dev_set_drvdata(dev, cxlhdm);
return cxlhdm;
}
diff --git a/tools/testing/cxl/test/mem.c b/tools/testing/cxl/test/mem.c
index 6584443144de..eaf091a3d331 100644
--- a/tools/testing/cxl/test/mem.c
+++ b/tools/testing/cxl/test/mem.c
@@ -3,6 +3,7 @@
#include <linux/platform_device.h>
#include <linux/mod_devicetable.h>
+#include <linux/vmalloc.h>
#include <linux/module.h>
#include <linux/delay.h>
#include <linux/sizes.h>
diff --git a/tools/testing/selftests/Makefile b/tools/testing/selftests/Makefile
index 9039f3709aff..06eed383fdc0 100644
--- a/tools/testing/selftests/Makefile
+++ b/tools/testing/selftests/Makefile
@@ -21,6 +21,7 @@ TARGETS += drivers/net
TARGETS += drivers/net/bonding
TARGETS += drivers/net/team
TARGETS += drivers/net/virtio_net
+TARGETS += drivers/platform/x86/intel/ifs
TARGETS += dt
TARGETS += efivarfs
TARGETS += exec
diff --git a/tools/testing/selftests/alsa/Makefile b/tools/testing/selftests/alsa/Makefile
index 5af9ba8a4645..c1ce39874e2b 100644
--- a/tools/testing/selftests/alsa/Makefile
+++ b/tools/testing/selftests/alsa/Makefile
@@ -1,7 +1,7 @@
# SPDX-License-Identifier: GPL-2.0
#
-CFLAGS += $(shell pkg-config --cflags alsa)
+CFLAGS += $(shell pkg-config --cflags alsa) $(KHDR_INCLUDES)
LDLIBS += $(shell pkg-config --libs alsa)
ifeq ($(LDLIBS),)
LDLIBS += -lasound
diff --git a/tools/testing/selftests/arm64/abi/ptrace.c b/tools/testing/selftests/arm64/abi/ptrace.c
index abe4d58d731d..4c941270d8de 100644
--- a/tools/testing/selftests/arm64/abi/ptrace.c
+++ b/tools/testing/selftests/arm64/abi/ptrace.c
@@ -47,7 +47,7 @@ static void test_tpidr(pid_t child)
/* ...write a new value.. */
write_iov.iov_len = sizeof(uint64_t);
- write_val[0] = read_val[0]++;
+ write_val[0] = read_val[0] + 1;
ret = ptrace(PTRACE_SETREGSET, child, NT_ARM_TLS, &write_iov);
ksft_test_result(ret == 0, "write_tpidr_one\n");
diff --git a/tools/testing/selftests/arm64/fp/.gitignore b/tools/testing/selftests/arm64/fp/.gitignore
index 00e52c966281..8362e7ec35ad 100644
--- a/tools/testing/selftests/arm64/fp/.gitignore
+++ b/tools/testing/selftests/arm64/fp/.gitignore
@@ -2,6 +2,7 @@ fp-pidbench
fp-ptrace
fp-stress
fpsimd-test
+kernel-test
rdvl-sme
rdvl-sve
sve-probe-vls
diff --git a/tools/testing/selftests/arm64/fp/Makefile b/tools/testing/selftests/arm64/fp/Makefile
index 55d4f00d9e8e..d171021e4cdd 100644
--- a/tools/testing/selftests/arm64/fp/Makefile
+++ b/tools/testing/selftests/arm64/fp/Makefile
@@ -12,6 +12,7 @@ TEST_GEN_PROGS := \
vec-syscfg \
za-fork za-ptrace
TEST_GEN_PROGS_EXTENDED := fp-pidbench fpsimd-test \
+ kernel-test \
rdvl-sme rdvl-sve \
sve-test \
ssve-test \
diff --git a/tools/testing/selftests/arm64/fp/fp-stress.c b/tools/testing/selftests/arm64/fp/fp-stress.c
index dd31647b00a2..faac24bdefeb 100644
--- a/tools/testing/selftests/arm64/fp/fp-stress.c
+++ b/tools/testing/selftests/arm64/fp/fp-stress.c
@@ -319,6 +319,19 @@ static void start_fpsimd(struct child_data *child, int cpu, int copy)
ksft_print_msg("Started %s\n", child->name);
}
+static void start_kernel(struct child_data *child, int cpu, int copy)
+{
+ int ret;
+
+ ret = asprintf(&child->name, "KERNEL-%d-%d", cpu, copy);
+ if (ret == -1)
+ ksft_exit_fail_msg("asprintf() failed\n");
+
+ child_start(child, "./kernel-test");
+
+ ksft_print_msg("Started %s\n", child->name);
+}
+
static void start_sve(struct child_data *child, int vl, int cpu)
{
int ret;
@@ -438,7 +451,7 @@ int main(int argc, char **argv)
int ret;
int timeout = 10;
int cpus, i, j, c;
- int sve_vl_count, sme_vl_count, fpsimd_per_cpu;
+ int sve_vl_count, sme_vl_count;
bool all_children_started = false;
int seen_children;
int sve_vls[MAX_VLS], sme_vls[MAX_VLS];
@@ -482,12 +495,7 @@ int main(int argc, char **argv)
have_sme2 = false;
}
- /* Force context switching if we only have FPSIMD */
- if (!sve_vl_count && !sme_vl_count)
- fpsimd_per_cpu = 2;
- else
- fpsimd_per_cpu = 1;
- tests += cpus * fpsimd_per_cpu;
+ tests += cpus * 2;
ksft_print_header();
ksft_set_plan(tests);
@@ -542,8 +550,8 @@ int main(int argc, char **argv)
tests);
for (i = 0; i < cpus; i++) {
- for (j = 0; j < fpsimd_per_cpu; j++)
- start_fpsimd(&children[num_children++], i, j);
+ start_fpsimd(&children[num_children++], i, 0);
+ start_kernel(&children[num_children++], i, 0);
for (j = 0; j < sve_vl_count; j++)
start_sve(&children[num_children++], sve_vls[j], i);
diff --git a/tools/testing/selftests/arm64/fp/kernel-test.c b/tools/testing/selftests/arm64/fp/kernel-test.c
new file mode 100644
index 000000000000..e8da3b4cbd23
--- /dev/null
+++ b/tools/testing/selftests/arm64/fp/kernel-test.c
@@ -0,0 +1,324 @@
+// SPDX-License-Identifier: GPL-2.0-only
+/*
+ * Copyright (C) 2024 ARM Limited.
+ */
+
+#define _GNU_SOURCE
+
+#include <stdio.h>
+#include <stdlib.h>
+#include <stdbool.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <signal.h>
+#include <string.h>
+#include <unistd.h>
+
+#include <sys/socket.h>
+
+#include <linux/kernel.h>
+#include <linux/if_alg.h>
+
+#define DATA_SIZE (16 * 4096)
+
+static int base, sock;
+
+static int digest_len;
+static char *ref;
+static char *digest;
+static char *alg_name;
+
+static struct iovec data_iov;
+static int zerocopy[2];
+static int sigs;
+static int iter;
+
+static void handle_exit_signal(int sig, siginfo_t *info, void *context)
+{
+ printf("Terminated by signal %d, iterations=%d, signals=%d\n",
+ sig, iter, sigs);
+ exit(0);
+}
+
+static void handle_kick_signal(int sig, siginfo_t *info, void *context)
+{
+ sigs++;
+}
+
+static char *drivers[] = {
+ "crct10dif-arm64-ce",
+ /* "crct10dif-arm64-neon", - Same priority as generic */
+ "sha1-ce",
+ "sha224-arm64",
+ "sha224-arm64-neon",
+ "sha224-ce",
+ "sha256-arm64",
+ "sha256-arm64-neon",
+ "sha256-ce",
+ "sha384-ce",
+ "sha512-ce",
+ "sha3-224-ce",
+ "sha3-256-ce",
+ "sha3-384-ce",
+ "sha3-512-ce",
+ "sm3-ce",
+ "sm3-neon",
+};
+
+static bool create_socket(void)
+{
+ FILE *proc;
+ struct sockaddr_alg addr;
+ char buf[1024];
+ char *c, *driver_name;
+ bool is_shash, match;
+ int ret, i;
+
+ ret = socket(AF_ALG, SOCK_SEQPACKET, 0);
+ if (ret < 0) {
+ if (errno == EAFNOSUPPORT) {
+ printf("AF_ALG not supported\n");
+ return false;
+ }
+
+ printf("Failed to create AF_ALG socket: %s (%d)\n",
+ strerror(errno), errno);
+ return false;
+ }
+ base = ret;
+
+ memset(&addr, 0, sizeof(addr));
+ addr.salg_family = AF_ALG;
+ strncpy((char *)addr.salg_type, "hash", sizeof(addr.salg_type));
+
+ proc = fopen("/proc/crypto", "r");
+ if (!proc) {
+ printf("Unable to open /proc/crypto\n");
+ return false;
+ }
+
+ driver_name = NULL;
+ is_shash = false;
+ match = false;
+
+ /* Look through /proc/crypto for a driver with kernel mode FP usage */
+ while (!match) {
+ c = fgets(buf, sizeof(buf), proc);
+ if (!c) {
+ if (feof(proc)) {
+ printf("Nothing found in /proc/crypto\n");
+ return false;
+ }
+ continue;
+ }
+
+ /* Algorithm descriptions are separated by a blank line */
+ if (*c == '\n') {
+ if (is_shash && driver_name) {
+ for (i = 0; i < ARRAY_SIZE(drivers); i++) {
+ if (strcmp(drivers[i],
+ driver_name) == 0) {
+ match = true;
+ }
+ }
+ }
+
+ if (!match) {
+ digest_len = 0;
+
+ free(driver_name);
+ driver_name = NULL;
+
+ free(alg_name);
+ alg_name = NULL;
+
+ is_shash = false;
+ }
+ continue;
+ }
+
+ /* Remove trailing newline */
+ c = strchr(buf, '\n');
+ if (c)
+ *c = '\0';
+
+ /* Find the field/value separator and start of the value */
+ c = strchr(buf, ':');
+ if (!c)
+ continue;
+ c += 2;
+
+ if (strncmp(buf, "digestsize", strlen("digestsize")) == 0)
+ sscanf(c, "%d", &digest_len);
+
+ if (strncmp(buf, "name", strlen("name")) == 0)
+ alg_name = strdup(c);
+
+ if (strncmp(buf, "driver", strlen("driver")) == 0)
+ driver_name = strdup(c);
+
+ if (strncmp(buf, "type", strlen("type")) == 0)
+ if (strncmp(c, "shash", strlen("shash")) == 0)
+ is_shash = true;
+ }
+
+ strncpy((char *)addr.salg_name, alg_name,
+ sizeof(addr.salg_name) - 1);
+
+ ret = bind(base, (struct sockaddr *)&addr, sizeof(addr));
+ if (ret < 0) {
+ printf("Failed to bind %s: %s (%d)\n",
+ addr.salg_name, strerror(errno), errno);
+ return false;
+ }
+
+ ret = accept(base, NULL, 0);
+ if (ret < 0) {
+ printf("Failed to accept %s: %s (%d)\n",
+ addr.salg_name, strerror(errno), errno);
+ return false;
+ }
+
+ sock = ret;
+
+ ret = pipe(zerocopy);
+ if (ret != 0) {
+ printf("Failed to create zerocopy pipe: %s (%d)\n",
+ strerror(errno), errno);
+ return false;
+ }
+
+ ref = malloc(digest_len);
+ if (!ref) {
+ printf("Failed to allocated %d byte reference\n", digest_len);
+ return false;
+ }
+
+ digest = malloc(digest_len);
+ if (!digest) {
+ printf("Failed to allocated %d byte digest\n", digest_len);
+ return false;
+ }
+
+ return true;
+}
+
+static bool compute_digest(void *buf)
+{
+ struct iovec iov;
+ int ret, wrote;
+
+ iov = data_iov;
+ while (iov.iov_len) {
+ ret = vmsplice(zerocopy[1], &iov, 1, SPLICE_F_GIFT);
+ if (ret < 0) {
+ printf("Failed to send buffer: %s (%d)\n",
+ strerror(errno), errno);
+ return false;
+ }
+
+ wrote = ret;
+ ret = splice(zerocopy[0], NULL, sock, NULL, wrote, 0);
+ if (ret < 0) {
+ printf("Failed to splice buffer: %s (%d)\n",
+ strerror(errno), errno);
+ } else if (ret != wrote) {
+ printf("Short splice: %d < %d\n", ret, wrote);
+ }
+
+ iov.iov_len -= wrote;
+ iov.iov_base += wrote;
+ }
+
+reread:
+ ret = recv(sock, buf, digest_len, 0);
+ if (ret == 0) {
+ printf("No digest returned\n");
+ return false;
+ }
+ if (ret != digest_len) {
+ if (errno == -EAGAIN)
+ goto reread;
+ printf("Failed to get digest: %s (%d)\n",
+ strerror(errno), errno);
+ return false;
+ }
+
+ return true;
+}
+
+int main(void)
+{
+ char *data;
+ struct sigaction sa;
+ int ret;
+
+ /* Ensure we have unbuffered output */
+ setvbuf(stdout, NULL, _IOLBF, 0);
+
+ /* The parent will communicate with us via signals */
+ memset(&sa, 0, sizeof(sa));
+ sa.sa_sigaction = handle_exit_signal;
+ sa.sa_flags = SA_RESTART | SA_SIGINFO;
+ sigemptyset(&sa.sa_mask);
+ ret = sigaction(SIGTERM, &sa, NULL);
+ if (ret < 0)
+ printf("Failed to install SIGTERM handler: %s (%d)\n",
+ strerror(errno), errno);
+
+ sa.sa_sigaction = handle_kick_signal;
+ ret = sigaction(SIGUSR2, &sa, NULL);
+ if (ret < 0)
+ printf("Failed to install SIGUSR2 handler: %s (%d)\n",
+ strerror(errno), errno);
+
+ data = malloc(DATA_SIZE);
+ if (!data) {
+ printf("Failed to allocate data buffer\n");
+ return EXIT_FAILURE;
+ }
+ memset(data, 0, DATA_SIZE);
+
+ data_iov.iov_base = data;
+ data_iov.iov_len = DATA_SIZE;
+
+ /*
+ * If we can't create a socket assume it's a lack of system
+ * support and fall back to a basic FPSIMD test for the
+ * benefit of fp-stress.
+ */
+ if (!create_socket()) {
+ execl("./fpsimd-test", "./fpsimd-test", NULL);
+ printf("Failed to fall back to fspimd-test: %d (%s)\n",
+ errno, strerror(errno));
+ return EXIT_FAILURE;
+ }
+
+ /*
+ * Compute a reference digest we hope is repeatable, we do
+ * this at runtime partly to make it easier to play with
+ * parameters.
+ */
+ if (!compute_digest(ref)) {
+ printf("Failed to compute reference digest\n");
+ return EXIT_FAILURE;
+ }
+
+ printf("AF_ALG using %s\n", alg_name);
+
+ while (true) {
+ if (!compute_digest(digest)) {
+ printf("Failed to compute digest, iter=%d\n", iter);
+ return EXIT_FAILURE;
+ }
+
+ if (memcmp(ref, digest, digest_len) != 0) {
+ printf("Digest mismatch, iter=%d\n", iter);
+ return EXIT_FAILURE;
+ }
+
+ iter++;
+ }
+
+ return EXIT_FAILURE;
+}
diff --git a/tools/testing/selftests/arm64/tags/Makefile b/tools/testing/selftests/arm64/tags/Makefile
index 6d29cfde43a2..0a77f35295fb 100644
--- a/tools/testing/selftests/arm64/tags/Makefile
+++ b/tools/testing/selftests/arm64/tags/Makefile
@@ -2,6 +2,5 @@
CFLAGS += $(KHDR_INCLUDES)
TEST_GEN_PROGS := tags_test
-TEST_PROGS := run_tags_test.sh
include ../../lib.mk
diff --git a/tools/testing/selftests/arm64/tags/run_tags_test.sh b/tools/testing/selftests/arm64/tags/run_tags_test.sh
deleted file mode 100755
index 745f11379930..000000000000
--- a/tools/testing/selftests/arm64/tags/run_tags_test.sh
+++ /dev/null
@@ -1,12 +0,0 @@
-#!/bin/sh
-# SPDX-License-Identifier: GPL-2.0
-
-echo "--------------------"
-echo "running tags test"
-echo "--------------------"
-./tags_test
-if [ $? -ne 0 ]; then
- echo "[FAIL]"
-else
- echo "[PASS]"
-fi
diff --git a/tools/testing/selftests/arm64/tags/tags_test.c b/tools/testing/selftests/arm64/tags/tags_test.c
index 955f87c1170d..8ae26e496c89 100644
--- a/tools/testing/selftests/arm64/tags/tags_test.c
+++ b/tools/testing/selftests/arm64/tags/tags_test.c
@@ -17,19 +17,21 @@ int main(void)
static int tbi_enabled = 0;
unsigned long tag = 0;
struct utsname *ptr;
- int err;
+
+ ksft_print_header();
+ ksft_set_plan(1);
if (prctl(PR_SET_TAGGED_ADDR_CTRL, PR_TAGGED_ADDR_ENABLE, 0, 0, 0) == 0)
tbi_enabled = 1;
ptr = (struct utsname *)malloc(sizeof(*ptr));
if (!ptr)
- ksft_exit_fail_msg("Failed to allocate utsname buffer\n");
+ ksft_exit_fail_perror("Failed to allocate utsname buffer");
if (tbi_enabled)
tag = 0x42;
ptr = (struct utsname *)SET_TAG(ptr, tag);
- err = uname(ptr);
+ ksft_test_result(!uname(ptr), "Syscall successful with tagged address\n");
free(ptr);
- return err;
+ ksft_finished();
}
diff --git a/tools/testing/selftests/bpf/DENYLIST.aarch64 b/tools/testing/selftests/bpf/DENYLIST.aarch64
index 0445ac38bc07..3c7c3e79aa93 100644
--- a/tools/testing/selftests/bpf/DENYLIST.aarch64
+++ b/tools/testing/selftests/bpf/DENYLIST.aarch64
@@ -6,6 +6,7 @@ kprobe_multi_test # needs CONFIG_FPROBE
module_attach # prog 'kprobe_multi': failed to auto-attach: -95
fentry_test/fentry_many_args # fentry_many_args:FAIL:fentry_many_args_attach unexpected error: -524
fexit_test/fexit_many_args # fexit_many_args:FAIL:fexit_many_args_attach unexpected error: -524
+tracing_struct/struct_many_args # struct_many_args:FAIL:tracing_struct_many_args__attach unexpected error: -524
fill_link_info/kprobe_multi_link_info # bpf_program__attach_kprobe_multi_opts unexpected error: -95
fill_link_info/kretprobe_multi_link_info # bpf_program__attach_kprobe_multi_opts unexpected error: -95
fill_link_info/kprobe_multi_invalid_ubuff # bpf_program__attach_kprobe_multi_opts unexpected error: -95
diff --git a/tools/testing/selftests/bpf/DENYLIST.s390x b/tools/testing/selftests/bpf/DENYLIST.s390x
index c34adf39eeb2..3ebd77206f98 100644
--- a/tools/testing/selftests/bpf/DENYLIST.s390x
+++ b/tools/testing/selftests/bpf/DENYLIST.s390x
@@ -1,9 +1,5 @@
# TEMPORARY
# Alphabetical order
-exceptions # JIT does not support calling kfunc bpf_throw (exceptions)
get_stack_raw_tp # user_stack corrupted user stack (no backchain userspace)
stacktrace_build_id # compare_map_keys stackid_hmap vs. stackmap err -2 errno 2 (?)
verifier_iterating_callbacks
-verifier_arena # JIT does not support arena
-arena_htab # JIT does not support arena
-arena_atomics
diff --git a/tools/testing/selftests/bpf/Makefile b/tools/testing/selftests/bpf/Makefile
index e0b3887b3d2d..dd49c1d23a60 100644
--- a/tools/testing/selftests/bpf/Makefile
+++ b/tools/testing/selftests/bpf/Makefile
@@ -457,7 +457,7 @@ LINKED_SKELS := test_static_linked.skel.h linked_funcs.skel.h \
LSKELS := fentry_test.c fexit_test.c fexit_sleep.c atomics.c \
trace_printk.c trace_vprintk.c map_ptr_kern.c \
core_kern.c core_kern_overflow.c test_ringbuf.c \
- test_ringbuf_n.c test_ringbuf_map_key.c
+ test_ringbuf_n.c test_ringbuf_map_key.c test_ringbuf_write.c
# Generate both light skeleton and libbpf skeleton for these
LSKELS_EXTRA := test_ksyms_module.c test_ksyms_weak.c kfunc_call_test.c \
diff --git a/tools/testing/selftests/bpf/bpf_arena_common.h b/tools/testing/selftests/bpf/bpf_arena_common.h
index 567491f3e1b5..68a51dcc0669 100644
--- a/tools/testing/selftests/bpf/bpf_arena_common.h
+++ b/tools/testing/selftests/bpf/bpf_arena_common.h
@@ -34,10 +34,12 @@
#if defined(__BPF_FEATURE_ADDR_SPACE_CAST) && !defined(BPF_ARENA_FORCE_ASM)
#define __arena __attribute__((address_space(1)))
+#define __arena_global __attribute__((address_space(1)))
#define cast_kern(ptr) /* nop for bpf prog. emitted by LLVM */
#define cast_user(ptr) /* nop for bpf prog. emitted by LLVM */
#else
#define __arena
+#define __arena_global SEC(".addr_space.1")
#define cast_kern(ptr) bpf_addr_space_cast(ptr, 0, 1)
#define cast_user(ptr) bpf_addr_space_cast(ptr, 1, 0)
#endif
diff --git a/tools/testing/selftests/bpf/bpf_experimental.h b/tools/testing/selftests/bpf/bpf_experimental.h
index 3d9e4b8c6b81..828556cdc2f0 100644
--- a/tools/testing/selftests/bpf/bpf_experimental.h
+++ b/tools/testing/selftests/bpf/bpf_experimental.h
@@ -163,7 +163,7 @@ struct bpf_iter_task_vma;
extern int bpf_iter_task_vma_new(struct bpf_iter_task_vma *it,
struct task_struct *task,
- unsigned long addr) __ksym;
+ __u64 addr) __ksym;
extern struct vm_area_struct *bpf_iter_task_vma_next(struct bpf_iter_task_vma *it) __ksym;
extern void bpf_iter_task_vma_destroy(struct bpf_iter_task_vma *it) __ksym;
@@ -351,6 +351,7 @@ l_true: \
l_continue:; \
})
#else
+#if __BYTE_ORDER__ == __ORDER_LITTLE_ENDIAN__
#define can_loop \
({ __label__ l_break, l_continue; \
bool ret = true; \
@@ -376,6 +377,33 @@ l_true: \
l_break: break; \
l_continue:; \
})
+#else
+#define can_loop \
+ ({ __label__ l_break, l_continue; \
+ bool ret = true; \
+ asm volatile goto("1:.byte 0xe5; \
+ .byte 0; \
+ .long (((%l[l_break] - 1b - 8) / 8) & 0xffff) << 16; \
+ .short 0" \
+ :::: l_break); \
+ goto l_continue; \
+ l_break: ret = false; \
+ l_continue:; \
+ ret; \
+ })
+
+#define cond_break \
+ ({ __label__ l_break, l_continue; \
+ asm volatile goto("1:.byte 0xe5; \
+ .byte 0; \
+ .long (((%l[l_break] - 1b - 8) / 8) & 0xffff) << 16; \
+ .short 0" \
+ :::: l_break); \
+ goto l_continue; \
+ l_break: break; \
+ l_continue:; \
+ })
+#endif
#endif
#ifndef bpf_nop_mov
@@ -524,7 +552,7 @@ extern void bpf_iter_css_destroy(struct bpf_iter_css *it) __weak __ksym;
extern int bpf_wq_init(struct bpf_wq *wq, void *p__map, unsigned int flags) __weak __ksym;
extern int bpf_wq_start(struct bpf_wq *wq, unsigned int flags) __weak __ksym;
extern int bpf_wq_set_callback_impl(struct bpf_wq *wq,
- int (callback_fn)(void *map, int *key, struct bpf_wq *wq),
+ int (callback_fn)(void *map, int *key, void *value),
unsigned int flags__k, void *aux__ign) __ksym;
#define bpf_wq_set_callback(timer, cb, flags) \
bpf_wq_set_callback_impl(timer, cb, flags, NULL)
diff --git a/tools/testing/selftests/bpf/bpf_kfuncs.h b/tools/testing/selftests/bpf/bpf_kfuncs.h
index be91a6919315..3b6675ab4086 100644
--- a/tools/testing/selftests/bpf/bpf_kfuncs.h
+++ b/tools/testing/selftests/bpf/bpf_kfuncs.h
@@ -77,5 +77,5 @@ extern int bpf_verify_pkcs7_signature(struct bpf_dynptr *data_ptr,
struct bpf_key *trusted_keyring) __ksym;
extern bool bpf_session_is_return(void) __ksym __weak;
-extern long *bpf_session_cookie(void) __ksym __weak;
+extern __u64 *bpf_session_cookie(void) __ksym __weak;
#endif
diff --git a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c b/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c
index b1dd889d5d7d..948eb3962732 100644
--- a/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c
+++ b/tools/testing/selftests/bpf/bpf_test_no_cfi/bpf_test_no_cfi.c
@@ -22,12 +22,12 @@ static int dummy_init_member(const struct btf_type *t,
return 0;
}
-static int dummy_reg(void *kdata)
+static int dummy_reg(void *kdata, struct bpf_link *link)
{
return 0;
}
-static void dummy_unreg(void *kdata)
+static void dummy_unreg(void *kdata, struct bpf_link *link)
{
}
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c b/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c
index 2a18bd320e92..f8962a1dd397 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c
+++ b/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod.c
@@ -53,6 +53,13 @@ struct bpf_testmod_struct_arg_4 {
int b;
};
+struct bpf_testmod_struct_arg_5 {
+ char a;
+ short b;
+ int c;
+ long d;
+};
+
__bpf_hook_start();
noinline int
@@ -111,6 +118,15 @@ bpf_testmod_test_struct_arg_8(u64 a, void *b, short c, int d, void *e,
}
noinline int
+bpf_testmod_test_struct_arg_9(u64 a, void *b, short c, int d, void *e, char f,
+ short g, struct bpf_testmod_struct_arg_5 h, long i)
+{
+ bpf_testmod_test_struct_arg_result = a + (long)b + c + d + (long)e +
+ f + g + h.a + h.b + h.c + h.d + i;
+ return bpf_testmod_test_struct_arg_result;
+}
+
+noinline int
bpf_testmod_test_arg_ptr_to_struct(struct bpf_testmod_struct_arg_1 *a) {
bpf_testmod_test_struct_arg_result = a->a;
return bpf_testmod_test_struct_arg_result;
@@ -154,6 +170,42 @@ __bpf_kfunc void bpf_kfunc_common_test(void)
{
}
+__bpf_kfunc void bpf_kfunc_dynptr_test(struct bpf_dynptr *ptr,
+ struct bpf_dynptr *ptr__nullable)
+{
+}
+
+__bpf_kfunc struct bpf_testmod_ctx *
+bpf_testmod_ctx_create(int *err)
+{
+ struct bpf_testmod_ctx *ctx;
+
+ ctx = kzalloc(sizeof(*ctx), GFP_ATOMIC);
+ if (!ctx) {
+ *err = -ENOMEM;
+ return NULL;
+ }
+ refcount_set(&ctx->usage, 1);
+
+ return ctx;
+}
+
+static void testmod_free_cb(struct rcu_head *head)
+{
+ struct bpf_testmod_ctx *ctx;
+
+ ctx = container_of(head, struct bpf_testmod_ctx, rcu);
+ kfree(ctx);
+}
+
+__bpf_kfunc void bpf_testmod_ctx_release(struct bpf_testmod_ctx *ctx)
+{
+ if (!ctx)
+ return;
+ if (refcount_dec_and_test(&ctx->usage))
+ call_rcu(&ctx->rcu, testmod_free_cb);
+}
+
struct bpf_testmod_btf_type_tag_1 {
int a;
};
@@ -269,6 +321,7 @@ bpf_testmod_test_read(struct file *file, struct kobject *kobj,
struct bpf_testmod_struct_arg_2 struct_arg2 = {2, 3};
struct bpf_testmod_struct_arg_3 *struct_arg3;
struct bpf_testmod_struct_arg_4 struct_arg4 = {21, 22};
+ struct bpf_testmod_struct_arg_5 struct_arg5 = {23, 24, 25, 26};
int i = 1;
while (bpf_testmod_return_ptr(i))
@@ -283,6 +336,8 @@ bpf_testmod_test_read(struct file *file, struct kobject *kobj,
(void *)20, struct_arg4);
(void)bpf_testmod_test_struct_arg_8(16, (void *)17, 18, 19,
(void *)20, struct_arg4, 23);
+ (void)bpf_testmod_test_struct_arg_9(16, (void *)17, 18, 19, (void *)20,
+ 21, 22, struct_arg5, 27);
(void)bpf_testmod_test_arg_ptr_to_struct(&struct_arg1_2);
@@ -363,8 +418,15 @@ BTF_ID_FLAGS(func, bpf_iter_testmod_seq_new, KF_ITER_NEW)
BTF_ID_FLAGS(func, bpf_iter_testmod_seq_next, KF_ITER_NEXT | KF_RET_NULL)
BTF_ID_FLAGS(func, bpf_iter_testmod_seq_destroy, KF_ITER_DESTROY)
BTF_ID_FLAGS(func, bpf_kfunc_common_test)
+BTF_ID_FLAGS(func, bpf_kfunc_dynptr_test)
+BTF_ID_FLAGS(func, bpf_testmod_ctx_create, KF_ACQUIRE | KF_RET_NULL)
+BTF_ID_FLAGS(func, bpf_testmod_ctx_release, KF_RELEASE)
BTF_KFUNCS_END(bpf_testmod_common_kfunc_ids)
+BTF_ID_LIST(bpf_testmod_dtor_ids)
+BTF_ID(struct, bpf_testmod_ctx)
+BTF_ID(func, bpf_testmod_ctx_release)
+
static const struct btf_kfunc_id_set bpf_testmod_common_kfunc_set = {
.owner = THIS_MODULE,
.set = &bpf_testmod_common_kfunc_ids,
@@ -820,7 +882,7 @@ static const struct bpf_verifier_ops bpf_testmod_verifier_ops = {
.is_valid_access = bpf_testmod_ops_is_valid_access,
};
-static int bpf_dummy_reg(void *kdata)
+static int bpf_dummy_reg(void *kdata, struct bpf_link *link)
{
struct bpf_testmod_ops *ops = kdata;
@@ -835,7 +897,7 @@ static int bpf_dummy_reg(void *kdata)
return 0;
}
-static void bpf_dummy_unreg(void *kdata)
+static void bpf_dummy_unreg(void *kdata, struct bpf_link *link)
{
}
@@ -871,7 +933,7 @@ struct bpf_struct_ops bpf_bpf_testmod_ops = {
.owner = THIS_MODULE,
};
-static int bpf_dummy_reg2(void *kdata)
+static int bpf_dummy_reg2(void *kdata, struct bpf_link *link)
{
struct bpf_testmod_ops2 *ops = kdata;
@@ -898,6 +960,12 @@ extern int bpf_fentry_test1(int a);
static int bpf_testmod_init(void)
{
+ const struct btf_id_dtor_kfunc bpf_testmod_dtors[] = {
+ {
+ .btf_id = bpf_testmod_dtor_ids[0],
+ .kfunc_btf_id = bpf_testmod_dtor_ids[1]
+ },
+ };
int ret;
ret = register_btf_kfunc_id_set(BPF_PROG_TYPE_UNSPEC, &bpf_testmod_common_kfunc_set);
@@ -906,6 +974,9 @@ static int bpf_testmod_init(void)
ret = ret ?: register_btf_kfunc_id_set(BPF_PROG_TYPE_SYSCALL, &bpf_testmod_kfunc_set);
ret = ret ?: register_bpf_struct_ops(&bpf_bpf_testmod_ops, bpf_testmod_ops);
ret = ret ?: register_bpf_struct_ops(&bpf_testmod_ops2, bpf_testmod_ops2);
+ ret = ret ?: register_btf_id_dtor_kfuncs(bpf_testmod_dtors,
+ ARRAY_SIZE(bpf_testmod_dtors),
+ THIS_MODULE);
if (ret < 0)
return ret;
if (bpf_fentry_test1(0) < 0)
diff --git a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h b/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h
index b0d586a6751f..e587a79f2239 100644
--- a/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h
+++ b/tools/testing/selftests/bpf/bpf_testmod/bpf_testmod_kfunc.h
@@ -80,6 +80,11 @@ struct sendmsg_args {
int msglen;
};
+struct bpf_testmod_ctx {
+ struct callback_head rcu;
+ refcount_t usage;
+};
+
struct prog_test_ref_kfunc *
bpf_kfunc_call_test_acquire(unsigned long *scalar_ptr) __ksym;
void bpf_kfunc_call_test_release(struct prog_test_ref_kfunc *p) __ksym;
@@ -134,4 +139,9 @@ int bpf_kfunc_call_sock_sendmsg(struct sendmsg_args *args) __ksym;
int bpf_kfunc_call_kernel_getsockname(struct addr_args *args) __ksym;
int bpf_kfunc_call_kernel_getpeername(struct addr_args *args) __ksym;
+void bpf_kfunc_dynptr_test(struct bpf_dynptr *ptr, struct bpf_dynptr *ptr__nullable) __ksym;
+
+struct bpf_testmod_ctx *bpf_testmod_ctx_create(int *err) __ksym;
+void bpf_testmod_ctx_release(struct bpf_testmod_ctx *ctx) __ksym;
+
#endif /* _BPF_TESTMOD_KFUNC_H */
diff --git a/tools/testing/selftests/bpf/config b/tools/testing/selftests/bpf/config
index eeabd798bc3a..4ca84c8d9116 100644
--- a/tools/testing/selftests/bpf/config
+++ b/tools/testing/selftests/bpf/config
@@ -58,9 +58,12 @@ CONFIG_MPLS=y
CONFIG_MPLS_IPTUNNEL=y
CONFIG_MPLS_ROUTING=y
CONFIG_MPTCP=y
+CONFIG_NET_ACT_SKBMOD=y
+CONFIG_NET_CLS=y
CONFIG_NET_CLS_ACT=y
CONFIG_NET_CLS_BPF=y
CONFIG_NET_CLS_FLOWER=y
+CONFIG_NET_CLS_MATCHALL=y
CONFIG_NET_FOU=y
CONFIG_NET_FOU_IP_TUNNELS=y
CONFIG_NET_IPGRE=y
@@ -80,8 +83,22 @@ CONFIG_NETFILTER_XT_TARGET_CT=y
CONFIG_NETKIT=y
CONFIG_NF_CONNTRACK=y
CONFIG_NF_CONNTRACK_MARK=y
+CONFIG_NF_CONNTRACK_ZONES=y
CONFIG_NF_DEFRAG_IPV4=y
CONFIG_NF_DEFRAG_IPV6=y
+CONFIG_NF_TABLES=y
+CONFIG_NF_TABLES_INET=y
+CONFIG_NF_TABLES_NETDEV=y
+CONFIG_NF_TABLES_IPV4=y
+CONFIG_NF_TABLES_IPV6=y
+CONFIG_NETFILTER_INGRESS=y
+CONFIG_NF_FLOW_TABLE=y
+CONFIG_NF_FLOW_TABLE_INET=y
+CONFIG_NETFILTER_NETLINK=y
+CONFIG_NFT_FLOW_OFFLOAD=y
+CONFIG_IP_NF_IPTABLES=y
+CONFIG_IP6_NF_IPTABLES=y
+CONFIG_IP6_NF_FILTER=y
CONFIG_NF_NAT=y
CONFIG_RC_CORE=y
CONFIG_SECURITY=y
diff --git a/tools/testing/selftests/bpf/network_helpers.c b/tools/testing/selftests/bpf/network_helpers.c
index 35250e6cde7f..e0cba4178e41 100644
--- a/tools/testing/selftests/bpf/network_helpers.c
+++ b/tools/testing/selftests/bpf/network_helpers.c
@@ -94,7 +94,8 @@ static int __start_server(int type, const struct sockaddr *addr, socklen_t addrl
if (settimeo(fd, opts->timeout_ms))
goto error_close;
- if (opts->post_socket_cb && opts->post_socket_cb(fd, NULL)) {
+ if (opts->post_socket_cb &&
+ opts->post_socket_cb(fd, opts->cb_opts)) {
log_err("Failed to call post_socket_cb");
goto error_close;
}
@@ -105,7 +106,7 @@ static int __start_server(int type, const struct sockaddr *addr, socklen_t addrl
}
if (type == SOCK_STREAM) {
- if (listen(fd, 1) < 0) {
+ if (listen(fd, opts->backlog ? MAX(opts->backlog, 0) : 1) < 0) {
log_err("Failed to listed on socket");
goto error_close;
}
@@ -118,22 +119,32 @@ error_close:
return -1;
}
-int start_server(int family, int type, const char *addr_str, __u16 port,
- int timeout_ms)
+int start_server_str(int family, int type, const char *addr_str, __u16 port,
+ const struct network_helper_opts *opts)
{
- struct network_helper_opts opts = {
- .timeout_ms = timeout_ms,
- };
struct sockaddr_storage addr;
socklen_t addrlen;
+ if (!opts)
+ opts = &default_opts;
+
if (make_sockaddr(family, addr_str, port, &addr, &addrlen))
return -1;
- return __start_server(type, (struct sockaddr *)&addr, addrlen, &opts);
+ return __start_server(type, (struct sockaddr *)&addr, addrlen, opts);
}
-static int reuseport_cb(int fd, const struct post_socket_opts *opts)
+int start_server(int family, int type, const char *addr_str, __u16 port,
+ int timeout_ms)
+{
+ struct network_helper_opts opts = {
+ .timeout_ms = timeout_ms,
+ };
+
+ return start_server_str(family, type, addr_str, port, &opts);
+}
+
+static int reuseport_cb(int fd, void *opts)
{
int on = 1;
@@ -238,6 +249,34 @@ error_close:
return -1;
}
+int client_socket(int family, int type,
+ const struct network_helper_opts *opts)
+{
+ int fd;
+
+ if (!opts)
+ opts = &default_opts;
+
+ fd = socket(family, type, opts->proto);
+ if (fd < 0) {
+ log_err("Failed to create client socket");
+ return -1;
+ }
+
+ if (settimeo(fd, opts->timeout_ms))
+ goto error_close;
+
+ if (opts->post_socket_cb &&
+ opts->post_socket_cb(fd, opts->cb_opts))
+ goto error_close;
+
+ return fd;
+
+error_close:
+ save_errno_close(fd);
+ return -1;
+}
+
static int connect_fd_to_addr(int fd,
const struct sockaddr_storage *addr,
socklen_t addrlen, const bool must_fail)
@@ -273,15 +312,12 @@ int connect_to_addr(int type, const struct sockaddr_storage *addr, socklen_t add
if (!opts)
opts = &default_opts;
- fd = socket(addr->ss_family, type, opts->proto);
+ fd = client_socket(addr->ss_family, type, opts);
if (fd < 0) {
log_err("Failed to create client socket");
return -1;
}
- if (settimeo(fd, opts->timeout_ms))
- goto error_close;
-
if (connect_fd_to_addr(fd, addr, addrlen, opts->must_fail))
goto error_close;
@@ -292,66 +328,21 @@ error_close:
return -1;
}
-int connect_to_fd_opts(int server_fd, const struct network_helper_opts *opts)
+int connect_to_fd_opts(int server_fd, int type, const struct network_helper_opts *opts)
{
struct sockaddr_storage addr;
- struct sockaddr_in *addr_in;
- socklen_t addrlen, optlen;
- int fd, type, protocol;
+ socklen_t addrlen;
if (!opts)
opts = &default_opts;
- optlen = sizeof(type);
-
- if (opts->type) {
- type = opts->type;
- } else {
- if (getsockopt(server_fd, SOL_SOCKET, SO_TYPE, &type, &optlen)) {
- log_err("getsockopt(SOL_TYPE)");
- return -1;
- }
- }
-
- if (opts->proto) {
- protocol = opts->proto;
- } else {
- if (getsockopt(server_fd, SOL_SOCKET, SO_PROTOCOL, &protocol, &optlen)) {
- log_err("getsockopt(SOL_PROTOCOL)");
- return -1;
- }
- }
-
addrlen = sizeof(addr);
if (getsockname(server_fd, (struct sockaddr *)&addr, &addrlen)) {
log_err("Failed to get server addr");
return -1;
}
- addr_in = (struct sockaddr_in *)&addr;
- fd = socket(addr_in->sin_family, type, protocol);
- if (fd < 0) {
- log_err("Failed to create client socket");
- return -1;
- }
-
- if (settimeo(fd, opts->timeout_ms))
- goto error_close;
-
- if (opts->cc && opts->cc[0] &&
- setsockopt(fd, SOL_TCP, TCP_CONGESTION, opts->cc,
- strlen(opts->cc) + 1))
- goto error_close;
-
- if (!opts->noconnect)
- if (connect_fd_to_addr(fd, &addr, addrlen, opts->must_fail))
- goto error_close;
-
- return fd;
-
-error_close:
- save_errno_close(fd);
- return -1;
+ return connect_to_addr(type, &addr, addrlen, opts);
}
int connect_to_fd(int server_fd, int timeout_ms)
@@ -359,8 +350,23 @@ int connect_to_fd(int server_fd, int timeout_ms)
struct network_helper_opts opts = {
.timeout_ms = timeout_ms,
};
+ int type, protocol;
+ socklen_t optlen;
+
+ optlen = sizeof(type);
+ if (getsockopt(server_fd, SOL_SOCKET, SO_TYPE, &type, &optlen)) {
+ log_err("getsockopt(SOL_TYPE)");
+ return -1;
+ }
+
+ optlen = sizeof(protocol);
+ if (getsockopt(server_fd, SOL_SOCKET, SO_PROTOCOL, &protocol, &optlen)) {
+ log_err("getsockopt(SOL_PROTOCOL)");
+ return -1;
+ }
+ opts.proto = protocol;
- return connect_to_fd_opts(server_fd, &opts);
+ return connect_to_fd_opts(server_fd, type, &opts);
}
int connect_fd_to_fd(int client_fd, int server_fd, int timeout_ms)
diff --git a/tools/testing/selftests/bpf/network_helpers.h b/tools/testing/selftests/bpf/network_helpers.h
index 883c7ea9d8d5..aac5b94d6379 100644
--- a/tools/testing/selftests/bpf/network_helpers.h
+++ b/tools/testing/selftests/bpf/network_helpers.h
@@ -21,16 +21,22 @@ typedef __u16 __sum16;
#define VIP_NUM 5
#define MAGIC_BYTES 123
-struct post_socket_opts {};
-
struct network_helper_opts {
- const char *cc;
int timeout_ms;
bool must_fail;
- bool noconnect;
- int type;
int proto;
- int (*post_socket_cb)(int fd, const struct post_socket_opts *opts);
+ /* +ve: Passed to listen() as-is.
+ * 0: Default when the test does not set
+ * a particular value during the struct init.
+ * It is changed to 1 before passing to listen().
+ * Most tests only have one on-going connection.
+ * -ve: It is changed to 0 before passing to listen().
+ * It is useful to force syncookie without
+ * changing the "tcp_syncookies" sysctl from 1 to 2.
+ */
+ int backlog;
+ int (*post_socket_cb)(int fd, void *opts);
+ void *cb_opts;
};
/* ipv4 test vector */
@@ -50,6 +56,8 @@ struct ipv6_packet {
extern struct ipv6_packet pkt_v6;
int settimeo(int fd, int timeout_ms);
+int start_server_str(int family, int type, const char *addr_str, __u16 port,
+ const struct network_helper_opts *opts);
int start_server(int family, int type, const char *addr, __u16 port,
int timeout_ms);
int *start_reuseport_server(int family, int type, const char *addr_str,
@@ -58,10 +66,12 @@ int *start_reuseport_server(int family, int type, const char *addr_str,
int start_server_addr(int type, const struct sockaddr_storage *addr, socklen_t len,
const struct network_helper_opts *opts);
void free_fds(int *fds, unsigned int nr_close_fds);
+int client_socket(int family, int type,
+ const struct network_helper_opts *opts);
int connect_to_addr(int type, const struct sockaddr_storage *addr, socklen_t len,
const struct network_helper_opts *opts);
int connect_to_fd(int server_fd, int timeout_ms);
-int connect_to_fd_opts(int server_fd, const struct network_helper_opts *opts);
+int connect_to_fd_opts(int server_fd, int type, const struct network_helper_opts *opts);
int connect_fd_to_fd(int client_fd, int server_fd, int timeout_ms);
int fastopen_connect(int server_fd, const char *data, unsigned int data_len,
int timeout_ms);
diff --git a/tools/testing/selftests/bpf/prog_tests/arena_atomics.c b/tools/testing/selftests/bpf/prog_tests/arena_atomics.c
index 0807a48a58ee..26e7c06c6cb4 100644
--- a/tools/testing/selftests/bpf/prog_tests/arena_atomics.c
+++ b/tools/testing/selftests/bpf/prog_tests/arena_atomics.c
@@ -146,6 +146,22 @@ static void test_xchg(struct arena_atomics *skel)
ASSERT_EQ(skel->arena->xchg32_result, 1, "xchg32_result");
}
+static void test_uaf(struct arena_atomics *skel)
+{
+ LIBBPF_OPTS(bpf_test_run_opts, topts);
+ int err, prog_fd;
+
+ /* No need to attach it, just run it directly */
+ prog_fd = bpf_program__fd(skel->progs.uaf);
+ err = bpf_prog_test_run_opts(prog_fd, &topts);
+ if (!ASSERT_OK(err, "test_run_opts err"))
+ return;
+ if (!ASSERT_OK(topts.retval, "test_run_opts retval"))
+ return;
+
+ ASSERT_EQ(skel->arena->uaf_recovery_fails, 0, "uaf_recovery_fails");
+}
+
void test_arena_atomics(void)
{
struct arena_atomics *skel;
@@ -180,6 +196,8 @@ void test_arena_atomics(void)
test_cmpxchg(skel);
if (test__start_subtest("xchg"))
test_xchg(skel);
+ if (test__start_subtest("uaf"))
+ test_uaf(skel);
cleanup:
arena_atomics__destroy(skel);
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_cookie.c b/tools/testing/selftests/bpf/prog_tests/bpf_cookie.c
index 4407ea428e77..070c52c312e5 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_cookie.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_cookie.c
@@ -451,7 +451,7 @@ static void pe_subtest(struct test_bpf_cookie *skel)
attr.type = PERF_TYPE_SOFTWARE;
attr.config = PERF_COUNT_SW_CPU_CLOCK;
attr.freq = 1;
- attr.sample_freq = 1000;
+ attr.sample_freq = 10000;
pfd = syscall(__NR_perf_event_open, &attr, -1, 0, -1, PERF_FLAG_FD_CLOEXEC);
if (!ASSERT_GE(pfd, 0, "perf_fd"))
goto cleanup;
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_nf.c b/tools/testing/selftests/bpf/prog_tests/bpf_nf.c
index b30ff6b3b81a..a4a1f93878d4 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_nf.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_nf.c
@@ -104,6 +104,7 @@ static void test_bpf_nf_ct(int mode)
ASSERT_EQ(skel->bss->test_einval_bpf_tuple, -EINVAL, "Test EINVAL for NULL bpf_tuple");
ASSERT_EQ(skel->bss->test_einval_reserved, -EINVAL, "Test EINVAL for reserved not set to 0");
+ ASSERT_EQ(skel->bss->test_einval_reserved_new, -EINVAL, "Test EINVAL for reserved in new struct not set to 0");
ASSERT_EQ(skel->bss->test_einval_netns_id, -EINVAL, "Test EINVAL for netns_id < -1");
ASSERT_EQ(skel->bss->test_einval_len_opts, -EINVAL, "Test EINVAL for len__opts != NF_BPF_CT_OPTS_SZ");
ASSERT_EQ(skel->bss->test_eproto_l4proto, -EPROTO, "Test EPROTO for l4proto != TCP or UDP");
@@ -122,6 +123,12 @@ static void test_bpf_nf_ct(int mode)
ASSERT_EQ(skel->bss->test_exist_lookup_mark, 43, "Test existing connection lookup ctmark");
ASSERT_EQ(skel->data->test_snat_addr, 0, "Test for source natting");
ASSERT_EQ(skel->data->test_dnat_addr, 0, "Test for destination natting");
+ ASSERT_EQ(skel->data->test_ct_zone_id_alloc_entry, 0, "Test for alloc new entry in specified ct zone");
+ ASSERT_EQ(skel->data->test_ct_zone_id_insert_entry, 0, "Test for insert new entry in specified ct zone");
+ ASSERT_EQ(skel->data->test_ct_zone_id_succ_lookup, 0, "Test for successful lookup in specified ct_zone");
+ ASSERT_EQ(skel->bss->test_ct_zone_dir_enoent_lookup, -ENOENT, "Test ENOENT for lookup with wrong ct zone dir");
+ ASSERT_EQ(skel->bss->test_ct_zone_id_enoent_lookup, -ENOENT, "Test ENOENT for lookup in wrong ct zone");
+
end:
if (client_fd != -1)
close(client_fd);
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
index 0aca02532794..63422f4f3896 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
@@ -23,6 +23,11 @@
static const unsigned int total_bytes = 10 * 1024 * 1024;
static int expected_stg = 0xeB9F;
+struct cb_opts {
+ const char *cc;
+ int map_fd;
+};
+
static int settcpca(int fd, const char *tcp_ca)
{
int err;
@@ -34,55 +39,66 @@ static int settcpca(int fd, const char *tcp_ca)
return 0;
}
-static void do_test(const char *tcp_ca, const struct bpf_map *sk_stg_map)
+static bool start_test(char *addr_str,
+ const struct network_helper_opts *srv_opts,
+ const struct network_helper_opts *cli_opts,
+ int *srv_fd, int *cli_fd)
{
- int lfd = -1, fd = -1;
- int err;
+ *srv_fd = start_server_str(AF_INET6, SOCK_STREAM, addr_str, 0, srv_opts);
+ if (!ASSERT_NEQ(*srv_fd, -1, "start_server_str"))
+ goto err;
- lfd = start_server(AF_INET6, SOCK_STREAM, NULL, 0, 0);
- if (!ASSERT_NEQ(lfd, -1, "socket"))
- return;
-
- fd = socket(AF_INET6, SOCK_STREAM, 0);
- if (!ASSERT_NEQ(fd, -1, "socket")) {
- close(lfd);
- return;
- }
+ /* connect to server */
+ *cli_fd = connect_to_fd_opts(*srv_fd, SOCK_STREAM, cli_opts);
+ if (!ASSERT_NEQ(*cli_fd, -1, "connect_to_fd_opts"))
+ goto err;
- if (settcpca(lfd, tcp_ca) || settcpca(fd, tcp_ca))
- goto done;
+ return true;
- if (sk_stg_map) {
- err = bpf_map_update_elem(bpf_map__fd(sk_stg_map), &fd,
- &expected_stg, BPF_NOEXIST);
- if (!ASSERT_OK(err, "bpf_map_update_elem(sk_stg_map)"))
- goto done;
+err:
+ if (*srv_fd != -1) {
+ close(*srv_fd);
+ *srv_fd = -1;
}
+ if (*cli_fd != -1) {
+ close(*cli_fd);
+ *cli_fd = -1;
+ }
+ return false;
+}
- /* connect to server */
- err = connect_fd_to_fd(fd, lfd, 0);
- if (!ASSERT_NEQ(err, -1, "connect"))
- goto done;
-
- if (sk_stg_map) {
- int tmp_stg;
+static void do_test(const struct network_helper_opts *opts)
+{
+ int lfd = -1, fd = -1;
- err = bpf_map_lookup_elem(bpf_map__fd(sk_stg_map), &fd,
- &tmp_stg);
- if (!ASSERT_ERR(err, "bpf_map_lookup_elem(sk_stg_map)") ||
- !ASSERT_EQ(errno, ENOENT, "bpf_map_lookup_elem(sk_stg_map)"))
- goto done;
- }
+ if (!start_test(NULL, opts, opts, &lfd, &fd))
+ goto done;
ASSERT_OK(send_recv_data(lfd, fd, total_bytes), "send_recv_data");
done:
- close(lfd);
- close(fd);
+ if (lfd != -1)
+ close(lfd);
+ if (fd != -1)
+ close(fd);
+}
+
+static int cc_cb(int fd, void *opts)
+{
+ struct cb_opts *cb_opts = (struct cb_opts *)opts;
+
+ return settcpca(fd, cb_opts->cc);
}
static void test_cubic(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "bpf_cubic",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
struct bpf_cubic *cubic_skel;
struct bpf_link *link;
@@ -96,7 +112,7 @@ static void test_cubic(void)
return;
}
- do_test("bpf_cubic", NULL);
+ do_test(&opts);
ASSERT_EQ(cubic_skel->bss->bpf_cubic_acked_called, 1, "pkts_acked called");
@@ -104,8 +120,37 @@ static void test_cubic(void)
bpf_cubic__destroy(cubic_skel);
}
+static int stg_post_socket_cb(int fd, void *opts)
+{
+ struct cb_opts *cb_opts = (struct cb_opts *)opts;
+ int err;
+
+ err = settcpca(fd, cb_opts->cc);
+ if (err)
+ return err;
+
+ err = bpf_map_update_elem(cb_opts->map_fd, &fd,
+ &expected_stg, BPF_NOEXIST);
+ if (!ASSERT_OK(err, "bpf_map_update_elem(sk_stg_map)"))
+ return err;
+
+ return 0;
+}
+
static void test_dctcp(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "bpf_dctcp",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
+ struct network_helper_opts cli_opts = {
+ .post_socket_cb = stg_post_socket_cb,
+ .cb_opts = &cb_opts,
+ };
+ int lfd = -1, fd = -1, tmp_stg, err;
struct bpf_dctcp *dctcp_skel;
struct bpf_link *link;
@@ -119,11 +164,58 @@ static void test_dctcp(void)
return;
}
- do_test("bpf_dctcp", dctcp_skel->maps.sk_stg_map);
+ cb_opts.map_fd = bpf_map__fd(dctcp_skel->maps.sk_stg_map);
+ if (!start_test(NULL, &opts, &cli_opts, &lfd, &fd))
+ goto done;
+
+ err = bpf_map_lookup_elem(cb_opts.map_fd, &fd, &tmp_stg);
+ if (!ASSERT_ERR(err, "bpf_map_lookup_elem(sk_stg_map)") ||
+ !ASSERT_EQ(errno, ENOENT, "bpf_map_lookup_elem(sk_stg_map)"))
+ goto done;
+
+ ASSERT_OK(send_recv_data(lfd, fd, total_bytes), "send_recv_data");
ASSERT_EQ(dctcp_skel->bss->stg_result, expected_stg, "stg_result");
+done:
bpf_link__destroy(link);
bpf_dctcp__destroy(dctcp_skel);
+ if (lfd != -1)
+ close(lfd);
+ if (fd != -1)
+ close(fd);
+}
+
+static void test_dctcp_autoattach_map(void)
+{
+ struct cb_opts cb_opts = {
+ .cc = "bpf_dctcp",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
+ struct bpf_dctcp *dctcp_skel;
+ struct bpf_link *link;
+
+ dctcp_skel = bpf_dctcp__open_and_load();
+ if (!ASSERT_OK_PTR(dctcp_skel, "bpf_dctcp__open_and_load"))
+ return;
+
+ bpf_map__set_autoattach(dctcp_skel->maps.dctcp, true);
+ bpf_map__set_autoattach(dctcp_skel->maps.dctcp_nouse, false);
+
+ if (!ASSERT_OK(bpf_dctcp__attach(dctcp_skel), "bpf_dctcp__attach"))
+ goto destroy;
+
+ /* struct_ops is auto-attached */
+ link = dctcp_skel->links.dctcp;
+ if (!ASSERT_OK_PTR(link, "link"))
+ goto destroy;
+
+ do_test(&opts);
+
+destroy:
+ bpf_dctcp__destroy(dctcp_skel);
}
static char *err_str;
@@ -171,11 +263,22 @@ static void test_invalid_license(void)
static void test_dctcp_fallback(void)
{
int err, lfd = -1, cli_fd = -1, srv_fd = -1;
- struct network_helper_opts opts = {
- .cc = "cubic",
- };
struct bpf_dctcp *dctcp_skel;
struct bpf_link *link = NULL;
+ struct cb_opts dctcp = {
+ .cc = "bpf_dctcp",
+ };
+ struct network_helper_opts srv_opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &dctcp,
+ };
+ struct cb_opts cubic = {
+ .cc = "cubic",
+ };
+ struct network_helper_opts cli_opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cubic,
+ };
char srv_cc[16];
socklen_t cc_len = sizeof(srv_cc);
@@ -190,13 +293,7 @@ static void test_dctcp_fallback(void)
if (!ASSERT_OK_PTR(link, "dctcp link"))
goto done;
- lfd = start_server(AF_INET6, SOCK_STREAM, "::1", 0, 0);
- if (!ASSERT_GE(lfd, 0, "lfd") ||
- !ASSERT_OK(settcpca(lfd, "bpf_dctcp"), "lfd=>bpf_dctcp"))
- goto done;
-
- cli_fd = connect_to_fd_opts(lfd, &opts);
- if (!ASSERT_GE(cli_fd, 0, "cli_fd"))
+ if (!start_test("::1", &srv_opts, &cli_opts, &lfd, &cli_fd))
goto done;
srv_fd = accept(lfd, NULL, 0);
@@ -297,6 +394,13 @@ static void test_unsupp_cong_op(void)
static void test_update_ca(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "tcp_ca_update",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
struct tcp_ca_update *skel;
struct bpf_link *link;
int saved_ca1_cnt;
@@ -307,25 +411,34 @@ static void test_update_ca(void)
return;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
- ASSERT_OK_PTR(link, "attach_struct_ops");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+ goto out;
- do_test("tcp_ca_update", NULL);
+ do_test(&opts);
saved_ca1_cnt = skel->bss->ca1_cnt;
ASSERT_GT(saved_ca1_cnt, 0, "ca1_ca1_cnt");
err = bpf_link__update_map(link, skel->maps.ca_update_2);
ASSERT_OK(err, "update_map");
- do_test("tcp_ca_update", NULL);
+ do_test(&opts);
ASSERT_EQ(skel->bss->ca1_cnt, saved_ca1_cnt, "ca2_ca1_cnt");
ASSERT_GT(skel->bss->ca2_cnt, 0, "ca2_ca2_cnt");
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
static void test_update_wrong(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "tcp_ca_update",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
struct tcp_ca_update *skel;
struct bpf_link *link;
int saved_ca1_cnt;
@@ -336,24 +449,33 @@ static void test_update_wrong(void)
return;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
- ASSERT_OK_PTR(link, "attach_struct_ops");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+ goto out;
- do_test("tcp_ca_update", NULL);
+ do_test(&opts);
saved_ca1_cnt = skel->bss->ca1_cnt;
ASSERT_GT(saved_ca1_cnt, 0, "ca1_ca1_cnt");
err = bpf_link__update_map(link, skel->maps.ca_wrong);
ASSERT_ERR(err, "update_map");
- do_test("tcp_ca_update", NULL);
+ do_test(&opts);
ASSERT_GT(skel->bss->ca1_cnt, saved_ca1_cnt, "ca2_ca1_cnt");
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
static void test_mixed_links(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "tcp_ca_update",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
struct tcp_ca_update *skel;
struct bpf_link *link, *link_nl;
int err;
@@ -363,12 +485,13 @@ static void test_mixed_links(void)
return;
link_nl = bpf_map__attach_struct_ops(skel->maps.ca_no_link);
- ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl");
+ if (!ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl"))
+ goto out;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
ASSERT_OK_PTR(link, "attach_struct_ops");
- do_test("tcp_ca_update", NULL);
+ do_test(&opts);
ASSERT_GT(skel->bss->ca1_cnt, 0, "ca1_ca1_cnt");
err = bpf_link__update_map(link, skel->maps.ca_no_link);
@@ -376,6 +499,7 @@ static void test_mixed_links(void)
bpf_link__destroy(link);
bpf_link__destroy(link_nl);
+out:
tcp_ca_update__destroy(skel);
}
@@ -418,7 +542,8 @@ static void test_link_replace(void)
bpf_link__destroy(link);
link = bpf_map__attach_struct_ops(skel->maps.ca_update_2);
- ASSERT_OK_PTR(link, "attach_struct_ops_2nd");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops_2nd"))
+ goto out;
/* BPF_F_REPLACE with a wrong old map Fd. It should fail!
*
@@ -441,6 +566,7 @@ static void test_link_replace(void)
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
@@ -455,6 +581,13 @@ static void test_tcp_ca_kfunc(void)
static void test_cc_cubic(void)
{
+ struct cb_opts cb_opts = {
+ .cc = "bpf_cc_cubic",
+ };
+ struct network_helper_opts opts = {
+ .post_socket_cb = cc_cb,
+ .cb_opts = &cb_opts,
+ };
struct bpf_cc_cubic *cc_cubic_skel;
struct bpf_link *link;
@@ -468,7 +601,7 @@ static void test_cc_cubic(void)
return;
}
- do_test("bpf_cc_cubic", NULL);
+ do_test(&opts);
bpf_link__destroy(link);
bpf_cc_cubic__destroy(cc_cubic_skel);
@@ -506,4 +639,6 @@ void test_bpf_tcp_ca(void)
test_tcp_ca_kfunc();
if (test__start_subtest("cc_cubic"))
test_cc_cubic();
+ if (test__start_subtest("dctcp_autoattach_map"))
+ test_dctcp_autoattach_map();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_verif_scale.c b/tools/testing/selftests/bpf/prog_tests/bpf_verif_scale.c
index 4c6ada5b270b..73f669014b69 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_verif_scale.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_verif_scale.c
@@ -45,12 +45,6 @@ err_out:
return err;
}
-struct scale_test_def {
- const char *file;
- enum bpf_prog_type attach_type;
- bool fails;
-};
-
static void scale_test(const char *file,
enum bpf_prog_type attach_type,
bool should_fail)
diff --git a/tools/testing/selftests/bpf/prog_tests/btf_distill.c b/tools/testing/selftests/bpf/prog_tests/btf_distill.c
new file mode 100644
index 000000000000..bfbe795823a2
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/btf_distill.c
@@ -0,0 +1,552 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024, Oracle and/or its affiliates. */
+
+#include <test_progs.h>
+#include <bpf/btf.h>
+#include "btf_helpers.h"
+
+/* Fabricate base, split BTF with references to base types needed; then create
+ * split BTF with distilled base BTF and ensure expectations are met:
+ * - only referenced base types from split BTF are present
+ * - struct/union/enum are represented as empty unless anonymous, when they
+ * are represented in full in split BTF
+ */
+static void test_distilled_base(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_ptr(btf1, 1); /* [2] ptr to int */
+ btf__add_struct(btf1, "s1", 8); /* [3] struct s1 { */
+ btf__add_field(btf1, "f1", 2, 0, 0); /* int *f1; */
+ /* } */
+ btf__add_struct(btf1, "", 12); /* [4] struct { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ btf__add_field(btf1, "f2", 3, 32, 0); /* struct s1 f2; */
+ /* } */
+ btf__add_int(btf1, "unsigned int", 4, 0); /* [5] unsigned int */
+ btf__add_union(btf1, "u1", 12); /* [6] union u1 { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ btf__add_field(btf1, "f2", 2, 0, 0); /* int *f2; */
+ /* } */
+ btf__add_union(btf1, "", 4); /* [7] union { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ btf__add_enum(btf1, "e1", 4); /* [8] enum e1 { */
+ btf__add_enum_value(btf1, "v1", 1); /* v1 = 1; */
+ /* } */
+ btf__add_enum(btf1, "", 4); /* [9] enum { */
+ btf__add_enum_value(btf1, "av1", 2); /* av1 = 2; */
+ /* } */
+ btf__add_enum64(btf1, "e641", 8, true); /* [10] enum64 { */
+ btf__add_enum64_value(btf1, "v1", 1024); /* v1 = 1024; */
+ /* } */
+ btf__add_enum64(btf1, "", 8, true); /* [11] enum64 { */
+ btf__add_enum64_value(btf1, "v1", 1025); /* v1 = 1025; */
+ /* } */
+ btf__add_struct(btf1, "unneeded", 4); /* [12] struct unneeded { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ btf__add_struct(btf1, "embedded", 4); /* [13] struct embedded { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ btf__add_func_proto(btf1, 1); /* [14] int (*)(int *p1); */
+ btf__add_func_param(btf1, "p1", 1);
+
+ btf__add_array(btf1, 1, 1, 3); /* [15] int [3]; */
+
+ btf__add_struct(btf1, "from_proto", 4); /* [16] struct from_proto { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ btf__add_union(btf1, "u1", 4); /* [17] union u1 { */
+ btf__add_field(btf1, "f1", 1, 0, 0); /* int f1; */
+ /* } */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] PTR '(anon)' type_id=1",
+ "[3] STRUCT 's1' size=8 vlen=1\n"
+ "\t'f1' type_id=2 bits_offset=0",
+ "[4] STRUCT '(anon)' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=3 bits_offset=32",
+ "[5] INT 'unsigned int' size=4 bits_offset=0 nr_bits=32 encoding=(none)",
+ "[6] UNION 'u1' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=2 bits_offset=0",
+ "[7] UNION '(anon)' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[8] ENUM 'e1' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'v1' val=1",
+ "[9] ENUM '(anon)' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'av1' val=2",
+ "[10] ENUM64 'e641' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1024",
+ "[11] ENUM64 '(anon)' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1025",
+ "[12] STRUCT 'unneeded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[13] STRUCT 'embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[14] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=1",
+ "[15] ARRAY '(anon)' type_id=1 index_type_id=1 nr_elems=3",
+ "[16] STRUCT 'from_proto' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[17] UNION 'u1' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0");
+
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+
+ btf__add_ptr(btf2, 3); /* [18] ptr to struct s1 */
+ /* add ptr to struct anon */
+ btf__add_ptr(btf2, 4); /* [19] ptr to struct (anon) */
+ btf__add_const(btf2, 6); /* [20] const union u1 */
+ btf__add_restrict(btf2, 7); /* [21] restrict union (anon) */
+ btf__add_volatile(btf2, 8); /* [22] volatile enum e1 */
+ btf__add_typedef(btf2, "et", 9); /* [23] typedef enum (anon) */
+ btf__add_const(btf2, 10); /* [24] const enum64 e641 */
+ btf__add_ptr(btf2, 11); /* [25] restrict enum64 (anon) */
+ btf__add_struct(btf2, "with_embedded", 4); /* [26] struct with_embedded { */
+ btf__add_field(btf2, "f1", 13, 0, 0); /* struct embedded f1; */
+ /* } */
+ btf__add_func(btf2, "fn", BTF_FUNC_STATIC, 14); /* [27] int fn(int p1); */
+ btf__add_typedef(btf2, "arraytype", 15); /* [28] typedef int[3] foo; */
+ btf__add_func_proto(btf2, 1); /* [29] int (*)(struct from proto p1); */
+ btf__add_func_param(btf2, "p1", 16);
+
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] PTR '(anon)' type_id=1",
+ "[3] STRUCT 's1' size=8 vlen=1\n"
+ "\t'f1' type_id=2 bits_offset=0",
+ "[4] STRUCT '(anon)' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=3 bits_offset=32",
+ "[5] INT 'unsigned int' size=4 bits_offset=0 nr_bits=32 encoding=(none)",
+ "[6] UNION 'u1' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=2 bits_offset=0",
+ "[7] UNION '(anon)' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[8] ENUM 'e1' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'v1' val=1",
+ "[9] ENUM '(anon)' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'av1' val=2",
+ "[10] ENUM64 'e641' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1024",
+ "[11] ENUM64 '(anon)' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1025",
+ "[12] STRUCT 'unneeded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[13] STRUCT 'embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[14] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=1",
+ "[15] ARRAY '(anon)' type_id=1 index_type_id=1 nr_elems=3",
+ "[16] STRUCT 'from_proto' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[17] UNION 'u1' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[18] PTR '(anon)' type_id=3",
+ "[19] PTR '(anon)' type_id=4",
+ "[20] CONST '(anon)' type_id=6",
+ "[21] RESTRICT '(anon)' type_id=7",
+ "[22] VOLATILE '(anon)' type_id=8",
+ "[23] TYPEDEF 'et' type_id=9",
+ "[24] CONST '(anon)' type_id=10",
+ "[25] PTR '(anon)' type_id=11",
+ "[26] STRUCT 'with_embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=13 bits_offset=0",
+ "[27] FUNC 'fn' type_id=14 linkage=static",
+ "[28] TYPEDEF 'arraytype' type_id=15",
+ "[29] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=16");
+
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(8, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+
+ VALIDATE_RAW_BTF(
+ btf4,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] STRUCT 's1' size=8 vlen=0",
+ "[3] UNION 'u1' size=12 vlen=0",
+ "[4] ENUM 'e1' encoding=UNSIGNED size=4 vlen=0",
+ "[5] ENUM 'e641' encoding=UNSIGNED size=8 vlen=0",
+ "[6] STRUCT 'embedded' size=4 vlen=0",
+ "[7] STRUCT 'from_proto' size=4 vlen=0",
+ /* split BTF; these types should match split BTF above from 17-28, with
+ * updated type id references
+ */
+ "[8] PTR '(anon)' type_id=2",
+ "[9] PTR '(anon)' type_id=20",
+ "[10] CONST '(anon)' type_id=3",
+ "[11] RESTRICT '(anon)' type_id=21",
+ "[12] VOLATILE '(anon)' type_id=4",
+ "[13] TYPEDEF 'et' type_id=22",
+ "[14] CONST '(anon)' type_id=5",
+ "[15] PTR '(anon)' type_id=23",
+ "[16] STRUCT 'with_embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=6 bits_offset=0",
+ "[17] FUNC 'fn' type_id=24 linkage=static",
+ "[18] TYPEDEF 'arraytype' type_id=25",
+ "[19] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=7",
+ /* split BTF types added from original base BTF below */
+ "[20] STRUCT '(anon)' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=2 bits_offset=32",
+ "[21] UNION '(anon)' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[22] ENUM '(anon)' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'av1' val=2",
+ "[23] ENUM64 '(anon)' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1025",
+ "[24] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=1",
+ "[25] ARRAY '(anon)' type_id=1 index_type_id=1 nr_elems=3");
+
+ if (!ASSERT_EQ(btf__relocate(btf4, btf1), 0, "relocate_split"))
+ goto cleanup;
+
+ VALIDATE_RAW_BTF(
+ btf4,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] PTR '(anon)' type_id=1",
+ "[3] STRUCT 's1' size=8 vlen=1\n"
+ "\t'f1' type_id=2 bits_offset=0",
+ "[4] STRUCT '(anon)' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=3 bits_offset=32",
+ "[5] INT 'unsigned int' size=4 bits_offset=0 nr_bits=32 encoding=(none)",
+ "[6] UNION 'u1' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=2 bits_offset=0",
+ "[7] UNION '(anon)' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[8] ENUM 'e1' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'v1' val=1",
+ "[9] ENUM '(anon)' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'av1' val=2",
+ "[10] ENUM64 'e641' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1024",
+ "[11] ENUM64 '(anon)' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1025",
+ "[12] STRUCT 'unneeded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[13] STRUCT 'embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[14] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=1",
+ "[15] ARRAY '(anon)' type_id=1 index_type_id=1 nr_elems=3",
+ "[16] STRUCT 'from_proto' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[17] UNION 'u1' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[18] PTR '(anon)' type_id=3",
+ "[19] PTR '(anon)' type_id=30",
+ "[20] CONST '(anon)' type_id=6",
+ "[21] RESTRICT '(anon)' type_id=31",
+ "[22] VOLATILE '(anon)' type_id=8",
+ "[23] TYPEDEF 'et' type_id=32",
+ "[24] CONST '(anon)' type_id=10",
+ "[25] PTR '(anon)' type_id=33",
+ "[26] STRUCT 'with_embedded' size=4 vlen=1\n"
+ "\t'f1' type_id=13 bits_offset=0",
+ "[27] FUNC 'fn' type_id=34 linkage=static",
+ "[28] TYPEDEF 'arraytype' type_id=35",
+ "[29] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=16",
+ /* below here are (duplicate) anon base types added by distill
+ * process to split BTF.
+ */
+ "[30] STRUCT '(anon)' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=3 bits_offset=32",
+ "[31] UNION '(anon)' size=4 vlen=1\n"
+ "\t'f1' type_id=1 bits_offset=0",
+ "[32] ENUM '(anon)' encoding=UNSIGNED size=4 vlen=1\n"
+ "\t'av1' val=2",
+ "[33] ENUM64 '(anon)' encoding=SIGNED size=8 vlen=1\n"
+ "\t'v1' val=1025",
+ "[34] FUNC_PROTO '(anon)' ret_type_id=1 vlen=1\n"
+ "\t'p1' type_id=1",
+ "[35] ARRAY '(anon)' type_id=1 index_type_id=1 nr_elems=3");
+
+cleanup:
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
+/* ensure we can cope with multiple types with the same name in
+ * distilled base BTF. In this case because sizes are different,
+ * we can still disambiguate them.
+ */
+static void test_distilled_base_multi(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_int(btf1, "int", 8, BTF_INT_SIGNED); /* [2] int */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED");
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+ btf__add_ptr(btf2, 1);
+ btf__add_const(btf2, 2);
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED",
+ "[3] PTR '(anon)' type_id=1",
+ "[4] CONST '(anon)' type_id=2");
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(3, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+ VALIDATE_RAW_BTF(
+ btf3,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED");
+ if (!ASSERT_EQ(btf__relocate(btf4, btf1), 0, "relocate_split"))
+ goto cleanup;
+
+ VALIDATE_RAW_BTF(
+ btf4,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED",
+ "[3] PTR '(anon)' type_id=1",
+ "[4] CONST '(anon)' type_id=2");
+
+cleanup:
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
+/* If a needed type is not present in the base BTF we wish to relocate
+ * with, btf__relocate() should error our.
+ */
+static void test_distilled_base_missing_err(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL, *btf5 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_int(btf1, "int", 8, BTF_INT_SIGNED); /* [2] int */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED");
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+ btf__add_ptr(btf2, 1);
+ btf__add_const(btf2, 2);
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED",
+ "[3] PTR '(anon)' type_id=1",
+ "[4] CONST '(anon)' type_id=2");
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(3, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+ VALIDATE_RAW_BTF(
+ btf3,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED");
+ btf5 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf"))
+ return;
+ btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ VALIDATE_RAW_BTF(
+ btf5,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ ASSERT_EQ(btf__relocate(btf4, btf5), -EINVAL, "relocate_split");
+
+cleanup:
+ btf__free(btf5);
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
+/* With 2 types of same size in distilled base BTF, relocation should
+ * fail as we have no means to choose between them.
+ */
+static void test_distilled_base_multi_err(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [2] int */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+ btf__add_ptr(btf2, 1);
+ btf__add_const(btf2, 2);
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[3] PTR '(anon)' type_id=1",
+ "[4] CONST '(anon)' type_id=2");
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(3, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+ VALIDATE_RAW_BTF(
+ btf3,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ ASSERT_EQ(btf__relocate(btf4, btf1), -EINVAL, "relocate_split");
+cleanup:
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
+/* With 2 types of same size in base BTF, relocation should
+ * fail as we have no means to choose between them.
+ */
+static void test_distilled_base_multi_err2(void)
+{
+ struct btf *btf1 = NULL, *btf2 = NULL, *btf3 = NULL, *btf4 = NULL, *btf5 = NULL;
+
+ btf1 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf1, "empty_main_btf"))
+ return;
+ btf__add_int(btf1, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ VALIDATE_RAW_BTF(
+ btf1,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ btf2 = btf__new_empty_split(btf1);
+ if (!ASSERT_OK_PTR(btf2, "empty_split_btf"))
+ goto cleanup;
+ btf__add_ptr(btf2, 1);
+ VALIDATE_RAW_BTF(
+ btf2,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] PTR '(anon)' type_id=1");
+ if (!ASSERT_EQ(0, btf__distill_base(btf2, &btf3, &btf4),
+ "distilled_base") ||
+ !ASSERT_OK_PTR(btf3, "distilled_base") ||
+ !ASSERT_OK_PTR(btf4, "distilled_split") ||
+ !ASSERT_EQ(2, btf__type_cnt(btf3), "distilled_base_type_cnt"))
+ goto cleanup;
+ VALIDATE_RAW_BTF(
+ btf3,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ btf5 = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf5, "empty_reloc_btf"))
+ return;
+ btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_int(btf5, "int", 4, BTF_INT_SIGNED); /* [2] int */
+ VALIDATE_RAW_BTF(
+ btf5,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED");
+ ASSERT_EQ(btf__relocate(btf4, btf5), -EINVAL, "relocate_split");
+cleanup:
+ btf__free(btf5);
+ btf__free(btf4);
+ btf__free(btf3);
+ btf__free(btf2);
+ btf__free(btf1);
+}
+
+/* create split reference BTF from vmlinux + split BTF with a few type references;
+ * ensure the resultant split reference BTF is as expected, containing only types
+ * needed to disambiguate references from split BTF.
+ */
+static void test_distilled_base_vmlinux(void)
+{
+ struct btf *split_btf = NULL, *vmlinux_btf = btf__load_vmlinux_btf();
+ struct btf *split_dist = NULL, *base_dist = NULL;
+ __s32 int_id, myint_id;
+
+ if (!ASSERT_OK_PTR(vmlinux_btf, "load_vmlinux"))
+ return;
+ int_id = btf__find_by_name_kind(vmlinux_btf, "int", BTF_KIND_INT);
+ if (!ASSERT_GT(int_id, 0, "find_int"))
+ goto cleanup;
+ split_btf = btf__new_empty_split(vmlinux_btf);
+ if (!ASSERT_OK_PTR(split_btf, "new_split"))
+ goto cleanup;
+ myint_id = btf__add_typedef(split_btf, "myint", int_id);
+ btf__add_ptr(split_btf, myint_id);
+
+ if (!ASSERT_EQ(btf__distill_base(split_btf, &base_dist, &split_dist), 0,
+ "distill_vmlinux_base"))
+ goto cleanup;
+
+ if (!ASSERT_OK_PTR(split_dist, "split_distilled") ||
+ !ASSERT_OK_PTR(base_dist, "base_dist"))
+ goto cleanup;
+ VALIDATE_RAW_BTF(
+ split_dist,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] TYPEDEF 'myint' type_id=1",
+ "[3] PTR '(anon)' type_id=2");
+
+cleanup:
+ btf__free(split_dist);
+ btf__free(base_dist);
+ btf__free(split_btf);
+ btf__free(vmlinux_btf);
+}
+
+void test_btf_distill(void)
+{
+ if (test__start_subtest("distilled_base"))
+ test_distilled_base();
+ if (test__start_subtest("distilled_base_multi"))
+ test_distilled_base_multi();
+ if (test__start_subtest("distilled_base_missing_err"))
+ test_distilled_base_missing_err();
+ if (test__start_subtest("distilled_base_multi_err"))
+ test_distilled_base_multi_err();
+ if (test__start_subtest("distilled_base_multi_err2"))
+ test_distilled_base_multi_err2();
+ if (test__start_subtest("distilled_base_vmlinux"))
+ test_distilled_base_vmlinux();
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/btf_field_iter.c b/tools/testing/selftests/bpf/prog_tests/btf_field_iter.c
new file mode 100644
index 000000000000..32159d3eb281
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/btf_field_iter.c
@@ -0,0 +1,161 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024, Oracle and/or its affiliates. */
+
+#include <test_progs.h>
+#include <bpf/btf.h>
+#include "btf_helpers.h"
+#include "bpf/libbpf_internal.h"
+
+struct field_data {
+ __u32 ids[5];
+ const char *strs[5];
+} fields[] = {
+ { .ids = {}, .strs = {} },
+ { .ids = {}, .strs = { "int" } },
+ { .ids = {}, .strs = { "int64" } },
+ { .ids = { 1 }, .strs = { "" } },
+ { .ids = { 2, 1 }, .strs = { "" } },
+ { .ids = { 3, 1 }, .strs = { "s1", "f1", "f2" } },
+ { .ids = { 1, 5 }, .strs = { "u1", "f1", "f2" } },
+ { .ids = {}, .strs = { "e1", "v1", "v2" } },
+ { .ids = {}, .strs = { "fw1" } },
+ { .ids = { 1 }, .strs = { "t" } },
+ { .ids = { 2 }, .strs = { "" } },
+ { .ids = { 1 }, .strs = { "" } },
+ { .ids = { 3 }, .strs = { "" } },
+ { .ids = { 1, 1, 3 }, .strs = { "", "p1", "p2" } },
+ { .ids = { 13 }, .strs = { "func" } },
+ { .ids = { 1 }, .strs = { "var1" } },
+ { .ids = { 3 }, .strs = { "var2" } },
+ { .ids = {}, .strs = { "float" } },
+ { .ids = { 11 }, .strs = { "decltag" } },
+ { .ids = { 6 }, .strs = { "typetag" } },
+ { .ids = {}, .strs = { "e64", "eval1", "eval2", "eval3" } },
+ { .ids = { 15, 16 }, .strs = { "datasec1" } }
+
+};
+
+/* Fabricate BTF with various types and check BTF field iteration finds types,
+ * strings expected.
+ */
+void test_btf_field_iter(void)
+{
+ struct btf *btf = NULL;
+ int id;
+
+ btf = btf__new_empty();
+ if (!ASSERT_OK_PTR(btf, "empty_btf"))
+ return;
+
+ btf__add_int(btf, "int", 4, BTF_INT_SIGNED); /* [1] int */
+ btf__add_int(btf, "int64", 8, BTF_INT_SIGNED); /* [2] int64 */
+ btf__add_ptr(btf, 1); /* [3] int * */
+ btf__add_array(btf, 1, 2, 3); /* [4] int64[3] */
+ btf__add_struct(btf, "s1", 12); /* [5] struct s1 { */
+ btf__add_field(btf, "f1", 3, 0, 0); /* int *f1; */
+ btf__add_field(btf, "f2", 1, 0, 0); /* int f2; */
+ /* } */
+ btf__add_union(btf, "u1", 12); /* [6] union u1 { */
+ btf__add_field(btf, "f1", 1, 0, 0); /* int f1; */
+ btf__add_field(btf, "f2", 5, 0, 0); /* struct s1 f2; */
+ /* } */
+ btf__add_enum(btf, "e1", 4); /* [7] enum e1 { */
+ btf__add_enum_value(btf, "v1", 1); /* v1 = 1; */
+ btf__add_enum_value(btf, "v2", 2); /* v2 = 2; */
+ /* } */
+
+ btf__add_fwd(btf, "fw1", BTF_FWD_STRUCT); /* [8] struct fw1; */
+ btf__add_typedef(btf, "t", 1); /* [9] typedef int t; */
+ btf__add_volatile(btf, 2); /* [10] volatile int64; */
+ btf__add_const(btf, 1); /* [11] const int; */
+ btf__add_restrict(btf, 3); /* [12] restrict int *; */
+ btf__add_func_proto(btf, 1); /* [13] int (*)(int p1, int *p2); */
+ btf__add_func_param(btf, "p1", 1);
+ btf__add_func_param(btf, "p2", 3);
+
+ btf__add_func(btf, "func", BTF_FUNC_GLOBAL, 13);/* [14] int func(int p1, int *p2); */
+ btf__add_var(btf, "var1", BTF_VAR_STATIC, 1); /* [15] static int var1; */
+ btf__add_var(btf, "var2", BTF_VAR_STATIC, 3); /* [16] static int *var2; */
+ btf__add_float(btf, "float", 4); /* [17] float; */
+ btf__add_decl_tag(btf, "decltag", 11, -1); /* [18] decltag const int; */
+ btf__add_type_tag(btf, "typetag", 6); /* [19] typetag union u1; */
+ btf__add_enum64(btf, "e64", 8, true); /* [20] enum { */
+ btf__add_enum64_value(btf, "eval1", 1000); /* eval1 = 1000, */
+ btf__add_enum64_value(btf, "eval2", 2000); /* eval2 = 2000, */
+ btf__add_enum64_value(btf, "eval3", 3000); /* eval3 = 3000 */
+ /* } */
+ btf__add_datasec(btf, "datasec1", 12); /* [21] datasec datasec1 */
+ btf__add_datasec_var_info(btf, 15, 0, 4);
+ btf__add_datasec_var_info(btf, 16, 4, 8);
+
+ VALIDATE_RAW_BTF(
+ btf,
+ "[1] INT 'int' size=4 bits_offset=0 nr_bits=32 encoding=SIGNED",
+ "[2] INT 'int64' size=8 bits_offset=0 nr_bits=64 encoding=SIGNED",
+ "[3] PTR '(anon)' type_id=1",
+ "[4] ARRAY '(anon)' type_id=2 index_type_id=1 nr_elems=3",
+ "[5] STRUCT 's1' size=12 vlen=2\n"
+ "\t'f1' type_id=3 bits_offset=0\n"
+ "\t'f2' type_id=1 bits_offset=0",
+ "[6] UNION 'u1' size=12 vlen=2\n"
+ "\t'f1' type_id=1 bits_offset=0\n"
+ "\t'f2' type_id=5 bits_offset=0",
+ "[7] ENUM 'e1' encoding=UNSIGNED size=4 vlen=2\n"
+ "\t'v1' val=1\n"
+ "\t'v2' val=2",
+ "[8] FWD 'fw1' fwd_kind=struct",
+ "[9] TYPEDEF 't' type_id=1",
+ "[10] VOLATILE '(anon)' type_id=2",
+ "[11] CONST '(anon)' type_id=1",
+ "[12] RESTRICT '(anon)' type_id=3",
+ "[13] FUNC_PROTO '(anon)' ret_type_id=1 vlen=2\n"
+ "\t'p1' type_id=1\n"
+ "\t'p2' type_id=3",
+ "[14] FUNC 'func' type_id=13 linkage=global",
+ "[15] VAR 'var1' type_id=1, linkage=static",
+ "[16] VAR 'var2' type_id=3, linkage=static",
+ "[17] FLOAT 'float' size=4",
+ "[18] DECL_TAG 'decltag' type_id=11 component_idx=-1",
+ "[19] TYPE_TAG 'typetag' type_id=6",
+ "[20] ENUM64 'e64' encoding=SIGNED size=8 vlen=3\n"
+ "\t'eval1' val=1000\n"
+ "\t'eval2' val=2000\n"
+ "\t'eval3' val=3000",
+ "[21] DATASEC 'datasec1' size=12 vlen=2\n"
+ "\ttype_id=15 offset=0 size=4\n"
+ "\ttype_id=16 offset=4 size=8");
+
+ for (id = 1; id < btf__type_cnt(btf); id++) {
+ struct btf_type *t = btf_type_by_id(btf, id);
+ struct btf_field_iter it_strs, it_ids;
+ int str_idx = 0, id_idx = 0;
+ __u32 *next_str, *next_id;
+
+ if (!ASSERT_OK_PTR(t, "btf_type_by_id"))
+ break;
+ if (!ASSERT_OK(btf_field_iter_init(&it_strs, t, BTF_FIELD_ITER_STRS),
+ "iter_init_strs"))
+ break;
+ if (!ASSERT_OK(btf_field_iter_init(&it_ids, t, BTF_FIELD_ITER_IDS),
+ "iter_init_ids"))
+ break;
+ while ((next_str = btf_field_iter_next(&it_strs))) {
+ const char *str = btf__str_by_offset(btf, *next_str);
+
+ if (!ASSERT_OK(strcmp(fields[id].strs[str_idx], str), "field_str_match"))
+ break;
+ str_idx++;
+ }
+ /* ensure no more strings are expected */
+ ASSERT_EQ(fields[id].strs[str_idx], NULL, "field_str_cnt");
+
+ while ((next_id = btf_field_iter_next(&it_ids))) {
+ if (!ASSERT_EQ(*next_id, fields[id].ids[id_idx], "field_id_match"))
+ break;
+ id_idx++;
+ }
+ /* ensure no more ids are expected */
+ ASSERT_EQ(fields[id].ids[id_idx], 0, "field_id_cnt");
+ }
+ btf__free(btf);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/cgroup_v1v2.c b/tools/testing/selftests/bpf/prog_tests/cgroup_v1v2.c
index addf720428f7..9709c8db7275 100644
--- a/tools/testing/selftests/bpf/prog_tests/cgroup_v1v2.c
+++ b/tools/testing/selftests/bpf/prog_tests/cgroup_v1v2.c
@@ -32,7 +32,7 @@ static int run_test(int cgroup_fd, int server_fd, bool classid)
goto out;
}
- fd = connect_to_fd_opts(server_fd, &opts);
+ fd = connect_to_fd_opts(server_fd, SOCK_STREAM, &opts);
if (fd < 0)
err = -1;
else
@@ -52,7 +52,7 @@ void test_cgroup_v1v2(void)
server_fd = start_server(AF_INET, SOCK_STREAM, NULL, port, 0);
if (!ASSERT_GE(server_fd, 0, "server_fd"))
return;
- client_fd = connect_to_fd_opts(server_fd, &opts);
+ client_fd = connect_to_fd_opts(server_fd, SOCK_STREAM, &opts);
if (!ASSERT_GE(client_fd, 0, "client_fd")) {
close(server_fd);
return;
diff --git a/tools/testing/selftests/bpf/prog_tests/cpumask.c b/tools/testing/selftests/bpf/prog_tests/cpumask.c
index ecf89df78109..2570bd4b0cb2 100644
--- a/tools/testing/selftests/bpf/prog_tests/cpumask.c
+++ b/tools/testing/selftests/bpf/prog_tests/cpumask.c
@@ -18,6 +18,11 @@ static const char * const cpumask_success_testcases[] = {
"test_insert_leave",
"test_insert_remove_release",
"test_global_mask_rcu",
+ "test_global_mask_array_one_rcu",
+ "test_global_mask_array_rcu",
+ "test_global_mask_array_l2_rcu",
+ "test_global_mask_nested_rcu",
+ "test_global_mask_nested_deep_rcu",
"test_cpumask_weight",
};
diff --git a/tools/testing/selftests/bpf/prog_tests/ctx_rewrite.c b/tools/testing/selftests/bpf/prog_tests/ctx_rewrite.c
index 3b7c57fe55a5..08b6391f2f56 100644
--- a/tools/testing/selftests/bpf/prog_tests/ctx_rewrite.c
+++ b/tools/testing/selftests/bpf/prog_tests/ctx_rewrite.c
@@ -69,15 +69,17 @@ static struct test_case test_cases[] = {
{
N(SCHED_CLS, struct __sk_buff, tstamp),
.read = "r11 = *(u8 *)($ctx + sk_buff::__mono_tc_offset);"
- "w11 &= 3;"
- "if w11 != 0x3 goto pc+2;"
+ "if w11 & 0x4 goto pc+1;"
+ "goto pc+4;"
+ "if w11 & 0x3 goto pc+1;"
+ "goto pc+2;"
"$dst = 0;"
"goto pc+1;"
"$dst = *(u64 *)($ctx + sk_buff::tstamp);",
.write = "r11 = *(u8 *)($ctx + sk_buff::__mono_tc_offset);"
- "if w11 & 0x2 goto pc+1;"
+ "if w11 & 0x4 goto pc+1;"
"goto pc+2;"
- "w11 &= -2;"
+ "w11 &= -4;"
"*(u8 *)($ctx + sk_buff::__mono_tc_offset) = r11;"
"*(u64 *)($ctx + sk_buff::tstamp) = $src;",
},
diff --git a/tools/testing/selftests/bpf/prog_tests/fexit_stress.c b/tools/testing/selftests/bpf/prog_tests/fexit_stress.c
index 596536def43d..49b1ffc9af1f 100644
--- a/tools/testing/selftests/bpf/prog_tests/fexit_stress.c
+++ b/tools/testing/selftests/bpf/prog_tests/fexit_stress.c
@@ -50,9 +50,9 @@ void serial_test_fexit_stress(void)
out:
for (i = 0; i < bpf_max_tramp_links; i++) {
- if (link_fd[i])
+ if (link_fd[i] > 0)
close(link_fd[i]);
- if (fexit_fd[i])
+ if (fexit_fd[i] > 0)
close(fexit_fd[i]);
}
free(fd);
diff --git a/tools/testing/selftests/bpf/prog_tests/find_vma.c b/tools/testing/selftests/bpf/prog_tests/find_vma.c
index 5165b38f0e59..f7619e0ade10 100644
--- a/tools/testing/selftests/bpf/prog_tests/find_vma.c
+++ b/tools/testing/selftests/bpf/prog_tests/find_vma.c
@@ -29,8 +29,8 @@ static int open_pe(void)
/* create perf event */
attr.size = sizeof(attr);
- attr.type = PERF_TYPE_HARDWARE;
- attr.config = PERF_COUNT_HW_CPU_CYCLES;
+ attr.type = PERF_TYPE_SOFTWARE;
+ attr.config = PERF_COUNT_SW_CPU_CLOCK;
attr.freq = 1;
attr.sample_freq = 1000;
pfd = syscall(__NR_perf_event_open, &attr, 0, -1, -1, PERF_FLAG_FD_CLOEXEC);
diff --git a/tools/testing/selftests/bpf/prog_tests/ip_check_defrag.c b/tools/testing/selftests/bpf/prog_tests/ip_check_defrag.c
index 284764e7179f..4ddb8a5fece8 100644
--- a/tools/testing/selftests/bpf/prog_tests/ip_check_defrag.c
+++ b/tools/testing/selftests/bpf/prog_tests/ip_check_defrag.c
@@ -158,15 +158,13 @@ static int send_frags6(int client)
void test_bpf_ip_check_defrag_ok(bool ipv6)
{
+ int family = ipv6 ? AF_INET6 : AF_INET;
struct network_helper_opts rx_opts = {
.timeout_ms = 1000,
- .noconnect = true,
};
struct network_helper_opts tx_ops = {
.timeout_ms = 1000,
- .type = SOCK_RAW,
.proto = IPPROTO_RAW,
- .noconnect = true,
};
struct sockaddr_storage caddr;
struct ip_check_defrag *skel;
@@ -192,7 +190,7 @@ void test_bpf_ip_check_defrag_ok(bool ipv6)
nstoken = open_netns(NS1);
if (!ASSERT_OK_PTR(nstoken, "setns ns1"))
goto out;
- srv_fd = start_server(ipv6 ? AF_INET6 : AF_INET, SOCK_DGRAM, NULL, SERVER_PORT, 0);
+ srv_fd = start_server(family, SOCK_DGRAM, NULL, SERVER_PORT, 0);
close_netns(nstoken);
if (!ASSERT_GE(srv_fd, 0, "start_server"))
goto out;
@@ -201,18 +199,18 @@ void test_bpf_ip_check_defrag_ok(bool ipv6)
nstoken = open_netns(NS0);
if (!ASSERT_OK_PTR(nstoken, "setns ns0"))
goto out;
- client_tx_fd = connect_to_fd_opts(srv_fd, &tx_ops);
+ client_tx_fd = client_socket(family, SOCK_RAW, &tx_ops);
close_netns(nstoken);
- if (!ASSERT_GE(client_tx_fd, 0, "connect_to_fd_opts"))
+ if (!ASSERT_GE(client_tx_fd, 0, "client_socket"))
goto out;
/* Open rx socket in ns0 */
nstoken = open_netns(NS0);
if (!ASSERT_OK_PTR(nstoken, "setns ns0"))
goto out;
- client_rx_fd = connect_to_fd_opts(srv_fd, &rx_opts);
+ client_rx_fd = client_socket(family, SOCK_DGRAM, &rx_opts);
close_netns(nstoken);
- if (!ASSERT_GE(client_rx_fd, 0, "connect_to_fd_opts"))
+ if (!ASSERT_GE(client_rx_fd, 0, "client_socket"))
goto out;
/* Bind rx socket to a premeditated port */
diff --git a/tools/testing/selftests/bpf/prog_tests/kfunc_call.c b/tools/testing/selftests/bpf/prog_tests/kfunc_call.c
index 2eb71559713c..5b743212292f 100644
--- a/tools/testing/selftests/bpf/prog_tests/kfunc_call.c
+++ b/tools/testing/selftests/bpf/prog_tests/kfunc_call.c
@@ -78,6 +78,7 @@ static struct kfunc_test_params kfunc_tests[] = {
SYSCALL_TEST(kfunc_syscall_test, 0),
SYSCALL_NULL_CTX_TEST(kfunc_syscall_test_null, 0),
TC_TEST(kfunc_call_test_static_unused_arg, 0),
+ TC_TEST(kfunc_call_ctx, 0),
};
struct syscall_test_args {
diff --git a/tools/testing/selftests/bpf/prog_tests/kfunc_param_nullable.c b/tools/testing/selftests/bpf/prog_tests/kfunc_param_nullable.c
new file mode 100644
index 000000000000..c8f4dcaac7c7
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/kfunc_param_nullable.c
@@ -0,0 +1,11 @@
+// SPDX-License-Identifier: GPL-2.0
+
+/* Copyright (c) 2024 Meta Platforms, Inc */
+
+#include <test_progs.h>
+#include "test_kfunc_param_nullable.skel.h"
+
+void test_kfunc_param_nullable(void)
+{
+ RUN_TESTS(test_kfunc_param_nullable);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/linked_list.c b/tools/testing/selftests/bpf/prog_tests/linked_list.c
index 2fb89de63bd2..77d07e0a4a55 100644
--- a/tools/testing/selftests/bpf/prog_tests/linked_list.c
+++ b/tools/testing/selftests/bpf/prog_tests/linked_list.c
@@ -183,6 +183,18 @@ static void test_linked_list_success(int mode, bool leave_in_map)
if (!leave_in_map)
clear_fields(skel->maps.bss_A);
+ ret = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.global_list_push_pop_nested), &opts);
+ ASSERT_OK(ret, "global_list_push_pop_nested");
+ ASSERT_OK(opts.retval, "global_list_push_pop_nested retval");
+ if (!leave_in_map)
+ clear_fields(skel->maps.bss_A);
+
+ ret = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.global_list_array_push_pop), &opts);
+ ASSERT_OK(ret, "global_list_array_push_pop");
+ ASSERT_OK(opts.retval, "global_list_array_push_pop retval");
+ if (!leave_in_map)
+ clear_fields(skel->maps.bss_A);
+
if (mode == PUSH_POP)
goto end;
diff --git a/tools/testing/selftests/bpf/prog_tests/mptcp.c b/tools/testing/selftests/bpf/prog_tests/mptcp.c
index 274d2e033e39..d2ca32fa3b21 100644
--- a/tools/testing/selftests/bpf/prog_tests/mptcp.c
+++ b/tools/testing/selftests/bpf/prog_tests/mptcp.c
@@ -89,13 +89,8 @@ static int start_mptcp_server(int family, const char *addr_str, __u16 port,
.timeout_ms = timeout_ms,
.proto = IPPROTO_MPTCP,
};
- struct sockaddr_storage addr;
- socklen_t addrlen;
- if (make_sockaddr(family, addr_str, port, &addr, &addrlen))
- return -1;
-
- return start_server_addr(SOCK_STREAM, &addr, addrlen, &opts);
+ return start_server_str(family, SOCK_STREAM, addr_str, port, &opts);
}
static int verify_tsk(int map_fd, int client_fd)
diff --git a/tools/testing/selftests/bpf/prog_tests/rbtree.c b/tools/testing/selftests/bpf/prog_tests/rbtree.c
index e9300c96607d..9818f06c97c5 100644
--- a/tools/testing/selftests/bpf/prog_tests/rbtree.c
+++ b/tools/testing/selftests/bpf/prog_tests/rbtree.c
@@ -31,6 +31,28 @@ static void test_rbtree_add_nodes(void)
rbtree__destroy(skel);
}
+static void test_rbtree_add_nodes_nested(void)
+{
+ LIBBPF_OPTS(bpf_test_run_opts, opts,
+ .data_in = &pkt_v4,
+ .data_size_in = sizeof(pkt_v4),
+ .repeat = 1,
+ );
+ struct rbtree *skel;
+ int ret;
+
+ skel = rbtree__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "rbtree__open_and_load"))
+ return;
+
+ ret = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.rbtree_add_nodes_nested), &opts);
+ ASSERT_OK(ret, "rbtree_add_nodes_nested run");
+ ASSERT_OK(opts.retval, "rbtree_add_nodes_nested retval");
+ ASSERT_EQ(skel->data->less_callback_ran, 1, "rbtree_add_nodes_nested less_callback_ran");
+
+ rbtree__destroy(skel);
+}
+
static void test_rbtree_add_and_remove(void)
{
LIBBPF_OPTS(bpf_test_run_opts, opts,
@@ -53,6 +75,27 @@ static void test_rbtree_add_and_remove(void)
rbtree__destroy(skel);
}
+static void test_rbtree_add_and_remove_array(void)
+{
+ LIBBPF_OPTS(bpf_test_run_opts, opts,
+ .data_in = &pkt_v4,
+ .data_size_in = sizeof(pkt_v4),
+ .repeat = 1,
+ );
+ struct rbtree *skel;
+ int ret;
+
+ skel = rbtree__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "rbtree__open_and_load"))
+ return;
+
+ ret = bpf_prog_test_run_opts(bpf_program__fd(skel->progs.rbtree_add_and_remove_array), &opts);
+ ASSERT_OK(ret, "rbtree_add_and_remove_array");
+ ASSERT_OK(opts.retval, "rbtree_add_and_remove_array retval");
+
+ rbtree__destroy(skel);
+}
+
static void test_rbtree_first_and_remove(void)
{
LIBBPF_OPTS(bpf_test_run_opts, opts,
@@ -104,8 +147,12 @@ void test_rbtree_success(void)
{
if (test__start_subtest("rbtree_add_nodes"))
test_rbtree_add_nodes();
+ if (test__start_subtest("rbtree_add_nodes_nested"))
+ test_rbtree_add_nodes_nested();
if (test__start_subtest("rbtree_add_and_remove"))
test_rbtree_add_and_remove();
+ if (test__start_subtest("rbtree_add_and_remove_array"))
+ test_rbtree_add_and_remove_array();
if (test__start_subtest("rbtree_first_and_remove"))
test_rbtree_first_and_remove();
if (test__start_subtest("rbtree_api_release_aliasing"))
diff --git a/tools/testing/selftests/bpf/prog_tests/ringbuf.c b/tools/testing/selftests/bpf/prog_tests/ringbuf.c
index 4c6f42dae409..da430df45aa4 100644
--- a/tools/testing/selftests/bpf/prog_tests/ringbuf.c
+++ b/tools/testing/selftests/bpf/prog_tests/ringbuf.c
@@ -12,9 +12,11 @@
#include <sys/sysinfo.h>
#include <linux/perf_event.h>
#include <linux/ring_buffer.h>
+
#include "test_ringbuf.lskel.h"
#include "test_ringbuf_n.lskel.h"
#include "test_ringbuf_map_key.lskel.h"
+#include "test_ringbuf_write.lskel.h"
#define EDONE 7777
@@ -84,6 +86,58 @@ static void *poll_thread(void *input)
return (void *)(long)ring_buffer__poll(ringbuf, timeout);
}
+static void ringbuf_write_subtest(void)
+{
+ struct test_ringbuf_write_lskel *skel;
+ int page_size = getpagesize();
+ size_t *mmap_ptr;
+ int err, rb_fd;
+
+ skel = test_ringbuf_write_lskel__open();
+ if (!ASSERT_OK_PTR(skel, "skel_open"))
+ return;
+
+ skel->maps.ringbuf.max_entries = 0x4000;
+
+ err = test_ringbuf_write_lskel__load(skel);
+ if (!ASSERT_OK(err, "skel_load"))
+ goto cleanup;
+
+ rb_fd = skel->maps.ringbuf.map_fd;
+
+ mmap_ptr = mmap(NULL, page_size, PROT_READ | PROT_WRITE, MAP_SHARED, rb_fd, 0);
+ if (!ASSERT_OK_PTR(mmap_ptr, "rw_cons_pos"))
+ goto cleanup;
+ *mmap_ptr = 0x3000;
+ ASSERT_OK(munmap(mmap_ptr, page_size), "unmap_rw");
+
+ skel->bss->pid = getpid();
+
+ ringbuf = ring_buffer__new(rb_fd, process_sample, NULL, NULL);
+ if (!ASSERT_OK_PTR(ringbuf, "ringbuf_new"))
+ goto cleanup;
+
+ err = test_ringbuf_write_lskel__attach(skel);
+ if (!ASSERT_OK(err, "skel_attach"))
+ goto cleanup_ringbuf;
+
+ skel->bss->discarded = 0;
+ skel->bss->passed = 0;
+
+ /* trigger exactly two samples */
+ syscall(__NR_getpgid);
+ syscall(__NR_getpgid);
+
+ ASSERT_EQ(skel->bss->discarded, 2, "discarded");
+ ASSERT_EQ(skel->bss->passed, 0, "passed");
+
+ test_ringbuf_write_lskel__detach(skel);
+cleanup_ringbuf:
+ ring_buffer__free(ringbuf);
+cleanup:
+ test_ringbuf_write_lskel__destroy(skel);
+}
+
static void ringbuf_subtest(void)
{
const size_t rec_sz = BPF_RINGBUF_HDR_SZ + sizeof(struct sample);
@@ -451,4 +505,6 @@ void test_ringbuf(void)
ringbuf_n_subtest();
if (test__start_subtest("ringbuf_map_key"))
ringbuf_map_key_subtest();
+ if (test__start_subtest("ringbuf_write"))
+ ringbuf_write_subtest();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/send_signal.c b/tools/testing/selftests/bpf/prog_tests/send_signal.c
index 920aee41bd58..6cc69900b310 100644
--- a/tools/testing/selftests/bpf/prog_tests/send_signal.c
+++ b/tools/testing/selftests/bpf/prog_tests/send_signal.c
@@ -156,7 +156,8 @@ static void test_send_signal_tracepoint(bool signal_thread)
static void test_send_signal_perf(bool signal_thread)
{
struct perf_event_attr attr = {
- .sample_period = 1,
+ .freq = 1,
+ .sample_freq = 1000,
.type = PERF_TYPE_SOFTWARE,
.config = PERF_COUNT_SW_CPU_CLOCK,
};
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..ae87c00867ba 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -77,6 +77,12 @@ struct test {
bool reuseport_has_conns; /* Add a connected socket to reuseport group */
};
+struct cb_opts {
+ int family;
+ int sotype;
+ bool reuseport;
+};
+
static __u32 duration; /* for CHECK macro */
static bool is_ipv6(const char *ip)
@@ -142,19 +148,14 @@ static int make_socket(int sotype, const char *ip, int port,
return fd;
}
-static int make_server(int sotype, const char *ip, int port,
- struct bpf_program *reuseport_prog)
+static int setsockopts(int fd, void *opts)
{
- struct sockaddr_storage addr = {0};
+ struct cb_opts *co = (struct cb_opts *)opts;
const int one = 1;
- int err, fd = -1;
-
- fd = make_socket(sotype, ip, port, &addr);
- if (fd < 0)
- return -1;
+ int err = 0;
/* Enabled for UDPv6 sockets for IPv4-mapped IPv6 to work. */
- if (sotype == SOCK_DGRAM) {
+ if (co->sotype == SOCK_DGRAM) {
err = setsockopt(fd, SOL_IP, IP_RECVORIGDSTADDR, &one,
sizeof(one));
if (CHECK(err, "setsockopt(IP_RECVORIGDSTADDR)", "failed\n")) {
@@ -163,7 +164,7 @@ static int make_server(int sotype, const char *ip, int port,
}
}
- if (sotype == SOCK_DGRAM && addr.ss_family == AF_INET6) {
+ if (co->sotype == SOCK_DGRAM && co->family == AF_INET6) {
err = setsockopt(fd, SOL_IPV6, IPV6_RECVORIGDSTADDR, &one,
sizeof(one));
if (CHECK(err, "setsockopt(IPV6_RECVORIGDSTADDR)", "failed\n")) {
@@ -172,7 +173,7 @@ static int make_server(int sotype, const char *ip, int port,
}
}
- if (sotype == SOCK_STREAM) {
+ if (co->sotype == SOCK_STREAM) {
err = setsockopt(fd, SOL_SOCKET, SO_REUSEADDR, &one,
sizeof(one));
if (CHECK(err, "setsockopt(SO_REUSEADDR)", "failed\n")) {
@@ -181,7 +182,7 @@ static int make_server(int sotype, const char *ip, int port,
}
}
- if (reuseport_prog) {
+ if (co->reuseport) {
err = setsockopt(fd, SOL_SOCKET, SO_REUSEPORT, &one,
sizeof(one));
if (CHECK(err, "setsockopt(SO_REUSEPORT)", "failed\n")) {
@@ -190,19 +191,28 @@ static int make_server(int sotype, const char *ip, int port,
}
}
- err = bind(fd, (void *)&addr, inetaddr_len(&addr));
- if (CHECK(err, "bind", "failed\n")) {
- log_err("failed to bind listen socket");
- goto fail;
- }
+fail:
+ return err;
+}
- if (sotype == SOCK_STREAM) {
- err = listen(fd, SOMAXCONN);
- if (CHECK(err, "make_server", "listen")) {
- log_err("failed to listen on port %d", port);
- goto fail;
- }
- }
+static int make_server(int sotype, const char *ip, int port,
+ struct bpf_program *reuseport_prog)
+{
+ struct cb_opts cb_opts = {
+ .family = is_ipv6(ip) ? AF_INET6 : AF_INET,
+ .sotype = sotype,
+ .reuseport = reuseport_prog,
+ };
+ struct network_helper_opts opts = {
+ .backlog = SOMAXCONN,
+ .post_socket_cb = setsockopts,
+ .cb_opts = &cb_opts,
+ };
+ int err, fd;
+
+ fd = start_server_str(cb_opts.family, sotype, ip, port, &opts);
+ if (!ASSERT_OK_FD(fd, "start_server_str"))
+ return -1;
/* Late attach reuseport prog so we can have one init path */
if (reuseport_prog) {
@@ -406,18 +416,12 @@ static int udp_recv_send(int server_fd)
}
/* Reply from original destination address. */
- fd = socket(dst_addr->ss_family, SOCK_DGRAM, 0);
- if (CHECK(fd < 0, "socket", "failed\n")) {
+ fd = start_server_addr(SOCK_DGRAM, dst_addr, sizeof(*dst_addr), NULL);
+ if (!ASSERT_OK_FD(fd, "start_server_addr")) {
log_err("failed to create tx socket");
return -1;
}
- ret = bind(fd, (struct sockaddr *)dst_addr, sizeof(*dst_addr));
- if (CHECK(ret, "bind", "failed\n")) {
- log_err("failed to bind tx socket");
- goto out;
- }
-
msg.msg_control = NULL;
msg.msg_controllen = 0;
n = sendmsg(fd, &msg, 0);
@@ -629,9 +633,6 @@ static void run_lookup_prog(const struct test *t)
* BPF socket lookup.
