summaryrefslogtreecommitdiff
path: root/tools
diff options
context:
space:
mode:
Diffstat (limited to 'tools')
-rw-r--r--tools/arch/arm64/include/uapi/asm/kvm.h6
-rw-r--r--tools/arch/x86/include/asm/cpufeatures.h11
-rw-r--r--tools/arch/x86/include/uapi/asm/kvm.h1
-rw-r--r--tools/bpf/bpftool/prog.c17
-rw-r--r--tools/hv/.gitignore3
-rw-r--r--tools/hv/hv_fcopy_uio_daemon.c12
-rwxr-xr-xtools/hv/hv_get_dns_info.sh4
-rw-r--r--tools/hv/hv_kvp_daemon.c9
-rwxr-xr-xtools/hv/hv_set_ifconfig.sh2
-rw-r--r--tools/include/linux/objtool_types.h12
-rw-r--r--tools/include/nolibc/sys.h18
-rw-r--r--tools/include/uapi/asm-generic/mman.h4
-rw-r--r--tools/include/uapi/asm-generic/socket.h2
-rw-r--r--tools/include/uapi/asm-generic/unistd.h11
-rw-r--r--tools/include/uapi/drm/drm.h17
-rw-r--r--tools/include/uapi/linux/if_link.h2
-rw-r--r--tools/include/uapi/linux/kvm.h8
-rw-r--r--tools/include/uapi/linux/perf_event.h11
-rw-r--r--tools/include/uapi/linux/stddef.h15
-rw-r--r--tools/lib/perf/evlist.c18
-rw-r--r--tools/net/ynl/Makefile29
-rw-r--r--tools/net/ynl/generated/.gitignore1
-rw-r--r--tools/net/ynl/generated/Makefile51
-rw-r--r--tools/net/ynl/lib/.gitignore1
-rw-r--r--tools/net/ynl/lib/Makefile1
-rw-r--r--tools/net/ynl/pyproject.toml24
-rw-r--r--tools/net/ynl/pyynl/.gitignore2
-rw-r--r--tools/net/ynl/pyynl/__init__.py0
-rwxr-xr-xtools/net/ynl/pyynl/cli.py (renamed from tools/net/ynl/cli.py)45
-rwxr-xr-xtools/net/ynl/pyynl/ethtool.py (renamed from tools/net/ynl/ethtool.py)7
-rw-r--r--tools/net/ynl/pyynl/lib/__init__.py (renamed from tools/net/ynl/lib/__init__.py)0
-rw-r--r--tools/net/ynl/pyynl/lib/nlspec.py (renamed from tools/net/ynl/lib/nlspec.py)5
-rw-r--r--tools/net/ynl/pyynl/lib/ynl.py (renamed from tools/net/ynl/lib/ynl.py)80
-rwxr-xr-xtools/net/ynl/pyynl/ynl_gen_c.py (renamed from tools/net/ynl/ynl-gen-c.py)201
-rwxr-xr-xtools/net/ynl/pyynl/ynl_gen_rst.py (renamed from tools/net/ynl/ynl-gen-rst.py)0
-rwxr-xr-xtools/net/ynl/ynl-regen.sh2
-rw-r--r--tools/objtool/arch/loongarch/special.c3
-rw-r--r--tools/objtool/arch/powerpc/special.c3
-rw-r--r--tools/objtool/arch/x86/special.c4
-rw-r--r--tools/objtool/check.c435
-rw-r--r--tools/objtool/include/objtool/check.h5
-rw-r--r--tools/objtool/include/objtool/special.h3
-rw-r--r--tools/objtool/noreturns.h1
-rw-r--r--tools/perf/Documentation/perf-arm-spe.txt26
-rw-r--r--tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl4
-rw-r--r--tools/perf/arch/powerpc/entry/syscalls/syscall.tbl4
-rw-r--r--tools/perf/arch/s390/entry/syscalls/syscall.tbl4
-rw-r--r--tools/perf/arch/x86/entry/syscalls/syscall_32.tbl4
-rw-r--r--tools/perf/arch/x86/entry/syscalls/syscall_64.tbl4
-rw-r--r--tools/perf/builtin-ftrace.c3
-rw-r--r--tools/perf/tests/builtin-test.c2
-rw-r--r--tools/perf/tests/expr.c19
-rw-r--r--tools/perf/tests/hwmon_pmu.c29
-rwxr-xr-xtools/perf/trace/beauty/fs_at_flags.sh3
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/fcntl.h5
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/mount.h14
-rw-r--r--tools/perf/trace/beauty/include/uapi/linux/prctl.h27
-rw-r--r--tools/perf/util/build-id.c4
-rw-r--r--tools/perf/util/evsel.c6
-rw-r--r--tools/perf/util/hwmon_pmu.c15
-rw-r--r--tools/perf/util/machine.c2
-rw-r--r--tools/perf/util/probe-event.c2
-rw-r--r--tools/power/cpupower/Makefile8
-rw-r--r--tools/power/cpupower/bindings/python/Makefile10
-rw-r--r--tools/power/cpupower/bindings/python/README25
-rw-r--r--tools/power/cpupower/bindings/python/raw_pylibcpupower.swg5
-rw-r--r--tools/power/cpupower/lib/cpufreq.c18
-rw-r--r--tools/power/cpupower/lib/cpufreq.h8
-rw-r--r--tools/power/cpupower/utils/cpufreq-info.c36
-rw-r--r--tools/power/cpupower/utils/helpers/amd.c18