*/
if (t->reuseport_has_conns) {
- struct sockaddr_storage addr = {};
- socklen_t len = sizeof(addr);
-
/* Add an extra socket to reuseport group */
reuse_conn_fd = make_server(t->sotype, t->listen_at.ip,
t->listen_at.port,
@@ -639,12 +640,9 @@ static void run_lookup_prog(const struct test *t)
if (reuse_conn_fd < 0)
goto close;
- /* Connect the extra socket to itself */
- err = getsockname(reuse_conn_fd, (void *)&addr, &len);
- if (CHECK(err, "getsockname", "errno %d\n", errno))
- goto close;
- err = connect(reuse_conn_fd, (void *)&addr, len);
- if (CHECK(err, "connect", "errno %d\n", errno))
+ /* Connect the extra socket to itself */
+ err = connect_fd_to_fd(reuse_conn_fd, reuse_conn_fd, 0);
+ if (!ASSERT_OK(err, "connect_fd_to_fd"))
goto close;
}
@@ -994,7 +992,7 @@ static void drop_on_reuseport(const struct test *t)
err = update_lookup_map(t->sock_map, SERVER_A, server1);
if (err)
- goto detach;
+ goto close_srv1;
/* second server on destination address we should never reach */
server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/sockopt_inherit.c b/tools/testing/selftests/bpf/prog_tests/sockopt_inherit.c
index 1d3a20f01b60..7cd8be2780ca 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockopt_inherit.c
+++ b/tools/testing/selftests/bpf/prog_tests/sockopt_inherit.c
@@ -70,7 +70,7 @@ static void *server_thread(void *arg)
return (void *)(long)err;
}
-static int custom_cb(int fd, const struct post_socket_opts *opts)
+static int custom_cb(int fd, void *opts)
{
char buf;
int err;
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_links.c b/tools/testing/selftests/bpf/prog_tests/tc_links.c
index bc9841144685..1af9ec1149aa 100644
--- a/tools/testing/selftests/bpf/prog_tests/tc_links.c
+++ b/tools/testing/selftests/bpf/prog_tests/tc_links.c
@@ -9,6 +9,8 @@
#define ping_cmd "ping -q -c1 -w1 127.0.0.1 > /dev/null"
#include "test_tc_link.skel.h"
+
+#include "netlink_helpers.h"
#include "tc_helpers.h"
void serial_test_tc_links_basic(void)
@@ -1787,6 +1789,65 @@ void serial_test_tc_links_ingress(void)
test_tc_links_ingress(BPF_TCX_INGRESS, false, false);
}
+struct qdisc_req {
+ struct nlmsghdr n;
+ struct tcmsg t;
+ char buf[1024];
+};
+
+static int qdisc_replace(int ifindex, const char *kind, bool block)
+{
+ struct rtnl_handle rth = { .fd = -1 };
+ struct qdisc_req req;
+ int err;
+
+ err = rtnl_open(&rth, 0);
+ if (!ASSERT_OK(err, "open_rtnetlink"))
+ return err;
+
+ memset(&req, 0, sizeof(req));
+ req.n.nlmsg_len = NLMSG_LENGTH(sizeof(struct tcmsg));
+ req.n.nlmsg_flags = NLM_F_CREATE | NLM_F_REPLACE | NLM_F_REQUEST;
+ req.n.nlmsg_type = RTM_NEWQDISC;
+ req.t.tcm_family = AF_UNSPEC;
+ req.t.tcm_ifindex = ifindex;
+ req.t.tcm_parent = 0xfffffff1;
+
+ addattr_l(&req.n, sizeof(req), TCA_KIND, kind, strlen(kind) + 1);
+ if (block)
+ addattr32(&req.n, sizeof(req), TCA_INGRESS_BLOCK, 1);
+
+ err = rtnl_talk(&rth, &req.n, NULL);
+ ASSERT_OK(err, "talk_rtnetlink");
+ rtnl_close(&rth);
+ return err;
+}
+
+void serial_test_tc_links_dev_chain0(void)
+{
+ int err, ifindex;
+
+ ASSERT_OK(system("ip link add dev foo type veth peer name bar"), "add veth");
+ ifindex = if_nametoindex("foo");
+ ASSERT_NEQ(ifindex, 0, "non_zero_ifindex");
+ err = qdisc_replace(ifindex, "ingress", true);
+ if (!ASSERT_OK(err, "attaching ingress"))
+ goto cleanup;
+ ASSERT_OK(system("tc filter add block 1 matchall action skbmod swap mac"), "add block");
+ err = qdisc_replace(ifindex, "clsact", false);
+ if (!ASSERT_OK(err, "attaching clsact"))
+ goto cleanup;
+ /* Heuristic: kern_sync_rcu() alone does not work; a wait-time of ~5s
+ * triggered the issue without the fix reliably 100% of the time.
+ */
+ sleep(5);
+ ASSERT_OK(system("tc filter add dev foo ingress matchall action skbmod swap mac"), "add filter");
+cleanup:
+ ASSERT_OK(system("ip link del dev foo"), "del veth");
+ ASSERT_EQ(if_nametoindex("foo"), 0, "foo removed");
+ ASSERT_EQ(if_nametoindex("bar"), 0, "bar removed");
+}
+
static void test_tc_links_dev_mixed(int target)
{
LIBBPF_OPTS(bpf_tc_opts, tc_opts, .handle = 1, .priority = 1);
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
index 15ee7b2fc410..b9135720024c 100644
--- a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
+++ b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
@@ -73,6 +73,16 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
"up primary");
ASSERT_OK(system("ip addr add dev " netkit_name " 10.0.0.1/24"),
"addr primary");
+
+ if (mode == NETKIT_L3) {
+ ASSERT_EQ(system("ip link set dev " netkit_name
+ " addr ee:ff:bb:cc:aa:dd 2> /dev/null"), 512,
+ "set hwaddress");
+ } else {
+ ASSERT_OK(system("ip link set dev " netkit_name
+ " addr ee:ff:bb:cc:aa:dd"),
+ "set hwaddress");
+ }
if (same_netns) {
ASSERT_OK(system("ip link set dev " netkit_peer " up"),
"up peer");
@@ -89,6 +99,16 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
return err;
}
+static void move_netkit(void)
+{
+ ASSERT_OK(system("ip link set " netkit_peer " netns foo"),
+ "move peer");
+ ASSERT_OK(system("ip netns exec foo ip link set dev "
+ netkit_peer " up"), "up peer");
+ ASSERT_OK(system("ip netns exec foo ip addr add dev "
+ netkit_peer " 10.0.0.2/24"), "addr peer");
+}
+
static void destroy_netkit(void)
{
ASSERT_OK(system("ip link del dev " netkit_name), "del primary");
@@ -685,3 +705,77 @@ void serial_test_tc_netkit_neigh_links(void)
serial_test_tc_netkit_neigh_links_target(NETKIT_L2, BPF_NETKIT_PRIMARY);
serial_test_tc_netkit_neigh_links_target(NETKIT_L3, BPF_NETKIT_PRIMARY);
}
+
+static void serial_test_tc_netkit_pkt_type_mode(int mode)
+{
+ LIBBPF_OPTS(bpf_netkit_opts, optl_nk);
+ LIBBPF_OPTS(bpf_tcx_opts, optl_tcx);
+ int err, ifindex, ifindex2;
+ struct test_tc_link *skel;
+ struct bpf_link *link;
+
+ err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
+ &ifindex, true);
+ if (err)
+ return;
+
+ ifindex2 = if_nametoindex(netkit_peer);
+ ASSERT_NEQ(ifindex, ifindex2, "ifindex_1_2");
+
+ skel = test_tc_link__open();
+ if (!ASSERT_OK_PTR(skel, "skel_open"))
+ goto cleanup;
+
+ ASSERT_EQ(bpf_program__set_expected_attach_type(skel->progs.tc1,
+ BPF_NETKIT_PRIMARY), 0, "tc1_attach_type");
+ ASSERT_EQ(bpf_program__set_expected_attach_type(skel->progs.tc7,
+ BPF_TCX_INGRESS), 0, "tc7_attach_type");
+
+ err = test_tc_link__load(skel);
+ if (!ASSERT_OK(err, "skel_load"))
+ goto cleanup;
+
+ assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 0);
+ assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 0);
+
+ link = bpf_program__attach_netkit(skel->progs.tc1, ifindex, &optl_nk);
+ if (!ASSERT_OK_PTR(link, "link_attach"))
+ goto cleanup;
+
+ skel->links.tc1 = link;
+
+ assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 1);
+ assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 0);
+
+ link = bpf_program__attach_tcx(skel->progs.tc7, ifindex2, &optl_tcx);
+ if (!ASSERT_OK_PTR(link, "link_attach"))
+ goto cleanup;
+
+ skel->links.tc7 = link;
+
+ assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 1);
+ assert_mprog_count_ifindex(ifindex2, BPF_TCX_INGRESS, 1);
+
+ move_netkit();
+
+ tc_skel_reset_all_seen(skel);
+ skel->bss->set_type = true;
+ ASSERT_EQ(send_icmp(), 0, "icmp_pkt");
+
+ ASSERT_EQ(skel->bss->seen_tc1, true, "seen_tc1");
+ ASSERT_EQ(skel->bss->seen_tc7, true, "seen_tc7");
+
+ ASSERT_EQ(skel->bss->seen_host, true, "seen_host");
+ ASSERT_EQ(skel->bss->seen_mcast, true, "seen_mcast");
+cleanup:
+ test_tc_link__destroy(skel);
+
+ assert_mprog_count_ifindex(ifindex, BPF_NETKIT_PRIMARY, 0);
+ destroy_netkit();
+}
+
+void serial_test_tc_netkit_pkt_type(void)
+{
+ serial_test_tc_netkit_pkt_type_mode(NETKIT_L2);
+ serial_test_tc_netkit_pkt_type_mode(NETKIT_L3);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_redirect.c b/tools/testing/selftests/bpf/prog_tests/tc_redirect.c
index b1073d36d77a..327d51f59142 100644
--- a/tools/testing/selftests/bpf/prog_tests/tc_redirect.c
+++ b/tools/testing/selftests/bpf/prog_tests/tc_redirect.c
@@ -890,9 +890,6 @@ static void test_udp_dtime(struct test_tc_dtime *skel, int family, bool bpf_fwd)
ASSERT_EQ(dtimes[INGRESS_FWDNS_P100], 0,
dtime_cnt_str(t, INGRESS_FWDNS_P100));
- /* non mono delivery time is not forwarded */
- ASSERT_EQ(dtimes[INGRESS_FWDNS_P101], 0,
- dtime_cnt_str(t, INGRESS_FWDNS_P101));
for (i = EGRESS_FWDNS_P100; i < SET_DTIME; i++)
ASSERT_GT(dtimes[i], 0, dtime_cnt_str(t, i));
diff --git a/tools/testing/selftests/bpf/prog_tests/test_skb_pkt_end.c b/tools/testing/selftests/bpf/prog_tests/test_skb_pkt_end.c
index ae93411fd582..09ca13bdf6ca 100644
--- a/tools/testing/selftests/bpf/prog_tests/test_skb_pkt_end.c
+++ b/tools/testing/selftests/bpf/prog_tests/test_skb_pkt_end.c
@@ -11,6 +11,7 @@ static int sanity_run(struct bpf_program *prog)
.data_in = &pkt_v4,
.data_size_in = sizeof(pkt_v4),
.repeat = 1,
+ .flags = BPF_F_TEST_SKB_CHECKSUM_COMPLETE,
);
prog_fd = bpf_program__fd(prog);
diff --git a/tools/testing/selftests/bpf/prog_tests/test_struct_ops_module.c b/tools/testing/selftests/bpf/prog_tests/test_struct_ops_module.c
index 29e183a80f49..bbcf12696a6b 100644
--- a/tools/testing/selftests/bpf/prog_tests/test_struct_ops_module.c
+++ b/tools/testing/selftests/bpf/prog_tests/test_struct_ops_module.c
@@ -3,9 +3,12 @@
#include <test_progs.h>
#include <time.h>
+#include <sys/epoll.h>
+
#include "struct_ops_module.skel.h"
#include "struct_ops_nulled_out_cb.skel.h"
#include "struct_ops_forgotten_cb.skel.h"
+#include "struct_ops_detach.skel.h"
static void check_map_info(struct bpf_map_info *info)
{
@@ -242,6 +245,58 @@ cleanup:
struct_ops_forgotten_cb__destroy(skel);
}
+/* Detach a link from a user space program */
+static void test_detach_link(void)
+{
+ struct epoll_event ev, events[2];
+ struct struct_ops_detach *skel;
+ struct bpf_link *link = NULL;
+ int fd, epollfd = -1, nfds;
+ int err;
+
+ skel = struct_ops_detach__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "struct_ops_detach__open_and_load"))
+ return;
+
+ link = bpf_map__attach_struct_ops(skel->maps.testmod_do_detach);
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+ goto cleanup;
+
+ fd = bpf_link__fd(link);
+ if (!ASSERT_GE(fd, 0, "link_fd"))
+ goto cleanup;
+
+ epollfd = epoll_create1(0);
+ if (!ASSERT_GE(epollfd, 0, "epoll_create1"))
+ goto cleanup;
+
+ ev.events = EPOLLHUP;
+ ev.data.fd = fd;
+ err = epoll_ctl(epollfd, EPOLL_CTL_ADD, fd, &ev);
+ if (!ASSERT_OK(err, "epoll_ctl"))
+ goto cleanup;
+
+ err = bpf_link__detach(link);
+ if (!ASSERT_OK(err, "detach_link"))
+ goto cleanup;
+
+ /* Wait for EPOLLHUP */
+ nfds = epoll_wait(epollfd, events, 2, 500);
+ if (!ASSERT_EQ(nfds, 1, "epoll_wait"))
+ goto cleanup;
+
+ if (!ASSERT_EQ(events[0].data.fd, fd, "epoll_wait_fd"))
+ goto cleanup;
+ if (!ASSERT_TRUE(events[0].events & EPOLLHUP, "events[0].events"))
+ goto cleanup;
+
+cleanup:
+ if (epollfd >= 0)
+ close(epollfd);
+ bpf_link__destroy(link);
+ struct_ops_detach__destroy(skel);
+}
+
void serial_test_struct_ops_module(void)
{
if (test__start_subtest("struct_ops_load"))
@@ -254,5 +309,7 @@ void serial_test_struct_ops_module(void)
test_struct_ops_nulled_out_cb();
if (test__start_subtest("struct_ops_forgotten_cb"))
test_struct_ops_forgotten_cb();
+ if (test__start_subtest("test_detach_link"))
+ test_detach_link();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/timer_lockup.c b/tools/testing/selftests/bpf/prog_tests/timer_lockup.c
new file mode 100644
index 000000000000..871d16cb95cf
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/timer_lockup.c
@@ -0,0 +1,91 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#define _GNU_SOURCE
+#include <sched.h>
+#include <test_progs.h>
+#include <pthread.h>
+#include <network_helpers.h>
+
+#include "timer_lockup.skel.h"
+
+static long cpu;
+static int *timer1_err;
+static int *timer2_err;
+static bool skip;
+
+volatile int k = 0;
+
+static void *timer_lockup_thread(void *arg)
+{
+ LIBBPF_OPTS(bpf_test_run_opts, opts,
+ .data_in = &pkt_v4,
+ .data_size_in = sizeof(pkt_v4),
+ .repeat = 1000,
+ );
+ int i, prog_fd = *(int *)arg;
+ cpu_set_t cpuset;
+
+ CPU_ZERO(&cpuset);
+ CPU_SET(__sync_fetch_and_add(&cpu, 1), &cpuset);
+ ASSERT_OK(pthread_setaffinity_np(pthread_self(), sizeof(cpuset),
+ &cpuset),
+ "cpu affinity");
+
+ for (i = 0; !READ_ONCE(*timer1_err) && !READ_ONCE(*timer2_err); i++) {
+ bpf_prog_test_run_opts(prog_fd, &opts);
+ /* Skip the test if we can't reproduce the race in a reasonable
+ * amount of time.
+ */
+ if (i > 50) {
+ WRITE_ONCE(skip, true);
+ break;
+ }
+ }
+
+ return NULL;
+}
+
+void test_timer_lockup(void)
+{
+ int timer1_prog, timer2_prog;
+ struct timer_lockup *skel;
+ pthread_t thrds[2];
+ void *ret;
+
+ skel = timer_lockup__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "timer_lockup__open_and_load"))
+ return;
+
+ timer1_prog = bpf_program__fd(skel->progs.timer1_prog);
+ timer2_prog = bpf_program__fd(skel->progs.timer2_prog);
+
+ timer1_err = &skel->bss->timer1_err;
+ timer2_err = &skel->bss->timer2_err;
+
+ if (!ASSERT_OK(pthread_create(&thrds[0], NULL, timer_lockup_thread,
+ &timer1_prog),
+ "pthread_create thread1"))
+ goto out;
+ if (!ASSERT_OK(pthread_create(&thrds[1], NULL, timer_lockup_thread,
+ &timer2_prog),
+ "pthread_create thread2")) {
+ pthread_exit(&thrds[0]);
+ goto out;
+ }
+
+ pthread_join(thrds[1], &ret);
+ pthread_join(thrds[0], &ret);
+
+ if (skip) {
+ test__skip();
+ goto out;
+ }
+
+ if (*timer1_err != -EDEADLK && *timer1_err != 0)
+ ASSERT_FAIL("timer1_err bad value");
+ if (*timer2_err != -EDEADLK && *timer2_err != 0)
+ ASSERT_FAIL("timer2_err bad value");
+out:
+ timer_lockup__destroy(skel);
+ return;
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/tracing_struct.c b/tools/testing/selftests/bpf/prog_tests/tracing_struct.c
index fe0fb0c9849a..19e68d4b3532 100644
--- a/tools/testing/selftests/bpf/prog_tests/tracing_struct.c
+++ b/tools/testing/selftests/bpf/prog_tests/tracing_struct.c
@@ -3,8 +3,9 @@
#include <test_progs.h>
#include "tracing_struct.skel.h"
+#include "tracing_struct_many_args.skel.h"
-static void test_fentry(void)
+static void test_struct_args(void)
{
struct tracing_struct *skel;
int err;
@@ -55,6 +56,25 @@ static void test_fentry(void)
ASSERT_EQ(skel->bss->t6, 1, "t6 ret");
+destroy_skel:
+ tracing_struct__destroy(skel);
+}
+
+static void test_struct_many_args(void)
+{
+ struct tracing_struct_many_args *skel;
+ int err;
+
+ skel = tracing_struct_many_args__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "tracing_struct_many_args__open_and_load"))
+ return;
+
+ err = tracing_struct_many_args__attach(skel);
+ if (!ASSERT_OK(err, "tracing_struct_many_args__attach"))
+ goto destroy_skel;
+
+ ASSERT_OK(trigger_module_test_read(256), "trigger_read");
+
ASSERT_EQ(skel->bss->t7_a, 16, "t7:a");
ASSERT_EQ(skel->bss->t7_b, 17, "t7:b");
ASSERT_EQ(skel->bss->t7_c, 18, "t7:c");
@@ -74,12 +94,28 @@ static void test_fentry(void)
ASSERT_EQ(skel->bss->t8_g, 23, "t8:g");
ASSERT_EQ(skel->bss->t8_ret, 156, "t8 ret");
- tracing_struct__detach(skel);
+ ASSERT_EQ(skel->bss->t9_a, 16, "t9:a");
+ ASSERT_EQ(skel->bss->t9_b, 17, "t9:b");
+ ASSERT_EQ(skel->bss->t9_c, 18, "t9:c");
+ ASSERT_EQ(skel->bss->t9_d, 19, "t9:d");
+ ASSERT_EQ(skel->bss->t9_e, 20, "t9:e");
+ ASSERT_EQ(skel->bss->t9_f, 21, "t9:f");
+ ASSERT_EQ(skel->bss->t9_g, 22, "t9:f");
+ ASSERT_EQ(skel->bss->t9_h_a, 23, "t9:h.a");
+ ASSERT_EQ(skel->bss->t9_h_b, 24, "t9:h.b");
+ ASSERT_EQ(skel->bss->t9_h_c, 25, "t9:h.c");
+ ASSERT_EQ(skel->bss->t9_h_d, 26, "t9:h.d");
+ ASSERT_EQ(skel->bss->t9_i, 27, "t9:i");
+ ASSERT_EQ(skel->bss->t9_ret, 258, "t9 ret");
+
destroy_skel:
- tracing_struct__destroy(skel);
+ tracing_struct_many_args__destroy(skel);
}
void test_tracing_struct(void)
{
- test_fentry();
+ if (test__start_subtest("struct_args"))
+ test_struct_args();
+ if (test__start_subtest("struct_many_args"))
+ test_struct_many_args();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c b/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c
index 8269cdee33ae..bf6ca8e3eb13 100644
--- a/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c
+++ b/tools/testing/selftests/bpf/prog_tests/uprobe_multi_test.c
@@ -1,12 +1,14 @@
// SPDX-License-Identifier: GPL-2.0
#include <unistd.h>
+#include <pthread.h>
#include <test_progs.h>
#include "uprobe_multi.skel.h"
#include "uprobe_multi_bench.skel.h"
#include "uprobe_multi_usdt.skel.h"
#include "bpf/libbpf_internal.h"
#include "testing_helpers.h"
+#include "../sdt.h"
static char test_data[] = "test_data";
@@ -25,9 +27,17 @@ noinline void uprobe_multi_func_3(void)
asm volatile ("");
}
+noinline void usdt_trigger(void)
+{
+ STAP_PROBE(test, pid_filter_usdt);
+}
+
struct child {
int go[2];
+ int c2p[2]; /* child -> parent channel */
int pid;
+ int tid;
+ pthread_t thread;
};
static void release_child(struct child *child)
@@ -38,6 +48,10 @@ static void release_child(struct child *child)
return;
close(child->go[1]);
close(child->go[0]);
+ if (child->thread)
+ pthread_join(child->thread, NULL);
+ close(child->c2p[0]);
+ close(child->c2p[1]);
if (child->pid > 0)
waitpid(child->pid, &child_status, 0);
}
@@ -63,7 +77,7 @@ static struct child *spawn_child(void)
if (pipe(child.go))
return NULL;
- child.pid = fork();
+ child.pid = child.tid = fork();
if (child.pid < 0) {
release_child(&child);
errno = EINVAL;
@@ -82,6 +96,7 @@ static struct child *spawn_child(void)
uprobe_multi_func_1();
uprobe_multi_func_2();
uprobe_multi_func_3();
+ usdt_trigger();
exit(errno);
}
@@ -89,6 +104,67 @@ static struct child *spawn_child(void)
return &child;
}
+static void *child_thread(void *ctx)
+{
+ struct child *child = ctx;
+ int c = 0, err;
+
+ child->tid = syscall(SYS_gettid);
+
+ /* let parent know we are ready */
+ err = write(child->c2p[1], &c, 1);
+ if (err != 1)
+ pthread_exit(&err);
+
+ /* wait for parent's kick */
+ err = read(child->go[0], &c, 1);
+ if (err != 1)
+ pthread_exit(&err);
+
+ uprobe_multi_func_1();
+ uprobe_multi_func_2();
+ uprobe_multi_func_3();
+ usdt_trigger();
+
+ err = 0;
+ pthread_exit(&err);
+}
+
+static struct child *spawn_thread(void)
+{
+ static struct child child;
+ int c, err;
+
+ /* pipe to notify child to execute the trigger functions */
+ if (pipe(child.go))
+ return NULL;
+ /* pipe to notify parent that child thread is ready */
+ if (pipe(child.c2p)) {
+ close(child.go[0]);
+ close(child.go[1]);
+ return NULL;
+ }
+
+ child.pid = getpid();
+
+ err = pthread_create(&child.thread, NULL, child_thread, &child);
+ if (err) {
+ err = -errno;
+ close(child.go[0]);
+ close(child.go[1]);
+ close(child.c2p[0]);
+ close(child.c2p[1]);
+ errno = -err;
+ return NULL;
+ }
+
+ err = read(child.c2p[0], &c, 1);
+ if (!ASSERT_EQ(err, 1, "child_thread_ready"))
+ return NULL;
+
+ return &child;
+}
+
static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child)
{
skel->bss->uprobe_multi_func_1_addr = (__u64) uprobe_multi_func_1;
@@ -103,15 +179,23 @@ static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child
* passed at the probe attach.
*/
skel->bss->pid = child ? 0 : getpid();
+ skel->bss->expect_pid = child ? child->pid : 0;
+
+ /* trigger all probes, if we are testing child *process*, just to make
+ * sure that PID filtering doesn't let through activations from wrong
+ * PIDs; when we test child *thread*, we don't want to do this to
+ * avoid double counting number of triggering events
+ */
+ if (!child || !child->thread) {
+ uprobe_multi_func_1();
+ uprobe_multi_func_2();
+ uprobe_multi_func_3();
+ usdt_trigger();
+ }
if (child)
kick_child(child);
- /* trigger all probes */
- uprobe_multi_func_1();
- uprobe_multi_func_2();
- uprobe_multi_func_3();
-
/*
* There are 2 entry and 2 exit probe called for each uprobe_multi_func_[123]
* function and each slepable probe (6) increments uprobe_multi_sleep_result.
@@ -126,8 +210,12 @@ static void uprobe_multi_test_run(struct uprobe_multi *skel, struct child *child
ASSERT_EQ(skel->bss->uprobe_multi_sleep_result, 6, "uprobe_multi_sleep_result");
- if (child)
+ ASSERT_FALSE(skel->bss->bad_pid_seen, "bad_pid_seen");
+
+ if (child) {
ASSERT_EQ(skel->bss->child_pid, child->pid, "uprobe_multi_child_pid");
+ ASSERT_EQ(skel->bss->child_tid, child->tid, "uprobe_multi_child_tid");
+ }
}
static void test_skel_api(void)
@@ -190,8 +278,24 @@ __test_attach_api(const char *binary, const char *pattern, struct bpf_uprobe_mul
if (!ASSERT_OK_PTR(skel->links.uprobe_extra, "bpf_program__attach_uprobe_multi"))
goto cleanup;
+ /* Attach (uprobe-backed) USDTs */
+ skel->links.usdt_pid = bpf_program__attach_usdt(skel->progs.usdt_pid, pid, binary,
+ "test", "pid_filter_usdt", NULL);
+ if (!ASSERT_OK_PTR(skel->links.usdt_pid, "attach_usdt_pid"))
+ goto cleanup;
+
+ skel->links.usdt_extra = bpf_program__attach_usdt(skel->progs.usdt_extra, -1, binary,
+ "test", "pid_filter_usdt", NULL);
+ if (!ASSERT_OK_PTR(skel->links.usdt_extra, "attach_usdt_extra"))
+ goto cleanup;
+
uprobe_multi_test_run(skel, child);
+ ASSERT_FALSE(skel->bss->bad_pid_seen_usdt, "bad_pid_seen_usdt");
+ if (child) {
+ ASSERT_EQ(skel->bss->child_pid_usdt, child->pid, "usdt_multi_child_pid");
+ ASSERT_EQ(skel->bss->child_tid_usdt, child->tid, "usdt_multi_child_tid");
+ }
cleanup:
uprobe_multi__destroy(skel);
}
@@ -210,6 +314,13 @@ test_attach_api(const char *binary, const char *pattern, struct bpf_uprobe_multi
return;
__test_attach_api(binary, pattern, opts, child);
+
+ /* pid filter (thread) */
+ child = spawn_thread();
+ if (!ASSERT_OK_PTR(child, "spawn_thread"))
+ return;
+
+ __test_attach_api(binary, pattern, opts, child);
}
static void test_attach_api_pattern(void)
@@ -397,7 +508,7 @@ static void test_attach_api_fails(void)
link_fd = bpf_link_create(prog_fd, 0, BPF_TRACE_UPROBE_MULTI, &opts);
if (!ASSERT_ERR(link_fd, "link_fd"))
goto cleanup;
- ASSERT_EQ(link_fd, -ESRCH, "pid_is_wrong");
+ ASSERT_EQ(link_fd, -EINVAL, "pid_is_wrong");
cleanup:
if (link_fd >= 0)
@@ -495,6 +606,13 @@ static void test_link_api(void)
return;
__test_link_api(child);
+
+ /* pid filter (thread) */
+ child = spawn_thread();
+ if (!ASSERT_OK_PTR(child, "spawn_thread"))
+ return;
+
+ __test_link_api(child);
}
static void test_bench_attach_uprobe(void)
diff --git a/tools/testing/selftests/bpf/prog_tests/verifier.c b/tools/testing/selftests/bpf/prog_tests/verifier.c
index c60db8beeb73..9dc3687bc406 100644
--- a/tools/testing/selftests/bpf/prog_tests/verifier.c
+++ b/tools/testing/selftests/bpf/prog_tests/verifier.c
@@ -53,6 +53,7 @@
#include "verifier_movsx.skel.h"
#include "verifier_netfilter_ctx.skel.h"
#include "verifier_netfilter_retcode.skel.h"
+#include "verifier_or_jmp32_k.skel.h"
#include "verifier_precision.skel.h"
#include "verifier_prevent_map_lookup.skel.h"
#include "verifier_raw_stack.skel.h"
@@ -67,6 +68,7 @@
#include "verifier_search_pruning.skel.h"
#include "verifier_sock.skel.h"
#include "verifier_sock_addr.skel.h"
+#include "verifier_sockmap_mutate.skel.h"
#include "verifier_spill_fill.skel.h"
#include "verifier_spin_lock.skel.h"
#include "verifier_stack_ptr.skel.h"
@@ -85,6 +87,7 @@
#include "verifier_xadd.skel.h"
#include "verifier_xdp.skel.h"
#include "verifier_xdp_direct_packet_access.skel.h"
+#include "verifier_bits_iter.skel.h"
#define MAX_ENTRIES 11
@@ -169,6 +172,7 @@ void test_verifier_meta_access(void) { RUN(verifier_meta_access); }
void test_verifier_movsx(void) { RUN(verifier_movsx); }
void test_verifier_netfilter_ctx(void) { RUN(verifier_netfilter_ctx); }
void test_verifier_netfilter_retcode(void) { RUN(verifier_netfilter_retcode); }
+void test_verifier_or_jmp32_k(void) { RUN(verifier_or_jmp32_k); }
void test_verifier_precision(void) { RUN(verifier_precision); }
void test_verifier_prevent_map_lookup(void) { RUN(verifier_prevent_map_lookup); }
void test_verifier_raw_stack(void) { RUN(verifier_raw_stack); }
@@ -183,6 +187,7 @@ void test_verifier_sdiv(void) { RUN(verifier_sdiv); }
void test_verifier_search_pruning(void) { RUN(verifier_search_pruning); }
void test_verifier_sock(void) { RUN(verifier_sock); }
void test_verifier_sock_addr(void) { RUN(verifier_sock_addr); }
+void test_verifier_sockmap_mutate(void) { RUN(verifier_sockmap_mutate); }
void test_verifier_spill_fill(void) { RUN(verifier_spill_fill); }
void test_verifier_spin_lock(void) { RUN(verifier_spin_lock); }
void test_verifier_stack_ptr(void) { RUN(verifier_stack_ptr); }
@@ -200,6 +205,7 @@ void test_verifier_var_off(void) { RUN(verifier_var_off); }
void test_verifier_xadd(void) { RUN(verifier_xadd); }
void test_verifier_xdp(void) { RUN(verifier_xdp); }
void test_verifier_xdp_direct_packet_access(void) { RUN(verifier_xdp_direct_packet_access); }
+void test_verifier_bits_iter(void) { RUN(verifier_bits_iter); }
static int init_test_val_map(struct bpf_object *obj, char *map_name)
{
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index f09505f8b038..53d6ad8c2257 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -222,7 +222,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
prog = bpf_object__next_program(obj, NULL);
if (bpf_object__load(obj))
- return;
+ goto out;
prog_fd = bpf_program__fd(prog);
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c
new file mode 100644
index 000000000000..e1bf141d3401
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_flowtable.c
@@ -0,0 +1,168 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <test_progs.h>
+#include <network_helpers.h>
+#include <bpf/btf.h>
+#include <linux/if_link.h>
+#include <linux/udp.h>
+#include <net/if.h>
+#include <unistd.h>
+
+#include "xdp_flowtable.skel.h"
+
+#define TX_NETNS_NAME "ns0"
+#define RX_NETNS_NAME "ns1"
+
+#define TX_NAME "v0"
+#define FORWARD_NAME "v1"
+#define RX_NAME "d0"
+
+#define TX_MAC "00:00:00:00:00:01"
+#define FORWARD_MAC "00:00:00:00:00:02"
+#define RX_MAC "00:00:00:00:00:03"
+#define DST_MAC "00:00:00:00:00:04"
+
+#define TX_ADDR "10.0.0.1"
+#define FORWARD_ADDR "10.0.0.2"
+#define RX_ADDR "20.0.0.1"
+#define DST_ADDR "20.0.0.2"
+
+#define PREFIX_LEN "8"
+#define N_PACKETS 10
+#define UDP_PORT 12345
+#define UDP_PORT_STR "12345"
+
+static int send_udp_traffic(void)
+{
+ struct sockaddr_storage addr;
+ int i, sock;
+
+ if (make_sockaddr(AF_INET, DST_ADDR, UDP_PORT, &addr, NULL))
+ return -EINVAL;
+
+ sock = socket(AF_INET, SOCK_DGRAM, 0);
+ if (sock < 0)
+ return sock;
+
+ for (i = 0; i < N_PACKETS; i++) {
+ unsigned char buf[] = { 0xaa, 0xbb, 0xcc };
+ int n;
+
+ n = sendto(sock, buf, sizeof(buf), MSG_NOSIGNAL | MSG_CONFIRM,
+ (struct sockaddr *)&addr, sizeof(addr));
+ if (n != sizeof(buf)) {
+ close(sock);
+ return -EINVAL;
+ }
+
+ usleep(50000); /* 50ms */
+ }
+ close(sock);
+
+ return 0;
+}
+
+void test_xdp_flowtable(void)
+{
+ struct xdp_flowtable *skel = NULL;
+ struct nstoken *tok = NULL;
+ int iifindex, stats_fd;
+ __u32 value, key = 0;
+ struct bpf_link *link;
+
+ if (SYS_NOFAIL("nft -v")) {
+ fprintf(stdout, "Missing required nft tool\n");
+ test__skip();
+ return;
+ }
+
+ SYS(out, "ip netns add " TX_NETNS_NAME);
+ SYS(out, "ip netns add " RX_NETNS_NAME);
+
+ tok = open_netns(RX_NETNS_NAME);
+ if (!ASSERT_OK_PTR(tok, "setns"))
+ goto out;
+
+ SYS(out, "sysctl -qw net.ipv4.conf.all.forwarding=1");
+
+ SYS(out, "ip link add " TX_NAME " type veth peer " FORWARD_NAME);
+ SYS(out, "ip link set " TX_NAME " netns " TX_NETNS_NAME);
+ SYS(out, "ip link set dev " FORWARD_NAME " address " FORWARD_MAC);
+ SYS(out,
+ "ip addr add " FORWARD_ADDR "/" PREFIX_LEN " dev " FORWARD_NAME);
+ SYS(out, "ip link set dev " FORWARD_NAME " up");
+
+ SYS(out, "ip link add " RX_NAME " type dummy");
+ SYS(out, "ip link set dev " RX_NAME " address " RX_MAC);
+ SYS(out, "ip addr add " RX_ADDR "/" PREFIX_LEN " dev " RX_NAME);
+ SYS(out, "ip link set dev " RX_NAME " up");
+
+ /* configure the flowtable */
+ SYS(out, "nft add table ip filter");
+ SYS(out,
+ "nft add flowtable ip filter f { hook ingress priority 0\\; "
+ "devices = { " FORWARD_NAME ", " RX_NAME " }\\; }");
+ SYS(out,
+ "nft add chain ip filter forward "
+ "{ type filter hook forward priority 0\\; }");
+ SYS(out,
+ "nft add rule ip filter forward ip protocol udp th dport "
+ UDP_PORT_STR " flow add @f");
+
+ /* Avoid ARP calls */
+ SYS(out,
+ "ip -4 neigh add " DST_ADDR " lladdr " DST_MAC " dev " RX_NAME);
+
+ close_netns(tok);
+ tok = open_netns(TX_NETNS_NAME);
+ if (!ASSERT_OK_PTR(tok, "setns"))
+ goto out;
+
+ SYS(out, "ip addr add " TX_ADDR "/" PREFIX_LEN " dev " TX_NAME);
+ SYS(out, "ip link set dev " TX_NAME " address " TX_MAC);
+ SYS(out, "ip link set dev " TX_NAME " up");
+ SYS(out, "ip route add default via " FORWARD_ADDR);
+
+ close_netns(tok);
+ tok = open_netns(RX_NETNS_NAME);
+ if (!ASSERT_OK_PTR(tok, "setns"))
+ goto out;
+
+ iifindex = if_nametoindex(FORWARD_NAME);
+ if (!ASSERT_NEQ(iifindex, 0, "iifindex"))
+ goto out;
+
+ skel = xdp_flowtable__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "skel"))
+ goto out;
+
+ link = bpf_program__attach_xdp(skel->progs.xdp_flowtable_do_lookup,
+ iifindex);
+ if (!ASSERT_OK_PTR(link, "prog_attach"))
+ goto out;
+
+ close_netns(tok);
+ tok = open_netns(TX_NETNS_NAME);
+ if (!ASSERT_OK_PTR(tok, "setns"))
+ goto out;
+
+ if (!ASSERT_OK(send_udp_traffic(), "send udp"))
+ goto out;
+
+ close_netns(tok);
+ tok = open_netns(RX_NETNS_NAME);
+ if (!ASSERT_OK_PTR(tok, "setns"))
+ goto out;
+
+ stats_fd = bpf_map__fd(skel->maps.stats);
+ if (!ASSERT_OK(bpf_map_lookup_elem(stats_fd, &key, &value),
+ "bpf_map_update_elem stats"))
+ goto out;
+
+ ASSERT_GE(value, N_PACKETS - 2, "bpf_xdp_flow_lookup failed");
+out:
+ xdp_flowtable__destroy(skel);
+ if (tok)
+ close_netns(tok);
+ SYS_NOFAIL("ip netns del " TX_NETNS_NAME);
+ SYS_NOFAIL("ip netns del " RX_NETNS_NAME);
+}
diff --git a/tools/testing/selftests/bpf/progs/arena_atomics.c b/tools/testing/selftests/bpf/progs/arena_atomics.c
index 55f10563208d..bb0acd79d28a 100644
--- a/tools/testing/selftests/bpf/progs/arena_atomics.c
+++ b/tools/testing/selftests/bpf/progs/arena_atomics.c
@@ -25,20 +25,13 @@ bool skip_tests = true;
__u32 pid = 0;
-#undef __arena
-#if defined(__BPF_FEATURE_ADDR_SPACE_CAST)
-#define __arena __attribute__((address_space(1)))
-#else
-#define __arena SEC(".addr_space.1")
-#endif
-
-__u64 __arena add64_value = 1;
-__u64 __arena add64_result = 0;
-__u32 __arena add32_value = 1;
-__u32 __arena add32_result = 0;
-__u64 __arena add_stack_value_copy = 0;
-__u64 __arena add_stack_result = 0;
-__u64 __arena add_noreturn_value = 1;
+__u64 __arena_global add64_value = 1;
+__u64 __arena_global add64_result = 0;
+__u32 __arena_global add32_value = 1;
+__u32 __arena_global add32_result = 0;
+__u64 __arena_global add_stack_value_copy = 0;
+__u64 __arena_global add_stack_result = 0;
+__u64 __arena_global add_noreturn_value = 1;
SEC("raw_tp/sys_enter")
int add(const void *ctx)
@@ -58,13 +51,13 @@ int add(const void *ctx)
return 0;
}
-__s64 __arena sub64_value = 1;
-__s64 __arena sub64_result = 0;
-__s32 __arena sub32_value = 1;
-__s32 __arena sub32_result = 0;
-__s64 __arena sub_stack_value_copy = 0;
-__s64 __arena sub_stack_result = 0;
-__s64 __arena sub_noreturn_value = 1;
+__s64 __arena_global sub64_value = 1;
+__s64 __arena_global sub64_result = 0;
+__s32 __arena_global sub32_value = 1;
+__s32 __arena_global sub32_result = 0;
+__s64 __arena_global sub_stack_value_copy = 0;
+__s64 __arena_global sub_stack_result = 0;
+__s64 __arena_global sub_noreturn_value = 1;
SEC("raw_tp/sys_enter")
int sub(const void *ctx)
@@ -84,8 +77,8 @@ int sub(const void *ctx)
return 0;
}
-__u64 __arena and64_value = (0x110ull << 32);
-__u32 __arena and32_value = 0x110;
+__u64 __arena_global and64_value = (0x110ull << 32);
+__u32 __arena_global and32_value = 0x110;
SEC("raw_tp/sys_enter")
int and(const void *ctx)
@@ -101,8 +94,8 @@ int and(const void *ctx)
return 0;
}
-__u32 __arena or32_value = 0x110;
-__u64 __arena or64_value = (0x110ull << 32);
+__u32 __arena_global or32_value = 0x110;
+__u64 __arena_global or64_value = (0x110ull << 32);
SEC("raw_tp/sys_enter")
int or(const void *ctx)
@@ -117,8 +110,8 @@ int or(const void *ctx)
return 0;
}
-__u64 __arena xor64_value = (0x110ull << 32);
-__u32 __arena xor32_value = 0x110;
+__u64 __arena_global xor64_value = (0x110ull << 32);
+__u32 __arena_global xor32_value = 0x110;
SEC("raw_tp/sys_enter")
int xor(const void *ctx)
@@ -133,12 +126,12 @@ int xor(const void *ctx)
return 0;
}
-__u32 __arena cmpxchg32_value = 1;
-__u32 __arena cmpxchg32_result_fail = 0;
-__u32 __arena cmpxchg32_result_succeed = 0;
-__u64 __arena cmpxchg64_value = 1;
-__u64 __arena cmpxchg64_result_fail = 0;
-__u64 __arena cmpxchg64_result_succeed = 0;
+__u32 __arena_global cmpxchg32_value = 1;
+__u32 __arena_global cmpxchg32_result_fail = 0;
+__u32 __arena_global cmpxchg32_result_succeed = 0;
+__u64 __arena_global cmpxchg64_value = 1;
+__u64 __arena_global cmpxchg64_result_fail = 0;
+__u64 __arena_global cmpxchg64_result_succeed = 0;
SEC("raw_tp/sys_enter")
int cmpxchg(const void *ctx)
@@ -156,10 +149,10 @@ int cmpxchg(const void *ctx)
return 0;
}
-__u64 __arena xchg64_value = 1;
-__u64 __arena xchg64_result = 0;
-__u32 __arena xchg32_value = 1;
-__u32 __arena xchg32_result = 0;
+__u64 __arena_global xchg64_value = 1;
+__u64 __arena_global xchg64_result = 0;
+__u32 __arena_global xchg32_value = 1;
+__u32 __arena_global xchg32_result = 0;
SEC("raw_tp/sys_enter")
int xchg(const void *ctx)
@@ -176,3 +169,79 @@ int xchg(const void *ctx)
return 0;
}
+
+__u64 __arena_global uaf_sink;
+volatile __u64 __arena_global uaf_recovery_fails;
+
+SEC("syscall")
+int uaf(const void *ctx)
+{
+ if (pid != (bpf_get_current_pid_tgid() >> 32))
+ return 0;
+#if defined(ENABLE_ATOMICS_TESTS) && !defined(__TARGET_ARCH_arm64) && \
+ !defined(__TARGET_ARCH_x86)
+ __u32 __arena *page32;
+ __u64 __arena *page64;
+ void __arena *page;
+
+ page = bpf_arena_alloc_pages(&arena, NULL, 1, NUMA_NO_NODE, 0);
+ bpf_arena_free_pages(&arena, page, 1);
+ uaf_recovery_fails = 24;
+
+ page32 = (__u32 __arena *)page;
+ uaf_sink += __sync_fetch_and_add(page32, 1);
+ uaf_recovery_fails -= 1;
+ __sync_add_and_fetch(page32, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_sub(page32, 1);
+ uaf_recovery_fails -= 1;
+ __sync_sub_and_fetch(page32, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_and(page32, 1);
+ uaf_recovery_fails -= 1;
+ __sync_and_and_fetch(page32, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_or(page32, 1);
+ uaf_recovery_fails -= 1;
+ __sync_or_and_fetch(page32, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_xor(page32, 1);
+ uaf_recovery_fails -= 1;
+ __sync_xor_and_fetch(page32, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_val_compare_and_swap(page32, 0, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_lock_test_and_set(page32, 1);
+ uaf_recovery_fails -= 1;
+
+ page64 = (__u64 __arena *)page;
+ uaf_sink += __sync_fetch_and_add(page64, 1);
+ uaf_recovery_fails -= 1;
+ __sync_add_and_fetch(page64, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_sub(page64, 1);
+ uaf_recovery_fails -= 1;
+ __sync_sub_and_fetch(page64, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_and(page64, 1);
+ uaf_recovery_fails -= 1;
+ __sync_and_and_fetch(page64, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_or(page64, 1);
+ uaf_recovery_fails -= 1;
+ __sync_or_and_fetch(page64, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_fetch_and_xor(page64, 1);
+ uaf_recovery_fails -= 1;
+ __sync_xor_and_fetch(page64, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_val_compare_and_swap(page64, 0, 1);
+ uaf_recovery_fails -= 1;
+ uaf_sink += __sync_lock_test_and_set(page64, 1);
+ uaf_recovery_fails -= 1;
+#endif
+
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/arena_htab.c b/tools/testing/selftests/bpf/progs/arena_htab.c
index 1e6ac187a6a0..81eaa94afeb0 100644
--- a/tools/testing/selftests/bpf/progs/arena_htab.c
+++ b/tools/testing/selftests/bpf/progs/arena_htab.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
@@ -18,25 +19,35 @@ void __arena *htab_for_user;
bool skip = false;
int zero = 0;
+char __arena arr1[100000];
+char arr2[1000];
SEC("syscall")
int arena_htab_llvm(void *ctx)
{
#if defined(__BPF_FEATURE_ADDR_SPACE_CAST) || defined(BPF_ARENA_FORCE_ASM)
struct htab __arena *htab;
+ char __arena *arr = arr1;
__u64 i;
htab = bpf_alloc(sizeof(*htab));
cast_kern(htab);
htab_init(htab);
+ cast_kern(arr);
+
/* first run. No old elems in the table */
- for (i = zero; i < 1000; i++)
+ for (i = zero; i < 100000 && can_loop; i++) {
htab_update_elem(htab, i, i);
+ arr[i] = i;
+ }
- /* should replace all elems with new ones */
- for (i = zero; i < 1000; i++)
+ /* should replace some elems with new ones */
+ for (i = zero; i < 1000 && can_loop; i++) {
htab_update_elem(htab, i, i);
+ /* Access mem to make the verifier use bounded loop logic */
+ arr2[i] = i;
+ }
cast_user(htab);
htab_for_user = htab;
#else
diff --git a/tools/testing/selftests/bpf/progs/arena_list.c b/tools/testing/selftests/bpf/progs/arena_list.c
index 93bd0600eba0..3a2ddcacbea6 100644
--- a/tools/testing/selftests/bpf/progs/arena_list.c
+++ b/tools/testing/selftests/bpf/progs/arena_list.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
diff --git a/tools/testing/selftests/bpf/progs/bpf_dctcp.c b/tools/testing/selftests/bpf/progs/bpf_dctcp.c
index 3c9ffe340312..02f552e7fd4d 100644
--- a/tools/testing/selftests/bpf/progs/bpf_dctcp.c
+++ b/tools/testing/selftests/bpf/progs/bpf_dctcp.c
@@ -65,7 +65,7 @@ static void dctcp_reset(const struct tcp_sock *tp, struct bpf_dctcp *ca)
}
SEC("struct_ops")
-void BPF_PROG(dctcp_init, struct sock *sk)
+void BPF_PROG(bpf_dctcp_init, struct sock *sk)
{
const struct tcp_sock *tp = tcp_sk(sk);
struct bpf_dctcp *ca = inet_csk_ca(sk);
@@ -77,7 +77,7 @@ void BPF_PROG(dctcp_init, struct sock *sk)
(void *)fallback, sizeof(fallback)) == -EBUSY)
ebusy_cnt++;
- /* Switch back to myself and the recurred dctcp_init()
+ /* Switch back to myself and the recurred bpf_dctcp_init()
* will get -EBUSY for all bpf_setsockopt(TCP_CONGESTION),
* except the last "cdg" one.
*/
@@ -112,7 +112,7 @@ void BPF_PROG(dctcp_init, struct sock *sk)
}
SEC("struct_ops")
-__u32 BPF_PROG(dctcp_ssthresh, struct sock *sk)
+__u32 BPF_PROG(bpf_dctcp_ssthresh, struct sock *sk)
{
struct bpf_dctcp *ca = inet_csk_ca(sk);
struct tcp_sock *tp = tcp_sk(sk);
@@ -122,7 +122,7 @@ __u32 BPF_PROG(dctcp_ssthresh, struct sock *sk)
}
SEC("struct_ops")
-void BPF_PROG(dctcp_update_alpha, struct sock *sk, __u32 flags)
+void BPF_PROG(bpf_dctcp_update_alpha, struct sock *sk, __u32 flags)
{
const struct tcp_sock *tp = tcp_sk(sk);
struct bpf_dctcp *ca = inet_csk_ca(sk);
@@ -161,12 +161,12 @@ static void dctcp_react_to_loss(struct sock *sk)
}
SEC("struct_ops")
-void BPF_PROG(dctcp_state, struct sock *sk, __u8 new_state)
+void BPF_PROG(bpf_dctcp_state, struct sock *sk, __u8 new_state)
{
if (new_state == TCP_CA_Recovery &&
new_state != BPF_CORE_READ_BITFIELD(inet_csk(sk), icsk_ca_state))
dctcp_react_to_loss(sk);
- /* We handle RTO in dctcp_cwnd_event to ensure that we perform only
+ /* We handle RTO in bpf_dctcp_cwnd_event to ensure that we perform only
* one loss-adjustment per RTT.
*/
}
@@ -208,7 +208,7 @@ static void dctcp_ece_ack_update(struct sock *sk, enum tcp_ca_event evt,
}
SEC("struct_ops")
-void BPF_PROG(dctcp_cwnd_event, struct sock *sk, enum tcp_ca_event ev)
+void BPF_PROG(bpf_dctcp_cwnd_event, struct sock *sk, enum tcp_ca_event ev)
{
struct bpf_dctcp *ca = inet_csk_ca(sk);
@@ -227,7 +227,7 @@ void BPF_PROG(dctcp_cwnd_event, struct sock *sk, enum tcp_ca_event ev)
}
SEC("struct_ops")
-__u32 BPF_PROG(dctcp_cwnd_undo, struct sock *sk)
+__u32 BPF_PROG(bpf_dctcp_cwnd_undo, struct sock *sk)
{
const struct bpf_dctcp *ca = inet_csk_ca(sk);
@@ -237,28 +237,28 @@ __u32 BPF_PROG(dctcp_cwnd_undo, struct sock *sk)
extern void tcp_reno_cong_avoid(struct sock *sk, __u32 ack, __u32 acked) __ksym;
SEC("struct_ops")
-void BPF_PROG(dctcp_cong_avoid, struct sock *sk, __u32 ack, __u32 acked)
+void BPF_PROG(bpf_dctcp_cong_avoid, struct sock *sk, __u32 ack, __u32 acked)
{
tcp_reno_cong_avoid(sk, ack, acked);
}
SEC(".struct_ops")
struct tcp_congestion_ops dctcp_nouse = {
- .init = (void *)dctcp_init,
- .set_state = (void *)dctcp_state,
+ .init = (void *)bpf_dctcp_init,
+ .set_state = (void *)bpf_dctcp_state,
.flags = TCP_CONG_NEEDS_ECN,
.name = "bpf_dctcp_nouse",
};
SEC(".struct_ops")
struct tcp_congestion_ops dctcp = {
- .init = (void *)dctcp_init,
- .in_ack_event = (void *)dctcp_update_alpha,
- .cwnd_event = (void *)dctcp_cwnd_event,
- .ssthresh = (void *)dctcp_ssthresh,
- .cong_avoid = (void *)dctcp_cong_avoid,
- .undo_cwnd = (void *)dctcp_cwnd_undo,
- .set_state = (void *)dctcp_state,
+ .init = (void *)bpf_dctcp_init,
+ .in_ack_event = (void *)bpf_dctcp_update_alpha,
+ .cwnd_event = (void *)bpf_dctcp_cwnd_event,
+ .ssthresh = (void *)bpf_dctcp_ssthresh,
+ .cong_avoid = (void *)bpf_dctcp_cong_avoid,
+ .undo_cwnd = (void *)bpf_dctcp_cwnd_undo,
+ .set_state = (void *)bpf_dctcp_state,
.flags = TCP_CONG_NEEDS_ECN,
.name = "bpf_dctcp",
};
diff --git a/tools/testing/selftests/bpf/progs/bpf_iter_bpf_array_map.c b/tools/testing/selftests/bpf/progs/bpf_iter_bpf_array_map.c
index c5969ca6f26b..564835ba7d51 100644
--- a/tools/testing/selftests/bpf/progs/bpf_iter_bpf_array_map.c
+++ b/tools/testing/selftests/bpf/progs/bpf_iter_bpf_array_map.c
@@ -6,12 +6,6 @@
char _license[] SEC("license") = "GPL";
-struct key_t {
- int a;
- int b;
- int c;
-};
-
struct {
__uint(type, BPF_MAP_TYPE_ARRAY);
__uint(max_entries, 3);
diff --git a/tools/testing/selftests/bpf/progs/bpf_iter_bpf_percpu_array_map.c b/tools/testing/selftests/bpf/progs/bpf_iter_bpf_percpu_array_map.c
index 85fa710fad90..9f0e0705b2bf 100644
--- a/tools/testing/selftests/bpf/progs/bpf_iter_bpf_percpu_array_map.c
+++ b/tools/testing/selftests/bpf/progs/bpf_iter_bpf_percpu_array_map.c
@@ -6,12 +6,6 @@
char _license[] SEC("license") = "GPL";
-struct key_t {
- int a;
- int b;
- int c;
-};
-
struct {
__uint(type, BPF_MAP_TYPE_PERCPU_ARRAY);
__uint(max_entries, 3);
diff --git a/tools/testing/selftests/bpf/progs/bpf_misc.h b/tools/testing/selftests/bpf/progs/bpf_misc.h
index fb2f5513e29e..81097a3f15eb 100644
--- a/tools/testing/selftests/bpf/progs/bpf_misc.h
+++ b/tools/testing/selftests/bpf/progs/bpf_misc.h
@@ -7,9 +7,9 @@
*
* The test_loader sequentially loads each program in a skeleton.
* Programs could be loaded in privileged and unprivileged modes.
- * - __success, __failure, __msg imply privileged mode;
- * - __success_unpriv, __failure_unpriv, __msg_unpriv imply
- * unprivileged mode.
+ * - __success, __failure, __msg, __regex imply privileged mode;
+ * - __success_unpriv, __failure_unpriv, __msg_unpriv, __regex_unpriv
+ * imply unprivileged mode.
* If combination of privileged and unprivileged attributes is present
* both modes are used. If none are present privileged mode is implied.
*
@@ -24,6 +24,9 @@
* Multiple __msg attributes could be specified.
* __msg_unpriv Same as __msg but for unprivileged mode.
*
+ * __regex Same as __msg, but using a regular expression.
+ * __regex_unpriv Same as __msg_unpriv but using a regular expression.
+ *
* __success Expect program load success in privileged mode.
* __success_unpriv Expect program load success in unprivileged mode.
*
@@ -59,10 +62,12 @@
* __auxiliary_unpriv Same, but load program in unprivileged mode.
*/
#define __msg(msg) __attribute__((btf_decl_tag("comment:test_expect_msg=" msg)))
+#define __regex(regex) __attribute__((btf_decl_tag("comment:test_expect_regex=" regex)))
#define __failure __attribute__((btf_decl_tag("comment:test_expect_failure")))
#define __success __attribute__((btf_decl_tag("comment:test_expect_success")))
#define __description(desc) __attribute__((btf_decl_tag("comment:test_description=" desc)))
#define __msg_unpriv(msg) __attribute__((btf_decl_tag("comment:test_expect_msg_unpriv=" msg)))
+#define __regex_unpriv(regex) __attribute__((btf_decl_tag("comment:test_expect_regex_unpriv=" regex)))
#define __failure_unpriv __attribute__((btf_decl_tag("comment:test_expect_failure_unpriv")))
#define __success_unpriv __attribute__((btf_decl_tag("comment:test_expect_success_unpriv")))
#define __log_level(lvl) __attribute__((btf_decl_tag("comment:test_log_level="#lvl)))
@@ -135,4 +140,8 @@
/* make it look to compiler like value is read and written */
#define __sink(expr) asm volatile("" : "+g"(expr))
+#ifndef ARRAY_SIZE
+#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
+#endif
+
#endif
diff --git a/tools/testing/selftests/bpf/progs/cpumask_success.c b/tools/testing/selftests/bpf/progs/cpumask_success.c
index 7a1e64c6c065..fd8106831c32 100644
--- a/tools/testing/selftests/bpf/progs/cpumask_success.c
+++ b/tools/testing/selftests/bpf/progs/cpumask_success.c
@@ -12,6 +12,31 @@ char _license[] SEC("license") = "GPL";
int pid, nr_cpus;
+struct kptr_nested {
+ struct bpf_cpumask __kptr * mask;
+};
+
+struct kptr_nested_pair {
+ struct bpf_cpumask __kptr * mask_1;
+ struct bpf_cpumask __kptr * mask_2;
+};
+
+struct kptr_nested_mid {
+ int dummy;
+ struct kptr_nested m;
+};
+
+struct kptr_nested_deep {
+ struct kptr_nested_mid ptrs[2];
+ struct kptr_nested_pair ptr_pairs[3];
+};
+
+private(MASK) static struct bpf_cpumask __kptr * global_mask_array[2];
+private(MASK) static struct bpf_cpumask __kptr * global_mask_array_l2[2][1];
+private(MASK) static struct bpf_cpumask __kptr * global_mask_array_one[1];
+private(MASK) static struct kptr_nested global_mask_nested[2];
+private(MASK_DEEP) static struct kptr_nested_deep global_mask_nested_deep;
+
static bool is_test_task(void)
{
int cur_pid = bpf_get_current_pid_tgid() >> 32;
@@ -461,6 +486,152 @@ int BPF_PROG(test_global_mask_rcu, struct task_struct *task, u64 clone_flags)
}
SEC("tp_btf/task_newtask")
+int BPF_PROG(test_global_mask_array_one_rcu, struct task_struct *task, u64 clone_flags)
+{
+ struct bpf_cpumask *local, *prev;
+
+ if (!is_test_task())
+ return 0;
+
+ /* Kptr arrays with one element are special cased, being treated
+ * just like a single pointer.
+ */
+
+ local = create_cpumask();
+ if (!local)
+ return 0;
+
+ prev = bpf_kptr_xchg(&global_mask_array_one[0], local);
+ if (prev) {
+ bpf_cpumask_release(prev);
+ err = 3;
+ return 0;
+ }
+
+ bpf_rcu_read_lock();
+ local = global_mask_array_one[0];
+ if (!local) {
+ err = 4;
+ bpf_rcu_read_unlock();
+ return 0;
+ }
+
+ bpf_rcu_read_unlock();
+
+ return 0;
+}
+
+static int _global_mask_array_rcu(struct bpf_cpumask **mask0,
+ struct bpf_cpumask **mask1)
+{
+ struct bpf_cpumask *local;
+
+ if (!is_test_task())
+ return 0;
+
+ /* Check if two kptrs in the array work and independently */
+
+ local = create_cpumask();
+ if (!local)
+ return 0;
+
+ bpf_rcu_read_lock();
+
+ local = bpf_kptr_xchg(mask0, local);
+ if (local) {
+ err = 1;
+ goto err_exit;
+ }
+
+ /* [<mask 0>, NULL] */
+ if (!*mask0 || *mask1) {
+ err = 2;
+ goto err_exit;
+ }
+
+ local = create_cpumask();
+ if (!local) {
+ err = 9;
+ goto err_exit;
+ }
+
+ local = bpf_kptr_xchg(mask1, local);
+ if (local) {
+ err = 10;
+ goto err_exit;
+ }
+
+ /* [<mask 0>, <mask 1>] */
+ if (!*mask0 || !*mask1 || *mask0 == *mask1) {
+ err = 11;
+ goto err_exit;
+ }
+
+err_exit:
+ if (local)
+ bpf_cpumask_release(local);
+ bpf_rcu_read_unlock();
+ return 0;
+}
+
+SEC("tp_btf/task_newtask")
+int BPF_PROG(test_global_mask_array_rcu, struct task_struct *task, u64 clone_flags)
+{
+ return _global_mask_array_rcu(&global_mask_array[0], &global_mask_array[1]);
+}
+
+SEC("tp_btf/task_newtask")
+int BPF_PROG(test_global_mask_array_l2_rcu, struct task_struct *task, u64 clone_flags)
+{
+ return _global_mask_array_rcu(&global_mask_array_l2[0][0], &global_mask_array_l2[1][0]);
+}
+
+SEC("tp_btf/task_newtask")
+int BPF_PROG(test_global_mask_nested_rcu, struct task_struct *task, u64 clone_flags)
+{
+ return _global_mask_array_rcu(&global_mask_nested[0].mask, &global_mask_nested[1].mask);
+}
+
+/* Ensure that the field->offset has been correctly advanced from one
+ * nested struct or array sub-tree to another. In the case of
+ * kptr_nested_deep, it comprises two sub-trees: ktpr_1 and kptr_2. By
+ * calling bpf_kptr_xchg() on every single kptr in both nested sub-trees,
+ * the verifier should reject the program if the field->offset of any kptr
+ * is incorrect.
+ *
+ * For instance, if we have 10 kptrs in a nested struct and a program that
+ * accesses each kptr individually with bpf_kptr_xchg(), the compiler
+ * should emit instructions to access 10 different offsets if it works
+ * correctly. If the field->offset values of any pair of them are
+ * incorrectly the same, the number of unique offsets in btf_record for
+ * this nested struct should be less than 10. The verifier should fail to
+ * discover some of the offsets emitted by the compiler.
+ *
+ * Even if the field->offset values of kptrs are not duplicated, the
+ * verifier should fail to find a btf_field for the instruction accessing a
+ * kptr if the corresponding field->offset is pointing to a random
+ * incorrect offset.
+ */
+SEC("tp_btf/task_newtask")
+int BPF_PROG(test_global_mask_nested_deep_rcu, struct task_struct *task, u64 clone_flags)
+{
+ int r, i;
+
+ r = _global_mask_array_rcu(&global_mask_nested_deep.ptrs[0].m.mask,
+ &global_mask_nested_deep.ptrs[1].m.mask);
+ if (r)
+ return r;
+
+ for (i = 0; i < 3; i++) {
+ r = _global_mask_array_rcu(&global_mask_nested_deep.ptr_pairs[i].mask_1,
+ &global_mask_nested_deep.ptr_pairs[i].mask_2);
+ if (r)
+ return r;
+ }
+ return 0;
+}
+
+SEC("tp_btf/task_newtask")
int BPF_PROG(test_cpumask_weight, struct task_struct *task, u64 clone_flags)
{
struct bpf_cpumask *local;
diff --git a/tools/testing/selftests/bpf/progs/crypto_bench.c b/tools/testing/selftests/bpf/progs/crypto_bench.c
index e61fe0882293..4ac956b26240 100644
--- a/tools/testing/selftests/bpf/progs/crypto_bench.c
+++ b/tools/testing/selftests/bpf/progs/crypto_bench.c
@@ -57,7 +57,7 @@ int crypto_encrypt(struct __sk_buff *skb)
{
struct __crypto_ctx_value *v;
struct bpf_crypto_ctx *ctx;
- struct bpf_dynptr psrc, pdst, iv;
+ struct bpf_dynptr psrc, pdst;
v = crypto_ctx_value_lookup();
if (!v) {
@@ -73,9 +73,8 @@ int crypto_encrypt(struct __sk_buff *skb)
bpf_dynptr_from_skb(skb, 0, &psrc);
bpf_dynptr_from_mem(dst, len, 0, &pdst);
- bpf_dynptr_from_mem(dst, 0, 0, &iv);
- status = bpf_crypto_encrypt(ctx, &psrc, &pdst, &iv);
+ status = bpf_crypto_encrypt(ctx, &psrc, &pdst, NULL);
__sync_add_and_fetch(&hits, 1);
return 0;
@@ -84,7 +83,7 @@ int crypto_encrypt(struct __sk_buff *skb)
SEC("tc")
int crypto_decrypt(struct __sk_buff *skb)
{
- struct bpf_dynptr psrc, pdst, iv;
+ struct bpf_dynptr psrc, pdst;
struct __crypto_ctx_value *v;
struct bpf_crypto_ctx *ctx;
@@ -98,9 +97,8 @@ int crypto_decrypt(struct __sk_buff *skb)
bpf_dynptr_from_skb(skb, 0, &psrc);
bpf_dynptr_from_mem(dst, len, 0, &pdst);
- bpf_dynptr_from_mem(dst, 0, 0, &iv);
- status = bpf_crypto_decrypt(ctx, &psrc, &pdst, &iv);
+ status = bpf_crypto_decrypt(ctx, &psrc, &pdst, NULL);
__sync_add_and_fetch(&hits, 1);
return 0;
diff --git a/tools/testing/selftests/bpf/progs/crypto_sanity.c b/tools/testing/selftests/bpf/progs/crypto_sanity.c
index 1be0a3fa5efd..645be6cddf36 100644
--- a/tools/testing/selftests/bpf/progs/crypto_sanity.c
+++ b/tools/testing/selftests/bpf/progs/crypto_sanity.c
@@ -89,7 +89,7 @@ int decrypt_sanity(struct __sk_buff *skb)
{
struct __crypto_ctx_value *v;
struct bpf_crypto_ctx *ctx;
- struct bpf_dynptr psrc, pdst, iv;
+ struct bpf_dynptr psrc, pdst;
int err;
err = skb_dynptr_validate(skb, &psrc);
@@ -114,12 +114,8 @@ int decrypt_sanity(struct __sk_buff *skb)
* production code, a percpu map should be used to store the result.
*/
bpf_dynptr_from_mem(dst, sizeof(dst), 0, &pdst);
- /* iv dynptr has to be initialized with 0 size, but proper memory region
- * has to be provided anyway
- */
- bpf_dynptr_from_mem(dst, 0, 0, &iv);
- status = bpf_crypto_decrypt(ctx, &psrc, &pdst, &iv);
+ status = bpf_crypto_decrypt(ctx, &psrc, &pdst, NULL);
return TC_ACT_SHOT;
}
@@ -129,7 +125,7 @@ int encrypt_sanity(struct __sk_buff *skb)
{
struct __crypto_ctx_value *v;
struct bpf_crypto_ctx *ctx;
- struct bpf_dynptr psrc, pdst, iv;
+ struct bpf_dynptr psrc, pdst;
int err;
status = 0;
@@ -156,12 +152,8 @@ int encrypt_sanity(struct __sk_buff *skb)
* production code, a percpu map should be used to store the result.
*/
bpf_dynptr_from_mem(dst, sizeof(dst), 0, &pdst);
- /* iv dynptr has to be initialized with 0 size, but proper memory region
- * has to be provided anyway
- */
- bpf_dynptr_from_mem(dst, 0, 0, &iv);
- status = bpf_crypto_encrypt(ctx, &psrc, &pdst, &iv);
+ status = bpf_crypto_encrypt(ctx, &psrc, &pdst, NULL);
return TC_ACT_SHOT;
}
diff --git a/tools/testing/selftests/bpf/progs/dynptr_fail.c b/tools/testing/selftests/bpf/progs/dynptr_fail.c
index 66a60bfb5867..e35bc1eac52a 100644
--- a/tools/testing/selftests/bpf/progs/dynptr_fail.c
+++ b/tools/testing/selftests/bpf/progs/dynptr_fail.c
@@ -964,7 +964,7 @@ int dynptr_invalidate_slice_reinit(void *ctx)
* mem_or_null pointers.
*/
SEC("?raw_tp")
-__failure __msg("R1 type=scalar expected=percpu_ptr_")
+__failure __regex("R[0-9]+ type=scalar expected=percpu_ptr_")
int dynptr_invalidate_slice_or_null(void *ctx)
{
struct bpf_dynptr ptr;
@@ -982,7 +982,7 @@ int dynptr_invalidate_slice_or_null(void *ctx)
/* Destruction of dynptr should also any slices obtained from it */
SEC("?raw_tp")
-__failure __msg("R7 invalid mem access 'scalar'")
+__failure __regex("R[0-9]+ invalid mem access 'scalar'")
int dynptr_invalidate_slice_failure(void *ctx)
{
struct bpf_dynptr ptr1;
@@ -1069,7 +1069,7 @@ int dynptr_read_into_slot(void *ctx)
/* bpf_dynptr_slice()s are read-only and cannot be written to */
SEC("?tc")
-__failure __msg("R0 cannot write into rdonly_mem")
+__failure __regex("R[0-9]+ cannot write into rdonly_mem")
int skb_invalid_slice_write(struct __sk_buff *skb)
{
struct bpf_dynptr ptr;
@@ -1686,3 +1686,27 @@ int test_dynptr_skb_small_buff(struct __sk_buff *skb)
return !!data;
}
+
+__noinline long global_call_bpf_dynptr(const struct bpf_dynptr *dynptr)
+{
+ long ret = 0;
+ /* Avoid leaving this global function empty to avoid having the compiler
+ * optimize away the call to this global function.
+ */
+ __sink(ret);
+ return ret;
+}
+
+SEC("?raw_tp")
+__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
+int test_dynptr_reg_type(void *ctx)
+{
+ struct task_struct *current = NULL;
+ /* R1 should be holding a PTR_TO_BTF_ID, so this shouldn't be a
+ * reg->type that can be passed to a function accepting a
+ * ARG_PTR_TO_DYNPTR | MEM_RDONLY. process_dynptr_func() should catch
+ * this.
+ */
+ global_call_bpf_dynptr((const struct bpf_dynptr *)current);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/get_func_ip_test.c b/tools/testing/selftests/bpf/progs/get_func_ip_test.c
index 8956eb78a226..2011cacdeb18 100644
--- a/tools/testing/selftests/bpf/progs/get_func_ip_test.c
+++ b/tools/testing/selftests/bpf/progs/get_func_ip_test.c
@@ -5,13 +5,12 @@
char _license[] SEC("license") = "GPL";
-extern const void bpf_fentry_test1 __ksym;
+extern int bpf_fentry_test1(int a) __ksym;
+extern int bpf_modify_return_test(int a, int *b) __ksym;
+
extern const void bpf_fentry_test2 __ksym;
extern const void bpf_fentry_test3 __ksym;
extern const void bpf_fentry_test4 __ksym;
-extern const void bpf_modify_return_test __ksym;
-extern const void bpf_fentry_test6 __ksym;
-extern const void bpf_fentry_test7 __ksym;
extern bool CONFIG_X86_KERNEL_IBT __kconfig __weak;
diff --git a/tools/testing/selftests/bpf/progs/ip_check_defrag.c b/tools/testing/selftests/bpf/progs/ip_check_defrag.c
index 1c2b6c1616b0..645b2c9f7867 100644
--- a/tools/testing/selftests/bpf/progs/ip_check_defrag.c
+++ b/tools/testing/selftests/bpf/progs/ip_check_defrag.c
@@ -12,7 +12,7 @@
#define IP_OFFSET 0x1FFF
#define NEXTHDR_FRAGMENT 44
-extern int bpf_dynptr_from_skb(struct sk_buff *skb, __u64 flags,
+extern int bpf_dynptr_from_skb(struct __sk_buff *skb, __u64 flags,
struct bpf_dynptr *ptr__uninit) __ksym;
extern void *bpf_dynptr_slice(const struct bpf_dynptr *ptr, uint32_t offset,
void *buffer, uint32_t buffer__sz) __ksym;
@@ -42,7 +42,7 @@ static bool is_frag_v6(struct ipv6hdr *ip6h)
return ip6h->nexthdr == NEXTHDR_FRAGMENT;
}
-static int handle_v4(struct sk_buff *skb)
+static int handle_v4(struct __sk_buff *skb)
{
struct bpf_dynptr ptr;
u8 iph_buf[20] = {};
@@ -64,7 +64,7 @@ static int handle_v4(struct sk_buff *skb)
return NF_ACCEPT;
}
-static int handle_v6(struct sk_buff *skb)
+static int handle_v6(struct __sk_buff *skb)
{
struct bpf_dynptr ptr;
struct ipv6hdr *ip6h;
@@ -89,9 +89,9 @@ static int handle_v6(struct sk_buff *skb)
SEC("netfilter")
int defrag(struct bpf_nf_ctx *ctx)
{
- struct sk_buff *skb = ctx->skb;
+ struct __sk_buff *skb = (struct __sk_buff *)ctx->skb;
- switch (bpf_ntohs(skb->protocol)) {
+ switch (bpf_ntohs(ctx->skb->protocol)) {
case ETH_P_IP:
return handle_v4(skb);
case ETH_P_IPV6:
diff --git a/tools/testing/selftests/bpf/progs/iters.c b/tools/testing/selftests/bpf/progs/iters.c
index fe65e0952a1e..16bdc3e25591 100644
--- a/tools/testing/selftests/bpf/progs/iters.c
+++ b/tools/testing/selftests/bpf/progs/iters.c
@@ -7,8 +7,6 @@
#include "bpf_misc.h"
#include "bpf_compiler.h"
-#define ARRAY_SIZE(x) (int)(sizeof(x) / sizeof((x)[0]))
-
static volatile int zero = 0;
int my_pid;
diff --git a/tools/testing/selftests/bpf/progs/kfunc_call_test.c b/tools/testing/selftests/bpf/progs/kfunc_call_test.c
index cf68d1e48a0f..f502f755f567 100644
--- a/tools/testing/selftests/bpf/progs/kfunc_call_test.c
+++ b/tools/testing/selftests/bpf/progs/kfunc_call_test.c
@@ -177,4 +177,41 @@ int kfunc_call_test_static_unused_arg(struct __sk_buff *skb)
return actual != expected ? -1 : 0;
}
+struct ctx_val {
+ struct bpf_testmod_ctx __kptr *ctx;
+};
+
+struct {
+ __uint(type, BPF_MAP_TYPE_ARRAY);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, struct ctx_val);
+} ctx_map SEC(".maps");
+
+SEC("tc")
+int kfunc_call_ctx(struct __sk_buff *skb)
+{
+ struct bpf_testmod_ctx *ctx;
+ int err = 0;
+
+ ctx = bpf_testmod_ctx_create(&err);
+ if (!ctx && !err)
+ err = -1;
+ if (ctx) {
+ int key = 0;
+ struct ctx_val *ctx_val = bpf_map_lookup_elem(&ctx_map, &key);
+
+ /* Transfer ctx to map to be freed via implicit dtor call
+ * on cleanup.
+ */
+ if (ctx_val)
+ ctx = bpf_kptr_xchg(&ctx_val->ctx, ctx);
+ if (ctx) {
+ bpf_testmod_ctx_release(ctx);
+ err = -1;
+ }
+ }
+ return err;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/kprobe_multi_session.c b/tools/testing/selftests/bpf/progs/kprobe_multi_session.c
index bbba9eb46551..bd8b7fb7061e 100644
--- a/tools/testing/selftests/bpf/progs/kprobe_multi_session.c
+++ b/tools/testing/selftests/bpf/progs/kprobe_multi_session.c
@@ -4,8 +4,7 @@
#include <bpf/bpf_tracing.h>
#include <stdbool.h>
#include "bpf_kfuncs.h"
-
-#define ARRAY_SIZE(x) (int)(sizeof(x) / sizeof((x)[0]))
+#include "bpf_misc.h"
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/kprobe_multi_session_cookie.c b/tools/testing/selftests/bpf/progs/kprobe_multi_session_cookie.c
index d49070803e22..0835b5edf685 100644
--- a/tools/testing/selftests/bpf/progs/kprobe_multi_session_cookie.c
+++ b/tools/testing/selftests/bpf/progs/kprobe_multi_session_cookie.c
@@ -25,7 +25,7 @@ int BPF_PROG(trigger)
static int check_cookie(__u64 val, __u64 *result)
{
- long *cookie;
+ __u64 *cookie;
if (bpf_get_current_pid_tgid() >> 32 != pid)
return 1;
diff --git a/tools/testing/selftests/bpf/progs/linked_list.c b/tools/testing/selftests/bpf/progs/linked_list.c
index 26205ca80679..421f40835acd 100644
--- a/tools/testing/selftests/bpf/progs/linked_list.c
+++ b/tools/testing/selftests/bpf/progs/linked_list.c
@@ -4,13 +4,26 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_core_read.h>
#include "bpf_experimental.h"
-
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (int)(sizeof(x) / sizeof((x)[0]))
-#endif
+#include "bpf_misc.h"
#include "linked_list.h"
+struct head_nested_inner {
+ struct bpf_spin_lock lock;
+ struct bpf_list_head head __contains(foo, node2);
+};
+
+struct head_nested {
+ int dummy;
+ struct head_nested_inner inner;
+};
+
+private(C) struct bpf_spin_lock glock_c;
+private(C) struct bpf_list_head ghead_array[2] __contains(foo, node2);
+private(C) struct bpf_list_head ghead_array_one[1] __contains(foo, node2);
+
+private(D) struct head_nested ghead_nested;
+
static __always_inline
int list_push_pop(struct bpf_spin_lock *lock, struct bpf_list_head *head, bool leave_in_map)
{
@@ -310,6 +323,32 @@ int global_list_push_pop(void *ctx)
}
SEC("tc")
+int global_list_push_pop_nested(void *ctx)
+{
+ return test_list_push_pop(&ghead_nested.inner.lock, &ghead_nested.inner.head);
+}
+
+SEC("tc")
+int global_list_array_push_pop(void *ctx)
+{
+ int r;
+
+ r = test_list_push_pop(&glock_c, &ghead_array[0]);
+ if (r)
+ return r;
+
+ r = test_list_push_pop(&glock_c, &ghead_array[1]);
+ if (r)
+ return r;
+
+ /* Arrays with only one element is a special case, being treated
+ * just like a bpf_list_head variable by the verifier, not an
+ * array.
+ */
+ return test_list_push_pop(&glock_c, &ghead_array_one[0]);
+}
+
+SEC("tc")
int map_list_push_pop_multiple(void *ctx)
{
struct map_value *v;
diff --git a/tools/testing/selftests/bpf/progs/map_percpu_stats.c b/tools/testing/selftests/bpf/progs/map_percpu_stats.c
index 10b2325c1720..63245785eb69 100644
--- a/tools/testing/selftests/bpf/progs/map_percpu_stats.c
+++ b/tools/testing/selftests/bpf/progs/map_percpu_stats.c
@@ -7,7 +7,7 @@
__u32 target_id;
-__s64 bpf_map_sum_elem_count(struct bpf_map *map) __ksym;
+__s64 bpf_map_sum_elem_count(const struct bpf_map *map) __ksym;
SEC("iter/bpf_map")
int dump_bpf_map(struct bpf_iter__bpf_map *ctx)
diff --git a/tools/testing/selftests/bpf/progs/nested_trust_common.h b/tools/testing/selftests/bpf/progs/nested_trust_common.h
index 83d33931136e..1784b496be2e 100644
--- a/tools/testing/selftests/bpf/progs/nested_trust_common.h
+++ b/tools/testing/selftests/bpf/progs/nested_trust_common.h
@@ -7,6 +7,6 @@
#include <stdbool.h>
bool bpf_cpumask_test_cpu(unsigned int cpu, const struct cpumask *cpumask) __ksym;
-bool bpf_cpumask_first_zero(const struct cpumask *cpumask) __ksym;
+__u32 bpf_cpumask_first_zero(const struct cpumask *cpumask) __ksym;
#endif /* _NESTED_TRUST_COMMON_H */
diff --git a/tools/testing/selftests/bpf/progs/nested_trust_failure.c b/tools/testing/selftests/bpf/progs/nested_trust_failure.c
index ea39497f11ed..3568ec450100 100644
--- a/tools/testing/selftests/bpf/progs/nested_trust_failure.c
+++ b/tools/testing/selftests/bpf/progs/nested_trust_failure.c
@@ -31,14 +31,6 @@ int BPF_PROG(test_invalid_nested_user_cpus, struct task_struct *task, u64 clone_
return 0;
}
-SEC("tp_btf/task_newtask")
-__failure __msg("R1 must have zero offset when passed to release func or trusted arg to kfunc")
-int BPF_PROG(test_invalid_nested_offset, struct task_struct *task, u64 clone_flags)
-{
- bpf_cpumask_first_zero(&task->cpus_mask);
- return 0;
-}
-
/* Although R2 is of type sk_buff but sock_common is expected, we will hit untrusted ptr first. */
SEC("tp_btf/tcp_probe")
__failure __msg("R2 type=untrusted_ptr_ expected=ptr_, trusted_ptr_, rcu_ptr_")
diff --git a/tools/testing/selftests/bpf/progs/nested_trust_success.c b/tools/testing/selftests/bpf/progs/nested_trust_success.c
index 833840bffd3b..2b66953ca82e 100644
--- a/tools/testing/selftests/bpf/progs/nested_trust_success.c
+++ b/tools/testing/selftests/bpf/progs/nested_trust_success.c
@@ -32,3 +32,11 @@ int BPF_PROG(test_skb_field, struct sock *sk, struct sk_buff *skb)
bpf_sk_storage_get(&sk_storage_map, skb->sk, 0, 0);
return 0;
}
+
+SEC("tp_btf/task_newtask")
+__success
+int BPF_PROG(test_nested_offset, struct task_struct *task, u64 clone_flags)
+{
+ bpf_cpumask_first_zero(&task->cpus_mask);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/netif_receive_skb.c b/tools/testing/selftests/bpf/progs/netif_receive_skb.c
index c0062645fc68..9e067dcbf607 100644
--- a/tools/testing/selftests/bpf/progs/netif_receive_skb.c
+++ b/tools/testing/selftests/bpf/progs/netif_receive_skb.c
@@ -5,6 +5,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_core_read.h>
+#include "bpf_misc.h"
#include <errno.h>
@@ -23,10 +24,6 @@ bool skip = false;
#define BADPTR 0
#endif
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
-
struct {
__uint(type, BPF_MAP_TYPE_PERCPU_ARRAY);
__uint(max_entries, 1);
diff --git a/tools/testing/selftests/bpf/progs/profiler.inc.h b/tools/testing/selftests/bpf/progs/profiler.inc.h
index 6957d9f2805e..8bd1ebd7d6af 100644
--- a/tools/testing/selftests/bpf/progs/profiler.inc.h
+++ b/tools/testing/selftests/bpf/progs/profiler.inc.h
@@ -9,6 +9,7 @@
#include "err.h"
#include "bpf_experimental.h"
#include "bpf_compiler.h"
+#include "bpf_misc.h"
#ifndef NULL
#define NULL 0
@@ -133,10 +134,6 @@ struct {
__uint(max_entries, 16);
} disallowed_exec_inodes SEC(".maps");
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(arr) (int)(sizeof(arr) / sizeof(arr[0]))
-#endif
-
static INLINE bool IS_ERR(const void* ptr)
{
return IS_ERR_VALUE((unsigned long)ptr);
diff --git a/tools/testing/selftests/bpf/progs/rbtree.c b/tools/testing/selftests/bpf/progs/rbtree.c
index b09f4fffe57c..a3620c15c136 100644
--- a/tools/testing/selftests/bpf/progs/rbtree.c
+++ b/tools/testing/selftests/bpf/progs/rbtree.c
@@ -13,6 +13,15 @@ struct node_data {
struct bpf_rb_node node;
};
+struct root_nested_inner {
+ struct bpf_spin_lock glock;
+ struct bpf_rb_root root __contains(node_data, node);
+};
+
+struct root_nested {
+ struct root_nested_inner inner;
+};
+
long less_callback_ran = -1;
long removed_key = -1;
long first_data[2] = {-1, -1};
@@ -20,6 +29,9 @@ long first_data[2] = {-1, -1};
#define private(name) SEC(".data." #name) __hidden __attribute__((aligned(8)))
private(A) struct bpf_spin_lock glock;
private(A) struct bpf_rb_root groot __contains(node_data, node);
+private(A) struct bpf_rb_root groot_array[2] __contains(node_data, node);
+private(A) struct bpf_rb_root groot_array_one[1] __contains(node_data, node);
+private(B) struct root_nested groot_nested;
static bool less(struct bpf_rb_node *a, const struct bpf_rb_node *b)
{
@@ -72,6 +84,12 @@ long rbtree_add_nodes(void *ctx)
}
SEC("tc")
+long rbtree_add_nodes_nested(void *ctx)
+{
+ return __add_three(&groot_nested.inner.root, &groot_nested.inner.glock);
+}
+
+SEC("tc")
long rbtree_add_and_remove(void *ctx)
{
struct bpf_rb_node *res = NULL;
@@ -110,6 +128,65 @@ err_out:
}
SEC("tc")
+long rbtree_add_and_remove_array(void *ctx)
+{
+ struct bpf_rb_node *res1 = NULL, *res2 = NULL, *res3 = NULL;
+ struct node_data *nodes[3][2] = {{NULL, NULL}, {NULL, NULL}, {NULL, NULL}};
+ struct node_data *n;
+ long k1 = -1, k2 = -1, k3 = -1;
+ int i, j;
+
+ for (i = 0; i < 3; i++) {
+ for (j = 0; j < 2; j++) {
+ nodes[i][j] = bpf_obj_new(typeof(*nodes[i][j]));
+ if (!nodes[i][j])
+ goto err_out;
+ nodes[i][j]->key = i * 2 + j;
+ }
+ }
+
+ bpf_spin_lock(&glock);
+ for (i = 0; i < 2; i++)
+ for (j = 0; j < 2; j++)
+ bpf_rbtree_add(&groot_array[i], &nodes[i][j]->node, less);
+ for (j = 0; j < 2; j++)
+ bpf_rbtree_add(&groot_array_one[0], &nodes[2][j]->node, less);
+ res1 = bpf_rbtree_remove(&groot_array[0], &nodes[0][0]->node);
+ res2 = bpf_rbtree_remove(&groot_array[1], &nodes[1][0]->node);
+ res3 = bpf_rbtree_remove(&groot_array_one[0], &nodes[2][0]->node);
+ bpf_spin_unlock(&glock);
+
+ if (res1) {
+ n = container_of(res1, struct node_data, node);
+ k1 = n->key;
+ bpf_obj_drop(n);
+ }
+ if (res2) {
+ n = container_of(res2, struct node_data, node);
+ k2 = n->key;
+ bpf_obj_drop(n);
+ }
+ if (res3) {
+ n = container_of(res3, struct node_data, node);
+ k3 = n->key;
+ bpf_obj_drop(n);
+ }
+ if (k1 != 0 || k2 != 2 || k3 != 4)
+ return 2;
+
+ return 0;
+
+err_out:
+ for (i = 0; i < 3; i++) {
+ for (j = 0; j < 2; j++) {
+ if (nodes[i][j])
+ bpf_obj_drop(nodes[i][j]);
+ }
+ }
+ return 1;
+}
+
+SEC("tc")
long rbtree_first_and_remove(void *ctx)
{
struct bpf_rb_node *res = NULL;
diff --git a/tools/testing/selftests/bpf/progs/rbtree_fail.c b/tools/testing/selftests/bpf/progs/rbtree_fail.c
index 3fecf1c6dfe5..b722a1e1ddef 100644
--- a/tools/testing/selftests/bpf/progs/rbtree_fail.c
+++ b/tools/testing/selftests/bpf/progs/rbtree_fail.c
@@ -105,7 +105,7 @@ long rbtree_api_remove_unadded_node(void *ctx)
}
SEC("?tc")
-__failure __msg("Unreleased reference id=3 alloc_insn=10")
+__failure __regex("Unreleased reference id=3 alloc_insn=[0-9]+")
long rbtree_api_remove_no_drop(void *ctx)
{
struct bpf_rb_node *res;
diff --git a/tools/testing/selftests/bpf/progs/refcounted_kptr_fail.c b/tools/testing/selftests/bpf/progs/refcounted_kptr_fail.c
index 1553b9c16aa7..f8d4b7cfcd68 100644
--- a/tools/testing/selftests/bpf/progs/refcounted_kptr_fail.c
+++ b/tools/testing/selftests/bpf/progs/refcounted_kptr_fail.c
@@ -32,7 +32,7 @@ static bool less(struct bpf_rb_node *a, const struct bpf_rb_node *b)
}
SEC("?tc")
-__failure __msg("Unreleased reference id=4 alloc_insn=21")
+__failure __regex("Unreleased reference id=4 alloc_insn=[0-9]+")
long rbtree_refcounted_node_ref_escapes(void *ctx)
{
struct node_acquire *n, *m;
@@ -73,7 +73,7 @@ long refcount_acquire_maybe_null(void *ctx)
}
SEC("?tc")
-__failure __msg("Unreleased reference id=3 alloc_insn=9")
+__failure __regex("Unreleased reference id=3 alloc_insn=[0-9]+")
long rbtree_refcounted_node_ref_escapes_owning_input(void *ctx)
{
struct node_acquire *n, *m;
diff --git a/tools/testing/selftests/bpf/progs/setget_sockopt.c b/tools/testing/selftests/bpf/progs/setget_sockopt.c
index 7a438600ae98..60518aed1ffc 100644
--- a/tools/testing/selftests/bpf/progs/setget_sockopt.c
+++ b/tools/testing/selftests/bpf/progs/setget_sockopt.c
@@ -6,10 +6,7 @@
#include <bpf/bpf_core_read.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
+#include "bpf_misc.h"
extern unsigned long CONFIG_HZ __kconfig;
diff --git a/tools/testing/selftests/bpf/progs/skb_pkt_end.c b/tools/testing/selftests/bpf/progs/skb_pkt_end.c
index db4abd2682fc..3bb4451524a1 100644
--- a/tools/testing/selftests/bpf/progs/skb_pkt_end.c
+++ b/tools/testing/selftests/bpf/progs/skb_pkt_end.c
@@ -33,6 +33,8 @@ int main_prog(struct __sk_buff *skb)
struct iphdr *ip = NULL;
struct tcphdr *tcp;
__u8 proto = 0;
+ int urg_ptr;
+ u32 offset;
if (!(ip = get_iphdr(skb)))
goto out;
@@ -48,7 +50,14 @@ int main_prog(struct __sk_buff *skb)
if (!tcp)
goto out;
- return tcp->urg_ptr;
+ urg_ptr = tcp->urg_ptr;
+
+ /* Checksum validation part */
+ proto++;
+ offset = sizeof(struct ethhdr) + offsetof(struct iphdr, protocol);
+ bpf_skb_store_bytes(skb, offset, &proto, sizeof(proto), BPF_F_RECOMPUTE_CSUM);
+
+ return urg_ptr;
out:
return -1;
}
diff --git a/tools/testing/selftests/bpf/progs/struct_ops_detach.c b/tools/testing/selftests/bpf/progs/struct_ops_detach.c
new file mode 100644
index 000000000000..56b787a89876
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/struct_ops_detach.c
@@ -0,0 +1,10 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#include <vmlinux.h>
+#include <bpf/bpf_helpers.h>
+#include "../bpf_testmod/bpf_testmod.h"
+
+char _license[] SEC("license") = "GPL";
+
+SEC(".struct_ops.link")
+struct bpf_testmod_ops testmod_do_detach;
diff --git a/tools/testing/selftests/bpf/progs/test_bpf_ma.c b/tools/testing/selftests/bpf/progs/test_bpf_ma.c
index 3494ca30fa7f..4a4e0b8d9b72 100644
--- a/tools/testing/selftests/bpf/progs/test_bpf_ma.c
+++ b/tools/testing/selftests/bpf/progs/test_bpf_ma.c
@@ -7,10 +7,6 @@
#include "bpf_experimental.h"
#include "bpf_misc.h"
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
-
struct generic_map_value {
void *data;
};
diff --git a/tools/testing/selftests/bpf/progs/test_bpf_nf.c b/tools/testing/selftests/bpf/progs/test_bpf_nf.c
index 77ad8adf68da..f7b330ddd007 100644
--- a/tools/testing/selftests/bpf/progs/test_bpf_nf.c
+++ b/tools/testing/selftests/bpf/progs/test_bpf_nf.c
@@ -1,4 +1,5 @@
// SPDX-License-Identifier: GPL-2.0
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_endian.h>
@@ -9,10 +10,14 @@
#define EINVAL 22
#define ENOENT 2
+#define NF_CT_ZONE_DIR_ORIG (1 << IP_CT_DIR_ORIGINAL)
+#define NF_CT_ZONE_DIR_REPL (1 << IP_CT_DIR_REPLY)
+
extern unsigned long CONFIG_HZ __kconfig;
int test_einval_bpf_tuple = 0;
int test_einval_reserved = 0;
+int test_einval_reserved_new = 0;
int test_einval_netns_id = 0;
int test_einval_len_opts = 0;
int test_eproto_l4proto = 0;
@@ -22,6 +27,11 @@ int test_eafnosupport = 0;
int test_alloc_entry = -EINVAL;
int test_insert_entry = -EAFNOSUPPORT;
int test_succ_lookup = -ENOENT;
+int test_ct_zone_id_alloc_entry = -EINVAL;
+int test_ct_zone_id_insert_entry = -EAFNOSUPPORT;
+int test_ct_zone_id_succ_lookup = -ENOENT;
+int test_ct_zone_dir_enoent_lookup = 0;
+int test_ct_zone_id_enoent_lookup = 0;
u32 test_delta_timeout = 0;
u32 test_status = 0;
u32 test_insert_lookup_mark = 0;
@@ -45,6 +55,17 @@ struct bpf_ct_opts___local {
s32 netns_id;
s32 error;
u8 l4proto;
+ u8 dir;
+ u8 reserved[2];
+};
+
+struct bpf_ct_opts___new {
+ s32 netns_id;
+ s32 error;
+ u8 l4proto;
+ u8 dir;
+ u16 ct_zone_id;
+ u8 ct_zone_dir;
u8 reserved[3];
} __attribute__((preserve_access_index));
@@ -220,10 +241,97 @@ nf_ct_test(struct nf_conn *(*lookup_fn)(void *, struct bpf_sock_tuple *, u32,
}
}
+static __always_inline void
+nf_ct_opts_new_test(struct nf_conn *(*lookup_fn)(void *, struct bpf_sock_tuple *, u32,
+ struct bpf_ct_opts___new *, u32),
+ struct nf_conn *(*alloc_fn)(void *, struct bpf_sock_tuple *, u32,
+ struct bpf_ct_opts___new *, u32),
+ void *ctx)
+{
+ struct bpf_ct_opts___new opts_def = { .l4proto = IPPROTO_TCP, .netns_id = -1 };
+ struct bpf_sock_tuple bpf_tuple;
+ struct nf_conn *ct;
+
+ __builtin_memset(&bpf_tuple, 0, sizeof(bpf_tuple.ipv4));
+
+ opts_def.reserved[0] = 1;
+ ct = lookup_fn(ctx, &bpf_tuple, sizeof(bpf_tuple.ipv4), &opts_def,
+ sizeof(opts_def));
+ opts_def.reserved[0] = 0;
+ if (ct)
+ bpf_ct_release(ct);
+ else
+ test_einval_reserved_new = opts_def.error;
+
+ bpf_tuple.ipv4.saddr = bpf_get_prandom_u32(); /* src IP */
+ bpf_tuple.ipv4.daddr = bpf_get_prandom_u32(); /* dst IP */
+ bpf_tuple.ipv4.sport = bpf_get_prandom_u32(); /* src port */
+ bpf_tuple.ipv4.dport = bpf_get_prandom_u32(); /* dst port */
+
+ /* use non-default ct zone */
+ opts_def.ct_zone_id = 10;
+ opts_def.ct_zone_dir = NF_CT_ZONE_DIR_ORIG;
+ ct = alloc_fn(ctx, &bpf_tuple, sizeof(bpf_tuple.ipv4), &opts_def,
+ sizeof(opts_def));
+ if (ct) {
+ __u16 sport = bpf_get_prandom_u32();
+ __u16 dport = bpf_get_prandom_u32();
+ union nf_inet_addr saddr = {};
+ union nf_inet_addr daddr = {};
+ struct nf_conn *ct_ins;
+
+ bpf_ct_set_timeout(ct, 10000);
+
+ /* snat */
+ saddr.ip = bpf_get_prandom_u32();
+ bpf_ct_set_nat_info(ct, &saddr, sport, NF_NAT_MANIP_SRC___local);
+ /* dnat */
+ daddr.ip = bpf_get_prandom_u32();
+ bpf_ct_set_nat_info(ct, &daddr, dport, NF_NAT_MANIP_DST___local);
+
+ ct_ins = bpf_ct_insert_entry(ct);
+ if (ct_ins) {
+ struct nf_conn *ct_lk;
+
+ /* entry should exist in same ct zone we inserted it */
+ ct_lk = lookup_fn(ctx, &bpf_tuple, sizeof(bpf_tuple.ipv4),
+ &opts_def, sizeof(opts_def));
+ if (ct_lk) {
+ bpf_ct_release(ct_lk);
+ test_ct_zone_id_succ_lookup = 0;
+ }
+
+ /* entry should not exist with wrong direction */
+ opts_def.ct_zone_dir = NF_CT_ZONE_DIR_REPL;
+ ct_lk = lookup_fn(ctx, &bpf_tuple, sizeof(bpf_tuple.ipv4),
+ &opts_def, sizeof(opts_def));
+ opts_def.ct_zone_dir = NF_CT_ZONE_DIR_ORIG;
+ if (ct_lk)
+ bpf_ct_release(ct_lk);
+ else
+ test_ct_zone_dir_enoent_lookup = opts_def.error;
+
+ /* entry should not exist in default ct zone */
+ opts_def.ct_zone_id = 0;
+ ct_lk = lookup_fn(ctx, &bpf_tuple, sizeof(bpf_tuple.ipv4),
+ &opts_def, sizeof(opts_def));
+ if (ct_lk)
+ bpf_ct_release(ct_lk);
+ else
+ test_ct_zone_id_enoent_lookup = opts_def.error;
+
+ bpf_ct_release(ct_ins);
+ test_ct_zone_id_insert_entry = 0;
+ }
+ test_ct_zone_id_alloc_entry = 0;
+ }
+}
+
SEC("xdp")
int nf_xdp_ct_test(struct xdp_md *ctx)
{
nf_ct_test((void *)bpf_xdp_ct_lookup, (void *)bpf_xdp_ct_alloc, ctx);
+ nf_ct_opts_new_test((void *)bpf_xdp_ct_lookup, (void *)bpf_xdp_ct_alloc, ctx);
return 0;
}
@@ -231,6 +339,7 @@ SEC("tc")
int nf_skb_ct_test(struct __sk_buff *ctx)
{
nf_ct_test((void *)bpf_skb_ct_lookup, (void *)bpf_skb_ct_alloc, ctx);
+ nf_ct_opts_new_test((void *)bpf_skb_ct_lookup, (void *)bpf_skb_ct_alloc, ctx);
return 0;
}
diff --git a/tools/testing/selftests/bpf/progs/test_bpf_nf_fail.c b/tools/testing/selftests/bpf/progs/test_bpf_nf_fail.c
index 0e4759ab38ff..a586f087ffeb 100644
--- a/tools/testing/selftests/bpf/progs/test_bpf_nf_fail.c
+++ b/tools/testing/selftests/bpf/progs/test_bpf_nf_fail.c
@@ -1,4 +1,5 @@
// SPDX-License-Identifier: GPL-2.0
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
#include <bpf/bpf_helpers.h>
diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
index 2dde8e3fe4c9..e68667aec6a6 100644
--- a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
+++ b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
@@ -45,7 +45,7 @@ int BPF_PROG(not_valid_dynptr, int cmd, union bpf_attr *attr, unsigned int size)
}
SEC("?lsm.s/bpf")
-__failure __msg("arg#0 expected pointer to stack or dynptr_ptr")
+__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
int BPF_PROG(not_ptr_to_stack, int cmd, union bpf_attr *attr, unsigned int size)
{
unsigned long val = 0;
diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c
new file mode 100644
index 000000000000..7ac7e1de34d8
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_kfunc_param_nullable.c
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 Meta Platforms, Inc */
+#include <vmlinux.h>
+#include <bpf/bpf_helpers.h>
+#include "bpf_misc.h"
+#include "bpf_kfuncs.h"
+#include "../bpf_testmod/bpf_testmod_kfunc.h"
+
+SEC("tc")
+int kfunc_dynptr_nullable_test1(struct __sk_buff *skb)
+{
+ struct bpf_dynptr data;
+
+ bpf_dynptr_from_skb(skb, 0, &data);
+ bpf_kfunc_dynptr_test(&data, NULL);
+
+ return 0;
+}
+
+SEC("tc")
+int kfunc_dynptr_nullable_test2(struct __sk_buff *skb)
+{
+ struct bpf_dynptr data;
+
+ bpf_dynptr_from_skb(skb, 0, &data);
+ bpf_kfunc_dynptr_test(&data, &data);
+
+ return 0;
+}
+
+SEC("tc")
+__failure __msg("expected pointer to stack or const struct bpf_dynptr")
+int kfunc_dynptr_nullable_test3(struct __sk_buff *skb)
+{
+ struct bpf_dynptr data;
+
+ bpf_dynptr_from_skb(skb, 0, &data);
+ bpf_kfunc_dynptr_test(NULL, &data);
+
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/test_ringbuf_write.c b/tools/testing/selftests/bpf/progs/test_ringbuf_write.c
new file mode 100644
index 000000000000..350513c0e4c9
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_ringbuf_write.c
@@ -0,0 +1,46 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include "bpf_misc.h"
+
+char _license[] SEC("license") = "GPL";
+
+struct {
+ __uint(type, BPF_MAP_TYPE_RINGBUF);
+} ringbuf SEC(".maps");
+
+/* inputs */
+int pid = 0;
+
+/* outputs */
+long passed = 0;
+long discarded = 0;
+
+SEC("fentry/" SYS_PREFIX "sys_getpgid")
+int test_ringbuf_write(void *ctx)
+{
+ int *foo, cur_pid = bpf_get_current_pid_tgid() >> 32;
+ void *sample1, *sample2;
+
+ if (cur_pid != pid)
+ return 0;
+
+ sample1 = bpf_ringbuf_reserve(&ringbuf, 0x3000, 0);
+ if (!sample1)
+ return 0;
+ /* first one can pass */
+ sample2 = bpf_ringbuf_reserve(&ringbuf, 0x3000, 0);
+ if (!sample2) {
+ bpf_ringbuf_discard(sample1, 0);
+ __sync_fetch_and_add(&discarded, 1);
+ return 0;
+ }
+ /* second one must not */
+ __sync_fetch_and_add(&passed, 1);
+ foo = sample2 + 4084;
+ *foo = 256;
+ bpf_ringbuf_discard(sample1, 0);
+ bpf_ringbuf_discard(sample2, 0);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c b/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c
index 02e718f06e0f..40531e56776e 100644
--- a/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c
+++ b/tools/testing/selftests/bpf/progs/test_sk_storage_tracing.c
@@ -84,7 +84,7 @@ int BPF_PROG(trace_tcp_connect, struct sock *sk)
}
SEC("fexit/inet_csk_accept")
-int BPF_PROG(inet_csk_accept, struct sock *sk, int flags, int *err, bool kern,
+int BPF_PROG(inet_csk_accept, struct sock *sk, struct proto_accept_arg *arg,
struct sock *accepted_sk)
{
set_task_info(accepted_sk);
diff --git a/tools/testing/selftests/bpf/progs/test_sockmap_kern.h b/tools/testing/selftests/bpf/progs/test_sockmap_kern.h
index 99d2ea9fb658..f48f85f1bd70 100644
--- a/tools/testing/selftests/bpf/progs/test_sockmap_kern.h
+++ b/tools/testing/selftests/bpf/progs/test_sockmap_kern.h
@@ -92,7 +92,7 @@ struct {
__uint(value_size, sizeof(int));
} tls_sock_map SEC(".maps");
-SEC("sk_skb1")
+SEC("sk_skb/stream_parser")
int bpf_prog1(struct __sk_buff *skb)
{
int *f, two = 2;
@@ -104,7 +104,7 @@ int bpf_prog1(struct __sk_buff *skb)
return skb->len;
}
-SEC("sk_skb2")
+SEC("sk_skb/stream_verdict")
int bpf_prog2(struct __sk_buff *skb)
{
__u32 lport = skb->local_port;
@@ -151,7 +151,7 @@ static inline void bpf_write_pass(struct __sk_buff *skb, int offset)
memcpy(c + offset, "PASS", 4);
}
-SEC("sk_skb3")
+SEC("sk_skb/stream_verdict")
int bpf_prog3(struct __sk_buff *skb)
{
int err, *f, ret = SK_PASS;
@@ -177,9 +177,6 @@ int bpf_prog3(struct __sk_buff *skb)
return bpf_sk_redirect_hash(skb, &tls_sock_map, &ret, flags);
#endif
}
- f = bpf_map_lookup_elem(&sock_skb_opts, &one);
- if (f && *f)
- ret = SK_DROP;
err = bpf_skb_adjust_room(skb, 4, 0, 0);
if (err)
return SK_DROP;
@@ -233,7 +230,7 @@ int bpf_sockmap(struct bpf_sock_ops *skops)
return 0;
}
-SEC("sk_msg1")
+SEC("sk_msg")
int bpf_prog4(struct sk_msg_md *msg)
{
int *bytes, zero = 0, one = 1, two = 2, three = 3, four = 4, five = 5;
@@ -263,7 +260,7 @@ int bpf_prog4(struct sk_msg_md *msg)
return SK_PASS;
}
-SEC("sk_msg2")
+SEC("sk_msg")
int bpf_prog6(struct sk_msg_md *msg)
{
int zero = 0, one = 1, two = 2, three = 3, four = 4, five = 5, key = 0;
@@ -308,7 +305,7 @@ int bpf_prog6(struct sk_msg_md *msg)
#endif
}
-SEC("sk_msg3")
+SEC("sk_msg")
int bpf_prog8(struct sk_msg_md *msg)
{
void *data_end = (void *)(long) msg->data_end;
@@ -329,7 +326,8 @@ int bpf_prog8(struct sk_msg_md *msg)
return SK_PASS;
}
-SEC("sk_msg4")
+
+SEC("sk_msg")
int bpf_prog9(struct sk_msg_md *msg)
{
void *data_end = (void *)(long) msg->data_end;
@@ -347,7 +345,7 @@ int bpf_prog9(struct sk_msg_md *msg)
return SK_PASS;
}
-SEC("sk_msg5")
+SEC("sk_msg")
int bpf_prog10(struct sk_msg_md *msg)
{
int *bytes, *start, *end, *start_push, *end_push, *start_pop, *pop;
diff --git a/tools/testing/selftests/bpf/progs/test_sysctl_loop1.c b/tools/testing/selftests/bpf/progs/test_sysctl_loop1.c
index 7f74077d6622..548660e299a5 100644
--- a/tools/testing/selftests/bpf/progs/test_sysctl_loop1.c
+++ b/tools/testing/selftests/bpf/progs/test_sysctl_loop1.c
@@ -10,10 +10,7 @@
#include <bpf/bpf_helpers.h>
#include "bpf_compiler.h"
-
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
+#include "bpf_misc.h"
/* tcp_mem sysctl has only 3 ints, but this test is doing TCP_MEM_LOOPS */
#define TCP_MEM_LOOPS 28 /* because 30 doesn't fit into 512 bytes of stack */
diff --git a/tools/testing/selftests/bpf/progs/test_sysctl_loop2.c b/tools/testing/selftests/bpf/progs/test_sysctl_loop2.c
index 68a75436e8af..81249d119a8b 100644
--- a/tools/testing/selftests/bpf/progs/test_sysctl_loop2.c
+++ b/tools/testing/selftests/bpf/progs/test_sysctl_loop2.c
@@ -10,10 +10,7 @@
#include <bpf/bpf_helpers.h>
#include "bpf_compiler.h"
-
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
+#include "bpf_misc.h"
/* tcp_mem sysctl has only 3 ints, but this test is doing TCP_MEM_LOOPS */
#define TCP_MEM_LOOPS 20 /* because 30 doesn't fit into 512 bytes of stack */
diff --git a/tools/testing/selftests/bpf/progs/test_sysctl_prog.c b/tools/testing/selftests/bpf/progs/test_sysctl_prog.c
index efc3c61f7852..bbdd08764789 100644
--- a/tools/testing/selftests/bpf/progs/test_sysctl_prog.c
+++ b/tools/testing/selftests/bpf/progs/test_sysctl_prog.c
@@ -10,6 +10,7 @@
#include <bpf/bpf_helpers.h>
#include "bpf_compiler.h"
+#include "bpf_misc.h"
/* Max supported length of a string with unsigned long in base 10 (pow2 - 1). */
#define MAX_ULONG_STR_LEN 0xF
@@ -17,10 +18,6 @@
/* Max supported length of sysctl value string (pow2). */
#define MAX_VALUE_STR_LEN 0x40
-#ifndef ARRAY_SIZE
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof((x)[0]))
-#endif
-
const char tcp_mem_name[] = "net/ipv4/tcp_mem";
static __always_inline int is_tcp_mem(struct bpf_sysctl *ctx)
{
diff --git a/tools/testing/selftests/bpf/progs/test_tc_dtime.c b/tools/testing/selftests/bpf/progs/test_tc_dtime.c
index 74ec09f040b7..ca8e8734d901 100644
--- a/tools/testing/selftests/bpf/progs/test_tc_dtime.c
+++ b/tools/testing/selftests/bpf/progs/test_tc_dtime.c
@@ -222,17 +222,21 @@ int egress_host(struct __sk_buff *skb)
return TC_ACT_OK;
if (skb_proto(skb_type) == IPPROTO_TCP) {
- if (skb->tstamp_type == BPF_SKB_TSTAMP_DELIVERY_MONO &&
+ if (skb->tstamp_type == BPF_SKB_CLOCK_MONOTONIC &&
skb->tstamp)
inc_dtimes(EGRESS_ENDHOST);
else
inc_errs(EGRESS_ENDHOST);
- } else {
- if (skb->tstamp_type == BPF_SKB_TSTAMP_UNSPEC &&
+ } else if (skb_proto(skb_type) == IPPROTO_UDP) {
+ if (skb->tstamp_type == BPF_SKB_CLOCK_TAI &&
skb->tstamp)
inc_dtimes(EGRESS_ENDHOST);
else
inc_errs(EGRESS_ENDHOST);
+ } else {
+ if (skb->tstamp_type == BPF_SKB_CLOCK_REALTIME &&
+ skb->tstamp)
+ inc_errs(EGRESS_ENDHOST);
}
skb->tstamp = EGRESS_ENDHOST_MAGIC;
@@ -252,7 +256,7 @@ int ingress_host(struct __sk_buff *skb)
if (!skb_type)
return TC_ACT_OK;
- if (skb->tstamp_type == BPF_SKB_TSTAMP_DELIVERY_MONO &&
+ if (skb->tstamp_type == BPF_SKB_CLOCK_MONOTONIC &&
skb->tstamp == EGRESS_FWDNS_MAGIC)
inc_dtimes(INGRESS_ENDHOST);
else
@@ -315,7 +319,6 @@ int egress_fwdns_prio100(struct __sk_buff *skb)
SEC("tc")
int ingress_fwdns_prio101(struct __sk_buff *skb)
{
- __u64 expected_dtime = EGRESS_ENDHOST_MAGIC;
int skb_type;
skb_type = skb_get_type(skb);
@@ -323,29 +326,24 @@ int ingress_fwdns_prio101(struct __sk_buff *skb)
/* Should have handled in prio100 */
return TC_ACT_SHOT;
- if (skb_proto(skb_type) == IPPROTO_UDP)
- expected_dtime = 0;
-
if (skb->tstamp_type) {
if (fwdns_clear_dtime() ||
- skb->tstamp_type != BPF_SKB_TSTAMP_DELIVERY_MONO ||
- skb->tstamp != expected_dtime)
+ (skb->tstamp_type != BPF_SKB_CLOCK_MONOTONIC &&
+ skb->tstamp_type != BPF_SKB_CLOCK_TAI) ||
+ skb->tstamp != EGRESS_ENDHOST_MAGIC)
inc_errs(INGRESS_FWDNS_P101);
else
inc_dtimes(INGRESS_FWDNS_P101);
} else {
- if (!fwdns_clear_dtime() && expected_dtime)
+ if (!fwdns_clear_dtime())
inc_errs(INGRESS_FWDNS_P101);
}
- if (skb->tstamp_type == BPF_SKB_TSTAMP_DELIVERY_MONO) {
+ if (skb->tstamp_type == BPF_SKB_CLOCK_MONOTONIC) {
skb->tstamp = INGRESS_FWDNS_MAGIC;
} else {
if (bpf_skb_set_tstamp(skb, INGRESS_FWDNS_MAGIC,
- BPF_SKB_TSTAMP_DELIVERY_MONO))
- inc_errs(SET_DTIME);
- if (!bpf_skb_set_tstamp(skb, INGRESS_FWDNS_MAGIC,
- BPF_SKB_TSTAMP_UNSPEC))
+ BPF_SKB_CLOCK_MONOTONIC))
inc_errs(SET_DTIME);
}
@@ -370,7 +368,7 @@ int egress_fwdns_prio101(struct __sk_buff *skb)
if (skb->tstamp_type) {
if (fwdns_clear_dtime() ||
- skb->tstamp_type != BPF_SKB_TSTAMP_DELIVERY_MONO ||
+ skb->tstamp_type != BPF_SKB_CLOCK_MONOTONIC ||
skb->tstamp != INGRESS_FWDNS_MAGIC)
inc_errs(EGRESS_FWDNS_P101);
else
@@ -380,14 +378,11 @@ int egress_fwdns_prio101(struct __sk_buff *skb)
inc_errs(EGRESS_FWDNS_P101);
}
- if (skb->tstamp_type == BPF_SKB_TSTAMP_DELIVERY_MONO) {
+ if (skb->tstamp_type == BPF_SKB_CLOCK_MONOTONIC) {
skb->tstamp = EGRESS_FWDNS_MAGIC;
} else {
if (bpf_skb_set_tstamp(skb, EGRESS_FWDNS_MAGIC,
- BPF_SKB_TSTAMP_DELIVERY_MONO))
- inc_errs(SET_DTIME);
- if (!bpf_skb_set_tstamp(skb, INGRESS_FWDNS_MAGIC,
- BPF_SKB_TSTAMP_UNSPEC))
+ BPF_SKB_CLOCK_MONOTONIC))
inc_errs(SET_DTIME);
}
diff --git a/tools/testing/selftests/bpf/progs/test_tc_link.c b/tools/testing/selftests/bpf/progs/test_tc_link.c
index 992400acb957..ab3eae3d6af8 100644
--- a/tools/testing/selftests/bpf/progs/test_tc_link.c
+++ b/tools/testing/selftests/bpf/progs/test_tc_link.c
@@ -4,7 +4,8 @@
#include <linux/bpf.h>
#include <linux/if_ether.h>
-
+#include <linux/stddef.h>
+#include <linux/if_packet.h>
#include <bpf/bpf_endian.h>
#include <bpf/bpf_helpers.h>
@@ -16,7 +17,13 @@ bool seen_tc3;
bool seen_tc4;
bool seen_tc5;
bool seen_tc6;
+bool seen_tc7;
+
+bool set_type;
+
bool seen_eth;
+bool seen_host;
+bool seen_mcast;
SEC("tc/ingress")
int tc1(struct __sk_buff *skb)
@@ -28,8 +35,16 @@ int tc1(struct __sk_buff *skb)
if (bpf_skb_load_bytes(skb, 0, &eth, sizeof(eth)))
goto out;
seen_eth = eth.h_proto == bpf_htons(ETH_P_IP);
+ seen_host = skb->pkt_type == PACKET_HOST;
+ if (seen_host && set_type) {
+ eth.h_dest[0] = 4;
+ if (bpf_skb_store_bytes(skb, 0, &eth, sizeof(eth), 0))
+ goto fail;
+ bpf_skb_change_type(skb, PACKET_MULTICAST);
+ }
out:
seen_tc1 = true;
+fail:
return TCX_NEXT;
}
@@ -67,3 +82,21 @@ int tc6(struct __sk_buff *skb)
seen_tc6 = true;
return TCX_PASS;
}
+
+SEC("tc/ingress")
+int tc7(struct __sk_buff *skb)
+{
+ struct ethhdr eth = {};
+
+ if (skb->protocol != __bpf_constant_htons(ETH_P_IP))
+ goto out;
+ if (bpf_skb_load_bytes(skb, 0, &eth, sizeof(eth)))
+ goto out;
+ if (eth.h_dest[0] == 4 && set_type) {
+ seen_mcast = skb->pkt_type == PACKET_MULTICAST;
+ bpf_skb_change_type(skb, PACKET_HOST);
+ }
+out:
+ seen_tc7 = true;
+ return TCX_PASS;
+}
diff --git a/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.c b/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.c
index c8e4553648bf..44ee0d037f95 100644
--- a/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.c
+++ b/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.c
@@ -9,6 +9,7 @@
#include "bpf_kfuncs.h"
#include "test_siphash.h"
#include "test_tcp_custom_syncookie.h"
+#include "bpf_misc.h"
#define MAX_PACKET_OFF 0xffff
diff --git a/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.h b/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.h
index 29a6a53cf229..f8b1b7e68d2e 100644
--- a/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.h
+++ b/tools/testing/selftests/bpf/progs/test_tcp_custom_syncookie.h
@@ -7,8 +7,6 @@
#define __packed __attribute__((__packed__))
#define __force
-#define ARRAY_SIZE(arr) (sizeof(arr) / sizeof((arr)[0]))
-
#define swap(a, b) \
do { \
typeof(a) __tmp = (a); \
diff --git a/tools/testing/selftests/bpf/progs/timer_lockup.c b/tools/testing/selftests/bpf/progs/timer_lockup.c
new file mode 100644
index 000000000000..3e520133281e
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/timer_lockup.c
@@ -0,0 +1,87 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <time.h>
+#include <errno.h>
+#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_tracing.h>
+#include "bpf_misc.h"
+
+char _license[] SEC("license") = "GPL";
+
+struct elem {
+ struct bpf_timer t;
+};
+
+struct {
+ __uint(type, BPF_MAP_TYPE_ARRAY);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, struct elem);
+} timer1_map SEC(".maps");
+
+struct {
+ __uint(type, BPF_MAP_TYPE_ARRAY);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, struct elem);
+} timer2_map SEC(".maps");
+
+int timer1_err;
+int timer2_err;
+
+static int timer_cb1(void *map, int *k, struct elem *v)
+{
+ struct bpf_timer *timer;
+ int key = 0;
+
+ timer = bpf_map_lookup_elem(&timer2_map, &key);
+ if (timer)
+ timer2_err = bpf_timer_cancel(timer);
+
+ return 0;
+}
+
+static int timer_cb2(void *map, int *k, struct elem *v)
+{
+ struct bpf_timer *timer;
+ int key = 0;
+
+ timer = bpf_map_lookup_elem(&timer1_map, &key);
+ if (timer)
+ timer1_err = bpf_timer_cancel(timer);
+
+ return 0;
+}
+
+SEC("tc")
+int timer1_prog(void *ctx)
+{
+ struct bpf_timer *timer;
+ int key = 0;
+
+ timer = bpf_map_lookup_elem(&timer1_map, &key);
+ if (timer) {
+ bpf_timer_init(timer, &timer1_map, CLOCK_BOOTTIME);
+ bpf_timer_set_callback(timer, timer_cb1);
+ bpf_timer_start(timer, 1, BPF_F_TIMER_CPU_PIN);
+ }
+
+ return 0;
+}
+
+SEC("tc")
+int timer2_prog(void *ctx)
+{
+ struct bpf_timer *timer;
+ int key = 0;
+
+ timer = bpf_map_lookup_elem(&timer2_map, &key);
+ if (timer) {
+ bpf_timer_init(timer, &timer2_map, CLOCK_BOOTTIME);
+ bpf_timer_set_callback(timer, timer_cb2);
+ bpf_timer_start(timer, 1, BPF_F_TIMER_CPU_PIN);
+ }
+
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/tracing_struct.c b/tools/testing/selftests/bpf/progs/tracing_struct.c
index 515daef3c84b..c435a3a8328a 100644
--- a/tools/testing/selftests/bpf/progs/tracing_struct.c
+++ b/tools/testing/selftests/bpf/progs/tracing_struct.c
@@ -18,11 +18,6 @@ struct bpf_testmod_struct_arg_3 {
int b[];
};
-struct bpf_testmod_struct_arg_4 {
- u64 a;
- int b;
-};
-
long t1_a_a, t1_a_b, t1_b, t1_c, t1_ret, t1_nregs;
__u64 t1_reg0, t1_reg1, t1_reg2, t1_reg3;
long t2_a, t2_b_a, t2_b_b, t2_c, t2_ret;
@@ -30,9 +25,6 @@ long t3_a, t3_b, t3_c_a, t3_c_b, t3_ret;
long t4_a_a, t4_b, t4_c, t4_d, t4_e_a, t4_e_b, t4_ret;
long t5_ret;
int t6;
-long t7_a, t7_b, t7_c, t7_d, t7_e, t7_f_a, t7_f_b, t7_ret;
-long t8_a, t8_b, t8_c, t8_d, t8_e, t8_f_a, t8_f_b, t8_g, t8_ret;
-
SEC("fentry/bpf_testmod_test_struct_arg_1")
int BPF_PROG2(test_struct_arg_1, struct bpf_testmod_struct_arg_2, a, int, b, int, c)
@@ -138,50 +130,4 @@ int BPF_PROG2(test_struct_arg_11, struct bpf_testmod_struct_arg_3 *, a)
return 0;
}
-SEC("fentry/bpf_testmod_test_struct_arg_7")
-int BPF_PROG2(test_struct_arg_12, __u64, a, void *, b, short, c, int, d,
- void *, e, struct bpf_testmod_struct_arg_4, f)
-{
- t7_a = a;
- t7_b = (long)b;
- t7_c = c;
- t7_d = d;
- t7_e = (long)e;
- t7_f_a = f.a;
- t7_f_b = f.b;
- return 0;
-}
-
-SEC("fexit/bpf_testmod_test_struct_arg_7")
-int BPF_PROG2(test_struct_arg_13, __u64, a, void *, b, short, c, int, d,
- void *, e, struct bpf_testmod_struct_arg_4, f, int, ret)
-{
- t7_ret = ret;
- return 0;
-}
-
-SEC("fentry/bpf_testmod_test_struct_arg_8")
-int BPF_PROG2(test_struct_arg_14, __u64, a, void *, b, short, c, int, d,
- void *, e, struct bpf_testmod_struct_arg_4, f, int, g)
-{
- t8_a = a;
- t8_b = (long)b;
- t8_c = c;
- t8_d = d;
- t8_e = (long)e;
- t8_f_a = f.a;
- t8_f_b = f.b;
- t8_g = g;
- return 0;
-}
-
-SEC("fexit/bpf_testmod_test_struct_arg_8")
-int BPF_PROG2(test_struct_arg_15, __u64, a, void *, b, short, c, int, d,
- void *, e, struct bpf_testmod_struct_arg_4, f, int, g,
- int, ret)
-{
- t8_ret = ret;
- return 0;
-}
-
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/tracing_struct_many_args.c b/tools/testing/selftests/bpf/progs/tracing_struct_many_args.c
new file mode 100644
index 000000000000..4742012ace06
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/tracing_struct_many_args.c
@@ -0,0 +1,95 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <vmlinux.h>
+#include <bpf/bpf_tracing.h>
+#include <bpf/bpf_helpers.h>
+
+struct bpf_testmod_struct_arg_4 {
+ u64 a;
+ int b;
+};
+
+struct bpf_testmod_struct_arg_5 {
+ char a;
+ short b;
+ int c;
+ long d;
+};
+
+long t7_a, t7_b, t7_c, t7_d, t7_e, t7_f_a, t7_f_b, t7_ret;
+long t8_a, t8_b, t8_c, t8_d, t8_e, t8_f_a, t8_f_b, t8_g, t8_ret;
+long t9_a, t9_b, t9_c, t9_d, t9_e, t9_f, t9_g, t9_h_a, t9_h_b, t9_h_c, t9_h_d, t9_i, t9_ret;
+
+SEC("fentry/bpf_testmod_test_struct_arg_7")
+int BPF_PROG2(test_struct_many_args_1, __u64, a, void *, b, short, c, int, d,
+ void *, e, struct bpf_testmod_struct_arg_4, f)
+{
+ t7_a = a;
+ t7_b = (long)b;
+ t7_c = c;
+ t7_d = d;
+ t7_e = (long)e;
+ t7_f_a = f.a;
+ t7_f_b = f.b;
+ return 0;
+}
+
+SEC("fexit/bpf_testmod_test_struct_arg_7")
+int BPF_PROG2(test_struct_many_args_2, __u64, a, void *, b, short, c, int, d,
+ void *, e, struct bpf_testmod_struct_arg_4, f, int, ret)
+{
+ t7_ret = ret;
+ return 0;
+}
+
+SEC("fentry/bpf_testmod_test_struct_arg_8")
+int BPF_PROG2(test_struct_many_args_3, __u64, a, void *, b, short, c, int, d,
+ void *, e, struct bpf_testmod_struct_arg_4, f, int, g)
+{
+ t8_a = a;
+ t8_b = (long)b;
+ t8_c = c;
+ t8_d = d;
+ t8_e = (long)e;
+ t8_f_a = f.a;
+ t8_f_b = f.b;
+ t8_g = g;
+ return 0;
+}
+
+SEC("fexit/bpf_testmod_test_struct_arg_8")
+int BPF_PROG2(test_struct_many_args_4, __u64, a, void *, b, short, c, int, d,
+ void *, e, struct bpf_testmod_struct_arg_4, f, int, g,
+ int, ret)
+{
+ t8_ret = ret;
+ return 0;
+}
+
+SEC("fentry/bpf_testmod_test_struct_arg_9")
+int BPF_PROG2(test_struct_many_args_5, __u64, a, void *, b, short, c, int, d, void *, e,
+ char, f, short, g, struct bpf_testmod_struct_arg_5, h, long, i)
+{
+ t9_a = a;
+ t9_b = (long)b;
+ t9_c = c;
+ t9_d = d;
+ t9_e = (long)e;
+ t9_f = f;
+ t9_g = g;
+ t9_h_a = h.a;
+ t9_h_b = h.b;
+ t9_h_c = h.c;
+ t9_h_d = h.d;
+ t9_i = i;
+ return 0;
+}
+
+SEC("fexit/bpf_testmod_test_struct_arg_9")
+int BPF_PROG2(test_struct_many_args_6, __u64, a, void *, b, short, c, int, d, void *, e,
+ char, f, short, g, struct bpf_testmod_struct_arg_5, h, long, i, int, ret)
+{
+ t9_ret = ret;
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/uprobe_multi.c b/tools/testing/selftests/bpf/progs/uprobe_multi.c
index 419d9aa28fce..44190efcdba2 100644
--- a/tools/testing/selftests/bpf/progs/uprobe_multi.c
+++ b/tools/testing/selftests/bpf/progs/uprobe_multi.c
@@ -1,8 +1,8 @@
// SPDX-License-Identifier: GPL-2.0
-#include <linux/bpf.h>
+#include "vmlinux.h"
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-#include <stdbool.h>
+#include <bpf/usdt.bpf.h>
char _license[] SEC("license") = "GPL";
@@ -22,6 +22,13 @@ __u64 uprobe_multi_sleep_result = 0;
int pid = 0;
int child_pid = 0;
+int child_tid = 0;
+int child_pid_usdt = 0;
+int child_tid_usdt = 0;
+
+int expect_pid = 0;
+bool bad_pid_seen = false;
+bool bad_pid_seen_usdt = false;
bool test_cookie = false;
void *user_ptr = 0;
@@ -36,11 +43,19 @@ static __always_inline bool verify_sleepable_user_copy(void)
static void uprobe_multi_check(void *ctx, bool is_return, bool is_sleep)
{
- child_pid = bpf_get_current_pid_tgid() >> 32;
+ __u64 cur_pid_tgid = bpf_get_current_pid_tgid();
+ __u32 cur_pid;
- if (pid && child_pid != pid)
+ cur_pid = cur_pid_tgid >> 32;
+ if (pid && cur_pid != pid)
return;
+ if (expect_pid && cur_pid != expect_pid)
+ bad_pid_seen = true;
+
+ child_pid = cur_pid_tgid >> 32;
+ child_tid = (__u32)cur_pid_tgid;
+
__u64 cookie = test_cookie ? bpf_get_attach_cookie(ctx) : 0;
__u64 addr = bpf_get_func_ip(ctx);
@@ -97,5 +112,32 @@ int uretprobe_sleep(struct pt_regs *ctx)
SEC("uprobe.multi//proc/self/exe:uprobe_multi_func_*")
int uprobe_extra(struct pt_regs *ctx)
{
+ /* we need this one just to mix PID-filtered and global uprobes */
+ return 0;
+}
+
+SEC("usdt")
+int usdt_pid(struct pt_regs *ctx)
+{
+ __u64 cur_pid_tgid = bpf_get_current_pid_tgid();
+ __u32 cur_pid;
+
+ cur_pid = cur_pid_tgid >> 32;
+ if (pid && cur_pid != pid)
+ return 0;
+
+ if (expect_pid && cur_pid != expect_pid)
+ bad_pid_seen_usdt = true;
+
+ child_pid_usdt = cur_pid_tgid >> 32;
+ child_tid_usdt = (__u32)cur_pid_tgid;
+
+ return 0;
+}
+
+SEC("usdt")
+int usdt_extra(struct pt_regs *ctx)
+{
+ /* we need this one just to mix PID-filtered and global USDT probes */
return 0;
}
diff --git a/tools/testing/selftests/bpf/progs/user_ringbuf_fail.c b/tools/testing/selftests/bpf/progs/user_ringbuf_fail.c
index 11ab25c42c36..54de0389f878 100644
--- a/tools/testing/selftests/bpf/progs/user_ringbuf_fail.c
+++ b/tools/testing/selftests/bpf/progs/user_ringbuf_fail.c
@@ -221,3 +221,25 @@ int user_ringbuf_callback_reinit_dynptr_ringbuf(void *ctx)
bpf_user_ringbuf_drain(&user_ringbuf, try_reinit_dynptr_ringbuf, NULL, 0);
return 0;
}
+
+__noinline long global_call_bpf_dynptr_data(struct bpf_dynptr *dynptr)
+{
+ bpf_dynptr_data(dynptr, 0xA, 0xA);
+ return 0;
+}
+
+static long callback_adjust_bpf_dynptr_reg_off(struct bpf_dynptr *dynptr,
+ void *ctx)
+{
+ global_call_bpf_dynptr_data(dynptr += 1024);
+ return 0;
+}
+
+SEC("?raw_tp")
+__failure __msg("dereference of modified dynptr_ptr ptr R1 off=16384 disallowed")
+int user_ringbuf_callback_const_ptr_to_dynptr_reg_off(void *ctx)
+{
+ bpf_user_ringbuf_drain(&user_ringbuf,
+ callback_adjust_bpf_dynptr_reg_off, NULL, 0);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/verifier_arena.c b/tools/testing/selftests/bpf/progs/verifier_arena.c
index 93144ae6df74..67509c5d3982 100644
--- a/tools/testing/selftests/bpf/progs/verifier_arena.c
+++ b/tools/testing/selftests/bpf/progs/verifier_arena.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
diff --git a/tools/testing/selftests/bpf/progs/verifier_arena_large.c b/tools/testing/selftests/bpf/progs/verifier_arena_large.c
index ef66ea460264..6065f862d964 100644
--- a/tools/testing/selftests/bpf/progs/verifier_arena_large.c
+++ b/tools/testing/selftests/bpf/progs/verifier_arena_large.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+#define BPF_NO_KFUNC_PROTOTYPES
#include <vmlinux.h>
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
diff --git a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
new file mode 100644
index 000000000000..716113c2bce2
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
@@ -0,0 +1,153 @@
+// SPDX-License-Identifier: GPL-2.0-only
+/* Copyright (c) 2024 Yafang Shao <laoar.shao@gmail.com> */
+
+#include "vmlinux.h"
+#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_tracing.h>
+
+#include "bpf_misc.h"
+#include "task_kfunc_common.h"
+
+char _license[] SEC("license") = "GPL";
+
+int bpf_iter_bits_new(struct bpf_iter_bits *it, const u64 *unsafe_ptr__ign,
+ u32 nr_bits) __ksym __weak;
+int *bpf_iter_bits_next(struct bpf_iter_bits *it) __ksym __weak;
+void bpf_iter_bits_destroy(struct bpf_iter_bits *it) __ksym __weak;
+
+SEC("iter.s/cgroup")
+__description("bits iter without destroy")
+__failure __msg("Unreleased reference")
+int BPF_PROG(no_destroy, struct bpf_iter_meta *meta, struct cgroup *cgrp)
+{
+ struct bpf_iter_bits it;
+ u64 data = 1;
+
+ bpf_iter_bits_new(&it, &data, 1);
+ bpf_iter_bits_next(&it);
+ return 0;
+}
+
+SEC("iter/cgroup")
+__description("uninitialized iter in ->next()")
+__failure __msg("expected an initialized iter_bits as arg #1")
+int BPF_PROG(next_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
+{
+ struct bpf_iter_bits *it = NULL;
+
+ bpf_iter_bits_next(it);
+ return 0;
+}
+
+SEC("iter/cgroup")
+__description("uninitialized iter in ->destroy()")
+__failure __msg("expected an initialized iter_bits as arg #1")
+int BPF_PROG(destroy_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
+{
+ struct bpf_iter_bits it = {};
+
+ bpf_iter_bits_destroy(&it);
+ return 0;
+}
+
+SEC("syscall")
+__description("null pointer")
+__success __retval(0)
+int null_pointer(void)
+{
+ int nr = 0;
+ int *bit;
+
+ bpf_for_each(bits, bit, NULL, 1)
+ nr++;
+ return nr;
+}
+
+SEC("syscall")
+__description("bits copy")
+__success __retval(10)
+int bits_copy(void)
+{
+ u64 data = 0xf7310UL; /* 4 + 3 + 2 + 1 + 0*/
+ int nr = 0;
+ int *bit;
+
+ bpf_for_each(bits, bit, &data, 1)
+ nr++;
+ return nr;
+}
+
+SEC("syscall")
+__description("bits memalloc")
+__success __retval(64)
+int bits_memalloc(void)
+{
+ u64 data[2];
+ int nr = 0;
+ int *bit;
+
+ __builtin_memset(&data, 0xf0, sizeof(data)); /* 4 * 16 */
+ bpf_for_each(bits, bit, &data[0], sizeof(data) / sizeof(u64))
+ nr++;
+ return nr;
+}
+
+SEC("syscall")
+__description("bit index")
+__success __retval(8)
+int bit_index(void)
+{
+ u64 data = 0x100;
+ int bit_idx = 0;
+ int *bit;
+
+ bpf_for_each(bits, bit, &data, 1) {
+ if (*bit == 0)
+ continue;
+ bit_idx = *bit;
+ }
+ return bit_idx;
+}
+
+SEC("syscall")
+__description("bits nomem")
+__success __retval(0)
+int bits_nomem(void)
+{
+ u64 data[4];
+ int nr = 0;
+ int *bit;
+
+ __builtin_memset(&data, 0xff, sizeof(data));
+ bpf_for_each(bits, bit, &data[0], 513) /* Be greater than 512 */
+ nr++;
+ return nr;
+}
+
+SEC("syscall")
+__description("fewer words")
+__success __retval(1)
+int fewer_words(void)
+{
+ u64 data[2] = {0x1, 0xff};
+ int nr = 0;
+ int *bit;
+
+ bpf_for_each(bits, bit, &data[0], 1)
+ nr++;
+ return nr;
+}
+
+SEC("syscall")
+__description("zero words")
+__success __retval(0)
+int zero_words(void)
+{
+ u64 data[2] = {0x1, 0xff};
+ int nr = 0;
+ int *bit;
+
+ bpf_for_each(bits, bit, &data[0], 0)
+ nr++;
+ return nr;
+}
diff --git a/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c b/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c
index bd676d7e615f..e54bb5385bc1 100644
--- a/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c
+++ b/tools/testing/selftests/bpf/progs/verifier_iterating_callbacks.c
@@ -274,6 +274,58 @@ static __naked void iter_limit_bug_cb(void)
);
}
+int tmp_var;
+SEC("socket")
+__failure __msg("infinite loop detected at insn 2")
+__naked void jgt_imm64_and_may_goto(void)
+{
+ asm volatile (" \
+ r0 = %[tmp_var] ll; \
+l0_%=: .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short -3; /* off -3 */ \
+ .long 0; /* imm */ \
+ if r0 > 10 goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" :: __imm_addr(tmp_var)
+ : __clobber_all);
+}
+
+SEC("socket")
+__failure __msg("infinite loop detected at insn 1")
+__naked void may_goto_self(void)
+{
+ asm volatile (" \
+ r0 = *(u32 *)(r10 - 4); \
+l0_%=: .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short -1; /* off -1 */ \
+ .long 0; /* imm */ \
+ if r0 > 10 goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("socket")
+__success __retval(0)
+__naked void may_goto_neg_off(void)
+{
+ asm volatile (" \
+ r0 = *(u32 *)(r10 - 4); \
+ goto l0_%=; \
+ goto l1_%=; \
+l0_%=: .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short -2; /* off -2 */ \
+ .long 0; /* imm */ \
+ if r0 > 10 goto l0_%=; \
+l1_%=: r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
SEC("tc")
__failure
__flag(BPF_F_TEST_STATE_FREQ)
@@ -307,6 +359,100 @@ int iter_limit_bug(struct __sk_buff *skb)
return 0;
}
+SEC("socket")
+__success __retval(0)
+__naked void ja_and_may_goto(void)
+{
+ asm volatile (" \
+l0_%=: .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 1; /* off 1 */ \
+ .long 0; /* imm */ \
+ goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_common);
+}
+
+SEC("socket")
+__success __retval(0)
+__naked void ja_and_may_goto2(void)
+{
+ asm volatile (" \
+l0_%=: r0 = 0; \
+ .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 1; /* off 1 */ \
+ .long 0; /* imm */ \
+ goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_common);
+}
+
+SEC("socket")
+__success __retval(0)
+__naked void jlt_and_may_goto(void)
+{
+ asm volatile (" \
+l0_%=: call %[bpf_jiffies64]; \
+ .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 1; /* off 1 */ \
+ .long 0; /* imm */ \
+ if r0 < 10 goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" :: __imm(bpf_jiffies64)
+ : __clobber_all);
+}
+
+#if (defined(__TARGET_ARCH_arm64) || defined(__TARGET_ARCH_x86) || \
+ (defined(__TARGET_ARCH_riscv) && __riscv_xlen == 64) || \
+ defined(__TARGET_ARCH_arm) || defined(__TARGET_ARCH_s390) || \
+ defined(__TARGET_ARCH_loongarch)) && \
+ __clang_major__ >= 18
+SEC("socket")
+__success __retval(0)
+__naked void gotol_and_may_goto(void)
+{
+ asm volatile (" \
+l0_%=: r0 = 0; \
+ .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 1; /* off 1 */ \
+ .long 0; /* imm */ \
+ gotol l0_%=; \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_common);
+}
+#endif
+
+SEC("socket")
+__success __retval(0)
+__naked void ja_and_may_goto_subprog(void)
+{
+ asm volatile (" \
+ call subprog_with_may_goto; \
+ exit; \
+" ::: __clobber_all);
+}
+
+static __naked __noinline __used
+void subprog_with_may_goto(void)
+{
+ asm volatile (" \
+l0_%=: .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 1; /* off 1 */ \
+ .long 0; /* imm */ \
+ goto l0_%=; \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
#define ARR_SZ 1000000
int zero;
char arr[ARR_SZ];
@@ -405,4 +551,240 @@ int cond_break5(const void *ctx)
return cnt1 > 1 && cnt2 > 1 ? 1 : 0;
}
+#define ARR2_SZ 1000
+SEC(".data.arr2")
+char arr2[ARR2_SZ];
+
+SEC("socket")
+__success __flag(BPF_F_TEST_STATE_FREQ)
+int loop_inside_iter(const void *ctx)
+{
+ struct bpf_iter_num it;
+ int *v, sum = 0;
+ __u64 i = 0;
+
+ bpf_iter_num_new(&it, 0, ARR2_SZ);
+ while ((v = bpf_iter_num_next(&it))) {
+ if (i < ARR2_SZ)
+ sum += arr2[i++];
+ }
+ bpf_iter_num_destroy(&it);
+ return sum;
+}
+
+SEC("socket")
+__success __flag(BPF_F_TEST_STATE_FREQ)
+int loop_inside_iter_signed(const void *ctx)
+{
+ struct bpf_iter_num it;
+ int *v, sum = 0;
+ long i = 0;
+
+ bpf_iter_num_new(&it, 0, ARR2_SZ);
+ while ((v = bpf_iter_num_next(&it))) {
+ if (i < ARR2_SZ && i >= 0)
+ sum += arr2[i++];
+ }
+ bpf_iter_num_destroy(&it);
+ return sum;
+}
+
+volatile const int limit = ARR2_SZ;
+
+SEC("socket")
+__success __flag(BPF_F_TEST_STATE_FREQ)
+int loop_inside_iter_volatile_limit(const void *ctx)
+{
+ struct bpf_iter_num it;
+ int *v, sum = 0;
+ __u64 i = 0;
+
+ bpf_iter_num_new(&it, 0, ARR2_SZ);
+ while ((v = bpf_iter_num_next(&it))) {
+ if (i < limit)
+ sum += arr2[i++];
+ }
+ bpf_iter_num_destroy(&it);
+ return sum;
+}
+
+#define ARR_LONG_SZ 1000
+
+SEC(".data.arr_long")
+long arr_long[ARR_LONG_SZ];
+
+SEC("socket")
+__success
+int test1(const void *ctx)
+{
+ long i;
+
+ for (i = 0; i < ARR_LONG_SZ && can_loop; i++)
+ arr_long[i] = i;
+ return 0;
+}
+
+SEC("socket")
+__success
+int test2(const void *ctx)
+{
+ __u64 i;
+
+ for (i = zero; i < ARR_LONG_SZ && can_loop; i++) {
+ barrier_var(i);
+ arr_long[i] = i;
+ }
+ return 0;
+}
+
+SEC(".data.arr_foo")
+struct {
+ int a;
+ int b;
+} arr_foo[ARR_LONG_SZ];
+
+SEC("socket")
+__success
+int test3(const void *ctx)
+{
+ __u64 i;
+
+ for (i = zero; i < ARR_LONG_SZ && can_loop; i++) {
+ barrier_var(i);
+ arr_foo[i].a = i;
+ arr_foo[i].b = i;
+ }
+ return 0;
+}
+
+SEC("socket")
+__success
+int test4(const void *ctx)
+{
+ long i;
+
+ for (i = zero + ARR_LONG_SZ - 1; i < ARR_LONG_SZ && i >= 0 && can_loop; i--) {
+ barrier_var(i);
+ arr_foo[i].a = i;
+ arr_foo[i].b = i;
+ }
+ return 0;
+}
+
+char buf[10] SEC(".data.buf");
+
+SEC("socket")
+__description("check add const")
+__success
+__naked void check_add_const(void)
+{
+ /* typical LLVM generated loop with may_goto */
+ asm volatile (" \
+ call %[bpf_ktime_get_ns]; \
+ if r0 > 9 goto l1_%=; \
+l0_%=: r1 = %[buf]; \
+ r2 = r0; \
+ r1 += r2; \
+ r3 = *(u8 *)(r1 +0); \
+ .byte 0xe5; /* may_goto */ \
+ .byte 0; /* regs */ \
+ .short 4; /* off of l1_%=: */ \
+ .long 0; /* imm */ \
+ r0 = r2; \
+ r0 += 1; \
+ if r2 < 9 goto l0_%=; \
+ exit; \
+l1_%=: r0 = 0; \
+ exit; \
+" :
+ : __imm(bpf_ktime_get_ns),
+ __imm_ptr(buf)
+ : __clobber_common);
+}
+
+SEC("socket")
+__failure
+__msg("*(u8 *)(r7 +0) = r0")
+__msg("invalid access to map value, value_size=10 off=10 size=1")
+__naked void check_add_const_3regs(void)
+{
+ asm volatile (
+ "r6 = %[buf];"
+ "r7 = %[buf];"
+ "call %[bpf_ktime_get_ns];"
+ "r1 = r0;" /* link r0.id == r1.id == r2.id */
+ "r2 = r0;"
+ "r1 += 1;" /* r1 == r0+1 */
+ "r2 += 2;" /* r2 == r0+2 */
+ "if r0 > 8 goto 1f;" /* r0 range [0, 8] */
+ "r6 += r1;" /* r1 range [1, 9] */
+ "r7 += r2;" /* r2 range [2, 10] */
+ "*(u8 *)(r6 +0) = r0;" /* safe, within bounds */
+ "*(u8 *)(r7 +0) = r0;" /* unsafe, out of bounds */
+ "1: exit;"
+ :
+ : __imm(bpf_ktime_get_ns),
+ __imm_ptr(buf)
+ : __clobber_common);
+}
+
+SEC("socket")
+__failure
+__msg("*(u8 *)(r8 -1) = r0")
+__msg("invalid access to map value, value_size=10 off=10 size=1")
+__naked void check_add_const_3regs_2if(void)
+{
+ asm volatile (
+ "r6 = %[buf];"
+ "r7 = %[buf];"
+ "r8 = %[buf];"
+ "call %[bpf_ktime_get_ns];"
+ "if r0 < 2 goto 1f;"
+ "r1 = r0;" /* link r0.id == r1.id == r2.id */
+ "r2 = r0;"
+ "r1 += 1;" /* r1 == r0+1 */
+ "r2 += 2;" /* r2 == r0+2 */
+ "if r2 > 11 goto 1f;" /* r2 range [0, 11] -> r0 range [-2, 9]; r1 range [-1, 10] */
+ "if r0 s< 0 goto 1f;" /* r0 range [0, 9] -> r1 range [1, 10]; r2 range [2, 11]; */
+ "r6 += r0;" /* r0 range [0, 9] */
+ "r7 += r1;" /* r1 range [1, 10] */
+ "r8 += r2;" /* r2 range [2, 11] */
+ "*(u8 *)(r6 +0) = r0;" /* safe, within bounds */
+ "*(u8 *)(r7 -1) = r0;" /* safe */
+ "*(u8 *)(r8 -1) = r0;" /* unsafe */
+ "1: exit;"
+ :
+ : __imm(bpf_ktime_get_ns),
+ __imm_ptr(buf)
+ : __clobber_common);
+}
+
+SEC("socket")
+__failure
+__flag(BPF_F_TEST_STATE_FREQ)
+__naked void check_add_const_regsafe_off(void)
+{
+ asm volatile (
+ "r8 = %[buf];"
+ "call %[bpf_ktime_get_ns];"
+ "r6 = r0;"
+ "call %[bpf_ktime_get_ns];"
+ "r7 = r0;"
+ "call %[bpf_ktime_get_ns];"
+ "r1 = r0;" /* same ids for r1 and r0 */
+ "if r6 > r7 goto 1f;" /* this jump can't be predicted */
+ "r1 += 1;" /* r1.off == +1 */
+ "goto 2f;"
+ "1: r1 += 100;" /* r1.off == +100 */
+ "goto +0;" /* verify r1.off in regsafe() after this insn */
+ "2: if r0 > 8 goto 3f;" /* r0 range [0,8], r1 range either [1,9] or [100,108]*/
+ "r8 += r1;"
+ "*(u8 *)(r8 +0) = r0;" /* potentially unsafe, buf size is 10 */
+ "3: exit;"
+ :
+ : __imm(bpf_ktime_get_ns),
+ __imm_ptr(buf)
+ : __clobber_common);
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_movsx.c b/tools/testing/selftests/bpf/progs/verifier_movsx.c
index cbb9d6714f53..028ec855587b 100644
--- a/tools/testing/selftests/bpf/progs/verifier_movsx.c
+++ b/tools/testing/selftests/bpf/progs/verifier_movsx.c
@@ -224,6 +224,69 @@ l0_%=: \
: __clobber_all);
}
+SEC("socket")
+__description("MOV32SX, S8, var_off u32_max")
+__failure __msg("infinite loop detected")
+__failure_unpriv __msg_unpriv("back-edge from insn 2 to 0")
+__naked void mov64sx_s32_varoff_1(void)
+{
+ asm volatile (" \
+l0_%=: \
+ r3 = *(u8 *)(r10 -387); \
+ w7 = (s8)w3; \
+ if w7 >= 0x2533823b goto l0_%=; \
+ w0 = 0; \
+ exit; \
+" :
+ :
+ : __clobber_all);
+}
+
+SEC("socket")
+__description("MOV32SX, S8, var_off not u32_max, positive after s8 extension")
+__success __retval(0)
+__failure_unpriv __msg_unpriv("frame pointer is read only")
+__naked void mov64sx_s32_varoff_2(void)
+{
+ asm volatile (" \
+ call %[bpf_get_prandom_u32]; \
+ r3 = r0; \
+ r3 &= 0xf; \
+ w7 = (s8)w3; \
+ if w7 s>= 16 goto l0_%=; \
+ w0 = 0; \
+ exit; \
+l0_%=: \
+ r10 = 1; \
+ exit; \
+" :
+ : __imm(bpf_get_prandom_u32)
+ : __clobber_all);
+}
+
+SEC("socket")
+__description("MOV32SX, S8, var_off not u32_max, negative after s8 extension")
+__success __retval(0)
+__failure_unpriv __msg_unpriv("frame pointer is read only")
+__naked void mov64sx_s32_varoff_3(void)
+{
+ asm volatile (" \
+ call %[bpf_get_prandom_u32]; \
+ r3 = r0; \
+ r3 &= 0xf; \
+ r3 |= 0x80; \
+ w7 = (s8)w3; \
+ if w7 s>= -5 goto l0_%=; \
+ w0 = 0; \
+ exit; \
+l0_%=: \
+ r10 = 1; \
+ exit; \
+" :
+ : __imm(bpf_get_prandom_u32)
+ : __clobber_all);
+}
+
#else
SEC("socket")
diff --git a/tools/testing/selftests/bpf/progs/verifier_netfilter_ctx.c b/tools/testing/selftests/bpf/progs/verifier_netfilter_ctx.c
index 65bba330e7e5..ab9f9f2620ed 100644
--- a/tools/testing/selftests/bpf/progs/verifier_netfilter_ctx.c
+++ b/tools/testing/selftests/bpf/progs/verifier_netfilter_ctx.c
@@ -79,7 +79,7 @@ int with_invalid_ctx_access_test5(struct bpf_nf_ctx *ctx)
return NF_ACCEPT;
}
-extern int bpf_dynptr_from_skb(struct sk_buff *skb, __u64 flags,
+extern int bpf_dynptr_from_skb(struct __sk_buff *skb, __u64 flags,
struct bpf_dynptr *ptr__uninit) __ksym;
extern void *bpf_dynptr_slice(const struct bpf_dynptr *ptr, uint32_t offset,
void *buffer, uint32_t buffer__sz) __ksym;
@@ -90,8 +90,8 @@ __success __failure_unpriv
__retval(0)
int with_valid_ctx_access_test6(struct bpf_nf_ctx *ctx)
{
+ struct __sk_buff *skb = (struct __sk_buff *)ctx->skb;
const struct nf_hook_state *state = ctx->state;
- struct sk_buff *skb = ctx->skb;
const struct iphdr *iph;
const struct tcphdr *th;
u8 buffer_iph[20] = {};
@@ -99,7 +99,7 @@ int with_valid_ctx_access_test6(struct bpf_nf_ctx *ctx)
struct bpf_dynptr ptr;
uint8_t ihl;
- if (skb->len <= 20 || bpf_dynptr_from_skb(skb, 0, &ptr))
+ if (ctx->skb->len <= 20 || bpf_dynptr_from_skb(skb, 0, &ptr))
return NF_ACCEPT;
iph = bpf_dynptr_slice(&ptr, 0, buffer_iph, sizeof(buffer_iph));
diff --git a/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c b/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c
new file mode 100644
index 000000000000..f37713a265ac
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/verifier_or_jmp32_k.c
@@ -0,0 +1,41 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include "bpf_misc.h"
+
+SEC("socket")
+__description("or_jmp32_k: bit ops + branch on unknown value")
+__failure
+__msg("R0 invalid mem access 'scalar'")
+__naked void or_jmp32_k(void)
+{
+ asm volatile (" \
+ r0 = 0xffffffff; \
+ r0 /= 1; \
+ r1 = 0; \
+ w1 = -1; \
+ w1 >>= 1; \
+ w0 &= w1; \
+ w0 |= 2; \
+ if w0 != 0x7ffffffd goto l1; \
+ r0 = 1; \
+ exit; \
+l3: \
+ r0 = 5; \
+ *(u64*)(r0 - 8) = r0; \
+ exit; \
+l2: \
+ w0 -= 0xe; \
+ if w0 == 1 goto l3; \
+ r0 = 4; \
+ exit; \
+l1: \
+ w0 -= 0x7ffffff0; \
+ if w0 s>= 0xe goto l2; \
+ r0 = 3; \
+ exit; \
+" ::: __clobber_all);
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c b/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c
new file mode 100644
index 000000000000..fe4b123187b8
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/verifier_sockmap_mutate.c
@@ -0,0 +1,187 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_tracing.h>
+
+#include "bpf_misc.h"
+
+#define __always_unused __attribute__((unused))
+
+char _license[] SEC("license") = "GPL";
+
+struct sock {
+} __attribute__((preserve_access_index));
+
+struct bpf_iter__sockmap {
+ union {
+ struct sock *sk;
+ };
+} __attribute__((preserve_access_index));
+
+struct {
+ __uint(type, BPF_MAP_TYPE_SOCKHASH);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, int);
+} sockhash SEC(".maps");
+
+struct {
+ __uint(type, BPF_MAP_TYPE_SOCKMAP);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, int);
+} sockmap SEC(".maps");
+
+enum { CG_OK = 1 };
+
+int zero = 0;
+
+static __always_inline void test_sockmap_delete(void)
+{
+ bpf_map_delete_elem(&sockmap, &zero);
+ bpf_map_delete_elem(&sockhash, &zero);
+}
+
+static __always_inline void test_sockmap_update(void *sk)
+{
+ if (sk) {
+ bpf_map_update_elem(&sockmap, &zero, sk, BPF_ANY);
+ bpf_map_update_elem(&sockhash, &zero, sk, BPF_ANY);
+ }
+}
+
+static __always_inline void test_sockmap_lookup_and_update(void)
+{
+ struct bpf_sock *sk = bpf_map_lookup_elem(&sockmap, &zero);
+
+ if (sk) {
+ test_sockmap_update(sk);
+ bpf_sk_release(sk);
+ }
+}
+
+static __always_inline void test_sockmap_mutate(void *sk)
+{
+ test_sockmap_delete();
+ test_sockmap_update(sk);
+}
+
+static __always_inline void test_sockmap_lookup_and_mutate(void)
+{
+ test_sockmap_delete();
+ test_sockmap_lookup_and_update();
+}
+
+SEC("action")
+__success
+int test_sched_act(struct __sk_buff *skb)
+{
+ test_sockmap_mutate(skb->sk);
+ return 0;
+}
+
+SEC("classifier")
+__success
+int test_sched_cls(struct __sk_buff *skb)
+{
+ test_sockmap_mutate(skb->sk);
+ return 0;
+}
+
+SEC("flow_dissector")
+__success
+int test_flow_dissector_delete(struct __sk_buff *skb __always_unused)
+{
+ test_sockmap_delete();
+ return 0;
+}
+
+SEC("flow_dissector")
+__failure __msg("program of this type cannot use helper bpf_sk_release")
+int test_flow_dissector_update(struct __sk_buff *skb __always_unused)
+{
+ test_sockmap_lookup_and_update(); /* no access to skb->sk */
+ return 0;
+}
+
+SEC("iter/sockmap")
+__success
+int test_trace_iter(struct bpf_iter__sockmap *ctx)
+{
+ test_sockmap_mutate(ctx->sk);
+ return 0;
+}
+
+SEC("raw_tp/kfree")
+__failure __msg("cannot update sockmap in this context")
+int test_raw_tp_delete(const void *ctx __always_unused)
+{
+ test_sockmap_delete();
+ return 0;
+}
+
+SEC("raw_tp/kfree")
+__failure __msg("cannot update sockmap in this context")
+int test_raw_tp_update(const void *ctx __always_unused)
+{
+ test_sockmap_lookup_and_update();
+ return 0;
+}
+
+SEC("sk_lookup")
+__success
+int test_sk_lookup(struct bpf_sk_lookup *ctx)
+{
+ test_sockmap_mutate(ctx->sk);
+ return 0;
+}
+
+SEC("sk_reuseport")
+__success
+int test_sk_reuseport(struct sk_reuseport_md *ctx)
+{
+ test_sockmap_mutate(ctx->sk);
+ return 0;
+}
+
+SEC("socket")
+__success
+int test_socket_filter(struct __sk_buff *skb)
+{
+ test_sockmap_mutate(skb->sk);
+ return 0;
+}
+
+SEC("sockops")
+__success
+int test_sockops_delete(struct bpf_sock_ops *ctx __always_unused)
+{
+ test_sockmap_delete();
+ return CG_OK;
+}
+
+SEC("sockops")
+__failure __msg("cannot update sockmap in this context")
+int test_sockops_update(struct bpf_sock_ops *ctx)
+{
+ test_sockmap_update(ctx->sk);
+ return CG_OK;
+}
+
+SEC("sockops")
+__success
+int test_sockops_update_dedicated(struct bpf_sock_ops *ctx)
+{
+ bpf_sock_map_update(ctx, &sockmap, &zero, BPF_ANY);
+ bpf_sock_hash_update(ctx, &sockhash, &zero, BPF_ANY);
+ return CG_OK;
+}
+
+SEC("xdp")
+__success
+int test_xdp(struct xdp_md *ctx __always_unused)
+{
+ test_sockmap_lookup_and_mutate();
+ return XDP_PASS;
+}
diff --git a/tools/testing/selftests/bpf/progs/verifier_subprog_precision.c b/tools/testing/selftests/bpf/progs/verifier_subprog_precision.c
index 4a58e0398e72..6a6fad625f7e 100644
--- a/tools/testing/selftests/bpf/progs/verifier_subprog_precision.c
+++ b/tools/testing/selftests/bpf/progs/verifier_subprog_precision.c
@@ -8,8 +8,6 @@
#include "bpf_misc.h"
#include <../../../tools/include/linux/filter.h>
-#define ARRAY_SIZE(x) (sizeof(x) / sizeof(x[0]))
-
int vals[] SEC(".data.vals") = {1, 2, 3, 4};
__naked __noinline __used
diff --git a/tools/testing/selftests/bpf/progs/wq.c b/tools/testing/selftests/bpf/progs/wq.c
index 49e712acbf60..f8d3ae0c29ae 100644
--- a/tools/testing/selftests/bpf/progs/wq.c
+++ b/tools/testing/selftests/bpf/progs/wq.c
@@ -32,6 +32,7 @@ struct {
} hmap_malloc SEC(".maps");
struct elem {
+ int ok_offset;
struct bpf_wq w;
};
@@ -53,7 +54,7 @@ __u32 ok;
__u32 ok_sleepable;
static int test_elem_callback(void *map, int *key,
- int (callback_fn)(void *map, int *key, struct bpf_wq *wq))
+ int (callback_fn)(void *map, int *key, void *value))
{
struct elem init = {}, *val;
struct bpf_wq *wq;
@@ -70,6 +71,8 @@ static int test_elem_callback(void *map, int *key,
if (!val)
return -2;
+ val->ok_offset = *key;
+
wq = &val->w;
if (bpf_wq_init(wq, map, 0) != 0)
return -3;
@@ -84,7 +87,7 @@ static int test_elem_callback(void *map, int *key,
}
static int test_hmap_elem_callback(void *map, int *key,
- int (callback_fn)(void *map, int *key, struct bpf_wq *wq))
+ int (callback_fn)(void *map, int *key, void *value))
{
struct hmap_elem init = {}, *val;
struct bpf_wq *wq;
@@ -114,7 +117,7 @@ static int test_hmap_elem_callback(void *map, int *key,
}
/* callback for non sleepable workqueue */
-static int wq_callback(void *map, int *key, struct bpf_wq *work)
+static int wq_callback(void *map, int *key, void *value)
{
bpf_kfunc_common_test();
ok |= (1 << *key);
@@ -122,10 +125,16 @@ static int wq_callback(void *map, int *key, struct bpf_wq *work)
}
/* callback for sleepable workqueue */
-static int wq_cb_sleepable(void *map, int *key, struct bpf_wq *work)
+static int wq_cb_sleepable(void *map, int *key, void *value)
{
+ struct elem *data = (struct elem *)value;
+ int offset = data->ok_offset;
+
+ if (*key != offset)
+ return 0;
+
bpf_kfunc_call_test_sleepable();
- ok_sleepable |= (1 << *key);
+ ok_sleepable |= (1 << offset);
return 0;
}
diff --git a/tools/testing/selftests/bpf/progs/wq_failures.c b/tools/testing/selftests/bpf/progs/wq_failures.c
index 4cbdb425f223..25b51a72fe0f 100644
--- a/tools/testing/selftests/bpf/progs/wq_failures.c
+++ b/tools/testing/selftests/bpf/progs/wq_failures.c
@@ -28,14 +28,14 @@ struct {
} lru SEC(".maps");
/* callback for non sleepable workqueue */
-static int wq_callback(void *map, int *key, struct bpf_wq *work)
+static int wq_callback(void *map, int *key, void *value)
{
bpf_kfunc_common_test();
return 0;
}
/* callback for sleepable workqueue */
-static int wq_cb_sleepable(void *map, int *key, struct bpf_wq *work)
+static int wq_cb_sleepable(void *map, int *key, void *value)
{
bpf_kfunc_call_test_sleepable();
return 0;
diff --git a/tools/testing/selftests/bpf/progs/xdp_flowtable.c b/tools/testing/selftests/bpf/progs/xdp_flowtable.c
new file mode 100644
index 000000000000..7fdc7b23ee74
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/xdp_flowtable.c
@@ -0,0 +1,148 @@
+// SPDX-License-Identifier: GPL-2.0
+#define BPF_NO_KFUNC_PROTOTYPES
+#include <vmlinux.h>
+#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_endian.h>
+
+#define ETH_P_IP 0x0800
+#define ETH_P_IPV6 0x86dd
+#define IP_MF 0x2000 /* "More Fragments" */
+#define IP_OFFSET 0x1fff /* "Fragment Offset" */
+#define AF_INET 2
+#define AF_INET6 10
+
+struct bpf_flowtable_opts___local {
+ s32 error;
+};
+
+struct flow_offload_tuple_rhash *
+bpf_xdp_flow_lookup(struct xdp_md *, struct bpf_fib_lookup *,
+ struct bpf_flowtable_opts___local *, u32) __ksym;
+
+struct {
+ __uint(type, BPF_MAP_TYPE_ARRAY);
+ __type(key, __u32);
+ __type(value, __u32);
+ __uint(max_entries, 1);
+} stats SEC(".maps");
+
+static bool xdp_flowtable_offload_check_iphdr(struct iphdr *iph)
+{
+ /* ip fragmented traffic */
+ if (iph->frag_off & bpf_htons(IP_MF | IP_OFFSET))
+ return false;
+
+ /* ip options */
+ if (iph->ihl * 4 != sizeof(*iph))
+ return false;
+
+ if (iph->ttl <= 1)
+ return false;
+
+ return true;
+}
+
+static bool xdp_flowtable_offload_check_tcp_state(void *ports, void *data_end,
+ u8 proto)
+{
+ if (proto == IPPROTO_TCP) {
+ struct tcphdr *tcph = ports;
+
+ if (tcph + 1 > data_end)
+ return false;
+
+ if (tcph->fin || tcph->rst)
+ return false;
+ }
+
+ return true;
+}
+
+struct flow_ports___local {
+ __be16 source, dest;
+} __attribute__((preserve_access_index));
+
+SEC("xdp.frags")
+int xdp_flowtable_do_lookup(struct xdp_md *ctx)
+{
+ void *data_end = (void *)(long)ctx->data_end;
+ struct bpf_flowtable_opts___local opts = {};
+ struct flow_offload_tuple_rhash *tuplehash;
+ struct bpf_fib_lookup tuple = {
+ .ifindex = ctx->ingress_ifindex,
+ };
+ void *data = (void *)(long)ctx->data;
+ struct ethhdr *eth = data;
+ struct flow_ports___local *ports;
+ __u32 *val, key = 0;
+
+ if (eth + 1 > data_end)
+ return XDP_DROP;
+
+ switch (eth->h_proto) {
+ case bpf_htons(ETH_P_IP): {
+ struct iphdr *iph = data + sizeof(*eth);
+
+ ports = (struct flow_ports___local *)(iph + 1);
+ if (ports + 1 > data_end)
+ return XDP_PASS;
+
+ /* sanity check on ip header */
+ if (!xdp_flowtable_offload_check_iphdr(iph))
+ return XDP_PASS;
+
+ if (!xdp_flowtable_offload_check_tcp_state(ports, data_end,
+ iph->protocol))
+ return XDP_PASS;
+
+ tuple.family = AF_INET;
+ tuple.tos = iph->tos;
+ tuple.l4_protocol = iph->protocol;
+ tuple.tot_len = bpf_ntohs(iph->tot_len);
+ tuple.ipv4_src = iph->saddr;
+ tuple.ipv4_dst = iph->daddr;
+ tuple.sport = ports->source;
+ tuple.dport = ports->dest;
+ break;
+ }
+ case bpf_htons(ETH_P_IPV6): {
+ struct in6_addr *src = (struct in6_addr *)tuple.ipv6_src;
+ struct in6_addr *dst = (struct in6_addr *)tuple.ipv6_dst;
+ struct ipv6hdr *ip6h = data + sizeof(*eth);
+
+ ports = (struct flow_ports___local *)(ip6h + 1);
+ if (ports + 1 > data_end)
+ return XDP_PASS;
+
+ if (ip6h->hop_limit <= 1)
+ return XDP_PASS;
+
+ if (!xdp_flowtable_offload_check_tcp_state(ports, data_end,
+ ip6h->nexthdr))
+ return XDP_PASS;
+
+ tuple.family = AF_INET6;
+ tuple.l4_protocol = ip6h->nexthdr;
+ tuple.tot_len = bpf_ntohs(ip6h->payload_len);
+ *src = ip6h->saddr;
+ *dst = ip6h->daddr;
+ tuple.sport = ports->source;
+ tuple.dport = ports->dest;
+ break;
+ }
+ default:
+ return XDP_PASS;
+ }
+
+ tuplehash = bpf_xdp_flow_lookup(ctx, &tuple, &opts, sizeof(opts));
+ if (!tuplehash)
+ return XDP_PASS;
+
+ val = bpf_map_lookup_elem(&stats, &key);
+ if (val)
+ __sync_add_and_fetch(val, 1);
+
+ return XDP_PASS;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/xdp_synproxy_kern.c b/tools/testing/selftests/bpf/progs/xdp_synproxy_kern.c
index 7ea9785738b5..f8f5dc9f72b8 100644
--- a/tools/testing/selftests/bpf/progs/xdp_synproxy_kern.c
+++ b/tools/testing/selftests/bpf/progs/xdp_synproxy_kern.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: LGPL-2.1 OR BSD-2-Clause
/* Copyright (c) 2022, NVIDIA CORPORATION & AFFILIATES. All rights reserved. */
+#define BPF_NO_KFUNC_PROTOTYPES
#include "vmlinux.h"
#include <bpf/bpf_helpers.h>
diff --git a/tools/testing/selftests/bpf/progs/xfrm_info.c b/tools/testing/selftests/bpf/progs/xfrm_info.c
index f6a501fbba2b..a1d9f106c3f0 100644
--- a/tools/testing/selftests/bpf/progs/xfrm_info.c
+++ b/tools/testing/selftests/bpf/progs/xfrm_info.c
@@ -1,4 +1,5 @@
// SPDX-License-Identifier: GPL-2.0
+#define BPF_NO_KFUNC_PROTOTYPES
#include "vmlinux.h"
#include "bpf_tracing_net.h"
#include <bpf/bpf_helpers.h>
diff --git a/tools/testing/selftests/bpf/test_loader.c b/tools/testing/selftests/bpf/test_loader.c
index 524c38e9cde4..f14e10b0de96 100644
--- a/tools/testing/selftests/bpf/test_loader.c
+++ b/tools/testing/selftests/bpf/test_loader.c
@@ -2,6 +2,7 @@
/* Copyright (c) 2022 Meta Platforms, Inc. and affiliates. */
#include <linux/capability.h>
#include <stdlib.h>
+#include <regex.h>
#include <test_progs.h>
#include <bpf/btf.h>
@@ -17,9 +18,11 @@
#define TEST_TAG_EXPECT_FAILURE "comment:test_expect_failure"
#define TEST_TAG_EXPECT_SUCCESS "comment:test_expect_success"
#define TEST_TAG_EXPECT_MSG_PFX "comment:test_expect_msg="
+#define TEST_TAG_EXPECT_REGEX_PFX "comment:test_expect_regex="
#define TEST_TAG_EXPECT_FAILURE_UNPRIV "comment:test_expect_failure_unpriv"
#define TEST_TAG_EXPECT_SUCCESS_UNPRIV "comment:test_expect_success_unpriv"
#define TEST_TAG_EXPECT_MSG_PFX_UNPRIV "comment:test_expect_msg_unpriv="
+#define TEST_TAG_EXPECT_REGEX_PFX_UNPRIV "comment:test_expect_regex_unpriv="
#define TEST_TAG_LOG_LEVEL_PFX "comment:test_log_level="
#define TEST_TAG_PROG_FLAGS_PFX "comment:test_prog_flags="
#define TEST_TAG_DESCRIPTION_PFX "comment:test_description="
@@ -46,10 +49,16 @@ enum mode {
UNPRIV = 2
};
+struct expect_msg {
+ const char *substr; /* substring match */
+ const char *regex_str; /* regex-based match */
+ regex_t regex;
+};
+
struct test_subspec {
char *name;
bool expect_failure;
- const char **expect_msgs;
+ struct expect_msg *expect_msgs;
size_t expect_msg_cnt;
int retval;
bool execute;
@@ -89,6 +98,16 @@ void test_loader_fini(struct test_loader *tester)
static void free_test_spec(struct test_spec *spec)
{
+ int i;
+
+ /* Deallocate expect_msgs arrays. */
+ for (i = 0; i < spec->priv.expect_msg_cnt; i++)
+ if (spec->priv.expect_msgs[i].regex_str)
+ regfree(&spec->priv.expect_msgs[i].regex);
+ for (i = 0; i < spec->unpriv.expect_msg_cnt; i++)
+ if (spec->unpriv.expect_msgs[i].regex_str)
+ regfree(&spec->unpriv.expect_msgs[i].regex);
+
free(spec->priv.name);
free(spec->unpriv.name);
free(spec->priv.expect_msgs);
@@ -100,18 +119,38 @@ static void free_test_spec(struct test_spec *spec)
spec->unpriv.expect_msgs = NULL;
}
-static int push_msg(const char *msg, struct test_subspec *subspec)
+static int push_msg(const char *substr, const char *regex_str, struct test_subspec *subspec)
{
void *tmp;
+ int regcomp_res;
+ char error_msg[100];
+ struct expect_msg *msg;
- tmp = realloc(subspec->expect_msgs, (1 + subspec->expect_msg_cnt) * sizeof(void *));
+ tmp = realloc(subspec->expect_msgs,
+ (1 + subspec->expect_msg_cnt) * sizeof(struct expect_msg));
if (!tmp) {
ASSERT_FAIL("failed to realloc memory for messages\n");
return -ENOMEM;
}
subspec->expect_msgs = tmp;
- subspec->expect_msgs[subspec->expect_msg_cnt++] = msg;
+ msg = &subspec->expect_msgs[subspec->expect_msg_cnt];
+
+ if (substr) {
+ msg->substr = substr;
+ msg->regex_str = NULL;
+ } else {
+ msg->regex_str = regex_str;
+ msg->substr = NULL;
+ regcomp_res = regcomp(&msg->regex, regex_str, REG_EXTENDED|REG_NEWLINE);
+ if (regcomp_res != 0) {
+ regerror(regcomp_res, &msg->regex, error_msg, sizeof(error_msg));
+ PRINT_FAIL("Regexp compilation error in '%s': '%s'\n",
+ regex_str, error_msg);
+ return -EINVAL;
+ }
+ }
+ subspec->expect_msg_cnt += 1;
return 0;
}
@@ -233,13 +272,25 @@ static int parse_test_spec(struct test_loader *tester,
spec->mode_mask |= UNPRIV;
} else if (str_has_pfx(s, TEST_TAG_EXPECT_MSG_PFX)) {
msg = s + sizeof(TEST_TAG_EXPECT_MSG_PFX) - 1;
- err = push_msg(msg, &spec->priv);
+ err = push_msg(msg, NULL, &spec->priv);
if (err)
goto cleanup;
spec->mode_mask |= PRIV;
} else if (str_has_pfx(s, TEST_TAG_EXPECT_MSG_PFX_UNPRIV)) {
msg = s + sizeof(TEST_TAG_EXPECT_MSG_PFX_UNPRIV) - 1;
- err = push_msg(msg, &spec->unpriv);
+ err = push_msg(msg, NULL, &spec->unpriv);
+ if (err)
+ goto cleanup;
+ spec->mode_mask |= UNPRIV;
+ } else if (str_has_pfx(s, TEST_TAG_EXPECT_REGEX_PFX)) {
+ msg = s + sizeof(TEST_TAG_EXPECT_REGEX_PFX) - 1;
+ err = push_msg(NULL, msg, &spec->priv);
+ if (err)
+ goto cleanup;
+ spec->mode_mask |= PRIV;
+ } else if (str_has_pfx(s, TEST_TAG_EXPECT_REGEX_PFX_UNPRIV)) {
+ msg = s + sizeof(TEST_TAG_EXPECT_REGEX_PFX_UNPRIV) - 1;
+ err = push_msg(NULL, msg, &spec->unpriv);
if (err)
goto cleanup;
spec->mode_mask |= UNPRIV;
@@ -337,16 +388,13 @@ static int parse_test_spec(struct test_loader *tester,
}
if (!spec->unpriv.expect_msgs) {
- size_t sz = spec->priv.expect_msg_cnt * sizeof(void *);
+ for (i = 0; i < spec->priv.expect_msg_cnt; i++) {
+ struct expect_msg *msg = &spec->priv.expect_msgs[i];
- spec->unpriv.expect_msgs = malloc(sz);
- if (!spec->unpriv.expect_msgs) {
- PRINT_FAIL("failed to allocate memory for unpriv.expect_msgs\n");
- err = -ENOMEM;
- goto cleanup;
+ err = push_msg(msg->substr, msg->regex_str, &spec->unpriv);
+ if (err)
+ goto cleanup;
}
- memcpy(spec->unpriv.expect_msgs, spec->priv.expect_msgs, sz);
- spec->unpriv.expect_msg_cnt = spec->priv.expect_msg_cnt;
}
}
@@ -402,27 +450,40 @@ static void validate_case(struct test_loader *tester,
struct bpf_program *prog,
int load_err)
{
- int i, j;
+ int i, j, err;
+ char *match;
+ regmatch_t reg_match[1];
for (i = 0; i < subspec->expect_msg_cnt; i++) {
- char *match;
- const char *expect_msg;
-
- expect_msg = subspec->expect_msgs[i];
+ struct expect_msg *msg = &subspec->expect_msgs[i];
+
+ if (msg->substr) {
+ match = strstr(tester->log_buf + tester->next_match_pos, msg->substr);
+ if (match)
+ tester->next_match_pos = match - tester->log_buf + strlen(msg->substr);
+ } else {
+ err = regexec(&msg->regex,
+ tester->log_buf + tester->next_match_pos, 1, reg_match, 0);
+ if (err == 0) {
+ match = tester->log_buf + tester->next_match_pos + reg_match[0].rm_so;
+ tester->next_match_pos += reg_match[0].rm_eo;
+ } else {
+ match = NULL;
+ }
+ }
- match = strstr(tester->log_buf + tester->next_match_pos, expect_msg);
if (!ASSERT_OK_PTR(match, "expect_msg")) {
- /* if we are in verbose mode, we've already emitted log */
if (env.verbosity == VERBOSE_NONE)
emit_verifier_log(tester->log_buf, true /*force*/);
- for (j = 0; j < i; j++)
- fprintf(stderr,
- "MATCHED MSG: '%s'\n", subspec->expect_msgs[j]);
- fprintf(stderr, "EXPECTED MSG: '%s'\n", expect_msg);
+ for (j = 0; j <= i; j++) {
+ msg = &subspec->expect_msgs[j];
+ fprintf(stderr, "%s %s: '%s'\n",
+ j < i ? "MATCHED " : "EXPECTED",
+ msg->substr ? "SUBSTR" : " REGEX",
+ msg->substr ?: msg->regex_str);
+ }
return;
}
-
- tester->next_match_pos = match - tester->log_buf + strlen(expect_msg);
}
}
diff --git a/tools/testing/selftests/bpf/test_progs.h b/tools/testing/selftests/bpf/test_progs.h
index 0ba5a20b19ba..51341d50213b 100644
--- a/tools/testing/selftests/bpf/test_progs.h
+++ b/tools/testing/selftests/bpf/test_progs.h
@@ -377,6 +377,15 @@ int test__join_cgroup(const char *path);
___ok; \
})
+#define ASSERT_OK_FD(fd, name) ({ \
+ static int duration = 0; \
+ int ___fd = (fd); \
+ bool ___ok = ___fd >= 0; \
+ CHECK(!___ok, (name), "unexpected fd: %d (errno %d)\n", \
+ ___fd, errno); \
+ ___ok; \
+})
+
#define SYS(goto_label, fmt, ...) \
({ \
char cmd[1024]; \
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index 92752f5eeded..3e02d7267de8 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,8 @@ int passed;
int failed;
int map_fd[9];
struct bpf_map *maps[9];
-int prog_fd[11];
+struct bpf_program *progs[9];
+struct bpf_link *links[9];
int txmsg_pass;
int txmsg_redir;
@@ -680,7 +681,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
}
}
- s->bytes_recvd += recv;
+ if (recv > 0)
+ s->bytes_recvd += recv;
if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
errno = EMSGSIZE;
@@ -952,7 +954,8 @@ enum {
static int run_options(struct sockmap_options *options, int cg_fd, int test)
{
- int i, key, next_key, err, tx_prog_fd = -1, zero = 0;
+ int i, key, next_key, err, zero = 0;
+ struct bpf_program *tx_prog;
/* If base test skip BPF setup */
if (test == BASE || test == BASE_SENDPAGE)
@@ -960,48 +963,44 @@ static int run_options(struct sockmap_options *options, int cg_fd, int test)
/* Attach programs to sockmap */
if (!txmsg_omit_skb_parser) {
- err = bpf_prog_attach(prog_fd[0], map_fd[0],
- BPF_SK_SKB_STREAM_PARSER, 0);
- if (err) {
+ links[0] = bpf_program__attach_sockmap(progs[0], map_fd[0]);
+ if (!links[0]) {
fprintf(stderr,
- "ERROR: bpf_prog_attach (sockmap %i->%i): %d (%s)\n",
- prog_fd[0], map_fd[0], err, strerror(errno));
- return err;
+ "ERROR: bpf_program__attach_sockmap (sockmap %i->%i): (%s)\n",
+ bpf_program__fd(progs[0]), map_fd[0], strerror(errno));
+ return -1;
}
}
- err = bpf_prog_attach(prog_fd[1], map_fd[0],
- BPF_SK_SKB_STREAM_VERDICT, 0);
- if (err) {
- fprintf(stderr, "ERROR: bpf_prog_attach (sockmap): %d (%s)\n",
- err, strerror(errno));
- return err;
+ links[1] = bpf_program__attach_sockmap(progs[1], map_fd[0]);
+ if (!links[1]) {
+ fprintf(stderr, "ERROR: bpf_program__attach_sockmap (sockmap): (%s)\n",
+ strerror(errno));
+ return -1;
}
/* Attach programs to TLS sockmap */
if (txmsg_ktls_skb) {
if (!txmsg_omit_skb_parser) {
- err = bpf_prog_attach(prog_fd[0], map_fd[8],
- BPF_SK_SKB_STREAM_PARSER, 0);
- if (err) {
+ links[2] = bpf_program__attach_sockmap(progs[0], map_fd[8]);
+ if (!links[2]) {
fprintf(stderr,
- "ERROR: bpf_prog_attach (TLS sockmap %i->%i): %d (%s)\n",
- prog_fd[0], map_fd[8], err, strerror(errno));
- return err;
+ "ERROR: bpf_program__attach_sockmap (TLS sockmap %i->%i): (%s)\n",
+ bpf_program__fd(progs[0]), map_fd[8], strerror(errno));
+ return -1;
}
}
- err = bpf_prog_attach(prog_fd[2], map_fd[8],
- BPF_SK_SKB_STREAM_VERDICT, 0);
- if (err) {
- fprintf(stderr, "ERROR: bpf_prog_attach (TLS sockmap): %d (%s)\n",
- err, strerror(errno));
- return err;
+ links[3] = bpf_program__attach_sockmap(progs[2], map_fd[8]);
+ if (!links[3]) {
+ fprintf(stderr, "ERROR: bpf_program__attach_sockmap (TLS sockmap): (%s)\n",
+ strerror(errno));
+ return -1;
}
}
/* Attach to cgroups */
- err = bpf_prog_attach(prog_fd[3], cg_fd, BPF_CGROUP_SOCK_OPS, 0);
+ err = bpf_prog_attach(bpf_program__fd(progs[3]), cg_fd, BPF_CGROUP_SOCK_OPS, 0);
if (err) {
fprintf(stderr, "ERROR: bpf_prog_attach (groups): %d (%s)\n",
err, strerror(errno));
@@ -1017,30 +1016,31 @@ run:
/* Attach txmsg program to sockmap */
if (txmsg_pass)
- tx_prog_fd = prog_fd[4];
+ tx_prog = progs[4];
else if (txmsg_redir)
- tx_prog_fd = prog_fd[5];
+ tx_prog = progs[5];
else if (txmsg_apply)
- tx_prog_fd = prog_fd[6];
+ tx_prog = progs[6];
else if (txmsg_cork)
- tx_prog_fd = prog_fd[7];
+ tx_prog = progs[7];
else if (txmsg_drop)
- tx_prog_fd = prog_fd[8];
+ tx_prog = progs[8];
else
- tx_prog_fd = 0;
+ tx_prog = NULL;
- if (tx_prog_fd) {
- int redir_fd, i = 0;
+ if (tx_prog) {
+ int redir_fd;
- err = bpf_prog_attach(tx_prog_fd,
- map_fd[1], BPF_SK_MSG_VERDICT, 0);
- if (err) {
+ links[4] = bpf_program__attach_sockmap(tx_prog, map_fd[1]);
+ if (!links[4]) {
fprintf(stderr,
- "ERROR: bpf_prog_attach (txmsg): %d (%s)\n",
- err, strerror(errno));
+ "ERROR: bpf_program__attach_sockmap (txmsg): (%s)\n",
+ strerror(errno));
+ err = -1;
goto out;
}
+ i = 0;
err = bpf_map_update_elem(map_fd[1], &i, &c1, BPF_ANY);
if (err) {
fprintf(stderr,
@@ -1279,16 +1279,14 @@ run:
fprintf(stderr, "unknown test\n");
out:
/* Detatch and zero all the maps */
- bpf_prog_detach2(prog_fd[3], cg_fd, BPF_CGROUP_SOCK_OPS);
- bpf_prog_detach2(prog_fd[0], map_fd[0], BPF_SK_SKB_STREAM_PARSER);
- bpf_prog_detach2(prog_fd[1], map_fd[0], BPF_SK_SKB_STREAM_VERDICT);
- bpf_prog_detach2(prog_fd[0], map_fd[8], BPF_SK_SKB_STREAM_PARSER);
- bpf_prog_detach2(prog_fd[2], map_fd[8], BPF_SK_SKB_STREAM_VERDICT);
+ bpf_prog_detach2(bpf_program__fd(progs[3]), cg_fd, BPF_CGROUP_SOCK_OPS);
- if (tx_prog_fd >= 0)
- bpf_prog_detach2(tx_prog_fd, map_fd[1], BPF_SK_MSG_VERDICT);
+ for (i = 0; i < ARRAY_SIZE(links); i++) {
+ if (links[i])
+ bpf_link__detach(links[i]);
+ }
- for (i = 0; i < 8; i++) {
+ for (i = 0; i < ARRAY_SIZE(map_fd); i++) {
key = next_key = 0;
bpf_map_update_elem(map_fd[i], &key, &zero, BPF_ANY);
while (bpf_map_get_next_key(map_fd[i], &key, &next_key) == 0) {
@@ -1783,34 +1781,6 @@ char *map_names[] = {
"tls_sock_map",
};
-int prog_attach_type[] = {
- BPF_SK_SKB_STREAM_PARSER,
- BPF_SK_SKB_STREAM_VERDICT,
- BPF_SK_SKB_STREAM_VERDICT,
- BPF_CGROUP_SOCK_OPS,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
-};
-
-int prog_type[] = {
- BPF_PROG_TYPE_SK_SKB,
- BPF_PROG_TYPE_SK_SKB,
- BPF_PROG_TYPE_SK_SKB,
- BPF_PROG_TYPE_SOCK_OPS,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
-};
-
static int populate_progs(char *bpf_file)
{
struct bpf_program *prog;
@@ -1829,17 +1799,10 @@ static int populate_progs(char *bpf_file)
return -1;
}
- bpf_object__for_each_program(prog, obj) {
- bpf_program__set_type(prog, prog_type[i]);
- bpf_program__set_expected_attach_type(prog,
- prog_attach_type[i]);
- i++;
- }
-
i = bpf_object__load(obj);
i = 0;
bpf_object__for_each_program(prog, obj) {
- prog_fd[i] = bpf_program__fd(prog);
+ progs[i] = prog;
i++;
}
@@ -1853,6 +1816,9 @@ static int populate_progs(char *bpf_file)
}
}
+ for (i = 0; i < ARRAY_SIZE(links); i++)
+ links[i] = NULL;
+
return 0;
}
@@ -1970,7 +1936,6 @@ static void test_selftests_ktls(int cg_fd, struct sockmap_options *opt)
static int test_selftest(int cg_fd, struct sockmap_options *opt)
{
-
test_selftests_sockmap(cg_fd, opt);
test_selftests_sockhash(cg_fd, opt);
test_selftests_ktls(cg_fd, opt);
diff --git a/tools/testing/selftests/bpf/test_tcp_check_syncookie_user.c b/tools/testing/selftests/bpf/test_tcp_check_syncookie_user.c
index 7b5fc98838cd..3844f9b8232a 100644
--- a/tools/testing/selftests/bpf/test_tcp_check_syncookie_user.c
+++ b/tools/testing/selftests/bpf/test_tcp_check_syncookie_user.c
@@ -139,14 +139,14 @@ out:
return ret;
}
-static int v6only_true(int fd, const struct post_socket_opts *opts)
+static int v6only_true(int fd, void *opts)
{
int mode = true;
return setsockopt(fd, IPPROTO_IPV6, IPV6_V6ONLY, &mode, sizeof(mode));
}
-static int v6only_false(int fd, const struct post_socket_opts *opts)
+static int v6only_false(int fd, void *opts)
{
int mode = false;
@@ -156,10 +156,6 @@ static int v6only_false(int fd, const struct post_socket_opts *opts)
int main(int argc, char **argv)
{
struct network_helper_opts opts = { 0 };
- struct sockaddr_in addr4;
- struct sockaddr_in6 addr6;
- struct sockaddr_in addr4dual;
- struct sockaddr_in6 addr6dual;
int server = -1;
int server_v6 = -1;
int server_dual = -1;
@@ -181,36 +177,17 @@ int main(int argc, char **argv)
goto err;
}
- memset(&addr4, 0, sizeof(addr4));
- addr4.sin_family = AF_INET;
- addr4.sin_addr.s_addr = htonl(INADDR_LOOPBACK);
- addr4.sin_port = 0;
- memcpy(&addr4dual, &addr4, sizeof(addr4dual));
-
- memset(&addr6, 0, sizeof(addr6));
- addr6.sin6_family = AF_INET6;
- addr6.sin6_addr = in6addr_loopback;
- addr6.sin6_port = 0;
-
- memset(&addr6dual, 0, sizeof(addr6dual));
- addr6dual.sin6_family = AF_INET6;
- addr6dual.sin6_addr = in6addr_any;
- addr6dual.sin6_port = 0;
-
- server = start_server_addr(SOCK_STREAM, (struct sockaddr_storage *)&addr4,
- sizeof(addr4), NULL);
+ server = start_server_str(AF_INET, SOCK_STREAM, "127.0.0.1", 0, NULL);
if (server == -1)
goto err;
opts.post_socket_cb = v6only_true;
- server_v6 = start_server_addr(SOCK_STREAM, (struct sockaddr_storage *)&addr6,
- sizeof(addr6), &opts);
+ server_v6 = start_server_str(AF_INET6, SOCK_STREAM, "::1", 0, &opts);
if (server_v6 == -1)
goto err;
opts.post_socket_cb = v6only_false;
- server_dual = start_server_addr(SOCK_STREAM, (struct sockaddr_storage *)&addr6dual,
- sizeof(addr6dual), &opts);
+ server_dual = start_server_str(AF_INET6, SOCK_STREAM, "::0", 0, &opts);
if (server_dual == -1)
goto err;
diff --git a/tools/testing/selftests/bpf/test_verifier.c b/tools/testing/selftests/bpf/test_verifier.c
index df04bda1c927..610392dfc4fb 100644
--- a/tools/testing/selftests/bpf/test_verifier.c
+++ b/tools/testing/selftests/bpf/test_verifier.c
@@ -1237,11 +1237,6 @@ static void do_test_fixup(struct bpf_test *test, enum bpf_prog_type prog_type,
fixup_prog_kfuncs(prog, fd_array, test->fixup_kfunc_btf_id);
}
-struct libcap {
- struct __user_cap_header_struct hdr;
- struct __user_cap_data_struct data[2];
-};
-
static int set_admin(bool admin)
{
int err;
diff --git a/tools/testing/selftests/bpf/trace_helpers.c b/tools/testing/selftests/bpf/trace_helpers.c
index 70e29f316fe7..465d196c7165 100644
--- a/tools/testing/selftests/bpf/trace_helpers.c
+++ b/tools/testing/selftests/bpf/trace_helpers.c
@@ -211,7 +211,7 @@ long ksym_get_addr(const char *name)
*/
int kallsyms_find(const char *sym, unsigned long long *addr)
{
- char type, name[500];
+ char type, name[500], *match;
unsigned long long value;
int err = 0;
FILE *f;
@@ -221,6 +221,17 @@ int kallsyms_find(const char *sym, unsigned long long *addr)
return -EINVAL;
while (fscanf(f, "%llx %c %499s%*[^\n]\n", &value, &type, name) > 0) {
+ /* If CONFIG_LTO_CLANG_THIN is enabled, static variable/function
+ * symbols could be promoted to global due to cross-file inlining.
+ * For such cases, clang compiler will add .llvm.<hash> suffix
+ * to those symbols to avoid potential naming conflict.
+ * Let us ignore .llvm.<hash> suffix during symbol comparison.
+ */
+ if (type == 'd') {
+ match = strstr(name, ".llvm.");
+ if (match)
+ *match = '\0';
+ }
if (strcmp(name, sym) == 0) {
*addr = value;
goto out;
diff --git a/tools/testing/selftests/bpf/verifier/calls.c b/tools/testing/selftests/bpf/verifier/calls.c
index ab25a81fd3a1..d0cdd156cd55 100644
--- a/tools/testing/selftests/bpf/verifier/calls.c
+++ b/tools/testing/selftests/bpf/verifier/calls.c
@@ -76,7 +76,7 @@
},
.prog_type = BPF_PROG_TYPE_SCHED_CLS,
.result = REJECT,
- .errstr = "R1 must have zero offset when passed to release func or trusted arg to kfunc",
+ .errstr = "arg#0 expected pointer to ctx, but got PTR",
.fixup_kfunc_btf_id = {
{ "bpf_kfunc_call_test_pass_ctx", 2 },
},
@@ -276,6 +276,19 @@
.result = ACCEPT,
},
{
+ "calls: invalid kfunc call: must provide (attach_prog_fd, btf_id) pair when freplace",
+ .insns = {
+ BPF_RAW_INSN(BPF_JMP | BPF_CALL, 0, BPF_PSEUDO_KFUNC_CALL, 0, 0),
+ BPF_EXIT_INSN(),
+ },
+ .prog_type = BPF_PROG_TYPE_EXT,
+ .result = REJECT,
+ .errstr = "Tracing programs must provide btf_id",
+ .fixup_kfunc_btf_id = {
+ { "bpf_dynptr_from_skb", 0 },
+ },
+},
+{
"calls: basic sanity",
.insns = {
BPF_RAW_INSN(BPF_JMP | BPF_CALL, 0, 1, 0, 2),
diff --git a/tools/testing/selftests/bpf/verifier/precise.c b/tools/testing/selftests/bpf/verifier/precise.c
index 0a9293a57211..90643ccc221d 100644
--- a/tools/testing/selftests/bpf/verifier/precise.c
+++ b/tools/testing/selftests/bpf/verifier/precise.c
@@ -39,12 +39,12 @@
.result = VERBOSE_ACCEPT,
.errstr =
"mark_precise: frame0: last_idx 26 first_idx 20\
- mark_precise: frame0: regs=r2 stack= before 25\
- mark_precise: frame0: regs=r2 stack= before 24\
- mark_precise: frame0: regs=r2 stack= before 23\
- mark_precise: frame0: regs=r2 stack= before 22\
- mark_precise: frame0: regs=r2 stack= before 20\
- mark_precise: frame0: parent state regs=r2 stack=:\
+ mark_precise: frame0: regs=r2,r9 stack= before 25\
+ mark_precise: frame0: regs=r2,r9 stack= before 24\
+ mark_precise: frame0: regs=r2,r9 stack= before 23\
+ mark_precise: frame0: regs=r2,r9 stack= before 22\
+ mark_precise: frame0: regs=r2,r9 stack= before 20\
+ mark_precise: frame0: parent state regs=r2,r9 stack=:\
mark_precise: frame0: last_idx 19 first_idx 10\
mark_precise: frame0: regs=r2,r9 stack= before 19\
mark_precise: frame0: regs=r9 stack= before 18\
@@ -100,11 +100,11 @@
.errstr =
"26: (85) call bpf_probe_read_kernel#113\
mark_precise: frame0: last_idx 26 first_idx 22\
- mark_precise: frame0: regs=r2 stack= before 25\
- mark_precise: frame0: regs=r2 stack= before 24\
- mark_precise: frame0: regs=r2 stack= before 23\
- mark_precise: frame0: regs=r2 stack= before 22\
- mark_precise: frame0: parent state regs=r2 stack=:\
+ mark_precise: frame0: regs=r2,r9 stack= before 25\
+ mark_precise: frame0: regs=r2,r9 stack= before 24\
+ mark_precise: frame0: regs=r2,r9 stack= before 23\
+ mark_precise: frame0: regs=r2,r9 stack= before 22\
+ mark_precise: frame0: parent state regs=r2,r9 stack=:\
mark_precise: frame0: last_idx 20 first_idx 20\
mark_precise: frame0: regs=r2,r9 stack= before 20\
mark_precise: frame0: parent state regs=r2,r9 stack=:\
diff --git a/tools/testing/selftests/bpf/xskxceiver.c b/tools/testing/selftests/bpf/xskxceiver.c
index 2eac0895b0a1..8144fd145237 100644
--- a/tools/testing/selftests/bpf/xskxceiver.c
+++ b/tools/testing/selftests/bpf/xskxceiver.c
@@ -196,6 +196,12 @@ static int xsk_configure_umem(struct ifobject *ifobj, struct xsk_umem_info *umem
};
int ret;
+ if (umem->fill_size)
+ cfg.fill_size = umem->fill_size;
+
+ if (umem->comp_size)
+ cfg.comp_size = umem->comp_size;
+
if (umem->unaligned_mode)
cfg.flags |= XDP_UMEM_UNALIGNED_CHUNK_FLAG;
@@ -265,6 +271,10 @@ static int __xsk_configure_socket(struct xsk_socket_info *xsk, struct xsk_umem_i
cfg.bind_flags |= XDP_SHARED_UMEM;
if (ifobject->mtu > MAX_ETH_PKT_SIZE)
cfg.bind_flags |= XDP_USE_SG;
+ if (umem->comp_size)
+ cfg.tx_size = umem->comp_size;
+ if (umem->fill_size)
+ cfg.rx_size = umem->fill_size;
txr = ifobject->tx_on ? &xsk->tx : NULL;
rxr = ifobject->rx_on ? &xsk->rx : NULL;
@@ -1616,7 +1626,7 @@ static void xsk_populate_fill_ring(struct xsk_umem_info *umem, struct pkt_stream
if (umem->num_frames < XSK_RING_PROD__DEFAULT_NUM_DESCS)
buffers_to_fill = umem->num_frames;
else
- buffers_to_fill = XSK_RING_PROD__DEFAULT_NUM_DESCS;
+ buffers_to_fill = umem->fill_size;
ret = xsk_ring_prod__reserve(&umem->fq, buffers_to_fill, &idx);
if (ret != buffers_to_fill)
@@ -1899,11 +1909,15 @@ static int testapp_validate_traffic(struct test_spec *test)
}
if (test->set_ring) {
- if (ifobj_tx->hw_ring_size_supp)
- return set_ring_size(ifobj_tx);
-
- ksft_test_result_skip("Changing HW ring size not supported.\n");
- return TEST_SKIP;
+ if (ifobj_tx->hw_ring_size_supp) {
+ if (set_ring_size(ifobj_tx)) {
+ ksft_test_result_skip("Failed to change HW ring size.\n");
+ return TEST_FAILURE;
+ }
+ } else {
+ ksft_test_result_skip("Changing HW ring size not supported.\n");
+ return TEST_SKIP;
+ }
}
xsk_attach_xdp_progs(test, ifobj_rx, ifobj_tx);
@@ -2441,7 +2455,7 @@ static int testapp_hw_sw_min_ring_size(struct test_spec *test)
static int testapp_hw_sw_max_ring_size(struct test_spec *test)
{
- u32 max_descs = XSK_RING_PROD__DEFAULT_NUM_DESCS * 2;
+ u32 max_descs = XSK_RING_PROD__DEFAULT_NUM_DESCS * 4;
int ret;
test->set_ring = true;
@@ -2449,7 +2463,8 @@ static int testapp_hw_sw_max_ring_size(struct test_spec *test)
test->ifobj_tx->ring.tx_pending = test->ifobj_tx->ring.tx_max_pending;
test->ifobj_tx->ring.rx_pending = test->ifobj_tx->ring.rx_max_pending;
test->ifobj_rx->umem->num_frames = max_descs;
- test->ifobj_rx->xsk->rxqsize = max_descs;
+ test->ifobj_rx->umem->fill_size = max_descs;
+ test->ifobj_rx->umem->comp_size = max_descs;
test->ifobj_tx->xsk->batch_size = XSK_RING_PROD__DEFAULT_NUM_DESCS;
test->ifobj_rx->xsk->batch_size = XSK_RING_PROD__DEFAULT_NUM_DESCS;
@@ -2457,9 +2472,12 @@ static int testapp_hw_sw_max_ring_size(struct test_spec *test)
if (ret)
return ret;
- /* Set batch_size to 4095 */
- test->ifobj_tx->xsk->batch_size = max_descs - 1;
- test->ifobj_rx->xsk->batch_size = max_descs - 1;
+ /* Set batch_size to 8152 for testing, as the ice HW ignores the 3 lowest bits when
+ * updating the Rx HW tail register.
+ */
+ test->ifobj_tx->xsk->batch_size = test->ifobj_tx->ring.tx_max_pending - 8;
+ test->ifobj_rx->xsk->batch_size = test->ifobj_tx->ring.tx_max_pending - 8;
+ pkt_stream_replace(test, max_descs, MIN_PKT_SIZE);
return testapp_validate_traffic(test);
}
diff --git a/tools/testing/selftests/bpf/xskxceiver.h b/tools/testing/selftests/bpf/xskxceiver.h
index 906de5fab7a3..885c948c5d83 100644
--- a/tools/testing/selftests/bpf/xskxceiver.h
+++ b/tools/testing/selftests/bpf/xskxceiver.h
@@ -80,6 +80,8 @@ struct xsk_umem_info {
void *buffer;
u32 frame_size;
u32 base_addr;
+ u32 fill_size;
+ u32 comp_size;
bool unaligned_mode;
};
diff --git a/tools/testing/selftests/breakpoints/step_after_suspend_test.c b/tools/testing/selftests/breakpoints/step_after_suspend_test.c
index b8703c499d28..dfec31fb9b30 100644
--- a/tools/testing/selftests/breakpoints/step_after_suspend_test.c
+++ b/tools/testing/selftests/breakpoints/step_after_suspend_test.c
@@ -130,7 +130,6 @@ int run_test(int cpu)
void suspend(void)
{
int power_state_fd;
- struct sigevent event = {};
int timerfd;
int err;
struct itimerspec spec = {};
diff --git a/tools/testing/selftests/cachestat/test_cachestat.c b/tools/testing/selftests/cachestat/test_cachestat.c
index b171fd53b004..632ab44737ec 100644
--- a/tools/testing/selftests/cachestat/test_cachestat.c
+++ b/tools/testing/selftests/cachestat/test_cachestat.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
#define _GNU_SOURCE
+#define __SANE_USERSPACE_TYPES__ // Use ll64
#include <stdio.h>
#include <stdbool.h>
diff --git a/tools/testing/selftests/cgroup/.gitignore b/tools/testing/selftests/cgroup/.gitignore
index 2732e0b29271..952e4448bf07 100644
--- a/tools/testing/selftests/cgroup/.gitignore
+++ b/tools/testing/selftests/cgroup/.gitignore
@@ -1,11 +1,12 @@
# SPDX-License-Identifier: GPL-2.0-only
-test_memcontrol
test_core
-test_freezer
-test_kmem
-test_kill
test_cpu
test_cpuset
-test_zswap
+test_freezer
test_hugetlb_memcg
+test_kill
+test_kmem
+test_memcontrol
+test_pids
+test_zswap
wait_inotify
diff --git a/tools/testing/selftests/cgroup/Makefile b/tools/testing/selftests/cgroup/Makefile
index 16461dc0ffdf..1b897152bab6 100644
--- a/tools/testing/selftests/cgroup/Makefile
+++ b/tools/testing/selftests/cgroup/Makefile
@@ -6,26 +6,29 @@ all: ${HELPER_PROGS}
TEST_FILES := with_stress.sh
TEST_PROGS := test_stress.sh test_cpuset_prs.sh test_cpuset_v1_hp.sh
TEST_GEN_FILES := wait_inotify
-TEST_GEN_PROGS = test_memcontrol
-TEST_GEN_PROGS += test_kmem
-TEST_GEN_PROGS += test_core
-TEST_GEN_PROGS += test_freezer
-TEST_GEN_PROGS += test_kill
+# Keep the lists lexicographically sorted
+TEST_GEN_PROGS = test_core
TEST_GEN_PROGS += test_cpu
TEST_GEN_PROGS += test_cpuset
-TEST_GEN_PROGS += test_zswap
+TEST_GEN_PROGS += test_freezer
TEST_GEN_PROGS += test_hugetlb_memcg
+TEST_GEN_PROGS += test_kill
+TEST_GEN_PROGS += test_kmem
+TEST_GEN_PROGS += test_memcontrol
+TEST_GEN_PROGS += test_pids
+TEST_GEN_PROGS += test_zswap
LOCAL_HDRS += $(selfdir)/clone3/clone3_selftests.h $(selfdir)/pidfd/pidfd.h
include ../lib.mk
-$(OUTPUT)/test_memcontrol: cgroup_util.c
-$(OUTPUT)/test_kmem: cgroup_util.c
$(OUTPUT)/test_core: cgroup_util.c
-$(OUTPUT)/test_freezer: cgroup_util.c
-$(OUTPUT)/test_kill: cgroup_util.c
$(OUTPUT)/test_cpu: cgroup_util.c
$(OUTPUT)/test_cpuset: cgroup_util.c
-$(OUTPUT)/test_zswap: cgroup_util.c
+$(OUTPUT)/test_freezer: cgroup_util.c
$(OUTPUT)/test_hugetlb_memcg: cgroup_util.c
+$(OUTPUT)/test_kill: cgroup_util.c
+$(OUTPUT)/test_kmem: cgroup_util.c
+$(OUTPUT)/test_memcontrol: cgroup_util.c
+$(OUTPUT)/test_pids: cgroup_util.c
+$(OUTPUT)/test_zswap: cgroup_util.c
diff --git a/tools/testing/selftests/cgroup/test_cpuset_prs.sh b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
index b5eb1be2248c..7c08cc153367 100755
--- a/tools/testing/selftests/cgroup/test_cpuset_prs.sh
+++ b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
@@ -28,6 +28,14 @@ CPULIST=$(cat $CGROUP2/cpuset.cpus.effective)
NR_CPUS=$(lscpu | grep "^CPU(s):" | sed -e "s/.*:[[:space:]]*//")
[[ $NR_CPUS -lt 8 ]] && skip_test "Test needs at least 8 cpus available!"
+# Check to see if /dev/console exists and is writable
+if [[ -c /dev/console && -w /dev/console ]]
+then
+ CONSOLE=/dev/console
+else
+ CONSOLE=/dev/null
+fi
+
# Set verbose flag and delay factor
PROG=$1
VERBOSE=0
@@ -103,8 +111,8 @@ console_msg()
{
MSG=$1
echo "$MSG"
- echo "" > /dev/console
- echo "$MSG" > /dev/console
+ echo "" > $CONSOLE
+ echo "$MSG" > $CONSOLE
pause 0.01
}
@@ -161,6 +169,14 @@ test_add_proc()
# T = put a task into cgroup
# O<c>=<v> = Write <v> to CPU online file of <c>
#
+# ECPUs - effective CPUs of cpusets
+# Pstate - partition root state
+# ISOLCPUS - isolated CPUs (<icpus>[,<icpus2>])
+#
+# Note that if there are 2 fields in ISOLCPUS, the first one is for
+# sched-debug matching which includes offline CPUs and single-CPU partitions
+# while the second one is for matching cpuset.cpus.isolated.
+#
SETUP_A123_PARTITIONS="C1-3:P1:S+ C2-3:P1:S+ C3:P1"
TEST_MATRIX=(
# old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS
@@ -220,23 +236,29 @@ TEST_MATRIX=(
" C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3:P2 . . 0 A1:0-1,A2:2-3,A3:2-3 A1:P0,A2:P2 2-3"
" C0-3:S+ C1-3:S+ C2-3 . X2-3 X3:P2 . . 0 A1:0-2,A2:3,A3:3 A1:P0,A2:P2 3"
" C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2 . 0 A1:0-1,A2:1,A3:2-3 A1:P0,A3:P2 2-3"
- " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2:C3 . 0 A1:0-2,A2:1-2,A3:3 A1:P0,A3:P2 3"
+ " C0-3:S+ C1-3:S+ C2-3 . X2-3 X2-3 X2-3:P2:C3 . 0 A1:0-1,A2:1,A3:2-3 A1:P0,A3:P2 2-3"
" C0-3:S+ C1-3:S+ C2-3 C2-3 . . . P2 0 A1:0-3,A2:1-3,A3:2-3,B1:2-3 A1:P0,A3:P0,B1:P-2"
" C0-3:S+ C1-3:S+ C2-3 C4-5 . . . P2 0 B1:4-5 B1:P2 4-5"
" C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2 P2 0 A3:2-3,B1:4 A3:P2,B1:P2 2-4"
" C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2:C1-3 P2 0 A3:2-3,B1:4 A3:P2,B1:P2 2-4"
" C0-3:S+ C1-3:S+ C2-3 C4 X1-3 X1-3:P2 P2 . 0 A2:1,A3:2-3 A2:P2,A3:P2 1-3"
" C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3 X2-3:P2 P2:C4-5 0 A3:2-3,B1:4-5 A3:P2,B1:P2 2-5"
+ " C4:X0-3:S+ X1-3:S+ X2-3 . . P2 . . 0 A1:4,A2:1-3,A3:1-3 A2:P2 1-3"
+ " C4:X0-3:S+ X1-3:S+ X2-3 . . . P2 . 0 A1:4,A2:4,A3:2-3 A3:P2 2-3"
# Nested remote/local partition tests
" C0-3:S+ C1-3:S+ C2-3 C4-5 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:,A3:2-3,B1:4-5 \
A1:P0,A2:P1,A3:P2,B1:P1 2-3"
" C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:,A3:2-3,B1:4 \
A1:P0,A2:P1,A3:P2,B1:P1 2-4,2-3"
+ " C0-3:S+ C1-3:S+ C2-3 C4 X2-3 X2-3:P1 . P1 0 A1:0-1,A2:2-3,A3:2-3,B1:4 \
+ A1:P0,A2:P1,A3:P0,B1:P1"
" C0-3:S+ C1-3:S+ C3 C4 X2-3 X2-3:P1 P2 P1 0 A1:0-1,A2:2,A3:3,B1:4 \
A1:P0,A2:P1,A3:P2,B1:P1 2-4,3"
" C0-4:S+ C1-4:S+ C2-4 . X2-4 X2-4:P2 X4:P1 . 0 A1:0-1,A2:2-3,A3:4 \
A1:P0,A2:P2,A3:P1 2-4,2-3"
+ " C0-4:S+ C1-4:S+ C2-4 . X2-4 X2-4:P2 X3-4:P1 . 0 A1:0-1,A2:2,A3:3-4 \
+ A1:P0,A2:P2,A3:P1 2"
" C0-4:X2-4:S+ C1-4:X2-4:S+:P2 C2-4:X4:P1 \
. . X5 . . 0 A1:0-4,A2:1-4,A3:2-4 \
A1:P0,A2:P-2,A3:P-1"
@@ -262,8 +284,8 @@ TEST_MATRIX=(
. . X2-3 P2 . . 0 A1:0-2,A2:3,XA2:3 A2:P2 3"
# Invalid to valid local partition direct transition tests
- " C1-3:S+:P2 C2-3:X1:P2 . . . . . . 0 A1:1-3,XA1:1-3,A2:2-3:XA2: A1:P2,A2:P-2 1-3"
- " C1-3:S+:P2 C2-3:X1:P2 . . . X3:P2 . . 0 A1:1-2,XA1:1-3,A2:3:XA2:3 A1:P2,A2:P2 1-3"
+ " C1-3:S+:P2 X4:P2 . . . . . . 0 A1:1-3,XA1:1-3,A2:1-3:XA2: A1:P2,A2:P-2 1-3"
+ " C1-3:S+:P2 X4:P2 . . . X3:P2 . . 0 A1:1-2,XA1:1-3,A2:3:XA2:3 A1:P2,A2:P2 1-3"
" C0-3:P2 . . C4-6 C0-4 . . . 0 A1:0-4,B1:4-6 A1:P-2,B1:P0"
" C0-3:P2 . . C4-6 C0-4:C0-3 . . . 0 A1:0-3,B1:4-6 A1:P2,B1:P0 0-3"
" C0-3:P2 . . C3-5:C4-5 . . . . 0 A1:0-3,B1:4-5 A1:P2,B1:P0 0-3"
@@ -274,32 +296,26 @@ TEST_MATRIX=(
" C0-3:X1-3:S+:P2 C1-3:X2-3:S+:P2 C2-3:X3:P2 \
. . X4 . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3"
" C0-3:X1-3:S+:P2 C1-3:X2-3:S+:P2 C2-3:X3:P2 \
- . . C4 . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3"
+ . . C4:X . . 0 A1:1-3,A2:1-3,A3:2-3,XA2:,XA3: A1:P2,A2:P-2,A3:P-2 1-3"
# Local partition CPU change tests
" C0-5:S+:P2 C4-5:S+:P1 . . . C3-5 . . 0 A1:0-2,A2:3-5 A1:P2,A2:P1 0-2"
" C0-5:S+:P2 C4-5:S+:P1 . . C1-5 . . . 0 A1:1-3,A2:4-5 A1:P2,A2:P1 1-3"
# cpus_allowed/exclusive_cpus update tests
" C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \
- . C4 . P2 . 0 A1:4,A2:4,XA2:,XA3:,A3:4 \
+ . X:C4 . P2 . 0 A1:4,A2:4,XA2:,XA3:,A3:4 \
A1:P0,A3:P-2"
" C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \
. X1 . P2 . 0 A1:0-3,A2:1-3,XA1:1,XA2:,XA3:,A3:2-3 \
A1:P0,A3:P-2"
" C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \
- . . C3 P2 . 0 A1:0-2,A2:0-2,XA2:3,XA3:3,A3:3 \
- A1:P0,A3:P2 3"
- " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3 \
. . X3 P2 . 0 A1:0-2,A2:1-2,XA2:3,XA3:3,A3:3 \
A1:P0,A3:P2 3"
" C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \
. . X3 . . 0 A1:0-3,A2:1-3,XA2:3,XA3:3,A3:2-3 \
A1:P0,A3:P-2"
" C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \
- . . C3 . . 0 A1:0-3,A2:3,XA2:3,XA3:3,A3:3 \
- A1:P0,A3:P-2"
- " C0-3:X2-3:S+ C1-3:X2-3:S+ C2-3:X2-3:P2 \
- . C4 . . . 0 A1:4,A2:4,A3:4,XA1:,XA2:,XA3 \
+ . X4 . . . 0 A1:0-3,A2:1-3,A3:2-3,XA1:4,XA2:,XA3 \
A1:P0,A3:P-2"
# old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS
@@ -346,6 +362,9 @@ TEST_MATRIX=(
" C0-1:P1 . . P1:C2-3 C0-2 . . . 0 A1:0-2,B1:2-3 A1:P-1,B1:P-1"
" C0-1 . . P1:C2-3 C0-2 . . . 0 A1:0-2,B1:2-3 A1:P0,B1:P-1"
+ # cpuset.cpus can overlap with sibling cpuset.cpus.exclusive but not subsumed by it
+ " C0-3 . . C4-5 X5 . . . 0 A1:0-3,B1:4-5"
+
# old-A1 old-A2 old-A3 old-B1 new-A1 new-A2 new-A3 new-B1 fail ECPUs Pstate ISOLCPUS
# ------ ------ ------ ------ ------ ------ ------ ------ ---- ----- ------ --------
# Failure cases:
@@ -355,6 +374,9 @@ TEST_MATRIX=(
# Changes to cpuset.cpus.exclusive that violate exclusivity rule is rejected
" C0-3 . . C4-5 X0-3 . . X3-5 1 A1:0-3,B1:4-5"
+
+ # cpuset.cpus cannot be a subset of sibling cpuset.cpus.exclusive
+ " C0-3 . . C4-5 X3-5 . . . 1 A1:0-3,B1:4-5"
)
#
@@ -556,14 +578,15 @@ check_cgroup_states()
do
set -- $(echo $CHK | sed -e "s/:/ /g")
CGRP=$1
+ CGRP_DIR=$CGRP
STATE=$2
FILE=
EVAL=$(expr substr $STATE 2 2)
- [[ $CGRP = A2 ]] && CGRP=A1/A2
- [[ $CGRP = A3 ]] && CGRP=A1/A2/A3
+ [[ $CGRP = A2 ]] && CGRP_DIR=A1/A2
+ [[ $CGRP = A3 ]] && CGRP_DIR=A1/A2/A3
case $STATE in
- P*) FILE=$CGRP/cpuset.cpus.partition
+ P*) FILE=$CGRP_DIR/cpuset.cpus.partition
;;
*) echo "Unknown state: $STATE!"
exit 1
@@ -587,6 +610,16 @@ check_cgroup_states()
;;
esac
[[ $EVAL != $VAL ]] && return 1
+
+ #
+ # For root partition, dump sched-domains info to console if
+ # verbose mode set for manual comparison with sched debug info.
+ #
+ [[ $VAL -eq 1 && $VERBOSE -gt 0 ]] && {
+ DOMS=$(cat $CGRP_DIR/cpuset.cpus.effective)
+ [[ -n "$DOMS" ]] &&
+ echo " [$CGRP] sched-domain: $DOMS" > $CONSOLE
+ }
done
return 0
}
@@ -694,9 +727,9 @@ null_isolcpus_check()
[[ $VERBOSE -gt 0 ]] || return 0
# Retry a few times before printing error
RETRY=0
- while [[ $RETRY -lt 5 ]]
+ while [[ $RETRY -lt 8 ]]
do
- pause 0.01
+ pause 0.02
check_isolcpus "."
[[ $? -eq 0 ]] && return 0
((RETRY++))
@@ -726,7 +759,7 @@ run_state_test()
while [[ $I -lt $CNT ]]
do
- echo "Running test $I ..." > /dev/console
+ echo "Running test $I ..." > $CONSOLE
[[ $VERBOSE -gt 1 ]] && {
echo ""
eval echo \${$TEST[$I]}
@@ -783,7 +816,7 @@ run_state_test()
while [[ $NEWLIST != $CPULIST && $RETRY -lt 8 ]]
do
# Wait a bit longer & recheck a few times
- pause 0.01
+ pause 0.02
((RETRY++))
NEWLIST=$(cat cpuset.cpus.effective)
done
diff --git a/tools/testing/selftests/cgroup/test_pids.c b/tools/testing/selftests/cgroup/test_pids.c
new file mode 100644
index 000000000000..9ecb83c6cc5c
--- /dev/null
+++ b/tools/testing/selftests/cgroup/test_pids.c
@@ -0,0 +1,178 @@
+// SPDX-License-Identifier: GPL-2.0
+#define _GNU_SOURCE
+
+#include <errno.h>
+#include <linux/limits.h>
+#include <signal.h>
+#include <string.h>
+#include <sys/stat.h>
+#include <sys/types.h>
+#include <unistd.h>
+
+#include "../kselftest.h"
+#include "cgroup_util.h"
+
+static int run_success(const char *cgroup, void *arg)
+{
+ return 0;
+}
+
+static int run_pause(const char *cgroup, void *arg)
+{
+ return pause();
+}
+
+/*
+ * This test checks that pids.max prevents forking new children above the
+ * specified limit in the cgroup.
+ */
+static int test_pids_max(const char *root)
+{
+ int ret = KSFT_FAIL;
+ char *cg_pids;
+ int pid;
+
+ cg_pids = cg_name(root, "pids_test");
+ if (!cg_pids)
+ goto cleanup;
+
+ if (cg_create(cg_pids))
+ goto cleanup;
+
+ if (cg_read_strcmp(cg_pids, "pids.max", "max\n"))
+ goto cleanup;
+
+ if (cg_write(cg_pids, "pids.max", "2"))
+ goto cleanup;
+
+ if (cg_enter_current(cg_pids))
+ goto cleanup;
+
+ pid = cg_run_nowait(cg_pids, run_pause, NULL);
+ if (pid < 0)
+ goto cleanup;
+
+ if (cg_run_nowait(cg_pids, run_success, NULL) != -1 || errno != EAGAIN)
+ goto cleanup;
+
+ if (kill(pid, SIGINT))
+ goto cleanup;
+
+ ret = KSFT_PASS;
+
+cleanup:
+ cg_enter_current(root);
+ cg_destroy(cg_pids);
+ free(cg_pids);
+
+ return ret;
+}
+
+/*
+ * This test checks that pids.events are counted in cgroup associated with pids.max
+ */
+static int test_pids_events(const char *root)
+{
+ int ret = KSFT_FAIL;
+ char *cg_parent = NULL, *cg_child = NULL;
+ int pid;
+
+ cg_parent = cg_name(root, "pids_parent");
+ cg_child = cg_name(cg_parent, "pids_child");
+ if (!cg_parent || !cg_child)
+ goto cleanup;
+
+ if (cg_create(cg_parent))
+ goto cleanup;
+ if (cg_write(cg_parent, "cgroup.subtree_control", "+pids"))
+ goto cleanup;
+ if (cg_create(cg_child))
+ goto cleanup;
+
+ if (cg_write(cg_parent, "pids.max", "2"))
+ goto cleanup;
+
+ if (cg_read_strcmp(cg_child, "pids.max", "max\n"))
+ goto cleanup;
+
+ if (cg_enter_current(cg_child))
+ goto cleanup;
+
+ pid = cg_run_nowait(cg_child, run_pause, NULL);
+ if (pid < 0)
+ goto cleanup;
+
+ if (cg_run_nowait(cg_child, run_success, NULL) != -1 || errno != EAGAIN)
+ goto cleanup;
+
+ if (kill(pid, SIGINT))
+ goto cleanup;
+
+ if (cg_read_key_long(cg_child, "pids.events", "max ") != 0)
+ goto cleanup;
+ if (cg_read_key_long(cg_parent, "pids.events", "max ") != 1)
+ goto cleanup;
+
+
+ ret = KSFT_PASS;
+
+cleanup:
+ cg_enter_current(root);
+ if (cg_child)
+ cg_destroy(cg_child);
+ if (cg_parent)
+ cg_destroy(cg_parent);
+ free(cg_child);
+ free(cg_parent);
+
+ return ret;
+}
+
+
+
+#define T(x) { x, #x }
+struct pids_test {
+ int (*fn)(const char *root);
+ const char *name;
+} tests[] = {
+ T(test_pids_max),
+ T(test_pids_events),
+};
+#undef T
+
+int main(int argc, char **argv)
+{
+ char root[PATH_MAX];
+
+ ksft_print_header();
+ ksft_set_plan(ARRAY_SIZE(tests));
+ if (cg_find_unified_root(root, sizeof(root), NULL))
+ ksft_exit_skip("cgroup v2 isn't mounted\n");
+
+ /*
+ * Check that pids controller is available:
+ * pids is listed in cgroup.controllers
+ */
+ if (cg_read_strstr(root, "cgroup.controllers", "pids"))
+ ksft_exit_skip("pids controller isn't available\n");
+
+ if (cg_read_strstr(root, "cgroup.subtree_control", "pids"))
+ if (cg_write(root, "cgroup.subtree_control", "+pids"))
+ ksft_exit_skip("Failed to set pids controller\n");
+
+ for (int i = 0; i < ARRAY_SIZE(tests); i++) {
+ switch (tests[i].fn(root)) {
+ case KSFT_PASS:
+ ksft_test_result_pass("%s\n", tests[i].name);
+ break;
+ case KSFT_SKIP:
+ ksft_test_result_skip("%s\n", tests[i].name);
+ break;
+ default:
+ ksft_test_result_fail("%s\n", tests[i].name);
+ break;
+ }
+ }
+
+ ksft_finished();
+}
diff --git a/tools/testing/selftests/dma/dma_map_benchmark.c b/tools/testing/selftests/dma/dma_map_benchmark.c
index 5c997f17fcbd..b12f1f9babf8 100644
--- a/tools/testing/selftests/dma/dma_map_benchmark.c
+++ b/tools/testing/selftests/dma/dma_map_benchmark.c
@@ -33,7 +33,6 @@ int main(int argc, char **argv)
int granule = 1;
int cmd = DMA_MAP_BENCHMARK;
- char *p;
while ((opt = getopt(argc, argv, "t:s:n:b:d:x:g:")) != -1) {
switch (opt) {
diff --git a/tools/testing/selftests/drivers/net/hw/Makefile b/tools/testing/selftests/drivers/net/hw/Makefile
index 4933d045ab66..c9f2f48fc30f 100644
--- a/tools/testing/selftests/drivers/net/hw/Makefile
+++ b/tools/testing/selftests/drivers/net/hw/Makefile
@@ -11,6 +11,7 @@ TEST_PROGS = \
hw_stats_l3_gre.sh \
loopback.sh \
pp_alloc_fail.py \
+ rss_ctx.py \
#
TEST_FILES := \
diff --git a/tools/testing/selftests/drivers/net/hw/rss_ctx.py b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
new file mode 100755
index 000000000000..931dbc36ca43
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
@@ -0,0 +1,522 @@
+#!/usr/bin/env python3
+# SPDX-License-Identifier: GPL-2.0
+
+import datetime
+import random
+from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ge, ksft_lt
+from lib.py import NetDrvEpEnv
+from lib.py import EthtoolFamily, NetdevFamily
+from lib.py import KsftSkipEx
+from lib.py import rand_port
+from lib.py import ethtool, ip, defer, GenerateTraffic, CmdExitFailure
+
+
+def _rss_key_str(key):
+ return ":".join(["{:02x}".format(x) for x in key])
+
+
+def _rss_key_rand(length):
+ return [random.randint(0, 255) for _ in range(length)]
+
+
+def get_rss(cfg, context=0):
+ return ethtool(f"-x {cfg.ifname} context {context}", json=True)[0]
+
+
+def get_drop_err_sum(cfg):
+ stats = ip("-s -s link show dev " + cfg.ifname, json=True)[0]
+ cnt = 0
+ for key in ['errors', 'dropped', 'over_errors', 'fifo_errors',
+ 'length_errors', 'crc_errors', 'missed_errors',
+ 'frame_errors']:
+ cnt += stats["stats64"]["rx"][key]
+ return cnt, stats["stats64"]["tx"]["carrier_changes"]
+
+
+def ethtool_create(cfg, act, opts):
+ output = ethtool(f"{act} {cfg.ifname} {opts}").stdout
+ # Output will be something like: "New RSS context is 1" or
+ # "Added rule with ID 7", we want the integer from the end
+ return int(output.split()[-1])
+
+
+def require_ntuple(cfg):
+ features = ethtool(f"-k {cfg.ifname}", json=True)[0]
+ if not features["ntuple-filters"]["active"]:
+ # ntuple is more of a capability than a config knob, don't bother
+ # trying to enable it (until some driver actually needs it).
+ raise KsftSkipEx("Ntuple filters not enabled on the device: " + str(features["ntuple-filters"]))
+
+
+# Get Rx packet counts for all queues, as a simple list of integers
+# if @prev is specified the prev counts will be subtracted
+def _get_rx_cnts(cfg, prev=None):
+ cfg.wait_hw_stats_settle()
+ data = cfg.netdevnl.qstats_get({"ifindex": cfg.ifindex, "scope": ["queue"]}, dump=True)
+ data = [x for x in data if x['queue-type'] == "rx"]
+ max_q = max([x["queue-id"] for x in data])
+ queue_stats = [0] * (max_q + 1)
+ for q in data:
+ queue_stats[q["queue-id"]] = q["rx-packets"]
+ if prev and q["queue-id"] < len(prev):
+ queue_stats[q["queue-id"]] -= prev[q["queue-id"]]
+ return queue_stats
+
+
+def _send_traffic_check(cfg, port, name, params):
+ # params is a dict with 3 possible keys:
+ # - "target": required, which queues we expect to get iperf traffic
+ # - "empty": optional, which queues should see no traffic at all
+ # - "noise": optional, which queues we expect to see low traffic;
+ # used for queues of the main context, since some background
+ # OS activity may use those queues while we're testing
+ # the value for each is a list, or some other iterable containing queue ids.
+
+ cnts = _get_rx_cnts(cfg)
+ GenerateTraffic(cfg, port=port).wait_pkts_and_stop(20000)
+ cnts = _get_rx_cnts(cfg, prev=cnts)
+
+ directed = sum(cnts[i] for i in params['target'])
+
+ ksft_ge(directed, 20000, f"traffic on {name}: " + str(cnts))
+ if params.get('noise'):
+ ksft_lt(sum(cnts[i] for i in params['noise']), directed / 2,
+ "traffic on other queues:" + str(cnts))
+ if params.get('empty'):
+ ksft_eq(sum(cnts[i] for i in params['empty']), 0,
+ "traffic on inactive queues: " + str(cnts))
+
+
+def test_rss_key_indir(cfg):
+ """Test basics like updating the main RSS key and indirection table."""
+
+ if len(_get_rx_cnts(cfg)) < 2:
+ KsftSkipEx("Device has only one queue (or doesn't support queue stats)")
+
+ data = get_rss(cfg)
+ want_keys = ['rss-hash-key', 'rss-hash-function', 'rss-indirection-table']
+ for k in want_keys:
+ if k not in data:
+ raise KsftFailEx("ethtool results missing key: " + k)
+ if not data[k]:
+ raise KsftFailEx(f"ethtool results empty for '{k}': {data[k]}")
+
+ key_len = len(data['rss-hash-key'])
+
+ # Set the key
+ key = _rss_key_rand(key_len)
+ ethtool(f"-X {cfg.ifname} hkey " + _rss_key_str(key))
+
+ data = get_rss(cfg)
+ ksft_eq(key, data['rss-hash-key'])
+
+ # Set the indirection table
+ ethtool(f"-X {cfg.ifname} equal 2")
+ reset_indir = defer(ethtool, f"-X {cfg.ifname} default")
+ data = get_rss(cfg)
+ ksft_eq(0, min(data['rss-indirection-table']))
+ ksft_eq(1, max(data['rss-indirection-table']))
+
+ # Check we only get traffic on the first 2 queues
+ cnts = _get_rx_cnts(cfg)
+ GenerateTraffic(cfg).wait_pkts_and_stop(20000)
+ cnts = _get_rx_cnts(cfg, prev=cnts)
+ # 2 queues, 20k packets, must be at least 5k per queue
+ ksft_ge(cnts[0], 5000, "traffic on main context (1/2): " + str(cnts))
+ ksft_ge(cnts[1], 5000, "traffic on main context (2/2): " + str(cnts))
+ # The other queues should be unused
+ ksft_eq(sum(cnts[2:]), 0, "traffic on unused queues: " + str(cnts))
+
+ # Restore, and check traffic gets spread again
+ reset_indir.exec()
+
+ cnts = _get_rx_cnts(cfg)
+ GenerateTraffic(cfg).wait_pkts_and_stop(20000)
+ cnts = _get_rx_cnts(cfg, prev=cnts)
+ # First two queues get less traffic than all the rest
+ ksft_lt(sum(cnts[:2]), sum(cnts[2:]), "traffic distributed: " + str(cnts))
+
+
+def test_rss_queue_reconfigure(cfg, main_ctx=True):
+ """Make sure queue changes can't override requested RSS config.
+
+ By default main RSS table should change to include all queues.
+ When user sets a specific RSS config the driver should preserve it,
+ even when queue count changes. Driver should refuse to deactivate
+ queues used in the user-set RSS config.
+ """
+
+ if not main_ctx:
+ require_ntuple(cfg)
+
+ # Start with 4 queues, an arbitrary known number.
+ try:
+ qcnt = len(_get_rx_cnts(cfg))
+ ethtool(f"-L {cfg.ifname} combined 4")
+ defer(ethtool, f"-L {cfg.ifname} combined {qcnt}")
+ except:
+ raise KsftSkipEx("Not enough queues for the test or qstat not supported")
+
+ if main_ctx:
+ ctx_id = 0
+ ctx_ref = ""
+ else:
+ ctx_id = ethtool_create(cfg, "-X", "context new")
+ ctx_ref = f"context {ctx_id}"
+ defer(ethtool, f"-X {cfg.ifname} {ctx_ref} delete")
+
+ # Indirection table should be distributing to all queues.
+ data = get_rss(cfg, context=ctx_id)
+ ksft_eq(0, min(data['rss-indirection-table']))
+ ksft_eq(3, max(data['rss-indirection-table']))
+
+ # Increase queues, indirection table should be distributing to all queues.
+ # It's unclear whether tables of additional contexts should be reset, too.
+ if main_ctx:
+ ethtool(f"-L {cfg.ifname} combined 5")
+ data = get_rss(cfg)
+ ksft_eq(0, min(data['rss-indirection-table']))
+ ksft_eq(4, max(data['rss-indirection-table']))
+ ethtool(f"-L {cfg.ifname} combined 4")
+
+ # Configure the table explicitly
+ port = rand_port()
+ ethtool(f"-X {cfg.ifname} {ctx_ref} weight 1 0 0 1")
+ if main_ctx:
+ other_key = 'empty'
+ defer(ethtool, f"-X {cfg.ifname} default")
+ else:
+ other_key = 'noise'
+ flow = f"flow-type tcp{cfg.addr_ipver} dst-port {port} context {ctx_id}"
+ ntuple = ethtool_create(cfg, "-N", flow)
+ defer(ethtool, f"-N {cfg.ifname} delete {ntuple}")
+
+ _send_traffic_check(cfg, port, ctx_ref, { 'target': (0, 3),
+ other_key: (1, 2) })
+
+ # We should be able to increase queues, but table should be left untouched
+ ethtool(f"-L {cfg.ifname} combined 5")
+ data = get_rss(cfg, context=ctx_id)
+ ksft_eq({0, 3}, set(data['rss-indirection-table']))
+
+ _send_traffic_check(cfg, port, ctx_ref, { 'target': (0, 3),
+ other_key: (1, 2, 4) })
+
+ # Setting queue count to 3 should fail, queue 3 is used
+ try:
+ ethtool(f"-L {cfg.ifname} combined 3")
+ except CmdExitFailure:
+ pass
+ else:
+ raise Exception(f"Driver didn't prevent us from deactivating a used queue (context {ctx_id})")
+
+
+def test_rss_resize(cfg):
+ """Test resizing of the RSS table.
+
+ Some devices dynamically increase and decrease the size of the RSS
+ indirection table based on the number of enabled queues.
+ When that happens driver must maintain the balance of entries
+ (preferably duplicating the smaller table).
+ """
+
+ channels = cfg.ethnl.channels_get({'header': {'dev-index': cfg.ifindex}})
+ ch_max = channels['combined-max']
+ qcnt = channels['combined-count']
+
+ if ch_max < 2:
+ raise KsftSkipEx(f"Not enough queues for the test: {ch_max}")
+
+ ethtool(f"-L {cfg.ifname} combined 2")
+ defer(ethtool, f"-L {cfg.ifname} combined {qcnt}")
+
+ ethtool(f"-X {cfg.ifname} weight 1 7")
+ defer(ethtool, f"-X {cfg.ifname} default")
+
+ ethtool(f"-L {cfg.ifname} combined {ch_max}")
+ data = get_rss(cfg)
+ ksft_eq(0, min(data['rss-indirection-table']))
+ ksft_eq(1, max(data['rss-indirection-table']))
+
+ ksft_eq(7,
+ data['rss-indirection-table'].count(1) /
+ data['rss-indirection-table'].count(0),
+ f"Table imbalance after resize: {data['rss-indirection-table']}")
+
+
+def test_hitless_key_update(cfg):
+ """Test that flows may be rehashed without impacting traffic.
+
+ Some workloads may want to rehash the flows in response to an imbalance.
+ Most effective way to do that is changing the RSS key. Check that changing
+ the key does not cause link flaps or traffic disruption.
+
+ Disrupting traffic for key update is not a bug, but makes the key
+ update unusable for rehashing under load.
+ """
+ data = get_rss(cfg)
+ key_len = len(data['rss-hash-key'])
+
+ key = _rss_key_rand(key_len)
+
+ tgen = GenerateTraffic(cfg)
+ try:
+ errors0, carrier0 = get_drop_err_sum(cfg)
+ t0 = datetime.datetime.now()
+ ethtool(f"-X {cfg.ifname} hkey " + _rss_key_str(key))
+ t1 = datetime.datetime.now()
+ errors1, carrier1 = get_drop_err_sum(cfg)
+ finally:
+ tgen.wait_pkts_and_stop(5000)
+
+ ksft_lt((t1 - t0).total_seconds(), 0.2)
+ ksft_eq(errors1 - errors1, 0)
+ ksft_eq(carrier1 - carrier0, 0)
+
+
+def test_rss_context(cfg, ctx_cnt=1, create_with_cfg=None):
+ """
+ Test separating traffic into RSS contexts.
+ The queues will be allocated 2 for each context:
+ ctx0 ctx1 ctx2 ctx3
+ [0 1] [2 3] [4 5] [6 7] ...
+ """
+
+ require_ntuple(cfg)
+
+ requested_ctx_cnt = ctx_cnt
+
+ # Try to allocate more queues when necessary
+ qcnt = len(_get_rx_cnts(cfg))
+ if qcnt < 2 + 2 * ctx_cnt:
+ try:
+ ksft_pr(f"Increasing queue count {qcnt} -> {2 + 2 * ctx_cnt}")
+ ethtool(f"-L {cfg.ifname} combined {2 + 2 * ctx_cnt}")
+ defer(ethtool, f"-L {cfg.ifname} combined {qcnt}")
+ except:
+ raise KsftSkipEx("Not enough queues for the test")
+
+ ports = []
+
+ # Use queues 0 and 1 for normal traffic
+ ethtool(f"-X {cfg.ifname} equal 2")
+ defer(ethtool, f"-X {cfg.ifname} default")
+
+ for i in range(ctx_cnt):
+ want_cfg = f"start {2 + i * 2} equal 2"
+ create_cfg = want_cfg if create_with_cfg else ""
+
+ try:
+ ctx_id = ethtool_create(cfg, "-X", f"context new {create_cfg}")
+ defer(ethtool, f"-X {cfg.ifname} context {ctx_id} delete")
+ except CmdExitFailure:
+ # try to carry on and skip at the end
+ if i == 0:
+ raise
+ ksft_pr(f"Failed to create context {i + 1}, trying to test what we got")
+ ctx_cnt = i
+ break
+
+ if not create_with_cfg:
+ ethtool(f"-X {cfg.ifname} context {ctx_id} {want_cfg}")
+
+ # Sanity check the context we just created
+ data = get_rss(cfg, ctx_id)
+ ksft_eq(min(data['rss-indirection-table']), 2 + i * 2, "Unexpected context cfg: " + str(data))
+ ksft_eq(max(data['rss-indirection-table']), 2 + i * 2 + 1, "Unexpected context cfg: " + str(data))
+
+ ports.append(rand_port())
+ flow = f"flow-type tcp{cfg.addr_ipver} dst-port {ports[i]} context {ctx_id}"
+ ntuple = ethtool_create(cfg, "-N", flow)
+ defer(ethtool, f"-N {cfg.ifname} delete {ntuple}")
+
+ for i in range(ctx_cnt):
+ _send_traffic_check(cfg, ports[i], f"context {i}",
+ { 'target': (2+i*2, 3+i*2),
+ 'noise': (0, 1),
+ 'empty': list(range(2, 2+i*2)) + list(range(4+i*2, 2+2*ctx_cnt)) })
+
+ if requested_ctx_cnt != ctx_cnt:
+ raise KsftSkipEx(f"Tested only {ctx_cnt} contexts, wanted {requested_ctx_cnt}")
+
+
+def test_rss_context4(cfg):
+ test_rss_context(cfg, 4)
+
+
+def test_rss_context32(cfg):
+ test_rss_context(cfg, 32)
+
+
+def test_rss_context4_create_with_cfg(cfg):
+ test_rss_context(cfg, 4, create_with_cfg=True)
+
+
+def test_rss_context_queue_reconfigure(cfg):
+ test_rss_queue_reconfigure(cfg, main_ctx=False)
+
+
+def test_rss_context_out_of_order(cfg, ctx_cnt=4):
+ """
+ Test separating traffic into RSS contexts.
+ Contexts are removed in semi-random order, and steering re-tested
+ to make sure removal doesn't break steering to surviving contexts.
+ Test requires 3 contexts to work.
+ """
+
+ require_ntuple(cfg)
+
+ requested_ctx_cnt = ctx_cnt
+
+ # Try to allocate more queues when necessary
+ qcnt = len(_get_rx_cnts(cfg))
+ if qcnt < 2 + 2 * ctx_cnt:
+ try:
+ ksft_pr(f"Increasing queue count {qcnt} -> {2 + 2 * ctx_cnt}")
+ ethtool(f"-L {cfg.ifname} combined {2 + 2 * ctx_cnt}")
+ defer(ethtool, f"-L {cfg.ifname} combined {qcnt}")
+ except:
+ raise KsftSkipEx("Not enough queues for the test")
+
+ ntuple = []
+ ctx = []
+ ports = []
+
+ def remove_ctx(idx):
+ ntuple[idx].exec()
+ ntuple[idx] = None
+ ctx[idx].exec()
+ ctx[idx] = None
+
+ def check_traffic():
+ for i in range(ctx_cnt):
+ if ctx[i]:
+ expected = {
+ 'target': (2+i*2, 3+i*2),
+ 'noise': (0, 1),
+ 'empty': list(range(2, 2+i*2)) + list(range(4+i*2, 2+2*ctx_cnt))
+ }
+ else:
+ expected = {
+ 'target': (0, 1),
+ 'empty': range(2, 2+2*ctx_cnt)
+ }
+
+ _send_traffic_check(cfg, ports[i], f"context {i}", expected)
+
+ # Use queues 0 and 1 for normal traffic
+ ethtool(f"-X {cfg.ifname} equal 2")
+ defer(ethtool, f"-X {cfg.ifname} default")
+
+ for i in range(ctx_cnt):
+ ctx_id = ethtool_create(cfg, "-X", f"context new start {2 + i * 2} equal 2")
+ ctx.append(defer(ethtool, f"-X {cfg.ifname} context {ctx_id} delete"))
+
+ ports.append(rand_port())
+ flow = f"flow-type tcp{cfg.addr_ipver} dst-port {ports[i]} context {ctx_id}"
+ ntuple_id = ethtool_create(cfg, "-N", flow)
+ ntuple.append(defer(ethtool, f"-N {cfg.ifname} delete {ntuple_id}"))
+
+ check_traffic()
+
+ # Remove middle context
+ remove_ctx(ctx_cnt // 2)
+ check_traffic()
+
+ # Remove first context
+ remove_ctx(0)
+ check_traffic()
+
+ # Remove last context
+ remove_ctx(-1)
+ check_traffic()
+
+ if requested_ctx_cnt != ctx_cnt:
+ raise KsftSkipEx(f"Tested only {ctx_cnt} contexts, wanted {requested_ctx_cnt}")
+
+
+def test_rss_context_overlap(cfg, other_ctx=0):
+ """
+ Test contexts overlapping with each other.
+ Use 4 queues for the main context, but only queues 2 and 3 for context 1.
+ """
+
+ require_ntuple(cfg)
+
+ queue_cnt = len(_get_rx_cnts(cfg))
+ if queue_cnt < 4:
+ try:
+ ksft_pr(f"Increasing queue count {queue_cnt} -> 4")
+ ethtool(f"-L {cfg.ifname} combined 4")
+ defer(ethtool, f"-L {cfg.ifname} combined {queue_cnt}")
+ except:
+ raise KsftSkipEx("Not enough queues for the test")
+
+ if other_ctx == 0:
+ ethtool(f"-X {cfg.ifname} equal 4")
+ defer(ethtool, f"-X {cfg.ifname} default")
+ else:
+ other_ctx = ethtool_create(cfg, "-X", "context new")
+ ethtool(f"-X {cfg.ifname} context {other_ctx} equal 4")
+ defer(ethtool, f"-X {cfg.ifname} context {other_ctx} delete")
+
+ ctx_id = ethtool_create(cfg, "-X", "context new")
+ ethtool(f"-X {cfg.ifname} context {ctx_id} start 2 equal 2")
+ defer(ethtool, f"-X {cfg.ifname} context {ctx_id} delete")
+
+ port = rand_port()
+ if other_ctx:
+ flow = f"flow-type tcp{cfg.addr_ipver} dst-port {port} context {other_ctx}"
+ ntuple_id = ethtool_create(cfg, "-N", flow)
+ ntuple = defer(ethtool, f"-N {cfg.ifname} delete {ntuple_id}")
+
+ # Test the main context
+ cnts = _get_rx_cnts(cfg)
+ GenerateTraffic(cfg, port=port).wait_pkts_and_stop(20000)
+ cnts = _get_rx_cnts(cfg, prev=cnts)
+
+ ksft_ge(sum(cnts[ :4]), 20000, "traffic on main context: " + str(cnts))
+ ksft_ge(sum(cnts[ :2]), 7000, "traffic on main context (1/2): " + str(cnts))
+ ksft_ge(sum(cnts[2:4]), 7000, "traffic on main context (2/2): " + str(cnts))
+ if other_ctx == 0:
+ ksft_eq(sum(cnts[4: ]), 0, "traffic on other queues: " + str(cnts))
+
+ # Now create a rule for context 1 and make sure traffic goes to a subset
+ if other_ctx:
+ ntuple.exec()
+ flow = f"flow-type tcp{cfg.addr_ipver} dst-port {port} context {ctx_id}"
+ ntuple_id = ethtool_create(cfg, "-N", flow)
+ defer(ethtool, f"-N {cfg.ifname} delete {ntuple_id}")
+
+ cnts = _get_rx_cnts(cfg)
+ GenerateTraffic(cfg, port=port).wait_pkts_and_stop(20000)
+ cnts = _get_rx_cnts(cfg, prev=cnts)
+
+ directed = sum(cnts[2:4])
+ ksft_lt(sum(cnts[ :2]), directed / 2, "traffic on main context: " + str(cnts))
+ ksft_ge(directed, 20000, "traffic on extra context: " + str(cnts))
+ if other_ctx == 0:
+ ksft_eq(sum(cnts[4: ]), 0, "traffic on other queues: " + str(cnts))
+
+
+def test_rss_context_overlap2(cfg):
+ test_rss_context_overlap(cfg, True)
+
+
+def main() -> None:
+ with NetDrvEpEnv(__file__, nsim_test=False) as cfg:
+ cfg.ethnl = EthtoolFamily()
+ cfg.netdevnl = NetdevFamily()
+
+ ksft_run([test_rss_key_indir, test_rss_queue_reconfigure,
+ test_rss_resize, test_hitless_key_update,
+ test_rss_context, test_rss_context4, test_rss_context32,
+ test_rss_context_queue_reconfigure,
+ test_rss_context_overlap, test_rss_context_overlap2,
+ test_rss_context_out_of_order, test_rss_context4_create_with_cfg],
+ args=(cfg, ))
+ ksft_exit()
+
+
+if __name__ == "__main__":
+ main()
diff --git a/tools/testing/selftests/drivers/net/lib/py/env.py b/tools/testing/selftests/drivers/net/lib/py/env.py
index edcedd7bffab..a5e800b8f103 100644
--- a/tools/testing/selftests/drivers/net/lib/py/env.py
+++ b/tools/testing/selftests/drivers/net/lib/py/env.py
@@ -1,9 +1,10 @@
# SPDX-License-Identifier: GPL-2.0
import os
+import time
from pathlib import Path
from lib.py import KsftSkipEx, KsftXfailEx
-from lib.py import cmd, ip
+from lib.py import cmd, ethtool, ip
from lib.py import NetNS, NetdevSimDev
from .remote import Remote
@@ -82,6 +83,8 @@ class NetDrvEpEnv:
self.env = _load_env_file(src_path)
+ self._stats_settle_time = None
+
# Things we try to destroy
self.remote = None
# These are for local testing state
@@ -222,3 +225,17 @@ class NetDrvEpEnv:
if remote:
if not self._require_cmd(comm, "remote"):
raise KsftSkipEx("Test requires (remote) command: " + comm)
+
+ def wait_hw_stats_settle(self):
+ """
+ Wait for HW stats to become consistent, some devices DMA HW stats
+ periodically so events won't be reflected until next sync.
+ Good drivers will tell us via ethtool what their sync period is.
+ """
+ if self._stats_settle_time is None:
+ data = ethtool("-c " + self.ifname, json=True)[0]
+
+ self._stats_settle_time = 0.025 + \
+ data.get('stats-block-usecs', 0) / 1000 / 1000
+
+ time.sleep(self._stats_settle_time)
diff --git a/tools/testing/selftests/drivers/net/lib/py/load.py b/tools/testing/selftests/drivers/net/lib/py/load.py
index abdb677bdb1c..d9c10613ae67 100644
--- a/tools/testing/selftests/drivers/net/lib/py/load.py
+++ b/tools/testing/selftests/drivers/net/lib/py/load.py
@@ -5,28 +5,45 @@ import time
from lib.py import ksft_pr, cmd, ip, rand_port, wait_port_listen
class GenerateTraffic:
- def __init__(self, env):
+ def __init__(self, env, port=None):
env.require_cmd("iperf3", remote=True)
self.env = env
- port = rand_port()
- self._iperf_server = cmd(f"iperf3 -s -p {port}", background=True)
+ if port is None:
+ port = rand_port()
+ self._iperf_server = cmd(f"iperf3 -s -1 -p {port}", background=True)
wait_port_listen(port)
time.sleep(0.1)
self._iperf_client = cmd(f"iperf3 -c {env.addr} -P 16 -p {port} -t 86400",
background=True, host=env.remote)
# Wait for traffic to ramp up
- pkt = ip("-s link show dev " + env.ifname, json=True)[0]["stats64"]["rx"]["packets"]
+ if not self._wait_pkts(pps=1000):
+ self.stop(verbose=True)
+ raise Exception("iperf3 traffic did not ramp up")
+
+ def _wait_pkts(self, pkt_cnt=None, pps=None):
+ """
+ Wait until we've seen pkt_cnt or until traffic ramps up to pps.
+ Only one of pkt_cnt or pss can be specified.
+ """
+ pkt_start = ip("-s link show dev " + self.env.ifname, json=True)[0]["stats64"]["rx"]["packets"]
for _ in range(50):
time.sleep(0.1)
- now = ip("-s link show dev " + env.ifname, json=True)[0]["stats64"]["rx"]["packets"]
- if now - pkt > 1000:
- return
- pkt = now
- self.stop(verbose=True)
- raise Exception("iperf3 traffic did not ramp up")
+ pkt_now = ip("-s link show dev " + self.env.ifname, json=True)[0]["stats64"]["rx"]["packets"]
+ if pps:
+ if pkt_now - pkt_start > pps / 10:
+ return True
+ pkt_start = pkt_now
+ elif pkt_cnt:
+ if pkt_now - pkt_start > pkt_cnt:
+ return True
+ return False
+
+ def wait_pkts_and_stop(self, pkt_cnt):
+ failed = not self._wait_pkts(pkt_cnt=pkt_cnt)
+ self.stop(verbose=failed)
def stop(self, verbose=None):
self._iperf_client.process(terminate=True)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/mirror_gre.sh b/tools/testing/selftests/drivers/net/mlxsw/mirror_gre.sh
index 76f1ab4898d9..e1ad623146d7 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/mirror_gre.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/mirror_gre.sh
@@ -15,6 +15,13 @@ source $lib_dir/mirror_lib.sh
source $lib_dir/mirror_gre_lib.sh
source $lib_dir/mirror_gre_topo_lib.sh
+ALL_TESTS="
+ test_keyful
+ test_soft
+ test_tos_fixed
+ test_ttl_inherit
+"
+
setup_keyful()
{
tunnel_create gt6-key ip6gretap 2001:db8:3::1 2001:db8:3::2 \
@@ -118,15 +125,15 @@ test_span_gre_ttl_inherit()
RET=0
ip link set dev $tundev type $type ttl inherit
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
ip link set dev $tundev type $type ttl 100
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: no offload on TTL of inherit ($tcflags)"
+ log_test "$what: no offload on TTL of inherit"
}
test_span_gre_tos_fixed()
@@ -138,61 +145,49 @@ test_span_gre_tos_fixed()
RET=0
ip link set dev $tundev type $type tos 0x10
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
ip link set dev $tundev type $type tos inherit
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: no offload on a fixed TOS ($tcflags)"
+ log_test "$what: no offload on a fixed TOS"
}
test_span_failable()
{
- local should_fail=$1; shift
local tundev=$1; shift
local what=$1; shift
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- if ((should_fail)); then
- fail_test_span_gre_dir $tundev ingress
- else
- quick_test_span_gre_dir $tundev ingress
- fi
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: should_fail=$should_fail ($tcflags)"
+ log_test "fail $what"
}
-test_failable()
+test_keyful()
{
- local should_fail=$1; shift
-
- test_span_failable $should_fail gt6-key "mirror to keyful gretap"
- test_span_failable $should_fail gt6-soft "mirror to gretap w/ soft underlay"
+ test_span_failable gt6-key "mirror to keyful gretap"
}
-test_sw()
+test_soft()
{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- test_failable 0
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
+ test_span_failable gt6-soft "mirror to gretap w/ soft underlay"
}
-test_hw()
+test_tos_fixed()
{
- test_failable 1
-
test_span_gre_tos_fixed gt4 gretap "mirror to gretap"
test_span_gre_tos_fixed gt6 ip6gretap "mirror to ip6gretap"
+}
+
+test_ttl_inherit()
+{
test_span_gre_ttl_inherit gt4 gretap "mirror to gretap"
test_span_gre_ttl_inherit gt6 ip6gretap "mirror to ip6gretap"
}
@@ -202,16 +197,6 @@ trap cleanup EXIT
setup_prepare
setup_wait
-if ! tc_offload_check; then
- check_err 1 "Could not test offloaded functionality"
- log_test "mlxsw-specific tests for mirror to gretap"
- exit
-fi
-
-tcflags="skip_hw"
-test_sw
-
-tcflags="skip_sw"
-test_hw
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/drivers/net/mlxsw/mirror_gre_scale.sh b/tools/testing/selftests/drivers/net/mlxsw/mirror_gre_scale.sh
index e5589e2fca85..d43093310e23 100644
--- a/tools/testing/selftests/drivers/net/mlxsw/mirror_gre_scale.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/mirror_gre_scale.sh
@@ -79,7 +79,7 @@ mirror_gre_tunnels_create()
cat >> $MIRROR_GRE_BATCH_FILE <<-EOF
filter add dev $swp1 ingress pref 1000 \
protocol ipv6 \
- flower $tcflags dst_ip $match_dip \
+ flower skip_sw dst_ip $match_dip \
action mirred egress mirror dev $tun
EOF
done
@@ -107,7 +107,7 @@ mirror_gre_tunnels_destroy()
done
}
-__mirror_gre_test()
+mirror_gre_test()
{
local count=$1; shift
local should_fail=$1; shift
@@ -131,20 +131,6 @@ __mirror_gre_test()
done
}
-mirror_gre_test()
-{
- local count=$1; shift
- local should_fail=$1; shift
-
- if ! tc_offload_check $TC_FLOWER_NUM_NETIFS; then
- check_err 1 "Could not test offloaded functionality"
- return
- fi
-
- tcflags="skip_sw"
- __mirror_gre_test $count $should_fail
-}
-
mirror_gre_setup_prepare()
{
h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 31252bc8775e..4994bea5daf8 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
multiple_masks_test ctcam_edge_cases_test delta_simple_test \
delta_two_masks_one_key_test delta_simple_rehash_test \
bloom_simple_test bloom_complex_test bloom_delta_test \
- max_erp_entries_test max_group_size_test"
+ max_erp_entries_test max_group_size_test collision_test"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
{
# If 2 keys are the same and only differ in mask in a way that
# they belong under the same ERP (second is delta of the first),
- # there should be no C-TCAM spill.
+ # there should be C-TCAM spill.
RET=0
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
action drop"
- tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
- check_err $? "incorrect C-TCAM spill while inserting the second rule"
+ tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+ check_err $? "C-TCAM spill did not happen while inserting the second rule"
$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
log_test "max ACL group size test ($tcflags). max size $max_size"
}
+collision_test()
+{
+ # Filters cannot share an eRP if in the common unmasked part (i.e.,
+ # without the delta bits) they have the same values. If the driver does
+ # not prevent such configuration (by spilling into the C-TCAM), then
+ # multiple entries will be present in the device with the same key,
+ # leading to collisions and a reduced scale.
+ #
+ # Create such a scenario and make sure all the filters are successfully
+ # added.
+
+ RET=0
+
+ local ret
+
+ if [[ "$tcflags" != "skip_sw" ]]; then
+ return 0;
+ fi
+
+ # Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+ # have the same values in the common unmasked part (dst_ip/24).
+
+ tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+ flower $tcflags dst_ip 198.51.100.0/24 \
+ action drop
+
+ for i in {0..255}; do
+ tc filter add dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) \
+ flower $tcflags dst_ip 198.51.100.${i}/32 \
+ action drop
+ ret=$?
+ [[ $ret -ne 0 ]] && break
+ done
+
+ check_err $ret "failed to add all the filters"
+
+ for i in {255..0}; do
+ tc filter del dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) flower
+ done
+
+ tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+ log_test "collision test ($tcflags)"
+}
+
setup_prepare()
{
h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/drivers/net/virtio_net/config b/tools/testing/selftests/drivers/net/virtio_net/config
index f35de0542b60..bcf7555eaffe 100644
--- a/tools/testing/selftests/drivers/net/virtio_net/config
+++ b/tools/testing/selftests/drivers/net/virtio_net/config
@@ -1,2 +1,8 @@
-CONFIG_VIRTIO_NET=y
+CONFIG_BPF_SYSCALL=y
+CONFIG_CGROUP_BPF=y
+CONFIG_IPV6=y
+CONFIG_IPV6_MULTIPLE_TABLES=y
+CONFIG_NET_L3_MASTER_DEV=y
+CONFIG_NET_VRF=m
CONFIG_VIRTIO_DEBUG=y
+CONFIG_VIRTIO_NET=y
diff --git a/tools/testing/selftests/drivers/platform/x86/intel/ifs/Makefile b/tools/testing/selftests/drivers/platform/x86/intel/ifs/Makefile
new file mode 100644
index 000000000000..03d0449d307c
--- /dev/null
+++ b/tools/testing/selftests/drivers/platform/x86/intel/ifs/Makefile
@@ -0,0 +1,6 @@
+# SPDX-License-Identifier: GPL-2.0
+# Makefile for ifs(In Field Scan) selftests
+
+TEST_PROGS := test_ifs.sh
+
+include ../../../../../lib.mk
diff --git a/tools/testing/selftests/drivers/platform/x86/intel/ifs/test_ifs.sh b/tools/testing/selftests/drivers/platform/x86/intel/ifs/test_ifs.sh
new file mode 100755
index 000000000000..8b68964b29f4
--- /dev/null
+++ b/tools/testing/selftests/drivers/platform/x86/intel/ifs/test_ifs.sh
@@ -0,0 +1,494 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# Test the functionality of the Intel IFS(In Field Scan) driver.
+#
+
+# Matched with kselftest framework: tools/testing/selftests/kselftest.h
+readonly KSFT_PASS=0
+readonly KSFT_FAIL=1
+readonly KSFT_XFAIL=2
+readonly KSFT_SKIP=4
+
+readonly CPU_SYSFS="/sys/devices/system/cpu"
+readonly CPU_OFFLINE_SYSFS="${CPU_SYSFS}/offline"
+readonly IMG_PATH="/lib/firmware/intel/ifs_0"
+readonly IFS_SCAN_MODE="0"
+readonly IFS_ARRAY_BIST_SCAN_MODE="1"
+readonly IFS_PATH="/sys/devices/virtual/misc/intel_ifs"
+readonly IFS_SCAN_SYSFS_PATH="${IFS_PATH}_${IFS_SCAN_MODE}"
+readonly IFS_ARRAY_BIST_SYSFS_PATH="${IFS_PATH}_${IFS_ARRAY_BIST_SCAN_MODE}"
+readonly RUN_TEST="run_test"
+readonly STATUS="status"
+readonly DETAILS="details"
+readonly STATUS_PASS="pass"
+readonly PASS="PASS"
+readonly FAIL="FAIL"
+readonly INFO="INFO"
+readonly XFAIL="XFAIL"
+readonly SKIP="SKIP"
+readonly IFS_NAME="intel_ifs"
+readonly ALL="all"
+readonly SIBLINGS="siblings"
+
+# Matches arch/x86/include/asm/intel-family.h and
+# drivers/platform/x86/intel/ifs/core.c requirement as follows
+readonly SAPPHIRERAPIDS_X="8f"
+readonly EMERALDRAPIDS_X="cf"
+
+readonly INTEL_FAM6="06"
+
+LOOP_TIMES=3
+FML=""
+MODEL=""
+STEPPING=""
+CPU_FMS=""
+TRUE="true"
+FALSE="false"
+RESULT=$KSFT_PASS
+IMAGE_NAME=""
+INTERVAL_TIME=1
+OFFLINE_CPUS=""
+# For IFS cleanup tags
+ORIGIN_IFS_LOADED=""
+IFS_IMAGE_NEED_RESTORE=$FALSE
+IFS_LOG="/tmp/ifs_logs.$$"
+RANDOM_CPU=""
+DEFAULT_IMG_ID=""
+
+append_log()
+{
+ echo -e "$1" | tee -a "$IFS_LOG"
+}
+
+online_offline_cpu_list()
+{
+ local on_off=$1
+ local target_cpus=$2
+ local cpu=""
+ local cpu_start=""
+ local cpu_end=""
+ local i=""
+
+ if [[ -n "$target_cpus" ]]; then
+ for cpu in $(echo "$target_cpus" | tr ',' ' '); do
+ if [[ "$cpu" == *"-"* ]]; then
+ cpu_start=""
+ cpu_end=""
+ i=""
+ cpu_start=$(echo "$cpu" | cut -d "-" -f 1)
+ cpu_end=$(echo "$cpu" | cut -d "-" -f 2)
+ for((i=cpu_start;i<=cpu_end;i++)); do
+ append_log "[$INFO] echo $on_off > \
+${CPU_SYSFS}/cpu${i}/online"
+ echo "$on_off" > "$CPU_SYSFS"/cpu"$i"/online
+ done
+ else
+ set_target_cpu "$on_off" "$cpu"
+ fi
+ done
+ fi
+}
+
+ifs_scan_result_summary()
+{
+ local failed_info pass_num skip_num fail_num
+
+ if [[ -e "$IFS_LOG" ]]; then
+ failed_info=$(grep ^"\[${FAIL}\]" "$IFS_LOG")
+ fail_num=$(grep -c ^"\[${FAIL}\]" "$IFS_LOG")
+ skip_num=$(grep -c ^"\[${SKIP}\]" "$IFS_LOG")
+ pass_num=$(grep -c ^"\[${PASS}\]" "$IFS_LOG")
+
+ if [[ "$fail_num" -ne 0 ]]; then
+ RESULT=$KSFT_FAIL
+ echo "[$INFO] IFS test failure summary:"
+ echo "$failed_info"
+ elif [[ "$skip_num" -ne 0 ]]; then
+ RESULT=$KSFT_SKIP
+ fi
+ echo "[$INFO] IFS test pass:$pass_num, skip:$skip_num, fail:$fail_num"
+ else
+ echo "[$INFO] No file $IFS_LOG for IFS scan summary"
+ fi
+}
+
+ifs_cleanup()
+{
+ echo "[$INFO] Restore environment after IFS test"
+
+ # Restore ifs origin image if origin image backup step is needed
+ [[ "$IFS_IMAGE_NEED_RESTORE" == "$TRUE" ]] && {
+ mv -f "$IMG_PATH"/"$IMAGE_NAME"_origin "$IMG_PATH"/"$IMAGE_NAME"
+ }
+
+ # Restore the CPUs to the state before testing
+ [[ -z "$OFFLINE_CPUS" ]] || online_offline_cpu_list "0" "$OFFLINE_CPUS"
+
+ lsmod | grep -q "$IFS_NAME" && [[ "$ORIGIN_IFS_LOADED" == "$FALSE" ]] && {
+ echo "[$INFO] modprobe -r $IFS_NAME"
+ modprobe -r "$IFS_NAME"
+ }
+
+ ifs_scan_result_summary
+ [[ -e "$IFS_LOG" ]] && rm -rf "$IFS_LOG"
+
+ echo "[RESULT] IFS test exit with $RESULT"
+ exit "$RESULT"
+}
+
+do_cmd()
+{
+ local cmd=$*
+ local ret=""
+
+ append_log "[$INFO] $cmd"
+ eval "$cmd"
+ ret=$?
+ if [[ $ret -ne 0 ]]; then
+ append_log "[$FAIL] $cmd failed. Return code is $ret"
+ RESULT=$KSFT_XFAIL
+ ifs_cleanup
+ fi
+}
+
+test_exit()
+{
+ local info=$1
+ RESULT=$2
+
+ declare -A EXIT_MAP
+ EXIT_MAP[$KSFT_PASS]=$PASS
+ EXIT_MAP[$KSFT_FAIL]=$FAIL
+ EXIT_MAP[$KSFT_XFAIL]=$XFAIL
+ EXIT_MAP[$KSFT_SKIP]=$SKIP
+
+ append_log "[${EXIT_MAP[$RESULT]}] $info"
+ ifs_cleanup
+}
+
+online_all_cpus()
+{
+ local off_cpus=""
+
+ OFFLINE_CPUS=$(cat "$CPU_OFFLINE_SYSFS")
+ online_offline_cpu_list "1" "$OFFLINE_CPUS"
+
+ off_cpus=$(cat "$CPU_OFFLINE_SYSFS")
+ if [[ -z "$off_cpus" ]]; then
+ append_log "[$INFO] All CPUs are online."
+ else
+ append_log "[$XFAIL] There is offline cpu:$off_cpus after online all cpu!"
+ RESULT=$KSFT_XFAIL
+ ifs_cleanup
+ fi
+}
+
+get_cpu_fms()
+{
+ FML=$(grep -m 1 "family" /proc/cpuinfo | awk -F ":" '{printf "%02x",$2;}')
+ MODEL=$(grep -m 1 "model" /proc/cpuinfo | awk -F ":" '{printf "%02x",$2;}')
+ STEPPING=$(grep -m 1 "stepping" /proc/cpuinfo | awk -F ":" '{printf "%02x",$2;}')
+ CPU_FMS="${FML}-${MODEL}-${STEPPING}"
+}
+
+check_cpu_ifs_support_interval_time()
+{
+ get_cpu_fms
+
+ if [[ "$FML" != "$INTEL_FAM6" ]]; then
+ test_exit "CPU family:$FML does not support IFS" "$KSFT_SKIP"
+ fi
+
+ # Ucode has time interval requirement for IFS scan on same CPU as follows:
+ case $MODEL in
+ "$SAPPHIRERAPIDS_X")
+ INTERVAL_TIME=180;
+ ;;
+ "$EMERALDRAPIDS_X")
+ INTERVAL_TIME=30;
+ ;;
+ *)
+ # Set default interval time for other platforms
+ INTERVAL_TIME=1;
+ append_log "[$INFO] CPU FML:$FML model:0x$MODEL, default: 1s interval time"
+ ;;
+ esac
+}
+
+check_ifs_loaded()
+{
+ local ifs_info=""
+
+ ifs_info=$(lsmod | grep "$IFS_NAME")
+ if [[ -z "$ifs_info" ]]; then
+ append_log "[$INFO] modprobe $IFS_NAME"
+ modprobe "$IFS_NAME" || {
+ test_exit "Check if CONFIG_INTEL_IFS is set to m or \
+platform doesn't support ifs" "$KSFT_SKIP"
+ }
+ ifs_info=$(lsmod | grep "$IFS_NAME")
+ [[ -n "$ifs_info" ]] || test_exit "No ifs module listed by lsmod" "$KSFT_FAIL"
+ fi
+}
+
+test_ifs_scan_entry()
+{
+ local ifs_info=""
+
+ ifs_info=$(lsmod | grep "$IFS_NAME")
+
+ if [[ -z "$ifs_info" ]]; then
+ ORIGIN_IFS_LOADED="$FALSE"
+ check_ifs_loaded
+ else
+ ORIGIN_IFS_LOADED="$TRUE"
+ append_log "[$INFO] Module $IFS_NAME is already loaded"
+ fi
+
+ if [[ -d "$IFS_SCAN_SYSFS_PATH" ]]; then
+ append_log "[$PASS] IFS sysfs $IFS_SCAN_SYSFS_PATH entry is created\n"
+ else
+ test_exit "No sysfs entry in $IFS_SCAN_SYSFS_PATH" "$KSFT_FAIL"
+ fi
+}
+
+load_image()
+{
+ local image_id=$1
+ local image_info=""
+ local ret=""
+
+ check_ifs_loaded
+ if [[ -e "${IMG_PATH}/${IMAGE_NAME}" ]]; then
+ append_log "[$INFO] echo 0x$image_id > ${IFS_SCAN_SYSFS_PATH}/current_batch"
+ echo "0x$image_id" > "$IFS_SCAN_SYSFS_PATH"/current_batch 2>/dev/null
+ ret=$?
+ [[ "$ret" -eq 0 ]] || {
+ append_log "[$FAIL] Load ifs image $image_id failed with ret:$ret\n"
+ return "$ret"
+ }
+ image_info=$(cat ${IFS_SCAN_SYSFS_PATH}/current_batch)
+ if [[ "$image_info" == 0x"$image_id" ]]; then
+ append_log "[$PASS] load IFS current_batch:$image_info"
+ else
+ append_log "[$FAIL] current_batch:$image_info is not expected:$image_id"
+ return "$KSFT_FAIL"
+ fi
+ else
+ append_log "[$FAIL] No IFS image file ${IMG_PATH}/${IMAGE_NAME}"\
+ return "$KSFT_FAIL"
+ fi
+ return 0
+}
+
+test_load_origin_ifs_image()
+{
+ local image_id=$1
+
+ IMAGE_NAME="${CPU_FMS}-${image_id}.scan"
+
+ load_image "$image_id" || return $?
+ return 0
+}
+
+test_load_bad_ifs_image()
+{
+ local image_id=$1
+
+ IMAGE_NAME="${CPU_FMS}-${image_id}.scan"
+
+ do_cmd "mv -f ${IMG_PATH}/${IMAGE_NAME} ${IMG_PATH}/${IMAGE_NAME}_origin"
+
+ # Set IFS_IMAGE_NEED_RESTORE to true before corrupt the origin ifs image file
+ IFS_IMAGE_NEED_RESTORE=$TRUE
+ do_cmd "dd if=/dev/urandom of=${IMG_PATH}/${IMAGE_NAME} bs=1K count=6 2>/dev/null"
+
+ # Use the specified judgment for negative testing
+ append_log "[$INFO] echo 0x$image_id > ${IFS_SCAN_SYSFS_PATH}/current_batch"
+ echo "0x$image_id" > "$IFS_SCAN_SYSFS_PATH"/current_batch 2>/dev/null
+ ret=$?
+ if [[ "$ret" -ne 0 ]]; then
+ append_log "[$PASS] Load invalid ifs image failed with ret:$ret not 0 as expected"
+ else
+ append_log "[$FAIL] Load invalid ifs image ret:$ret unexpectedly"
+ fi
+
+ do_cmd "mv -f ${IMG_PATH}/${IMAGE_NAME}_origin ${IMG_PATH}/${IMAGE_NAME}"
+ IFS_IMAGE_NEED_RESTORE=$FALSE
+}
+
+test_bad_and_origin_ifs_image()
+{
+ local image_id=$1
+
+ append_log "[$INFO] Test loading bad and then loading original IFS image:"
+ test_load_origin_ifs_image "$image_id" || return $?
+ test_load_bad_ifs_image "$image_id"
+ # Load origin image again and make sure it's worked
+ test_load_origin_ifs_image "$image_id" || return $?
+ append_log "[$INFO] Loading invalid IFS image and then loading initial image passed.\n"
+}
+
+ifs_test_cpu()
+{
+ local ifs_mode=$1
+ local cpu_num=$2
+ local image_id status details ret result result_info
+
+ echo "$cpu_num" > "$IFS_PATH"_"$ifs_mode"/"$RUN_TEST"
+ ret=$?
+
+ status=$(cat "${IFS_PATH}_${ifs_mode}/${STATUS}")
+ details=$(cat "${IFS_PATH}_${ifs_mode}/${DETAILS}")
+
+ if [[ "$ret" -eq 0 && "$status" == "$STATUS_PASS" ]]; then
+ result="$PASS"
+ else
+ result="$FAIL"
+ fi
+
+ cpu_num=$(cat "${CPU_SYSFS}/cpu${cpu_num}/topology/thread_siblings_list")
+
+ # There is no image file for IFS ARRAY BIST scan
+ if [[ -e "${IFS_PATH}_${ifs_mode}/current_batch" ]]; then
+ image_id=$(cat "${IFS_PATH}_${ifs_mode}/current_batch")
+ result_info=$(printf "[%s] ifs_%1d cpu(s):%s, current_batch:0x%02x, \
+ret:%2d, status:%s, details:0x%016x" \
+ "$result" "$ifs_mode" "$cpu_num" "$image_id" "$ret" \
+ "$status" "$details")
+ else
+ result_info=$(printf "[%s] ifs_%1d cpu(s):%s, ret:%2d, status:%s, details:0x%016x" \
+ "$result" "$ifs_mode" "$cpu_num" "$ret" "$status" "$details")
+ fi
+
+ append_log "$result_info"
+}
+
+ifs_test_cpus()
+{
+ local cpus_type=$1
+ local ifs_mode=$2
+ local image_id=$3
+ local cpu_max_num=""
+ local cpu_num=""
+
+ case "$cpus_type" in
+ "$ALL")
+ cpu_max_num=$(($(nproc) - 1))
+ cpus=$(seq 0 $cpu_max_num)
+ ;;
+ "$SIBLINGS")
+ cpus=$(cat ${CPU_SYSFS}/cpu*/topology/thread_siblings_list \
+ | sed -e 's/,.*//' \
+ | sed -e 's/-.*//' \
+ | sort -n \
+ | uniq)
+ ;;
+ *)
+ test_exit "Invalid cpus_type:$cpus_type" "$KSFT_XFAIL"
+ ;;
+ esac
+
+ for cpu_num in $cpus; do
+ ifs_test_cpu "$ifs_mode" "$cpu_num"
+ done
+
+ if [[ -z "$image_id" ]]; then
+ append_log "[$INFO] ifs_$ifs_mode test $cpus_type cpus completed\n"
+ else
+ append_log "[$INFO] ifs_$ifs_mode $cpus_type cpus with $CPU_FMS-$image_id.scan \
+completed\n"
+ fi
+}
+
+test_ifs_same_cpu_loop()
+{
+ local ifs_mode=$1
+ local cpu_num=$2
+ local loop_times=$3
+
+ append_log "[$INFO] Test ifs mode $ifs_mode on CPU:$cpu_num for $loop_times rounds:"
+ [[ "$ifs_mode" == "$IFS_SCAN_MODE" ]] && {
+ load_image "$DEFAULT_IMG_ID" || return $?
+ }
+ for (( i=1; i<=loop_times; i++ )); do
+ append_log "[$INFO] Loop iteration: $i in total of $loop_times"
+ # Only IFS scan needs the interval time
+ if [[ "$ifs_mode" == "$IFS_SCAN_MODE" ]]; then
+ do_cmd "sleep $INTERVAL_TIME"
+ elif [[ "$ifs_mode" == "$IFS_ARRAY_BIST_SCAN_MODE" ]]; then
+ true
+ else
+ test_exit "Invalid ifs_mode:$ifs_mode" "$KSFT_XFAIL"
+ fi
+
+ ifs_test_cpu "$ifs_mode" "$cpu_num"
+ done
+ append_log "[$INFO] $loop_times rounds of ifs_$ifs_mode test on CPU:$cpu_num completed.\n"
+}
+
+test_ifs_scan_available_imgs()
+{
+ local image_ids=""
+ local image_id=""
+
+ append_log "[$INFO] Test ifs scan with available images:"
+ image_ids=$(find "$IMG_PATH" -maxdepth 1 -name "${CPU_FMS}-[0-9a-fA-F][0-9a-fA-F].scan" \
+ 2>/dev/null \
+ | sort \
+ | awk -F "-" '{print $NF}' \
+ | cut -d "." -f 1)
+
+ for image_id in $image_ids; do
+ load_image "$image_id" || return $?
+
+ ifs_test_cpus "$SIBLINGS" "$IFS_SCAN_MODE" "$image_id"
+ # IFS scan requires time interval for the scan on the same CPU
+ do_cmd "sleep $INTERVAL_TIME"
+ done
+}
+
+prepare_ifs_test_env()
+{
+ local max_cpu=""
+
+ check_cpu_ifs_support_interval_time
+
+ online_all_cpus
+ max_cpu=$(($(nproc) - 1))
+ RANDOM_CPU=$(shuf -i 0-$max_cpu -n 1)
+
+ DEFAULT_IMG_ID=$(find $IMG_PATH -maxdepth 1 -name "${CPU_FMS}-[0-9a-fA-F][0-9a-fA-F].scan" \
+ 2>/dev/null \
+ | sort \
+ | head -n 1 \
+ | awk -F "-" '{print $NF}' \
+ | cut -d "." -f 1)
+}
+
+test_ifs()
+{
+ prepare_ifs_test_env
+
+ test_ifs_scan_entry
+
+ if [[ -z "$DEFAULT_IMG_ID" ]]; then
+ append_log "[$SKIP] No proper ${IMG_PATH}/${CPU_FMS}-*.scan, skip ifs_0 scan"
+ else
+ test_bad_and_origin_ifs_image "$DEFAULT_IMG_ID"
+ test_ifs_scan_available_imgs
+ test_ifs_same_cpu_loop "$IFS_SCAN_MODE" "$RANDOM_CPU" "$LOOP_TIMES"
+ fi
+
+ if [[ -d "$IFS_ARRAY_BIST_SYSFS_PATH" ]]; then
+ ifs_test_cpus "$SIBLINGS" "$IFS_ARRAY_BIST_SCAN_MODE"
+ test_ifs_same_cpu_loop "$IFS_ARRAY_BIST_SCAN_MODE" "$RANDOM_CPU" "$LOOP_TIMES"
+ else
+ append_log "[$SKIP] No $IFS_ARRAY_BIST_SYSFS_PATH, skip IFS ARRAY BIST scan"
+ fi
+}
+
+trap ifs_cleanup SIGTERM SIGINT
+test_ifs
+ifs_cleanup
diff --git a/tools/testing/selftests/exec/Makefile b/tools/testing/selftests/exec/Makefile
index fb4472ddffd8..ab67d58cfab7 100644
--- a/tools/testing/selftests/exec/Makefile
+++ b/tools/testing/selftests/exec/Makefile
@@ -3,8 +3,13 @@ CFLAGS = -Wall
CFLAGS += -Wno-nonnull
CFLAGS += -D_GNU_SOURCE
+ALIGNS := 0x1000 0x200000 0x1000000
+ALIGN_PIES := $(patsubst %,load_address.%,$(ALIGNS))
+ALIGN_STATIC_PIES := $(patsubst %,load_address.static.%,$(ALIGNS))
+ALIGNMENT_TESTS := $(ALIGN_PIES) $(ALIGN_STATIC_PIES)
+
TEST_PROGS := binfmt_script.py
-TEST_GEN_PROGS := execveat load_address_4096 load_address_2097152 load_address_16777216 non-regular
+TEST_GEN_PROGS := execveat non-regular $(ALIGNMENT_TESTS)
TEST_GEN_FILES := execveat.symlink execveat.denatured script subdir
# Makefile is a run-time dependency, since it's accessed by the execveat test
TEST_FILES := Makefile
@@ -28,9 +33,9 @@ $(OUTPUT)/execveat.symlink: $(OUTPUT)/execveat
$(OUTPUT)/execveat.denatured: $(OUTPUT)/execveat
cp $< $@
chmod -x $@
-$(OUTPUT)/load_address_4096: load_address.c
- $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x1000 -pie -static $< -o $@
-$(OUTPUT)/load_address_2097152: load_address.c
- $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x200000 -pie -static $< -o $@
-$(OUTPUT)/load_address_16777216: load_address.c
- $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=0x1000000 -pie -static $< -o $@
+$(OUTPUT)/load_address.0x%: load_address.c
+ $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \
+ -fPIE -pie $< -o $@
+$(OUTPUT)/load_address.static.0x%: load_address.c
+ $(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \
+ -fPIE -static-pie $< -o $@
diff --git a/tools/testing/selftests/exec/load_address.c b/tools/testing/selftests/exec/load_address.c
index 17e3207d34ae..8257fddba8c8 100644
--- a/tools/testing/selftests/exec/load_address.c
+++ b/tools/testing/selftests/exec/load_address.c
@@ -5,11 +5,13 @@
#include <link.h>
#include <stdio.h>
#include <stdlib.h>
+#include <stdbool.h>
#include "../kselftest.h"
struct Statistics {
unsigned long long load_address;
unsigned long long alignment;
+ bool interp;
};
int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data)
@@ -26,11 +28,20 @@ int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data)
stats->alignment = 0;
for (i = 0; i < info->dlpi_phnum; i++) {
+ unsigned long long align;
+
+ if (info->dlpi_phdr[i].p_type == PT_INTERP) {
+ stats->interp = true;
+ continue;
+ }
+
if (info->dlpi_phdr[i].p_type != PT_LOAD)
continue;
- if (info->dlpi_phdr[i].p_align > stats->alignment)
- stats->alignment = info->dlpi_phdr[i].p_align;
+ align = info->dlpi_phdr[i].p_align;
+
+ if (align > stats->alignment)
+ stats->alignment = align;
}
return 1; // Terminate dl_iterate_phdr.
@@ -38,27 +49,57 @@ int ExtractStatistics(struct dl_phdr_info *info, size_t size, void *data)
int main(int argc, char **argv)
{
- struct Statistics extracted;
- unsigned long long misalign;
+ struct Statistics extracted = { };
+ unsigned long long misalign, pow2;
+ bool interp_needed;
+ char buf[1024];
+ FILE *maps;
int ret;
ksft_print_header();
- ksft_set_plan(1);
+ ksft_set_plan(4);
+
+ /* Dump maps file for debugging reference. */
+ maps = fopen("/proc/self/maps", "r");
+ if (!maps)
+ ksft_exit_fail_msg("FAILED: /proc/self/maps: %s\n", strerror(errno));
+ while (fgets(buf, sizeof(buf), maps)) {
+ ksft_print_msg("%s", buf);
+ }
+ fclose(maps);
+ /* Walk the program headers. */
ret = dl_iterate_phdr(ExtractStatistics, &extracted);
if (ret != 1)
ksft_exit_fail_msg("FAILED: dl_iterate_phdr\n");
- if (extracted.alignment == 0)
- ksft_exit_fail_msg("FAILED: No alignment found\n");
- else if (extracted.alignment & (extracted.alignment - 1))
- ksft_exit_fail_msg("FAILED: Alignment is not a power of 2\n");
+ /* Report our findings. */
+ ksft_print_msg("load_address=%#llx alignment=%#llx\n",
+ extracted.load_address, extracted.alignment);
+
+ /* If we're named with ".static." we expect no INTERP. */
+ interp_needed = strstr(argv[0], ".static.") == NULL;
+
+ /* Were we built as expected? */
+ ksft_test_result(interp_needed == extracted.interp,
+ "%s INTERP program header %s\n",
+ interp_needed ? "Wanted" : "Unwanted",
+ extracted.interp ? "seen" : "missing");
+
+ /* Did we find an alignment? */
+ ksft_test_result(extracted.alignment != 0,
+ "Alignment%s found\n", extracted.alignment ? "" : " NOT");
+
+ /* Is the alignment sane? */
+ pow2 = extracted.alignment & (extracted.alignment - 1);
+ ksft_test_result(pow2 == 0,
+ "Alignment is%s a power of 2: %#llx\n",
+ pow2 == 0 ? "" : " NOT", extracted.alignment);
+ /* Is the load address aligned? */
misalign = extracted.load_address & (extracted.alignment - 1);
- if (misalign)
- ksft_exit_fail_msg("FAILED: alignment = %llu, load_address = %llu\n",
- extracted.alignment, extracted.load_address);
+ ksft_test_result(misalign == 0, "Load Address is %saligned (%#llx)\n",
+ misalign ? "MIS" : "", misalign);
- ksft_test_result_pass("Completed\n");
ksft_finished();
}
diff --git a/tools/testing/selftests/fchmodat2/Makefile b/tools/testing/selftests/fchmodat2/Makefile
index 71ec34bf1501..4373cea79b79 100644
--- a/tools/testing/selftests/fchmodat2/Makefile
+++ b/tools/testing/selftests/fchmodat2/Makefile
@@ -1,6 +1,15 @@
# SPDX-License-Identifier: GPL-2.0-or-later
-CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined -static-libasan $(KHDR_INCLUDES)
+CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined $(KHDR_INCLUDES)
+
+# gcc requires -static-libasan in order to ensure that Address Sanitizer's
+# library is the first one loaded. However, clang already statically links the
+# Address Sanitizer if -fsanitize is specified. Therefore, simply omit
+# -static-libasan for clang builds.
+ifeq ($(LLVM),)
+ CFLAGS += -static-libasan
+endif
+
TEST_GEN_PROGS := fchmodat2_test
include ../lib.mk
diff --git a/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c b/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c
index 759f86e7d263..2862aae58b79 100644
--- a/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c
+++ b/tools/testing/selftests/filesystems/overlayfs/dev_in_maps.c
@@ -1,5 +1,6 @@
// SPDX-License-Identifier: GPL-2.0
#define _GNU_SOURCE
+#define __SANE_USERSPACE_TYPES__ // Use ll64
#include <inttypes.h>
#include <unistd.h>
diff --git a/tools/testing/selftests/filesystems/statmount/Makefile b/tools/testing/selftests/filesystems/statmount/Makefile
index 07a0d5b545ca..3af3136e35a4 100644
--- a/tools/testing/selftests/filesystems/statmount/Makefile
+++ b/tools/testing/selftests/filesystems/statmount/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0-or-later
CFLAGS += -Wall -O2 -g $(KHDR_INCLUDES)
-TEST_GEN_PROGS := statmount_test
+TEST_GEN_PROGS := statmount_test statmount_test_ns
include ../../lib.mk
diff --git a/tools/testing/selftests/filesystems/statmount/statmount.h b/tools/testing/selftests/filesystems/statmount/statmount.h
new file mode 100644
index 000000000000..f4294bab9d73
--- /dev/null
+++ b/tools/testing/selftests/filesystems/statmount/statmount.h
@@ -0,0 +1,46 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+
+#ifndef __STATMOUNT_H
+#define __STATMOUNT_H
+
+#include <stdint.h>
+#include <linux/mount.h>
+#include <asm/unistd.h>
+
+static inline int statmount(uint64_t mnt_id, uint64_t mnt_ns_id, uint64_t mask,
+ struct statmount *buf, size_t bufsize,
+ unsigned int flags)
+{
+ struct mnt_id_req req = {
+ .size = MNT_ID_REQ_SIZE_VER0,
+ .mnt_id = mnt_id,
+ .param = mask,
+ };
+
+ if (mnt_ns_id) {
+ req.size = MNT_ID_REQ_SIZE_VER1;
+ req.mnt_ns_id = mnt_ns_id;
+ }
+
+ return syscall(__NR_statmount, &req, buf, bufsize, flags);
+}
+
+static ssize_t listmount(uint64_t mnt_id, uint64_t mnt_ns_id,
+ uint64_t last_mnt_id, uint64_t list[], size_t num,
+ unsigned int flags)
+{
+ struct mnt_id_req req = {
+ .size = MNT_ID_REQ_SIZE_VER0,
+ .mnt_id = mnt_id,
+ .param = last_mnt_id,
+ };
+
+ if (mnt_ns_id) {
+ req.size = MNT_ID_REQ_SIZE_VER1;
+ req.mnt_ns_id = mnt_ns_id;
+ }
+
+ return syscall(__NR_listmount, &req, list, num, flags);
+}
+
+#endif /* __STATMOUNT_H */
diff --git a/tools/testing/selftests/filesystems/statmount/statmount_test.c b/tools/testing/selftests/filesystems/statmount/statmount_test.c
index e6d7c4f1c85b..c773334bbcc9 100644
--- a/tools/testing/selftests/filesystems/statmount/statmount_test.c
+++ b/tools/testing/selftests/filesystems/statmount/statmount_test.c
@@ -4,17 +4,15 @@
#include <assert.h>
#include <stddef.h>
-#include <stdint.h>
#include <sched.h>
#include <fcntl.h>
#include <sys/param.h>
#include <sys/mount.h>
#include <sys/stat.h>
#include <sys/statfs.h>
-#include <linux/mount.h>
#include <linux/stat.h>
-#include <asm/unistd.h>
+#include "statmount.h"
#include "../../kselftest.h"
static const char *const known_fs[] = {
@@ -36,18 +34,6 @@ static const char *const known_fs[] = {
"ufs", "v7", "vboxsf", "vfat", "virtiofs", "vxfs", "xenfs", "xfs",
"zonefs", NULL };
-static int statmount(uint64_t mnt_id, uint64_t mask, struct statmount *buf,
- size_t bufsize, unsigned int flags)
-{
- struct mnt_id_req req = {
- .size = MNT_ID_REQ_SIZE_VER0,
- .mnt_id = mnt_id,
- .param = mask,
- };
-
- return syscall(__NR_statmount, &req, buf, bufsize, flags);
-}
-
static struct statmount *statmount_alloc(uint64_t mnt_id, uint64_t mask, unsigned int flags)
{
size_t bufsize = 1 << 15;
@@ -56,7 +42,7 @@ static struct statmount *statmount_alloc(uint64_t mnt_id, uint64_t mask, unsigne
int ret;
for (;;) {
- ret = statmount(mnt_id, mask, tmp, bufsize, flags);
+ ret = statmount(mnt_id, 0, mask, tmp, bufsize, flags);
if (ret != -1)
break;
if (tofree)
@@ -121,12 +107,20 @@ static char root_mntpoint[] = "/tmp/statmount_test_root.XXXXXX";
static int orig_root;
static uint64_t root_id, parent_id;
static uint32_t old_root_id, old_parent_id;
-
+static FILE *f_mountinfo;
static void cleanup_namespace(void)
{
- fchdir(orig_root);
- chroot(".");
+ int ret;
+
+ ret = fchdir(orig_root);
+ if (ret == -1)
+ ksft_perror("fchdir to original root");
+
+ ret = chroot(".");
+ if (ret == -1)
+ ksft_perror("chroot to original root");
+
umount2(root_mntpoint, MNT_DETACH);
rmdir(root_mntpoint);
}
@@ -138,7 +132,7 @@ static void setup_namespace(void)
uid_t uid = getuid();
gid_t gid = getgid();
- ret = unshare(CLONE_NEWNS|CLONE_NEWUSER);
+ ret = unshare(CLONE_NEWNS|CLONE_NEWUSER|CLONE_NEWPID);
if (ret == -1)
ksft_exit_fail_msg("unsharing mountns and userns: %s\n",
strerror(errno));
@@ -149,6 +143,11 @@ static void setup_namespace(void)
sprintf(buf, "0 %d 1", gid);
write_file("/proc/self/gid_map", buf);
+ f_mountinfo = fopen("/proc/self/mountinfo", "re");
+ if (!f_mountinfo)
+ ksft_exit_fail_msg("failed to open mountinfo: %s\n",
+ strerror(errno));
+
ret = mount("", "/", NULL, MS_REC|MS_PRIVATE, NULL);
if (ret == -1)
ksft_exit_fail_msg("making mount tree private: %s\n",
@@ -208,25 +207,13 @@ static int setup_mount_tree(int log2_num)
return 0;
}
-static ssize_t listmount(uint64_t mnt_id, uint64_t last_mnt_id,
- uint64_t list[], size_t num, unsigned int flags)
-{
- struct mnt_id_req req = {
- .size = MNT_ID_REQ_SIZE_VER0,
- .mnt_id = mnt_id,
- .param = last_mnt_id,
- };
-
- return syscall(__NR_listmount, &req, list, num, flags);
-}
-
static void test_listmount_empty_root(void)
{
ssize_t res;
const unsigned int size = 32;
uint64_t list[size];
- res = listmount(LSMT_ROOT, 0, list, size, 0);
+ res = listmount(LSMT_ROOT, 0, 0, list, size, 0);
if (res == -1) {
ksft_test_result_fail("listmount: %s\n", strerror(errno));
return;
@@ -251,7 +238,7 @@ static void test_statmount_zero_mask(void)
struct statmount sm;
int ret;
- ret = statmount(root_id, 0, &sm, sizeof(sm), 0);
+ ret = statmount(root_id, 0, 0, &sm, sizeof(sm), 0);
if (ret == -1) {
ksft_test_result_fail("statmount zero mask: %s\n",
strerror(errno));
@@ -277,7 +264,7 @@ static void test_statmount_mnt_basic(void)
int ret;
uint64_t mask = STATMOUNT_MNT_BASIC;
- ret = statmount(root_id, mask, &sm, sizeof(sm), 0);
+ ret = statmount(root_id, 0, mask, &sm, sizeof(sm), 0);
if (ret == -1) {
ksft_test_result_fail("statmount mnt basic: %s\n",
strerror(errno));
@@ -337,7 +324,7 @@ static void test_statmount_sb_basic(void)
struct statx sx;
struct statfs sf;
- ret = statmount(root_id, mask, &sm, sizeof(sm), 0);
+ ret = statmount(root_id, 0, mask, &sm, sizeof(sm), 0);
if (ret == -1) {
ksft_test_result_fail("statmount sb basic: %s\n",
strerror(errno));
@@ -462,6 +449,88 @@ static void test_statmount_fs_type(void)
free(sm);
}
+static void test_statmount_mnt_opts(void)
+{
+ struct statmount *sm;
+ const char *statmount_opts;
+ char *line = NULL;
+ size_t len = 0;
+
+ sm = statmount_alloc(root_id, STATMOUNT_MNT_BASIC | STATMOUNT_MNT_OPTS,
+ 0);
+ if (!sm) {
+ ksft_test_result_fail("statmount mnt opts: %s\n",
+ strerror(errno));
+ return;
+ }
+
+ while (getline(&line, &len, f_mountinfo) != -1) {
+ int i;
+ char *p, *p2;
+ unsigned int old_mnt_id;
+
+ old_mnt_id = atoi(line);
+ if (old_mnt_id != sm->mnt_id_old)
+ continue;
+
+ for (p = line, i = 0; p && i < 5; i++)
+ p = strchr(p + 1, ' ');
+ if (!p)
+ continue;
+
+ p2 = strchr(p + 1, ' ');
+ if (!p2)
+ continue;
+ *p2 = '\0';
+ p = strchr(p2 + 1, '-');
+ if (!p)
+ continue;
+ for (p++, i = 0; p && i < 2; i++)
+ p = strchr(p + 1, ' ');
+ if (!p)
+ continue;
+ p++;
+
+ /* skip generic superblock options */
+ if (strncmp(p, "ro", 2) == 0)
+ p += 2;
+ else if (strncmp(p, "rw", 2) == 0)
+ p += 2;
+ if (*p == ',')
+ p++;
+ if (strncmp(p, "sync", 4) == 0)
+ p += 4;
+ if (*p == ',')
+ p++;
+ if (strncmp(p, "dirsync", 7) == 0)
+ p += 7;
+ if (*p == ',')
+ p++;
+ if (strncmp(p, "lazytime", 8) == 0)
+ p += 8;
+ if (*p == ',')
+ p++;
+ p2 = strrchr(p, '\n');
+ if (p2)
+ *p2 = '\0';
+
+ statmount_opts = sm->str + sm->mnt_opts;
+ if (strcmp(statmount_opts, p) != 0)
+ ksft_test_result_fail(
+ "unexpected mount options: '%s' != '%s'\n",
+ statmount_opts, p);
+ else
+ ksft_test_result_pass("statmount mount options\n");
+ free(sm);
+ free(line);
+ return;
+ }
+
+ ksft_test_result_fail("didnt't find mount entry\n");
+ free(sm);
+ free(line);
+}
+
static void test_statmount_string(uint64_t mask, size_t off, const char *name)
{
struct statmount *sm;
@@ -498,14 +567,14 @@ static void test_statmount_string(uint64_t mask, size_t off, const char *name)
exactsize = sm->size;
shortsize = sizeof(*sm) + i;
- ret = statmount(root_id, mask, sm, exactsize, 0);
+ ret = statmount(root_id, 0, mask, sm, exactsize, 0);
if (ret == -1) {
ksft_test_result_fail("statmount exact size: %s\n",
strerror(errno));
goto out;
}
errno = 0;
- ret = statmount(root_id, mask, sm, shortsize, 0);
+ ret = statmount(root_id, 0, mask, sm, shortsize, 0);
if (ret != -1 || errno != EOVERFLOW) {
ksft_test_result_fail("should have failed with EOVERFLOW: %s\n",
strerror(errno));
@@ -533,7 +602,7 @@ static void test_listmount_tree(void)
if (res == -1)
return;
- num = res = listmount(LSMT_ROOT, 0, list, size, 0);
+ num = res = listmount(LSMT_ROOT, 0, 0, list, size, 0);
if (res == -1) {
ksft_test_result_fail("listmount: %s\n", strerror(errno));
return;
@@ -545,7 +614,7 @@ static void test_listmount_tree(void)
}
for (i = 0; i < size - step;) {
- res = listmount(LSMT_ROOT, i ? list2[i - 1] : 0, list2 + i, step, 0);
+ res = listmount(LSMT_ROOT, 0, i ? list2[i - 1] : 0, list2 + i, step, 0);
if (res == -1)
ksft_test_result_fail("short listmount: %s\n",
strerror(errno));
@@ -577,18 +646,18 @@ int main(void)
int ret;
uint64_t all_mask = STATMOUNT_SB_BASIC | STATMOUNT_MNT_BASIC |
STATMOUNT_PROPAGATE_FROM | STATMOUNT_MNT_ROOT |
- STATMOUNT_MNT_POINT | STATMOUNT_FS_TYPE;
+ STATMOUNT_MNT_POINT | STATMOUNT_FS_TYPE | STATMOUNT_MNT_NS_ID;
ksft_print_header();
- ret = statmount(0, 0, NULL, 0, 0);
+ ret = statmount(0, 0, 0, NULL, 0, 0);
assert(ret == -1);
if (errno == ENOSYS)
ksft_exit_skip("statmount() syscall not supported\n");
setup_namespace();
- ksft_set_plan(14);
+ ksft_set_plan(15);
test_listmount_empty_root();
test_statmount_zero_mask();
test_statmount_mnt_basic();
@@ -596,6 +665,7 @@ int main(void)
test_statmount_mnt_root();
test_statmount_mnt_point();
test_statmount_fs_type();
+ test_statmount_mnt_opts();
test_statmount_string(STATMOUNT_MNT_ROOT, str_off(mnt_root), "mount root");
test_statmount_string(STATMOUNT_MNT_POINT, str_off(mnt_point), "mount point");
test_statmount_string(STATMOUNT_FS_TYPE, str_off(fs_type), "fs type");
diff --git a/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c b/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c
new file mode 100644
index 000000000000..e044f5fc57fd
--- /dev/null
+++ b/tools/testing/selftests/filesystems/statmount/statmount_test_ns.c
@@ -0,0 +1,364 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+
+#define _GNU_SOURCE
+
+#include <assert.h>
+#include <fcntl.h>
+#include <limits.h>
+#include <sched.h>
+#include <stdlib.h>
+#include <sys/mount.h>
+#include <sys/stat.h>
+#include <sys/wait.h>
+#include <linux/nsfs.h>
+#include <linux/stat.h>
+
+#include "statmount.h"
+#include "../../kselftest.h"
+
+#define NSID_PASS 0
+#define NSID_FAIL 1
+#define NSID_SKIP 2
+#define NSID_ERROR 3
+
+static void handle_result(int ret, const char *testname)
+{
+ if (ret == NSID_PASS)
+ ksft_test_result_pass("%s\n", testname);
+ else if (ret == NSID_FAIL)
+ ksft_test_result_fail("%s\n", testname);
+ else if (ret == NSID_ERROR)
+ ksft_exit_fail_msg("%s\n", testname);
+ else
+ ksft_test_result_skip("%s\n", testname);
+}
+
+static inline int wait_for_pid(pid_t pid)
+{
+ int status, ret;
+
+again:
+ ret = waitpid(pid, &status, 0);
+ if (ret == -1) {
+ if (errno == EINTR)
+ goto again;
+
+ ksft_print_msg("waitpid returned -1, errno=%d\n", errno);
+ return -1;
+ }
+
+ if (!WIFEXITED(status)) {
+ ksft_print_msg(
+ "waitpid !WIFEXITED, WIFSIGNALED=%d, WTERMSIG=%d\n",
+ WIFSIGNALED(status), WTERMSIG(status));
+ return -1;
+ }
+
+ ret = WEXITSTATUS(status);
+ return ret;
+}
+
+static int get_mnt_ns_id(const char *mnt_ns, uint64_t *mnt_ns_id)
+{
+ int fd = open(mnt_ns, O_RDONLY);
+
+ if (fd < 0) {
+ ksft_print_msg("failed to open for ns %s: %s\n",
+ mnt_ns, strerror(errno));
+ sleep(60);
+ return NSID_ERROR;
+ }
+
+ if (ioctl(fd, NS_GET_MNTNS_ID, mnt_ns_id) < 0) {
+ ksft_print_msg("failed to get the nsid for ns %s: %s\n",
+ mnt_ns, strerror(errno));
+ return NSID_ERROR;
+ }
+ close(fd);
+ return NSID_PASS;
+}
+
+static int get_mnt_id(const char *path, uint64_t *mnt_id)
+{
+ struct statx sx;
+ int ret;
+
+ ret = statx(AT_FDCWD, path, 0, STATX_MNT_ID_UNIQUE, &sx);
+ if (ret == -1) {
+ ksft_print_msg("retrieving unique mount ID for %s: %s\n", path,
+ strerror(errno));
+ return NSID_ERROR;
+ }
+
+ if (!(sx.stx_mask & STATX_MNT_ID_UNIQUE)) {
+ ksft_print_msg("no unique mount ID available for %s\n", path);
+ return NSID_ERROR;
+ }
+
+ *mnt_id = sx.stx_mnt_id;
+ return NSID_PASS;
+}
+
+static int write_file(const char *path, const char *val)
+{
+ int fd = open(path, O_WRONLY);
+ size_t len = strlen(val);
+ int ret;
+
+ if (fd == -1) {
+ ksft_print_msg("opening %s for write: %s\n", path, strerror(errno));
+ return NSID_ERROR;
+ }
+
+ ret = write(fd, val, len);
+ if (ret == -1) {
+ ksft_print_msg("writing to %s: %s\n", path, strerror(errno));
+ return NSID_ERROR;
+ }
+ if (ret != len) {
+ ksft_print_msg("short write to %s\n", path);
+ return NSID_ERROR;
+ }
+
+ ret = close(fd);
+ if (ret == -1) {
+ ksft_print_msg("closing %s\n", path);
+ return NSID_ERROR;
+ }
+
+ return NSID_PASS;
+}
+
+static int setup_namespace(void)
+{
+ int ret;
+ char buf[32];
+ uid_t uid = getuid();
+ gid_t gid = getgid();
+
+ ret = unshare(CLONE_NEWNS|CLONE_NEWUSER|CLONE_NEWPID);
+ if (ret == -1)
+ ksft_exit_fail_msg("unsharing mountns and userns: %s\n",
+ strerror(errno));
+
+ sprintf(buf, "0 %d 1", uid);
+ ret = write_file("/proc/self/uid_map", buf);
+ if (ret != NSID_PASS)
+ return ret;
+ ret = write_file("/proc/self/setgroups", "deny");
+ if (ret != NSID_PASS)
+ return ret;
+ sprintf(buf, "0 %d 1", gid);
+ ret = write_file("/proc/self/gid_map", buf);
+ if (ret != NSID_PASS)
+ return ret;
+
+ ret = mount("", "/", NULL, MS_REC|MS_PRIVATE, NULL);
+ if (ret == -1) {
+ ksft_print_msg("making mount tree private: %s\n",
+ strerror(errno));
+ return NSID_ERROR;
+ }
+
+ return NSID_PASS;
+}
+
+static int _test_statmount_mnt_ns_id(void)
+{
+ struct statmount sm;
+ uint64_t mnt_ns_id;
+ uint64_t root_id;
+ int ret;
+
+ ret = get_mnt_ns_id("/proc/self/ns/mnt", &mnt_ns_id);
+ if (ret != NSID_PASS)
+ return ret;
+
+ ret = get_mnt_id("/", &root_id);
+ if (ret != NSID_PASS)
+ return ret;
+
+ ret = statmount(root_id, 0, STATMOUNT_MNT_NS_ID, &sm, sizeof(sm), 0);
+ if (ret == -1) {
+ ksft_print_msg("statmount mnt ns id: %s\n", strerror(errno));
+ return NSID_ERROR;
+ }
+
+ if (sm.size != sizeof(sm)) {
+ ksft_print_msg("unexpected size: %u != %u\n", sm.size,
+ (uint32_t)sizeof(sm));
+ return NSID_FAIL;
+ }
+ if (sm.mask != STATMOUNT_MNT_NS_ID) {
+ ksft_print_msg("statmount mnt ns id unavailable\n");
+ return NSID_SKIP;
+ }
+
+ if (sm.mnt_ns_id != mnt_ns_id) {
+ ksft_print_msg("unexpected mnt ns ID: 0x%llx != 0x%llx\n",
+ (unsigned long long)sm.mnt_ns_id,
+ (unsigned long long)mnt_ns_id);
+ return NSID_FAIL;
+ }
+
+ return NSID_PASS;
+}
+
+static void test_statmount_mnt_ns_id(void)
+{
+ pid_t pid;
+ int ret;
+
+ pid = fork();
+ if (pid < 0)
+ ksft_exit_fail_msg("failed to fork: %s\n", strerror(errno));
+
+ /* We're the original pid, wait for the result. */
+ if (pid != 0) {
+ ret = wait_for_pid(pid);
+ handle_result(ret, "test statmount ns id");
+ return;
+ }
+
+ ret = setup_namespace();
+ if (ret != NSID_PASS)
+ exit(ret);
+ ret = _test_statmount_mnt_ns_id();
+ exit(ret);
+}
+
+static int validate_external_listmount(pid_t pid, uint64_t child_nr_mounts)
+{
+ uint64_t list[256];
+ uint64_t mnt_ns_id;
+ uint64_t nr_mounts;
+ char buf[256];
+ int ret;
+
+ /* Get the mount ns id for our child. */
+ snprintf(buf, sizeof(buf), "/proc/%lu/ns/mnt", (unsigned long)pid);
+ ret = get_mnt_ns_id(buf, &mnt_ns_id);
+
+ nr_mounts = listmount(LSMT_ROOT, mnt_ns_id, 0, list, 256, 0);
+ if (nr_mounts == (uint64_t)-1) {
+ ksft_print_msg("listmount: %s\n", strerror(errno));
+ return NSID_ERROR;
+ }
+
+ if (nr_mounts != child_nr_mounts) {
+ ksft_print_msg("listmount results is %zi != %zi\n", nr_mounts,
+ child_nr_mounts);
+ return NSID_FAIL;
+ }
+
+ /* Validate that all of our entries match our mnt_ns_id. */
+ for (int i = 0; i < nr_mounts; i++) {
+ struct statmount sm;
+
+ ret = statmount(list[i], mnt_ns_id, STATMOUNT_MNT_NS_ID, &sm,
+ sizeof(sm), 0);
+ if (ret < 0) {
+ ksft_print_msg("statmount mnt ns id: %s\n", strerror(errno));
+ return NSID_ERROR;
+ }
+
+ if (sm.mask != STATMOUNT_MNT_NS_ID) {
+ ksft_print_msg("statmount mnt ns id unavailable\n");
+ return NSID_SKIP;
+ }
+
+ if (sm.mnt_ns_id != mnt_ns_id) {
+ ksft_print_msg("listmount gave us the wrong ns id: 0x%llx != 0x%llx\n",
+ (unsigned long long)sm.mnt_ns_id,
+ (unsigned long long)mnt_ns_id);
+ return NSID_FAIL;
+ }
+ }
+
+ return NSID_PASS;
+}
+
+static void test_listmount_ns(void)
+{
+ uint64_t nr_mounts;
+ char pval;
+ int child_ready_pipe[2];
+ int parent_ready_pipe[2];
+ pid_t pid;
+ int ret, child_ret;
+
+ if (pipe(child_ready_pipe) < 0)
+ ksft_exit_fail_msg("failed to create the child pipe: %s\n",
+ strerror(errno));
+ if (pipe(parent_ready_pipe) < 0)
+ ksft_exit_fail_msg("failed to create the parent pipe: %s\n",
+ strerror(errno));
+
+ pid = fork();
+ if (pid < 0)
+ ksft_exit_fail_msg("failed to fork: %s\n", strerror(errno));
+
+ if (pid == 0) {
+ char cval;
+ uint64_t list[256];
+
+ close(child_ready_pipe[0]);
+ close(parent_ready_pipe[1]);
+
+ ret = setup_namespace();
+ if (ret != NSID_PASS)
+ exit(ret);
+
+ nr_mounts = listmount(LSMT_ROOT, 0, 0, list, 256, 0);
+ if (nr_mounts == (uint64_t)-1) {
+ ksft_print_msg("listmount: %s\n", strerror(errno));
+ exit(NSID_FAIL);
+ }
+
+ /*
+ * Tell our parent how many mounts we have, and then wait for it
+ * to tell us we're done.
+ */
+ write(child_ready_pipe[1], &nr_mounts, sizeof(nr_mounts));
+ read(parent_ready_pipe[0], &cval, sizeof(cval));
+ exit(NSID_PASS);
+ }
+
+ close(child_ready_pipe[1]);
+ close(parent_ready_pipe[0]);
+
+ /* Wait until the child has created everything. */
+ if (read(child_ready_pipe[0], &nr_mounts, sizeof(nr_mounts)) !=
+ sizeof(nr_mounts))
+ ret = NSID_ERROR;
+
+ ret = validate_external_listmount(pid, nr_mounts);
+
+ if (write(parent_ready_pipe[1], &pval, sizeof(pval)) != sizeof(pval))
+ ret = NSID_ERROR;
+
+ child_ret = wait_for_pid(pid);
+ if (child_ret != NSID_PASS)
+ ret = child_ret;
+ handle_result(ret, "test listmount ns id");
+}
+
+int main(void)
+{
+ int ret;
+
+ ksft_print_header();
+ ret = statmount(0, 0, 0, NULL, 0, 0);
+ assert(ret == -1);
+ if (errno == ENOSYS)
+ ksft_exit_skip("statmount() syscall not supported\n");
+
+ ksft_set_plan(2);
+ test_statmount_mnt_ns_id();
+ test_listmount_ns();
+
+ if (ksft_get_fail_cnt() + ksft_get_error_cnt() > 0)
+ ksft_exit_fail();
+ else
+ ksft_exit_pass();
+}
diff --git a/tools/testing/selftests/ftrace/config b/tools/testing/selftests/ftrace/config
index e59d985eeff0..048a312abf40 100644
--- a/tools/testing/selftests/ftrace/config
+++ b/tools/testing/selftests/ftrace/config
@@ -1,16 +1,28 @@
-CONFIG_KPROBES=y
+CONFIG_BPF_SYSCALL=y
+CONFIG_DEBUG_INFO_BTF=y
+CONFIG_DEBUG_INFO_DWARF4=y
+CONFIG_EPROBE_EVENTS=y
+CONFIG_FPROBE=y
+CONFIG_FPROBE_EVENTS=y
CONFIG_FTRACE=y
+CONFIG_FTRACE_SYSCALLS=y
+CONFIG_FUNCTION_GRAPH_RETVAL=y
CONFIG_FUNCTION_PROFILER=y
-CONFIG_TRACER_SNAPSHOT=y
-CONFIG_STACK_TRACER=y
CONFIG_HIST_TRIGGERS=y
-CONFIG_SCHED_TRACER=y
-CONFIG_PREEMPT_TRACER=y
CONFIG_IRQSOFF_TRACER=y
-CONFIG_PREEMPTIRQ_DELAY_TEST=m
+CONFIG_KALLSYMS_ALL=y
+CONFIG_KPROBES=y
+CONFIG_KPROBE_EVENTS=y
CONFIG_MODULES=y
CONFIG_MODULE_UNLOAD=y
+CONFIG_PREEMPTIRQ_DELAY_TEST=m
+CONFIG_PREEMPT_TRACER=y
+CONFIG_PROBE_EVENTS_BTF_ARGS=y
CONFIG_SAMPLES=y
CONFIG_SAMPLE_FTRACE_DIRECT=m
CONFIG_SAMPLE_TRACE_PRINTK=m
-CONFIG_KALLSYMS_ALL=y
+CONFIG_SCHED_TRACER=y
+CONFIG_STACK_TRACER=y
+CONFIG_TRACER_SNAPSHOT=y
+CONFIG_UPROBES=y
+CONFIG_UPROBE_EVENTS=y
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc b/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc
index d3a79da215c8..5f72abe6fa79 100644
--- a/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/test_duplicates.tc
@@ -1,7 +1,7 @@
#!/bin/sh
# SPDX-License-Identifier: GPL-2.0
# description: Generic dynamic event - check if duplicate events are caught
-# requires: dynamic_events "e[:[<group>/][<event>]] <attached-group>.<attached-event> [<args>]":README
+# requires: dynamic_events "e[:[<group>/][<event>]] <attached-group>.<attached-event> [<args>]":README events/syscalls/sys_enter_openat
echo 0 > events/enable
diff --git a/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc b/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc
index 3f74c09c56b6..118247b8dd84 100644
--- a/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc
+++ b/tools/testing/selftests/ftrace/test.d/filter/event-filter-function.tc
@@ -10,7 +10,6 @@ fail() { #msg
}
sample_events() {
- echo > trace
echo 1 > events/kmem/kmem_cache_free/enable
echo 1 > tracing_on
ls > /dev/null
@@ -22,6 +21,7 @@ echo 0 > tracing_on
echo 0 > events/enable
echo "Get the most frequently calling function"
+echo > trace
sample_events
target_func=`cat trace | grep -o 'call_site=\([^+]*\)' | sed 's/call_site=//' | sort | uniq -c | sort | tail -n 1 | sed 's/^[ 0-9]*//'`
@@ -32,7 +32,16 @@ echo > trace
echo "Test event filter function name"
echo "call_site.function == $target_func" > events/kmem/kmem_cache_free/filter
+
+sample_events
+max_retry=10
+while [ `grep kmem_cache_free trace| wc -l` -eq 0 ]; do
sample_events
+max_retry=$((max_retry - 1))
+if [ $max_retry -eq 0 ]; then
+ exit_fail
+fi
+done
hitcnt=`grep kmem_cache_free trace| grep $target_func | wc -l`
misscnt=`grep kmem_cache_free trace| grep -v $target_func | wc -l`
@@ -49,7 +58,16 @@ address=`grep " ${target_func}\$" /proc/kallsyms | cut -d' ' -f1`
echo "Test event filter function address"
echo "call_site.function == 0x$address" > events/kmem/kmem_cache_free/filter
+echo > trace
+sample_events
+max_retry=10
+while [ `grep kmem_cache_free trace| wc -l` -eq 0 ]; do
sample_events
+max_retry=$((max_retry - 1))
+if [ $max_retry -eq 0 ]; then
+ exit_fail
+fi
+done
hitcnt=`grep kmem_cache_free trace| grep $target_func | wc -l`
misscnt=`grep kmem_cache_free trace| grep -v $target_func | wc -l`
diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc
index 1f6981ef7afa..ba19b81cef39 100644
--- a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc
+++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_eventname.tc
@@ -30,7 +30,8 @@ find_dot_func() {
fi
grep " [tT] .*\.isra\..*" /proc/kallsyms | cut -f 3 -d " " | while read f; do
- if grep -s $f available_filter_functions; then
+ cnt=`grep -s $f available_filter_functions | wc -l`;
+ if [ $cnt -eq 1 ]; then
echo $f
break
fi
diff --git a/tools/testing/selftests/futex/Makefile b/tools/testing/selftests/futex/Makefile
index 11e157d7533b..78ab2cd111f6 100644
--- a/tools/testing/selftests/futex/Makefile
+++ b/tools/testing/selftests/futex/Makefile
@@ -3,8 +3,6 @@ SUBDIRS := functional
TEST_PROGS := run.sh
-.PHONY: all clean
-
include ../lib.mk
all:
diff --git a/tools/testing/selftests/futex/functional/Makefile b/tools/testing/selftests/futex/functional/Makefile
index a392d0917b4e..994fa3468f17 100644
--- a/tools/testing/selftests/futex/functional/Makefile
+++ b/tools/testing/selftests/futex/functional/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0
INCLUDES := -I../include -I../../ $(KHDR_INCLUDES)
-CFLAGS := $(CFLAGS) -g -O2 -Wall -D_GNU_SOURCE -pthread $(INCLUDES) $(KHDR_INCLUDES)
+CFLAGS := $(CFLAGS) -g -O2 -Wall -D_GNU_SOURCE= -pthread $(INCLUDES) $(KHDR_INCLUDES)
LDLIBS := -lpthread -lrt
LOCAL_HDRS := \
diff --git a/tools/testing/selftests/futex/functional/futex_requeue_pi.c b/tools/testing/selftests/futex/functional/futex_requeue_pi.c
index 7f3ca5c78df1..215c6cb539b4 100644
--- a/tools/testing/selftests/futex/functional/futex_requeue_pi.c
+++ b/tools/testing/selftests/futex/functional/futex_requeue_pi.c
@@ -360,7 +360,7 @@ out:
int main(int argc, char *argv[])
{
- const char *test_name;
+ char *test_name;
int c, ret;
while ((c = getopt(argc, argv, "bchlot:v:")) != -1) {
diff --git a/tools/testing/selftests/hid/hid_bpf.c b/tools/testing/selftests/hid/hid_bpf.c
index f825623e3edc..dc0408a831d0 100644
--- a/tools/testing/selftests/hid/hid_bpf.c
+++ b/tools/testing/selftests/hid/hid_bpf.c
@@ -460,7 +460,7 @@ FIXTURE(hid_bpf) {
int hid_id;
pthread_t tid;
struct hid *skel;
- int hid_links[3]; /* max number of programs loaded in a single test */
+ struct bpf_link *hid_links[3]; /* max number of programs loaded in a single test */
};
static void detach_bpf(FIXTURE_DATA(hid_bpf) * self)
{
@@ -470,9 +470,14 @@ static void detach_bpf(FIXTURE_DATA(hid_bpf) * self)
close(self->hidraw_fd);
self->hidraw_fd = 0;
+ if (!self->skel)
+ return;
+
+ hid__detach(self->skel);
+
for (i = 0; i < ARRAY_SIZE(self->hid_links); i++) {
if (self->hid_links[i])
- close(self->hid_links[i]);
+ bpf_link__destroy(self->hid_links[i]);
}
hid__destroy(self->skel);
@@ -527,14 +532,7 @@ static void load_programs(const struct test_program programs[],
FIXTURE_DATA(hid_bpf) * self,
const FIXTURE_VARIANT(hid_bpf) * variant)
{
- int attach_fd, err = -EINVAL;
- struct attach_prog_args args = {
- .retval = -1,
- };
- DECLARE_LIBBPF_OPTS(bpf_test_run_opts, tattr,
- .ctx_in = &args,
- .ctx_size_in = sizeof(args),
- );
+ int err = -EINVAL;
ASSERT_LE(progs_count, ARRAY_SIZE(self->hid_links))
TH_LOG("too many programs are to be loaded");
@@ -545,37 +543,45 @@ static void load_programs(const struct test_program programs[],
for (int i = 0; i < progs_count; i++) {
struct bpf_program *prog;
+ struct bpf_map *map;
+ int *ops_hid_id;
prog = bpf_object__find_program_by_name(*self->skel->skeleton->obj,
programs[i].name);
ASSERT_OK_PTR(prog) TH_LOG("can not find program by name '%s'", programs[i].name);
bpf_program__set_autoload(prog, true);
+
+ map = bpf_object__find_map_by_name(*self->skel->skeleton->obj,
+ programs[i].name + 4);
+ ASSERT_OK_PTR(map) TH_LOG("can not find struct_ops by name '%s'",
+ programs[i].name + 4);
+
+ /* hid_id is the first field of struct hid_bpf_ops */
+ ops_hid_id = bpf_map__initial_value(map, NULL);
+ ASSERT_OK_PTR(ops_hid_id) TH_LOG("unable to retrieve struct_ops data");
+
+ *ops_hid_id = self->hid_id;
}
err = hid__load(self->skel);
ASSERT_OK(err) TH_LOG("hid_skel_load failed: %d", err);
- attach_fd = bpf_program__fd(self->skel->progs.attach_prog);
- ASSERT_GE(attach_fd, 0) TH_LOG("locate attach_prog: %d", attach_fd);
-
for (int i = 0; i < progs_count; i++) {
- struct bpf_program *prog;
+ struct bpf_map *map;
- prog = bpf_object__find_program_by_name(*self->skel->skeleton->obj,
- programs[i].name);
- ASSERT_OK_PTR(prog) TH_LOG("can not find program by name '%s'", programs[i].name);
-
- args.prog_fd = bpf_program__fd(prog);
- args.hid = self->hid_id;
- args.insert_head = programs[i].insert_head;
- err = bpf_prog_test_run_opts(attach_fd, &tattr);
- ASSERT_GE(args.retval, 0)
- TH_LOG("attach_hid(%s): %d", programs[i].name, args.retval);
+ map = bpf_object__find_map_by_name(*self->skel->skeleton->obj,
+ programs[i].name + 4);
+ ASSERT_OK_PTR(map) TH_LOG("can not find struct_ops by name '%s'",
+ programs[i].name + 4);
- self->hid_links[i] = args.retval;
+ self->hid_links[i] = bpf_map__attach_struct_ops(map);
+ ASSERT_OK_PTR(self->hid_links[i]) TH_LOG("failed to attach struct ops '%s'",
+ programs[i].name + 4);
}
+ hid__attach(self->skel);
+
self->hidraw_fd = open_hidraw(self->dev_id);
ASSERT_GE(self->hidraw_fd, 0) TH_LOG("open_hidraw");
}
@@ -640,6 +646,47 @@ TEST_F(hid_bpf, raw_event)
}
/*
+ * Attach hid_first_event to the given uhid device,
+ * retrieve and open the matching hidraw node,
+ * inject one event in the uhid device,
+ * check that the program sees it and can change the data
+ */
+TEST_F(hid_bpf, subprog_raw_event)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_subprog_first_event" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* inject one event */
+ buf[0] = 1;
+ buf[1] = 42;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[2], 47);
+
+ /* inject another event */
+ memset(buf, 0, sizeof(buf));
+ buf[0] = 1;
+ buf[1] = 47;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[2], 52);
+}
+
+/*
* Ensures that we can attach/detach programs
*/
TEST_F(hid_bpf, test_attach_detach)
@@ -648,13 +695,17 @@ TEST_F(hid_bpf, test_attach_detach)
{ .name = "hid_first_event" },
{ .name = "hid_second_event" },
};
+ struct bpf_link *link;
__u8 buf[10] = {0};
- int err, link;
+ int err, link_fd;
LOAD_PROGRAMS(progs);
link = self->hid_links[0];
- ASSERT_GT(link, 0) TH_LOG("HID-BPF link not created");
+ ASSERT_OK_PTR(link) TH_LOG("HID-BPF link not created");
+
+ link_fd = bpf_link__fd(link);
+ ASSERT_GE(link_fd, 0) TH_LOG("HID-BPF link FD not valid");
/* inject one event */
buf[0] = 1;
@@ -673,7 +724,7 @@ TEST_F(hid_bpf, test_attach_detach)
/* pin the first program and immediately unpin it */
#define PIN_PATH "/sys/fs/bpf/hid_first_event"
- err = bpf_obj_pin(link, PIN_PATH);
+ err = bpf_obj_pin(link_fd, PIN_PATH);
ASSERT_OK(err) TH_LOG("error while calling bpf_obj_pin");
remove(PIN_PATH);
#undef PIN_PATH
@@ -876,6 +927,325 @@ TEST_F(hid_bpf, test_hid_user_raw_request_call)
}
/*
+ * Call hid_hw_raw_request against the given uhid device,
+ * check that the program is called and prevents the
+ * call to uhid.
+ */
+TEST_F(hid_bpf, test_hid_filter_raw_request_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_filter_raw_request" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* first check that we did not attach to device_event */
+
+ /* inject one event */
+ buf[0] = 1;
+ buf[1] = 42;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[1], 42);
+ ASSERT_EQ(buf[2], 0) TH_LOG("leftovers_from_previous_test");
+
+ /* now check that our program is preventing hid_hw_raw_request() */
+
+ /* emit hid_hw_raw_request from hidraw */
+ /* Get Feature */
+ memset(buf, 0, sizeof(buf));
+ buf[0] = 0x1; /* Report Number */
+ err = ioctl(self->hidraw_fd, HIDIOCGFEATURE(sizeof(buf)), buf);
+ ASSERT_LT(err, 0) TH_LOG("unexpected success while reading HIDIOCGFEATURE: %d", err);
+ ASSERT_EQ(errno, 20) TH_LOG("unexpected error code while reading HIDIOCGFEATURE: %d",
+ errno);
+
+ /* remove our bpf program and check that we can now emit commands */
+
+ /* detach the program */
+ detach_bpf(self);
+
+ self->hidraw_fd = open_hidraw(self->dev_id);
+ ASSERT_GE(self->hidraw_fd, 0) TH_LOG("open_hidraw");
+
+ err = ioctl(self->hidraw_fd, HIDIOCGFEATURE(sizeof(buf)), buf);
+ ASSERT_GE(err, 0) TH_LOG("error while reading HIDIOCGFEATURE: %d", err);
+}
+
+/*
+ * Call hid_hw_raw_request against the given uhid device,
+ * check that the program is called and can issue the call
+ * to uhid and transform the answer.
+ */
+TEST_F(hid_bpf, test_hid_change_raw_request_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_hidraw_raw_request" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* emit hid_hw_raw_request from hidraw */
+ /* Get Feature */
+ memset(buf, 0, sizeof(buf));
+ buf[0] = 0x1; /* Report Number */
+ err = ioctl(self->hidraw_fd, HIDIOCGFEATURE(sizeof(buf)), buf);
+ ASSERT_EQ(err, 3) TH_LOG("unexpected returned size while reading HIDIOCGFEATURE: %d", err);
+
+ ASSERT_EQ(buf[0], 2);
+ ASSERT_EQ(buf[1], 3);
+ ASSERT_EQ(buf[2], 4);
+}
+
+/*
+ * Call hid_hw_raw_request against the given uhid device,
+ * check that the program is not making infinite loops.
+ */
+TEST_F(hid_bpf, test_hid_infinite_loop_raw_request_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_infinite_loop_raw_request" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* emit hid_hw_raw_request from hidraw */
+ /* Get Feature */
+ memset(buf, 0, sizeof(buf));
+ buf[0] = 0x1; /* Report Number */
+ err = ioctl(self->hidraw_fd, HIDIOCGFEATURE(sizeof(buf)), buf);
+ ASSERT_EQ(err, 3) TH_LOG("unexpected returned size while reading HIDIOCGFEATURE: %d", err);
+}
+
+/*
+ * Call hid_hw_output_report against the given uhid device,
+ * check that the program is called and prevents the
+ * call to uhid.
+ */
+TEST_F(hid_bpf, test_hid_filter_output_report_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_filter_output_report" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* first check that we did not attach to device_event */
+
+ /* inject one event */
+ buf[0] = 1;
+ buf[1] = 42;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[1], 42);
+ ASSERT_EQ(buf[2], 0) TH_LOG("leftovers_from_previous_test");
+
+ /* now check that our program is preventing hid_hw_output_report() */
+
+ buf[0] = 1; /* report ID */
+ buf[1] = 2;
+ buf[2] = 42;
+
+ err = write(self->hidraw_fd, buf, 3);
+ ASSERT_LT(err, 0) TH_LOG("unexpected success while sending hid_hw_output_report: %d", err);
+ ASSERT_EQ(errno, 25) TH_LOG("unexpected error code while sending hid_hw_output_report: %d",
+ errno);
+
+ /* remove our bpf program and check that we can now emit commands */
+
+ /* detach the program */
+ detach_bpf(self);
+
+ self->hidraw_fd = open_hidraw(self->dev_id);
+ ASSERT_GE(self->hidraw_fd, 0) TH_LOG("open_hidraw");
+
+ err = write(self->hidraw_fd, buf, 3);
+ ASSERT_GE(err, 0) TH_LOG("error while sending hid_hw_output_report: %d", err);
+}
+
+/*
+ * Call hid_hw_output_report against the given uhid device,
+ * check that the program is called and can issue the call
+ * to uhid and transform the answer.
+ */
+TEST_F(hid_bpf, test_hid_change_output_report_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_hidraw_output_report" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* emit hid_hw_output_report from hidraw */
+ buf[0] = 1; /* report ID */
+ buf[1] = 2;
+ buf[2] = 42;
+
+ err = write(self->hidraw_fd, buf, 10);
+ ASSERT_EQ(err, 2) TH_LOG("unexpected returned size while sending hid_hw_output_report: %d",
+ err);
+}
+
+/*
+ * Call hid_hw_output_report against the given uhid device,
+ * check that the program is not making infinite loops.
+ */
+TEST_F(hid_bpf, test_hid_infinite_loop_output_report_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_infinite_loop_output_report" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* emit hid_hw_output_report from hidraw */
+ buf[0] = 1; /* report ID */
+ buf[1] = 2;
+ buf[2] = 42;
+
+ err = write(self->hidraw_fd, buf, 8);
+ ASSERT_EQ(err, 2) TH_LOG("unexpected returned size while sending hid_hw_output_report: %d",
+ err);
+}
+
+/*
+ * Attach hid_multiply_event_wq to the given uhid device,
+ * retrieve and open the matching hidraw node,
+ * inject one event in the uhid device,
+ * check that the program sees it and can add extra data
+ */
+TEST_F(hid_bpf, test_multiply_events_wq)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_multiply_events_wq" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* inject one event */
+ buf[0] = 1;
+ buf[1] = 42;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[1], 47);
+
+ usleep(100000);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 9) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 2);
+ ASSERT_EQ(buf[1], 3);
+}
+
+/*
+ * Attach hid_multiply_event to the given uhid device,
+ * retrieve and open the matching hidraw node,
+ * inject one event in the uhid device,
+ * check that the program sees it and can add extra data
+ */
+TEST_F(hid_bpf, test_multiply_events)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_multiply_events" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* inject one event */
+ buf[0] = 1;
+ buf[1] = 42;
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 9) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 2);
+ ASSERT_EQ(buf[1], 47);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 9) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 2);
+ ASSERT_EQ(buf[1], 52);
+}
+
+/*
+ * Call hid_bpf_input_report against the given uhid device,
+ * check that the program is not making infinite loops.
+ */
+TEST_F(hid_bpf, test_hid_infinite_loop_input_report_call)
+{
+ const struct test_program progs[] = {
+ { .name = "hid_test_infinite_loop_input_report" },
+ };
+ __u8 buf[10] = {0};
+ int err;
+
+ LOAD_PROGRAMS(progs);
+
+ /* emit hid_hw_output_report from hidraw */
+ buf[0] = 1; /* report ID */
+ buf[1] = 2;
+ buf[2] = 42;
+
+ uhid_send_event(_metadata, self->uhid_fd, buf, 6);
+
+ /* read the data from hidraw */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[1], 3);
+
+ /* read the data from hidraw: hid_bpf_try_input_report should work exactly one time */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, 6) TH_LOG("read_hidraw");
+ ASSERT_EQ(buf[0], 1);
+ ASSERT_EQ(buf[1], 4);
+
+ /* read the data from hidraw: there should be none */
+ memset(buf, 0, sizeof(buf));
+ err = read(self->hidraw_fd, buf, sizeof(buf));
+ ASSERT_EQ(err, -1) TH_LOG("read_hidraw");
+}
+
+/*
* Attach hid_insert{0,1,2} to the given uhid device,
* retrieve and open the matching hidraw node,
* inject one event in the uhid device,
diff --git a/tools/testing/selftests/hid/progs/hid.c b/tools/testing/selftests/hid/progs/hid.c
index f67d35def142..ee9bbbcf751b 100644
--- a/tools/testing/selftests/hid/progs/hid.c
+++ b/tools/testing/selftests/hid/progs/hid.c
@@ -14,8 +14,8 @@ struct attach_prog_args {
__u64 callback_check = 52;
__u64 callback2_check = 52;
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_first_event, struct hid_bpf_ctx *hid_ctx)
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_first_event, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *rw_data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 3 /* size */);
@@ -29,8 +29,38 @@ int BPF_PROG(hid_first_event, struct hid_bpf_ctx *hid_ctx)
return hid_ctx->size;
}
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_second_event, struct hid_bpf_ctx *hid_ctx)
+SEC(".struct_ops.link")
+struct hid_bpf_ops first_event = {
+ .hid_device_event = (void *)hid_first_event,
+ .hid_id = 2,
+};
+
+int __hid_subprog_first_event(struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
+{
+ __u8 *rw_data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 3 /* size */);
+
+ if (!rw_data)
+ return 0; /* EPERM check */
+
+ rw_data[2] = rw_data[1] + 5;
+
+ return hid_ctx->size;
+}
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_subprog_first_event, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
+{
+ return __hid_subprog_first_event(hid_ctx, type);
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops subprog_first_event = {
+ .hid_device_event = (void *)hid_subprog_first_event,
+ .hid_id = 2,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_second_event, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *rw_data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 4 /* size */);
@@ -42,8 +72,13 @@ int BPF_PROG(hid_second_event, struct hid_bpf_ctx *hid_ctx)
return hid_ctx->size;
}
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_change_report_id, struct hid_bpf_ctx *hid_ctx)
+SEC(".struct_ops.link")
+struct hid_bpf_ops second_event = {
+ .hid_device_event = (void *)hid_second_event,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_change_report_id, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *rw_data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 3 /* size */);
@@ -55,15 +90,10 @@ int BPF_PROG(hid_change_report_id, struct hid_bpf_ctx *hid_ctx)
return 9;
}
-SEC("syscall")
-int attach_prog(struct attach_prog_args *ctx)
-{
- ctx->retval = hid_bpf_attach_prog(ctx->hid,
- ctx->prog_fd,
- ctx->insert_head ? HID_BPF_FLAG_INSERT_HEAD :
- HID_BPF_FLAG_NONE);
- return 0;
-}
+SEC(".struct_ops.link")
+struct hid_bpf_ops change_report_id = {
+ .hid_device_event = (void *)hid_change_report_id,
+};
struct hid_hw_request_syscall_args {
/* data needs to come at offset 0 so we can use it in calls */
@@ -181,7 +211,12 @@ static const __u8 rdesc[] = {
0xc0, /* END_COLLECTION */
};
-SEC("?fmod_ret/hid_bpf_rdesc_fixup")
+/*
+ * the following program is marked as sleepable (struct_ops.s).
+ * This is not strictly mandatory but is a nice test for
+ * sleepable struct_ops
+ */
+SEC("?struct_ops.s/hid_rdesc_fixup")
int BPF_PROG(hid_rdesc_fixup, struct hid_bpf_ctx *hid_ctx)
{
__u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 4096 /* size */);
@@ -200,8 +235,13 @@ int BPF_PROG(hid_rdesc_fixup, struct hid_bpf_ctx *hid_ctx)
return sizeof(rdesc) + 73;
}
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_test_insert1, struct hid_bpf_ctx *hid_ctx)
+SEC(".struct_ops.link")
+struct hid_bpf_ops rdesc_fixup = {
+ .hid_rdesc_fixup = (void *)hid_rdesc_fixup,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_insert1, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 4 /* size */);
@@ -217,8 +257,14 @@ int BPF_PROG(hid_test_insert1, struct hid_bpf_ctx *hid_ctx)
return 0;
}
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_test_insert2, struct hid_bpf_ctx *hid_ctx)
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_insert1 = {
+ .hid_device_event = (void *)hid_test_insert1,
+ .flags = BPF_F_BEFORE,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_insert2, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 4 /* size */);
@@ -234,8 +280,13 @@ int BPF_PROG(hid_test_insert2, struct hid_bpf_ctx *hid_ctx)
return 0;
}
-SEC("?fmod_ret/hid_bpf_device_event")
-int BPF_PROG(hid_test_insert3, struct hid_bpf_ctx *hid_ctx)
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_insert2 = {
+ .hid_device_event = (void *)hid_test_insert2,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_insert3, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
{
__u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 4 /* size */);
@@ -250,3 +301,300 @@ int BPF_PROG(hid_test_insert3, struct hid_bpf_ctx *hid_ctx)
return 0;
}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_insert3 = {
+ .hid_device_event = (void *)hid_test_insert3,
+};
+
+SEC("?struct_ops/hid_hw_request")
+int BPF_PROG(hid_test_filter_raw_request, struct hid_bpf_ctx *hctx, unsigned char reportnum,
+ enum hid_report_type rtype, enum hid_class_request reqtype, __u64 source)
+{
+ return -20;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_filter_raw_request = {
+ .hid_hw_request = (void *)hid_test_filter_raw_request,
+};
+
+static struct file *current_file;
+
+SEC("fentry/hidraw_open")
+int BPF_PROG(hidraw_open, struct inode *inode, struct file *file)
+{
+ current_file = file;
+ return 0;
+}
+
+SEC("?struct_ops.s/hid_hw_request")
+int BPF_PROG(hid_test_hidraw_raw_request, struct hid_bpf_ctx *hctx, unsigned char reportnum,
+ enum hid_report_type rtype, enum hid_class_request reqtype, __u64 source)
+{
+ __u8 *data = hid_bpf_get_data(hctx, 0 /* offset */, 3 /* size */);
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ /* check if the incoming request comes from our hidraw operation */
+ if (source == (__u64)current_file) {
+ data[0] = reportnum;
+
+ ret = hid_bpf_hw_request(hctx, data, 2, rtype, reqtype);
+ if (ret != 2)
+ return -1;
+ data[0] = reportnum + 1;
+ data[1] = reportnum + 2;
+ data[2] = reportnum + 3;
+ return 3;
+ }
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_hidraw_raw_request = {
+ .hid_hw_request = (void *)hid_test_hidraw_raw_request,
+};
+
+SEC("?struct_ops.s/hid_hw_request")
+int BPF_PROG(hid_test_infinite_loop_raw_request, struct hid_bpf_ctx *hctx, unsigned char reportnum,
+ enum hid_report_type rtype, enum hid_class_request reqtype, __u64 source)
+{
+ __u8 *data = hid_bpf_get_data(hctx, 0 /* offset */, 3 /* size */);
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ /* always forward the request as-is to the device, hid-bpf should prevent
+ * infinite loops.
+ */
+ data[0] = reportnum;
+
+ ret = hid_bpf_hw_request(hctx, data, 2, rtype, reqtype);
+ if (ret == 2)
+ return 3;
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_infinite_loop_raw_request = {
+ .hid_hw_request = (void *)hid_test_infinite_loop_raw_request,
+};
+
+SEC("?struct_ops/hid_hw_output_report")
+int BPF_PROG(hid_test_filter_output_report, struct hid_bpf_ctx *hctx, unsigned char reportnum,
+ enum hid_report_type rtype, enum hid_class_request reqtype, __u64 source)
+{
+ return -25;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_filter_output_report = {
+ .hid_hw_output_report = (void *)hid_test_filter_output_report,
+};
+
+SEC("?struct_ops.s/hid_hw_output_report")
+int BPF_PROG(hid_test_hidraw_output_report, struct hid_bpf_ctx *hctx, __u64 source)
+{
+ __u8 *data = hid_bpf_get_data(hctx, 0 /* offset */, 3 /* size */);
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ /* check if the incoming request comes from our hidraw operation */
+ if (source == (__u64)current_file)
+ return hid_bpf_hw_output_report(hctx, data, 2);
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_hidraw_output_report = {
+ .hid_hw_output_report = (void *)hid_test_hidraw_output_report,
+};
+
+SEC("?struct_ops.s/hid_hw_output_report")
+int BPF_PROG(hid_test_infinite_loop_output_report, struct hid_bpf_ctx *hctx, __u64 source)
+{
+ __u8 *data = hid_bpf_get_data(hctx, 0 /* offset */, 3 /* size */);
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ /* always forward the request as-is to the device, hid-bpf should prevent
+ * infinite loops.
+ */
+
+ ret = hid_bpf_hw_output_report(hctx, data, 2);
+ if (ret == 2)
+ return 2;
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_infinite_loop_output_report = {
+ .hid_hw_output_report = (void *)hid_test_infinite_loop_output_report,
+};
+
+struct elem {
+ struct bpf_wq work;
+};
+
+struct {
+ __uint(type, BPF_MAP_TYPE_HASH);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, struct elem);
+} hmap SEC(".maps");
+
+static int wq_cb_sleepable(void *map, int *key, struct bpf_wq *work)
+{
+ __u8 buf[9] = {2, 3, 4, 5, 6, 7, 8, 9, 10};
+ struct hid_bpf_ctx *hid_ctx;
+
+ hid_ctx = hid_bpf_allocate_context(*key);
+ if (!hid_ctx)
+ return 0; /* EPERM check */
+
+ hid_bpf_input_report(hid_ctx, HID_INPUT_REPORT, buf, sizeof(buf));
+
+ hid_bpf_release_context(hid_ctx);
+
+ return 0;
+}
+
+static int test_inject_input_report_callback(int *key)
+{
+ struct elem init = {}, *val;
+ struct bpf_wq *wq;
+
+ if (bpf_map_update_elem(&hmap, key, &init, 0))
+ return -1;
+
+ val = bpf_map_lookup_elem(&hmap, key);
+ if (!val)
+ return -2;
+
+ wq = &val->work;
+ if (bpf_wq_init(wq, &hmap, 0) != 0)
+ return -3;
+
+ if (bpf_wq_set_callback(wq, wq_cb_sleepable, 0))
+ return -4;
+
+ if (bpf_wq_start(wq, 0))
+ return -5;
+
+ return 0;
+}
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_multiply_events_wq, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
+{
+ __u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 9 /* size */);
+ int hid = hid_ctx->hid->id;
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ if (data[0] != 1)
+ return 0;
+
+ ret = test_inject_input_report_callback(&hid);
+ if (ret)
+ return ret;
+
+ data[1] += 5;
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_multiply_events_wq = {
+ .hid_device_event = (void *)hid_test_multiply_events_wq,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_multiply_events, struct hid_bpf_ctx *hid_ctx, enum hid_report_type type)
+{
+ __u8 *data = hid_bpf_get_data(hid_ctx, 0 /* offset */, 9 /* size */);
+ __u8 buf[9];
+ int ret;
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ if (data[0] != 1)
+ return 0;
+
+ /*
+ * we have to use an intermediate buffer as hid_bpf_input_report
+ * will memset data to \0
+ */
+ __builtin_memcpy(buf, data, sizeof(buf));
+
+ buf[0] = 2;
+ buf[1] += 5;
+ ret = hid_bpf_try_input_report(hid_ctx, HID_INPUT_REPORT, buf, sizeof(buf));
+ if (ret < 0)
+ return ret;
+
+ /*
+ * In real world we should reset the original buffer as data might be garbage now,
+ * but it actually now has the content of 'buf'
+ */
+ data[1] += 5;
+
+ return 9;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_multiply_events = {
+ .hid_device_event = (void *)hid_test_multiply_events,
+};
+
+SEC("?struct_ops/hid_device_event")
+int BPF_PROG(hid_test_infinite_loop_input_report, struct hid_bpf_ctx *hctx,
+ enum hid_report_type report_type, __u64 source)
+{
+ __u8 *data = hid_bpf_get_data(hctx, 0 /* offset */, 6 /* size */);
+ __u8 buf[6];
+
+ if (!data)
+ return 0; /* EPERM check */
+
+ /*
+ * we have to use an intermediate buffer as hid_bpf_input_report
+ * will memset data to \0
+ */
+ __builtin_memcpy(buf, data, sizeof(buf));
+
+ /* always forward the request as-is to the device, hid-bpf should prevent
+ * infinite loops.
+ * the return value is ignored so the event is passing to userspace.
+ */
+
+ hid_bpf_try_input_report(hctx, report_type, buf, sizeof(buf));
+
+ /* each time we process the event, we increment by one data[1]:
+ * after each successful call to hid_bpf_try_input_report, buf
+ * has been memcopied into data by the kernel.
+ */
+ data[1] += 1;
+
+ return 0;
+}
+
+SEC(".struct_ops.link")
+struct hid_bpf_ops test_infinite_loop_input_report = {
+ .hid_device_event = (void *)hid_test_infinite_loop_input_report,
+};
diff --git a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
index 9cd56821d0f1..cfe37f491906 100644
--- a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
+++ b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
@@ -7,6 +7,7 @@
/* "undefine" structs and enums in vmlinux.h, because we "override" them below */
#define hid_bpf_ctx hid_bpf_ctx___not_used
+#define hid_bpf_ops hid_bpf_ops___not_used
#define hid_report_type hid_report_type___not_used
#define hid_class_request hid_class_request___not_used
#define hid_bpf_attach_flags hid_bpf_attach_flags___not_used
@@ -20,13 +21,11 @@
#define HID_REQ_SET_REPORT HID_REQ_SET_REPORT___not_used
#define HID_REQ_SET_IDLE HID_REQ_SET_IDLE___not_used
#define HID_REQ_SET_PROTOCOL HID_REQ_SET_PROTOCOL___not_used
-#define HID_BPF_FLAG_NONE HID_BPF_FLAG_NONE___not_used
-#define HID_BPF_FLAG_INSERT_HEAD HID_BPF_FLAG_INSERT_HEAD___not_used
-#define HID_BPF_FLAG_MAX HID_BPF_FLAG_MAX___not_used
#include "vmlinux.h"
#undef hid_bpf_ctx
+#undef hid_bpf_ops
#undef hid_report_type
#undef hid_class_request
#undef hid_bpf_attach_flags
@@ -40,9 +39,6 @@
#undef HID_REQ_SET_REPORT
#undef HID_REQ_SET_IDLE
#undef HID_REQ_SET_PROTOCOL
-#undef HID_BPF_FLAG_NONE
-#undef HID_BPF_FLAG_INSERT_HEAD
-#undef HID_BPF_FLAG_MAX
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
@@ -57,10 +53,8 @@ enum hid_report_type {
};
struct hid_bpf_ctx {
- __u32 index;
- const struct hid_device *hid;
+ struct hid_device *hid;
__u32 allocated_size;
- enum hid_report_type report_type;
union {
__s32 retval;
__s32 size;
@@ -76,17 +70,28 @@ enum hid_class_request {
HID_REQ_SET_PROTOCOL = 0x0B,
};
-enum hid_bpf_attach_flags {
- HID_BPF_FLAG_NONE = 0,
- HID_BPF_FLAG_INSERT_HEAD = _BITUL(0),
- HID_BPF_FLAG_MAX,
+struct hid_bpf_ops {
+ int hid_id;
+ u32 flags;
+ struct list_head list;
+ int (*hid_device_event)(struct hid_bpf_ctx *ctx, enum hid_report_type report_type,
+ u64 source);
+ int (*hid_rdesc_fixup)(struct hid_bpf_ctx *ctx);
+ int (*hid_hw_request)(struct hid_bpf_ctx *ctx, unsigned char reportnum,
+ enum hid_report_type rtype, enum hid_class_request reqtype,
+ u64 source);
+ int (*hid_hw_output_report)(struct hid_bpf_ctx *ctx, u64 source);
+ struct hid_device *hdev;
};
+#ifndef BPF_F_BEFORE
+#define BPF_F_BEFORE (1U << 3)
+#endif
+
/* following are kfuncs exported by HID for HID-BPF */
extern __u8 *hid_bpf_get_data(struct hid_bpf_ctx *ctx,
unsigned int offset,
const size_t __sz) __ksym;
-extern int hid_bpf_attach_prog(unsigned int hid_id, int prog_fd, u32 flags) __ksym;
extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __ksym;
extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __ksym;
extern int hid_bpf_hw_request(struct hid_bpf_ctx *ctx,
@@ -100,5 +105,18 @@ extern int hid_bpf_input_report(struct hid_bpf_ctx *ctx,
enum hid_report_type type,
__u8 *data,
size_t buf__sz) __ksym;
+extern int hid_bpf_try_input_report(struct hid_bpf_ctx *ctx,
+ enum hid_report_type type,
+ __u8 *data,
+ size_t buf__sz) __ksym;
+
+/* bpf_wq implementation */
+extern int bpf_wq_init(struct bpf_wq *wq, void *p__map, unsigned int flags) __weak __ksym;
+extern int bpf_wq_start(struct bpf_wq *wq, unsigned int flags) __weak __ksym;
+extern int bpf_wq_set_callback_impl(struct bpf_wq *wq,
+ int (callback_fn)(void *map, int *key, struct bpf_wq *wq),
+ unsigned int flags__k, void *aux__ign) __ksym;
+#define bpf_wq_set_callback(timer, cb, flags) \
+ bpf_wq_set_callback_impl(timer, cb, flags, NULL)
#endif /* __HID_BPF_HELPERS_H */
diff --git a/tools/testing/selftests/kselftest.h b/tools/testing/selftests/kselftest.h
index 76c2a6945d3e..b8967b6e29d5 100644
--- a/tools/testing/selftests/kselftest.h
+++ b/tools/testing/selftests/kselftest.h
@@ -168,15 +168,7 @@ static inline __printf(1, 2) void ksft_print_msg(const char *msg, ...)
static inline void ksft_perror(const char *msg)
{
-#ifndef NOLIBC
ksft_print_msg("%s: %s (%d)\n", msg, strerror(errno), errno);
-#else
- /*
- * nolibc doesn't provide strerror() and it seems
- * inappropriate to add one, just print the errno.
- */
- ksft_print_msg("%s: %d)\n", msg, errno);
-#endif
}
static inline __printf(1, 2) void ksft_test_result_pass(const char *msg, ...)
diff --git a/tools/testing/selftests/kselftest_harness.h b/tools/testing/selftests/kselftest_harness.h
index b634969cbb6f..40723a6a083f 100644
--- a/tools/testing/selftests/kselftest_harness.h
+++ b/tools/testing/selftests/kselftest_harness.h
@@ -66,8 +66,6 @@
#include <sys/wait.h>
#include <unistd.h>
#include <setjmp.h>
-#include <syscall.h>
-#include <linux/sched.h>
#include "kselftest.h"
@@ -82,17 +80,6 @@
# define TH_LOG_ENABLED 1
#endif
-/* Wait for the child process to end but without sharing memory mapping. */
-static inline pid_t clone3_vfork(void)
-{
- struct clone_args args = {
- .flags = CLONE_VFORK,
- .exit_signal = SIGCHLD,
- };
-
- return syscall(__NR_clone3, &args, sizeof(args));
-}
-
/**
* TH_LOG()
*
@@ -437,7 +424,7 @@ static inline pid_t clone3_vfork(void)
} \
if (setjmp(_metadata->env) == 0) { \
/* _metadata and potentially self are shared with all forks. */ \
- child = clone3_vfork(); \
+ child = fork(); \
if (child == 0) { \
fixture_name##_setup(_metadata, self, variant->data); \
/* Let setup failure terminate early. */ \
@@ -1016,7 +1003,14 @@ void __wait_for_test(struct __test_metadata *t)
.sa_flags = SA_SIGINFO,
};
struct sigaction saved_action;
- int status;
+ /*
+ * Sets status so that WIFEXITED(status) returns true and
+ * WEXITSTATUS(status) returns KSFT_FAIL. This safe default value
+ * should never be evaluated because of the waitpid(2) check and
+ * SIGALRM handling.
+ */
+ int status = KSFT_FAIL << 8;
+ int child;
if (sigaction(SIGALRM, &action, &saved_action)) {
t->exit_code = KSFT_FAIL;
@@ -1028,7 +1022,15 @@ void __wait_for_test(struct __test_metadata *t)
__active_test = t;
t->timed_out = false;
alarm(t->timeout);
- waitpid(t->pid, &status, 0);
+ child = waitpid(t->pid, &status, 0);
+ if (child == -1 && errno != EINTR) {
+ t->exit_code = KSFT_FAIL;
+ fprintf(TH_LOG_STREAM,
+ "# %s: Failed to wait for PID %d (errno: %d)\n",
+ t->name, t->pid, errno);
+ return;
+ }
+
alarm(0);
if (sigaction(SIGALRM, &saved_action, NULL)) {
t->exit_code = KSFT_FAIL;
@@ -1083,6 +1085,7 @@ void __wait_for_test(struct __test_metadata *t)
WTERMSIG(status));
}
} else {
+ t->exit_code = KSFT_FAIL;
fprintf(TH_LOG_STREAM,
"# %s: Test ended in some other way [%u]\n",
t->name,
@@ -1218,6 +1221,7 @@ void __run_test(struct __fixture_metadata *f,
struct __test_xfail *xfail;
char test_name[1024];
const char *diagnostic;
+ int child;
/* reset test struct */
t->exit_code = KSFT_PASS;
@@ -1236,15 +1240,16 @@ void __run_test(struct __fixture_metadata *f,
fflush(stdout);
fflush(stderr);
- t->pid = clone3_vfork();
- if (t->pid < 0) {
+ child = fork();
+ if (child < 0) {
ksft_print_msg("ERROR SPAWNING TEST CHILD\n");
t->exit_code = KSFT_FAIL;
- } else if (t->pid == 0) {
+ } else if (child == 0) {
setpgrp();
t->fn(t, variant);
_exit(t->exit_code);
} else {
+ t->pid = child;
__wait_for_test(t);
}
ksft_print_msg(" %4s %s\n",
diff --git a/tools/testing/selftests/kvm/Makefile b/tools/testing/selftests/kvm/Makefile
index ce8ff8e8ce3a..ac280dcba996 100644
--- a/tools/testing/selftests/kvm/Makefile
+++ b/tools/testing/selftests/kvm/Makefile
@@ -183,6 +183,7 @@ TEST_GEN_PROGS_s390x += s390x/sync_regs_test
TEST_GEN_PROGS_s390x += s390x/tprot
TEST_GEN_PROGS_s390x += s390x/cmma_test
TEST_GEN_PROGS_s390x += s390x/debug_test
+TEST_GEN_PROGS_s390x += s390x/shared_zeropage_test
TEST_GEN_PROGS_s390x += demand_paging_test
TEST_GEN_PROGS_s390x += dirty_log_test
TEST_GEN_PROGS_s390x += guest_print_test
diff --git a/tools/testing/selftests/kvm/include/x86_64/processor.h b/tools/testing/selftests/kvm/include/x86_64/processor.h
index 8eb57de0b587..c0c7c1fe93f9 100644
--- a/tools/testing/selftests/kvm/include/x86_64/processor.h
+++ b/tools/testing/selftests/kvm/include/x86_64/processor.h
@@ -277,6 +277,7 @@ struct kvm_x86_cpu_property {
#define X86_PROPERTY_MAX_EXT_LEAF KVM_X86_CPU_PROPERTY(0x80000000, 0, EAX, 0, 31)
#define X86_PROPERTY_MAX_PHY_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 0, 7)
#define X86_PROPERTY_MAX_VIRT_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 8, 15)
+#define X86_PROPERTY_GUEST_MAX_PHY_ADDR KVM_X86_CPU_PROPERTY(0x80000008, 0, EAX, 16, 23)
#define X86_PROPERTY_SEV_C_BIT KVM_X86_CPU_PROPERTY(0x8000001F, 0, EBX, 0, 5)
#define X86_PROPERTY_PHYS_ADDR_REDUCTION KVM_X86_CPU_PROPERTY(0x8000001F, 0, EBX, 6, 11)
diff --git a/tools/testing/selftests/kvm/lib/riscv/ucall.c b/tools/testing/selftests/kvm/lib/riscv/ucall.c
index 14ee17151a59..b5035c63d516 100644
--- a/tools/testing/selftests/kvm/lib/riscv/ucall.c
+++ b/tools/testing/selftests/kvm/lib/riscv/ucall.c
@@ -9,6 +9,7 @@
#include "kvm_util.h"
#include "processor.h"
+#include "sbi.h"
void *ucall_arch_get_ucall(struct kvm_vcpu *vcpu)
{
diff --git a/tools/testing/selftests/kvm/lib/x86_64/processor.c b/tools/testing/selftests/kvm/lib/x86_64/processor.c
index c664e446136b..594b061aef52 100644
--- a/tools/testing/selftests/kvm/lib/x86_64/processor.c
+++ b/tools/testing/selftests/kvm/lib/x86_64/processor.c
@@ -1247,9 +1247,20 @@ unsigned long vm_compute_max_gfn(struct kvm_vm *vm)
{
const unsigned long num_ht_pages = 12 << (30 - vm->page_shift); /* 12 GiB */
unsigned long ht_gfn, max_gfn, max_pfn;
- uint8_t maxphyaddr;
+ uint8_t maxphyaddr, guest_maxphyaddr;
- max_gfn = (1ULL << (vm->pa_bits - vm->page_shift)) - 1;
+ /*
+ * Use "guest MAXPHYADDR" from KVM if it's available. Guest MAXPHYADDR
+ * enumerates the max _mappable_ GPA, which can be less than the raw
+ * MAXPHYADDR, e.g. if MAXPHYADDR=52, KVM is using TDP, and the CPU
+ * doesn't support 5-level TDP.
+ */
+ guest_maxphyaddr = kvm_cpu_property(X86_PROPERTY_GUEST_MAX_PHY_ADDR);
+ guest_maxphyaddr = guest_maxphyaddr ?: vm->pa_bits;
+ TEST_ASSERT(guest_maxphyaddr <= vm->pa_bits,
+ "Guest MAXPHYADDR should never be greater than raw MAXPHYADDR");
+
+ max_gfn = (1ULL << (guest_maxphyaddr - vm->page_shift)) - 1;
/* Avoid reserved HyperTransport region on AMD processors. */
if (!host_cpu_is_amd)
diff --git a/tools/testing/selftests/kvm/riscv/ebreak_test.c b/tools/testing/selftests/kvm/riscv/ebreak_test.c
index 823c132069b4..0e0712854953 100644
--- a/tools/testing/selftests/kvm/riscv/ebreak_test.c
+++ b/tools/testing/selftests/kvm/riscv/ebreak_test.c
@@ -6,6 +6,7 @@
*
*/
#include "kvm_util.h"
+#include "ucall_common.h"
#define LABEL_ADDRESS(v) ((uint64_t)&(v))
diff --git a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c
index 69bb94e6b227..f299cbfd23ca 100644
--- a/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c
+++ b/tools/testing/selftests/kvm/riscv/sbi_pmu_test.c
@@ -15,6 +15,7 @@
#include "processor.h"
#include "sbi.h"
#include "arch_timer.h"
+#include "ucall_common.h"
/* Maximum counters(firmware + hardware) */
#define RISCV_MAX_PMU_COUNTERS 64
diff --git a/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c b/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c
new file mode 100644
index 000000000000..bba0d9a6dcc8
--- /dev/null
+++ b/tools/testing/selftests/kvm/s390x/shared_zeropage_test.c
@@ -0,0 +1,111 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+/*
+ * Test shared zeropage handling (with/without storage keys)
+ *
+ * Copyright (C) 2024, Red Hat, Inc.
+ */
+#include <sys/mman.h>
+
+#include <linux/fs.h>
+
+#include "test_util.h"
+#include "kvm_util.h"
+#include "kselftest.h"
+#include "ucall_common.h"
+
+static void set_storage_key(void *addr, uint8_t skey)
+{
+ asm volatile("sske %0,%1" : : "d" (skey), "a" (addr));
+}
+
+static void guest_code(void)
+{
+ /* Issue some storage key instruction. */
+ set_storage_key((void *)0, 0x98);
+ GUEST_DONE();
+}
+
+/*
+ * Returns 1 if the shared zeropage is mapped, 0 if something else is mapped.
+ * Returns < 0 on error or if nothing is mapped.
+ */
+static int maps_shared_zeropage(int pagemap_fd, void *addr)
+{
+ struct page_region region;
+ struct pm_scan_arg arg = {
+ .start = (uintptr_t)addr,
+ .end = (uintptr_t)addr + 4096,
+ .vec = (uintptr_t)&region,
+ .vec_len = 1,
+ .size = sizeof(struct pm_scan_arg),
+ .category_mask = PAGE_IS_PFNZERO,
+ .category_anyof_mask = PAGE_IS_PRESENT,
+ .return_mask = PAGE_IS_PFNZERO,
+ };
+ return ioctl(pagemap_fd, PAGEMAP_SCAN, &arg);
+}
+
+int main(int argc, char *argv[])
+{
+ char *mem, *page0, *page1, *page2, tmp;
+ const size_t pagesize = getpagesize();
+ struct kvm_vcpu *vcpu;
+ struct kvm_vm *vm;
+ struct ucall uc;
+ int pagemap_fd;
+
+ ksft_print_header();
+ ksft_set_plan(3);
+
+ /*
+ * We'll use memory that is not mapped into the VM for simplicity.
+ * Shared zeropages are enabled/disabled per-process.
+ */
+ mem = mmap(0, 3 * pagesize, PROT_READ, MAP_PRIVATE | MAP_ANON, -1, 0);
+ TEST_ASSERT(mem != MAP_FAILED, "mmap() failed");
+
+ /* Disable THP. Ignore errors on older kernels. */
+ madvise(mem, 3 * pagesize, MADV_NOHUGEPAGE);
+
+ page0 = mem;
+ page1 = page0 + pagesize;
+ page2 = page1 + pagesize;
+
+ /* Can we even detect shared zeropages? */
+ pagemap_fd = open("/proc/self/pagemap", O_RDONLY);
+ TEST_REQUIRE(pagemap_fd >= 0);
+
+ tmp = *page0;
+ asm volatile("" : "+r" (tmp));
+ TEST_REQUIRE(maps_shared_zeropage(pagemap_fd, page0) == 1);
+
+ vm = vm_create_with_one_vcpu(&vcpu, guest_code);
+
+ /* Verify that we get the shared zeropage after VM creation. */
+ tmp = *page1;
+ asm volatile("" : "+r" (tmp));
+ ksft_test_result(maps_shared_zeropage(pagemap_fd, page1) == 1,
+ "Shared zeropages should be enabled\n");
+
+ /*
+ * Let our VM execute a storage key instruction that should
+ * unshare all shared zeropages.
+ */
+ vcpu_run(vcpu);
+ get_ucall(vcpu, &uc);
+ TEST_ASSERT_EQ(uc.cmd, UCALL_DONE);
+
+ /* Verify that we don't have a shared zeropage anymore. */
+ ksft_test_result(!maps_shared_zeropage(pagemap_fd, page1),
+ "Shared zeropage should be gone\n");
+
+ /* Verify that we don't get any new shared zeropages. */
+ tmp = *page2;
+ asm volatile("" : "+r" (tmp));
+ ksft_test_result(!maps_shared_zeropage(pagemap_fd, page2),
+ "Shared zeropages should be disabled\n");
+
+ kvm_vm_free(vm);
+
+ ksft_finished();
+}
diff --git a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c b/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c
index 7a4a61be119b..3fb967f40c6a 100644
--- a/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c
+++ b/tools/testing/selftests/kvm/x86_64/sev_init2_tests.c
@@ -105,11 +105,11 @@ void test_features(uint32_t vm_type, uint64_t supported_features)
int i;
for (i = 0; i < 64; i++) {
- if (!(supported_features & (1u << i)))
+ if (!(supported_features & BIT_ULL(i)))
test_init2_invalid(vm_type,
&(struct kvm_sev_init){ .vmsa_features = BIT_ULL(i) },
"unknown feature");
- else if (KNOWN_FEATURES & (1u << i))
+ else if (KNOWN_FEATURES & BIT_ULL(i))
test_init2(vm_type,
&(struct kvm_sev_init){ .vmsa_features = BIT_ULL(i) });
}
diff --git a/tools/testing/selftests/landlock/fs_test.c b/tools/testing/selftests/landlock/fs_test.c
index 6b5a9ff88c3d..7d063c652be1 100644
--- a/tools/testing/selftests/landlock/fs_test.c
+++ b/tools/testing/selftests/landlock/fs_test.c
@@ -35,6 +35,7 @@
* See https://sourceware.org/glibc/wiki/Synchronizing_Headers.
*/
#include <linux/fs.h>
+#include <linux/mount.h>
#include "common.h"
@@ -47,6 +48,13 @@ int renameat2(int olddirfd, const char *oldpath, int newdirfd,
}
#endif
+#ifndef open_tree
+int open_tree(int dfd, const char *filename, unsigned int flags)
+{
+ return syscall(__NR_open_tree, dfd, filename, flags);
+}
+#endif
+
#ifndef RENAME_EXCHANGE
#define RENAME_EXCHANGE (1 << 1)
#endif
@@ -2400,6 +2408,43 @@ TEST_F_FORK(layout1, refer_denied_by_default4)
layer_dir_s1d1_refer);
}
+/*
+ * Tests walking through a denied root mount.
+ */
+TEST_F_FORK(layout1, refer_mount_root_deny)
+{
+ const struct landlock_ruleset_attr ruleset_attr = {
+ .handled_access_fs = LANDLOCK_ACCESS_FS_MAKE_DIR,
+ };
+ int root_fd, ruleset_fd;
+
+ /* Creates a mount object from a non-mount point. */
+ set_cap(_metadata, CAP_SYS_ADMIN);
+ root_fd =
+ open_tree(AT_FDCWD, dir_s1d1,
+ AT_EMPTY_PATH | OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC);
+ clear_cap(_metadata, CAP_SYS_ADMIN);
+ ASSERT_LE(0, root_fd);
+
+ ruleset_fd =
+ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+ ASSERT_LE(0, ruleset_fd);
+
+ ASSERT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+ ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+ EXPECT_EQ(0, close(ruleset_fd));
+
+ /* Link denied by Landlock: EACCES. */
+ EXPECT_EQ(-1, linkat(root_fd, ".", root_fd, "does_not_exist", 0));
+ EXPECT_EQ(EACCES, errno);
+
+ /* renameat2() always returns EBUSY. */
+ EXPECT_EQ(-1, renameat2(root_fd, ".", root_fd, "does_not_exist", 0));
+ EXPECT_EQ(EBUSY, errno);
+
+ EXPECT_EQ(0, close(root_fd));
+}
+
TEST_F_FORK(layout1, reparent_link)
{
const struct rule layer1[] = {
diff --git a/tools/testing/selftests/lib.mk b/tools/testing/selftests/lib.mk
index 429535816dbd..7b299ed5ff45 100644
--- a/tools/testing/selftests/lib.mk
+++ b/tools/testing/selftests/lib.mk
@@ -38,6 +38,14 @@ else
CLANG_FLAGS += --target=$(notdir $(CROSS_COMPILE:%-=%))
endif # CROSS_COMPILE
+# gcc defaults to silence (off) for the following warnings, but clang defaults
+# to the opposite. The warnings are not useful for the kernel itself, which is
+# why they have remained disabled in gcc for the main kernel build. And it is
+# only due to including kernel data structures in the selftests, that we get the
+# warnings from clang. Therefore, disable the warnings for clang builds.
+CFLAGS += -Wno-address-of-packed-member
+CFLAGS += -Wno-gnu-variable-sized-type-not-at-end
+
CC := $(CLANG) $(CLANG_FLAGS) -fintegrated-as
else
CC := $(CROSS_COMPILE)gcc
diff --git a/tools/testing/selftests/lkdtm/tests.txt b/tools/testing/selftests/lkdtm/tests.txt
index 368973f05250..cff124c1eddd 100644
--- a/tools/testing/selftests/lkdtm/tests.txt
+++ b/tools/testing/selftests/lkdtm/tests.txt
@@ -31,6 +31,7 @@ SLAB_FREE_CROSS
SLAB_FREE_PAGE
#SOFTLOCKUP Hangs the system
#HARDLOCKUP Hangs the system
+#SMP_CALL_LOCKUP Hangs the system
#SPINLOCKUP Hangs the system
#HUNG_TASK Hangs the system
EXEC_DATA
diff --git a/tools/testing/selftests/mm/ksm_functional_tests.c b/tools/testing/selftests/mm/ksm_functional_tests.c
index 37de82da9be7..b61803e36d1c 100644
--- a/tools/testing/selftests/mm/ksm_functional_tests.c
+++ b/tools/testing/selftests/mm/ksm_functional_tests.c
@@ -656,12 +656,33 @@ unmap:
munmap(map, size);
}
+static void init_global_file_handles(void)
+{
+ mem_fd = open("/proc/self/mem", O_RDWR);
+ if (mem_fd < 0)
+ ksft_exit_fail_msg("opening /proc/self/mem failed\n");
+ ksm_fd = open("/sys/kernel/mm/ksm/run", O_RDWR);
+ if (ksm_fd < 0)
+ ksft_exit_skip("open(\"/sys/kernel/mm/ksm/run\") failed\n");
+ ksm_full_scans_fd = open("/sys/kernel/mm/ksm/full_scans", O_RDONLY);
+ if (ksm_full_scans_fd < 0)
+ ksft_exit_skip("open(\"/sys/kernel/mm/ksm/full_scans\") failed\n");
+ pagemap_fd = open("/proc/self/pagemap", O_RDONLY);
+ if (pagemap_fd < 0)
+ ksft_exit_skip("open(\"/proc/self/pagemap\") failed\n");
+ proc_self_ksm_stat_fd = open("/proc/self/ksm_stat", O_RDONLY);
+ proc_self_ksm_merging_pages_fd = open("/proc/self/ksm_merging_pages",
+ O_RDONLY);
+ ksm_use_zero_pages_fd = open("/sys/kernel/mm/ksm/use_zero_pages", O_RDWR);
+}
+
int main(int argc, char **argv)
{
unsigned int tests = 8;
int err;
if (argc > 1 && !strcmp(argv[1], FORK_EXEC_CHILD_PRG_NAME)) {
+ init_global_file_handles();
exit(test_child_ksm());
}
@@ -674,22 +695,7 @@ int main(int argc, char **argv)
pagesize = getpagesize();
- mem_fd = open("/proc/self/mem", O_RDWR);
- if (mem_fd < 0)
- ksft_exit_fail_msg("opening /proc/self/mem failed\n");
- ksm_fd = open("/sys/kernel/mm/ksm/run", O_RDWR);
- if (ksm_fd < 0)
- ksft_exit_skip("open(\"/sys/kernel/mm/ksm/run\") failed\n");
- ksm_full_scans_fd = open("/sys/kernel/mm/ksm/full_scans", O_RDONLY);
- if (ksm_full_scans_fd < 0)
- ksft_exit_skip("open(\"/sys/kernel/mm/ksm/full_scans\") failed\n");
- pagemap_fd = open("/proc/self/pagemap", O_RDONLY);
- if (pagemap_fd < 0)
- ksft_exit_skip("open(\"/proc/self/pagemap\") failed\n");
- proc_self_ksm_stat_fd = open("/proc/self/ksm_stat", O_RDONLY);
- proc_self_ksm_merging_pages_fd = open("/proc/self/ksm_merging_pages",
- O_RDONLY);
- ksm_use_zero_pages_fd = open("/sys/kernel/mm/ksm/use_zero_pages", O_RDWR);
+ init_global_file_handles();
test_unmerge();
test_unmerge_zero_pages();
diff --git a/tools/testing/selftests/mm/map_fixed_noreplace.c b/tools/testing/selftests/mm/map_fixed_noreplace.c
index b74813fdc951..d53de2486080 100644
--- a/tools/testing/selftests/mm/map_fixed_noreplace.c
+++ b/tools/testing/selftests/mm/map_fixed_noreplace.c
@@ -67,7 +67,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error: munmap failed!?\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 5*PAGE_SIZE at base\n");
addr = base_addr + page_size;
size = 3 * page_size;
@@ -76,7 +77,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error: first mmap() failed unexpectedly\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 3*PAGE_SIZE at base+PAGE_SIZE\n");
/*
* Exact same mapping again:
@@ -93,7 +95,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:1: mmap() succeeded when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 5*PAGE_SIZE at base\n");
/*
* Second mapping contained within first:
@@ -111,7 +114,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:2: mmap() succeeded when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 2*PAGE_SIZE at base+PAGE_SIZE\n");
/*
* Overlap end of existing mapping:
@@ -128,7 +132,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:3: mmap() succeeded when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 2*PAGE_SIZE at base+(3*PAGE_SIZE)\n");
/*
* Overlap start of existing mapping:
@@ -145,7 +150,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:4: mmap() succeeded when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() 2*PAGE_SIZE bytes at base\n");
/*
* Adjacent to start of existing mapping:
@@ -162,7 +168,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:5: mmap() failed when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() PAGE_SIZE at base\n");
/*
* Adjacent to end of existing mapping:
@@ -179,7 +186,8 @@ int main(void)
dump_maps();
ksft_exit_fail_msg("Error:6: mmap() failed when it shouldn't have\n");
}
- ksft_test_result_pass("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_print_msg("mmap() @ 0x%lx-0x%lx p=%p result=%m\n", addr, addr + size, p);
+ ksft_test_result_pass("mmap() PAGE_SIZE at base+(4*PAGE_SIZE)\n");
addr = base_addr;
size = 5 * page_size;
diff --git a/tools/testing/selftests/net/.gitignore b/tools/testing/selftests/net/.gitignore
index 49a56eb5d036..666ab7d9390b 100644
--- a/tools/testing/selftests/net/.gitignore
+++ b/tools/testing/selftests/net/.gitignore
@@ -43,7 +43,6 @@ tap
tcp_fastopen_backup_key
tcp_inq
tcp_mmap
-test_unix_oob
timestamping
tls
toeplitz
diff --git a/tools/testing/selftests/net/Makefile b/tools/testing/selftests/net/Makefile
index bd01e4a0be2c..bc3925200637 100644
--- a/tools/testing/selftests/net/Makefile
+++ b/tools/testing/selftests/net/Makefile
@@ -43,6 +43,8 @@ TEST_PROGS += srv6_hl2encap_red_l2vpn_test.sh
TEST_PROGS += srv6_end_next_csid_l3vpn_test.sh
TEST_PROGS += srv6_end_x_next_csid_l3vpn_test.sh
TEST_PROGS += srv6_end_flavors_test.sh
+TEST_PROGS += srv6_end_dx4_netfilter_test.sh
+TEST_PROGS += srv6_end_dx6_netfilter_test.sh
TEST_PROGS += vrf_strict_mode_test.sh
TEST_PROGS += arp_ndisc_evict_nocarrier.sh
TEST_PROGS += ndisc_unsolicited_na_test.sh
@@ -53,6 +55,7 @@ TEST_PROGS += bind_bhash.sh
TEST_PROGS += ip_local_port_range.sh
TEST_PROGS += rps_default_mask.sh
TEST_PROGS += big_tcp.sh
+TEST_PROGS += netns-sysctl.sh
TEST_PROGS_EXTENDED := toeplitz_client.sh toeplitz.sh
TEST_GEN_FILES = socket nettest
TEST_GEN_FILES += psock_fanout psock_tpacket msg_zerocopy reuseport_addr_any
diff --git a/tools/testing/selftests/net/af_unix/Makefile b/tools/testing/selftests/net/af_unix/Makefile
index 3b83c797650d..50584479540b 100644
--- a/tools/testing/selftests/net/af_unix/Makefile
+++ b/tools/testing/selftests/net/af_unix/Makefile
@@ -1,4 +1,4 @@
CFLAGS += $(KHDR_INCLUDES)
-TEST_GEN_PROGS := diag_uid test_unix_oob unix_connect scm_pidfd scm_rights
+TEST_GEN_PROGS := diag_uid msg_oob scm_pidfd scm_rights unix_connect
include ../../lib.mk
diff --git a/tools/testing/selftests/net/af_unix/config b/tools/testing/selftests/net/af_unix/config
new file mode 100644
index 000000000000..37368567768c
--- /dev/null
+++ b/tools/testing/selftests/net/af_unix/config
@@ -0,0 +1,3 @@
+CONFIG_UNIX=y
+CONFIG_AF_UNIX_OOB=y
+CONFIG_UNIX_DIAG=m
diff --git a/tools/testing/selftests/net/af_unix/msg_oob.c b/tools/testing/selftests/net/af_unix/msg_oob.c
new file mode 100644
index 000000000000..16d0c172eaeb
--- /dev/null
+++ b/tools/testing/selftests/net/af_unix/msg_oob.c
@@ -0,0 +1,734 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright Amazon.com Inc. or its affiliates. */
+
+#include <fcntl.h>
+#include <string.h>
+#include <unistd.h>
+
+#include <netinet/in.h>
+#include <sys/epoll.h>
+#include <sys/ioctl.h>
+#include <sys/signalfd.h>
+#include <sys/socket.h>
+
+#include "../../kselftest_harness.h"
+
+#define BUF_SZ 32
+
+FIXTURE(msg_oob)
+{
+ int fd[4]; /* 0: AF_UNIX sender
+ * 1: AF_UNIX receiver
+ * 2: TCP sender
+ * 3: TCP receiver
+ */
+ int signal_fd;
+ int epoll_fd[2]; /* 0: AF_UNIX receiver
+ * 1: TCP receiver
+ */
+ bool tcp_compliant;
+};
+
+FIXTURE_VARIANT(msg_oob)
+{
+ bool peek;
+};
+
+FIXTURE_VARIANT_ADD(msg_oob, no_peek)
+{
+ .peek = false,
+};
+
+FIXTURE_VARIANT_ADD(msg_oob, peek)
+{
+ .peek = true
+};
+
+static void create_unix_socketpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self)
+{
+ int ret;
+
+ ret = socketpair(AF_UNIX, SOCK_STREAM | SOCK_NONBLOCK, 0, self->fd);
+ ASSERT_EQ(ret, 0);
+}
+
+static void create_tcp_socketpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self)
+{
+ struct sockaddr_in addr;
+ socklen_t addrlen;
+ int listen_fd;
+ int ret;
+
+ listen_fd = socket(AF_INET, SOCK_STREAM, 0);
+ ASSERT_GE(listen_fd, 0);
+
+ ret = listen(listen_fd, -1);
+ ASSERT_EQ(ret, 0);
+
+ addrlen = sizeof(addr);
+ ret = getsockname(listen_fd, (struct sockaddr *)&addr, &addrlen);
+ ASSERT_EQ(ret, 0);
+
+ self->fd[2] = socket(AF_INET, SOCK_STREAM, 0);
+ ASSERT_GE(self->fd[2], 0);
+
+ ret = connect(self->fd[2], (struct sockaddr *)&addr, addrlen);
+ ASSERT_EQ(ret, 0);
+
+ self->fd[3] = accept(listen_fd, (struct sockaddr *)&addr, &addrlen);
+ ASSERT_GE(self->fd[3], 0);
+
+ ret = fcntl(self->fd[3], F_SETFL, O_NONBLOCK);
+ ASSERT_EQ(ret, 0);
+}
+
+static void setup_sigurg(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self)
+{
+ struct signalfd_siginfo siginfo;
+ int pid = getpid();
+ sigset_t mask;
+ int i, ret;
+
+ for (i = 0; i < 2; i++) {
+ ret = ioctl(self->fd[i * 2 + 1], FIOSETOWN, &pid);
+ ASSERT_EQ(ret, 0);
+ }
+
+ ret = sigemptyset(&mask);
+ ASSERT_EQ(ret, 0);
+
+ ret = sigaddset(&mask, SIGURG);
+ ASSERT_EQ(ret, 0);
+
+ ret = sigprocmask(SIG_BLOCK, &mask, NULL);
+ ASSERT_EQ(ret, 0);
+
+ self->signal_fd = signalfd(-1, &mask, SFD_NONBLOCK);
+ ASSERT_GE(self->signal_fd, 0);
+
+ ret = read(self->signal_fd, &siginfo, sizeof(siginfo));
+ ASSERT_EQ(ret, -1);
+}
+
+static void setup_epollpri(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self)
+{
+ struct epoll_event event = {
+ .events = EPOLLPRI,
+ };
+ int i;
+
+ for (i = 0; i < 2; i++) {
+ int ret;
+
+ self->epoll_fd[i] = epoll_create1(0);
+ ASSERT_GE(self->epoll_fd[i], 0);
+
+ ret = epoll_ctl(self->epoll_fd[i], EPOLL_CTL_ADD, self->fd[i * 2 + 1], &event);
+ ASSERT_EQ(ret, 0);
+ }
+}
+
+static void close_sockets(FIXTURE_DATA(msg_oob) *self)
+{
+ int i;
+
+ for (i = 0; i < 4; i++)
+ close(self->fd[i]);
+}
+
+FIXTURE_SETUP(msg_oob)
+{
+ create_unix_socketpair(_metadata, self);
+ create_tcp_socketpair(_metadata, self);
+
+ setup_sigurg(_metadata, self);
+ setup_epollpri(_metadata, self);
+
+ self->tcp_compliant = true;
+}
+
+FIXTURE_TEARDOWN(msg_oob)
+{
+ close_sockets(self);
+}
+
+static void __epollpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self,
+ bool oob_remaining)
+{
+ struct epoll_event event[2] = {};
+ int i, ret[2];
+
+ for (i = 0; i < 2; i++)
+ ret[i] = epoll_wait(self->epoll_fd[i], &event[i], 1, 0);
+
+ ASSERT_EQ(ret[0], oob_remaining);
+
+ if (self->tcp_compliant)
+ ASSERT_EQ(ret[0], ret[1]);
+
+ if (oob_remaining) {
+ ASSERT_EQ(event[0].events, EPOLLPRI);
+
+ if (self->tcp_compliant)
+ ASSERT_EQ(event[0].events, event[1].events);
+ }
+}
+
+static void __sendpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self,
+ const void *buf, size_t len, int flags)
+{
+ int i, ret[2];
+
+ for (i = 0; i < 2; i++) {
+ struct signalfd_siginfo siginfo = {};
+ int bytes;
+
+ ret[i] = send(self->fd[i * 2], buf, len, flags);
+
+ bytes = read(self->signal_fd, &siginfo, sizeof(siginfo));
+
+ if (flags & MSG_OOB) {
+ ASSERT_EQ(bytes, sizeof(siginfo));
+ ASSERT_EQ(siginfo.ssi_signo, SIGURG);
+
+ bytes = read(self->signal_fd, &siginfo, sizeof(siginfo));
+ }
+
+ ASSERT_EQ(bytes, -1);
+ }
+
+ ASSERT_EQ(ret[0], len);
+ ASSERT_EQ(ret[0], ret[1]);
+}
+
+static void __recvpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self,
+ const void *expected_buf, int expected_len,
+ int buf_len, int flags)
+{
+ int i, ret[2], recv_errno[2], expected_errno = 0;
+ char recv_buf[2][BUF_SZ] = {};
+ bool printed = false;
+
+ ASSERT_GE(BUF_SZ, buf_len);
+
+ errno = 0;
+
+ for (i = 0; i < 2; i++) {
+ ret[i] = recv(self->fd[i * 2 + 1], recv_buf[i], buf_len, flags);
+ recv_errno[i] = errno;
+ }
+
+ if (expected_len < 0) {
+ expected_errno = -expected_len;
+ expected_len = -1;
+ }
+
+ if (ret[0] != expected_len || recv_errno[0] != expected_errno) {
+ TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]);
+ TH_LOG("Expected:%s", expected_errno ? strerror(expected_errno) : expected_buf);
+
+ ASSERT_EQ(ret[0], expected_len);
+ ASSERT_EQ(recv_errno[0], expected_errno);
+ }
+
+ if (ret[0] != ret[1] || recv_errno[0] != recv_errno[1]) {
+ TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]);
+ TH_LOG("TCP :%s", ret[1] < 0 ? strerror(recv_errno[1]) : recv_buf[1]);
+
+ printed = true;
+
+ if (self->tcp_compliant) {
+ ASSERT_EQ(ret[0], ret[1]);
+ ASSERT_EQ(recv_errno[0], recv_errno[1]);
+ }
+ }
+
+ if (expected_len >= 0) {
+ int cmp;
+
+ cmp = strncmp(expected_buf, recv_buf[0], expected_len);
+ if (cmp) {
+ TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]);
+ TH_LOG("Expected:%s", expected_errno ? strerror(expected_errno) : expected_buf);
+
+ ASSERT_EQ(cmp, 0);
+ }
+
+ cmp = strncmp(recv_buf[0], recv_buf[1], expected_len);
+ if (cmp) {
+ if (!printed) {
+ TH_LOG("AF_UNIX :%s", ret[0] < 0 ? strerror(recv_errno[0]) : recv_buf[0]);
+ TH_LOG("TCP :%s", ret[1] < 0 ? strerror(recv_errno[1]) : recv_buf[1]);
+ }
+
+ if (self->tcp_compliant)
+ ASSERT_EQ(cmp, 0);
+ }
+ }
+}
+
+static void __setinlinepair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self)
+{
+ int i, oob_inline = 1;
+
+ for (i = 0; i < 2; i++) {
+ int ret;
+
+ ret = setsockopt(self->fd[i * 2 + 1], SOL_SOCKET, SO_OOBINLINE,
+ &oob_inline, sizeof(oob_inline));
+ ASSERT_EQ(ret, 0);
+ }
+}
+
+static void __siocatmarkpair(struct __test_metadata *_metadata,
+ FIXTURE_DATA(msg_oob) *self,
+ bool oob_head)
+{
+ int answ[2] = {};
+ int i;
+
+ for (i = 0; i < 2; i++) {
+ int ret;
+
+ ret = ioctl(self->fd[i * 2 + 1], SIOCATMARK, &answ[i]);
+ ASSERT_EQ(ret, 0);
+ }
+
+ ASSERT_EQ(answ[0], oob_head);
+
+ if (self->tcp_compliant)
+ ASSERT_EQ(answ[0], answ[1]);
+}
+
+#define sendpair(buf, len, flags) \
+ __sendpair(_metadata, self, buf, len, flags)
+
+#define recvpair(expected_buf, expected_len, buf_len, flags) \
+ do { \
+ if (variant->peek) \
+ __recvpair(_metadata, self, \
+ expected_buf, expected_len, \
+ buf_len, (flags) | MSG_PEEK); \
+ __recvpair(_metadata, self, \
+ expected_buf, expected_len, buf_len, flags); \
+ } while (0)
+
+#define epollpair(oob_remaining) \
+ __epollpair(_metadata, self, oob_remaining)
+
+#define siocatmarkpair(oob_head) \
+ __siocatmarkpair(_metadata, self, oob_head)
+
+#define setinlinepair() \
+ __setinlinepair(_metadata, self)
+
+#define tcp_incompliant \
+ for (self->tcp_compliant = false; \
+ self->tcp_compliant == false; \
+ self->tcp_compliant = true)
+
+TEST_F(msg_oob, non_oob)
+{
+ sendpair("x", 1, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ recvpair("", -EINVAL, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, oob)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("x", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(true);
+}
+
+TEST_F(msg_oob, oob_drop)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("", -EAGAIN, 1, 0); /* Drop OOB. */
+ epollpair(false);
+ siocatmarkpair(false);
+
+ recvpair("", -EINVAL, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, oob_ahead)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 4, 0);
+ epollpair(false);
+ siocatmarkpair(true);
+}
+
+TEST_F(msg_oob, oob_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 5, 0); /* Break at OOB even with enough buffer. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(true);
+
+ recvpair("", -EAGAIN, 1, 0);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, oob_ahead_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("world", 5, 0);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 9, 0); /* Break at OOB even after it's recv()ed. */
+ epollpair(false);
+ siocatmarkpair(true);
+
+ recvpair("world", 5, 5, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, oob_break_drop)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("world", 5, 0);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 10, 0); /* Break at OOB even with enough buffer. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("world", 5, 10, 0); /* Drop OOB and recv() the next skb. */
+ epollpair(false);
+ siocatmarkpair(false);
+
+ recvpair("", -EINVAL, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, ex_oob_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("wor", 3, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("ld", 2, 0);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hellowo", 7, 10, 0); /* Break at OOB but not at ex-OOB. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("r", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(true);
+
+ recvpair("ld", 2, 2, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, ex_oob_drop)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */
+ epollpair(true);
+
+ tcp_incompliant {
+ siocatmarkpair(false);
+
+ recvpair("x", 1, 1, 0); /* TCP drops "y" by passing through it. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("y", 1, 1, MSG_OOB); /* TCP returns -EINVAL. */
+ epollpair(false);
+ siocatmarkpair(true);
+ }
+}
+
+TEST_F(msg_oob, ex_oob_drop_2)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */
+ epollpair(true);
+
+ tcp_incompliant {
+ siocatmarkpair(false);
+ }
+
+ recvpair("y", 1, 1, MSG_OOB);
+ epollpair(false);
+
+ tcp_incompliant {
+ siocatmarkpair(false);
+
+ recvpair("x", 1, 1, 0); /* TCP returns -EAGAIN. */
+ epollpair(false);
+ siocatmarkpair(true);
+ }
+}
+
+TEST_F(msg_oob, ex_oob_ahead_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("wor", 3, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("r", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ sendpair("ld", 2, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ tcp_incompliant {
+ recvpair("hellowol", 8, 10, 0); /* TCP recv()s "helloworl", why "r" ?? */
+ }
+
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("d", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(true);
+}
+
+TEST_F(msg_oob, ex_oob_siocatmark)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ sendpair("world", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 4, 0); /* Intentionally stop at ex-OOB. */
+ epollpair(true);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_oob)
+{
+ setinlinepair();
+
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("", -EINVAL, 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("x", 1, 1, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_oob_break)
+{
+ setinlinepair();
+
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("", -EINVAL, 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 5, 0); /* Break at OOB but not at ex-OOB. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("o", 1, 1, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_oob_ahead_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("world", 5, 0);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ setinlinepair();
+
+ recvpair("hell", 4, 9, 0); /* Break at OOB even with enough buffer. */
+ epollpair(false);
+ siocatmarkpair(true);
+
+ tcp_incompliant {
+ recvpair("world", 5, 6, 0); /* TCP recv()s "oworld", ... "o" ??? */
+ }
+
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_ex_oob_break)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("wor", 3, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ sendpair("ld", 2, 0);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ setinlinepair();
+
+ recvpair("hellowo", 7, 10, 0); /* Break at OOB but not at ex-OOB. */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("rld", 3, 3, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_ex_oob_no_drop)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ setinlinepair();
+
+ sendpair("y", 1, MSG_OOB); /* TCP does NOT drops "x" at this moment. */
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("x", 1, 1, 0);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("y", 1, 1, 0);
+ epollpair(false);
+ siocatmarkpair(false);
+}
+
+TEST_F(msg_oob, inline_ex_oob_drop)
+{
+ sendpair("x", 1, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(true);
+
+ sendpair("y", 1, MSG_OOB); /* TCP drops "x" at this moment. */
+ epollpair(true);
+
+ setinlinepair();
+
+ tcp_incompliant {
+ siocatmarkpair(false);
+
+ recvpair("x", 1, 1, 0); /* TCP recv()s "y". */
+ epollpair(true);
+ siocatmarkpair(true);
+
+ recvpair("y", 1, 1, 0); /* TCP returns -EAGAIN. */
+ epollpair(false);
+ siocatmarkpair(false);
+ }
+}
+
+TEST_F(msg_oob, inline_ex_oob_siocatmark)
+{
+ sendpair("hello", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("o", 1, 1, MSG_OOB);
+ epollpair(false);
+ siocatmarkpair(false);
+
+ setinlinepair();
+
+ sendpair("world", 5, MSG_OOB);
+ epollpair(true);
+ siocatmarkpair(false);
+
+ recvpair("hell", 4, 4, 0); /* Intentionally stop at ex-OOB. */
+ epollpair(true);
+ siocatmarkpair(false);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/net/af_unix/scm_rights.c b/tools/testing/selftests/net/af_unix/scm_rights.c
index 2bfed46e0b19..d66336256580 100644
--- a/tools/testing/selftests/net/af_unix/scm_rights.c
+++ b/tools/testing/selftests/net/af_unix/scm_rights.c
@@ -14,12 +14,12 @@
FIXTURE(scm_rights)
{
- int fd[16];
+ int fd[32];
};
FIXTURE_VARIANT(scm_rights)
{
- char name[16];
+ char name[32];
int type;
int flags;
bool test_listener;
@@ -172,6 +172,8 @@ static void __create_sockets(struct __test_metadata *_metadata,
const FIXTURE_VARIANT(scm_rights) *variant,
int n)
{
+ ASSERT_LE(n * 2, sizeof(self->fd) / sizeof(self->fd[0]));
+
if (variant->test_listener)
create_listeners(_metadata, self, n);
else
@@ -283,4 +285,23 @@ TEST_F(scm_rights, cross_edge)
close_sockets(8);
}
+TEST_F(scm_rights, backtrack_from_scc)
+{
+ create_sockets(10);
+
+ send_fd(0, 1);
+ send_fd(0, 4);
+ send_fd(1, 2);
+ send_fd(2, 3);
+ send_fd(3, 1);
+
+ send_fd(5, 6);
+ send_fd(5, 9);
+ send_fd(6, 7);
+ send_fd(7, 8);
+ send_fd(8, 6);
+
+ close_sockets(10);
+}
+
TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/net/af_unix/test_unix_oob.c b/tools/testing/selftests/net/af_unix/test_unix_oob.c
deleted file mode 100644
index a7c51889acd5..000000000000
--- a/tools/testing/selftests/net/af_unix/test_unix_oob.c
+++ /dev/null
@@ -1,436 +0,0 @@
-// SPDX-License-Identifier: GPL-2.0-or-later
-#include <stdio.h>
-#include <stdlib.h>
-#include <sys/socket.h>
-#include <arpa/inet.h>
-#include <unistd.h>
-#include <string.h>
-#include <fcntl.h>
-#include <sys/ioctl.h>
-#include <errno.h>
-#include <netinet/tcp.h>
-#include <sys/un.h>
-#include <sys/signal.h>
-#include <sys/poll.h>
-
-static int pipefd[2];
-static int signal_recvd;
-static pid_t producer_id;
-static char sock_name[32];
-
-static void sig_hand(int sn, siginfo_t *si, void *p)
-{
- signal_recvd = sn;
-}
-
-static int set_sig_handler(int signal)
-{
- struct sigaction sa;
-
- sa.sa_sigaction = sig_hand;
- sigemptyset(&sa.sa_mask);
- sa.sa_flags = SA_SIGINFO | SA_RESTART;
-
- return sigaction(signal, &sa, NULL);
-}
-
-static void set_filemode(int fd, int set)
-{
- int flags = fcntl(fd, F_GETFL, 0);
-
- if (set)
- flags &= ~O_NONBLOCK;
- else
- flags |= O_NONBLOCK;
- fcntl(fd, F_SETFL, flags);
-}
-
-static void signal_producer(int fd)
-{
- char cmd;
-
- cmd = 'S';
- write(fd, &cmd, sizeof(cmd));
-}
-
-static void wait_for_signal(int fd)
-{
- char buf[5];
-
- read(fd, buf, 5);
-}
-
-static void die(int status)
-{
- fflush(NULL);
- unlink(sock_name);
- kill(producer_id, SIGTERM);
- exit(status);
-}
-
-int is_sioctatmark(int fd)
-{
- int ans = -1;
-
- if (ioctl(fd, SIOCATMARK, &ans, sizeof(ans)) < 0) {
-#ifdef DEBUG
- perror("SIOCATMARK Failed");
-#endif
- }
- return ans;
-}
-
-void read_oob(int fd, char *c)
-{
-
- *c = ' ';
- if (recv(fd, c, sizeof(*c), MSG_OOB) < 0) {
-#ifdef DEBUG
- perror("Reading MSG_OOB Failed");
-#endif
- }
-}
-
-int read_data(int pfd, char *buf, int size)
-{
- int len = 0;
-
- memset(buf, size, '0');
- len = read(pfd, buf, size);
-#ifdef DEBUG
- if (len < 0)
- perror("read failed");
-#endif
- return len;
-}
-
-static void wait_for_data(int pfd, int event)
-{
- struct pollfd pfds[1];
-
- pfds[0].fd = pfd;
- pfds[0].events = event;
- poll(pfds, 1, -1);
-}
-
-void producer(struct sockaddr_un *consumer_addr)
-{
- int cfd;
- char buf[64];
- int i;
-
- memset(buf, 'x', sizeof(buf));
- cfd = socket(AF_UNIX, SOCK_STREAM, 0);
-
- wait_for_signal(pipefd[0]);
- if (connect(cfd, (struct sockaddr *)consumer_addr,
- sizeof(*consumer_addr)) != 0) {
- perror("Connect failed");
- kill(0, SIGTERM);
- exit(1);
- }
-
- for (i = 0; i < 2; i++) {
- /* Test 1: Test for SIGURG and OOB */
- wait_for_signal(pipefd[0]);
- memset(buf, 'x', sizeof(buf));
- buf[63] = '@';
- send(cfd, buf, sizeof(buf), MSG_OOB);
-
- wait_for_signal(pipefd[0]);
-
- /* Test 2: Test for OOB being overwitten */
- memset(buf, 'x', sizeof(buf));
- buf[63] = '%';
- send(cfd, buf, sizeof(buf), MSG_OOB);
-
- memset(buf, 'x', sizeof(buf));
- buf[63] = '#';
- send(cfd, buf, sizeof(buf), MSG_OOB);
-
- wait_for_signal(pipefd[0]);
-
- /* Test 3: Test for SIOCATMARK */
- memset(buf, 'x', sizeof(buf));
- buf[63] = '@';
- send(cfd, buf, sizeof(buf), MSG_OOB);
-
- memset(buf, 'x', sizeof(buf));
- buf[63] = '%';
- send(cfd, buf, sizeof(buf), MSG_OOB);
-
- memset(buf, 'x', sizeof(buf));
- send(cfd, buf, sizeof(buf), 0);
-
- wait_for_signal(pipefd[0]);
-
- /* Test 4: Test for 1byte OOB msg */
- memset(buf, 'x', sizeof(buf));
- buf[0] = '@';
- send(cfd, buf, 1, MSG_OOB);
- }
-}
-
-int
-main(int argc, char **argv)
-{
- int lfd, pfd;
- struct sockaddr_un consumer_addr, paddr;
- socklen_t len = sizeof(consumer_addr);
- char buf[1024];
- int on = 0;
- char oob;
- int atmark;
-
- lfd = socket(AF_UNIX, SOCK_STREAM, 0);
- memset(&consumer_addr, 0, sizeof(consumer_addr));
- consumer_addr.sun_family = AF_UNIX;
- sprintf(sock_name, "unix_oob_%d", getpid());
- unlink(sock_name);
- strcpy(consumer_addr.sun_path, sock_name);
-
- if ((bind(lfd, (struct sockaddr *)&consumer_addr,
- sizeof(consumer_addr))) != 0) {
- perror("socket bind failed");
- exit(1);
- }
-
- pipe(pipefd);
-
- listen(lfd, 1);
-
- producer_id = fork();
- if (producer_id == 0) {
- producer(&consumer_addr);
- exit(0);
- }
-
- set_sig_handler(SIGURG);
- signal_producer(pipefd[1]);
-
- pfd = accept(lfd, (struct sockaddr *) &paddr, &len);
- fcntl(pfd, F_SETOWN, getpid());
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 1:
- * veriyf that SIGURG is
- * delivered, 63 bytes are
- * read, oob is '@', and POLLPRI works.
- */
- wait_for_data(pfd, POLLPRI);
- read_oob(pfd, &oob);
- len = read_data(pfd, buf, 1024);
- if (!signal_recvd || len != 63 || oob != '@') {
- fprintf(stderr, "Test 1 failed sigurg %d len %d %c\n",
- signal_recvd, len, oob);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 2:
- * Verify that the first OOB is over written by
- * the 2nd one and the first OOB is returned as
- * part of the read, and sigurg is received.
- */
- wait_for_data(pfd, POLLIN | POLLPRI);
- len = 0;
- while (len < 70)
- len = recv(pfd, buf, 1024, MSG_PEEK);
- len = read_data(pfd, buf, 1024);
- read_oob(pfd, &oob);
- if (!signal_recvd || len != 127 || oob != '#') {
- fprintf(stderr, "Test 2 failed, sigurg %d len %d OOB %c\n",
- signal_recvd, len, oob);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 3:
- * verify that 2nd oob over writes
- * the first one and read breaks at
- * oob boundary returning 127 bytes
- * and sigurg is received and atmark
- * is set.
- * oob is '%' and second read returns
- * 64 bytes.
- */
- len = 0;
- wait_for_data(pfd, POLLIN | POLLPRI);
- while (len < 150)
- len = recv(pfd, buf, 1024, MSG_PEEK);
- len = read_data(pfd, buf, 1024);
- atmark = is_sioctatmark(pfd);
- read_oob(pfd, &oob);
-
- if (!signal_recvd || len != 127 || oob != '%' || atmark != 1) {
- fprintf(stderr,
- "Test 3 failed, sigurg %d len %d OOB %c atmark %d\n",
- signal_recvd, len, oob, atmark);
- die(1);
- }
-
- signal_recvd = 0;
-
- len = read_data(pfd, buf, 1024);
- if (len != 64) {
- fprintf(stderr, "Test 3.1 failed, sigurg %d len %d OOB %c\n",
- signal_recvd, len, oob);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 4:
- * verify that a single byte
- * oob message is delivered.
- * set non blocking mode and
- * check proper error is
- * returned and sigurg is
- * received and correct
- * oob is read.
- */
-
- set_filemode(pfd, 0);
-
- wait_for_data(pfd, POLLIN | POLLPRI);
- len = read_data(pfd, buf, 1024);
- if ((len == -1) && (errno == 11))
- len = 0;
-
- read_oob(pfd, &oob);
-
- if (!signal_recvd || len != 0 || oob != '@') {
- fprintf(stderr, "Test 4 failed, sigurg %d len %d OOB %c\n",
- signal_recvd, len, oob);
- die(1);
- }
-
- set_filemode(pfd, 1);
-
- /* Inline Testing */
-
- on = 1;
- if (setsockopt(pfd, SOL_SOCKET, SO_OOBINLINE, &on, sizeof(on))) {
- perror("SO_OOBINLINE");
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 1 -- Inline:
- * Check that SIGURG is
- * delivered and 63 bytes are
- * read and oob is '@'
- */
-
- wait_for_data(pfd, POLLIN | POLLPRI);
- len = read_data(pfd, buf, 1024);
-
- if (!signal_recvd || len != 63) {
- fprintf(stderr, "Test 1 Inline failed, sigurg %d len %d\n",
- signal_recvd, len);
- die(1);
- }
-
- len = read_data(pfd, buf, 1024);
-
- if (len != 1) {
- fprintf(stderr,
- "Test 1.1 Inline failed, sigurg %d len %d oob %c\n",
- signal_recvd, len, oob);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 2 -- Inline:
- * Verify that the first OOB is over written by
- * the 2nd one and read breaks correctly on
- * 2nd OOB boundary with the first OOB returned as
- * part of the read, and sigurg is delivered and
- * siocatmark returns true.
- * next read returns one byte, the oob byte
- * and siocatmark returns false.
- */
- len = 0;
- wait_for_data(pfd, POLLIN | POLLPRI);
- while (len < 70)
- len = recv(pfd, buf, 1024, MSG_PEEK);
- len = read_data(pfd, buf, 1024);
- atmark = is_sioctatmark(pfd);
- if (len != 127 || atmark != 1 || !signal_recvd) {
- fprintf(stderr, "Test 2 Inline failed, len %d atmark %d\n",
- len, atmark);
- die(1);
- }
-
- len = read_data(pfd, buf, 1024);
- atmark = is_sioctatmark(pfd);
- if (len != 1 || buf[0] != '#' || atmark == 1) {
- fprintf(stderr, "Test 2.1 Inline failed, len %d data %c atmark %d\n",
- len, buf[0], atmark);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 3 -- Inline:
- * verify that 2nd oob over writes
- * the first one and read breaks at
- * oob boundary returning 127 bytes
- * and sigurg is received and siocatmark
- * is true after the read.
- * subsequent read returns 65 bytes
- * because of oob which should be '%'.
- */
- len = 0;
- wait_for_data(pfd, POLLIN | POLLPRI);
- while (len < 126)
- len = recv(pfd, buf, 1024, MSG_PEEK);
- len = read_data(pfd, buf, 1024);
- atmark = is_sioctatmark(pfd);
- if (!signal_recvd || len != 127 || !atmark) {
- fprintf(stderr,
- "Test 3 Inline failed, sigurg %d len %d data %c\n",
- signal_recvd, len, buf[0]);
- die(1);
- }
-
- len = read_data(pfd, buf, 1024);
- atmark = is_sioctatmark(pfd);
- if (len != 65 || buf[0] != '%' || atmark != 0) {
- fprintf(stderr,
- "Test 3.1 Inline failed, len %d oob %c atmark %d\n",
- len, buf[0], atmark);
- die(1);
- }
-
- signal_recvd = 0;
- signal_producer(pipefd[1]);
-
- /* Test 4 -- Inline:
- * verify that a single
- * byte oob message is delivered
- * and read returns one byte, the oob
- * byte and sigurg is received
- */
- wait_for_data(pfd, POLLIN | POLLPRI);
- len = read_data(pfd, buf, 1024);
- if (!signal_recvd || len != 1 || buf[0] != '@') {
- fprintf(stderr,
- "Test 4 Inline failed, signal %d len %d data %c\n",
- signal_recvd, len, buf[0]);
- die(1);
- }
- die(0);
-}
diff --git a/tools/testing/selftests/net/amt.sh b/tools/testing/selftests/net/amt.sh
index 7e7ed6c558da..d458b45c775b 100755
--- a/tools/testing/selftests/net/amt.sh
+++ b/tools/testing/selftests/net/amt.sh
@@ -1,4 +1,4 @@
-#!/bin/sh
+#!/bin/bash
# SPDX-License-Identifier: GPL-2.0
# Author: Taehee Yoo <ap420073@gmail.com>
diff --git a/tools/testing/selftests/net/config b/tools/testing/selftests/net/config
index 04de7a6ba6f3..5b9baf708950 100644
--- a/tools/testing/selftests/net/config
+++ b/tools/testing/selftests/net/config
@@ -26,7 +26,6 @@ CONFIG_INET_ESP=y
CONFIG_INET_ESP_OFFLOAD=y
CONFIG_NET_FOU=y
CONFIG_NET_FOU_IP_TUNNELS=y
-CONFIG_IP_GRE=m
CONFIG_NETFILTER=y
CONFIG_NETFILTER_ADVANCED=y
CONFIG_NF_CONNTRACK=m
@@ -75,7 +74,12 @@ CONFIG_NET_SCH_ETF=m
CONFIG_NET_SCH_NETEM=y
CONFIG_NET_SCH_PRIO=m
CONFIG_NFT_COMPAT=m
+CONFIG_NF_CONNTRACK_OVS=y
CONFIG_NF_FLOW_TABLE=m
+CONFIG_OPENVSWITCH=m
+CONFIG_OPENVSWITCH_GENEVE=m
+CONFIG_OPENVSWITCH_GRE=m
+CONFIG_OPENVSWITCH_VXLAN=m
CONFIG_PSAMPLE=m
CONFIG_TCP_MD5SIG=y
CONFIG_TEST_BLACKHOLE_DEV=m
@@ -101,3 +105,5 @@ CONFIG_NETFILTER_XT_MATCH_POLICY=m
CONFIG_CRYPTO_ARIA=y
CONFIG_XFRM_INTERFACE=m
CONFIG_XFRM_USER=m
+CONFIG_IP_NF_MATCH_RPFILTER=m
+CONFIG_IP6_NF_MATCH_RPFILTER=m
diff --git a/tools/testing/selftests/net/forwarding/Makefile b/tools/testing/selftests/net/forwarding/Makefile
index fa7b59ff4029..224346426ef2 100644
--- a/tools/testing/selftests/net/forwarding/Makefile
+++ b/tools/testing/selftests/net/forwarding/Makefile
@@ -39,6 +39,7 @@ TEST_PROGS = bridge_fdb_learning_limit.sh \
ipip_hier_gre.sh \
lib_sh_test.sh \
local_termination.sh \
+ min_max_mtu.sh \
mirror_gre_bound.sh \
mirror_gre_bridge_1d.sh \
mirror_gre_bridge_1d_vlan.sh \
@@ -70,6 +71,7 @@ TEST_PROGS = bridge_fdb_learning_limit.sh \
router_broadcast.sh \
router_mpath_nh_res.sh \
router_mpath_nh.sh \
+ router_mpath_seed.sh \
router_multicast.sh \
router_multipath.sh \
router_nh.sh \
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index f1de525cfa55..62a05bca1e82 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
still_pending=$(devlink resource show "$DEVLINK_DEV" | \
grep -c "size_new")
check_err $still_pending "Failed reload - There are still unset sizes"
+
+ udevadm settle
}
declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/net/forwarding/lib.sh b/tools/testing/selftests/net/forwarding/lib.sh
index eabbdf00d8ca..ff96bb7535ff 100644
--- a/tools/testing/selftests/net/forwarding/lib.sh
+++ b/tools/testing/selftests/net/forwarding/lib.sh
@@ -1134,12 +1134,19 @@ bridge_ageing_time_get()
}
declare -A SYSCTL_ORIG
+sysctl_save()
+{
+ local key=$1; shift
+
+ SYSCTL_ORIG[$key]=$(sysctl -n $key)
+}
+
sysctl_set()
{
local key=$1; shift
local value=$1; shift
- SYSCTL_ORIG[$key]=$(sysctl -n $key)
+ sysctl_save "$key"
sysctl -qw $key="$value"
}
@@ -1218,22 +1225,6 @@ trap_uninstall()
tc filter del dev $dev $direction pref 1 flower
}
-slow_path_trap_install()
-{
- # For slow-path testing, we need to install a trap to get to
- # slow path the packets that would otherwise be switched in HW.
- if [ "${tcflags/skip_hw}" != "$tcflags" ]; then
- trap_install "$@"
- fi
-}
-
-slow_path_trap_uninstall()
-{
- if [ "${tcflags/skip_hw}" != "$tcflags" ]; then
- trap_uninstall "$@"
- fi
-}
-
__icmp_capture_add_del()
{
local add_del=$1; shift
@@ -1250,22 +1241,34 @@ __icmp_capture_add_del()
icmp_capture_install()
{
- __icmp_capture_add_del add 100 "" "$@"
+ local tundev=$1; shift
+ local filter=$1; shift
+
+ __icmp_capture_add_del add 100 "" "$tundev" "$filter"
}
icmp_capture_uninstall()
{
- __icmp_capture_add_del del 100 "" "$@"
+ local tundev=$1; shift
+ local filter=$1; shift
+
+ __icmp_capture_add_del del 100 "" "$tundev" "$filter"
}
icmp6_capture_install()
{
- __icmp_capture_add_del add 100 v6 "$@"
+ local tundev=$1; shift
+ local filter=$1; shift
+
+ __icmp_capture_add_del add 100 v6 "$tundev" "$filter"
}
icmp6_capture_uninstall()
{
- __icmp_capture_add_del del 100 v6 "$@"
+ local tundev=$1; shift
+ local filter=$1; shift
+
+ __icmp_capture_add_del del 100 v6 "$tundev" "$filter"
}
__vlan_capture_add_del()
@@ -1283,12 +1286,18 @@ __vlan_capture_add_del()
vlan_capture_install()
{
- __vlan_capture_add_del add 100 "$@"
+ local dev=$1; shift
+ local filter=$1; shift
+
+ __vlan_capture_add_del add 100 "$dev" "$filter"
}
vlan_capture_uninstall()
{
- __vlan_capture_add_del del 100 "$@"
+ local dev=$1; shift
+ local filter=$1; shift
+
+ __vlan_capture_add_del del 100 "$dev" "$filter"
}
__dscp_capture_add_del()
@@ -1648,34 +1657,61 @@ __start_traffic()
local sip=$1; shift
local dip=$1; shift
local dmac=$1; shift
+ local -a mz_args=("$@")
$MZ $h_in -p $pktsize -A $sip -B $dip -c 0 \
- -a own -b $dmac -t "$proto" -q "$@" &
+ -a own -b $dmac -t "$proto" -q "${mz_args[@]}" &
sleep 1
}
start_traffic_pktsize()
{
local pktsize=$1; shift
+ local h_in=$1; shift
+ local sip=$1; shift
+ local dip=$1; shift
+ local dmac=$1; shift
+ local -a mz_args=("$@")
- __start_traffic $pktsize udp "$@"
+ __start_traffic $pktsize udp "$h_in" "$sip" "$dip" "$dmac" \
+ "${mz_args[@]}"
}
start_tcp_traffic_pktsize()
{
local pktsize=$1; shift
+ local h_in=$1; shift
+ local sip=$1; shift
+ local dip=$1; shift
+ local dmac=$1; shift
+ local -a mz_args=("$@")
- __start_traffic $pktsize tcp "$@"
+ __start_traffic $pktsize tcp "$h_in" "$sip" "$dip" "$dmac" \
+ "${mz_args[@]}"
}
start_traffic()
{
- start_traffic_pktsize 8000 "$@"
+ local h_in=$1; shift
+ local sip=$1; shift
+ local dip=$1; shift
+ local dmac=$1; shift
+ local -a mz_args=("$@")
+
+ start_traffic_pktsize 8000 "$h_in" "$sip" "$dip" "$dmac" \
+ "${mz_args[@]}"
}
start_tcp_traffic()
{
- start_tcp_traffic_pktsize 8000 "$@"
+ local h_in=$1; shift
+ local sip=$1; shift
+ local dip=$1; shift
+ local dmac=$1; shift
+ local -a mz_args=("$@")
+
+ start_tcp_traffic_pktsize 8000 "$h_in" "$sip" "$dip" "$dmac" \
+ "${mz_args[@]}"
}
stop_traffic()
diff --git a/tools/testing/selftests/net/forwarding/min_max_mtu.sh b/tools/testing/selftests/net/forwarding/min_max_mtu.sh
new file mode 100755
index 000000000000..97bb8b221bed
--- /dev/null
+++ b/tools/testing/selftests/net/forwarding/min_max_mtu.sh
@@ -0,0 +1,283 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+# +--------------------+
+# | H1 |
+# | |
+# | $h1.10 + |
+# | 192.0.2.2/24 | |
+# | 2001:db8:1::2/64 | |
+# | | |
+# | $h1 + |
+# | | |
+# +------------------|-+
+# |
+# +------------------|-+
+# | SW | |
+# | $swp1 + |
+# | | |
+# | $swp1.10 + |
+# | 192.0.2.1/24 |
+# | 2001:db8:1::1/64 |
+# | |
+# +--------------------+
+
+ALL_TESTS="
+ ping_ipv4
+ ping_ipv6
+ max_mtu_config_test
+ max_mtu_traffic_test
+ min_mtu_config_test
+ min_mtu_traffic_test
+"
+
+NUM_NETIFS=2
+source lib.sh
+
+h1_create()
+{
+ simple_if_init $h1
+ vlan_create $h1 10 v$h1 192.0.2.2/24 2001:db8:1::2/64
+}
+
+h1_destroy()
+{
+ vlan_destroy $h1 10 192.0.2.2/24 2001:db8:1::2/64
+ simple_if_fini $h1
+}
+
+switch_create()
+{
+ ip li set dev $swp1 up
+ vlan_create $swp1 10 "" 192.0.2.1/24 2001:db8:1::1/64
+}
+
+switch_destroy()
+{
+ ip li set dev $swp1 down
+ vlan_destroy $swp1 10
+}
+
+setup_prepare()
+{
+ h1=${NETIFS[p1]}
+ swp1=${NETIFS[p2]}
+
+ vrf_prepare
+
+ h1_create
+
+ switch_create
+
+ forwarding_enable
+}
+
+cleanup()
+{
+ pre_cleanup
+
+ forwarding_restore
+
+ switch_destroy
+
+ h1_destroy
+
+ vrf_cleanup
+}
+
+ping_ipv4()
+{
+ ping_test $h1.10 192.0.2.1
+}
+
+ping_ipv6()
+{
+ ping6_test $h1.10 2001:db8:1::1
+}
+
+min_max_mtu_get_if()
+{
+ local dev=$1; shift
+ local min_max=$1; shift
+
+ ip -d -j link show $dev | jq ".[].$min_max"
+}
+
+ensure_compatible_min_max_mtu()
+{
+ local min_max=$1; shift
+
+ local mtu=$(min_max_mtu_get_if ${NETIFS[p1]} $min_max)
+ local i
+
+ for ((i = 2; i <= NUM_NETIFS; ++i)); do
+ local current_mtu=$(min_max_mtu_get_if ${NETIFS[p$i]} $min_max)
+
+ if [ $current_mtu -ne $mtu ]; then
+ return 1
+ fi
+ done
+}
+
+mtu_set_if()
+{
+ local dev=$1; shift
+ local mtu=$1; shift
+ local should_fail=${1:-0}; shift
+
+ mtu_set $dev $mtu 2>/dev/null
+ check_err_fail $should_fail $? "Set MTU $mtu for $dev"
+}
+
+mtu_set_all_if()
+{
+ local mtu=$1; shift
+ local i
+
+ for ((i = 1; i <= NUM_NETIFS; ++i)); do
+ mtu_set_if ${NETIFS[p$i]} $mtu
+ mtu_set_if ${NETIFS[p$i]}.10 $mtu
+ done
+}
+
+mtu_restore_all_if()
+{
+ local i
+
+ for ((i = 1; i <= NUM_NETIFS; ++i)); do
+ mtu_restore ${NETIFS[p$i]}.10
+ mtu_restore ${NETIFS[p$i]}
+ done
+}
+
+mtu_test_ping4()
+{
+ local mtu=$1; shift
+ local should_fail=$1; shift
+
+ # Ping adds 8 bytes for ICMP header and 20 bytes for IP header
+ local ping_headers_len=$((20 + 8))
+ local pkt_size=$((mtu - ping_headers_len))
+
+ ping_do $h1.10 192.0.2.1 "-s $pkt_size -M do"
+ check_err_fail $should_fail $? "Ping, packet size: $pkt_size"
+}
+
+mtu_test_ping6()
+{
+ local mtu=$1; shift
+ local should_fail=$1; shift
+
+ # Ping adds 8 bytes for ICMP header and 40 bytes for IPv6 header
+ local ping6_headers_len=$((40 + 8))
+ local pkt_size=$((mtu - ping6_headers_len))
+
+ ping6_do $h1.10 2001:db8:1::1 "-s $pkt_size -M do"
+ check_err_fail $should_fail $? "Ping6, packet size: $pkt_size"
+}
+
+max_mtu_config_test()
+{
+ local i
+
+ RET=0
+
+ for ((i = 1; i <= NUM_NETIFS; ++i)); do
+ local dev=${NETIFS[p$i]}
+ local max_mtu=$(min_max_mtu_get_if $dev "max_mtu")
+ local should_fail
+
+ should_fail=0
+ mtu_set_if $dev $max_mtu $should_fail
+ mtu_restore $dev
+
+ should_fail=1
+ mtu_set_if $dev $((max_mtu + 1)) $should_fail
+ mtu_restore $dev
+ done
+
+ log_test "Test maximum MTU configuration"
+}
+
+max_mtu_traffic_test()
+{
+ local should_fail
+ local max_mtu
+
+ RET=0
+
+ if ! ensure_compatible_min_max_mtu "max_mtu"; then
+ log_test_xfail "Topology has incompatible maximum MTU values"
+ return
+ fi
+
+ max_mtu=$(min_max_mtu_get_if ${NETIFS[p1]} "max_mtu")
+
+ should_fail=0
+ mtu_set_all_if $max_mtu
+ mtu_test_ping4 $max_mtu $should_fail
+ mtu_test_ping6 $max_mtu $should_fail
+ mtu_restore_all_if
+
+ should_fail=1
+ mtu_set_all_if $((max_mtu - 1))
+ mtu_test_ping4 $max_mtu $should_fail
+ mtu_test_ping6 $max_mtu $should_fail
+ mtu_restore_all_if
+
+ log_test "Test traffic, packet size is maximum MTU"
+}
+
+min_mtu_config_test()
+{
+ local i
+
+ RET=0
+
+ for ((i = 1; i <= NUM_NETIFS; ++i)); do
+ local dev=${NETIFS[p$i]}
+ local min_mtu=$(min_max_mtu_get_if $dev "min_mtu")
+ local should_fail
+
+ should_fail=0
+ mtu_set_if $dev $min_mtu $should_fail
+ mtu_restore $dev
+
+ should_fail=1
+ mtu_set_if $dev $((min_mtu - 1)) $should_fail
+ mtu_restore $dev
+ done
+
+ log_test "Test minimum MTU configuration"
+}
+
+min_mtu_traffic_test()
+{
+ local should_fail=0
+ local min_mtu
+
+ RET=0
+
+ if ! ensure_compatible_min_max_mtu "min_mtu"; then
+ log_test_xfail "Topology has incompatible minimum MTU values"
+ return
+ fi
+
+ min_mtu=$(min_max_mtu_get_if ${NETIFS[p1]} "min_mtu")
+ mtu_set_all_if $min_mtu
+ mtu_test_ping4 $min_mtu $should_fail
+ # Do not test minimum MTU with IPv6, as IPv6 requires higher MTU.
+
+ mtu_restore_all_if
+
+ log_test "Test traffic, packet size is minimum MTU"
+}
+
+trap cleanup EXIT
+
+setup_prepare
+setup_wait
+
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre.sh b/tools/testing/selftests/net/forwarding/mirror_gre.sh
index 0266443601bc..921c733ee04f 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre.sh
@@ -74,7 +74,7 @@ test_span_gre_mac()
RET=0
- mirror_install $swp1 $direction $tundev "matchall $tcflags"
+ mirror_install $swp1 $direction $tundev "matchall"
icmp_capture_install h3-${tundev} "src_mac $src_mac dst_mac $dst_mac"
mirror_test v$h1 192.0.2.1 192.0.2.2 h3-${tundev} 100 10
@@ -82,29 +82,29 @@ test_span_gre_mac()
icmp_capture_uninstall h3-${tundev}
mirror_uninstall $swp1 $direction
- log_test "$direction $what: envelope MAC ($tcflags)"
+ log_test "$direction $what: envelope MAC"
}
test_two_spans()
{
RET=0
- mirror_install $swp1 ingress gt4 "matchall $tcflags"
- mirror_install $swp1 egress gt6 "matchall $tcflags"
- quick_test_span_gre_dir gt4 ingress
- quick_test_span_gre_dir gt6 egress
+ mirror_install $swp1 ingress gt4 "matchall"
+ mirror_install $swp1 egress gt6 "matchall"
+ quick_test_span_gre_dir gt4 8 0
+ quick_test_span_gre_dir gt6 0 8
mirror_uninstall $swp1 ingress
- fail_test_span_gre_dir gt4 ingress
- quick_test_span_gre_dir gt6 egress
+ fail_test_span_gre_dir gt4 8 0
+ quick_test_span_gre_dir gt6 0 8
- mirror_install $swp1 ingress gt4 "matchall $tcflags"
+ mirror_install $swp1 ingress gt4 "matchall"
mirror_uninstall $swp1 egress
- quick_test_span_gre_dir gt4 ingress
- fail_test_span_gre_dir gt6 egress
+ quick_test_span_gre_dir gt4 8 0
+ fail_test_span_gre_dir gt6 0 8
mirror_uninstall $swp1 ingress
- log_test "two simultaneously configured mirrors ($tcflags)"
+ log_test "two simultaneously configured mirrors"
}
test_gretap()
@@ -131,30 +131,11 @@ test_ip6gretap_mac()
test_span_gre_mac gt6 egress "mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bound.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bound.sh
index 6c257ec03756..e3cd48e18eeb 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bound.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bound.sh
@@ -196,32 +196,11 @@ test_ip6gretap()
full_test_span_gre_dir gt6 egress 0 8 "mirror to ip6gretap w/ UL"
}
-test_all()
-{
- RET=0
-
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d.sh
index 04fd14b0a9b7..6c7bd33332c2 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d.sh
@@ -108,30 +108,11 @@ test_ip6gretap()
full_test_span_gre_dir gt6 egress 0 8 "mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d_vlan.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d_vlan.sh
index f35313c76fac..909ec956a5e5 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d_vlan.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1d_vlan.sh
@@ -104,30 +104,11 @@ test_ip6gretap_stp()
full_test_span_gre_stp gt6 $swp3.555 "mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q.sh
index 0cf4c47a46f9..40ac9dd3aff1 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q.sh
@@ -104,30 +104,11 @@ test_ip6gretap()
full_test_span_gre_dir gt6 egress 0 8 "mirror to ip6gretap"
}
-tests()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-tests
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- tests
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
index c53148b1dc63..fe4d7c906a70 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
@@ -227,10 +227,10 @@ test_lag_slave()
RET=0
tc filter add dev $swp1 ingress pref 999 \
- proto 802.1q flower vlan_ethtype arp $tcflags \
+ proto 802.1q flower vlan_ethtype arp \
action pass
mirror_install $swp1 ingress gt4 \
- "proto 802.1q flower vlan_id 333 $tcflags"
+ "proto 802.1q flower vlan_id 333"
# Test connectivity through $up_dev when $down_dev is set down.
ip link set dev $down_dev down
@@ -239,7 +239,7 @@ test_lag_slave()
setup_wait_dev $host_dev
$ARPING -I br1 192.0.2.130 -qfc 1
sleep 2
- mirror_test vrf-h1 192.0.2.1 192.0.2.18 $host_dev 1 10
+ mirror_test vrf-h1 192.0.2.1 192.0.2.18 $host_dev 1 ">= 10"
# Test lack of connectivity when both slaves are down.
ip link set dev $up_dev down
@@ -252,7 +252,7 @@ test_lag_slave()
mirror_uninstall $swp1 ingress
tc filter del dev $swp1 ingress pref 999
- log_test "$what ($tcflags)"
+ log_test "$what"
}
test_mirror_gretap_first()
@@ -265,30 +265,11 @@ test_mirror_gretap_second()
test_lag_slave $h4 $swp4 $swp3 "mirror to gretap: LAG second slave"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_changes.sh b/tools/testing/selftests/net/forwarding/mirror_gre_changes.sh
index 5ea9d63915f7..65ae9d960c18 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_changes.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_changes.sh
@@ -73,7 +73,7 @@ test_span_gre_ttl()
RET=0
mirror_install $swp1 ingress $tundev \
- "prot ip flower $tcflags ip_prot icmp"
+ "prot ip flower ip_prot icmp"
tc filter add dev $h3 ingress pref 77 prot $prot \
flower skip_hw ip_ttl 50 action pass
@@ -81,13 +81,13 @@ test_span_gre_ttl()
ip link set dev $tundev type $type ttl 50
sleep 2
- mirror_test v$h1 192.0.2.1 192.0.2.2 $h3 77 10
+ mirror_test v$h1 192.0.2.1 192.0.2.2 $h3 77 ">= 10"
ip link set dev $tundev type $type ttl 100
tc filter del dev $h3 ingress pref 77
mirror_uninstall $swp1 ingress
- log_test "$what: TTL change ($tcflags)"
+ log_test "$what: TTL change"
}
test_span_gre_tun_up()
@@ -98,15 +98,15 @@ test_span_gre_tun_up()
RET=0
ip link set dev $tundev down
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
ip link set dev $tundev up
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: tunnel down/up ($tcflags)"
+ log_test "$what: tunnel down/up"
}
test_span_gre_egress_up()
@@ -118,8 +118,8 @@ test_span_gre_egress_up()
RET=0
ip link set dev $swp3 down
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
# After setting the device up, wait for neighbor to get resolved so that
# we can expect mirroring to work.
@@ -127,10 +127,10 @@ test_span_gre_egress_up()
setup_wait_dev $swp3
ping -c 1 -I $swp3 $remote_ip &>/dev/null
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: egress down/up ($tcflags)"
+ log_test "$what: egress down/up"
}
test_span_gre_remote_ip()
@@ -144,14 +144,14 @@ test_span_gre_remote_ip()
RET=0
ip link set dev $tundev type $type remote $wrong_ip
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ fail_test_span_gre_dir $tundev
ip link set dev $tundev type $type remote $correct_ip
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: remote address change ($tcflags)"
+ log_test "$what: remote address change"
}
test_span_gre_tun_del()
@@ -165,10 +165,10 @@ test_span_gre_tun_del()
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
ip link del dev $tundev
- fail_test_span_gre_dir $tundev ingress
+ fail_test_span_gre_dir $tundev
tunnel_create $tundev $type $local_ip $remote_ip \
ttl 100 tos inherit $flags
@@ -176,11 +176,11 @@ test_span_gre_tun_del()
# Recreating the tunnel doesn't reestablish mirroring, so reinstall it
# and verify it works for the follow-up tests.
mirror_uninstall $swp1 ingress
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: tunnel deleted ($tcflags)"
+ log_test "$what: tunnel deleted"
}
test_span_gre_route_del()
@@ -192,18 +192,18 @@ test_span_gre_route_del()
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
ip route del $route dev $edev
- fail_test_span_gre_dir $tundev ingress
+ fail_test_span_gre_dir $tundev
ip route add $route dev $edev
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: underlay route removal ($tcflags)"
+ log_test "$what: underlay route removal"
}
test_ttl()
@@ -244,30 +244,11 @@ test_route_del()
test_span_gre_route_del gt6 $swp3 2001:db8:2::/64 "mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_flower.sh b/tools/testing/selftests/net/forwarding/mirror_gre_flower.sh
index 09389f3b9369..3a84f3ab5856 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_flower.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_flower.sh
@@ -64,12 +64,19 @@ cleanup()
test_span_gre_dir_acl()
{
- test_span_gre_dir_ips "$@" 192.0.2.3 192.0.2.4
+ local tundev=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
+
+ test_span_gre_dir_ips "$tundev" "$forward_type" \
+ "$backward_type" 192.0.2.3 192.0.2.4
}
fail_test_span_gre_dir_acl()
{
- fail_test_span_gre_dir_ips "$@" 192.0.2.3 192.0.2.4
+ local tundev=$1; shift
+
+ fail_test_span_gre_dir_ips "$tundev" 192.0.2.3 192.0.2.4
}
full_test_span_gre_dir_acl()
@@ -84,16 +91,15 @@ full_test_span_gre_dir_acl()
RET=0
mirror_install $swp1 $direction $tundev \
- "protocol ip flower $tcflags dst_ip $match_dip"
- fail_test_span_gre_dir $tundev $direction
- test_span_gre_dir_acl "$tundev" "$direction" \
- "$forward_type" "$backward_type"
+ "protocol ip flower dst_ip $match_dip"
+ fail_test_span_gre_dir $tundev
+ test_span_gre_dir_acl "$tundev" "$forward_type" "$backward_type"
mirror_uninstall $swp1 $direction
# Test lack of mirroring after ACL mirror is uninstalled.
- fail_test_span_gre_dir_acl "$tundev" "$direction"
+ fail_test_span_gre_dir_acl "$tundev"
- log_test "$direction $what ($tcflags)"
+ log_test "$direction $what"
}
test_gretap()
@@ -108,30 +114,11 @@ test_ip6gretap()
full_test_span_gre_dir_acl gt6 egress 0 8 192.0.2.3 "ACL mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
index 9edf4cb104a8..1261e6f46e34 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
@@ -37,8 +37,14 @@
# | \ / |
# | \____________________________________________/ |
# | | |
-# | + lag2 (team) |
-# | 192.0.2.130/28 |
+# | + lag2 (team) ------> + gt4-dst (gretap) |
+# | 192.0.2.130/28 loc=192.0.2.130 |
+# | rem=192.0.2.129 |
+# | ttl=100 |
+# | tos=inherit |
+# | |
+# | |
+# | |
# | |
# +---------------------------------------------------------------------------+
@@ -50,9 +56,6 @@ ALL_TESTS="
NUM_NETIFS=6
source lib.sh
source mirror_lib.sh
-source mirror_gre_lib.sh
-
-require_command $ARPING
vlan_host_create()
{
@@ -122,16 +125,21 @@ h3_create()
{
vrf_create vrf-h3
ip link set dev vrf-h3 up
- tc qdisc add dev $h3 clsact
- tc qdisc add dev $h4 clsact
h3_create_team
+
+ tunnel_create gt4-dst gretap 192.0.2.130 192.0.2.129 \
+ ttl 100 tos inherit
+ ip link set dev gt4-dst master vrf-h3
+ tc qdisc add dev gt4-dst clsact
}
h3_destroy()
{
+ tc qdisc del dev gt4-dst clsact
+ ip link set dev gt4-dst nomaster
+ tunnel_destroy gt4-dst
+
h3_destroy_team
- tc qdisc del dev $h4 clsact
- tc qdisc del dev $h3 clsact
ip link set dev vrf-h3 down
vrf_destroy vrf-h3
}
@@ -188,18 +196,12 @@ setup_prepare()
h2_create
h3_create
switch_create
-
- trap_install $h3 ingress
- trap_install $h4 ingress
}
cleanup()
{
pre_cleanup
- trap_uninstall $h4 ingress
- trap_uninstall $h3 ingress
-
switch_destroy
h3_destroy
h2_destroy
@@ -218,7 +220,8 @@ test_lag_slave()
RET=0
mirror_install $swp1 ingress gt4 \
- "proto 802.1q flower vlan_id 333 $tcflags"
+ "proto 802.1q flower vlan_id 333"
+ vlan_capture_install gt4-dst "vlan_ethtype ipv4 ip_proto icmp type 8"
# Move $down_dev away from the team. That will prompt change in
# txability of the connected device, without changing its upness. The
@@ -226,13 +229,14 @@ test_lag_slave()
# other slave.
ip link set dev $down_dev nomaster
sleep 2
- mirror_test vrf-h1 192.0.2.1 192.0.2.18 $up_dev 1 10
+ mirror_test vrf-h1 192.0.2.1 192.0.2.18 gt4-dst 100 10
# Test lack of connectivity when neither slave is txable.
ip link set dev $up_dev nomaster
sleep 2
- mirror_test vrf-h1 192.0.2.1 192.0.2.18 $h3 1 0
- mirror_test vrf-h1 192.0.2.1 192.0.2.18 $h4 1 0
+ mirror_test vrf-h1 192.0.2.1 192.0.2.18 gt4-dst 100 0
+
+ vlan_capture_uninstall gt4-dst
mirror_uninstall $swp1 ingress
# Recreate H3's team device, because mlxsw, which this test is
@@ -243,7 +247,7 @@ test_lag_slave()
# Wait for ${h,swp}{3,4}.
setup_wait
- log_test "$what ($tcflags)"
+ log_test "$what"
}
test_mirror_gretap_first()
@@ -256,30 +260,11 @@ test_mirror_gretap_second()
test_lag_slave $h4 $h3 "mirror to gretap: LAG second slave"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_lib.sh b/tools/testing/selftests/net/forwarding/mirror_gre_lib.sh
index 0c36546e131e..20078cc55f24 100644
--- a/tools/testing/selftests/net/forwarding/mirror_gre_lib.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_lib.sh
@@ -5,22 +5,34 @@ source "$net_forwarding_dir/mirror_lib.sh"
quick_test_span_gre_dir_ips()
{
local tundev=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
- do_test_span_dir_ips 10 h3-$tundev "$@"
+ do_test_span_dir_ips 10 h3-$tundev "$ip1" "$ip2" \
+ "$forward_type" "$backward_type"
}
fail_test_span_gre_dir_ips()
{
local tundev=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
- do_test_span_dir_ips 0 h3-$tundev "$@"
+ do_test_span_dir_ips 0 h3-$tundev "$ip1" "$ip2"
}
test_span_gre_dir_ips()
{
local tundev=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
- test_span_dir_ips h3-$tundev "$@"
+ test_span_dir_ips h3-$tundev "$forward_type" \
+ "$backward_type" "$ip1" "$ip2"
}
full_test_span_gre_dir_ips()
@@ -35,12 +47,12 @@ full_test_span_gre_dir_ips()
RET=0
- mirror_install $swp1 $direction $tundev "matchall $tcflags"
- test_span_dir_ips "h3-$tundev" "$direction" "$forward_type" \
+ mirror_install $swp1 $direction $tundev "matchall"
+ test_span_dir_ips "h3-$tundev" "$forward_type" \
"$backward_type" "$ip1" "$ip2"
mirror_uninstall $swp1 $direction
- log_test "$direction $what ($tcflags)"
+ log_test "$direction $what"
}
full_test_span_gre_dir_vlan_ips()
@@ -56,45 +68,63 @@ full_test_span_gre_dir_vlan_ips()
RET=0
- mirror_install $swp1 $direction $tundev "matchall $tcflags"
+ mirror_install $swp1 $direction $tundev "matchall"
- test_span_dir_ips "h3-$tundev" "$direction" "$forward_type" \
+ test_span_dir_ips "h3-$tundev" "$forward_type" \
"$backward_type" "$ip1" "$ip2"
tc filter add dev $h3 ingress pref 77 prot 802.1q \
flower $vlan_match \
action pass
- mirror_test v$h1 $ip1 $ip2 $h3 77 10
+ mirror_test v$h1 $ip1 $ip2 $h3 77 '>= 10'
tc filter del dev $h3 ingress pref 77
mirror_uninstall $swp1 $direction
- log_test "$direction $what ($tcflags)"
+ log_test "$direction $what"
}
quick_test_span_gre_dir()
{
- quick_test_span_gre_dir_ips "$@" 192.0.2.1 192.0.2.2
+ local tundev=$1; shift
+ local forward_type=${1-8}; shift
+ local backward_type=${1-0}; shift
+
+ quick_test_span_gre_dir_ips "$tundev" 192.0.2.1 192.0.2.2 \
+ "$forward_type" "$backward_type"
}
fail_test_span_gre_dir()
{
- fail_test_span_gre_dir_ips "$@" 192.0.2.1 192.0.2.2
-}
+ local tundev=$1; shift
-test_span_gre_dir()
-{
- test_span_gre_dir_ips "$@" 192.0.2.1 192.0.2.2
+ fail_test_span_gre_dir_ips "$tundev" 192.0.2.1 192.0.2.2
}
full_test_span_gre_dir()
{
- full_test_span_gre_dir_ips "$@" 192.0.2.1 192.0.2.2
+ local tundev=$1; shift
+ local direction=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
+ local what=$1; shift
+
+ full_test_span_gre_dir_ips "$tundev" "$direction" "$forward_type" \
+ "$backward_type" "$what" 192.0.2.1 192.0.2.2
}
full_test_span_gre_dir_vlan()
{
- full_test_span_gre_dir_vlan_ips "$@" 192.0.2.1 192.0.2.2
+ local tundev=$1; shift
+ local direction=$1; shift
+ local vlan_match=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
+ local what=$1; shift
+
+ full_test_span_gre_dir_vlan_ips "$tundev" "$direction" "$vlan_match" \
+ "$forward_type" "$backward_type" \
+ "$what" 192.0.2.1 192.0.2.2
}
full_test_span_gre_stp_ips()
@@ -104,27 +134,39 @@ full_test_span_gre_stp_ips()
local what=$1; shift
local ip1=$1; shift
local ip2=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
local h3mac=$(mac_get $h3)
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir_ips $tundev ingress $ip1 $ip2
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir_ips $tundev $ip1 $ip2 \
+ "$forward_type" "$backward_type"
bridge link set dev $nbpdev state disabled
sleep 1
- fail_test_span_gre_dir_ips $tundev ingress $ip1 $ip2
+ fail_test_span_gre_dir_ips $tundev $ip1 $ip2
bridge link set dev $nbpdev state forwarding
sleep 1
- quick_test_span_gre_dir_ips $tundev ingress $ip1 $ip2
+ quick_test_span_gre_dir_ips $tundev $ip1 $ip2 \
+ "$forward_type" "$backward_type"
mirror_uninstall $swp1 ingress
- log_test "$what: STP state ($tcflags)"
+ log_test "$what: STP state"
}
full_test_span_gre_stp()
{
- full_test_span_gre_stp_ips "$@" 192.0.2.1 192.0.2.2
+ local tundev=$1; shift
+ local nbpdev=$1; shift
+ local what=$1; shift
+ local forward_type=${1-8}; shift
+ local backward_type=${1-0}; shift
+
+ full_test_span_gre_stp_ips "$tundev" "$nbpdev" "$what" \
+ 192.0.2.1 192.0.2.2 \
+ "$forward_type" "$backward_type"
}
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_neigh.sh b/tools/testing/selftests/net/forwarding/mirror_gre_neigh.sh
index fc0508e40fca..2cbfbecf25c8 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_neigh.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_neigh.sh
@@ -60,41 +60,32 @@ test_span_gre_neigh()
local addr=$1; shift
local tundev=$1; shift
local direction=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
local what=$1; shift
RET=0
ip neigh replace dev $swp3 $addr lladdr 00:11:22:33:44:55
- mirror_install $swp1 $direction $tundev "matchall $tcflags"
- fail_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 $direction $tundev "matchall"
+ fail_test_span_gre_dir $tundev "$forward_type" "$backward_type"
ip neigh del dev $swp3 $addr
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev "$forward_type" "$backward_type"
mirror_uninstall $swp1 $direction
- log_test "$direction $what: neighbor change ($tcflags)"
+ log_test "$direction $what: neighbor change"
}
test_gretap()
{
- test_span_gre_neigh 192.0.2.130 gt4 ingress "mirror to gretap"
- test_span_gre_neigh 192.0.2.130 gt4 egress "mirror to gretap"
+ test_span_gre_neigh 192.0.2.130 gt4 ingress 8 0 "mirror to gretap"
+ test_span_gre_neigh 192.0.2.130 gt4 egress 0 8 "mirror to gretap"
}
test_ip6gretap()
{
- test_span_gre_neigh 2001:db8:2::2 gt6 ingress "mirror to ip6gretap"
- test_span_gre_neigh 2001:db8:2::2 gt6 egress "mirror to ip6gretap"
-}
-
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
+ test_span_gre_neigh 2001:db8:2::2 gt6 ingress 8 0 "mirror to ip6gretap"
+ test_span_gre_neigh 2001:db8:2::2 gt6 egress 0 8 "mirror to ip6gretap"
}
trap cleanup EXIT
@@ -102,14 +93,6 @@ trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_nh.sh b/tools/testing/selftests/net/forwarding/mirror_gre_nh.sh
index 6f9ef1820e93..34bc646938e3 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_nh.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_nh.sh
@@ -75,42 +75,31 @@ cleanup()
test_gretap()
{
RET=0
- mirror_install $swp1 ingress gt4 "matchall $tcflags"
+ mirror_install $swp1 ingress gt4 "matchall"
# For IPv4, test that there's no mirroring without the route directing
# the traffic to tunnel remote address. Then add it and test that
# mirroring starts. For IPv6 we can't test this due to the limitation
# that routes for locally-specified IPv6 addresses can't be added.
- fail_test_span_gre_dir gt4 ingress
+ fail_test_span_gre_dir gt4
ip route add 192.0.2.130/32 via 192.0.2.162
- quick_test_span_gre_dir gt4 ingress
+ quick_test_span_gre_dir gt4
ip route del 192.0.2.130/32 via 192.0.2.162
mirror_uninstall $swp1 ingress
- log_test "mirror to gre with next-hop remote ($tcflags)"
+ log_test "mirror to gre with next-hop remote"
}
test_ip6gretap()
{
RET=0
- mirror_install $swp1 ingress gt6 "matchall $tcflags"
- quick_test_span_gre_dir gt6 ingress
+ mirror_install $swp1 ingress gt6 "matchall"
+ quick_test_span_gre_dir gt6
mirror_uninstall $swp1 ingress
- log_test "mirror to ip6gre with next-hop remote ($tcflags)"
-}
-
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
+ log_test "mirror to ip6gre with next-hop remote"
}
trap cleanup EXIT
@@ -118,14 +107,6 @@ trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_vlan.sh b/tools/testing/selftests/net/forwarding/mirror_gre_vlan.sh
index 88cecdb9a861..63689928cb51 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_vlan.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_vlan.sh
@@ -63,30 +63,11 @@ test_gretap()
full_test_span_gre_dir gt4 egress 0 8 "mirror to gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_vlan_bridge_1q.sh b/tools/testing/selftests/net/forwarding/mirror_gre_vlan_bridge_1q.sh
index c8a9b5bd841f..1b902cc579f6 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_vlan_bridge_1q.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_vlan_bridge_1q.sh
@@ -153,21 +153,21 @@ test_span_gre_forbidden_cpu()
RET=0
# Run the pass-test first, to prime neighbor table.
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
# Now forbid the VLAN at the bridge and see it fail.
bridge vlan del dev br1 vid 555 self
sleep 1
- fail_test_span_gre_dir $tundev ingress
+ fail_test_span_gre_dir $tundev
bridge vlan add dev br1 vid 555 self
sleep 1
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: vlan forbidden at a bridge ($tcflags)"
+ log_test "$what: vlan forbidden at a bridge"
}
test_gretap_forbidden_cpu()
@@ -187,22 +187,22 @@ test_span_gre_forbidden_egress()
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
bridge vlan del dev $swp3 vid 555
sleep 1
- fail_test_span_gre_dir $tundev ingress
+ fail_test_span_gre_dir $tundev
bridge vlan add dev $swp3 vid 555
# Re-prime FDB
$ARPING -I br1.555 192.0.2.130 -fqc 1
sleep 1
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: vlan forbidden at a bridge egress ($tcflags)"
+ log_test "$what: vlan forbidden at a bridge egress"
}
test_gretap_forbidden_egress()
@@ -223,30 +223,30 @@ test_span_gre_untagged_egress()
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
+ mirror_install $swp1 ingress $tundev "matchall"
- quick_test_span_gre_dir $tundev ingress
- quick_test_span_vlan_dir $h3 555 ingress "$ul_proto"
+ quick_test_span_gre_dir $tundev
+ quick_test_span_vlan_dir $h3 555 "$ul_proto"
h3_addr_add_del del $h3.555
bridge vlan add dev $swp3 vid 555 pvid untagged
h3_addr_add_del add $h3
sleep 5
- quick_test_span_gre_dir $tundev ingress
- fail_test_span_vlan_dir $h3 555 ingress "$ul_proto"
+ quick_test_span_gre_dir $tundev
+ fail_test_span_vlan_dir $h3 555 "$ul_proto"
h3_addr_add_del del $h3
bridge vlan add dev $swp3 vid 555
h3_addr_add_del add $h3.555
sleep 5
- quick_test_span_gre_dir $tundev ingress
- quick_test_span_vlan_dir $h3 555 ingress "$ul_proto"
+ quick_test_span_gre_dir $tundev
+ quick_test_span_vlan_dir $h3 555 "$ul_proto"
mirror_uninstall $swp1 ingress
- log_test "$what: vlan untagged at a bridge egress ($tcflags)"
+ log_test "$what: vlan untagged at a bridge egress"
}
test_gretap_untagged_egress()
@@ -267,19 +267,19 @@ test_span_gre_fdb_roaming()
RET=0
- mirror_install $swp1 ingress $tundev "matchall $tcflags"
- quick_test_span_gre_dir $tundev ingress
+ mirror_install $swp1 ingress $tundev "matchall"
+ quick_test_span_gre_dir $tundev
while ((RET == 0)); do
bridge fdb del dev $swp3 $h3mac vlan 555 master 2>/dev/null
bridge fdb add dev $swp2 $h3mac vlan 555 master static
sleep 1
- fail_test_span_gre_dir $tundev ingress
+ fail_test_span_gre_dir $tundev
if ! bridge fdb sh dev $swp2 vlan 555 master \
| grep -q $h3mac; then
printf "TEST: %-60s [RETRY]\n" \
- "$what: MAC roaming ($tcflags)"
+ "$what: MAC roaming"
# ARP or ND probably reprimed the FDB while the test
# was running. We would get a spurious failure.
RET=0
@@ -292,11 +292,11 @@ test_span_gre_fdb_roaming()
# Re-prime FDB
$ARPING -I br1.555 192.0.2.130 -fqc 1
sleep 1
- quick_test_span_gre_dir $tundev ingress
+ quick_test_span_gre_dir $tundev
mirror_uninstall $swp1 ingress
- log_test "$what: MAC roaming ($tcflags)"
+ log_test "$what: MAC roaming"
}
test_gretap_fdb_roaming()
@@ -319,30 +319,11 @@ test_ip6gretap_stp()
full_test_span_gre_stp gt6 $swp3 "mirror to ip6gretap"
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
-
- tests_run
-
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/mirror_lib.sh b/tools/testing/selftests/net/forwarding/mirror_lib.sh
index 3e8ebeff3019..6bf9d5ae933c 100644
--- a/tools/testing/selftests/net/forwarding/mirror_lib.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_lib.sh
@@ -44,14 +44,17 @@ mirror_test()
local type="icmp echoreq"
fi
+ if [[ -z ${expect//[[:digit:]]/} ]]; then
+ expect="== $expect"
+ fi
+
local t0=$(tc_rule_stats_get $dev $pref)
$MZ $proto $vrf_name ${sip:+-A $sip} -B $dip -a own -b bc -q \
-c 10 -d 100msec -t $type
sleep 0.5
local t1=$(tc_rule_stats_get $dev $pref)
local delta=$((t1 - t0))
- # Tolerate a couple stray extra packets.
- ((expect <= delta && delta <= expect + 2))
+ ((delta $expect))
check_err $? "Expected to capture $expect packets, got $delta."
}
@@ -59,36 +62,42 @@ do_test_span_dir_ips()
{
local expect=$1; shift
local dev=$1; shift
- local direction=$1; shift
local ip1=$1; shift
local ip2=$1; shift
+ local forward_type=${1-8}; shift
+ local backward_type=${1-0}; shift
- icmp_capture_install $dev
+ icmp_capture_install $dev "type $forward_type"
mirror_test v$h1 $ip1 $ip2 $dev 100 $expect
+ icmp_capture_uninstall $dev
+
+ icmp_capture_install $dev "type $backward_type"
mirror_test v$h2 $ip2 $ip1 $dev 100 $expect
icmp_capture_uninstall $dev
}
quick_test_span_dir_ips()
{
- do_test_span_dir_ips 10 "$@"
-}
+ local dev=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
+ local forward_type=${1-8}; shift
+ local backward_type=${1-0}; shift
-fail_test_span_dir_ips()
-{
- do_test_span_dir_ips 0 "$@"
+ do_test_span_dir_ips 10 "$dev" "$ip1" "$ip2" \
+ "$forward_type" "$backward_type"
}
test_span_dir_ips()
{
local dev=$1; shift
- local direction=$1; shift
local forward_type=$1; shift
local backward_type=$1; shift
local ip1=$1; shift
local ip2=$1; shift
- quick_test_span_dir_ips "$dev" "$direction" "$ip1" "$ip2"
+ quick_test_span_dir_ips "$dev" "$ip1" "$ip2" \
+ "$forward_type" "$backward_type"
icmp_capture_install $dev "type $forward_type"
mirror_test v$h1 $ip1 $ip2 $dev 100 10
@@ -99,14 +108,14 @@ test_span_dir_ips()
icmp_capture_uninstall $dev
}
-fail_test_span_dir()
-{
- fail_test_span_dir_ips "$@" 192.0.2.1 192.0.2.2
-}
-
test_span_dir()
{
- test_span_dir_ips "$@" 192.0.2.1 192.0.2.2
+ local dev=$1; shift
+ local forward_type=$1; shift
+ local backward_type=$1; shift
+
+ test_span_dir_ips "$dev" "$forward_type" "$backward_type" \
+ 192.0.2.1 192.0.2.2
}
do_test_span_vlan_dir_ips()
@@ -114,7 +123,6 @@ do_test_span_vlan_dir_ips()
local expect=$1; shift
local dev=$1; shift
local vid=$1; shift
- local direction=$1; shift
local ul_proto=$1; shift
local ip1=$1; shift
local ip2=$1; shift
@@ -123,27 +131,50 @@ do_test_span_vlan_dir_ips()
# The traffic is meant for local box anyway, so will be trapped to
# kernel.
vlan_capture_install $dev "skip_hw vlan_id $vid vlan_ethtype $ul_proto"
- mirror_test v$h1 $ip1 $ip2 $dev 100 $expect
- mirror_test v$h2 $ip2 $ip1 $dev 100 $expect
+ mirror_test v$h1 $ip1 $ip2 $dev 100 "$expect"
+ mirror_test v$h2 $ip2 $ip1 $dev 100 "$expect"
vlan_capture_uninstall $dev
}
quick_test_span_vlan_dir_ips()
{
- do_test_span_vlan_dir_ips 10 "$@"
+ local dev=$1; shift
+ local vid=$1; shift
+ local ul_proto=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
+
+ do_test_span_vlan_dir_ips '>= 10' "$dev" "$vid" "$ul_proto" \
+ "$ip1" "$ip2"
}
fail_test_span_vlan_dir_ips()
{
- do_test_span_vlan_dir_ips 0 "$@"
+ local dev=$1; shift
+ local vid=$1; shift
+ local ul_proto=$1; shift
+ local ip1=$1; shift
+ local ip2=$1; shift
+
+ do_test_span_vlan_dir_ips 0 "$dev" "$vid" "$ul_proto" "$ip1" "$ip2"
}
quick_test_span_vlan_dir()
{
- quick_test_span_vlan_dir_ips "$@" 192.0.2.1 192.0.2.2
+ local dev=$1; shift
+ local vid=$1; shift
+ local ul_proto=$1; shift
+
+ quick_test_span_vlan_dir_ips "$dev" "$vid" "$ul_proto" \
+ 192.0.2.1 192.0.2.2
}
fail_test_span_vlan_dir()
{
- fail_test_span_vlan_dir_ips "$@" 192.0.2.1 192.0.2.2
+ local dev=$1; shift
+ local vid=$1; shift
+ local ul_proto=$1; shift
+
+ fail_test_span_vlan_dir_ips "$dev" "$vid" "$ul_proto" \
+ 192.0.2.1 192.0.2.2
}
diff --git a/tools/testing/selftests/net/forwarding/mirror_vlan.sh b/tools/testing/selftests/net/forwarding/mirror_vlan.sh
index 0b44e148235e..2f150a414d38 100755
--- a/tools/testing/selftests/net/forwarding/mirror_vlan.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_vlan.sh
@@ -40,12 +40,16 @@ setup_prepare()
vlan_create $h2 111 v$h2 192.0.2.18/28
bridge vlan add dev $swp2 vid 111
+
+ trap_install $h3 ingress
}
cleanup()
{
pre_cleanup
+ trap_uninstall $h3 ingress
+
vlan_destroy $h2 111
vlan_destroy $h1 111
vlan_destroy $h3 555
@@ -63,11 +67,11 @@ test_vlan_dir()
RET=0
- mirror_install $swp1 $direction $swp3.555 "matchall $tcflags"
- test_span_dir "$h3.555" "$direction" "$forward_type" "$backward_type"
+ mirror_install $swp1 $direction $swp3.555 "matchall"
+ test_span_dir "$h3.555" "$forward_type" "$backward_type"
mirror_uninstall $swp1 $direction
- log_test "$direction mirror to vlan ($tcflags)"
+ log_test "$direction mirror to vlan"
}
test_vlan()
@@ -84,14 +88,12 @@ test_tagged_vlan_dir()
RET=0
- mirror_install $swp1 $direction $swp3.555 "matchall $tcflags"
- do_test_span_vlan_dir_ips 10 "$h3.555" 111 "$direction" ip \
- 192.0.2.17 192.0.2.18
- do_test_span_vlan_dir_ips 0 "$h3.555" 555 "$direction" ip \
- 192.0.2.17 192.0.2.18
+ mirror_install $swp1 $direction $swp3.555 "matchall"
+ do_test_span_vlan_dir_ips '>= 10' "$h3.555" 111 ip 192.0.2.17 192.0.2.18
+ do_test_span_vlan_dir_ips 0 "$h3.555" 555 ip 192.0.2.17 192.0.2.18
mirror_uninstall $swp1 $direction
- log_test "$direction mirror tagged to vlan ($tcflags)"
+ log_test "$direction mirror tagged to vlan"
}
test_tagged_vlan()
@@ -100,32 +102,11 @@ test_tagged_vlan()
test_tagged_vlan_dir egress 0 8
}
-test_all()
-{
- slow_path_trap_install $swp1 ingress
- slow_path_trap_install $swp1 egress
- trap_install $h3 ingress
-
- tests_run
-
- trap_uninstall $h3 ingress
- slow_path_trap_uninstall $swp1 egress
- slow_path_trap_uninstall $swp1 ingress
-}
-
trap cleanup EXIT
setup_prepare
setup_wait
-tcflags="skip_hw"
-test_all
-
-if ! tc_offload_check; then
- echo "WARN: Could not test offloaded functionality"
-else
- tcflags="skip_sw"
- test_all
-fi
+tests_run
exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/router_mpath_seed.sh b/tools/testing/selftests/net/forwarding/router_mpath_seed.sh
new file mode 100755
index 000000000000..314cb906c1eb
--- /dev/null
+++ b/tools/testing/selftests/net/forwarding/router_mpath_seed.sh
@@ -0,0 +1,333 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+# +-------------------------+ +-------------------------+
+# | H1 | | H2 |
+# | $h1 + | | + $h2 |
+# | 192.0.2.1/28 | | | | 192.0.2.34/28 |
+# | 2001:db8:1::1/64 | | | | 2001:db8:3::2/64 |
+# +-------------------|-----+ +-|-----------------------+
+# | |
+# +-------------------|-----+ +-|-----------------------+
+# | R1 | | | | R2 |
+# | $rp11 + | | + $rp21 |
+# | 192.0.2.2/28 | | 192.0.2.33/28 |
+# | 2001:db8:1::2/64 | | 2001:db8:3::1/64 |
+# | | | |
+# | $rp12 + | | + $rp22 |
+# | 192.0.2.17/28 | | | | 192.0.2.18..27/28 |
+# | 2001:db8:2::17/64 | | | | 2001:db8:2::18..27/64 |
+# +-------------------|-----+ +-|-----------------------+
+# | |
+# `----------'
+
+ALL_TESTS="
+ ping_ipv4
+ ping_ipv6
+ test_mpath_seed_stability_ipv4
+ test_mpath_seed_stability_ipv6
+ test_mpath_seed_get
+ test_mpath_seed_ipv4
+ test_mpath_seed_ipv6
+"
+NUM_NETIFS=6
+source lib.sh
+
+h1_create()
+{
+ simple_if_init $h1 192.0.2.1/28 2001:db8:1::1/64
+ ip -4 route add 192.0.2.32/28 vrf v$h1 nexthop via 192.0.2.2
+ ip -6 route add 2001:db8:3::/64 vrf v$h1 nexthop via 2001:db8:1::2
+}
+
+h1_destroy()
+{
+ ip -6 route del 2001:db8:3::/64 vrf v$h1 nexthop via 2001:db8:1::2
+ ip -4 route del 192.0.2.32/28 vrf v$h1 nexthop via 192.0.2.2
+ simple_if_fini $h1 192.0.2.1/28 2001:db8:1::1/64
+}
+
+h2_create()
+{
+ simple_if_init $h2 192.0.2.34/28 2001:db8:3::2/64
+ ip -4 route add 192.0.2.0/28 vrf v$h2 nexthop via 192.0.2.33
+ ip -6 route add 2001:db8:1::/64 vrf v$h2 nexthop via 2001:db8:3::1
+}
+
+h2_destroy()
+{
+ ip -6 route del 2001:db8:1::/64 vrf v$h2 nexthop via 2001:db8:3::1
+ ip -4 route del 192.0.2.0/28 vrf v$h2 nexthop via 192.0.2.33
+ simple_if_fini $h2 192.0.2.34/28 2001:db8:3::2/64
+}
+
+router1_create()
+{
+ simple_if_init $rp11 192.0.2.2/28 2001:db8:1::2/64
+ __simple_if_init $rp12 v$rp11 192.0.2.17/28 2001:db8:2::17/64
+}
+
+router1_destroy()
+{
+ __simple_if_fini $rp12 192.0.2.17/28 2001:db8:2::17/64
+ simple_if_fini $rp11 192.0.2.2/28 2001:db8:1::2/64
+}
+
+router2_create()
+{
+ simple_if_init $rp21 192.0.2.33/28 2001:db8:3::1/64
+ __simple_if_init $rp22 v$rp21 192.0.2.18/28 2001:db8:2::18/64
+ ip -4 route add 192.0.2.0/28 vrf v$rp21 nexthop via 192.0.2.17
+ ip -6 route add 2001:db8:1::/64 vrf v$rp21 nexthop via 2001:db8:2::17
+}
+
+router2_destroy()
+{
+ ip -6 route del 2001:db8:1::/64 vrf v$rp21 nexthop via 2001:db8:2::17
+ ip -4 route del 192.0.2.0/28 vrf v$rp21 nexthop via 192.0.2.17
+ __simple_if_fini $rp22 192.0.2.18/28 2001:db8:2::18/64
+ simple_if_fini $rp21 192.0.2.33/28 2001:db8:3::1/64
+}
+
+nexthops_create()
+{
+ local i
+ for i in $(seq 10); do
+ ip nexthop add id $((1000 + i)) via 192.0.2.18 dev $rp12
+ ip nexthop add id $((2000 + i)) via 2001:db8:2::18 dev $rp12
+ done
+
+ ip nexthop add id 1000 group $(seq -s / 1001 1010) hw_stats on
+ ip nexthop add id 2000 group $(seq -s / 2001 2010) hw_stats on
+ ip -4 route add 192.0.2.32/28 vrf v$rp11 nhid 1000
+ ip -6 route add 2001:db8:3::/64 vrf v$rp11 nhid 2000
+}
+
+nexthops_destroy()
+{
+ local i
+
+ ip -6 route del 2001:db8:3::/64 vrf v$rp11 nhid 2000
+ ip -4 route del 192.0.2.32/28 vrf v$rp11 nhid 1000
+ ip nexthop del id 2000
+ ip nexthop del id 1000
+
+ for i in $(seq 10 -1 1); do
+ ip nexthop del id $((2000 + i))
+ ip nexthop del id $((1000 + i))
+ done
+}
+
+setup_prepare()
+{
+ h1=${NETIFS[p1]}
+ rp11=${NETIFS[p2]}
+
+ rp12=${NETIFS[p3]}
+ rp22=${NETIFS[p4]}
+
+ rp21=${NETIFS[p5]}
+ h2=${NETIFS[p6]}
+
+ sysctl_save net.ipv4.fib_multipath_hash_seed
+
+ vrf_prepare
+
+ h1_create
+ h2_create
+ router1_create
+ router2_create
+
+ forwarding_enable
+}
+
+cleanup()
+{
+ pre_cleanup
+
+ forwarding_restore
+
+ nexthops_destroy
+ router2_destroy
+ router1_destroy
+ h2_destroy
+ h1_destroy
+
+ vrf_cleanup
+
+ sysctl_restore net.ipv4.fib_multipath_hash_seed
+}
+
+ping_ipv4()
+{
+ ping_test $h1 192.0.2.34
+}
+
+ping_ipv6()
+{
+ ping6_test $h1 2001:db8:3::2
+}
+
+test_mpath_seed_get()
+{
+ RET=0
+
+ local i
+ for ((i = 0; i < 100; i++)); do
+ local seed_w=$((999331 * i))
+ sysctl -qw net.ipv4.fib_multipath_hash_seed=$seed_w
+ local seed_r=$(sysctl -n net.ipv4.fib_multipath_hash_seed)
+ ((seed_r == seed_w))
+ check_err $? "mpath seed written as $seed_w, but read as $seed_r"
+ done
+
+ log_test "mpath seed set/get"
+}
+
+nh_stats_snapshot()
+{
+ local group_id=$1; shift
+
+ ip -j -s -s nexthop show id $group_id |
+ jq -c '[.[].group_stats | sort_by(.id) | .[].packets]'
+}
+
+get_active_nh()
+{
+ local s0=$1; shift
+ local s1=$1; shift
+
+ jq -n --argjson s0 "$s0" --argjson s1 "$s1" -f /dev/stdin <<-"EOF"
+ [range($s0 | length)] |
+ map($s1[.] - $s0[.]) |
+ map(if . > 8 then 1 else 0 end) |
+ index(1)
+ EOF
+}
+
+probe_nh()
+{
+ local group_id=$1; shift
+ local -a mz=("$@")
+
+ local s0=$(nh_stats_snapshot $group_id)
+ "${mz[@]}"
+ local s1=$(nh_stats_snapshot $group_id)
+
+ get_active_nh "$s0" "$s1"
+}
+
+probe_seed()
+{
+ local group_id=$1; shift
+ local seed=$1; shift
+ local -a mz=("$@")
+
+ sysctl -qw net.ipv4.fib_multipath_hash_seed=$seed
+ probe_nh "$group_id" "${mz[@]}"
+}
+
+test_mpath_seed()
+{
+ local group_id=$1; shift
+ local what=$1; shift
+ local -a mz=("$@")
+ local ii
+
+ RET=0
+
+ local -a tally=(0 0 0 0 0 0 0 0 0 0)
+ for ((ii = 0; ii < 100; ii++)); do
+ local act=$(probe_seed $group_id $((999331 * ii)) "${mz[@]}")
+ ((tally[act]++))
+ done
+
+ local tally_str="${tally[@]}"
+ for ((ii = 0; ii < ${#tally[@]}; ii++)); do
+ ((tally[ii] > 0))
+ check_err $? "NH #$ii not hit, tally='$tally_str'"
+ done
+
+ log_test "mpath seed $what"
+ sysctl -qw net.ipv4.fib_multipath_hash_seed=0
+}
+
+test_mpath_seed_ipv4()
+{
+ test_mpath_seed 1000 IPv4 \
+ $MZ $h1 -A 192.0.2.1 -B 192.0.2.34 -q \
+ -p 64 -d 0 -c 10 -t udp
+}
+
+test_mpath_seed_ipv6()
+{
+ test_mpath_seed 2000 IPv6 \
+ $MZ -6 $h1 -A 2001:db8:1::1 -B 2001:db8:3::2 -q \
+ -p 64 -d 0 -c 10 -t udp
+}
+
+check_mpath_seed_stability()
+{
+ local seed=$1; shift
+ local act_0=$1; shift
+ local act_1=$1; shift
+
+ ((act_0 == act_1))
+ check_err $? "seed $seed: active NH moved from $act_0 to $act_1 after seed change"
+}
+
+test_mpath_seed_stability()
+{
+ local group_id=$1; shift
+ local what=$1; shift
+ local -a mz=("$@")
+
+ RET=0
+
+ local seed_0=0
+ local seed_1=3221338814
+ local seed_2=3735928559
+
+ # Initial active NH before touching the seed at all.
+ local act_ini=$(probe_nh $group_id "${mz[@]}")
+
+ local act_0_0=$(probe_seed $group_id $seed_0 "${mz[@]}")
+ local act_1_0=$(probe_seed $group_id $seed_1 "${mz[@]}")
+ local act_2_0=$(probe_seed $group_id $seed_2 "${mz[@]}")
+
+ local act_0_1=$(probe_seed $group_id $seed_0 "${mz[@]}")
+ local act_1_1=$(probe_seed $group_id $seed_1 "${mz[@]}")
+ local act_2_1=$(probe_seed $group_id $seed_2 "${mz[@]}")
+
+ check_mpath_seed_stability initial $act_ini $act_0_0
+ check_mpath_seed_stability $seed_0 $act_0_0 $act_0_1
+ check_mpath_seed_stability $seed_1 $act_1_0 $act_1_1
+ check_mpath_seed_stability $seed_2 $act_2_0 $act_2_1
+
+ log_test "mpath seed stability $what"
+ sysctl -qw net.ipv4.fib_multipath_hash_seed=0
+}
+
+test_mpath_seed_stability_ipv4()
+{
+ test_mpath_seed_stability 1000 IPv4 \
+ $MZ $h1 -A 192.0.2.1 -B 192.0.2.34 -q \
+ -p 64 -d 0 -c 10 -t udp
+}
+
+test_mpath_seed_stability_ipv6()
+{
+ test_mpath_seed_stability 2000 IPv6 \
+ $MZ -6 $h1 -A 2001:db8:1::1 -B 2001:db8:3::2 -q \
+ -p 64 -d 0 -c 10 -t udp
+}
+
+trap cleanup EXIT
+
+setup_prepare
+setup_wait
+nexthops_create
+
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/forwarding/vxlan_bridge_1d.sh b/tools/testing/selftests/net/forwarding/vxlan_bridge_1d.sh
index 6f0a2e452ba1..3f9d50f1ef9e 100755
--- a/tools/testing/selftests/net/forwarding/vxlan_bridge_1d.sh
+++ b/tools/testing/selftests/net/forwarding/vxlan_bridge_1d.sh
@@ -680,9 +680,9 @@ test_learning()
local mac=de:ad:be:ef:13:37
local dst=192.0.2.100
- # Enable learning on the VxLAN device and set ageing time to 10 seconds
- ip link set dev br1 type bridge ageing_time 1000
- ip link set dev vx1 type vxlan ageing 10
+ # Enable learning on the VxLAN device and set ageing time to 30 seconds
+ ip link set dev br1 type bridge ageing_time 3000
+ ip link set dev vx1 type vxlan ageing 30
ip link set dev vx1 type vxlan learning
reapply_config
@@ -740,7 +740,7 @@ test_learning()
vxlan_flood_test $mac $dst 0 10 0
- sleep 20
+ sleep 60
bridge fdb show brport vx1 | grep $mac | grep -q self
check_fail $?
diff --git a/tools/testing/selftests/net/hsr/config b/tools/testing/selftests/net/hsr/config
index 22061204fb69..241542441c51 100644
--- a/tools/testing/selftests/net/hsr/config
+++ b/tools/testing/selftests/net/hsr/config
@@ -2,3 +2,4 @@ CONFIG_IPV6=y
CONFIG_NET_SCH_NETEM=m
CONFIG_HSR=y
CONFIG_VETH=y
+CONFIG_BRIDGE=y
diff --git a/tools/testing/selftests/net/hsr/hsr_ping.sh b/tools/testing/selftests/net/hsr/hsr_ping.sh
index 790294c8af83..f5d207fc770a 100755
--- a/tools/testing/selftests/net/hsr/hsr_ping.sh
+++ b/tools/testing/selftests/net/hsr/hsr_ping.sh
@@ -152,6 +152,15 @@ setup_hsr_interfaces()
ip -net "$ns3" addr add 100.64.0.3/24 dev hsr3
ip -net "$ns3" addr add dead:beef:1::3/64 dev hsr3 nodad
+ ip -net "$ns1" link set address 00:11:22:00:01:01 dev ns1eth1
+ ip -net "$ns1" link set address 00:11:22:00:01:02 dev ns1eth2
+
+ ip -net "$ns2" link set address 00:11:22:00:02:01 dev ns2eth1
+ ip -net "$ns2" link set address 00:11:22:00:02:02 dev ns2eth2
+
+ ip -net "$ns3" link set address 00:11:22:00:03:01 dev ns3eth1
+ ip -net "$ns3" link set address 00:11:22:00:03:02 dev ns3eth2
+
# All Links up
ip -net "$ns1" link set ns1eth1 up
ip -net "$ns1" link set ns1eth2 up
@@ -174,6 +183,8 @@ trap cleanup_all_ns EXIT
setup_hsr_interfaces 0
do_complete_ping_test
+setup_ns ns1 ns2 ns3
+
setup_hsr_interfaces 1
do_complete_ping_test
diff --git a/tools/testing/selftests/net/hsr/hsr_redbox.sh b/tools/testing/selftests/net/hsr/hsr_redbox.sh
index 1f36785347c0..998103502d5d 100755
--- a/tools/testing/selftests/net/hsr/hsr_redbox.sh
+++ b/tools/testing/selftests/net/hsr/hsr_redbox.sh
@@ -96,6 +96,21 @@ setup_hsr_interfaces()
ip -n "${ns4}" link set ns4eth1 up
ip -n "${ns5}" link set ns5eth1 up
+ ip -net "$ns1" link set address 00:11:22:00:01:01 dev ns1eth1
+ ip -net "$ns1" link set address 00:11:22:00:01:02 dev ns1eth2
+
+ ip -net "$ns2" link set address 00:11:22:00:02:01 dev ns2eth1
+ ip -net "$ns2" link set address 00:11:22:00:02:02 dev ns2eth2
+ ip -net "$ns2" link set address 00:11:22:00:02:03 dev ns2eth3
+
+ ip -net "$ns3" link set address 00:11:22:00:03:11 dev ns3eth1
+ ip -net "$ns3" link set address 00:11:22:00:03:11 dev ns3eth2
+ ip -net "$ns3" link set address 00:11:22:00:03:11 dev ns3eth3
+ ip -net "$ns3" link set address 00:11:22:00:03:11 dev ns3br1
+
+ ip -net "$ns4" link set address 00:11:22:00:04:01 dev ns4eth1
+ ip -net "$ns5" link set address 00:11:22:00:05:01 dev ns5eth1
+
ip -net "${ns1}" link add name hsr1 type hsr slave1 ns1eth1 slave2 ns1eth2 supervision 45 version ${HSRv} proto 0
ip -net "${ns2}" link add name hsr2 type hsr slave1 ns2eth1 slave2 ns2eth2 interlink ns2eth3 supervision 45 version ${HSRv} proto 0
diff --git a/tools/testing/selftests/net/lib.sh b/tools/testing/selftests/net/lib.sh
index edc030e81a46..d0219032f773 100644
--- a/tools/testing/selftests/net/lib.sh
+++ b/tools/testing/selftests/net/lib.sh
@@ -15,7 +15,7 @@ ksft_xfail=2
ksft_skip=4
# namespace list created by setup_ns
-NS_LIST=""
+NS_LIST=()
##############################################################################
# Helpers
@@ -27,6 +27,7 @@ __ksft_status_merge()
local -A weights
local weight=0
+ local i
for i in "$@"; do
weights[$i]=$((weight++))
done
@@ -67,9 +68,7 @@ loopy_wait()
while true
do
local out
- out=$("$@")
- local ret=$?
- if ((!ret)); then
+ if out=$("$@"); then
echo -n "$out"
return 0
fi
@@ -126,74 +125,84 @@ slowwait_for_counter()
slowwait "$timeout" until_counter_is ">= $((base + delta))" "$@"
}
+remove_ns_list()
+{
+ local item=$1
+ local ns
+ local ns_list=("${NS_LIST[@]}")
+ NS_LIST=()
+
+ for ns in "${ns_list[@]}"; do
+ if [ "${ns}" != "${item}" ]; then
+ NS_LIST+=("${ns}")
+ fi
+ done
+}
+
cleanup_ns()
{
local ns=""
- local errexit=0
local ret=0
- # disable errexit temporary
- if [[ $- =~ "e" ]]; then
- errexit=1
- set +e
- fi
-
for ns in "$@"; do
- ip netns delete "${ns}" &> /dev/null
+ [ -z "${ns}" ] && continue
+ ip netns delete "${ns}" &> /dev/null || true
if ! busywait $BUSYWAIT_TIMEOUT ip netns list \| grep -vq "^$ns$" &> /dev/null; then
echo "Warn: Failed to remove namespace $ns"
ret=1
+ else
+ remove_ns_list "${ns}"
fi
done
- [ $errexit -eq 1 ] && set -e
return $ret
}
cleanup_all_ns()
{
- cleanup_ns $NS_LIST
+ cleanup_ns "${NS_LIST[@]}"
}
# setup netns with given names as prefix. e.g
# setup_ns local remote
setup_ns()
{
- local ns=""
local ns_name=""
- local ns_list=""
- local ns_exist=
+ local ns_list=()
for ns_name in "$@"; do
+ # avoid conflicts with local var: internal error
+ if [ "${ns_name}" = "ns_name" ]; then
+ echo "Failed to setup namespace '${ns_name}': invalid name"
+ cleanup_ns "${ns_list[@]}"
+ exit $ksft_fail
+ fi
+
# Some test may setup/remove same netns multi times
- if unset ${ns_name} 2> /dev/null; then
- ns="${ns_name,,}-$(mktemp -u XXXXXX)"
- eval readonly ${ns_name}="$ns"
- ns_exist=false
+ if [ -z "${!ns_name}" ]; then
+ eval "${ns_name}=${ns_name,,}-$(mktemp -u XXXXXX)"
else
- eval ns='$'${ns_name}
- cleanup_ns "$ns"
- ns_exist=true
+ cleanup_ns "${!ns_name}"
fi
- if ! ip netns add "$ns"; then
+ if ! ip netns add "${!ns_name}"; then
echo "Failed to create namespace $ns_name"
- cleanup_ns "$ns_list"
+ cleanup_ns "${ns_list[@]}"
return $ksft_skip
fi
- ip -n "$ns" link set lo up
- ! $ns_exist && ns_list="$ns_list $ns"
+ ip -n "${!ns_name}" link set lo up
+ ns_list+=("${!ns_name}")
done
- NS_LIST="$NS_LIST $ns_list"
+ NS_LIST+=("${ns_list[@]}")
}
tc_rule_stats_get()
{
local dev=$1; shift
local pref=$1; shift
- local dir=$1; shift
+ local dir=${1:-ingress}; shift
local selector=${1:-.packets}; shift
- tc -j -s filter show dev $dev ${dir:-ingress} pref $pref \
+ tc -j -s filter show dev $dev $dir pref $pref \
| jq ".[1].options.actions[].stats$selector"
}
diff --git a/tools/testing/selftests/net/lib/py/ksft.py b/tools/testing/selftests/net/lib/py/ksft.py
index 4769b4eb1ea1..f26c20df9db4 100644
--- a/tools/testing/selftests/net/lib/py/ksft.py
+++ b/tools/testing/selftests/net/lib/py/ksft.py
@@ -6,6 +6,7 @@ import sys
import time
import traceback
from .consts import KSFT_MAIN_NAME
+from .utils import global_defer_queue
KSFT_RESULT = None
KSFT_RESULT_ALL = True
@@ -57,6 +58,11 @@ def ksft_ge(a, b, comment=""):
_fail("Check failed", a, "<", b, comment)
+def ksft_lt(a, b, comment=""):
+ if a >= b:
+ _fail("Check failed", a, ">=", b, comment)
+
+
class ksft_raises:
def __init__(self, expected_type):
self.exception = None
@@ -103,6 +109,24 @@ def ktap_result(ok, cnt=1, case="", comment=""):
print(res)
+def ksft_flush_defer():
+ global KSFT_RESULT
+
+ i = 0
+ qlen_start = len(global_defer_queue)
+ while global_defer_queue:
+ i += 1
+ entry = global_defer_queue.pop()
+ try:
+ entry.exec_only()
+ except:
+ ksft_pr(f"Exception while handling defer / cleanup (callback {i} of {qlen_start})!")
+ tb = traceback.format_exc()
+ for line in tb.strip().split('\n'):
+ ksft_pr("Defer Exception|", line)
+ KSFT_RESULT = False
+
+
def ksft_run(cases=None, globs=None, case_pfx=None, args=()):
cases = cases or []
@@ -122,32 +146,41 @@ def ksft_run(cases=None, globs=None, case_pfx=None, args=()):
global KSFT_RESULT
cnt = 0
+ stop = False
for case in cases:
KSFT_RESULT = True
cnt += 1
+ comment = ""
+ cnt_key = ""
+
try:
case(*args)
except KsftSkipEx as e:
- ktap_result(True, cnt, case, comment="SKIP " + str(e))
- totals['skip'] += 1
- continue
+ comment = "SKIP " + str(e)
+ cnt_key = 'skip'
except KsftXfailEx as e:
- ktap_result(True, cnt, case, comment="XFAIL " + str(e))
- totals['xfail'] += 1
- continue
- except Exception as e:
+ comment = "XFAIL " + str(e)
+ cnt_key = 'xfail'
+ except BaseException as e:
+ stop |= isinstance(e, KeyboardInterrupt)
tb = traceback.format_exc()
for line in tb.strip().split('\n'):
ksft_pr("Exception|", line)
- ktap_result(False, cnt, case)
- totals['fail'] += 1
- continue
-
- ktap_result(KSFT_RESULT, cnt, case)
- if KSFT_RESULT:
- totals['pass'] += 1
- else:
- totals['fail'] += 1
+ if stop:
+ ksft_pr("Stopping tests due to KeyboardInterrupt.")
+ KSFT_RESULT = False
+ cnt_key = 'fail'
+
+ ksft_flush_defer()
+
+ if not cnt_key:
+ cnt_key = 'pass' if KSFT_RESULT else 'fail'
+
+ ktap_result(KSFT_RESULT, cnt, case, comment=comment)
+ totals[cnt_key] += 1
+
+ if stop:
+ break
print(
f"# Totals: pass:{totals['pass']} fail:{totals['fail']} xfail:{totals['xfail']} xpass:0 skip:{totals['skip']} error:0"
diff --git a/tools/testing/selftests/net/lib/py/utils.py b/tools/testing/selftests/net/lib/py/utils.py
index 0540ea24921d..72590c3f90f1 100644
--- a/tools/testing/selftests/net/lib/py/utils.py
+++ b/tools/testing/selftests/net/lib/py/utils.py
@@ -1,12 +1,18 @@
# SPDX-License-Identifier: GPL-2.0
+import errno
import json as _json
import random
import re
+import socket
import subprocess
import time
+class CmdExitFailure(Exception):
+ pass
+
+
class cmd:
def __init__(self, comm, shell=True, fail=True, ns=None, background=False, host=None, timeout=5):
if ns:
@@ -41,8 +47,8 @@ class cmd:
if self.proc.returncode != 0 and fail:
if len(stderr) > 0 and stderr[-1] == "\n":
stderr = stderr[:-1]
- raise Exception("Command failed: %s\nSTDOUT: %s\nSTDERR: %s" %
- (self.proc.args, stdout, stderr))
+ raise CmdExitFailure("Command failed: %s\nSTDOUT: %s\nSTDERR: %s" %
+ (self.proc.args, stdout, stderr))
class bkg(cmd):
@@ -60,6 +66,40 @@ class bkg(cmd):
return self.process(terminate=self.terminate, fail=self.check_fail)
+global_defer_queue = []
+
+
+class defer:
+ def __init__(self, func, *args, **kwargs):
+ global global_defer_queue
+
+ if not callable(func):
+ raise Exception("defer created with un-callable object, did you call the function instead of passing its name?")
+
+ self.func = func
+ self.args = args
+ self.kwargs = kwargs
+
+ self._queue = global_defer_queue
+ self._queue.append(self)
+
+ def __enter__(self):
+ return self
+
+ def __exit__(self, ex_type, ex_value, ex_tb):
+ return self.exec()
+
+ def exec_only(self):
+ self.func(*self.args, **self.kwargs)
+
+ def cancel(self):
+ self._queue.remove(self)
+
+ def exec(self):
+ self.cancel()
+ self.exec_only()
+
+
def tool(name, args, json=None, ns=None, host=None):
cmd_str = name + ' '
if json:
@@ -77,11 +117,24 @@ def ip(args, json=None, ns=None, host=None):
return tool('ip', args, json=json, host=host)
+def ethtool(args, json=None, ns=None, host=None):
+ return tool('ethtool', args, json=json, ns=ns, host=host)
+
+
def rand_port():
"""
- Get unprivileged port, for now just random, one day we may decide to check if used.
+ Get a random unprivileged port, try to make sure it's not already used.
"""
- return random.randint(10000, 65535)
+ for _ in range(1000):
+ port = random.randint(10000, 65535)
+ try:
+ with socket.socket(socket.AF_INET6, socket.SOCK_STREAM) as s:
+ s.bind(("", port))
+ return port
+ except OSError as e:
+ if e.errno != errno.EADDRINUSE:
+ raise
+ raise Exception("Can't find any free unprivileged port")
def wait_port_listen(port, proto="tcp", ns=None, host=None, sleep=0.005, deadline=5):
diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh
index fefa9173bdaa..108aeeb84ef1 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_join.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh
@@ -261,6 +261,8 @@ reset()
TEST_NAME="${1}"
+ MPTCP_LIB_SUBTEST_FLAKY=0 # reset if modified
+
if skip_test; then
MPTCP_LIB_TEST_COUNTER=$((MPTCP_LIB_TEST_COUNTER+1))
last_test_ignored=1
@@ -448,7 +450,9 @@ reset_with_tcp_filter()
# $1: err msg
fail_test()
{
- ret=${KSFT_FAIL}
+ if ! mptcp_lib_subtest_is_flaky; then
+ ret=${KSFT_FAIL}
+ fi
if [ ${#} -gt 0 ]; then
print_fail "${@}"
@@ -2245,9 +2249,10 @@ remove_tests()
if reset "remove invalid addresses"; then
pm_nl_set_limits $ns1 3 3
pm_nl_add_endpoint $ns1 10.0.12.1 flags signal
+ # broadcast IP: no packet for this address will be received on ns1
+ pm_nl_add_endpoint $ns1 224.0.0.1 flags signal
pm_nl_add_endpoint $ns1 10.0.3.1 flags signal
- pm_nl_add_endpoint $ns1 10.0.14.1 flags signal
- pm_nl_set_limits $ns2 3 3
+ pm_nl_set_limits $ns2 2 2
addr_nr_ns1=-3 speed=10 \
run_tests $ns1 $ns2 10.0.1.1
chk_join_nr 1 1 1
@@ -3069,6 +3074,7 @@ fullmesh_tests()
fastclose_tests()
{
if reset_check_counter "fastclose test" "MPTcpExtMPFastcloseTx"; then
+ MPTCP_LIB_SUBTEST_FLAKY=1
test_linkfail=1024 fastclose=client \
run_tests $ns1 $ns2 10.0.1.1
chk_join_nr 0 0 0
@@ -3077,6 +3083,7 @@ fastclose_tests()
fi
if reset_check_counter "fastclose server test" "MPTcpExtMPFastcloseRx"; then
+ MPTCP_LIB_SUBTEST_FLAKY=1
test_linkfail=1024 fastclose=server \
run_tests $ns1 $ns2 10.0.1.1
chk_join_nr 0 0 0 0 0 0 1
@@ -3095,6 +3102,7 @@ fail_tests()
{
# single subflow
if reset_with_fail "Infinite map" 1; then
+ MPTCP_LIB_SUBTEST_FLAKY=1
test_linkfail=128 \
run_tests $ns1 $ns2 10.0.1.1
chk_join_nr 0 0 0 +1 +0 1 0 1 "$(pedit_action_pkts)"
@@ -3103,6 +3111,7 @@ fail_tests()
# multiple subflows
if reset_with_fail "MP_FAIL MP_RST" 2; then
+ MPTCP_LIB_SUBTEST_FLAKY=1
tc -n $ns2 qdisc add dev ns2eth1 root netem rate 1mbit delay 5ms
pm_nl_set_limits $ns1 0 1
pm_nl_set_limits $ns2 0 1
diff --git a/tools/testing/selftests/net/mptcp/mptcp_lib.sh b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
index ad2ebda5cb64..438280e68434 100644
--- a/tools/testing/selftests/net/mptcp/mptcp_lib.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
@@ -1,6 +1,9 @@
#! /bin/bash
# SPDX-License-Identifier: GPL-2.0
+. "$(dirname "${0}")/../lib.sh"
+. "$(dirname "${0}")/../net_helper.sh"
+
readonly KSFT_PASS=0
readonly KSFT_FAIL=1
readonly KSFT_SKIP=4
@@ -21,6 +24,7 @@ declare -rx MPTCP_LIB_AF_INET6=10
MPTCP_LIB_SUBTESTS=()
MPTCP_LIB_SUBTESTS_DUPLICATED=0
+MPTCP_LIB_SUBTEST_FLAKY=0
MPTCP_LIB_TEST_COUNTER=0
MPTCP_LIB_TEST_FORMAT="%02u %-50s"
MPTCP_LIB_IP_MPTCP=0
@@ -41,6 +45,16 @@ else
readonly MPTCP_LIB_COLOR_RESET=
fi
+# SELFTESTS_MPTCP_LIB_OVERRIDE_FLAKY env var can be set not to ignore errors
+# from subtests marked as flaky
+mptcp_lib_override_flaky() {
+ [ "${SELFTESTS_MPTCP_LIB_OVERRIDE_FLAKY:-}" = 1 ]
+}
+
+mptcp_lib_subtest_is_flaky() {
+ [ "${MPTCP_LIB_SUBTEST_FLAKY}" = 1 ] && ! mptcp_lib_override_flaky
+}
+
# $1: color, $2: text
mptcp_lib_print_color() {
echo -e "${MPTCP_LIB_START_PRINT:-}${*}${MPTCP_LIB_COLOR_RESET}"
@@ -72,7 +86,16 @@ mptcp_lib_pr_skip() {
}
mptcp_lib_pr_fail() {
- mptcp_lib_print_err "[FAIL]${1:+ ${*}}"
+ local title cmt
+
+ if mptcp_lib_subtest_is_flaky; then
+ title="IGNO"
+ cmt=" (flaky)"
+ else
+ title="FAIL"
+ fi
+
+ mptcp_lib_print_err "[${title}]${cmt}${1:+ ${*}}"
}
mptcp_lib_pr_info() {
@@ -208,7 +231,13 @@ mptcp_lib_result_pass() {
# $1: test name
mptcp_lib_result_fail() {
- __mptcp_lib_result_add "not ok" "${1}"
+ if mptcp_lib_subtest_is_flaky; then
+ # It might sound better to use 'not ok # TODO' or 'ok # SKIP',
+ # but some CIs don't understand 'TODO' and treat SKIP as errors.
+ __mptcp_lib_result_add "ok" "${1} # IGNORE Flaky"
+ else
+ __mptcp_lib_result_add "not ok" "${1}"
+ fi
}
# $1: test name
@@ -335,20 +364,7 @@ mptcp_lib_check_transfer() {
# $1: ns, $2: port
mptcp_lib_wait_local_port_listen() {
- local listener_ns="${1}"
- local port="${2}"
-
- local port_hex
- port_hex="$(printf "%04X" "${port}")"
-
- local _
- for _ in $(seq 10); do
- ip netns exec "${listener_ns}" cat /proc/net/tcp* | \
- awk "BEGIN {rc=1} {if (\$2 ~ /:${port_hex}\$/ && \$4 ~ /0A/) \
- {rc=0; exit}} END {exit rc}" &&
- break
- sleep 0.1
- done
+ wait_local_port_listen "${@}" "tcp"
}
mptcp_lib_check_output() {
@@ -412,17 +428,13 @@ mptcp_lib_check_tools() {
}
mptcp_lib_ns_init() {
- local sec rndh
-
- sec=$(date +%s)
- rndh=$(printf %x "${sec}")-$(mktemp -u XXXXXX)
+ if ! setup_ns "${@}"; then
+ mptcp_lib_pr_fail "Failed to setup namespaces ${*}"
+ exit ${KSFT_FAIL}
+ fi
local netns
for netns in "${@}"; do
- eval "${netns}=${netns}-${rndh}"
-
- ip netns add "${!netns}" || exit ${KSFT_SKIP}
- ip -net "${!netns}" link set lo up
ip netns exec "${!netns}" sysctl -q net.mptcp.enabled=1
ip netns exec "${!netns}" sysctl -q net.ipv4.conf.all.rp_filter=0
ip netns exec "${!netns}" sysctl -q net.ipv4.conf.default.rp_filter=0
@@ -430,9 +442,10 @@ mptcp_lib_ns_init() {
}
mptcp_lib_ns_exit() {
+ cleanup_ns "${@}"
+
local netns
for netns in "${@}"; do
- ip netns del "${netns}"
rm -f /tmp/"${netns}".{nstat,out}
done
}
diff --git a/tools/testing/selftests/net/mptcp/simult_flows.sh b/tools/testing/selftests/net/mptcp/simult_flows.sh
index 4b14b4412166..f74e1c3c126d 100755
--- a/tools/testing/selftests/net/mptcp/simult_flows.sh
+++ b/tools/testing/selftests/net/mptcp/simult_flows.sh
@@ -244,7 +244,7 @@ run_test()
do_transfer $small $large $time
lret=$?
mptcp_lib_result_code "${lret}" "${msg}"
- if [ $lret -ne 0 ]; then
+ if [ $lret -ne 0 ] && ! mptcp_lib_subtest_is_flaky; then
ret=$lret
[ $bail -eq 0 ] || exit $ret
fi
@@ -254,7 +254,7 @@ run_test()
do_transfer $large $small $time
lret=$?
mptcp_lib_result_code "${lret}" "${msg}"
- if [ $lret -ne 0 ]; then
+ if [ $lret -ne 0 ] && ! mptcp_lib_subtest_is_flaky; then
ret=$lret
[ $bail -eq 0 ] || exit $ret
fi
@@ -290,7 +290,7 @@ run_test 10 10 0 0 "balanced bwidth"
run_test 10 10 1 25 "balanced bwidth with unbalanced delay"
# we still need some additional infrastructure to pass the following test-cases
-run_test 10 3 0 0 "unbalanced bwidth"
+MPTCP_LIB_SUBTEST_FLAKY=1 run_test 10 3 0 0 "unbalanced bwidth"
run_test 10 3 1 25 "unbalanced bwidth with unbalanced delay"
run_test 10 3 25 1 "unbalanced bwidth with opposed, unbalanced delay"
diff --git a/tools/testing/selftests/net/mptcp/userspace_pm.sh b/tools/testing/selftests/net/mptcp/userspace_pm.sh
index 9e2981f2d7f5..9cb05978269d 100755
--- a/tools/testing/selftests/net/mptcp/userspace_pm.sh
+++ b/tools/testing/selftests/net/mptcp/userspace_pm.sh
@@ -160,10 +160,12 @@ make_connection()
local is_v6=$1
local app_port=$app4_port
local connect_addr="10.0.1.1"
+ local client_addr="10.0.1.2"
local listen_addr="0.0.0.0"
if [ "$is_v6" = "v6" ]
then
connect_addr="dead:beef:1::1"
+ client_addr="dead:beef:1::2"
listen_addr="::"
app_port=$app6_port
else
@@ -206,6 +208,7 @@ make_connection()
[ "$server_serverside" = 1 ]
then
test_pass
+ print_title "Connection info: ${client_addr}:${client_port} -> ${connect_addr}:${app_port}"
else
test_fail "Expected tokens (c:${client_token} - s:${server_token}) and server (c:${client_serverside} - s:${server_serverside})"
mptcp_lib_result_print_all_tap
@@ -297,7 +300,7 @@ test_announce()
ip netns exec "$ns2"\
./pm_nl_ctl ann 10.0.2.2 token "$client4_token" id $client_addr_id dev\
ns2eth1
- print_test "ADD_ADDR id:${client_addr_id} 10.0.2.2 (ns2) => ns1, reuse port"
+ print_test "ADD_ADDR id:client 10.0.2.2 (ns2) => ns1, reuse port"
sleep 0.5
verify_announce_event $server_evts $ANNOUNCED $server4_token "10.0.2.2" $client_addr_id \
"$client4_port"
@@ -306,7 +309,7 @@ test_announce()
:>"$server_evts"
ip netns exec "$ns2" ./pm_nl_ctl ann\
dead:beef:2::2 token "$client6_token" id $client_addr_id dev ns2eth1
- print_test "ADD_ADDR6 id:${client_addr_id} dead:beef:2::2 (ns2) => ns1, reuse port"
+ print_test "ADD_ADDR6 id:client dead:beef:2::2 (ns2) => ns1, reuse port"
sleep 0.5
verify_announce_event "$server_evts" "$ANNOUNCED" "$server6_token" "dead:beef:2::2"\
"$client_addr_id" "$client6_port" "v6"
@@ -316,7 +319,7 @@ test_announce()
client_addr_id=$((client_addr_id+1))
ip netns exec "$ns2" ./pm_nl_ctl ann 10.0.2.2 token "$client4_token" id\
$client_addr_id dev ns2eth1 port $new4_port
- print_test "ADD_ADDR id:${client_addr_id} 10.0.2.2 (ns2) => ns1, new port"
+ print_test "ADD_ADDR id:client+1 10.0.2.2 (ns2) => ns1, new port"
sleep 0.5
verify_announce_event "$server_evts" "$ANNOUNCED" "$server4_token" "10.0.2.2"\
"$client_addr_id" "$new4_port"
@@ -327,7 +330,7 @@ test_announce()
# ADD_ADDR from the server to client machine reusing the subflow port
ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server4_token" id\
$server_addr_id dev ns1eth2
- print_test "ADD_ADDR id:${server_addr_id} 10.0.2.1 (ns1) => ns2, reuse port"
+ print_test "ADD_ADDR id:server 10.0.2.1 (ns1) => ns2, reuse port"
sleep 0.5
verify_announce_event "$client_evts" "$ANNOUNCED" "$client4_token" "10.0.2.1"\
"$server_addr_id" "$app4_port"
@@ -336,7 +339,7 @@ test_announce()
:>"$client_evts"
ip netns exec "$ns1" ./pm_nl_ctl ann dead:beef:2::1 token "$server6_token" id\
$server_addr_id dev ns1eth2
- print_test "ADD_ADDR6 id:${server_addr_id} dead:beef:2::1 (ns1) => ns2, reuse port"
+ print_test "ADD_ADDR6 id:server dead:beef:2::1 (ns1) => ns2, reuse port"
sleep 0.5
verify_announce_event "$client_evts" "$ANNOUNCED" "$client6_token" "dead:beef:2::1"\
"$server_addr_id" "$app6_port" "v6"
@@ -346,7 +349,7 @@ test_announce()
server_addr_id=$((server_addr_id+1))
ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server4_token" id\
$server_addr_id dev ns1eth2 port $new4_port
- print_test "ADD_ADDR id:${server_addr_id} 10.0.2.1 (ns1) => ns2, new port"
+ print_test "ADD_ADDR id:server+1 10.0.2.1 (ns1) => ns2, new port"
sleep 0.5
verify_announce_event "$client_evts" "$ANNOUNCED" "$client4_token" "10.0.2.1"\
"$server_addr_id" "$new4_port"
@@ -380,7 +383,7 @@ test_remove()
local invalid_token=$(( client4_token - 1 ))
ip netns exec "$ns2" ./pm_nl_ctl rem token $invalid_token id\
$client_addr_id > /dev/null 2>&1
- print_test "RM_ADDR id:${client_addr_id} ns2 => ns1, invalid token"
+ print_test "RM_ADDR id:client ns2 => ns1, invalid token"
local type
type=$(mptcp_lib_evts_get_info type "$server_evts")
if [ "$type" = "" ]
@@ -394,7 +397,7 @@ test_remove()
local invalid_id=$(( client_addr_id + 1 ))
ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\
$invalid_id > /dev/null 2>&1
- print_test "RM_ADDR id:${invalid_id} ns2 => ns1, invalid id"
+ print_test "RM_ADDR id:client+1 ns2 => ns1, invalid id"
type=$(mptcp_lib_evts_get_info type "$server_evts")
if [ "$type" = "" ]
then
@@ -407,7 +410,7 @@ test_remove()
:>"$server_evts"
ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\
$client_addr_id
- print_test "RM_ADDR id:${client_addr_id} ns2 => ns1"
+ print_test "RM_ADDR id:client ns2 => ns1"
sleep 0.5
verify_remove_event "$server_evts" "$REMOVED" "$server4_token" "$client_addr_id"
@@ -416,7 +419,7 @@ test_remove()
client_addr_id=$(( client_addr_id - 1 ))
ip netns exec "$ns2" ./pm_nl_ctl rem token "$client4_token" id\
$client_addr_id
- print_test "RM_ADDR id:${client_addr_id} ns2 => ns1"
+ print_test "RM_ADDR id:client-1 ns2 => ns1"
sleep 0.5
verify_remove_event "$server_evts" "$REMOVED" "$server4_token" "$client_addr_id"
@@ -424,7 +427,7 @@ test_remove()
:>"$server_evts"
ip netns exec "$ns2" ./pm_nl_ctl rem token "$client6_token" id\
$client_addr_id
- print_test "RM_ADDR6 id:${client_addr_id} ns2 => ns1"
+ print_test "RM_ADDR6 id:client-1 ns2 => ns1"
sleep 0.5
verify_remove_event "$server_evts" "$REMOVED" "$server6_token" "$client_addr_id"
@@ -434,7 +437,7 @@ test_remove()
# RM_ADDR from the server to client machine
ip netns exec "$ns1" ./pm_nl_ctl rem token "$server4_token" id\
$server_addr_id
- print_test "RM_ADDR id:${server_addr_id} ns1 => ns2"
+ print_test "RM_ADDR id:server ns1 => ns2"
sleep 0.5
verify_remove_event "$client_evts" "$REMOVED" "$client4_token" "$server_addr_id"
@@ -443,7 +446,7 @@ test_remove()
server_addr_id=$(( server_addr_id - 1 ))
ip netns exec "$ns1" ./pm_nl_ctl rem token "$server4_token" id\
$server_addr_id
- print_test "RM_ADDR id:${server_addr_id} ns1 => ns2"
+ print_test "RM_ADDR id:server-1 ns1 => ns2"
sleep 0.5
verify_remove_event "$client_evts" "$REMOVED" "$client4_token" "$server_addr_id"
@@ -451,7 +454,7 @@ test_remove()
:>"$client_evts"
ip netns exec "$ns1" ./pm_nl_ctl rem token "$server6_token" id\
$server_addr_id
- print_test "RM_ADDR6 id:${server_addr_id} ns1 => ns2"
+ print_test "RM_ADDR6 id:server-1 ns1 => ns2"
sleep 0.5
verify_remove_event "$client_evts" "$REMOVED" "$client6_token" "$server_addr_id"
}
@@ -479,8 +482,14 @@ verify_subflow_events()
local locid
local remid
local info
+ local e_dport_txt
- info="${e_saddr} (${e_from}) => ${e_daddr}:${e_dport} (${e_to})"
+ # only display the fixed ports
+ if [ "${e_dport}" -ge "${app4_port}" ] && [ "${e_dport}" -le "${app6_port}" ]; then
+ e_dport_txt=":${e_dport}"
+ fi
+
+ info="${e_saddr} (${e_from}) => ${e_daddr}${e_dport_txt} (${e_to})"
if [ "$e_type" = "$SUB_ESTABLISHED" ]
then
@@ -766,7 +775,7 @@ test_subflows_v4_v6_mix()
:>"$client_evts"
ip netns exec "$ns1" ./pm_nl_ctl ann 10.0.2.1 token "$server6_token" id\
$server_addr_id dev ns1eth2
- print_test "ADD_ADDR4 id:${server_addr_id} 10.0.2.1 (ns1) => ns2, reuse port"
+ print_test "ADD_ADDR4 id:server 10.0.2.1 (ns1) => ns2, reuse port"
sleep 0.5
verify_announce_event "$client_evts" "$ANNOUNCED" "$client6_token" "10.0.2.1"\
"$server_addr_id" "$app6_port"
@@ -861,7 +870,7 @@ test_listener()
local listener_pid=$!
sleep 0.5
- print_test "CREATE_LISTENER 10.0.2.2:$client4_port"
+ print_test "CREATE_LISTENER 10.0.2.2 (client port)"
verify_listener_events $client_evts $LISTENER_CREATED $AF_INET 10.0.2.2 $client4_port
# ADD_ADDR from client to server machine reusing the subflow port
@@ -878,13 +887,14 @@ test_listener()
mptcp_lib_kill_wait $listener_pid
sleep 0.5
- print_test "CLOSE_LISTENER 10.0.2.2:$client4_port"
+ print_test "CLOSE_LISTENER 10.0.2.2 (client port)"
verify_listener_events $client_evts $LISTENER_CLOSED $AF_INET 10.0.2.2 $client4_port
}
print_title "Make connections"
make_connection
make_connection "v6"
+print_title "Will be using address IDs ${client_addr_id} (client) and ${server_addr_id} (server)"
test_announce
test_remove
diff --git a/tools/testing/selftests/net/msg_zerocopy.c b/tools/testing/selftests/net/msg_zerocopy.c
index bdc03a2097e8..7ea5fb28c93d 100644
--- a/tools/testing/selftests/net/msg_zerocopy.c
+++ b/tools/testing/selftests/net/msg_zerocopy.c
@@ -85,6 +85,7 @@ static bool cfg_rx;
static int cfg_runtime_ms = 4200;
static int cfg_verbose;
static int cfg_waittime_ms = 500;
+static int cfg_notification_limit = 32;
static bool cfg_zerocopy;
static socklen_t cfg_alen;
@@ -95,6 +96,7 @@ static char payload[IP_MAXPACKET];
static long packets, bytes, completions, expected_completions;
static int zerocopied = -1;
static uint32_t next_completion;
+static uint32_t sends_since_notify;
static unsigned long gettimeofday_ms(void)
{
@@ -208,6 +210,7 @@ static bool do_sendmsg(int fd, struct msghdr *msg, bool do_zerocopy, int domain)
error(1, errno, "send");
if (cfg_verbose && ret != len)
fprintf(stderr, "send: ret=%u != %u\n", ret, len);
+ sends_since_notify++;
if (len) {
packets++;
@@ -435,7 +438,7 @@ static bool do_recv_completion(int fd, int domain)
/* Detect notification gaps. These should not happen often, if at all.
* Gaps can occur due to drops, reordering and retransmissions.
*/
- if (lo != next_completion)
+ if (cfg_verbose && lo != next_completion)
fprintf(stderr, "gap: %u..%u does not append to %u\n",
lo, hi, next_completion);
next_completion = hi + 1;
@@ -460,6 +463,7 @@ static bool do_recv_completion(int fd, int domain)
static void do_recv_completions(int fd, int domain)
{
while (do_recv_completion(fd, domain)) {}
+ sends_since_notify = 0;
}
/* Wait for all remaining completions on the errqueue */
@@ -549,6 +553,9 @@ static void do_tx(int domain, int type, int protocol)
else
do_sendmsg(fd, &msg, cfg_zerocopy, domain);
+ if (cfg_zerocopy && sends_since_notify >= cfg_notification_limit)
+ do_recv_completions(fd, domain);
+
while (!do_poll(fd, POLLOUT)) {
if (cfg_zerocopy)
do_recv_completions(fd, domain);
@@ -708,7 +715,7 @@ static void parse_opts(int argc, char **argv)
cfg_payload_len = max_payload_len;
- while ((c = getopt(argc, argv, "46c:C:D:i:mp:rs:S:t:vz")) != -1) {
+ while ((c = getopt(argc, argv, "46c:C:D:i:l:mp:rs:S:t:vz")) != -1) {
switch (c) {
case '4':
if (cfg_family != PF_UNSPEC)
@@ -736,6 +743,9 @@ static void parse_opts(int argc, char **argv)
if (cfg_ifindex == 0)
error(1, errno, "invalid iface: %s", optarg);
break;
+ case 'l':
+ cfg_notification_limit = strtoul(optarg, NULL, 0);
+ break;
case 'm':
cfg_cork_mixed = true;
break;
diff --git a/tools/testing/selftests/net/netfilter/nft_queue.sh b/tools/testing/selftests/net/netfilter/nft_queue.sh
index 8538f08c64c2..c61d23a8c88d 100755
--- a/tools/testing/selftests/net/netfilter/nft_queue.sh
+++ b/tools/testing/selftests/net/netfilter/nft_queue.sh
@@ -375,6 +375,42 @@ EOF
wait 2>/dev/null
}
+test_queue_removal()
+{
+ read tainted_then < /proc/sys/kernel/tainted
+
+ ip netns exec "$ns1" nft -f - <<EOF
+flush ruleset
+table ip filter {
+ chain output {
+ type filter hook output priority 0; policy accept;
+ ip protocol icmp queue num 0
+ }
+}
+EOF
+ ip netns exec "$ns1" ./nf_queue -q 0 -d 30000 -t "$timeout" &
+ local nfqpid=$!
+
+ busywait "$BUSYWAIT_TIMEOUT" nf_queue_wait "$ns1" 0
+
+ ip netns exec "$ns1" ping -w 2 -f -c 10 127.0.0.1 -q >/dev/null
+ kill $nfqpid
+
+ ip netns exec "$ns1" nft flush ruleset
+
+ if [ "$tainted_then" -ne 0 ];then
+ return
+ fi
+
+ read tainted_now < /proc/sys/kernel/tainted
+ if [ "$tainted_now" -eq 0 ];then
+ echo "PASS: queue program exiting while packets queued"
+ else
+ echo "TAINT: queue program exiting while packets queued"
+ ret=1
+ fi
+}
+
ip netns exec "$nsrouter" sysctl net.ipv6.conf.all.forwarding=1 > /dev/null
ip netns exec "$nsrouter" sysctl net.ipv4.conf.veth0.forwarding=1 > /dev/null
ip netns exec "$nsrouter" sysctl net.ipv4.conf.veth1.forwarding=1 > /dev/null
@@ -413,5 +449,6 @@ test_tcp_localhost
test_tcp_localhost_connectclose
test_tcp_localhost_requeue
test_icmp_vrf
+test_queue_removal
exit $ret
diff --git a/tools/testing/selftests/net/netns-sysctl.sh b/tools/testing/selftests/net/netns-sysctl.sh
new file mode 100755
index 000000000000..45c34a3b9aae
--- /dev/null
+++ b/tools/testing/selftests/net/netns-sysctl.sh
@@ -0,0 +1,40 @@
+#!/bin/bash -e
+# SPDX-License-Identifier: GPL-2.0
+#
+# This test checks that the network buffer sysctls are present
+# in a network namespaces, and that they are readonly.
+
+source lib.sh
+
+cleanup() {
+ cleanup_ns $test_ns
+}
+
+trap cleanup EXIT
+
+fail() {
+ echo "ERROR: $*" >&2
+ exit 1
+}
+
+setup_ns test_ns
+
+for sc in {r,w}mem_{default,max}; do
+ # check that this is writable in a netns
+ [ -w "/proc/sys/net/core/$sc" ] ||
+ fail "$sc isn't writable in the init netns!"
+
+ # change the value in the host netns
+ sysctl -qw "net.core.$sc=300000" ||
+ fail "Can't write $sc in init netns!"
+
+ # check that the value is read from the init netns
+ [ "$(ip netns exec $test_ns sysctl -n "net.core.$sc")" -eq 300000 ] ||
+ fail "Value for $sc mismatch!"
+
+ # check that this isn't writable in a netns
+ ip netns exec $test_ns [ -w "/proc/sys/net/core/$sc" ] &&
+ fail "$sc is writable in a netns!"
+done
+
+echo 'Test passed OK'
diff --git a/tools/testing/selftests/net/openvswitch/openvswitch.sh b/tools/testing/selftests/net/openvswitch/openvswitch.sh
index 5cae53543849..cc0bfae2bafa 100755
--- a/tools/testing/selftests/net/openvswitch/openvswitch.sh
+++ b/tools/testing/selftests/net/openvswitch/openvswitch.sh
@@ -1,4 +1,4 @@
-#!/bin/sh
+#!/bin/bash
# SPDX-License-Identifier: GPL-2.0
#
# OVS kernel module self tests
@@ -11,6 +11,11 @@ ksft_skip=4
PAUSE_ON_FAIL=no
VERBOSE=0
TRACING=0
+WAIT_TIMEOUT=5
+
+if test "X$KSFT_MACHINE_SLOW" == "Xyes"; then
+ WAIT_TIMEOUT=10
+fi
tests="
arp_ping eth-arp: Basic arp ping between two NS
@@ -20,10 +25,37 @@ tests="
nat_related_v4 ip4-nat-related: ICMP related matches work with SNAT
netlink_checks ovsnl: validate netlink attrs and settings
upcall_interfaces ovs: test the upcall interfaces
- drop_reason drop: test drop reasons are emitted"
+ drop_reason drop: test drop reasons are emitted
+ psample psample: Sampling packets with psample"
info() {
- [ $VERBOSE = 0 ] || echo $*
+ [ "${ovs_dir}" != "" ] &&
+ echo "`date +"[%m-%d %H:%M:%S]"` $*" >> ${ovs_dir}/debug.log
+ [ $VERBOSE = 0 ] || echo $*
+}
+
+ovs_wait() {
+ info "waiting $WAIT_TIMEOUT s for: $@"
+
+ if "$@" ; then
+ info "wait succeeded immediately"
+ return 0
+ fi
+
+ # A quick re-check helps speed up small races in fast systems.
+ # However, fractional sleeps might not necessarily work.
+ local start=0
+ sleep 0.1 || { sleep 1; start=1; }
+
+ for (( i=start; i<WAIT_TIMEOUT; i++ )); do
+ if "$@" ; then
+ info "wait succeeded after $i seconds"
+ return 0
+ fi
+ sleep 1
+ done
+ info "wait failed after $i seconds"
+ return 1
}
ovs_base=`pwd`
@@ -65,7 +97,8 @@ ovs_setenv() {
ovs_sbx() {
if test "X$2" != X; then
- (ovs_setenv $1; shift; "$@" >> ${ovs_dir}/debug.log)
+ (ovs_setenv $1; shift;
+ info "run cmd: $@"; "$@" >> ${ovs_dir}/debug.log)
else
ovs_setenv $1
fi
@@ -102,12 +135,21 @@ ovs_netns_spawn_daemon() {
shift
netns=$1
shift
- info "spawning cmd: $*"
- ip netns exec $netns $* >> $ovs_dir/stdout 2>> $ovs_dir/stderr &
+ if [ "$netns" == "_default" ]; then
+ $* >> $ovs_dir/stdout 2>> $ovs_dir/stderr &
+ else
+ ip netns exec $netns $* >> $ovs_dir/stdout 2>> $ovs_dir/stderr &
+ fi
pid=$!
ovs_sbx "$sbx" on_exit "kill -TERM $pid 2>/dev/null"
}
+ovs_spawn_daemon() {
+ sbx=$1
+ shift
+ ovs_netns_spawn_daemon $sbx "_default" $*
+}
+
ovs_add_netns_and_veths () {
info "Adding netns attached: sbx:$1 dp:$2 {$3, $4, $5}"
ovs_sbx "$1" ip netns add "$3" || return 1
@@ -139,7 +181,7 @@ ovs_add_flow () {
info "Adding flow to DP: sbx:$1 br:$2 flow:$3 act:$4"
ovs_sbx "$1" python3 $ovs_base/ovs-dpctl.py add-flow "$2" "$3" "$4"
if [ $? -ne 0 ]; then
- echo "Flow [ $3 : $4 ] failed" >> ${ovs_dir}/debug.log
+ info "Flow [ $3 : $4 ] failed"
return 1
fi
return 0
@@ -170,6 +212,19 @@ ovs_drop_reason_count()
return `echo "$perf_output" | grep "$pattern" | wc -l`
}
+ovs_test_flow_fails () {
+ ERR_MSG="Flow actions may not be safe on all matching packets"
+
+ PRE_TEST=$(dmesg | grep -c "${ERR_MSG}")
+ ovs_add_flow $@ &> /dev/null $@ && return 1
+ POST_TEST=$(dmesg | grep -c "${ERR_MSG}")
+
+ if [ "$PRE_TEST" == "$POST_TEST" ]; then
+ return 1
+ fi
+ return 0
+}
+
usage() {
echo
echo "$0 [OPTIONS] [TEST]..."
@@ -184,6 +239,91 @@ usage() {
exit 1
}
+
+# psample test
+# - use psample to observe packets
+test_psample() {
+ sbx_add "test_psample" || return $?
+
+ # Add a datapath with per-vport dispatching.
+ ovs_add_dp "test_psample" psample -V 2:1 || return 1
+
+ info "create namespaces"
+ ovs_add_netns_and_veths "test_psample" "psample" \
+ client c0 c1 172.31.110.10/24 -u || return 1
+ ovs_add_netns_and_veths "test_psample" "psample" \
+ server s0 s1 172.31.110.20/24 -u || return 1
+
+ # Check if psample actions can be configured.
+ ovs_add_flow "test_psample" psample \
+ 'in_port(1),eth(),eth_type(0x0806),arp()' 'psample(group=1)' &> /dev/null
+ if [ $? == 1 ]; then
+ info "no support for psample - skipping"
+ ovs_exit_sig
+ return $ksft_skip
+ fi
+
+ ovs_del_flows "test_psample" psample
+
+ # Test action verification.
+ OLDIFS=$IFS
+ IFS='*'
+ min_key='in_port(1),eth(),eth_type(0x0800),ipv4()'
+ for testcase in \
+ "cookie to large"*"psample(group=1,cookie=1615141312111009080706050403020100)" \
+ "no group with cookie"*"psample(cookie=abcd)" \
+ "no group"*"psample()";
+ do
+ set -- $testcase;
+ ovs_test_flow_fails "test_psample" psample $min_key $2
+ if [ $? == 1 ]; then
+ info "failed - $1"
+ return 1
+ fi
+ done
+ IFS=$OLDIFS
+
+ ovs_del_flows "test_psample" psample
+ # Allow ARP
+ ovs_add_flow "test_psample" psample \
+ 'in_port(1),eth(),eth_type(0x0806),arp()' '2' || return 1
+ ovs_add_flow "test_psample" psample \
+ 'in_port(2),eth(),eth_type(0x0806),arp()' '1' || return 1
+
+ # Sample first 14 bytes of all traffic.
+ ovs_add_flow "test_psample" psample \
+ "in_port(1),eth(),eth_type(0x0800),ipv4()" \
+ "trunc(14),psample(group=1,cookie=c0ffee),2"
+
+ # Sample all traffic. In this case, use a sample() action with both
+ # psample and an upcall emulating simultaneous local sampling and
+ # sFlow / IPFIX.
+ nlpid=$(grep -E "listening on upcall packet handler" \
+ $ovs_dir/s0.out | cut -d ":" -f 2 | tr -d ' ')
+
+ ovs_add_flow "test_psample" psample \
+ "in_port(2),eth(),eth_type(0x0800),ipv4()" \
+ "sample(sample=100%,actions(psample(group=2,cookie=eeff0c),userspace(pid=${nlpid},userdata=eeff0c))),1"
+
+ # Record psample data.
+ ovs_spawn_daemon "test_psample" python3 $ovs_base/ovs-dpctl.py psample-events
+ ovs_wait grep -q "listening for psample events" ${ovs_dir}/stdout
+
+ # Send a single ping.
+ ovs_sbx "test_psample" ip netns exec client ping -I c1 172.31.110.20 -c 1 || return 1
+
+ # We should have received one userspace action upcall and 2 psample packets.
+ ovs_wait grep -q "userspace action command" $ovs_dir/s0.out || return 1
+
+ # client -> server samples should only contain the first 14 bytes of the packet.
+ ovs_wait grep -qE "rate:4294967295,group:1,cookie:c0ffee data:[0-9a-f]{28}$" \
+ $ovs_dir/stdout || return 1
+
+ ovs_wait grep -q "rate:4294967295,group:2,cookie:eeff0c" $ovs_dir/stdout || return 1
+
+ return 0
+}
+
# drop_reason test
# - drop packets and verify the right drop reason is reported
test_drop_reason() {
@@ -599,7 +739,8 @@ test_upcall_interfaces() {
ovs_add_netns_and_veths "test_upcall_interfaces" ui0 upc left0 l0 \
172.31.110.1/24 -u || return 1
- sleep 1
+ ovs_wait grep -q "listening on upcall packet handler" ${ovs_dir}/left0.out
+
info "sending arping"
ip netns exec upc arping -I l0 172.31.110.20 -c 1 \
>$ovs_dir/arping.stdout 2>$ovs_dir/arping.stderr
@@ -613,16 +754,20 @@ run_test() {
tname="$1"
tdesc="$2"
- if ! lsmod | grep openvswitch >/dev/null 2>&1; then
- stdbuf -o0 printf "TEST: %-60s [NOMOD]\n" "${tdesc}"
- return $ksft_skip
- fi
-
if python3 ovs-dpctl.py -h 2>&1 | \
grep -E "Need to (install|upgrade) the python" >/dev/null 2>&1; then
stdbuf -o0 printf "TEST: %-60s [PYLIB]\n" "${tdesc}"
return $ksft_skip
fi
+
+ python3 ovs-dpctl.py show >/dev/null 2>&1 || \
+ echo "[DPCTL] show exception."
+
+ if ! lsmod | grep openvswitch >/dev/null 2>&1; then
+ stdbuf -o0 printf "TEST: %-60s [NOMOD]\n" "${tdesc}"
+ return $ksft_skip
+ fi
+
printf "TEST: %-60s [START]\n" "${tname}"
unset IFS
diff --git a/tools/testing/selftests/net/openvswitch/ovs-dpctl.py b/tools/testing/selftests/net/openvswitch/ovs-dpctl.py
index 1dd057afd3fb..8a0396bfaf99 100644
--- a/tools/testing/selftests/net/openvswitch/ovs-dpctl.py
+++ b/tools/testing/selftests/net/openvswitch/ovs-dpctl.py
@@ -8,8 +8,10 @@ import argparse
import errno
import ipaddress
import logging
+import math
import multiprocessing
import re
+import socket
import struct
import sys
import time
@@ -26,13 +28,16 @@ try:
from pyroute2.netlink import genlmsg
from pyroute2.netlink import nla
from pyroute2.netlink import nlmsg_atoms
+ from pyroute2.netlink.event import EventSocket
from pyroute2.netlink.exceptions import NetlinkError
from pyroute2.netlink.generic import GenericNetlinkSocket
+ from pyroute2.netlink.nlsocket import Marshal
import pyroute2
+ import pyroute2.iproute
except ModuleNotFoundError:
print("Need to install the python pyroute2 package >= 0.6.")
- sys.exit(0)
+ sys.exit(1)
OVS_DATAPATH_FAMILY = "ovs_datapath"
@@ -58,6 +63,7 @@ OVS_FLOW_CMD_DEL = 2
OVS_FLOW_CMD_GET = 3
OVS_FLOW_CMD_SET = 4
+UINT32_MAX = 0xFFFFFFFF
def macstr(mac):
outstr = ":".join(["%02X" % i for i in mac])
@@ -198,6 +204,18 @@ def convert_ipv4(data):
return int(ipaddress.IPv4Address(ip)), int(ipaddress.IPv4Address(mask))
+def convert_ipv6(data):
+ ip, _, mask = data.partition('/')
+
+ if not ip:
+ ip = mask = 0
+ elif not mask:
+ mask = 'ffff:ffff:ffff:ffff:ffff:ffff:ffff:ffff'
+ elif mask.isdigit():
+ mask = ipaddress.IPv6Network("::/" + mask).hostmask
+
+ return ipaddress.IPv6Address(ip).packed, ipaddress.IPv6Address(mask).packed
+
def convert_int(size):
def convert_int_sized(data):
value, _, mask = data.partition('/')
@@ -267,6 +285,75 @@ def parse_extract_field(
return str_skipped, data
+def parse_attrs(actstr, attr_desc):
+ """Parses the given action string and returns a list of netlink
+ attributes based on a list of attribute descriptions.
+
+ Each element in the attribute description list is a tuple such as:
+ (name, attr_name, parse_func)
+ where:
+ name: is the string representing the attribute
+ attr_name: is the name of the attribute as defined in the uAPI.
+ parse_func: is a callable accepting a string and returning either
+ a single object (the parsed attribute value) or a tuple of
+ two values (the parsed attribute value and the remaining string)
+
+ Returns a list of attributes and the remaining string.
+ """
+ def parse_attr(actstr, key, func):
+ actstr = actstr[len(key) :]
+
+ if not func:
+ return None, actstr
+
+ delim = actstr[0]
+ actstr = actstr[1:]
+
+ if delim == "=":
+ pos = strcspn(actstr, ",)")
+ ret = func(actstr[:pos])
+ else:
+ ret = func(actstr)
+
+ if isinstance(ret, tuple):
+ (datum, actstr) = ret
+ else:
+ datum = ret
+ actstr = actstr[strcspn(actstr, ",)"):]
+
+ if delim == "(":
+ if not actstr or actstr[0] != ")":
+ raise ValueError("Action contains unbalanced parentheses")
+
+ actstr = actstr[1:]
+
+ actstr = actstr[strspn(actstr, ", ") :]
+
+ return datum, actstr
+
+ attrs = []
+ attr_desc = list(attr_desc)
+ while actstr and actstr[0] != ")" and attr_desc:
+ found = False
+ for i, (key, attr, func) in enumerate(attr_desc):
+ if actstr.startswith(key):
+ datum, actstr = parse_attr(actstr, key, func)
+ attrs.append([attr, datum])
+ found = True
+ del attr_desc[i]
+
+ if not found:
+ raise ValueError("Unknown attribute: '%s'" % actstr)
+
+ actstr = actstr[strspn(actstr, ", ") :]
+
+ if actstr[0] != ")":
+ raise ValueError("Action string contains extra garbage or has "
+ "unbalanced parenthesis: '%s'" % actstr)
+
+ return attrs, actstr[1:]
+
+
class ovs_dp_msg(genlmsg):
# include the OVS version
# We need a custom header rather than just being able to rely on
@@ -282,15 +369,15 @@ class ovsactions(nla):
("OVS_ACTION_ATTR_UNSPEC", "none"),
("OVS_ACTION_ATTR_OUTPUT", "uint32"),
("OVS_ACTION_ATTR_USERSPACE", "userspace"),
- ("OVS_ACTION_ATTR_SET", "none"),
+ ("OVS_ACTION_ATTR_SET", "ovskey"),
("OVS_ACTION_ATTR_PUSH_VLAN", "none"),
("OVS_ACTION_ATTR_POP_VLAN", "flag"),
- ("OVS_ACTION_ATTR_SAMPLE", "none"),
+ ("OVS_ACTION_ATTR_SAMPLE", "sample"),
("OVS_ACTION_ATTR_RECIRC", "uint32"),
("OVS_ACTION_ATTR_HASH", "none"),
("OVS_ACTION_ATTR_PUSH_MPLS", "none"),
("OVS_ACTION_ATTR_POP_MPLS", "flag"),
- ("OVS_ACTION_ATTR_SET_MASKED", "none"),
+ ("OVS_ACTION_ATTR_SET_MASKED", "ovskey"),
("OVS_ACTION_ATTR_CT", "ctact"),
("OVS_ACTION_ATTR_TRUNC", "uint32"),
("OVS_ACTION_ATTR_PUSH_ETH", "none"),
@@ -304,8 +391,85 @@ class ovsactions(nla):
("OVS_ACTION_ATTR_ADD_MPLS", "none"),
("OVS_ACTION_ATTR_DEC_TTL", "none"),
("OVS_ACTION_ATTR_DROP", "uint32"),
+ ("OVS_ACTION_ATTR_PSAMPLE", "psample"),
)
+ class psample(nla):
+ nla_flags = NLA_F_NESTED
+
+ nla_map = (
+ ("OVS_PSAMPLE_ATTR_UNSPEC", "none"),
+ ("OVS_PSAMPLE_ATTR_GROUP", "uint32"),
+ ("OVS_PSAMPLE_ATTR_COOKIE", "array(uint8)"),
+ )
+
+ def dpstr(self, more=False):
+ args = "group=%d" % self.get_attr("OVS_PSAMPLE_ATTR_GROUP")
+
+ cookie = self.get_attr("OVS_PSAMPLE_ATTR_COOKIE")
+ if cookie:
+ args += ",cookie(%s)" % \
+ "".join(format(x, "02x") for x in cookie)
+
+ return "psample(%s)" % args
+
+ def parse(self, actstr):
+ desc = (
+ ("group", "OVS_PSAMPLE_ATTR_GROUP", int),
+ ("cookie", "OVS_PSAMPLE_ATTR_COOKIE",
+ lambda x: list(bytearray.fromhex(x)))
+ )
+
+ attrs, actstr = parse_attrs(actstr, desc)
+
+ for attr in attrs:
+ self["attrs"].append(attr)
+
+ return actstr
+
+ class sample(nla):
+ nla_flags = NLA_F_NESTED
+
+ nla_map = (
+ ("OVS_SAMPLE_ATTR_UNSPEC", "none"),
+ ("OVS_SAMPLE_ATTR_PROBABILITY", "uint32"),
+ ("OVS_SAMPLE_ATTR_ACTIONS", "ovsactions"),
+ )
+
+ def dpstr(self, more=False):
+ args = []
+
+ args.append("sample={:.2f}%".format(
+ 100 * self.get_attr("OVS_SAMPLE_ATTR_PROBABILITY") /
+ UINT32_MAX))
+
+ actions = self.get_attr("OVS_SAMPLE_ATTR_ACTIONS")
+ if actions:
+ args.append("actions(%s)" % actions.dpstr(more))
+
+ return "sample(%s)" % ",".join(args)
+
+ def parse(self, actstr):
+ def parse_nested_actions(actstr):
+ subacts = ovsactions()
+ parsed_len = subacts.parse(actstr)
+ return subacts, actstr[parsed_len :]
+
+ def percent_to_rate(percent):
+ percent = float(percent.strip('%'))
+ return int(math.floor(UINT32_MAX * (percent / 100.0) + .5))
+
+ desc = (
+ ("sample", "OVS_SAMPLE_ATTR_PROBABILITY", percent_to_rate),
+ ("actions", "OVS_SAMPLE_ATTR_ACTIONS", parse_nested_actions),
+ )
+ attrs, actstr = parse_attrs(actstr, desc)
+
+ for attr in attrs:
+ self["attrs"].append(attr)
+
+ return actstr
+
class ctact(nla):
nla_flags = NLA_F_NESTED
@@ -427,50 +591,77 @@ class ovsactions(nla):
print_str += "userdata="
for f in self.get_attr("OVS_USERSPACE_ATTR_USERDATA"):
print_str += "%x." % f
- if self.get_attr("OVS_USERSPACE_ATTR_TUN_PORT") is not None:
+ if self.get_attr("OVS_USERSPACE_ATTR_EGRESS_TUN_PORT") is not None:
print_str += "egress_tun_port=%d" % self.get_attr(
- "OVS_USERSPACE_ATTR_TUN_PORT"
+ "OVS_USERSPACE_ATTR_EGRESS_TUN_PORT"
)
print_str += ")"
return print_str
+ def parse(self, actstr):
+ attrs_desc = (
+ ("pid", "OVS_USERSPACE_ATTR_PID", int),
+ ("userdata", "OVS_USERSPACE_ATTR_USERDATA",
+ lambda x: list(bytearray.fromhex(x))),
+ ("egress_tun_port", "OVS_USERSPACE_ATTR_EGRESS_TUN_PORT", int)
+ )
+
+ attrs, actstr = parse_attrs(actstr, attrs_desc)
+ for attr in attrs:
+ self["attrs"].append(attr)
+
+ return actstr
+
def dpstr(self, more=False):
print_str = ""
- for field in self.nla_map:
+ for field in self["attrs"]:
if field[1] == "none" or self.get_attr(field[0]) is None:
continue
if print_str != "":
print_str += ","
- if field[1] == "uint32":
- if field[0] == "OVS_ACTION_ATTR_OUTPUT":
- print_str += "%d" % int(self.get_attr(field[0]))
- elif field[0] == "OVS_ACTION_ATTR_RECIRC":
- print_str += "recirc(0x%x)" % int(self.get_attr(field[0]))
- elif field[0] == "OVS_ACTION_ATTR_TRUNC":
- print_str += "trunc(%d)" % int(self.get_attr(field[0]))
- elif field[0] == "OVS_ACTION_ATTR_DROP":
- print_str += "drop(%d)" % int(self.get_attr(field[0]))
- elif field[1] == "flag":
- if field[0] == "OVS_ACTION_ATTR_CT_CLEAR":
- print_str += "ct_clear"
- elif field[0] == "OVS_ACTION_ATTR_POP_VLAN":
- print_str += "pop_vlan"
- elif field[0] == "OVS_ACTION_ATTR_POP_ETH":
- print_str += "pop_eth"
- elif field[0] == "OVS_ACTION_ATTR_POP_NSH":
- print_str += "pop_nsh"
- elif field[0] == "OVS_ACTION_ATTR_POP_MPLS":
- print_str += "pop_mpls"
+ if field[0] == "OVS_ACTION_ATTR_OUTPUT":
+ print_str += "%d" % int(self.get_attr(field[0]))
+ elif field[0] == "OVS_ACTION_ATTR_RECIRC":
+ print_str += "recirc(0x%x)" % int(self.get_attr(field[0]))
+ elif field[0] == "OVS_ACTION_ATTR_TRUNC":
+ print_str += "trunc(%d)" % int(self.get_attr(field[0]))
+ elif field[0] == "OVS_ACTION_ATTR_DROP":
+ print_str += "drop(%d)" % int(self.get_attr(field[0]))
+ elif field[0] == "OVS_ACTION_ATTR_CT_CLEAR":
+ print_str += "ct_clear"
+ elif field[0] == "OVS_ACTION_ATTR_POP_VLAN":
+ print_str += "pop_vlan"
+ elif field[0] == "OVS_ACTION_ATTR_POP_ETH":
+ print_str += "pop_eth"
+ elif field[0] == "OVS_ACTION_ATTR_POP_NSH":
+ print_str += "pop_nsh"
+ elif field[0] == "OVS_ACTION_ATTR_POP_MPLS":
+ print_str += "pop_mpls"
else:
datum = self.get_attr(field[0])
if field[0] == "OVS_ACTION_ATTR_CLONE":
print_str += "clone("
print_str += datum.dpstr(more)
print_str += ")"
+ elif field[0] == "OVS_ACTION_ATTR_SET" or \
+ field[0] == "OVS_ACTION_ATTR_SET_MASKED":
+ print_str += "set"
+ field = datum
+ mask = None
+ if field[0] == "OVS_ACTION_ATTR_SET_MASKED":
+ print_str += "_masked"
+ field = datum[0]
+ mask = datum[1]
+ print_str += "("
+ print_str += field.dpstr(mask, more)
+ print_str += ")"
else:
- print_str += datum.dpstr(more)
+ try:
+ print_str += datum.dpstr(more)
+ except:
+ print_str += "{ATTR: %s not decoded}" % field[0]
return print_str
@@ -531,7 +722,7 @@ class ovsactions(nla):
for flat_act in parse_flat_map:
if parse_starts_block(actstr, flat_act[0], False):
actstr = actstr[len(flat_act[0]):]
- self["attrs"].append([flat_act[1]])
+ self["attrs"].append([flat_act[1], True])
actstr = actstr[strspn(actstr, ", ") :]
parsed = True
@@ -544,6 +735,25 @@ class ovsactions(nla):
self["attrs"].append(("OVS_ACTION_ATTR_CLONE", subacts))
actstr = actstr[parsedLen:]
parsed = True
+ elif parse_starts_block(actstr, "set(", False):
+ parencount += 1
+ k = ovskey()
+ actstr = actstr[len("set("):]
+ actstr = k.parse(actstr, None)
+ self["attrs"].append(("OVS_ACTION_ATTR_SET", k))
+ if not actstr.startswith(")"):
+ actstr = ")" + actstr
+ parsed = True
+ elif parse_starts_block(actstr, "set_masked(", False):
+ parencount += 1
+ k = ovskey()
+ m = ovskey()
+ actstr = actstr[len("set_masked("):]
+ actstr = k.parse(actstr, m)
+ self["attrs"].append(("OVS_ACTION_ATTR_SET_MASKED", [k, m]))
+ if not actstr.startswith(")"):
+ actstr = ")" + actstr
+ parsed = True
elif parse_starts_block(actstr, "ct(", False):
parencount += 1
actstr = actstr[len("ct(") :]
@@ -637,6 +847,37 @@ class ovsactions(nla):
self["attrs"].append(["OVS_ACTION_ATTR_CT", ctact])
parsed = True
+ elif parse_starts_block(actstr, "sample(", False):
+ sampleact = self.sample()
+ actstr = sampleact.parse(actstr[len("sample(") : ])
+ self["attrs"].append(["OVS_ACTION_ATTR_SAMPLE", sampleact])
+ parsed = True
+
+ elif parse_starts_block(actstr, "psample(", False):
+ psampleact = self.psample()
+ actstr = psampleact.parse(actstr[len("psample(") : ])
+ self["attrs"].append(["OVS_ACTION_ATTR_PSAMPLE", psampleact])
+ parsed = True
+
+ elif parse_starts_block(actstr, "userspace(", False):
+ uact = self.userspace()
+ actstr = uact.parse(actstr[len("userspace(") : ])
+ self["attrs"].append(["OVS_ACTION_ATTR_USERSPACE", uact])
+ parsed = True
+
+ elif parse_starts_block(actstr, "trunc(", False):
+ parencount += 1
+ actstr, val = parse_extract_field(
+ actstr,
+ "trunc(",
+ r"([0-9]+)",
+ int,
+ False,
+ None,
+ )
+ self["attrs"].append(["OVS_ACTION_ATTR_TRUNC", val])
+ parsed = True
+
actstr = actstr[strspn(actstr, ", ") :]
while parencount > 0:
parencount -= 1
@@ -675,7 +916,7 @@ class ovskey(nla):
("OVS_KEY_ATTR_ARP", "ovs_key_arp"),
("OVS_KEY_ATTR_ND", "ovs_key_nd"),
("OVS_KEY_ATTR_SKB_MARK", "uint32"),
- ("OVS_KEY_ATTR_TUNNEL", "none"),
+ ("OVS_KEY_ATTR_TUNNEL", "ovs_key_tunnel"),
("OVS_KEY_ATTR_SCTP", "ovs_key_sctp"),
("OVS_KEY_ATTR_TCP_FLAGS", "be16"),
("OVS_KEY_ATTR_DP_HASH", "uint32"),
@@ -907,21 +1148,21 @@ class ovskey(nla):
"src",
"src",
lambda x: str(ipaddress.IPv6Address(x)),
- lambda x: int.from_bytes(x, "big"),
- lambda x: ipaddress.IPv6Address(x),
+ lambda x: ipaddress.IPv6Address(x).packed if x else 0,
+ convert_ipv6,
),
(
"dst",
"dst",
lambda x: str(ipaddress.IPv6Address(x)),
- lambda x: int.from_bytes(x, "big"),
- lambda x: ipaddress.IPv6Address(x),
+ lambda x: ipaddress.IPv6Address(x).packed if x else 0,
+ convert_ipv6,
),
- ("label", "label", "%d", int),
- ("proto", "proto", "%d", int),
- ("tclass", "tclass", "%d", int),
- ("hlimit", "hlimit", "%d", int),
- ("frag", "frag", "%d", int),
+ ("label", "label", "%d", lambda x: int(x) if x else 0),
+ ("proto", "proto", "%d", lambda x: int(x) if x else 0),
+ ("tclass", "tclass", "%d", lambda x: int(x) if x else 0),
+ ("hlimit", "hlimit", "%d", lambda x: int(x) if x else 0),
+ ("frag", "frag", "%d", lambda x: int(x) if x else 0),
)
def __init__(
@@ -1119,7 +1360,7 @@ class ovskey(nla):
"target",
"target",
lambda x: str(ipaddress.IPv6Address(x)),
- lambda x: int.from_bytes(x, "big"),
+ convert_ipv6,
),
("sll", "sll", macstr, lambda x: int.from_bytes(x, "big")),
("tll", "tll", macstr, lambda x: int.from_bytes(x, "big")),
@@ -1204,13 +1445,13 @@ class ovskey(nla):
"src",
"src",
lambda x: str(ipaddress.IPv6Address(x)),
- lambda x: int.from_bytes(x, "big", convertmac),
+ convert_ipv6,
),
(
"dst",
"dst",
lambda x: str(ipaddress.IPv6Address(x)),
- lambda x: int.from_bytes(x, "big"),
+ convert_ipv6,
),
("tp_src", "tp_src", "%d", int),
("tp_dst", "tp_dst", "%d", int),
@@ -1235,6 +1476,163 @@ class ovskey(nla):
init=init,
)
+ class ovs_key_tunnel(nla):
+ nla_flags = NLA_F_NESTED
+
+ nla_map = (
+ ("OVS_TUNNEL_KEY_ATTR_ID", "be64"),
+ ("OVS_TUNNEL_KEY_ATTR_IPV4_SRC", "ipaddr"),
+ ("OVS_TUNNEL_KEY_ATTR_IPV4_DST", "ipaddr"),
+ ("OVS_TUNNEL_KEY_ATTR_TOS", "uint8"),
+ ("OVS_TUNNEL_KEY_ATTR_TTL", "uint8"),
+ ("OVS_TUNNEL_KEY_ATTR_DONT_FRAGMENT", "flag"),
+ ("OVS_TUNNEL_KEY_ATTR_CSUM", "flag"),
+ ("OVS_TUNNEL_KEY_ATTR_OAM", "flag"),
+ ("OVS_TUNNEL_KEY_ATTR_GENEVE_OPTS", "array(uint32)"),
+ ("OVS_TUNNEL_KEY_ATTR_TP_SRC", "be16"),
+ ("OVS_TUNNEL_KEY_ATTR_TP_DST", "be16"),
+ ("OVS_TUNNEL_KEY_ATTR_VXLAN_OPTS", "none"),
+ ("OVS_TUNNEL_KEY_ATTR_IPV6_SRC", "ipaddr"),
+ ("OVS_TUNNEL_KEY_ATTR_IPV6_DST", "ipaddr"),
+ ("OVS_TUNNEL_KEY_ATTR_PAD", "none"),
+ ("OVS_TUNNEL_KEY_ATTR_ERSPAN_OPTS", "none"),
+ ("OVS_TUNNEL_KEY_ATTR_IPV4_INFO_BRIDGE", "flag"),
+ )
+
+ def parse(self, flowstr, mask=None):
+ if not flowstr.startswith("tunnel("):
+ return None, None
+
+ k = ovskey.ovs_key_tunnel()
+ if mask is not None:
+ mask = ovskey.ovs_key_tunnel()
+
+ flowstr = flowstr[len("tunnel("):]
+
+ v6_address = None
+
+ fields = [
+ ("tun_id=", r"(\d+)", int, "OVS_TUNNEL_KEY_ATTR_ID",
+ 0xffffffffffffffff, None, None),
+
+ ("src=", r"([0-9a-fA-F\.]+)", str,
+ "OVS_TUNNEL_KEY_ATTR_IPV4_SRC", "255.255.255.255", "0.0.0.0",
+ False),
+ ("dst=", r"([0-9a-fA-F\.]+)", str,
+ "OVS_TUNNEL_KEY_ATTR_IPV4_DST", "255.255.255.255", "0.0.0.0",
+ False),
+
+ ("ipv6_src=", r"([0-9a-fA-F:]+)", str,
+ "OVS_TUNNEL_KEY_ATTR_IPV6_SRC",
+ "ffff:ffff:ffff:ffff:ffff:ffff:ffff:ffff", "::", True),
+ ("ipv6_dst=", r"([0-9a-fA-F:]+)", str,
+ "OVS_TUNNEL_KEY_ATTR_IPV6_DST",
+ "ffff:ffff:ffff:ffff:ffff:ffff:ffff:ffff", "::", True),
+
+ ("tos=", r"(\d+)", int, "OVS_TUNNEL_KEY_ATTR_TOS", 255, 0,
+ None),
+ ("ttl=", r"(\d+)", int, "OVS_TUNNEL_KEY_ATTR_TTL", 255, 0,
+ None),
+
+ ("tp_src=", r"(\d+)", int, "OVS_TUNNEL_KEY_ATTR_TP_SRC",
+ 65535, 0, None),
+ ("tp_dst=", r"(\d+)", int, "OVS_TUNNEL_KEY_ATTR_TP_DST",
+ 65535, 0, None),
+ ]
+
+ forced_include = ["OVS_TUNNEL_KEY_ATTR_TTL"]
+
+ for prefix, regex, typ, attr_name, mask_val, default_val, v46_flag in fields:
+ flowstr, value = parse_extract_field(flowstr, prefix, regex, typ, False)
+ if not attr_name:
+ raise Exception("Bad list value in tunnel fields")
+
+ if value is None and attr_name in forced_include:
+ value = default_val
+ mask_val = default_val
+
+ if value is not None:
+ if v46_flag is not None:
+ if v6_address is None:
+ v6_address = v46_flag
+ if v46_flag != v6_address:
+ raise ValueError("Cannot mix v6 and v4 addresses")
+ k["attrs"].append([attr_name, value])
+ if mask is not None:
+ mask["attrs"].append([attr_name, mask_val])
+ else:
+ if v46_flag is not None:
+ if v6_address is None or v46_flag != v6_address:
+ continue
+ if mask is not None:
+ mask["attrs"].append([attr_name, default_val])
+
+ if k["attrs"][0][0] != "OVS_TUNNEL_KEY_ATTR_ID":
+ raise ValueError("Needs a tunid set")
+
+ if flowstr.startswith("flags("):
+ flowstr = flowstr[len("flags("):]
+ flagspos = flowstr.find(")")
+ flags = flowstr[:flagspos]
+ flowstr = flowstr[flagspos + 1:]
+
+ flag_attrs = {
+ "df": "OVS_TUNNEL_KEY_ATTR_DONT_FRAGMENT",
+ "csum": "OVS_TUNNEL_KEY_ATTR_CSUM",
+ "oam": "OVS_TUNNEL_KEY_ATTR_OAM"
+ }
+
+ for flag in flags.split("|"):
+ if flag in flag_attrs:
+ k["attrs"].append([flag_attrs[flag], True])
+ if mask is not None:
+ mask["attrs"].append([flag_attrs[flag], True])
+
+ flowstr = flowstr[strspn(flowstr, ", ") :]
+ return flowstr, k, mask
+
+ def dpstr(self, mask=None, more=False):
+ print_str = "tunnel("
+
+ flagsattrs = []
+ for k in self["attrs"]:
+ noprint = False
+ if k[0] == "OVS_TUNNEL_KEY_ATTR_ID":
+ print_str += "tun_id=%d" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_IPV4_SRC":
+ print_str += "src=%s" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_IPV4_DST":
+ print_str += "dst=%s" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_IPV6_SRC":
+ print_str += "ipv6_src=%s" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_IPV6_DST":
+ print_str += "ipv6_dst=%s" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_TOS":
+ print_str += "tos=%d" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_TTL":
+ print_str += "ttl=%d" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_TP_SRC":
+ print_str += "tp_src=%d" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_TP_DST":
+ print_str += "tp_dst=%d" % k[1]
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_DONT_FRAGMENT":
+ noprint = True
+ flagsattrs.append("df")
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_CSUM":
+ noprint = True
+ flagsattrs.append("csum")
+ elif k[0] == "OVS_TUNNEL_KEY_ATTR_OAM":
+ noprint = True
+ flagsattrs.append("oam")
+
+ if not noprint:
+ print_str += ","
+
+ if len(flagsattrs):
+ print_str += "flags(" + "|".join(flagsattrs) + ")"
+ print_str += ")"
+ return print_str
+
class ovs_key_mpls(nla):
fields = (("lse", ">I"),)
@@ -1243,6 +1641,7 @@ class ovskey(nla):
("OVS_KEY_ATTR_PRIORITY", "skb_priority", intparse),
("OVS_KEY_ATTR_SKB_MARK", "skb_mark", intparse),
("OVS_KEY_ATTR_RECIRC_ID", "recirc_id", intparse),
+ ("OVS_KEY_ATTR_TUNNEL", "tunnel", ovskey.ovs_key_tunnel),
("OVS_KEY_ATTR_DP_HASH", "dp_hash", intparse),
("OVS_KEY_ATTR_CT_STATE", "ct_state", parse_ct_state),
("OVS_KEY_ATTR_CT_ZONE", "ct_zone", intparse),
@@ -1309,7 +1708,7 @@ class ovskey(nla):
mask["attrs"].append([field[0], m])
self["attrs"].append([field[0], k])
- flowstr = flowstr[strspn(flowstr, "),") :]
+ flowstr = flowstr[strspn(flowstr, "), ") :]
return flowstr
@@ -1346,6 +1745,13 @@ class ovskey(nla):
True,
),
(
+ "OVS_KEY_ATTR_TUNNEL",
+ "tunnel",
+ None,
+ False,
+ False,
+ ),
+ (
"OVS_KEY_ATTR_CT_STATE",
"ct_state",
"0x%04x",
@@ -1617,7 +2023,7 @@ class OvsVport(GenericNetlinkSocket):
("OVS_VPORT_ATTR_PORT_NO", "uint32"),
("OVS_VPORT_ATTR_TYPE", "uint32"),
("OVS_VPORT_ATTR_NAME", "asciiz"),
- ("OVS_VPORT_ATTR_OPTIONS", "none"),
+ ("OVS_VPORT_ATTR_OPTIONS", "vportopts"),
("OVS_VPORT_ATTR_UPCALL_PID", "array(uint32)"),
("OVS_VPORT_ATTR_STATS", "vportstats"),
("OVS_VPORT_ATTR_PAD", "none"),
@@ -1625,6 +2031,13 @@ class OvsVport(GenericNetlinkSocket):
("OVS_VPORT_ATTR_NETNSID", "uint32"),
)
+ class vportopts(nla):
+ nla_map = (
+ ("OVS_TUNNEL_ATTR_UNSPEC", "none"),
+ ("OVS_TUNNEL_ATTR_DST_PORT", "uint16"),
+ ("OVS_TUNNEL_ATTR_EXTENSION", "none"),
+ )
+
class vportstats(nla):
fields = (
("rx_packets", "=Q"),
@@ -1693,7 +2106,7 @@ class OvsVport(GenericNetlinkSocket):
raise ne
return reply
- def attach(self, dpindex, vport_ifname, ptype):
+ def attach(self, dpindex, vport_ifname, ptype, dport, lwt):
msg = OvsVport.ovs_vport_msg()
msg["cmd"] = OVS_VPORT_CMD_NEW
@@ -1702,12 +2115,43 @@ class OvsVport(GenericNetlinkSocket):
msg["dpifindex"] = dpindex
port_type = OvsVport.str_to_type(ptype)
- msg["attrs"].append(["OVS_VPORT_ATTR_TYPE", port_type])
msg["attrs"].append(["OVS_VPORT_ATTR_NAME", vport_ifname])
msg["attrs"].append(
["OVS_VPORT_ATTR_UPCALL_PID", [self.upcall_packet.epid]]
)
+ TUNNEL_DEFAULTS = [("geneve", 6081),
+ ("vxlan", 4789)]
+
+ for tnl in TUNNEL_DEFAULTS:
+ if ptype == tnl[0]:
+ if not dport:
+ dport = tnl[1]
+
+ if not lwt:
+ vportopt = OvsVport.ovs_vport_msg.vportopts()
+ vportopt["attrs"].append(
+ ["OVS_TUNNEL_ATTR_DST_PORT", socket.htons(dport)]
+ )
+ msg["attrs"].append(
+ ["OVS_VPORT_ATTR_OPTIONS", vportopt]
+ )
+ else:
+ port_type = OvsVport.OVS_VPORT_TYPE_NETDEV
+ ipr = pyroute2.iproute.IPRoute()
+
+ if tnl[0] == "geneve":
+ ipr.link("add", ifname=vport_ifname, kind=tnl[0],
+ geneve_port=dport,
+ geneve_collect_metadata=True,
+ geneve_udp_zero_csum6_rx=1)
+ elif tnl[0] == "vxlan":
+ ipr.link("add", ifname=vport_ifname, kind=tnl[0],
+ vxlan_learning=0, vxlan_collect_metadata=1,
+ vxlan_udp_zero_csum6_rx=1, vxlan_port=dport)
+ break
+ msg["attrs"].append(["OVS_VPORT_ATTR_TYPE", port_type])
+
try:
reply = self.nlm_request(
msg, msg_type=self.prid, msg_flags=NLM_F_REQUEST | NLM_F_ACK
@@ -2018,10 +2462,71 @@ class OvsFlow(GenericNetlinkSocket):
print("MISS upcall[%d/%s]: %s" % (seq, pktpres, keystr), flush=True)
def execute(self, packetmsg):
- print("userspace execute command")
+ print("userspace execute command", flush=True)
def action(self, packetmsg):
- print("userspace action command")
+ print("userspace action command", flush=True)
+
+
+class psample_sample(genlmsg):
+ nla_map = (
+ ("PSAMPLE_ATTR_IIFINDEX", "none"),
+ ("PSAMPLE_ATTR_OIFINDEX", "none"),
+ ("PSAMPLE_ATTR_ORIGSIZE", "none"),
+ ("PSAMPLE_ATTR_SAMPLE_GROUP", "uint32"),
+ ("PSAMPLE_ATTR_GROUP_SEQ", "none"),
+ ("PSAMPLE_ATTR_SAMPLE_RATE", "uint32"),
+ ("PSAMPLE_ATTR_DATA", "array(uint8)"),
+ ("PSAMPLE_ATTR_GROUP_REFCOUNT", "none"),
+ ("PSAMPLE_ATTR_TUNNEL", "none"),
+ ("PSAMPLE_ATTR_PAD", "none"),
+ ("PSAMPLE_ATTR_OUT_TC", "none"),
+ ("PSAMPLE_ATTR_OUT_TC_OCC", "none"),
+ ("PSAMPLE_ATTR_LATENCY", "none"),
+ ("PSAMPLE_ATTR_TIMESTAMP", "none"),
+ ("PSAMPLE_ATTR_PROTO", "none"),
+ ("PSAMPLE_ATTR_USER_COOKIE", "array(uint8)"),
+ )
+
+ def dpstr(self):
+ fields = []
+ data = ""
+ for (attr, value) in self["attrs"]:
+ if attr == "PSAMPLE_ATTR_SAMPLE_GROUP":
+ fields.append("group:%d" % value)
+ if attr == "PSAMPLE_ATTR_SAMPLE_RATE":
+ fields.append("rate:%d" % value)
+ if attr == "PSAMPLE_ATTR_USER_COOKIE":
+ value = "".join(format(x, "02x") for x in value)
+ fields.append("cookie:%s" % value)
+ if attr == "PSAMPLE_ATTR_DATA" and len(value) > 0:
+ data = "data:%s" % "".join(format(x, "02x") for x in value)
+
+ return ("%s %s" % (",".join(fields), data)).strip()
+
+
+class psample_msg(Marshal):
+ PSAMPLE_CMD_SAMPLE = 0
+ PSAMPLE_CMD_GET_GROUP = 1
+ PSAMPLE_CMD_NEW_GROUP = 2
+ PSAMPLE_CMD_DEL_GROUP = 3
+ PSAMPLE_CMD_SET_FILTER = 4
+ msg_map = {PSAMPLE_CMD_SAMPLE: psample_sample}
+
+
+class PsampleEvent(EventSocket):
+ genl_family = "psample"
+ mcast_groups = ["packets"]
+ marshal_class = psample_msg
+
+ def read_samples(self):
+ print("listening for psample events", flush=True)
+ while True:
+ try:
+ for msg in self.get():
+ print(msg.dpstr(), flush=True)
+ except NetlinkError as ne:
+ raise ne
def print_ovsdp_full(dp_lookup_rep, ifindex, ndb=NDB(), vpl=OvsVport()):
@@ -2053,12 +2558,19 @@ def print_ovsdp_full(dp_lookup_rep, ifindex, ndb=NDB(), vpl=OvsVport()):
for iface in ndb.interfaces:
rep = vpl.info(iface.ifname, ifindex)
if rep is not None:
+ opts = ""
+ vpo = rep.get_attr("OVS_VPORT_ATTR_OPTIONS")
+ if vpo:
+ dpo = vpo.get_attr("OVS_TUNNEL_ATTR_DST_PORT")
+ if dpo:
+ opts += " tnl-dport:%s" % socket.ntohs(dpo)
print(
- " port %d: %s (%s)"
+ " port %d: %s (%s%s)"
% (
rep.get_attr("OVS_VPORT_ATTR_PORT_NO"),
rep.get_attr("OVS_VPORT_ATTR_NAME"),
OvsVport.type_to_str(rep.get_attr("OVS_VPORT_ATTR_TYPE")),
+ opts,
)
)
@@ -2081,7 +2593,7 @@ def main(argv):
help="Increment 'verbose' output counter.",
default=0,
)
- subparsers = parser.add_subparsers()
+ subparsers = parser.add_subparsers(dest="subcommand")
showdpcmd = subparsers.add_parser("show")
showdpcmd.add_argument(
@@ -2120,12 +2632,30 @@ def main(argv):
"--ptype",
type=str,
default="netdev",
- choices=["netdev", "internal"],
+ choices=["netdev", "internal", "geneve", "vxlan"],
help="Interface type (default netdev)",
)
+ addifcmd.add_argument(
+ "-p",
+ "--dport",
+ type=int,
+ default=0,
+ help="Destination port (0 for default)"
+ )
+ addifcmd.add_argument(
+ "-l",
+ "--lwt",
+ type=bool,
+ default=True,
+ help="Use LWT infrastructure instead of vport (default true)."
+ )
delifcmd = subparsers.add_parser("del-if")
delifcmd.add_argument("dpname", help="Datapath Name")
delifcmd.add_argument("delif", help="Interface name for adding")
+ delifcmd.add_argument("-d",
+ "--dellink",
+ type=bool, default=False,
+ help="Delete the link as well.")
dumpflcmd = subparsers.add_parser("dump-flows")
dumpflcmd.add_argument("dumpdp", help="Datapath Name")
@@ -2138,6 +2668,8 @@ def main(argv):
delfscmd = subparsers.add_parser("del-flows")
delfscmd.add_argument("flsbr", help="Datapath name")
+ subparsers.add_parser("psample-events")
+
args = parser.parse_args()
if args.verbose > 0:
@@ -2152,6 +2684,9 @@ def main(argv):
sys.setrecursionlimit(100000)
+ if args.subcommand == "psample-events":
+ PsampleEvent().read_samples()
+
if hasattr(args, "showdp"):
found = False
for iface in ndb.interfaces:
@@ -2186,7 +2721,8 @@ def main(argv):
print("DP '%s' not found." % args.dpname)
return 1
dpindex = rep["dpifindex"]
- rep = ovsvp.attach(rep["dpifindex"], args.addif, args.ptype)
+ rep = ovsvp.attach(rep["dpifindex"], args.addif, args.ptype,
+ args.dport, args.lwt)
msg = "vport '%s'" % args.addif
if rep and rep["header"]["error"] is None:
msg += " added."
@@ -2207,6 +2743,9 @@ def main(argv):
msg += " removed."
else:
msg += " failed to remove."
+ if args.dellink:
+ ipr = pyroute2.iproute.IPRoute()
+ ipr.link("del", index=ipr.link_lookup(ifname=args.delif)[0])
elif hasattr(args, "dumpdp"):
rep = ovsdp.info(args.dumpdp, 0)
if rep is None:
diff --git a/tools/testing/selftests/net/openvswitch/settings b/tools/testing/selftests/net/openvswitch/settings
new file mode 100644
index 000000000000..e2206265f67c
--- /dev/null
+++ b/tools/testing/selftests/net/openvswitch/settings
@@ -0,0 +1 @@
+timeout=900
diff --git a/tools/testing/selftests/net/pmtu.sh b/tools/testing/selftests/net/pmtu.sh
index cfc84958025a..5175c0c83a23 100755
--- a/tools/testing/selftests/net/pmtu.sh
+++ b/tools/testing/selftests/net/pmtu.sh
@@ -842,25 +842,97 @@ setup_bridge() {
run_cmd ${ns_a} ip link set veth_A-C master br0
}
+setup_ovs_via_internal_utility() {
+ type="${1}"
+ a_addr="${2}"
+ b_addr="${3}"
+ dport="${4}"
+
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-if ovs_br0 ${type}_a -t ${type} || return 1
+
+ ports=$(python3 ./openvswitch/ovs-dpctl.py show)
+ br0_port=$(echo "$ports" | grep -E "\sovs_br0" | sed -e 's@port @@' | cut -d: -f1 | xargs)
+ type_a_port=$(echo "$ports" | grep ${type}_a | sed -e 's@port @@' | cut -d: -f1 | xargs)
+ veth_a_port=$(echo "$ports" | grep veth_A | sed -e 's@port @@' | cut -d: -f1 | xargs)
+
+ v4_a_tun="${prefix4}.${a_r1}.1"
+ v4_b_tun="${prefix4}.${b_r1}.1"
+
+ v6_a_tun="${prefix6}:${a_r1}::1"
+ v6_b_tun="${prefix6}:${b_r1}::1"
+
+ if [ "${v4_a_tun}" = "${a_addr}" ]; then
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x0800),ipv4()" \
+ "set(tunnel(tun_id=1,dst=${v4_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x86dd),ipv6()" \
+ "set(tunnel(tun_id=1,dst=${v4_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,src=${v4_b_tun},dst=${v4_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x0800),ipv4()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,src=${v4_b_tun},dst=${v4_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x86dd),ipv6()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,src=${v4_b_tun},dst=${v4_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x0806),arp()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x0806),arp(sip=${veth4_c_addr},tip=${tunnel4_b_addr})" \
+ "set(tunnel(tun_id=1,dst=${v4_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ else
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x0800),ipv4()" \
+ "set(tunnel(tun_id=1,ipv6_dst=${v6_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x86dd),ipv6()" \
+ "set(tunnel(tun_id=1,ipv6_dst=${v6_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,ipv6_src=${v6_b_tun},ipv6_dst=${v6_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x0800),ipv4()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,ipv6_src=${v6_b_tun},ipv6_dst=${v6_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x86dd),ipv6()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),tunnel(tun_id=1,ipv6_src=${v6_b_tun},ipv6_dst=${v6_a_tun}),in_port(${type_a_port}),eth(),eth_type(0x0806),arp()" \
+ "${veth_a_port}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-flow ovs_br0 \
+ "recirc_id(0),in_port(${veth_a_port}),eth(),eth_type(0x0806),arp(sip=${veth4_c_addr},tip=${tunnel4_b_addr})" \
+ "set(tunnel(tun_id=1,ipv6_dst=${v6_b_tun},ttl=64,tp_dst=${dport},flags(df|csum))),${type_a_port}"
+ fi
+}
+
+setup_ovs_via_vswitchd() {
+ type="${1}"
+ b_addr="${2}"
+
+ run_cmd ovs-vsctl add-port ovs_br0 ${type}_a -- \
+ set interface ${type}_a type=${type} \
+ options:remote_ip=${b_addr} options:key=1 options:csum=true || return 1
+}
+
setup_ovs_vxlan_or_geneve() {
type="${1}"
a_addr="${2}"
b_addr="${3}"
+ dport="6081"
if [ "${type}" = "vxlan" ]; then
+ dport="4789"
opts="${opts} ttl 64 dstport 4789"
opts_b="local ${b_addr}"
fi
- run_cmd ovs-vsctl add-port ovs_br0 ${type}_a -- \
- set interface ${type}_a type=${type} \
- options:remote_ip=${b_addr} options:key=1 options:csum=true || return 1
+ setup_ovs_via_internal_utility "${type}" "${a_addr}" "${b_addr}" \
+ "${dport}" || \
+ setup_ovs_via_vswitchd "${type}" "${b_addr}" || return 1
run_cmd ${ns_b} ip link add ${type}_b type ${type} id 1 ${opts_b} remote ${a_addr} ${opts} || return 1
run_cmd ${ns_b} ip addr add ${tunnel4_b_addr}/${tunnel4_mask} dev ${type}_b
run_cmd ${ns_b} ip addr add ${tunnel6_b_addr}/${tunnel6_mask} dev ${type}_b
+ run_cmd ip link set ${type}_a up
run_cmd ${ns_b} ip link set ${type}_b up
}
@@ -880,8 +952,24 @@ setup_ovs_vxlan6() {
setup_ovs_vxlan_or_geneve vxlan ${prefix6}:${a_r1}::1 ${prefix6}:${b_r1}::1
}
+setup_ovs_br_internal() {
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-dp ovs_br0 || \
+ return 1
+}
+
+setup_ovs_br_vswitchd() {
+ run_cmd ovs-vsctl add-br ovs_br0 || return 1
+}
+
+setup_ovs_add_if() {
+ ifname="${1}"
+ run_cmd python3 ./openvswitch/ovs-dpctl.py add-if ovs_br0 \
+ "${ifname}" || \
+ run_cmd ovs-vsctl add-port ovs_br0 "${ifname}"
+}
+
setup_ovs_bridge() {
- run_cmd ovs-vsctl add-br ovs_br0 || return $ksft_skip
+ setup_ovs_br_internal || setup_ovs_br_vswitchd || return $ksft_skip
run_cmd ip link set ovs_br0 up
run_cmd ${ns_c} ip link add veth_C-A type veth peer name veth_A-C
@@ -891,7 +979,7 @@ setup_ovs_bridge() {
run_cmd ${ns_c} ip link set veth_C-A up
run_cmd ${ns_c} ip addr add ${veth4_c_addr}/${veth4_mask} dev veth_C-A
run_cmd ${ns_c} ip addr add ${veth6_c_addr}/${veth6_mask} dev veth_C-A
- run_cmd ovs-vsctl add-port ovs_br0 veth_A-C
+ setup_ovs_add_if veth_A-C
# Move veth_A-R1 to init
run_cmd ${ns_a} ip link set veth_A-R1 netns 1
@@ -922,6 +1010,18 @@ trace() {
sleep 1
}
+cleanup_del_ovs_internal() {
+ # squelch the output of the del-if commands since it can be wordy
+ python3 ./openvswitch/ovs-dpctl.py del-if ovs_br0 -d true vxlan_a >/dev/null 2>&1
+ python3 ./openvswitch/ovs-dpctl.py del-if ovs_br0 -d true geneve_a >/dev/null 2>&1
+ python3 ./openvswitch/ovs-dpctl.py del-dp ovs_br0 >/dev/null 2>&1
+}
+
+cleanup_del_ovs_vswitchd() {
+ ovs-vsctl --if-exists del-port vxlan_a 2>/dev/null
+ ovs-vsctl --if-exists del-br ovs_br0 2>/dev/null
+}
+
cleanup() {
for pid in ${tcpdump_pids}; do
kill ${pid}
@@ -940,10 +1040,10 @@ cleanup() {
cleanup_all_ns
- ip link del veth_A-C 2>/dev/null
- ip link del veth_A-R1 2>/dev/null
- ovs-vsctl --if-exists del-port vxlan_a 2>/dev/null
- ovs-vsctl --if-exists del-br ovs_br0 2>/dev/null
+ ip link del veth_A-C 2>/dev/null
+ ip link del veth_A-R1 2>/dev/null
+ cleanup_del_ovs_internal
+ cleanup_del_ovs_vswitchd
rm -f "$tmpoutfile"
}
@@ -1397,6 +1497,12 @@ test_pmtu_ipvX_over_ovs_vxlanY_or_geneveY_exception() {
outer_family=${3}
ll_mtu=4000
+ if [ "${type}" = "vxlan" ]; then
+ tun_a="vxlan_sys_4789"
+ elif [ "${type}" = "geneve" ]; then
+ tun_a="genev_sys_6081"
+ fi
+
if [ ${outer_family} -eq 4 ]; then
setup namespaces routing ovs_bridge ovs_${type}4 || return $ksft_skip
# IPv4 header UDP header VXLAN/GENEVE header Ethernet header
@@ -1407,17 +1513,11 @@ test_pmtu_ipvX_over_ovs_vxlanY_or_geneveY_exception() {
exp_mtu=$((${ll_mtu} - 40 - 8 - 8 - 14))
fi
- if [ "${type}" = "vxlan" ]; then
- tun_a="vxlan_sys_4789"
- elif [ "${type}" = "geneve" ]; then
- tun_a="genev_sys_6081"
- fi
-
- trace "" "${tun_a}" "${ns_b}" ${type}_b \
- "" veth_A-R1 "${ns_r1}" veth_R1-A \
- "${ns_b}" veth_B-R1 "${ns_r1}" veth_R1-B \
- "" ovs_br0 "" veth-A-C \
- "${ns_c}" veth_C-A
+ trace "" ${type}_a "${ns_b}" ${type}_b \
+ "" veth_A-R1 "${ns_r1}" veth_R1-A \
+ "${ns_b}" veth_B-R1 "${ns_r1}" veth_R1-B \
+ "" ovs_br0 "" veth-A_C \
+ "${ns_c}" veth_C-A "" "${tun_a}"
if [ ${family} -eq 4 ]; then
ping=ping
@@ -1436,8 +1536,9 @@ test_pmtu_ipvX_over_ovs_vxlanY_or_geneveY_exception() {
mtu "${ns_b}" veth_B-R1 ${ll_mtu}
mtu "${ns_r1}" veth_R1-B ${ll_mtu}
- mtu "" ${tun_a} $((${ll_mtu} + 1000))
- mtu "${ns_b}" ${type}_b $((${ll_mtu} + 1000))
+ mtu "" ${tun_a} $((${ll_mtu} + 1000)) 2>/dev/null || \
+ mtu "" ${type}_a $((${ll_mtu} + 1000)) 2>/dev/null
+ mtu "${ns_b}" ${type}_b $((${ll_mtu} + 1000))
run_cmd ${ns_c} ${ping} -q -M want -i 0.1 -c 20 -s $((${ll_mtu} + 500)) ${dst} || return 1
diff --git a/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh b/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh
new file mode 100755
index 000000000000..e23210aa547f
--- /dev/null
+++ b/tools/testing/selftests/net/srv6_end_dx4_netfilter_test.sh
@@ -0,0 +1,335 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# author: Jianguo Wu <wujianguo@chinatelecom.cn>
+#
+# Mostly copied from tools/testing/selftests/net/srv6_end_dt4_l3vpn_test.sh.
+#
+# This script is designed for testing the support of netfilter hooks for
+# SRv6 End.DX4 behavior.
+#
+# Hereafter a network diagram is shown, where one tenants (named 100) offer
+# IPv4 L3 VPN services allowing hosts to communicate with each other across
+# an IPv6 network.
+#
+# Routers rt-1 and rt-2 implement IPv4 L3 VPN services leveraging the SRv6
+# architecture. The key components for such VPNs are: a) SRv6 Encap behavior,
+# b) SRv6 End.DX4 behavior.
+#
+# To explain how an IPv4 L3 VPN based on SRv6 works, let us briefly consider an
+# example where, within the same domain of tenant 100, the host hs-1 pings
+# the host hs-2.
+#
+# First of all, L2 reachability of the host hs-2 is taken into account by
+# the router rt-1 which acts as an arp proxy.
+#
+# When the host hs-1 sends an IPv4 packet destined to hs-2, the router rt-1
+# receives the packet on the internal veth-t100 interface, rt-1 contains the
+# SRv6 Encap route for encapsulating the IPv4 packet in a IPv6 plus the Segment
+# Routing Header (SRH) packet. This packet is sent through the (IPv6) core
+# network up to the router rt-2 that receives it on veth0 interface.
+#
+# The rt-2 router uses the 'localsid' routing table to process incoming
+# IPv6+SRH packets which belong to the VPN of the tenant 100. For each of these
+# packets, the SRv6 End.DX4 behavior removes the outer IPv6+SRH headers and
+# routs the packet to the specified nexthop. Afterwards, the packet is sent to
+# the host hs-2 through the veth-t100 interface.
+#
+# The ping response follows the same processing but this time the role of rt-1
+# and rt-2 are swapped.
+#
+# And when net.netfilter.nf_hooks_lwtunnel is set to 1 in rt-1 or rt-2, and a
+# rpfilter iptables rule is added, SRv6 packets will go through netfilter PREROUTING
+# hooks.
+#
+#
+# +-------------------+ +-------------------+
+# | | | |
+# | hs-1 netns | | hs-2 netns |
+# | | | |
+# | +-------------+ | | +-------------+ |
+# | | veth0 | | | | veth0 | |
+# | | 10.0.0.1/24 | | | | 10.0.0.2/24 | |
+# | +-------------+ | | +-------------+ |
+# | . | | . |
+# +-------------------+ +-------------------+
+# . .
+# . .
+# . .
+# +-----------------------------------+ +-----------------------------------+
+# | . | | . |
+# | +---------------+ | | +---------------- |
+# | | veth-t100 | | | | veth-t100 | |
+# | | 10.0.0.11/24 | +----------+ | | +----------+ | 10.0.0.22/24 | |
+# | +-------+-------+ | route | | | | route | +-------+-------- |
+# | | table | | | | table | |
+# | +----------+ | | +----------+ |
+# | +--------------+ | | +--------------+ |
+# | | veth0 | | | | veth0 | |
+# | | 2001:11::1/64 |.|...|.| 2001:11::2/64 | |
+# | +--------------+ | | +--------------+ |
+# | | | |
+# | rt-1 netns | | rt-2 netns |
+# | | | |
+# +-----------------------------------+ +-----------------------------------+
+#
+# ~~~~~~~~~~~~~~~~~~~~~~~~~
+# | Network configuration |
+# ~~~~~~~~~~~~~~~~~~~~~~~~~
+#
+# rt-1: localsid table
+# +----------------------------------------------------------------+
+# |SID |Action |
+# +----------------------------------------------------------------+
+# |fc00:21:100::6004|apply SRv6 End.DX4 nh4 10.0.0.1 dev veth-t100 |
+# +----------------------------------------------------------------+
+#
+# rt-1: route table
+# +---------------------------------------------------+
+# |host |Action |
+# +---------------------------------------------------+
+# |10.0.0.2 |apply seg6 encap segs fc00:12:100::6004|
+# +---------------------------------------------------+
+# |10.0.0.0/24|forward to dev veth_t100 |
+# +---------------------------------------------------+
+#
+#
+# rt-2: localsid table
+# +---------------------------------------------------------------+
+# |SID |Action |
+# +---------------------------------------------------------------+
+# |fc00:12:100::6004|apply SRv6 End.DX4 nh4 10.0.0.2 dev veth-t100|
+# +---------------------------------------------------------------+
+#
+# rt-2: route table
+# +---------------------------------------------------+
+# |host |Action |
+# +---------------------------------------------------+
+# |10.0.0.1 |apply seg6 encap segs fc00:21:100::6004|
+# +---------------------------------------------------+
+# |10.0.0.0/24|forward to dev veth_t100 |
+# +---------------------------------------------------+
+#
+
+# Kselftest framework requirement - SKIP code is 4.
+ksft_skip=4
+
+readonly IPv6_RT_NETWORK=2001:11
+readonly IPv4_HS_NETWORK=10.0.0
+readonly SID_LOCATOR=fc00
+
+PING_TIMEOUT_SEC=4
+
+ret=0
+
+PAUSE_ON_FAIL=${PAUSE_ON_FAIL:=no}
+
+log_test()
+{
+ local rc=$1
+ local expected=$2
+ local msg="$3"
+
+ if [ ${rc} -eq ${expected} ]; then
+ nsuccess=$((nsuccess+1))
+ printf "\n TEST: %-60s [ OK ]\n" "${msg}"
+ else
+ ret=1
+ nfail=$((nfail+1))
+ printf "\n TEST: %-60s [FAIL]\n" "${msg}"
+ if [ "${PAUSE_ON_FAIL}" = "yes" ]; then
+ echo
+ echo "hit enter to continue, 'q' to quit"
+ read a
+ [ "$a" = "q" ] && exit 1
+ fi
+ fi
+}
+
+print_log_test_results()
+{
+ if [ "$TESTS" != "none" ]; then
+ printf "\nTests passed: %3d\n" ${nsuccess}
+ printf "Tests failed: %3d\n" ${nfail}
+ fi
+}
+
+log_section()
+{
+ echo
+ echo "################################################################################"
+ echo "TEST SECTION: $*"
+ echo "################################################################################"
+}
+
+cleanup()
+{
+ ip link del veth-rt-1 2>/dev/null || true
+ ip link del veth-rt-2 2>/dev/null || true
+
+ # destroy routers rt-* and hosts hs-*
+ for ns in $(ip netns show | grep -E 'rt-*|hs-*'); do
+ ip netns del ${ns} || true
+ done
+}
+
+# Setup the basic networking for the routers
+setup_rt_networking()
+{
+ local rt=$1
+ local nsname=rt-${rt}
+
+ ip netns add ${nsname}
+
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.accept_dad=0
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.default.accept_dad=0
+
+ ip link set veth-rt-${rt} netns ${nsname}
+ ip -netns ${nsname} link set veth-rt-${rt} name veth0
+
+ ip -netns ${nsname} addr add ${IPv6_RT_NETWORK}::${rt}/64 dev veth0 nodad
+ ip -netns ${nsname} link set veth0 up
+ ip -netns ${nsname} link set lo up
+
+ ip netns exec ${nsname} sysctl -wq net.ipv4.ip_forward=1
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.forwarding=1
+}
+
+setup_rt_netfilter()
+{
+ local rt=$1
+ local nsname=rt-${rt}
+
+ ip netns exec ${nsname} sysctl -wq net.netfilter.nf_hooks_lwtunnel=1
+ ip netns exec ${nsname} iptables -t raw -A PREROUTING -m rpfilter --invert -j DROP
+}
+
+setup_hs()
+{
+ local hs=$1
+ local rt=$2
+ local tid=$3
+ local hsname=hs-${hs}
+ local rtname=rt-${rt}
+ local rtveth=veth-t${tid}
+
+ # set the networking for the host
+ ip netns add ${hsname}
+
+ ip -netns ${hsname} link add veth0 type veth peer name ${rtveth}
+ ip -netns ${hsname} link set ${rtveth} netns ${rtname}
+ ip -netns ${hsname} addr add ${IPv4_HS_NETWORK}.${hs}/24 dev veth0
+ ip -netns ${hsname} link set veth0 up
+ ip -netns ${hsname} link set lo up
+
+ ip -netns ${rtname} addr add ${IPv4_HS_NETWORK}.${rt}${hs}/24 dev ${rtveth}
+ ip -netns ${rtname} link set ${rtveth} up
+
+ ip netns exec ${rtname} sysctl -wq net.ipv4.conf.${rtveth}.proxy_arp=1
+}
+
+setup_vpn_config()
+{
+ local hssrc=$1
+ local rtsrc=$2
+ local hsdst=$3
+ local rtdst=$4
+ local tid=$5
+
+ local hssrc_name=hs-t${tid}-${hssrc}
+ local hsdst_name=hs-t${tid}-${hsdst}
+ local rtsrc_name=rt-${rtsrc}
+ local rtdst_name=rt-${rtdst}
+ local vpn_sid=${SID_LOCATOR}:${hssrc}${hsdst}:${tid}::6004
+
+ # set the encap route for encapsulating packets which arrive from the
+ # host hssrc and destined to the access router rtsrc.
+ ip -netns ${rtsrc_name} -4 route add ${IPv4_HS_NETWORK}.${hsdst}/32 \
+ encap seg6 mode encap segs ${vpn_sid} dev veth0
+ ip -netns ${rtsrc_name} -6 route add ${vpn_sid}/128 \
+ via 2001:11::${rtdst} dev veth0
+
+ # set the decap route for decapsulating packets which arrive from
+ # the rtdst router and destined to the hsdst host.
+ ip -netns ${rtdst_name} -6 route add ${vpn_sid}/128 \
+ encap seg6local action End.DX4 nh4 ${IPv4_HS_NETWORK}.${hsdst} dev veth-t${tid}
+}
+
+setup()
+{
+ ip link add veth-rt-1 type veth peer name veth-rt-2
+ # setup the networking for router rt-1 and router rt-2
+ setup_rt_networking 1
+ setup_rt_networking 2
+
+ # setup two hosts for the tenant 100.
+ # - host hs-1 is directly connected to the router rt-1;
+ # - host hs-2 is directly connected to the router rt-2.
+ setup_hs 1 1 100
+ setup_hs 2 2 100
+
+ # setup the IPv4 L3 VPN which connects the host hs-1 and host hs-2.
+ setup_vpn_config 1 1 2 2 100 #args: src_host src_router dst_host dst_router tenant
+ setup_vpn_config 2 2 1 1 100
+}
+
+check_hs_connectivity()
+{
+ local hssrc=$1
+ local hsdst=$2
+ local tid=$3
+
+ ip netns exec hs-${hssrc} ping -c 1 -W ${PING_TIMEOUT_SEC} \
+ ${IPv4_HS_NETWORK}.${hsdst} >/dev/null 2>&1
+}
+
+check_and_log_hs_connectivity()
+{
+ local hssrc=$1
+ local hsdst=$2
+ local tid=$3
+
+ check_hs_connectivity ${hssrc} ${hsdst} ${tid}
+ log_test $? 0 "Hosts connectivity: hs-${hssrc} -> hs-${hsdst} (tenant ${tid})"
+}
+
+host_tests()
+{
+ log_section "SRv6 VPN connectivity test among hosts in the same tenant"
+
+ check_and_log_hs_connectivity 1 2 100
+ check_and_log_hs_connectivity 2 1 100
+}
+
+router_netfilter_tests()
+{
+ log_section "SRv6 VPN connectivity test with netfilter enabled in routers"
+ setup_rt_netfilter 1
+ setup_rt_netfilter 2
+
+ check_and_log_hs_connectivity 1 2 100
+ check_and_log_hs_connectivity 2 1 100
+}
+
+if [ "$(id -u)" -ne 0 ];then
+ echo "SKIP: Need root privileges"
+ exit $ksft_skip
+fi
+
+if [ ! -x "$(command -v ip)" ]; then
+ echo "SKIP: Could not run test without ip tool"
+ exit $ksft_skip
+fi
+
+cleanup &>/dev/null
+
+setup
+
+host_tests
+router_netfilter_tests
+
+print_log_test_results
+
+cleanup &>/dev/null
+
+exit ${ret}
diff --git a/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh b/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh
new file mode 100755
index 000000000000..9e69a2ed5bc3
--- /dev/null
+++ b/tools/testing/selftests/net/srv6_end_dx6_netfilter_test.sh
@@ -0,0 +1,340 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# author: Jianguo Wu <wujianguo@chinatelecom.cn>
+#
+# Mostly copied from tools/testing/selftests/net/srv6_end_dt6_l3vpn_test.sh.
+#
+# This script is designed for testing the support of netfilter hooks for
+# SRv6 End.DX4 behavior.
+#
+# Hereafter a network diagram is shown, where one tenants (named 100) offer
+# IPv6 L3 VPN services allowing hosts to communicate with each other across
+# an IPv6 network.
+#
+# Routers rt-1 and rt-2 implement IPv6 L3 VPN services leveraging the SRv6
+# architecture. The key components for such VPNs are: a) SRv6 Encap behavior,
+# b) SRv6 End.DX4 behavior.
+#
+# To explain how an IPv6 L3 VPN based on SRv6 works, let us briefly consider an
+# example where, within the same domain of tenant 100, the host hs-1 pings
+# the host hs-2.
+#
+# First of all, L2 reachability of the host hs-2 is taken into account by
+# the router rt-1 which acts as an arp proxy.
+#
+# When the host hs-1 sends an IPv6 packet destined to hs-2, the router rt-1
+# receives the packet on the internal veth-t100 interface, rt-1 contains the
+# SRv6 Encap route for encapsulating the IPv6 packet in a IPv6 plus the Segment
+# Routing Header (SRH) packet. This packet is sent through the (IPv6) core
+# network up to the router rt-2 that receives it on veth0 interface.
+#
+# The rt-2 router uses the 'localsid' routing table to process incoming
+# IPv6+SRH packets which belong to the VPN of the tenant 100. For each of these
+# packets, the SRv6 End.DX4 behavior removes the outer IPv6+SRH headers and
+# routs the packet to the specified nexthop. Afterwards, the packet is sent to
+# the host hs-2 through the veth-t100 interface.
+#
+# The ping response follows the same processing but this time the role of rt-1
+# and rt-2 are swapped.
+#
+# And when net.netfilter.nf_hooks_lwtunnel is set to 1 in rt-1 or rt-2, and a
+# rpfilter iptables rule is added, SRv6 packets will go through netfilter PREROUTING
+# hooks.
+#
+#
+# +-------------------+ +-------------------+
+# | | | |
+# | hs-1 netns | | hs-2 netns |
+# | | | |
+# | +-------------+ | | +-------------+ |
+# | | veth0 | | | | veth0 | |
+# | | cafe::1/64 | | | | cafe::2/64 | |
+# | +-------------+ | | +-------------+ |
+# | . | | . |
+# +-------------------+ +-------------------+
+# . .
+# . .
+# . .
+# +-----------------------------------+ +-----------------------------------+
+# | . | | . |
+# | +---------------+ | | +---------------- |
+# | | veth-t100 | | | | veth-t100 | |
+# | | cafe::11/64 | +----------+ | | +----------+ | cafe::22/64 | |
+# | +-------+-------+ | route | | | | route | +-------+-------- |
+# | | table | | | | table | |
+# | +----------+ | | +----------+ |
+# | +--------------+ | | +--------------+ |
+# | | veth0 | | | | veth0 | |
+# | | 2001:11::1/64 |.|...|.| 2001:11::2/64 | |
+# | +--------------+ | | +--------------+ |
+# | | | |
+# | rt-1 netns | | rt-2 netns |
+# | | | |
+# +-----------------------------------+ +-----------------------------------+
+#
+# ~~~~~~~~~~~~~~~~~~~~~~~~~
+# | Network configuration |
+# ~~~~~~~~~~~~~~~~~~~~~~~~~
+#
+# rt-1: localsid table
+# +----------------------------------------------------------------+
+# |SID |Action |
+# +----------------------------------------------------------------+
+# |fc00:21:100::6004|apply SRv6 End.DX6 nh6 cafe::1 dev veth-t100 |
+# +----------------------------------------------------------------+
+#
+# rt-1: route table
+# +---------------------------------------------------+
+# |host |Action |
+# +---------------------------------------------------+
+# |cafe::2 |apply seg6 encap segs fc00:12:100::6004|
+# +---------------------------------------------------+
+# |cafe::/64 |forward to dev veth_t100 |
+# +---------------------------------------------------+
+#
+#
+# rt-2: localsid table
+# +---------------------------------------------------------------+
+# |SID |Action |
+# +---------------------------------------------------------------+
+# |fc00:12:100::6004|apply SRv6 End.DX6 nh6 cafe::2 dev veth-t100 |
+# +---------------------------------------------------------------+
+#
+# rt-2: route table
+# +---------------------------------------------------+
+# |host |Action |
+# +---------------------------------------------------+
+# |cafe::1 |apply seg6 encap segs fc00:21:100::6004|
+# +---------------------------------------------------+
+# |cafe::/64 |forward to dev veth_t100 |
+# +---------------------------------------------------+
+#
+
+# Kselftest framework requirement - SKIP code is 4.
+ksft_skip=4
+
+readonly IPv6_RT_NETWORK=2001:11
+readonly IPv6_HS_NETWORK=cafe
+readonly SID_LOCATOR=fc00
+
+PING_TIMEOUT_SEC=4
+
+ret=0
+
+PAUSE_ON_FAIL=${PAUSE_ON_FAIL:=no}
+
+log_test()
+{
+ local rc=$1
+ local expected=$2
+ local msg="$3"
+
+ if [ ${rc} -eq ${expected} ]; then
+ nsuccess=$((nsuccess+1))
+ printf "\n TEST: %-60s [ OK ]\n" "${msg}"
+ else
+ ret=1
+ nfail=$((nfail+1))
+ printf "\n TEST: %-60s [FAIL]\n" "${msg}"
+ if [ "${PAUSE_ON_FAIL}" = "yes" ]; then
+ echo
+ echo "hit enter to continue, 'q' to quit"
+ read a
+ [ "$a" = "q" ] && exit 1
+ fi
+ fi
+}
+
+print_log_test_results()
+{
+ if [ "$TESTS" != "none" ]; then
+ printf "\nTests passed: %3d\n" ${nsuccess}
+ printf "Tests failed: %3d\n" ${nfail}
+ fi
+}
+
+log_section()
+{
+ echo
+ echo "################################################################################"
+ echo "TEST SECTION: $*"
+ echo "################################################################################"
+}
+
+cleanup()
+{
+ ip link del veth-rt-1 2>/dev/null || true
+ ip link del veth-rt-2 2>/dev/null || true
+
+ # destroy routers rt-* and hosts hs-*
+ for ns in $(ip netns show | grep -E 'rt-*|hs-*'); do
+ ip netns del ${ns} || true
+ done
+}
+
+# Setup the basic networking for the routers
+setup_rt_networking()
+{
+ local rt=$1
+ local nsname=rt-${rt}
+
+ ip netns add ${nsname}
+
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.accept_dad=0
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.default.accept_dad=0
+
+ ip link set veth-rt-${rt} netns ${nsname}
+ ip -netns ${nsname} link set veth-rt-${rt} name veth0
+
+ ip -netns ${nsname} addr add ${IPv6_RT_NETWORK}::${rt}/64 dev veth0 nodad
+ ip -netns ${nsname} link set veth0 up
+ ip -netns ${nsname} link set lo up
+
+ ip netns exec ${nsname} sysctl -wq net.ipv6.conf.all.forwarding=1
+}
+
+setup_rt_netfilter()
+{
+ local rt=$1
+ local nsname=rt-${rt}
+
+ ip netns exec ${nsname} sysctl -wq net.netfilter.nf_hooks_lwtunnel=1
+ ip netns exec ${nsname} ip6tables -t raw -A PREROUTING -m rpfilter --invert -j DROP
+}
+
+setup_hs()
+{
+ local hs=$1
+ local rt=$2
+ local tid=$3
+ local hsname=hs-${hs}
+ local rtname=rt-${rt}
+ local rtveth=veth-t${tid}
+
+ # set the networking for the host
+ ip netns add ${hsname}
+
+ ip -netns ${hsname} link add veth0 type veth peer name ${rtveth}
+ ip -netns ${hsname} link set ${rtveth} netns ${rtname}
+ ip -netns ${hsname} addr add ${IPv6_HS_NETWORK}::${hs}/64 dev veth0 nodad
+ ip -netns ${hsname} link set veth0 up
+ ip -netns ${hsname} link set lo up
+
+ ip -netns ${rtname} addr add ${IPv6_HS_NETWORK}::${rt}${hs}/64 dev ${rtveth}
+ ip -netns ${rtname} link set ${rtveth} up
+
+ ip netns exec ${rtname} sysctl -wq net.ipv6.conf.all.accept_dad=0
+ ip netns exec ${rtname} sysctl -wq net.ipv6.conf.default.accept_dad=0
+
+ ip netns exec ${rtname} sysctl -wq net.ipv6.conf.${rtveth}.proxy_ndp=1
+}
+
+setup_vpn_config()
+{
+ local hssrc=$1
+ local rtsrc=$2
+ local hsdst=$3
+ local rtdst=$4
+ local tid=$5
+
+ local hssrc_name=hs-t${tid}-${hssrc}
+ local hsdst_name=hs-t${tid}-${hsdst}
+ local rtsrc_name=rt-${rtsrc}
+ local rtdst_name=rt-${rtdst}
+ local rtveth=veth-t${tid}
+ local vpn_sid=${SID_LOCATOR}:${hssrc}${hsdst}:${tid}::6004
+
+ ip -netns ${rtsrc_name} -6 neigh add proxy ${IPv6_HS_NETWORK}::${hsdst} dev ${rtveth}
+
+ # set the encap route for encapsulating packets which arrive from the
+ # host hssrc and destined to the access router rtsrc.
+ ip -netns ${rtsrc_name} -6 route add ${IPv6_HS_NETWORK}::${hsdst}/128 \
+ encap seg6 mode encap segs ${vpn_sid} dev veth0
+ ip -netns ${rtsrc_name} -6 route add ${vpn_sid}/128 \
+ via 2001:11::${rtdst} dev veth0
+
+ # set the decap route for decapsulating packets which arrive from
+ # the rtdst router and destined to the hsdst host.
+ ip -netns ${rtdst_name} -6 route add ${vpn_sid}/128 \
+ encap seg6local action End.DX6 nh6 ${IPv6_HS_NETWORK}::${hsdst} dev veth-t${tid}
+}
+
+setup()
+{
+ ip link add veth-rt-1 type veth peer name veth-rt-2
+ # setup the networking for router rt-1 and router rt-2
+ setup_rt_networking 1
+ setup_rt_networking 2
+
+ # setup two hosts for the tenant 100.
+ # - host hs-1 is directly connected to the router rt-1;
+ # - host hs-2 is directly connected to the router rt-2.
+ setup_hs 1 1 100
+ setup_hs 2 2 100
+
+ # setup the IPv4 L3 VPN which connects the host hs-1 and host hs-2.
+ setup_vpn_config 1 1 2 2 100 #args: src_host src_router dst_host dst_router tenant
+ setup_vpn_config 2 2 1 1 100
+}
+
+check_hs_connectivity()
+{
+ local hssrc=$1
+ local hsdst=$2
+ local tid=$3
+
+ ip netns exec hs-${hssrc} ping -6 -c 1 -W ${PING_TIMEOUT_SEC} \
+ ${IPv6_HS_NETWORK}::${hsdst} >/dev/null 2>&1
+}
+
+check_and_log_hs_connectivity()
+{
+ local hssrc=$1
+ local hsdst=$2
+ local tid=$3
+
+ check_hs_connectivity ${hssrc} ${hsdst} ${tid}
+ log_test $? 0 "Hosts connectivity: hs-${hssrc} -> hs-${hsdst} (tenant ${tid})"
+}
+
+host_tests()
+{
+ log_section "SRv6 VPN connectivity test among hosts in the same tenant"
+
+ check_and_log_hs_connectivity 1 2 100
+ check_and_log_hs_connectivity 2 1 100
+}
+
+router_netfilter_tests()
+{
+ log_section "SRv6 VPN connectivity test with netfilter enabled in routers"
+ setup_rt_netfilter 1
+ setup_rt_netfilter 2
+
+ check_and_log_hs_connectivity 1 2 100
+ check_and_log_hs_connectivity 2 1 100
+}
+
+if [ "$(id -u)" -ne 0 ];then
+ echo "SKIP: Need root privileges"
+ exit $ksft_skip
+fi
+
+if [ ! -x "$(command -v ip)" ]; then
+ echo "SKIP: Could not run test without ip tool"
+ exit $ksft_skip
+fi
+
+cleanup &>/dev/null
+
+setup
+
+host_tests
+router_netfilter_tests
+
+print_log_test_results
+
+cleanup &>/dev/null
+
+exit ${ret}
diff --git a/tools/testing/selftests/net/tcp_ao/self-connect.c b/tools/testing/selftests/net/tcp_ao/self-connect.c
index e154d9e198a9..a5698b0a3718 100644
--- a/tools/testing/selftests/net/tcp_ao/self-connect.c
+++ b/tools/testing/selftests/net/tcp_ao/self-connect.c
@@ -30,8 +30,6 @@ static void setup_lo_intf(const char *lo_intf)
static void tcp_self_connect(const char *tst, unsigned int port,
bool different_keyids, bool check_restore)
{
- uint64_t before_challenge_ack, after_challenge_ack;
- uint64_t before_syn_challenge, after_syn_challenge;
struct tcp_ao_counters before_ao, after_ao;
uint64_t before_aogood, after_aogood;
struct netstat *ns_before, *ns_after;
@@ -62,8 +60,6 @@ static void tcp_self_connect(const char *tst, unsigned int port,
ns_before = netstat_read();
before_aogood = netstat_get(ns_before, "TCPAOGood", NULL);
- before_challenge_ack = netstat_get(ns_before, "TCPChallengeACK", NULL);
- before_syn_challenge = netstat_get(ns_before, "TCPSYNChallenge", NULL);
if (test_get_tcp_ao_counters(sk, &before_ao))
test_error("test_get_tcp_ao_counters()");
@@ -82,8 +78,6 @@ static void tcp_self_connect(const char *tst, unsigned int port,
ns_after = netstat_read();
after_aogood = netstat_get(ns_after, "TCPAOGood", NULL);
- after_challenge_ack = netstat_get(ns_after, "TCPChallengeACK", NULL);
- after_syn_challenge = netstat_get(ns_after, "TCPSYNChallenge", NULL);
if (test_get_tcp_ao_counters(sk, &after_ao))
test_error("test_get_tcp_ao_counters()");
if (!check_restore) {
@@ -98,18 +92,6 @@ static void tcp_self_connect(const char *tst, unsigned int port,
close(sk);
return;
}
- if (after_challenge_ack <= before_challenge_ack ||
- after_syn_challenge <= before_syn_challenge) {
- /*
- * It's also meant to test simultaneous open, so check
- * these counters as well.
- */
- test_fail("%s: Didn't challenge SYN or ACK: %zu <= %zu OR %zu <= %zu",
- tst, after_challenge_ack, before_challenge_ack,
- after_syn_challenge, before_syn_challenge);
- close(sk);
- return;
- }
if (test_tcp_ao_counters_cmp(tst, &before_ao, &after_ao, TEST_CNT_GOOD)) {
close(sk);
diff --git a/tools/testing/selftests/net/udpgso.c b/tools/testing/selftests/net/udpgso.c
index 85b3baa3f7f3..3e74cfa1a2bf 100644
--- a/tools/testing/selftests/net/udpgso.c
+++ b/tools/testing/selftests/net/udpgso.c
@@ -53,6 +53,7 @@ static bool cfg_do_ipv6;
static bool cfg_do_connected;
static bool cfg_do_connectionless;
static bool cfg_do_msgmore;
+static bool cfg_do_recv = true;
static bool cfg_do_setsockopt;
static int cfg_specific_test_id = -1;
@@ -414,6 +415,9 @@ static void run_one(struct testcase *test, int fdt, int fdr,
if (!sent)
return;
+ if (!cfg_do_recv)
+ return;
+
if (test->gso_len)
mss = test->gso_len;
else
@@ -464,8 +468,10 @@ static void run_test(struct sockaddr *addr, socklen_t alen)
if (fdr == -1)
error(1, errno, "socket r");
- if (bind(fdr, addr, alen))
- error(1, errno, "bind");
+ if (cfg_do_recv) {
+ if (bind(fdr, addr, alen))
+ error(1, errno, "bind");
+ }
/* Have tests fail quickly instead of hang */
if (setsockopt(fdr, SOL_SOCKET, SO_RCVTIMEO, &tv, sizeof(tv)))
@@ -524,7 +530,7 @@ static void parse_opts(int argc, char **argv)
{
int c;
- while ((c = getopt(argc, argv, "46cCmst:")) != -1) {
+ while ((c = getopt(argc, argv, "46cCmRst:")) != -1) {
switch (c) {
case '4':
cfg_do_ipv4 = true;
@@ -541,6 +547,9 @@ static void parse_opts(int argc, char **argv)
case 'm':
cfg_do_msgmore = true;
break;
+ case 'R':
+ cfg_do_recv = false;
+ break;
case 's':
cfg_do_setsockopt = true;
break;
diff --git a/tools/testing/selftests/net/udpgso.sh b/tools/testing/selftests/net/udpgso.sh
index 6c63178086b0..85d1fa3c1ff7 100755
--- a/tools/testing/selftests/net/udpgso.sh
+++ b/tools/testing/selftests/net/udpgso.sh
@@ -27,6 +27,31 @@ test_route_mtu() {
ip route add local fd00::1/128 table local dev lo mtu 1500
}
+setup_dummy_sink() {
+ ip link add name sink mtu 1500 type dummy
+ ip addr add dev sink 10.0.0.0/24
+ ip addr add dev sink fd00::2/64 nodad
+ ip link set dev sink up
+}
+
+test_hw_gso_hw_csum() {
+ setup_dummy_sink
+ ethtool -K sink tx-checksum-ip-generic on >/dev/null
+ ethtool -K sink tx-udp-segmentation on >/dev/null
+}
+
+test_sw_gso_hw_csum() {
+ setup_dummy_sink
+ ethtool -K sink tx-checksum-ip-generic on >/dev/null
+ ethtool -K sink tx-udp-segmentation off >/dev/null
+}
+
+test_sw_gso_sw_csum() {
+ setup_dummy_sink
+ ethtool -K sink tx-checksum-ip-generic off >/dev/null
+ ethtool -K sink tx-udp-segmentation off >/dev/null
+}
+
if [ "$#" -gt 0 ]; then
"$1"
shift 2 # pop "test_*" arg and "--" delimiter
@@ -56,3 +81,21 @@ echo "ipv4 msg_more"
echo "ipv6 msg_more"
./in_netns.sh "$0" test_dev_mtu -- ./udpgso -6 -C -m
+
+echo "ipv4 hw-gso hw-csum"
+./in_netns.sh "$0" test_hw_gso_hw_csum -- ./udpgso -4 -C -R
+
+echo "ipv6 hw-gso hw-csum"
+./in_netns.sh "$0" test_hw_gso_hw_csum -- ./udpgso -6 -C -R
+
+echo "ipv4 sw-gso hw-csum"
+./in_netns.sh "$0" test_sw_gso_hw_csum -- ./udpgso -4 -C -R
+
+echo "ipv6 sw-gso hw-csum"
+./in_netns.sh "$0" test_sw_gso_hw_csum -- ./udpgso -6 -C -R
+
+echo "ipv4 sw-gso sw-csum"
+./in_netns.sh "$0" test_sw_gso_sw_csum -- ./udpgso -4 -C -R
+
+echo "ipv6 sw-gso sw-csum"
+./in_netns.sh "$0" test_sw_gso_sw_csum -- ./udpgso -6 -C -R
diff --git a/tools/testing/selftests/net/vrf_route_leaking.sh b/tools/testing/selftests/net/vrf_route_leaking.sh
index 2da32f4c479b..152171fb1fc8 100755
--- a/tools/testing/selftests/net/vrf_route_leaking.sh
+++ b/tools/testing/selftests/net/vrf_route_leaking.sh
@@ -59,6 +59,7 @@
# while it is forwarded between different vrfs.
source lib.sh
+PATH=$PWD:$PWD/tools/testing/selftests/net:$PATH
VERBOSE=0
PAUSE_ON_FAIL=no
DEFAULT_TTYPE=sym
@@ -533,6 +534,86 @@ ipv6_ping_frag_asym()
ipv6_ping_frag asym
}
+ipv4_ping_local()
+{
+ log_section "IPv4 (sym route): VRF ICMP local error route lookup ping"
+
+ setup_sym
+
+ check_connectivity || return
+
+ run_cmd ip netns exec $r1 ip vrf exec blue ping -c1 -w1 ${H2_N2_IP}
+ log_test $? 0 "VRF ICMP local IPv4"
+}
+
+ipv4_tcp_local()
+{
+ log_section "IPv4 (sym route): VRF tcp local connection"
+
+ setup_sym
+
+ check_connectivity || return
+
+ run_cmd nettest -s -O "$h2" -l ${H2_N2_IP} -I eth0 -3 eth0 &
+ sleep 1
+ run_cmd nettest -N "$r1" -d blue -r ${H2_N2_IP}
+ log_test $? 0 "VRF tcp local connection IPv4"
+}
+
+ipv4_udp_local()
+{
+ log_section "IPv4 (sym route): VRF udp local connection"
+
+ setup_sym
+
+ check_connectivity || return
+
+ run_cmd nettest -s -D -O "$h2" -l ${H2_N2_IP} -I eth0 -3 eth0 &
+ sleep 1
+ run_cmd nettest -D -N "$r1" -d blue -r ${H2_N2_IP}
+ log_test $? 0 "VRF udp local connection IPv4"
+}
+
+ipv6_ping_local()
+{
+ log_section "IPv6 (sym route): VRF ICMP local error route lookup ping"
+
+ setup_sym
+
+ check_connectivity6 || return
+
+ run_cmd ip netns exec $r1 ip vrf exec blue ${ping6} -c1 -w1 ${H2_N2_IP6}
+ log_test $? 0 "VRF ICMP local IPv6"
+}
+
+ipv6_tcp_local()
+{
+ log_section "IPv6 (sym route): VRF tcp local connection"
+
+ setup_sym
+
+ check_connectivity6 || return
+
+ run_cmd nettest -s -6 -O "$h2" -l ${H2_N2_IP6} -I eth0 -3 eth0 &
+ sleep 1
+ run_cmd nettest -6 -N "$r1" -d blue -r ${H2_N2_IP6}
+ log_test $? 0 "VRF tcp local connection IPv6"
+}
+
+ipv6_udp_local()
+{
+ log_section "IPv6 (sym route): VRF udp local connection"
+
+ setup_sym
+
+ check_connectivity6 || return
+
+ run_cmd nettest -s -6 -D -O "$h2" -l ${H2_N2_IP6} -I eth0 -3 eth0 &
+ sleep 1
+ run_cmd nettest -6 -D -N "$r1" -d blue -r ${H2_N2_IP6}
+ log_test $? 0 "VRF udp local connection IPv6"
+}
+
################################################################################
# usage
@@ -555,8 +636,10 @@ EOF
# Some systems don't have a ping6 binary anymore
command -v ping6 > /dev/null 2>&1 && ping6=$(command -v ping6) || ping6=$(command -v ping)
-TESTS_IPV4="ipv4_ping_ttl ipv4_traceroute ipv4_ping_frag ipv4_ping_ttl_asym ipv4_traceroute_asym"
-TESTS_IPV6="ipv6_ping_ttl ipv6_traceroute ipv6_ping_ttl_asym ipv6_traceroute_asym"
+TESTS_IPV4="ipv4_ping_ttl ipv4_traceroute ipv4_ping_frag ipv4_ping_local ipv4_tcp_local
+ipv4_udp_local ipv4_ping_ttl_asym ipv4_traceroute_asym"
+TESTS_IPV6="ipv6_ping_ttl ipv6_traceroute ipv6_ping_local ipv6_tcp_local ipv6_udp_local
+ipv6_ping_ttl_asym ipv6_traceroute_asym"
ret=0
nsuccess=0
@@ -594,12 +677,18 @@ do
ipv4_traceroute|traceroute) ipv4_traceroute;;&
ipv4_traceroute_asym|traceroute) ipv4_traceroute_asym;;&
ipv4_ping_frag|ping) ipv4_ping_frag;;&
+ ipv4_ping_local|ping) ipv4_ping_local;;&
+ ipv4_tcp_local) ipv4_tcp_local;;&
+ ipv4_udp_local) ipv4_udp_local;;&
ipv6_ping_ttl|ping) ipv6_ping_ttl;;&
ipv6_ping_ttl_asym|ping) ipv6_ping_ttl_asym;;&
ipv6_traceroute|traceroute) ipv6_traceroute;;&
ipv6_traceroute_asym|traceroute) ipv6_traceroute_asym;;&
ipv6_ping_frag|ping) ipv6_ping_frag;;&
+ ipv6_ping_local|ping) ipv6_ping_local;;&
+ ipv6_tcp_local) ipv6_tcp_local;;&
+ ipv6_udp_local) ipv6_udp_local;;&
# setup namespaces and config, but do not run any tests
setup_sym|setup) setup_sym; exit 0;;
diff --git a/tools/testing/selftests/net/ynl.mk b/tools/testing/selftests/net/ynl.mk
new file mode 100644
index 000000000000..59cb26cf3f73
--- /dev/null
+++ b/tools/testing/selftests/net/ynl.mk
@@ -0,0 +1,21 @@
+# SPDX-License-Identifier: GPL-2.0
+
+# YNL selftest build snippet
+
+# Inputs:
+#
+# YNL_GENS: families we need in the selftests
+# YNL_PROGS: TEST_PROGS which need YNL (TODO, none exist, yet)
+# YNL_GEN_FILES: TEST_GEN_FILES which need YNL
+
+YNL_OUTPUTS := $(patsubst %,$(OUTPUT)/%,$(YNL_GEN_FILES))
+
+$(YNL_OUTPUTS): $(OUTPUT)/libynl.a
+$(YNL_OUTPUTS): CFLAGS += \
+ -I$(top_srcdir)/usr/include/ $(KHDR_INCLUDES) \
+ -I$(top_srcdir)/tools/net/ynl/lib/ \
+ -I$(top_srcdir)/tools/net/ynl/generated/
+
+$(OUTPUT)/libynl.a:
+ $(Q)$(MAKE) -C $(top_srcdir)/tools/net/ynl GENS="$(YNL_GENS)" libynl.a
+ $(Q)cp $(top_srcdir)/tools/net/ynl/libynl.a $(OUTPUT)/libynl.a
diff --git a/tools/testing/selftests/nolibc/Makefile b/tools/testing/selftests/nolibc/Makefile
index 40dd95228051..3fbabab46958 100644
--- a/tools/testing/selftests/nolibc/Makefile
+++ b/tools/testing/selftests/nolibc/Makefile
@@ -152,7 +152,7 @@ CFLAGS_mips32be = -EB -mabi=32
CFLAGS_STACKPROTECTOR ?= $(call cc-option,-mstack-protector-guard=global $(call cc-option,-fstack-protector-all))
CFLAGS ?= -Os -fno-ident -fno-asynchronous-unwind-tables -std=c89 -W -Wall -Wextra \
$(call cc-option,-fno-stack-protector) \
- $(CFLAGS_$(XARCH)) $(CFLAGS_STACKPROTECTOR)
+ $(CFLAGS_$(XARCH)) $(CFLAGS_STACKPROTECTOR) $(CFLAGS_EXTRA)
LDFLAGS :=
REPORT ?= awk '/\[OK\][\r]*$$/{p++} /\[FAIL\][\r]*$$/{if (!f) printf("\n"); f++; print;} /\[SKIPPED\][\r]*$$/{s++} \
diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c
index 94bb6e11c16f..093d0512f4c5 100644
--- a/tools/testing/selftests/nolibc/nolibc-test.c
+++ b/tools/testing/selftests/nolibc/nolibc-test.c
@@ -64,6 +64,14 @@ static const char *argv0;
/* will be used by constructor tests */
static int constructor_test_value;
+static const int is_nolibc =
+#ifdef NOLIBC
+ 1
+#else
+ 0
+#endif
+;
+
/* definition of a series of tests */
struct test {
const char *name; /* test name */
@@ -607,7 +615,7 @@ int expect_strne(const char *expr, int llen, const char *cmp)
static __attribute__((unused))
int expect_str_buf_eq(size_t expr, const char *buf, size_t val, int llen, const char *cmp)
{
- llen += printf(" = %lu <%s> ", expr, buf);
+ llen += printf(" = %lu <%s> ", (unsigned long)expr, buf);
if (strcmp(buf, cmp) != 0) {
result(llen, FAIL);
return 1;
@@ -621,6 +629,51 @@ int expect_str_buf_eq(size_t expr, const char *buf, size_t val, int llen, const
return 0;
}
+#define EXPECT_STRTOX(cond, func, input, base, expected, chars, expected_errno) \
+ do { if (!(cond)) result(llen, SKIPPED); else ret += expect_strtox(llen, func, input, base, expected, chars, expected_errno); } while (0)
+
+static __attribute__((unused))
+int expect_strtox(int llen, void *func, const char *input, int base, intmax_t expected, int expected_chars, int expected_errno)
+{
+ char *endptr;
+ int actual_errno, actual_chars;
+ intmax_t r;
+
+ errno = 0;
+ if (func == strtol) {
+ r = strtol(input, &endptr, base);
+ } else if (func == strtoul) {
+ r = strtoul(input, &endptr, base);
+ } else {
+ result(llen, FAIL);
+ return 1;
+ }
+ actual_errno = errno;
+ actual_chars = endptr - input;
+
+ llen += printf(" %lld = %lld", (long long)expected, (long long)r);
+ if (r != expected) {
+ result(llen, FAIL);
+ return 1;
+ }
+ if (expected_chars == -1) {
+ if (*endptr != '\0') {
+ result(llen, FAIL);
+ return 1;
+ }
+ } else if (expected_chars != actual_chars) {
+ result(llen, FAIL);
+ return 1;
+ }
+ if (actual_errno != expected_errno) {
+ result(llen, FAIL);
+ return 1;
+ }
+
+ result(llen, OK);
+ return 0;
+}
+
/* declare tests based on line numbers. There must be exactly one test per line. */
#define CASE_TEST(name) \
case __LINE__: llen += printf("%d %s", test, #name);
@@ -942,6 +995,7 @@ int run_syscall(int min, int max)
int ret = 0;
void *p1, *p2;
int has_gettid = 1;
+ int has_brk;
/* <proc> indicates whether or not /proc is mounted */
proc = stat("/proc", &stat_buf) == 0;
@@ -954,6 +1008,9 @@ int run_syscall(int min, int max)
has_gettid = __GLIBC__ > 2 || (__GLIBC__ == 2 && __GLIBC_MINOR__ >= 30);
#endif
+ /* on musl setting brk()/sbrk() always fails */
+ has_brk = brk(0) == 0;
+
for (test = min; test >= 0 && test <= max; test++) {
int llen = 0; /* line length */
@@ -969,9 +1026,9 @@ int run_syscall(int min, int max)
CASE_TEST(kill_0); EXPECT_SYSZR(1, kill(getpid(), 0)); break;
CASE_TEST(kill_CONT); EXPECT_SYSZR(1, kill(getpid(), 0)); break;
CASE_TEST(kill_BADPID); EXPECT_SYSER(1, kill(INT_MAX, 0), -1, ESRCH); break;
- CASE_TEST(sbrk_0); EXPECT_PTRNE(1, sbrk(0), (void *)-1); break;
- CASE_TEST(sbrk); if ((p1 = p2 = sbrk(4096)) != (void *)-1) p2 = sbrk(-4096); EXPECT_SYSZR(1, (p2 == (void *)-1) || p2 == p1); break;
- CASE_TEST(brk); EXPECT_SYSZR(1, brk(sbrk(0))); break;
+ CASE_TEST(sbrk_0); EXPECT_PTRNE(has_brk, sbrk(0), (void *)-1); break;
+ CASE_TEST(sbrk); if ((p1 = p2 = sbrk(4096)) != (void *)-1) p2 = sbrk(-4096); EXPECT_SYSZR(has_brk, (p2 == (void *)-1) || p2 == p1); break;
+ CASE_TEST(brk); EXPECT_SYSZR(has_brk, brk(sbrk(0))); break;
CASE_TEST(chdir_root); EXPECT_SYSZR(1, chdir("/")); chdir(getenv("PWD")); break;
CASE_TEST(chdir_dot); EXPECT_SYSZR(1, chdir(".")); break;
CASE_TEST(chdir_blah); EXPECT_SYSER(1, chdir("/blah"), -1, ENOENT); break;
@@ -1076,19 +1133,17 @@ int run_stdlib(int min, int max)
CASE_TEST(strchr_foobar_z); EXPECT_STRZR(1, strchr("foobar", 'z')); break;
CASE_TEST(strrchr_foobar_o); EXPECT_STREQ(1, strrchr("foobar", 'o'), "obar"); break;
CASE_TEST(strrchr_foobar_z); EXPECT_STRZR(1, strrchr("foobar", 'z')); break;
-#ifdef NOLIBC
- CASE_TEST(strlcat_0); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 0), buf, 3, "test"); break;
- CASE_TEST(strlcat_1); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 1), buf, 4, "test"); break;
- CASE_TEST(strlcat_5); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 5), buf, 7, "test"); break;
- CASE_TEST(strlcat_6); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 6), buf, 7, "testb"); break;
- CASE_TEST(strlcat_7); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 7), buf, 7, "testba"); break;
- CASE_TEST(strlcat_8); EXPECT_STRBUFEQ(1, strlcat(buf, "bar", 8), buf, 7, "testbar"); break;
- CASE_TEST(strlcpy_0); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 0), buf, 3, "test"); break;
- CASE_TEST(strlcpy_1); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 1), buf, 3, ""); break;
- CASE_TEST(strlcpy_2); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 2), buf, 3, "b"); break;
- CASE_TEST(strlcpy_3); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 3), buf, 3, "ba"); break;
- CASE_TEST(strlcpy_4); EXPECT_STRBUFEQ(1, strlcpy(buf, "bar", 4), buf, 3, "bar"); break;
-#endif
+ CASE_TEST(strlcat_0); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 0), buf, 3, "test"); break;
+ CASE_TEST(strlcat_1); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 1), buf, 4, "test"); break;
+ CASE_TEST(strlcat_5); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 5), buf, 7, "test"); break;
+ CASE_TEST(strlcat_6); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 6), buf, 7, "testb"); break;
+ CASE_TEST(strlcat_7); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 7), buf, 7, "testba"); break;
+ CASE_TEST(strlcat_8); EXPECT_STRBUFEQ(is_nolibc, strlcat(buf, "bar", 8), buf, 7, "testbar"); break;
+ CASE_TEST(strlcpy_0); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 0), buf, 3, "test"); break;
+ CASE_TEST(strlcpy_1); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 1), buf, 3, ""); break;
+ CASE_TEST(strlcpy_2); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 2), buf, 3, "b"); break;
+ CASE_TEST(strlcpy_3); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 3), buf, 3, "ba"); break;
+ CASE_TEST(strlcpy_4); EXPECT_STRBUFEQ(is_nolibc, strlcpy(buf, "bar", 4), buf, 3, "bar"); break;
CASE_TEST(memcmp_20_20); EXPECT_EQ(1, memcmp("aaa\x20", "aaa\x20", 4), 0); break;
CASE_TEST(memcmp_20_60); EXPECT_LT(1, memcmp("aaa\x20", "aaa\x60", 4), 0); break;
CASE_TEST(memcmp_60_20); EXPECT_GT(1, memcmp("aaa\x60", "aaa\x20", 4), 0); break;
@@ -1139,6 +1194,26 @@ int run_stdlib(int min, int max)
CASE_TEST(limit_ptrdiff_min); EXPECT_EQ(1, PTRDIFF_MIN, sizeof(long) == 8 ? (ptrdiff_t) 0x8000000000000000LL : (ptrdiff_t) 0x80000000); break;
CASE_TEST(limit_ptrdiff_max); EXPECT_EQ(1, PTRDIFF_MAX, sizeof(long) == 8 ? (ptrdiff_t) 0x7fffffffffffffffLL : (ptrdiff_t) 0x7fffffff); break;
CASE_TEST(limit_size_max); EXPECT_EQ(1, SIZE_MAX, sizeof(long) == 8 ? (size_t) 0xffffffffffffffffULL : (size_t) 0xffffffffU); break;
+ CASE_TEST(strtol_simple); EXPECT_STRTOX(1, strtol, "35", 10, 35, -1, 0); break;
+ CASE_TEST(strtol_positive); EXPECT_STRTOX(1, strtol, "+35", 10, 35, -1, 0); break;
+ CASE_TEST(strtol_negative); EXPECT_STRTOX(1, strtol, "-35", 10, -35, -1, 0); break;
+ CASE_TEST(strtol_hex_auto); EXPECT_STRTOX(1, strtol, "0xFF", 0, 255, -1, 0); break;
+ CASE_TEST(strtol_base36); EXPECT_STRTOX(1, strtol, "12yZ", 36, 50507, -1, 0); break;
+ CASE_TEST(strtol_cutoff); EXPECT_STRTOX(1, strtol, "1234567890", 8, 342391, 7, 0); break;
+ CASE_TEST(strtol_octal_auto); EXPECT_STRTOX(1, strtol, "011", 0, 9, -1, 0); break;
+ CASE_TEST(strtol_hex_00); EXPECT_STRTOX(1, strtol, "0x00", 16, 0, -1, 0); break;
+ CASE_TEST(strtol_hex_FF); EXPECT_STRTOX(1, strtol, "FF", 16, 255, -1, 0); break;
+ CASE_TEST(strtol_hex_ff); EXPECT_STRTOX(1, strtol, "ff", 16, 255, -1, 0); break;
+ CASE_TEST(strtol_hex_prefix); EXPECT_STRTOX(1, strtol, "0xFF", 16, 255, -1, 0); break;
+ CASE_TEST(strtol_trailer); EXPECT_STRTOX(1, strtol, "35foo", 10, 35, 2, 0); break;
+ CASE_TEST(strtol_overflow); EXPECT_STRTOX(1, strtol, "0x8000000000000000", 16, LONG_MAX, -1, ERANGE); break;
+ CASE_TEST(strtol_underflow); EXPECT_STRTOX(1, strtol, "-0x8000000000000001", 16, LONG_MIN, -1, ERANGE); break;
+ CASE_TEST(strtoul_negative); EXPECT_STRTOX(1, strtoul, "-0x1", 16, ULONG_MAX, 4, 0); break;
+ CASE_TEST(strtoul_overflow); EXPECT_STRTOX(1, strtoul, "0x10000000000000000", 16, ULONG_MAX, -1, ERANGE); break;
+ CASE_TEST(strerror_success); EXPECT_STREQ(is_nolibc, strerror(0), "errno=0"); break;
+ CASE_TEST(strerror_EINVAL); EXPECT_STREQ(is_nolibc, strerror(EINVAL), "errno=22"); break;
+ CASE_TEST(strerror_int_max); EXPECT_STREQ(is_nolibc, strerror(INT_MAX), "errno=2147483647"); break;
+ CASE_TEST(strerror_int_min); EXPECT_STREQ(is_nolibc, strerror(INT_MIN), "errno=-2147483648"); break;
case __LINE__:
return ret; /* must be last */
diff --git a/tools/testing/selftests/nolibc/run-tests.sh b/tools/testing/selftests/nolibc/run-tests.sh
index c0a5a7cea9fa..0446e6326a40 100755
--- a/tools/testing/selftests/nolibc/run-tests.sh
+++ b/tools/testing/selftests/nolibc/run-tests.sh
@@ -15,9 +15,10 @@ download_location="${cache_dir}/crosstools/"
build_location="$(realpath "${cache_dir}"/nolibc-tests/)"
perform_download=0
test_mode=system
+CFLAGS_EXTRA="-Werror"
archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv s390 loongarch"
-TEMP=$(getopt -o 'j:d:c:b:a:m:ph' -n "$0" -- "$@")
+TEMP=$(getopt -o 'j:d:c:b:a:m:peh' -n "$0" -- "$@")
eval set -- "$TEMP"
unset TEMP
@@ -40,6 +41,7 @@ Options:
-a [ARCH] Host architecture of toolchains to use (default: ${hostarch})
-b [DIR] Build location (default: ${build_location})
-m [MODE] Test mode user/system (default: ${test_mode})
+ -e Disable -Werror
EOF
}
@@ -66,6 +68,9 @@ while true; do
'-m')
test_mode="$2"
shift 2; continue ;;
+ '-e')
+ CFLAGS_EXTRA=""
+ shift; continue ;;
'-h')
print_usage
exit 0
@@ -153,7 +158,7 @@ test_arch() {
exit 1
esac
printf '%-15s' "$arch:"
- swallow_output "${MAKE[@]}" "$test_target" V=1
+ swallow_output "${MAKE[@]}" CFLAGS_EXTRA="$CFLAGS_EXTRA" "$test_target" V=1
cp run.out run.out."${arch}"
"${MAKE[@]}" report | grep passed
}
diff --git a/tools/testing/selftests/openat2/Makefile b/tools/testing/selftests/openat2/Makefile
index 254d676a2689..185dc76ebb5f 100644
--- a/tools/testing/selftests/openat2/Makefile
+++ b/tools/testing/selftests/openat2/Makefile
@@ -1,8 +1,18 @@
# SPDX-License-Identifier: GPL-2.0-or-later
-CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined -static-libasan
+CFLAGS += -Wall -O2 -g -fsanitize=address -fsanitize=undefined
TEST_GEN_PROGS := openat2_test resolve_test rename_attack_test
+# gcc requires -static-libasan in order to ensure that Address Sanitizer's
+# library is the first one loaded. However, clang already statically links the
+# Address Sanitizer if -fsanitize is specified. Therefore, simply omit
+# -static-libasan for clang builds.
+ifeq ($(LLVM),)
+ CFLAGS += -static-libasan
+endif
+
+LOCAL_HDRS += helpers.h
+
include ../lib.mk
-$(TEST_GEN_PROGS): helpers.c helpers.h
+$(TEST_GEN_PROGS): helpers.c
diff --git a/tools/testing/selftests/openat2/openat2_test.c b/tools/testing/selftests/openat2/openat2_test.c
index 9024754530b2..5790ab446527 100644
--- a/tools/testing/selftests/openat2/openat2_test.c
+++ b/tools/testing/selftests/openat2/openat2_test.c
@@ -5,6 +5,7 @@
*/
#define _GNU_SOURCE
+#define __SANE_USERSPACE_TYPES__ // Use ll64
#include <fcntl.h>
#include <sched.h>
#include <sys/stat.h>
diff --git a/tools/testing/selftests/powerpc/flags.mk b/tools/testing/selftests/powerpc/flags.mk
index b909bee3cb2a..abb9e58d95c4 100644
--- a/tools/testing/selftests/powerpc/flags.mk
+++ b/tools/testing/selftests/powerpc/flags.mk
@@ -5,8 +5,5 @@ GIT_VERSION := $(shell git describe --always --long --dirty || echo "unknown")
export GIT_VERSION
endif
-ifeq ($(CFLAGS),)
-CFLAGS := -std=gnu99 -O2 -Wall -Werror -DGIT_VERSION='"$(GIT_VERSION)"' -I$(selfdir)/powerpc/include $(CFLAGS)
+CFLAGS := -std=gnu99 -O2 -Wall -Werror -DGIT_VERSION='"$(GIT_VERSION)"' -I$(selfdir)/powerpc/include $(USERCFLAGS)
export CFLAGS
-endif
-
diff --git a/tools/testing/selftests/resctrl/cache.c b/tools/testing/selftests/resctrl/cache.c
index 1b339d6bbff1..1ff1104e6575 100644
--- a/tools/testing/selftests/resctrl/cache.c
+++ b/tools/testing/selftests/resctrl/cache.c
@@ -101,12 +101,12 @@ static int get_llc_occu_resctrl(unsigned long *llc_occupancy)
*
* Return: 0 on success, < 0 on error.
*/
-static int print_results_cache(const char *filename, int bm_pid, __u64 llc_value)
+static int print_results_cache(const char *filename, pid_t bm_pid, __u64 llc_value)
{
FILE *fp;
if (strcmp(filename, "stdio") == 0 || strcmp(filename, "stderr") == 0) {
- printf("Pid: %d \t LLC_value: %llu\n", bm_pid, llc_value);
+ printf("Pid: %d \t LLC_value: %llu\n", (int)bm_pid, llc_value);
} else {
fp = fopen(filename, "a");
if (!fp) {
@@ -114,7 +114,7 @@ static int print_results_cache(const char *filename, int bm_pid, __u64 llc_value
return -1;
}
- fprintf(fp, "Pid: %d \t llc_value: %llu\n", bm_pid, llc_value);
+ fprintf(fp, "Pid: %d \t llc_value: %llu\n", (int)bm_pid, llc_value);
fclose(fp);
}
@@ -133,7 +133,7 @@ static int print_results_cache(const char *filename, int bm_pid, __u64 llc_value
* Return: =0 on success. <0 on failure.
*/
int perf_event_measure(int pe_fd, struct perf_event_read *pe_read,
- const char *filename, int bm_pid)
+ const char *filename, pid_t bm_pid)
{
int ret;
@@ -161,7 +161,7 @@ int perf_event_measure(int pe_fd, struct perf_event_read *pe_read,
*
* Return: =0 on success. <0 on failure.
*/
-int measure_llc_resctrl(const char *filename, int bm_pid)
+int measure_llc_resctrl(const char *filename, pid_t bm_pid)
{
unsigned long llc_occu_resc = 0;
int ret;
diff --git a/tools/testing/selftests/resctrl/cat_test.c b/tools/testing/selftests/resctrl/cat_test.c
index c7686fb6641a..742782438ca3 100644
--- a/tools/testing/selftests/resctrl/cat_test.c
+++ b/tools/testing/selftests/resctrl/cat_test.c
@@ -158,7 +158,6 @@ static int cat_test(const struct resctrl_test *test,
struct resctrl_val_param *param,
size_t span, unsigned long current_mask)
{
- char *resctrl_val = param->resctrl_val;
struct perf_event_read pe_read;
struct perf_event_attr pea;
cpu_set_t old_affinity;
@@ -178,8 +177,7 @@ static int cat_test(const struct resctrl_test *test,
return ret;
/* Write benchmark to specified con_mon grp, mon_grp in resctrl FS*/
- ret = write_bm_pid_to_resctrl(bm_pid, param->ctrlgrp, param->mongrp,
- resctrl_val);
+ ret = write_bm_pid_to_resctrl(bm_pid, param->ctrlgrp, param->mongrp);
if (ret)
goto reset_affinity;
@@ -272,7 +270,6 @@ static int cat_run_test(const struct resctrl_test *test, const struct user_param
start_mask = create_bit_mask(start, n);
struct resctrl_val_param param = {
- .resctrl_val = CAT_STR,
.ctrlgrp = "c1",
.filename = RESULT_FILE_NAME,
.num_of_runs = 0,
@@ -291,11 +288,30 @@ static int cat_run_test(const struct resctrl_test *test, const struct user_param
return ret;
}
+static bool arch_supports_noncont_cat(const struct resctrl_test *test)
+{
+ unsigned int eax, ebx, ecx, edx;
+
+ /* AMD always supports non-contiguous CBM. */
+ if (get_vendor() == ARCH_AMD)
+ return true;
+
+ /* Intel support for non-contiguous CBM needs to be discovered. */
+ if (!strcmp(test->resource, "L3"))
+ __cpuid_count(0x10, 1, eax, ebx, ecx, edx);
+ else if (!strcmp(test->resource, "L2"))
+ __cpuid_count(0x10, 2, eax, ebx, ecx, edx);
+ else
+ return false;
+
+ return ((ecx >> 3) & 1);
+}
+
static int noncont_cat_run_test(const struct resctrl_test *test,
const struct user_params *uparams)
{
unsigned long full_cache_mask, cont_mask, noncont_mask;
- unsigned int eax, ebx, ecx, edx, sparse_masks;
+ unsigned int sparse_masks;
int bit_center, ret;
char schemata[64];
@@ -304,15 +320,8 @@ static int noncont_cat_run_test(const struct resctrl_test *test,
if (ret)
return ret;
- if (!strcmp(test->resource, "L3"))
- __cpuid_count(0x10, 1, eax, ebx, ecx, edx);
- else if (!strcmp(test->resource, "L2"))
- __cpuid_count(0x10, 2, eax, ebx, ecx, edx);
- else
- return -EINVAL;
-
- if (sparse_masks != ((ecx >> 3) & 1)) {
- ksft_print_msg("CPUID output doesn't match 'sparse_masks' file content!\n");
+ if (arch_supports_noncont_cat(test) != sparse_masks) {
+ ksft_print_msg("Hardware and kernel differ on non-contiguous CBM support!\n");
return 1;
}
diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c
index 0105afec6188..0c045080d808 100644
--- a/tools/testing/selftests/resctrl/cmt_test.c
+++ b/tools/testing/selftests/resctrl/cmt_test.c
@@ -16,6 +16,17 @@
#define MAX_DIFF 2000000
#define MAX_DIFF_PERCENT 15
+#define CON_MON_LCC_OCCUP_PATH \
+ "%s/%s/mon_data/mon_L3_%02d/llc_occupancy"
+
+static int cmt_init(const struct resctrl_val_param *param, int domain_id)
+{
+ sprintf(llc_occup_path, CON_MON_LCC_OCCUP_PATH, RESCTRL_PATH,
+ param->ctrlgrp, domain_id);
+
+ return 0;
+}
+
static int cmt_setup(const struct resctrl_test *test,
const struct user_params *uparams,
struct resctrl_val_param *p)
@@ -29,6 +40,13 @@ static int cmt_setup(const struct resctrl_test *test,
return 0;
}
+static int cmt_measure(const struct user_params *uparams,
+ struct resctrl_val_param *param, pid_t bm_pid)
+{
+ sleep(1);
+ return measure_llc_resctrl(param->filename, bm_pid);
+}
+
static int show_results_info(unsigned long sum_llc_val, int no_of_bits,
unsigned long cache_span, unsigned long max_diff,
unsigned long max_diff_percent, unsigned long num_of_runs,
@@ -126,13 +144,13 @@ static int cmt_run_test(const struct resctrl_test *test, const struct user_param
}
struct resctrl_val_param param = {
- .resctrl_val = CMT_STR,
.ctrlgrp = "c1",
- .mongrp = "m1",
.filename = RESULT_FILE_NAME,
.mask = ~(long_mask << n) & long_mask,
.num_of_runs = 0,
+ .init = cmt_init,
.setup = cmt_setup,
+ .measure = cmt_measure,
};
span = cache_portion_size(cache_total_size, param.mask, long_mask);
diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c
index a6ad39aae162..ab8496a4925b 100644
--- a/tools/testing/selftests/resctrl/mba_test.c
+++ b/tools/testing/selftests/resctrl/mba_test.c
@@ -17,6 +17,19 @@
#define ALLOCATION_MIN 10
#define ALLOCATION_STEP 10
+static int mba_init(const struct resctrl_val_param *param, int domain_id)
+{
+ int ret;
+
+ ret = initialize_mem_bw_imc();
+ if (ret)
+ return ret;
+
+ initialize_mem_bw_resctrl(param, domain_id);
+
+ return 0;
+}
+
/*
* Change schemata percentage from 100 to 10%. Write schemata to specified
* con_mon grp, mon_grp in resctrl FS.
@@ -51,6 +64,12 @@ static int mba_setup(const struct resctrl_test *test,
return 0;
}
+static int mba_measure(const struct user_params *uparams,
+ struct resctrl_val_param *param, pid_t bm_pid)
+{
+ return measure_mem_bw(uparams, param, bm_pid, "reads");
+}
+
static bool show_mba_info(unsigned long *bw_imc, unsigned long *bw_resc)
{
int allocation, runs;
@@ -145,12 +164,11 @@ static void mba_test_cleanup(void)
static int mba_run_test(const struct resctrl_test *test, const struct user_params *uparams)
{
struct resctrl_val_param param = {
- .resctrl_val = MBA_STR,
.ctrlgrp = "c1",
- .mongrp = "m1",
.filename = RESULT_FILE_NAME,
- .bw_report = "reads",
- .setup = mba_setup
+ .init = mba_init,
+ .setup = mba_setup,
+ .measure = mba_measure,
};
int ret;
diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c
index 6fec51e1ff46..6b5a3b52d861 100644
--- a/tools/testing/selftests/resctrl/mbm_test.c
+++ b/tools/testing/selftests/resctrl/mbm_test.c
@@ -86,6 +86,19 @@ static int check_results(size_t span)
return ret;
}
+static int mbm_init(const struct resctrl_val_param *param, int domain_id)
+{
+ int ret;
+
+ ret = initialize_mem_bw_imc();
+ if (ret)
+ return ret;
+
+ initialize_mem_bw_resctrl(param, domain_id);
+
+ return 0;
+}
+
static int mbm_setup(const struct resctrl_test *test,
const struct user_params *uparams,
struct resctrl_val_param *p)
@@ -105,6 +118,12 @@ static int mbm_setup(const struct resctrl_test *test,
return ret;
}
+static int mbm_measure(const struct user_params *uparams,
+ struct resctrl_val_param *param, pid_t bm_pid)
+{
+ return measure_mem_bw(uparams, param, bm_pid, "reads");
+}
+
static void mbm_test_cleanup(void)
{
remove(RESULT_FILE_NAME);
@@ -113,12 +132,11 @@ static void mbm_test_cleanup(void)
static int mbm_run_test(const struct resctrl_test *test, const struct user_params *uparams)
{
struct resctrl_val_param param = {
- .resctrl_val = MBM_STR,
.ctrlgrp = "c1",
- .mongrp = "m1",
.filename = RESULT_FILE_NAME,
- .bw_report = "reads",
- .setup = mbm_setup
+ .init = mbm_init,
+ .setup = mbm_setup,
+ .measure = mbm_measure,
};
int ret;
diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h
index 00d51fa7531c..2dda56084588 100644
--- a/tools/testing/selftests/resctrl/resctrl.h
+++ b/tools/testing/selftests/resctrl/resctrl.h
@@ -43,13 +43,6 @@
#define DEFAULT_SPAN (250 * MB)
-#define PARENT_EXIT() \
- do { \
- kill(ppid, SIGKILL); \
- umount_resctrlfs(); \
- exit(EXIT_FAILURE); \
- } while (0)
-
/*
* user_params: User supplied parameters
* @cpu: CPU number to which the benchmark will be bound to
@@ -88,24 +81,27 @@ struct resctrl_test {
/*
* resctrl_val_param: resctrl test parameters
- * @resctrl_val: Resctrl feature (Eg: mbm, mba.. etc)
* @ctrlgrp: Name of the control monitor group (con_mon grp)
* @mongrp: Name of the monitor group (mon grp)
* @filename: Name of file to which the o/p should be written
- * @bw_report: Bandwidth report type (reads vs writes)
- * @setup: Call back function to setup test environment
+ * @init: Callback function to initialize test environment
+ * @setup: Callback function to setup per test run environment
+ * @measure: Callback that performs the measurement (a single test)
*/
struct resctrl_val_param {
- char *resctrl_val;
- char ctrlgrp[64];
- char mongrp[64];
+ const char *ctrlgrp;
+ const char *mongrp;
char filename[64];
- char *bw_report;
unsigned long mask;
int num_of_runs;
+ int (*init)(const struct resctrl_val_param *param,
+ int domain_id);
int (*setup)(const struct resctrl_test *test,
const struct user_params *uparams,
struct resctrl_val_param *param);
+ int (*measure)(const struct user_params *uparams,
+ struct resctrl_val_param *param,
+ pid_t bm_pid);
};
struct perf_event_read {
@@ -115,11 +111,6 @@ struct perf_event_read {
} values[2];
};
-#define MBM_STR "mbm"
-#define MBA_STR "mba"
-#define CMT_STR "cmt"
-#define CAT_STR "cat"
-
/*
* Memory location that consumes values compiler must not optimize away.
* Volatile ensures writes to this location cannot be optimized away by
@@ -127,8 +118,6 @@ struct perf_event_read {
*/
extern volatile int *value_sink;
-extern pid_t bm_pid, ppid;
-
extern char llc_occup_path[1024];
int get_vendor(void);
@@ -137,7 +126,7 @@ int filter_dmesg(void);
int get_domain_id(const char *resource, int cpu_no, int *domain_id);
int mount_resctrlfs(void);
int umount_resctrlfs(void);
-int validate_bw_report_request(char *bw_report);
+const char *get_bw_report_type(const char *bw_report);
bool resctrl_resource_exists(const char *resource);
bool resctrl_mon_feature_exists(const char *resource, const char *feature);
bool resource_info_file_exists(const char *resource, const char *file);
@@ -145,15 +134,21 @@ bool test_resource_feature_check(const struct resctrl_test *test);
char *fgrep(FILE *inf, const char *str);
int taskset_benchmark(pid_t bm_pid, int cpu_no, cpu_set_t *old_affinity);
int taskset_restore(pid_t bm_pid, cpu_set_t *old_affinity);
-int write_schemata(char *ctrlgrp, char *schemata, int cpu_no, const char *resource);
-int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
- char *resctrl_val);
+int write_schemata(const char *ctrlgrp, char *schemata, int cpu_no,
+ const char *resource);
+int write_bm_pid_to_resctrl(pid_t bm_pid, const char *ctrlgrp, const char *mongrp);
int perf_event_open(struct perf_event_attr *hw_event, pid_t pid, int cpu,
int group_fd, unsigned long flags);
unsigned char *alloc_buffer(size_t buf_size, int memflush);
void mem_flush(unsigned char *buf, size_t buf_size);
void fill_cache_read(unsigned char *buf, size_t buf_size, bool once);
int run_fill_buf(size_t buf_size, int memflush, int op, bool once);
+int initialize_mem_bw_imc(void);
+int measure_mem_bw(const struct user_params *uparams,
+ struct resctrl_val_param *param, pid_t bm_pid,
+ const char *bw_report);
+void initialize_mem_bw_resctrl(const struct resctrl_val_param *param,
+ int domain_id);
int resctrl_val(const struct resctrl_test *test,
const struct user_params *uparams,
const char * const *benchmark_cmd,
@@ -174,8 +169,8 @@ void perf_event_initialize_read_format(struct perf_event_read *pe_read);
int perf_open(struct perf_event_attr *pea, pid_t pid, int cpu_no);
int perf_event_reset_enable(int pe_fd);
int perf_event_measure(int pe_fd, struct perf_event_read *pe_read,
- const char *filename, int bm_pid);
-int measure_llc_resctrl(const char *filename, int bm_pid);
+ const char *filename, pid_t bm_pid);
+int measure_llc_resctrl(const char *filename, pid_t bm_pid);
void show_cache_info(int no_of_bits, __u64 avg_llc_val, size_t cache_span, bool lines);
/*
diff --git a/tools/testing/selftests/resctrl/resctrl_val.c b/tools/testing/selftests/resctrl/resctrl_val.c
index 445f306d4c2f..8c275f6b4dd7 100644
--- a/tools/testing/selftests/resctrl/resctrl_val.c
+++ b/tools/testing/selftests/resctrl/resctrl_val.c
@@ -19,30 +19,10 @@
#define MAX_TOKENS 5
#define READ 0
#define WRITE 1
-#define CON_MON_MBM_LOCAL_BYTES_PATH \
- "%s/%s/mon_groups/%s/mon_data/mon_L3_%02d/mbm_local_bytes"
#define CON_MBM_LOCAL_BYTES_PATH \
"%s/%s/mon_data/mon_L3_%02d/mbm_local_bytes"
-#define MON_MBM_LOCAL_BYTES_PATH \
- "%s/mon_groups/%s/mon_data/mon_L3_%02d/mbm_local_bytes"
-
-#define MBM_LOCAL_BYTES_PATH \
- "%s/mon_data/mon_L3_%02d/mbm_local_bytes"
-
-#define CON_MON_LCC_OCCUP_PATH \
- "%s/%s/mon_groups/%s/mon_data/mon_L3_%02d/llc_occupancy"
-
-#define CON_LCC_OCCUP_PATH \
- "%s/%s/mon_data/mon_L3_%02d/llc_occupancy"
-
-#define MON_LCC_OCCUP_PATH \
- "%s/mon_groups/%s/mon_data/mon_L3_%02d/llc_occupancy"
-
-#define LCC_OCCUP_PATH \
- "%s/mon_data/mon_L3_%02d/llc_occupancy"
-
struct membw_read_format {
__u64 value; /* The value of the event */
__u64 time_enabled; /* if PERF_FORMAT_TOTAL_TIME_ENABLED */
@@ -276,7 +256,7 @@ static int num_of_imcs(void)
return count;
}
-static int initialize_mem_bw_imc(void)
+int initialize_mem_bw_imc(void)
{
int imc, j;
@@ -293,44 +273,93 @@ static int initialize_mem_bw_imc(void)
return 0;
}
+static void perf_close_imc_mem_bw(void)
+{
+ int mc;
+
+ for (mc = 0; mc < imcs; mc++) {
+ if (imc_counters_config[mc][READ].fd != -1)
+ close(imc_counters_config[mc][READ].fd);
+ if (imc_counters_config[mc][WRITE].fd != -1)
+ close(imc_counters_config[mc][WRITE].fd);
+ }
+}
+
/*
- * get_mem_bw_imc: Memory band width as reported by iMC counters
- * @cpu_no: CPU number that the benchmark PID is binded to
- * @bw_report: Bandwidth report type (reads, writes)
- *
- * Memory B/W utilized by a process on a socket can be calculated using
- * iMC counters. Perf events are used to read these counters.
+ * perf_open_imc_mem_bw - Open perf fds for IMCs
+ * @cpu_no: CPU number that the benchmark PID is bound to
*
* Return: = 0 on success. < 0 on failure.
*/
-static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
+static int perf_open_imc_mem_bw(int cpu_no)
{
- float reads, writes, of_mul_read, of_mul_write;
- int imc, j, ret;
+ int imc, ret;
- /* Start all iMC counters to log values (both read and write) */
- reads = 0, writes = 0, of_mul_read = 1, of_mul_write = 1;
for (imc = 0; imc < imcs; imc++) {
- for (j = 0; j < 2; j++) {
- ret = open_perf_event(imc, cpu_no, j);
- if (ret)
- return -1;
- }
- for (j = 0; j < 2; j++)
- membw_ioctl_perf_event_ioc_reset_enable(imc, j);
+ imc_counters_config[imc][READ].fd = -1;
+ imc_counters_config[imc][WRITE].fd = -1;
+ }
+
+ for (imc = 0; imc < imcs; imc++) {
+ ret = open_perf_event(imc, cpu_no, READ);
+ if (ret)
+ goto close_fds;
+ ret = open_perf_event(imc, cpu_no, WRITE);
+ if (ret)
+ goto close_fds;
+ }
+
+ return 0;
+
+close_fds:
+ perf_close_imc_mem_bw();
+ return -1;
+}
+
+/*
+ * do_mem_bw_test - Perform memory bandwidth test
+ *
+ * Runs memory bandwidth test over one second period. Also, handles starting
+ * and stopping of the IMC perf counters around the test.
+ */
+static void do_imc_mem_bw_test(void)
+{
+ int imc;
+
+ for (imc = 0; imc < imcs; imc++) {
+ membw_ioctl_perf_event_ioc_reset_enable(imc, READ);
+ membw_ioctl_perf_event_ioc_reset_enable(imc, WRITE);
}
sleep(1);
/* Stop counters after a second to get results (both read and write) */
for (imc = 0; imc < imcs; imc++) {
- for (j = 0; j < 2; j++)
- membw_ioctl_perf_event_ioc_disable(imc, j);
+ membw_ioctl_perf_event_ioc_disable(imc, READ);
+ membw_ioctl_perf_event_ioc_disable(imc, WRITE);
}
+}
+
+/*
+ * get_mem_bw_imc - Memory bandwidth as reported by iMC counters
+ * @bw_report: Bandwidth report type (reads, writes)
+ *
+ * Memory bandwidth utilized by a process on a socket can be calculated
+ * using iMC counters. Perf events are used to read these counters.
+ *
+ * Return: = 0 on success. < 0 on failure.
+ */
+static int get_mem_bw_imc(const char *bw_report, float *bw_imc)
+{
+ float reads, writes, of_mul_read, of_mul_write;
+ int imc;
+
+ /* Start all iMC counters to log values (both read and write) */
+ reads = 0, writes = 0, of_mul_read = 1, of_mul_write = 1;
/*
* Get results which are stored in struct type imc_counter_config
- * Take over flow into consideration before calculating total b/w
+ * Take overflow into consideration before calculating total bandwidth.
*/
for (imc = 0; imc < imcs; imc++) {
struct imc_counter_config *r =
@@ -340,15 +369,13 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
if (read(r->fd, &r->return_value,
sizeof(struct membw_read_format)) == -1) {
- ksft_perror("Couldn't get read b/w through iMC");
-
+ ksft_perror("Couldn't get read bandwidth through iMC");
return -1;
}
if (read(w->fd, &w->return_value,
sizeof(struct membw_read_format)) == -1) {
- ksft_perror("Couldn't get write bw through iMC");
-
+ ksft_perror("Couldn't get write bandwidth through iMC");
return -1;
}
@@ -369,11 +396,6 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
writes += w->return_value.value * of_mul_write * SCALE;
}
- for (imc = 0; imc < imcs; imc++) {
- close(imc_counters_config[imc][READ].fd);
- close(imc_counters_config[imc][WRITE].fd);
- }
-
if (strcmp(bw_report, "reads") == 0) {
*bw_imc = reads;
return 0;
@@ -388,84 +410,45 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
return 0;
}
-void set_mbm_path(const char *ctrlgrp, const char *mongrp, int domain_id)
+/*
+ * initialize_mem_bw_resctrl: Appropriately populate "mbm_total_path"
+ * @param: Parameters passed to resctrl_val()
+ * @domain_id: Domain ID (cache ID; for MB, L3 cache ID)
+ */
+void initialize_mem_bw_resctrl(const struct resctrl_val_param *param,
+ int domain_id)
{
- if (ctrlgrp && mongrp)
- sprintf(mbm_total_path, CON_MON_MBM_LOCAL_BYTES_PATH,
- RESCTRL_PATH, ctrlgrp, mongrp, domain_id);
- else if (!ctrlgrp && mongrp)
- sprintf(mbm_total_path, MON_MBM_LOCAL_BYTES_PATH, RESCTRL_PATH,
- mongrp, domain_id);
- else if (ctrlgrp && !mongrp)
- sprintf(mbm_total_path, CON_MBM_LOCAL_BYTES_PATH, RESCTRL_PATH,
- ctrlgrp, domain_id);
- else if (!ctrlgrp && !mongrp)
- sprintf(mbm_total_path, MBM_LOCAL_BYTES_PATH, RESCTRL_PATH,
- domain_id);
+ sprintf(mbm_total_path, CON_MBM_LOCAL_BYTES_PATH, RESCTRL_PATH,
+ param->ctrlgrp, domain_id);
}
/*
- * initialize_mem_bw_resctrl: Appropriately populate "mbm_total_path"
- * @ctrlgrp: Name of the control monitor group (con_mon grp)
- * @mongrp: Name of the monitor group (mon grp)
- * @cpu_no: CPU number that the benchmark PID is binded to
- * @resctrl_val: Resctrl feature (Eg: mbm, mba.. etc)
+ * Open file to read MBM local bytes from resctrl FS
*/
-static void initialize_mem_bw_resctrl(const char *ctrlgrp, const char *mongrp,
- int cpu_no, char *resctrl_val)
+static FILE *open_mem_bw_resctrl(const char *mbm_bw_file)
{
- int domain_id;
-
- if (get_domain_id("MB", cpu_no, &domain_id) < 0) {
- ksft_print_msg("Could not get domain ID\n");
- return;
- }
+ FILE *fp;
- if (!strncmp(resctrl_val, MBM_STR, sizeof(MBM_STR)))
- set_mbm_path(ctrlgrp, mongrp, domain_id);
+ fp = fopen(mbm_bw_file, "r");
+ if (!fp)
+ ksft_perror("Failed to open total memory bandwidth file");
- if (!strncmp(resctrl_val, MBA_STR, sizeof(MBA_STR))) {
- if (ctrlgrp)
- sprintf(mbm_total_path, CON_MBM_LOCAL_BYTES_PATH,
- RESCTRL_PATH, ctrlgrp, domain_id);
- else
- sprintf(mbm_total_path, MBM_LOCAL_BYTES_PATH,
- RESCTRL_PATH, domain_id);
- }
+ return fp;
}
/*
* Get MBM Local bytes as reported by resctrl FS
- * For MBM,
- * 1. If con_mon grp and mon grp are given, then read from con_mon grp's mon grp
- * 2. If only con_mon grp is given, then read from con_mon grp
- * 3. If both are not given, then read from root con_mon grp
- * For MBA,
- * 1. If con_mon grp is given, then read from it
- * 2. If con_mon grp is not given, then read from root con_mon grp
*/
-static int get_mem_bw_resctrl(unsigned long *mbm_total)
+static int get_mem_bw_resctrl(FILE *fp, unsigned long *mbm_total)
{
- FILE *fp;
-
- fp = fopen(mbm_total_path, "r");
- if (!fp) {
- ksft_perror("Failed to open total bw file");
-
+ if (fscanf(fp, "%lu\n", mbm_total) <= 0) {
+ ksft_perror("Could not get MBM local bytes");
return -1;
}
- if (fscanf(fp, "%lu", mbm_total) <= 0) {
- ksft_perror("Could not get mbm local bytes");
- fclose(fp);
-
- return -1;
- }
- fclose(fp);
-
return 0;
}
-pid_t bm_pid, ppid;
+static pid_t bm_pid, ppid;
void ctrlc_handler(int signum, siginfo_t *info, void *ptr)
{
@@ -523,6 +506,13 @@ void signal_handler_unregister(void)
}
}
+static void parent_exit(pid_t ppid)
+{
+ kill(ppid, SIGKILL);
+ umount_resctrlfs();
+ exit(EXIT_FAILURE);
+}
+
/*
* print_results_bw: the memory bandwidth results are stored in a file
* @filename: file that stores the results
@@ -532,14 +522,14 @@ void signal_handler_unregister(void)
*
* Return: 0 on success, < 0 on error.
*/
-static int print_results_bw(char *filename, int bm_pid, float bw_imc,
+static int print_results_bw(char *filename, pid_t bm_pid, float bw_imc,
unsigned long bw_resc)
{
unsigned long diff = fabs(bw_imc - bw_resc);
FILE *fp;
if (strcmp(filename, "stdio") == 0 || strcmp(filename, "stderr") == 0) {
- printf("Pid: %d \t Mem_BW_iMC: %f \t ", bm_pid, bw_imc);
+ printf("Pid: %d \t Mem_BW_iMC: %f \t ", (int)bm_pid, bw_imc);
printf("Mem_BW_resc: %lu \t Difference: %lu\n", bw_resc, diff);
} else {
fp = fopen(filename, "a");
@@ -549,7 +539,7 @@ static int print_results_bw(char *filename, int bm_pid, float bw_imc,
return -1;
}
if (fprintf(fp, "Pid: %d \t Mem_BW_iMC: %f \t Mem_BW_resc: %lu \t Difference: %lu\n",
- bm_pid, bw_imc, bw_resc, diff) <= 0) {
+ (int)bm_pid, bw_imc, bw_resc, diff) <= 0) {
ksft_print_msg("Could not log results\n");
fclose(fp);
@@ -561,73 +551,67 @@ static int print_results_bw(char *filename, int bm_pid, float bw_imc,
return 0;
}
-static void set_cmt_path(const char *ctrlgrp, const char *mongrp, char sock_num)
-{
- if (strlen(ctrlgrp) && strlen(mongrp))
- sprintf(llc_occup_path, CON_MON_LCC_OCCUP_PATH, RESCTRL_PATH,
- ctrlgrp, mongrp, sock_num);
- else if (!strlen(ctrlgrp) && strlen(mongrp))
- sprintf(llc_occup_path, MON_LCC_OCCUP_PATH, RESCTRL_PATH,
- mongrp, sock_num);
- else if (strlen(ctrlgrp) && !strlen(mongrp))
- sprintf(llc_occup_path, CON_LCC_OCCUP_PATH, RESCTRL_PATH,
- ctrlgrp, sock_num);
- else if (!strlen(ctrlgrp) && !strlen(mongrp))
- sprintf(llc_occup_path, LCC_OCCUP_PATH, RESCTRL_PATH, sock_num);
-}
-
/*
- * initialize_llc_occu_resctrl: Appropriately populate "llc_occup_path"
- * @ctrlgrp: Name of the control monitor group (con_mon grp)
- * @mongrp: Name of the monitor group (mon grp)
- * @cpu_no: CPU number that the benchmark PID is binded to
- * @resctrl_val: Resctrl feature (Eg: cat, cmt.. etc)
+ * measure_mem_bw - Measures memory bandwidth numbers while benchmark runs
+ * @uparams: User supplied parameters
+ * @param: Parameters passed to resctrl_val()
+ * @bm_pid: PID that runs the benchmark
+ * @bw_report: Bandwidth report type (reads, writes)
+ *
+ * Measure memory bandwidth from resctrl and from another source which is
+ * perf imc value or could be something else if perf imc event is not
+ * available. Compare the two values to validate resctrl value. It takes
+ * 1 sec to measure the data.
*/
-static void initialize_llc_occu_resctrl(const char *ctrlgrp, const char *mongrp,
- int cpu_no, char *resctrl_val)
+int measure_mem_bw(const struct user_params *uparams,
+ struct resctrl_val_param *param, pid_t bm_pid,
+ const char *bw_report)
{
- int domain_id;
+ unsigned long bw_resc, bw_resc_start, bw_resc_end;
+ FILE *mem_bw_fp;
+ float bw_imc;
+ int ret;
- if (get_domain_id("L3", cpu_no, &domain_id) < 0) {
- ksft_print_msg("Could not get domain ID\n");
- return;
- }
+ bw_report = get_bw_report_type(bw_report);
+ if (!bw_report)
+ return -1;
- if (!strncmp(resctrl_val, CMT_STR, sizeof(CMT_STR)))
- set_cmt_path(ctrlgrp, mongrp, domain_id);
-}
+ mem_bw_fp = open_mem_bw_resctrl(mbm_total_path);
+ if (!mem_bw_fp)
+ return -1;
-static int measure_vals(const struct user_params *uparams,
- struct resctrl_val_param *param,
- unsigned long *bw_resc_start)
-{
- unsigned long bw_resc, bw_resc_end;
- float bw_imc;
- int ret;
+ ret = perf_open_imc_mem_bw(uparams->cpu);
+ if (ret < 0)
+ goto close_fp;
- /*
- * Measure memory bandwidth from resctrl and from
- * another source which is perf imc value or could
- * be something else if perf imc event is not available.
- * Compare the two values to validate resctrl value.
- * It takes 1sec to measure the data.
- */
- ret = get_mem_bw_imc(uparams->cpu, param->bw_report, &bw_imc);
+ ret = get_mem_bw_resctrl(mem_bw_fp, &bw_resc_start);
if (ret < 0)
- return ret;
+ goto close_imc;
+
+ rewind(mem_bw_fp);
+
+ do_imc_mem_bw_test();
- ret = get_mem_bw_resctrl(&bw_resc_end);
+ ret = get_mem_bw_resctrl(mem_bw_fp, &bw_resc_end);
if (ret < 0)
- return ret;
+ goto close_imc;
- bw_resc = (bw_resc_end - *bw_resc_start) / MB;
- ret = print_results_bw(param->filename, bm_pid, bw_imc, bw_resc);
- if (ret)
- return ret;
+ ret = get_mem_bw_imc(bw_report, &bw_imc);
+ if (ret < 0)
+ goto close_imc;
- *bw_resc_start = bw_resc_end;
+ perf_close_imc_mem_bw();
+ fclose(mem_bw_fp);
- return 0;
+ bw_resc = (bw_resc_end - bw_resc_start) / MB;
+
+ return print_results_bw(param->filename, bm_pid, bw_imc, bw_resc);
+
+close_imc:
+ perf_close_imc_mem_bw();
+close_fp:
+ fclose(mem_bw_fp);
+ return ret;
}
/*
@@ -654,7 +638,7 @@ static void run_benchmark(int signum, siginfo_t *info, void *ucontext)
fp = freopen("/dev/null", "w", stdout);
if (!fp) {
ksft_perror("Unable to direct benchmark status to /dev/null");
- PARENT_EXIT();
+ parent_exit(ppid);
}
if (strcmp(benchmark_cmd[0], "fill_buf") == 0) {
@@ -668,7 +652,7 @@ static void run_benchmark(int signum, siginfo_t *info, void *ucontext)
once = false;
} else {
ksft_print_msg("Invalid once parameter\n");
- PARENT_EXIT();
+ parent_exit(ppid);
}
if (run_fill_buf(span, memflush, operation, once))
@@ -682,7 +666,7 @@ static void run_benchmark(int signum, siginfo_t *info, void *ucontext)
fclose(stdout);
ksft_print_msg("Unable to run specified benchmark\n");
- PARENT_EXIT();
+ parent_exit(ppid);
}
/*
@@ -700,21 +684,19 @@ int resctrl_val(const struct resctrl_test *test,
const char * const *benchmark_cmd,
struct resctrl_val_param *param)
{
- char *resctrl_val = param->resctrl_val;
- unsigned long bw_resc_start = 0;
struct sigaction sigact;
int ret = 0, pipefd[2];
char pipe_message = 0;
union sigval value;
+ int domain_id;
if (strcmp(param->filename, "") == 0)
sprintf(param->filename, "stdio");
- if (!strncmp(resctrl_val, MBA_STR, sizeof(MBA_STR)) ||
- !strncmp(resctrl_val, MBM_STR, sizeof(MBM_STR))) {
- ret = validate_bw_report_request(param->bw_report);
- if (ret)
- return ret;
+ ret = get_domain_id(test->resource, uparams->cpu, &domain_id);
+ if (ret < 0) {
+ ksft_print_msg("Could not get domain ID\n");
+ return ret;
}
/*
@@ -755,7 +737,7 @@ int resctrl_val(const struct resctrl_test *test,
/* Register for "SIGUSR1" signal from parent */
if (sigaction(SIGUSR1, &sigact, NULL)) {
ksft_perror("Can't register child for signal");
- PARENT_EXIT();
+ parent_exit(ppid);
}
/* Tell parent that child is ready */
@@ -773,10 +755,10 @@ int resctrl_val(const struct resctrl_test *test,
sigsuspend(&sigact.sa_mask);
ksft_perror("Child is done");
- PARENT_EXIT();
+ parent_exit(ppid);
}
- ksft_print_msg("Benchmark PID: %d\n", bm_pid);
+ ksft_print_msg("Benchmark PID: %d\n", (int)bm_pid);
/*
* The cast removes constness but nothing mutates benchmark_cmd within
@@ -792,22 +774,15 @@ int resctrl_val(const struct resctrl_test *test,
goto out;
/* Write benchmark to specified control&monitoring grp in resctrl FS */
- ret = write_bm_pid_to_resctrl(bm_pid, param->ctrlgrp, param->mongrp,
- resctrl_val);
+ ret = write_bm_pid_to_resctrl(bm_pid, param->ctrlgrp, param->mongrp);
if (ret)
goto out;
- if (!strncmp(resctrl_val, MBM_STR, sizeof(MBM_STR)) ||
- !strncmp(resctrl_val, MBA_STR, sizeof(MBA_STR))) {
- ret = initialize_mem_bw_imc();
+ if (param->init) {
+ ret = param->init(param, domain_id);
if (ret)
goto out;
-
- initialize_mem_bw_resctrl(param->ctrlgrp, param->mongrp,
- uparams->cpu, resctrl_val);
- } else if (!strncmp(resctrl_val, CMT_STR, sizeof(CMT_STR)))
- initialize_llc_occu_resctrl(param->ctrlgrp, param->mongrp,
- uparams->cpu, resctrl_val);
+ }
/* Parent waits for child to be ready. */
close(pipefd[1]);
@@ -841,17 +816,9 @@ int resctrl_val(const struct resctrl_test *test,
if (ret < 0)
break;
- if (!strncmp(resctrl_val, MBM_STR, sizeof(MBM_STR)) ||
- !strncmp(resctrl_val, MBA_STR, sizeof(MBA_STR))) {
- ret = measure_vals(uparams, param, &bw_resc_start);
- if (ret)
- break;
- } else if (!strncmp(resctrl_val, CMT_STR, sizeof(CMT_STR))) {
- sleep(1);
- ret = measure_llc_resctrl(param->filename, bm_pid);
- if (ret)
- break;
- }
+ ret = param->measure(uparams, param, bm_pid);
+ if (ret)
+ break;
}
out:
diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c
index 1cade75176eb..250c320349a7 100644
--- a/tools/testing/selftests/resctrl/resctrlfs.c
+++ b/tools/testing/selftests/resctrl/resctrlfs.c
@@ -456,6 +456,9 @@ int taskset_restore(pid_t bm_pid, cpu_set_t *old_affinity)
* @grp: Full path and name of the group
* @parent_grp: Full path and name of the parent group
*
+ * Creates a group @grp_name if it does not exist yet. If @grp_name is NULL,
+ * it is interpreted as the root group which always results in success.
+ *
* Return: 0 on success, < 0 on error.
*/
static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
@@ -464,12 +467,7 @@ static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
struct dirent *ep;
DIR *dp;
- /*
- * At this point, we are guaranteed to have resctrl FS mounted and if
- * length of grp_name == 0, it means, user wants to use root con_mon
- * grp, so do nothing
- */
- if (strlen(grp_name) == 0)
+ if (!grp_name)
return 0;
/* Check if requested grp exists or not */
@@ -508,7 +506,7 @@ static int write_pid_to_tasks(char *tasks, pid_t pid)
return -1;
}
- if (fprintf(fp, "%d\n", pid) < 0) {
+ if (fprintf(fp, "%d\n", (int)pid) < 0) {
ksft_print_msg("Failed to write pid to tasks file\n");
fclose(fp);
@@ -524,7 +522,6 @@ static int write_pid_to_tasks(char *tasks, pid_t pid)
* @bm_pid: PID that should be written
* @ctrlgrp: Name of the control monitor group (con_mon grp)
* @mongrp: Name of the monitor group (mon grp)
- * @resctrl_val: Resctrl feature (Eg: mbm, mba.. etc)
*
* If a con_mon grp is requested, create it and write pid to it, otherwise
* write pid to root con_mon grp.
@@ -534,14 +531,13 @@ static int write_pid_to_tasks(char *tasks, pid_t pid)
*
* Return: 0 on success, < 0 on error.
*/
-int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
- char *resctrl_val)
+int write_bm_pid_to_resctrl(pid_t bm_pid, const char *ctrlgrp, const char *mongrp)
{
char controlgroup[128], monitorgroup[512], monitorgroup_p[256];
char tasks[1024];
int ret = 0;
- if (strlen(ctrlgrp))
+ if (ctrlgrp)
sprintf(controlgroup, "%s/%s", RESCTRL_PATH, ctrlgrp);
else
sprintf(controlgroup, "%s", RESCTRL_PATH);
@@ -555,22 +551,19 @@ int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
if (ret)
goto out;
- /* Create mon grp and write pid into it for "mbm" and "cmt" test */
- if (!strncmp(resctrl_val, CMT_STR, sizeof(CMT_STR)) ||
- !strncmp(resctrl_val, MBM_STR, sizeof(MBM_STR))) {
- if (strlen(mongrp)) {
- sprintf(monitorgroup_p, "%s/mon_groups", controlgroup);
- sprintf(monitorgroup, "%s/%s", monitorgroup_p, mongrp);
- ret = create_grp(mongrp, monitorgroup, monitorgroup_p);
- if (ret)
- goto out;
-
- sprintf(tasks, "%s/mon_groups/%s/tasks",
- controlgroup, mongrp);
- ret = write_pid_to_tasks(tasks, bm_pid);
- if (ret)
- goto out;
- }
+ /* Create monitor group and write pid into if it is used */
+ if (mongrp) {
+ sprintf(monitorgroup_p, "%s/mon_groups", controlgroup);
+ sprintf(monitorgroup, "%s/%s", monitorgroup_p, mongrp);
+ ret = create_grp(mongrp, monitorgroup, monitorgroup_p);
+ if (ret)
+ goto out;
+
+ sprintf(tasks, "%s/mon_groups/%s/tasks",
+ controlgroup, mongrp);
+ ret = write_pid_to_tasks(tasks, bm_pid);
+ if (ret)
+ goto out;
}
out:
@@ -593,7 +586,8 @@ out:
*
* Return: 0 on success, < 0 on error.
*/
-int write_schemata(char *ctrlgrp, char *schemata, int cpu_no, const char *resource)
+int write_schemata(const char *ctrlgrp, char *schemata, int cpu_no,
+ const char *resource)
{
char controlgroup[1024], reason[128], schema[1024] = {};
int domain_id, fd, schema_len, ret = 0;
@@ -611,7 +605,7 @@ int write_schemata(char *ctrlgrp, char *schemata, int cpu_no, const char *resour
goto out;
}
- if (strlen(ctrlgrp) != 0)
+ if (ctrlgrp)
sprintf(controlgroup, "%s/%s/schemata", RESCTRL_PATH, ctrlgrp);
else
sprintf(controlgroup, "%s/schemata", RESCTRL_PATH);
@@ -837,22 +831,21 @@ int filter_dmesg(void)
return 0;
}
-int validate_bw_report_request(char *bw_report)
+const char *get_bw_report_type(const char *bw_report)
{
if (strcmp(bw_report, "reads") == 0)
- return 0;
+ return bw_report;
if (strcmp(bw_report, "writes") == 0)
- return 0;
+ return bw_report;
if (strcmp(bw_report, "nt-writes") == 0) {
- strcpy(bw_report, "writes");
- return 0;
+ return "writes";
}
if (strcmp(bw_report, "total") == 0)
- return 0;
+ return bw_report;
- fprintf(stderr, "Requested iMC B/W report type unavailable\n");
+ fprintf(stderr, "Requested iMC bandwidth report type unavailable\n");
- return -1;
+ return NULL;
}
int perf_event_open(struct perf_event_attr *hw_event, pid_t pid, int cpu,
diff --git a/tools/testing/selftests/riscv/sigreturn/sigreturn.c b/tools/testing/selftests/riscv/sigreturn/sigreturn.c
index 62397d5934f1..ed351a1cb917 100644
--- a/tools/testing/selftests/riscv/sigreturn/sigreturn.c
+++ b/tools/testing/selftests/riscv/sigreturn/sigreturn.c
@@ -51,7 +51,7 @@ static int vector_sigreturn(int data, void (*handler)(int, siginfo_t *, void *))
asm(".option push \n\
.option arch, +v \n\
- vsetivli x0, 1, e32, ta, ma \n\
+ vsetivli x0, 1, e32, m1, ta, ma \n\
vmv.s.x v0, %1 \n\
# Generate SIGSEGV \n\
lw a0, 0(x0) \n\
diff --git a/tools/testing/selftests/sched/cs_prctl_test.c b/tools/testing/selftests/sched/cs_prctl_test.c
index 62fba7356af2..52d97fae4dbd 100644
--- a/tools/testing/selftests/sched/cs_prctl_test.c
+++ b/tools/testing/selftests/sched/cs_prctl_test.c
@@ -42,11 +42,11 @@ static pid_t gettid(void)
#ifndef PR_SCHED_CORE
#define PR_SCHED_CORE 62
-# define PR_SCHED_CORE_GET 0
-# define PR_SCHED_CORE_CREATE 1 /* create unique core_sched cookie */
-# define PR_SCHED_CORE_SHARE_TO 2 /* push core_sched cookie to pid */
-# define PR_SCHED_CORE_SHARE_FROM 3 /* pull core_sched cookie to pid */
-# define PR_SCHED_CORE_MAX 4
+#define PR_SCHED_CORE_GET 0
+#define PR_SCHED_CORE_CREATE 1 /* create unique core_sched cookie */
+#define PR_SCHED_CORE_SHARE_TO 2 /* push core_sched cookie to pid */
+#define PR_SCHED_CORE_SHARE_FROM 3 /* pull core_sched cookie to pid */
+#define PR_SCHED_CORE_MAX 4
#endif
#define MAX_PROCESSES 128
diff --git a/tools/testing/selftests/seccomp/seccomp_benchmark.c b/tools/testing/selftests/seccomp/seccomp_benchmark.c
index b83099160fbc..94886c82ae60 100644
--- a/tools/testing/selftests/seccomp/seccomp_benchmark.c
+++ b/tools/testing/selftests/seccomp/seccomp_benchmark.c
@@ -194,14 +194,14 @@ int main(int argc, char *argv[])
ksft_set_plan(7);
ksft_print_msg("Running on:\n");
- ksft_print_msg("");
+ ksft_print_msg("%s", "");
system("uname -a");
ksft_print_msg("Current BPF sysctl settings:\n");
/* Avoid using "sysctl" which may not be installed. */
- ksft_print_msg("");
+ ksft_print_msg("%s", "");
system("grep -H . /proc/sys/net/core/bpf_jit_enable");
- ksft_print_msg("");
+ ksft_print_msg("%s", "");
system("grep -H . /proc/sys/net/core/bpf_jit_harden");
affinity();
diff --git a/tools/testing/selftests/seccomp/seccomp_bpf.c b/tools/testing/selftests/seccomp/seccomp_bpf.c
index 783ebce8c4de..e3f97f90d8db 100644
--- a/tools/testing/selftests/seccomp/seccomp_bpf.c
+++ b/tools/testing/selftests/seccomp/seccomp_bpf.c
@@ -3954,6 +3954,60 @@ TEST(user_notification_filter_empty)
EXPECT_GT((pollfd.revents & POLLHUP) ?: 0, 0);
}
+TEST(user_ioctl_notification_filter_empty)
+{
+ pid_t pid;
+ long ret;
+ int status, p[2];
+ struct __clone_args args = {
+ .flags = CLONE_FILES,
+ .exit_signal = SIGCHLD,
+ };
+ struct seccomp_notif req = {};
+
+ ret = prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0);
+ ASSERT_EQ(0, ret) {
+ TH_LOG("Kernel does not support PR_SET_NO_NEW_PRIVS!");
+ }
+
+ if (__NR_clone3 < 0)
+ SKIP(return, "Test not built with clone3 support");
+
+ ASSERT_EQ(0, pipe(p));
+
+ pid = sys_clone3(&args, sizeof(args));
+ ASSERT_GE(pid, 0);
+
+ if (pid == 0) {
+ int listener;
+
+ listener = user_notif_syscall(__NR_mknodat, SECCOMP_FILTER_FLAG_NEW_LISTENER);
+ if (listener < 0)
+ _exit(EXIT_FAILURE);
+
+ if (dup2(listener, 200) != 200)
+ _exit(EXIT_FAILURE);
+ close(p[1]);
+ close(listener);
+ sleep(1);
+
+ _exit(EXIT_SUCCESS);
+ }
+ if (read(p[0], &status, 1) != 0)
+ _exit(EXIT_SUCCESS);
+ close(p[0]);
+ /*
+ * The seccomp filter has become unused so we should be notified once
+ * the kernel gets around to cleaning up task struct.
+ */
+ EXPECT_EQ(ioctl(200, SECCOMP_IOCTL_NOTIF_RECV, &req), -1);
+ EXPECT_EQ(errno, ENOENT);
+
+ EXPECT_EQ(waitpid(pid, &status, 0), pid);
+ EXPECT_EQ(true, WIFEXITED(status));
+ EXPECT_EQ(0, WEXITSTATUS(status));
+}
+
static void *do_thread(void *data)
{
return NULL;
@@ -4755,6 +4809,83 @@ TEST(user_notification_wait_killable_fatal)
EXPECT_EQ(SIGTERM, WTERMSIG(status));
}
+struct tsync_vs_thread_leader_args {
+ pthread_t leader;
+};
+
+static void *tsync_vs_dead_thread_leader_sibling(void *_args)
+{
+ struct sock_filter allow_filter[] = {
+ BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW),
+ };
+ struct sock_fprog allow_prog = {
+ .len = (unsigned short)ARRAY_SIZE(allow_filter),
+ .filter = allow_filter,
+ };
+ struct tsync_vs_thread_leader_args *args = _args;
+ void *retval;
+ long ret;
+
+ ret = pthread_join(args->leader, &retval);
+ if (ret)
+ exit(1);
+ if (retval != _args)
+ exit(2);
+ ret = seccomp(SECCOMP_SET_MODE_FILTER, SECCOMP_FILTER_FLAG_TSYNC, &allow_prog);
+ if (ret)
+ exit(3);
+
+ exit(0);
+}
+
+/*
+ * Ensure that a dead thread leader doesn't prevent installing new filters with
+ * SECCOMP_FILTER_FLAG_TSYNC from other threads.
+ */
+TEST(tsync_vs_dead_thread_leader)
+{
+ int status;
+ pid_t pid;
+ long ret;
+
+ ret = prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0);
+ ASSERT_EQ(0, ret) {
+ TH_LOG("Kernel does not support PR_SET_NO_NEW_PRIVS!");
+ }
+
+ pid = fork();
+ ASSERT_GE(pid, 0);
+
+ if (pid == 0) {
+ struct sock_filter allow_filter[] = {
+ BPF_STMT(BPF_RET|BPF_K, SECCOMP_RET_ALLOW),
+ };
+ struct sock_fprog allow_prog = {
+ .len = (unsigned short)ARRAY_SIZE(allow_filter),
+ .filter = allow_filter,
+ };
+ struct tsync_vs_thread_leader_args *args;
+ pthread_t sibling;
+
+ args = malloc(sizeof(*args));
+ ASSERT_NE(NULL, args);
+ args->leader = pthread_self();
+
+ ret = pthread_create(&sibling, NULL,
+ tsync_vs_dead_thread_leader_sibling, args);
+ ASSERT_EQ(0, ret);
+
+ /* Install a new filter just to the leader thread. */
+ ret = seccomp(SECCOMP_SET_MODE_FILTER, 0, &allow_prog);
+ ASSERT_EQ(0, ret);
+ pthread_exit(args);
+ exit(1);
+ }
+
+ EXPECT_EQ(pid, waitpid(pid, &status, 0));
+ EXPECT_EQ(0, status);
+}
+
/*
* TODO:
* - expand NNP testing
diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json
index 12da0a939e3e..557fb074acf0 100644
--- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json
+++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/taprio.json
@@ -133,6 +133,50 @@
]
},
{
+ "id": "6f62",
+ "name": "Add taprio Qdisc with too short interval",
+ "category": [
+ "qdisc",
+ "taprio"
+ ],
+ "plugins": {
+ "requires": "nsPlugin"
+ },
+ "setup": [
+ "echo \"1 1 8\" > /sys/bus/netdevsim/new_device"
+ ],
+ "cmdUnderTest": "$TC qdisc add dev $ETH root handle 1: taprio num_tc 2 queues 1@0 1@1 sched-entry S 01 300 sched-entry S 02 1700 clockid CLOCK_TAI",
+ "expExitCode": "2",
+ "verifyCmd": "$TC qdisc show dev $ETH",
+ "matchPattern": "qdisc taprio 1: root refcnt",
+ "matchCount": "0",
+ "teardown": [
+ "echo \"1\" > /sys/bus/netdevsim/del_device"
+ ]
+ },
+ {
+ "id": "831f",
+ "name": "Add taprio Qdisc with too short cycle-time",
+ "category": [
+ "qdisc",
+ "taprio"
+ ],
+ "plugins": {
+ "requires": "nsPlugin"
+ },
+ "setup": [
+ "echo \"1 1 8\" > /sys/bus/netdevsim/new_device"
+ ],
+ "cmdUnderTest": "$TC qdisc add dev $ETH root handle 1: taprio num_tc 2 queues 1@0 1@1 sched-entry S 01 200000 sched-entry S 02 200000 cycle-time 100 clockid CLOCK_TAI",
+ "expExitCode": "2",
+ "verifyCmd": "$TC qdisc show dev $ETH",
+ "matchPattern": "qdisc taprio 1: root refcnt",
+ "matchCount": "0",
+ "teardown": [
+ "echo \"1\" > /sys/bus/netdevsim/del_device"
+ ]
+ },
+ {
"id": "3e1e",
"name": "Add taprio Qdisc with an invalid cycle-time",
"category": [
diff --git a/tools/testing/selftests/timens/exec.c b/tools/testing/selftests/timens/exec.c
index e40dc5be2f66..d12ff955de0d 100644
--- a/tools/testing/selftests/timens/exec.c
+++ b/tools/testing/selftests/timens/exec.c
@@ -30,7 +30,7 @@ int main(int argc, char *argv[])
for (i = 0; i < 2; i++) {
_gettime(CLOCK_MONOTONIC, &tst, i);
- if (abs(tst.tv_sec - now.tv_sec) > 5)
+ if (labs(tst.tv_sec - now.tv_sec) > 5)
return pr_fail("%ld %ld\n", now.tv_sec, tst.tv_sec);
}
return 0;
@@ -50,7 +50,7 @@ int main(int argc, char *argv[])
for (i = 0; i < 2; i++) {
_gettime(CLOCK_MONOTONIC, &tst, i);
- if (abs(tst.tv_sec - now.tv_sec) > 5)
+ if (labs(tst.tv_sec - now.tv_sec) > 5)
return pr_fail("%ld %ld\n",
now.tv_sec, tst.tv_sec);
}
@@ -70,7 +70,7 @@ int main(int argc, char *argv[])
/* Check that a child process is in the new timens. */
for (i = 0; i < 2; i++) {
_gettime(CLOCK_MONOTONIC, &tst, i);
- if (abs(tst.tv_sec - now.tv_sec - OFFSET) > 5)
+ if (labs(tst.tv_sec - now.tv_sec - OFFSET) > 5)
return pr_fail("%ld %ld\n",
now.tv_sec + OFFSET, tst.tv_sec);
}
diff --git a/tools/testing/selftests/timens/timer.c b/tools/testing/selftests/timens/timer.c
index 5e7f0051bd7b..5b939f59dfa4 100644
--- a/tools/testing/selftests/timens/timer.c
+++ b/tools/testing/selftests/timens/timer.c
@@ -56,7 +56,7 @@ int run_test(int clockid, struct timespec now)
return pr_perror("timerfd_gettime");
elapsed = new_value.it_value.tv_sec;
- if (abs(elapsed - 3600) > 60) {
+ if (llabs(elapsed - 3600) > 60) {
ksft_test_result_fail("clockid: %d elapsed: %lld\n",
clockid, elapsed);
return 1;
diff --git a/tools/testing/selftests/timens/timerfd.c b/tools/testing/selftests/timens/timerfd.c
index 9edd43d6b2c1..a4196bbd6e33 100644
--- a/tools/testing/selftests/timens/timerfd.c
+++ b/tools/testing/selftests/timens/timerfd.c
@@ -61,7 +61,7 @@ int run_test(int clockid, struct timespec now)
return pr_perror("timerfd_gettime(%d)", clockid);
elapsed = new_value.it_value.tv_sec;
- if (abs(elapsed - 3600) > 60) {
+ if (llabs(elapsed - 3600) > 60) {
ksft_test_result_fail("clockid: %d elapsed: %lld\n",
clockid, elapsed);
return 1;
diff --git a/tools/testing/selftests/timens/vfork_exec.c b/tools/testing/selftests/timens/vfork_exec.c
index beb7614941fb..5b8907bf451d 100644
--- a/tools/testing/selftests/timens/vfork_exec.c
+++ b/tools/testing/selftests/timens/vfork_exec.c
@@ -32,7 +32,7 @@ static void *tcheck(void *_args)
for (i = 0; i < 2; i++) {
_gettime(CLOCK_MONOTONIC, &tst, i);
- if (abs(tst.tv_sec - now->tv_sec) > 5) {
+ if (labs(tst.tv_sec - now->tv_sec) > 5) {
pr_fail("%s: in-thread: unexpected value: %ld (%ld)\n",
args->tst_name, tst.tv_sec, now->tv_sec);
return (void *)1UL;
@@ -64,7 +64,7 @@ static int check(char *tst_name, struct timespec *now)
for (i = 0; i < 2; i++) {
_gettime(CLOCK_MONOTONIC, &tst, i);
- if (abs(tst.tv_sec - now->tv_sec) > 5)
+ if (labs(tst.tv_sec - now->tv_sec) > 5)
return pr_fail("%s: unexpected value: %ld (%ld)\n",
tst_name, tst.tv_sec, now->tv_sec);
}
diff --git a/tools/testing/selftests/timers/rtcpie.c b/tools/testing/selftests/timers/rtcpie.c
index 4ef2184f1558..7c07edd0d450 100644
--- a/tools/testing/selftests/timers/rtcpie.c
+++ b/tools/testing/selftests/timers/rtcpie.c
@@ -29,7 +29,7 @@ static const char default_rtc[] = "/dev/rtc0";
int main(int argc, char **argv)
{
- int i, fd, retval, irqcount = 0;
+ int i, fd, retval;
unsigned long tmp, data, old_pie_rate;
const char *rtc = default_rtc;
struct timeval start, end, diff;
@@ -120,7 +120,6 @@ int main(int argc, char **argv)
fprintf(stderr, " %d",i);
fflush(stderr);
- irqcount++;
}
/* Disable periodic interrupts */
diff --git a/tools/testing/selftests/vDSO/Makefile b/tools/testing/selftests/vDSO/Makefile
index d53a4d8008f9..98d8ba2afa00 100644
--- a/tools/testing/selftests/vDSO/Makefile
+++ b/tools/testing/selftests/vDSO/Makefile
@@ -1,35 +1,30 @@
# SPDX-License-Identifier: GPL-2.0
-include ../lib.mk
-
uname_M := $(shell uname -m 2>/dev/null || echo not)
ARCH ?= $(shell echo $(uname_M) | sed -e s/i.86/x86/ -e s/x86_64/x86/)
-TEST_GEN_PROGS := $(OUTPUT)/vdso_test_gettimeofday $(OUTPUT)/vdso_test_getcpu
-TEST_GEN_PROGS += $(OUTPUT)/vdso_test_abi
-TEST_GEN_PROGS += $(OUTPUT)/vdso_test_clock_getres
+TEST_GEN_PROGS := vdso_test_gettimeofday
+TEST_GEN_PROGS += vdso_test_getcpu
+TEST_GEN_PROGS += vdso_test_abi
+TEST_GEN_PROGS += vdso_test_clock_getres
ifeq ($(ARCH),$(filter $(ARCH),x86 x86_64))
-TEST_GEN_PROGS += $(OUTPUT)/vdso_standalone_test_x86
+TEST_GEN_PROGS += vdso_standalone_test_x86
endif
-TEST_GEN_PROGS += $(OUTPUT)/vdso_test_correctness
+TEST_GEN_PROGS += vdso_test_correctness
CFLAGS := -std=gnu99
-CFLAGS_vdso_standalone_test_x86 := -nostdlib -fno-asynchronous-unwind-tables -fno-stack-protector
-LDFLAGS_vdso_test_correctness := -ldl
+
ifeq ($(CONFIG_X86_32),y)
LDLIBS += -lgcc_s
endif
-all: $(TEST_GEN_PROGS)
+include ../lib.mk
$(OUTPUT)/vdso_test_gettimeofday: parse_vdso.c vdso_test_gettimeofday.c
$(OUTPUT)/vdso_test_getcpu: parse_vdso.c vdso_test_getcpu.c
$(OUTPUT)/vdso_test_abi: parse_vdso.c vdso_test_abi.c
$(OUTPUT)/vdso_test_clock_getres: vdso_test_clock_getres.c
+
$(OUTPUT)/vdso_standalone_test_x86: vdso_standalone_test_x86.c parse_vdso.c
- $(CC) $(CFLAGS) $(CFLAGS_vdso_standalone_test_x86) \
- vdso_standalone_test_x86.c parse_vdso.c \
- -o $@
+$(OUTPUT)/vdso_standalone_test_x86: CFLAGS +=-nostdlib -fno-asynchronous-unwind-tables -fno-stack-protector
+
$(OUTPUT)/vdso_test_correctness: vdso_test_correctness.c
- $(CC) $(CFLAGS) \
- vdso_test_correctness.c \
- -o $@ \
- $(LDFLAGS_vdso_test_correctness)
+$(OUTPUT)/vdso_test_correctness: LDFLAGS += -ldl
diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c
index 413f75620a35..4ae417372e9e 100644
--- a/tools/testing/selftests/vDSO/parse_vdso.c
+++ b/tools/testing/selftests/vDSO/parse_vdso.c
@@ -55,14 +55,20 @@ static struct vdso_info
ELF(Verdef) *verdef;
} vdso_info;
-/* Straight from the ELF specification. */
-static unsigned long elf_hash(const unsigned char *name)
+/*
+ * Straight from the ELF specification...and then tweaked slightly, in order to
+ * avoid a few clang warnings.
+ */
+static unsigned long elf_hash(const char *name)
{
unsigned long h = 0, g;
- while (*name)
+ const unsigned char *uch_name = (const unsigned char *)name;
+
+ while (*uch_name)
{
- h = (h << 4) + *name++;
- if (g = h & 0xf0000000)
+ h = (h << 4) + *uch_name++;
+ g = h & 0xf0000000;
+ if (g)
h ^= g >> 24;
h &= ~g;
}
diff --git a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c
index 8a44ff973ee1..27f6fdf11969 100644
--- a/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c
+++ b/tools/testing/selftests/vDSO/vdso_standalone_test_x86.c
@@ -18,7 +18,7 @@
#include "parse_vdso.h"
-/* We need a libc functions... */
+/* We need some libc functions... */
int strcmp(const char *a, const char *b)
{
/* This implementation is buggy: it never returns -1. */
@@ -34,6 +34,20 @@ int strcmp(const char *a, const char *b)
return 0;
}
+/*
+ * The clang build needs this, although gcc does not.
+ * Stolen from lib/string.c.
+ */
+void *memcpy(void *dest, const void *src, size_t count)
+{
+ char *tmp = dest;
+ const char *s = src;
+
+ while (count--)
+ *tmp++ = *s++;
+ return dest;
+}
+
/* ...and two syscalls. This is x86-specific. */
static inline long x86_syscall3(long nr, long a0, long a1, long a2)
{
@@ -70,7 +84,7 @@ void to_base10(char *lastdig, time_t n)
}
}
-__attribute__((externally_visible)) void c_main(void **stack)
+void c_main(void **stack)
{
/* Parse the stack */
long argc = (long)*stack;
diff --git a/tools/testing/selftests/wireguard/qemu/Makefile b/tools/testing/selftests/wireguard/qemu/Makefile
index e95bd56b332f..35856b11c143 100644
--- a/tools/testing/selftests/wireguard/qemu/Makefile
+++ b/tools/testing/selftests/wireguard/qemu/Makefile
@@ -109,9 +109,9 @@ KERNEL_ARCH := x86_64
KERNEL_BZIMAGE := $(KERNEL_BUILD_PATH)/arch/x86/boot/bzImage
QEMU_VPORT_RESULT := virtio-serial-device
ifeq ($(HOST_ARCH),$(ARCH))
-QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off -no-acpi
+QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off,acpi=off
else
-QEMU_MACHINE := -cpu max -machine microvm -no-acpi
+QEMU_MACHINE := -cpu max -machine microvm,acpi=off
endif
else ifeq ($(ARCH),i686)
CHOST := i686-linux-musl
@@ -120,9 +120,9 @@ KERNEL_ARCH := x86
KERNEL_BZIMAGE := $(KERNEL_BUILD_PATH)/arch/x86/boot/bzImage
QEMU_VPORT_RESULT := virtio-serial-device
ifeq ($(subst x86_64,i686,$(HOST_ARCH)),$(ARCH))
-QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off -no-acpi
+QEMU_MACHINE := -cpu host -machine microvm,accel=kvm,pit=off,pic=off,rtc=off,acpi=off
else
-QEMU_MACHINE := -cpu coreduo -machine microvm -no-acpi
+QEMU_MACHINE := -cpu coreduo -machine microvm,acpi=off
endif
else ifeq ($(ARCH),mips64)
CHOST := mips64-linux-musl
diff --git a/tools/testing/selftests/x86/Makefile b/tools/testing/selftests/x86/Makefile
index 0b872c0a42d2..5c8757a25998 100644
--- a/tools/testing/selftests/x86/Makefile
+++ b/tools/testing/selftests/x86/Makefile
@@ -40,6 +40,13 @@ CFLAGS := -O2 -g -std=gnu99 -pthread -Wall $(KHDR_INCLUDES)
# call32_from_64 in thunks.S uses absolute addresses.
ifeq ($(CAN_BUILD_WITH_NOPIE),1)
CFLAGS += -no-pie
+
+ifneq ($(LLVM),)
+# clang only wants to see -no-pie during linking. Here, we don't have a separate
+# linking stage, so a compiler warning is unavoidable without (wastefully)
+# restructuring the Makefile. Avoid this by simply disabling that warning.
+CFLAGS += -Wno-unused-command-line-argument
+endif
endif
define gen-target-rule-32
@@ -73,10 +80,10 @@ all_64: $(BINARIES_64)
EXTRA_CLEAN := $(BINARIES_32) $(BINARIES_64)
$(BINARIES_32): $(OUTPUT)/%_32: %.c helpers.h
- $(CC) -m32 -o $@ $(CFLAGS) $(EXTRA_CFLAGS) $^ -lrt -ldl -lm
+ $(CC) -m32 -o $@ $(CFLAGS) $(EXTRA_CFLAGS) $< $(EXTRA_FILES) -lrt -ldl -lm
$(BINARIES_64): $(OUTPUT)/%_64: %.c helpers.h
- $(CC) -m64 -o $@ $(CFLAGS) $(EXTRA_CFLAGS) $^ -lrt -ldl
+ $(CC) -m64 -o $@ $(CFLAGS) $(EXTRA_CFLAGS) $< $(EXTRA_FILES) -lrt -ldl
# x86_64 users should be encouraged to install 32-bit libraries
ifeq ($(CAN_BUILD_I386)$(CAN_BUILD_X86_64),01)
@@ -100,10 +107,22 @@ warn_32bit_failure:
exit 0;
endif
-# Some tests have additional dependencies.
-$(OUTPUT)/sysret_ss_attrs_64: thunks.S
-$(OUTPUT)/ptrace_syscall_32: raw_syscall_helper_32.S
-$(OUTPUT)/test_syscall_vdso_32: thunks_32.S
+# Add an additional file to the source file list for a given target, and also
+# add a Makefile dependency on that same file. However, do these separately, so
+# that the compiler invocation ("$(CC) file1.c file2.S") is not combined with
+# the dependencies ("header3.h"), because clang, unlike gcc, will not accept
+# header files as an input to the compiler invocation.
+define extra-files
+$(OUTPUT)/$(1): EXTRA_FILES := $(2)
+$(OUTPUT)/$(1): $(2)
+endef
+
+$(eval $(call extra-files,sysret_ss_attrs_64,thunks.S))
+$(eval $(call extra-files,ptrace_syscall_32,raw_syscall_helper_32.S))
+$(eval $(call extra-files,test_syscall_vdso_32,thunks_32.S))
+$(eval $(call extra-files,fsgsbase_restore_64,clang_helpers_64.S))
+$(eval $(call extra-files,fsgsbase_restore_32,clang_helpers_32.S))
+$(eval $(call extra-files,sysret_rip_64,clang_helpers_64.S))
# check_initial_reg_state is special: it needs a custom entry, and it
# needs to be static so that its interpreter doesn't destroy its initial
diff --git a/tools/testing/selftests/x86/amx.c b/tools/testing/selftests/x86/amx.c
index 95aad6d8849b..1fdf35a4d7f6 100644
--- a/tools/testing/selftests/x86/amx.c
+++ b/tools/testing/selftests/x86/amx.c
@@ -39,16 +39,6 @@ struct xsave_buffer {
};
};
-static inline uint64_t xgetbv(uint32_t index)
-{
- uint32_t eax, edx;
-
- asm volatile("xgetbv;"
- : "=a" (eax), "=d" (edx)
- : "c" (index));
- return eax + ((uint64_t)edx << 32);
-}
-
static inline void xsave(struct xsave_buffer *xbuf, uint64_t rfbm)
{
uint32_t rfbm_lo = rfbm;
@@ -164,12 +154,6 @@ static inline void clear_xstate_header(struct xsave_buffer *buffer)
memset(&buffer->header, 0, sizeof(buffer->header));
}
-static inline uint64_t get_xstatebv(struct xsave_buffer *buffer)
-{
- /* XSTATE_BV is at the beginning of the header: */
- return *(uint64_t *)&buffer->header;
-}
-
static inline void set_xstatebv(struct xsave_buffer *buffer, uint64_t bv)
{
/* XSTATE_BV is at the beginning of the header: */
diff --git a/tools/testing/selftests/x86/clang_helpers_32.S b/tools/testing/selftests/x86/clang_helpers_32.S
new file mode 100644
index 000000000000..dc16271bac70
--- /dev/null
+++ b/tools/testing/selftests/x86/clang_helpers_32.S
@@ -0,0 +1,11 @@
+/* SPDX-License-Identifier: GPL-2.0-only */
+/*
+ * 32-bit assembly helpers for asm operations that lack support in both gcc and
+ * clang. For example, clang asm does not support segment prefixes.
+ */
+.global dereference_seg_base
+dereference_seg_base:
+ mov %fs:(0), %eax
+ ret
+
+.section .note.GNU-stack,"",%progbits
diff --git a/tools/testing/selftests/x86/clang_helpers_64.S b/tools/testing/selftests/x86/clang_helpers_64.S
new file mode 100644
index 000000000000..185a69dbf39c
--- /dev/null
+++ b/tools/testing/selftests/x86/clang_helpers_64.S
@@ -0,0 +1,28 @@
+/* SPDX-License-Identifier: GPL-2.0-only */
+/*
+ * 64-bit assembly helpers for asm operations that lack support in both gcc and
+ * clang. For example, clang asm does not support segment prefixes.
+ */
+.global dereference_seg_base
+
+dereference_seg_base:
+ mov %gs:(0), %rax
+ ret
+
+.global test_page
+.global test_syscall_insn
+
+.pushsection ".text", "ax"
+.balign 4096
+test_page: .globl test_page
+ .fill 4094,1,0xcc
+
+test_syscall_insn:
+ syscall
+
+.ifne . - test_page - 4096
+ .error "test page is not one page long"
+.endif
+.popsection
+
+.section .note.GNU-stack,"",%progbits
diff --git a/tools/testing/selftests/x86/fsgsbase.c b/tools/testing/selftests/x86/fsgsbase.c
index 8c780cce941d..50cf32de6313 100644
--- a/tools/testing/selftests/x86/fsgsbase.c
+++ b/tools/testing/selftests/x86/fsgsbase.c
@@ -109,11 +109,6 @@ static inline void wrgsbase(unsigned long gsbase)
asm volatile("wrgsbase %0" :: "r" (gsbase) : "memory");
}
-static inline void wrfsbase(unsigned long fsbase)
-{
- asm volatile("wrfsbase %0" :: "r" (fsbase) : "memory");
-}
-
enum which_base { FS, GS };
static unsigned long read_base(enum which_base which)
@@ -212,7 +207,6 @@ static void mov_0_gs(unsigned long initial_base, bool schedule)
}
static volatile unsigned long remote_base;
-static volatile bool remote_hard_zero;
static volatile unsigned int ftx;
/*
diff --git a/tools/testing/selftests/x86/fsgsbase_restore.c b/tools/testing/selftests/x86/fsgsbase_restore.c
index 6fffadc51579..224058c1e4b2 100644
--- a/tools/testing/selftests/x86/fsgsbase_restore.c
+++ b/tools/testing/selftests/x86/fsgsbase_restore.c
@@ -39,12 +39,11 @@
# define SEG "%fs"
#endif
-static unsigned int dereference_seg_base(void)
-{
- int ret;
- asm volatile ("mov %" SEG ":(0), %0" : "=rm" (ret));
- return ret;
-}
+/*
+ * Defined in clang_helpers_[32|64].S, because unlike gcc, clang inline asm does
+ * not support segmentation prefixes.
+ */
+unsigned int dereference_seg_base(void);
static void init_seg(void)
{
diff --git a/tools/testing/selftests/x86/sigreturn.c b/tools/testing/selftests/x86/sigreturn.c
index 5d7961a5f7f6..0b75b29f794b 100644
--- a/tools/testing/selftests/x86/sigreturn.c
+++ b/tools/testing/selftests/x86/sigreturn.c
@@ -487,7 +487,7 @@ static void sigtrap(int sig, siginfo_t *info, void *ctx_void)
greg_t asm_ss = ctx->uc_mcontext.gregs[REG_CX];
if (asm_ss != sig_ss && sig == SIGTRAP) {
/* Sanity check failure. */
- printf("[FAIL]\tSIGTRAP: ss = %hx, frame ss = %hx, ax = %llx\n",
+ printf("[FAIL]\tSIGTRAP: ss = %hx, frame ss = %x, ax = %llx\n",
ss, *ssptr(ctx), (unsigned long long)asm_ss);
nerrs++;
}
diff --git a/tools/testing/selftests/x86/syscall_arg_fault.c b/tools/testing/selftests/x86/syscall_arg_fault.c
index 461fa41a4d02..48ab065a76f9 100644
--- a/tools/testing/selftests/x86/syscall_arg_fault.c
+++ b/tools/testing/selftests/x86/syscall_arg_fault.c
@@ -29,7 +29,6 @@ static void sethandler(int sig, void (*handler)(int, siginfo_t *, void *),
err(1, "sigaction");
}
-static volatile sig_atomic_t sig_traps;
static sigjmp_buf jmpbuf;
static volatile sig_atomic_t n_errs;
diff --git a/tools/testing/selftests/x86/sysret_rip.c b/tools/testing/selftests/x86/sysret_rip.c
index 84d74be1d902..b30de9aaa6d4 100644
--- a/tools/testing/selftests/x86/sysret_rip.c
+++ b/tools/testing/selftests/x86/sysret_rip.c
@@ -22,21 +22,13 @@
#include <sys/mman.h>
#include <assert.h>
-
-asm (
- ".pushsection \".text\", \"ax\"\n\t"
- ".balign 4096\n\t"
- "test_page: .globl test_page\n\t"
- ".fill 4094,1,0xcc\n\t"
- "test_syscall_insn:\n\t"
- "syscall\n\t"
- ".ifne . - test_page - 4096\n\t"
- ".error \"test page is not one page long\"\n\t"
- ".endif\n\t"
- ".popsection"
- );
-
+/*
+ * These items are in clang_helpers_64.S, in order to avoid clang inline asm
+ * limitations:
+ */
+void test_syscall_ins(void);
extern const char test_page[];
+
static void const *current_test_page_addr = test_page;
static void sethandler(int sig, void (*handler)(int, siginfo_t *, void *),
diff --git a/tools/testing/selftests/x86/test_FISTTP.c b/tools/testing/selftests/x86/test_FISTTP.c
index 09789c0ce3e9..b9ae9d8cebcb 100644
--- a/tools/testing/selftests/x86/test_FISTTP.c
+++ b/tools/testing/selftests/x86/test_FISTTP.c
@@ -25,7 +25,7 @@ int test(void)
feclearexcept(FE_DIVBYZERO|FE_INEXACT|FE_INVALID|FE_OVERFLOW|FE_UNDERFLOW);
asm volatile ("\n"
" fld1""\n"
- " fisttp res16""\n"
+ " fisttps res16""\n"
" fld1""\n"
" fisttpl res32""\n"
" fld1""\n"
@@ -45,7 +45,7 @@ int test(void)
feclearexcept(FE_DIVBYZERO|FE_INEXACT|FE_INVALID|FE_OVERFLOW|FE_UNDERFLOW);
asm volatile ("\n"
" fldpi""\n"
- " fisttp res16""\n"
+ " fisttps res16""\n"
" fldpi""\n"
" fisttpl res32""\n"
" fldpi""\n"
@@ -66,7 +66,7 @@ int test(void)
asm volatile ("\n"
" fldpi""\n"
" fchs""\n"
- " fisttp res16""\n"
+ " fisttps res16""\n"
" fldpi""\n"
" fchs""\n"
" fisttpl res32""\n"
@@ -88,7 +88,7 @@ int test(void)
feclearexcept(FE_DIVBYZERO|FE_INEXACT|FE_INVALID|FE_OVERFLOW|FE_UNDERFLOW);
asm volatile ("\n"
" fldln2""\n"
- " fisttp res16""\n"
+ " fisttps res16""\n"
" fldln2""\n"
" fisttpl res32""\n"
" fldln2""\n"
diff --git a/tools/testing/selftests/x86/test_vsyscall.c b/tools/testing/selftests/x86/test_vsyscall.c
index d4c8e8d79d38..6de11b4df458 100644
--- a/tools/testing/selftests/x86/test_vsyscall.c
+++ b/tools/testing/selftests/x86/test_vsyscall.c
@@ -97,11 +97,6 @@ static inline long sys_gtod(struct timeval *tv, struct timezone *tz)
return syscall(SYS_gettimeofday, tv, tz);
}
-static inline int sys_clock_gettime(clockid_t id, struct timespec *ts)
-{
- return syscall(SYS_clock_gettime, id, ts);
-}
-
static inline long sys_time(time_t *t)
{
return syscall(SYS_time, t);
@@ -252,7 +247,7 @@ static void test_getcpu(int cpu)
if (ret_sys == 0) {
if (cpu_sys != cpu)
- ksft_print_msg("syscall reported CPU %hu but should be %d\n",
+ ksft_print_msg("syscall reported CPU %u but should be %d\n",
cpu_sys, cpu);
have_node = true;
@@ -270,10 +265,10 @@ static void test_getcpu(int cpu)
if (cpu_vdso != cpu || node_vdso != node) {
if (cpu_vdso != cpu)
- ksft_print_msg("vDSO reported CPU %hu but should be %d\n",
+ ksft_print_msg("vDSO reported CPU %u but should be %d\n",
cpu_vdso, cpu);
if (node_vdso != node)
- ksft_print_msg("vDSO reported node %hu but should be %hu\n",
+ ksft_print_msg("vDSO reported node %u but should be %u\n",
node_vdso, node);
ksft_test_result_fail("Wrong values\n");
} else {
@@ -295,10 +290,10 @@ static void test_getcpu(int cpu)
if (cpu_vsys != cpu || node_vsys != node) {
if (cpu_vsys != cpu)
- ksft_print_msg("vsyscall reported CPU %hu but should be %d\n",
+ ksft_print_msg("vsyscall reported CPU %u but should be %d\n",
cpu_vsys, cpu);
if (node_vsys != node)
- ksft_print_msg("vsyscall reported node %hu but should be %hu\n",
+ ksft_print_msg("vsyscall reported node %u but should be %u\n",
node_vsys, node);
ksft_test_result_fail("Wrong values\n");
} else {
diff --git a/tools/testing/selftests/x86/vdso_restorer.c b/tools/testing/selftests/x86/vdso_restorer.c
index fe99f2434155..ac8d8e1e9805 100644
--- a/tools/testing/selftests/x86/vdso_restorer.c
+++ b/tools/testing/selftests/x86/vdso_restorer.c
@@ -92,4 +92,6 @@ int main()
printf("[FAIL]\t!SA_SIGINFO handler was not called\n");
nerrs++;
}
+
+ return nerrs;
}
diff --git a/tools/testing/vsock/Makefile b/tools/testing/vsock/Makefile
index a7f56a09ca9f..6e0b4e95e230 100644
--- a/tools/testing/vsock/Makefile
+++ b/tools/testing/vsock/Makefile
@@ -13,3 +13,16 @@ CFLAGS += -g -O2 -Werror -Wall -I. -I../../include -I../../../usr/include -Wno-p
clean:
${RM} *.o *.d vsock_test vsock_diag_test vsock_perf vsock_uring_test
-include *.d
+
+VSOCK_INSTALL_PATH ?=
+
+install: all
+ifdef VSOCK_INSTALL_PATH
+ mkdir -p $(VSOCK_INSTALL_PATH)
+ install -m 744 vsock_test $(VSOCK_INSTALL_PATH)
+ install -m 744 vsock_perf $(VSOCK_INSTALL_PATH)
+ install -m 744 vsock_diag_test $(VSOCK_INSTALL_PATH)
+ install -m 744 vsock_uring_test $(VSOCK_INSTALL_PATH)
+else
+ $(error Error: set VSOCK_INSTALL_PATH to use install)
+endif