-rw-r--r--tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c4
-rw-r--r--tools/power/cpupower/utils/idle_monitor/mperf_monitor.c17
-rw-r--r--tools/power/cpupower/utils/idle_monitor/nhm_idle.c2
-rw-r--r--tools/power/cpupower/utils/idle_monitor/snb_idle.c4
-rw-r--r--tools/sched_ext/include/scx/common.bpf.h6
-rw-r--r--tools/sched_ext/scx_central.c2
-rw-r--r--tools/scripts/Makefile.arch4
-rw-r--r--tools/testing/cxl/cxl_core_exports.c2
-rw-r--r--tools/testing/cxl/test/cxl.c4
-rw-r--r--tools/testing/cxl/test/mem.c2
-rw-r--r--tools/testing/cxl/test/mock.c28
-rwxr-xr-xtools/testing/kunit/kunit.py11
-rw-r--r--tools/testing/kunit/kunit_kernel.py3
-rw-r--r--tools/testing/kunit/qemu_configs/arm64.py2
-rw-r--r--tools/testing/nvdimm/test/ndtest.c2
-rw-r--r--tools/testing/selftests/acct/acct_syscall.c2
-rw-r--r--tools/testing/selftests/alsa/Makefile2
-rw-r--r--tools/testing/selftests/arm64/abi/hwcap.c235
-rw-r--r--tools/testing/selftests/arm64/abi/syscall-abi-asm.S32
-rw-r--r--tools/testing/selftests/arm64/fp/kernel-test.c3
-rw-r--r--tools/testing/selftests/bpf/.gitignore1
-rw-r--r--tools/testing/selftests/bpf/Makefile3
-rw-r--r--tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c (renamed from tools/testing/selftests/bpf/test_lpm_map.c)405
-rw-r--r--tools/testing/selftests/bpf/map_tests/task_storage_map.c4
-rw-r--r--tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c107
-rw-r--r--tools/testing/selftests/bpf/prog_tests/raw_tp_null.c3
-rw-r--r--tools/testing/selftests/bpf/prog_tests/socket_helpers.h394
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockmap_basic.c136
-rw-r--r--tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h385
-rw-r--r--tools/testing/selftests/bpf/prog_tests/task_local_storage.c2
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_change_tail.c62
-rw-r--r--tools/testing/selftests/bpf/prog_tests/tc_netkit.c49
-rw-r--r--tools/testing/selftests/bpf/prog_tests/verifier.c19
-rw-r--r--tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c87
-rw-r--r--tools/testing/selftests/bpf/progs/bpf_misc.h12
-rw-r--r--tools/testing/selftests/bpf/progs/changes_pkt_data.c39
-rw-r--r--tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c18
-rw-r--r--tools/testing/selftests/bpf/progs/dynptr_fail.c22
-rw-r--r--tools/testing/selftests/bpf/progs/iters.c26
-rw-r--r--tools/testing/selftests/bpf/progs/iters_state_safety.c14
-rw-r--r--tools/testing/selftests/bpf/progs/iters_testmod_seq.c4
-rw-r--r--tools/testing/selftests/bpf/progs/raw_tp_null.c19
-rw-r--r--tools/testing/selftests/bpf/progs/raw_tp_null_fail.c24
-rw-r--r--tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c4
-rw-r--r--tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c4
-rw-r--r--tools/testing/selftests/bpf/progs/tc_bpf2bpf.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c2
-rw-r--r--tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c40
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_change_tail.c106
-rw-r--r--tools/testing/selftests/bpf/progs/test_tc_link.c15
-rw-r--r--tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c6
-rw-r--r--tools/testing/selftests/bpf/progs/test_xdp_meta.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_bits_iter.c8
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c40
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_d_path.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_mtu.c4
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_sock.c56
-rw-r--r--tools/testing/selftests/bpf/progs/verifier_spill_fill.c35
-rw-r--r--tools/testing/selftests/bpf/sdt.h2
-rw-r--r--tools/testing/selftests/bpf/test_loader.c46
-rw-r--r--tools/testing/selftests/bpf/test_sockmap.c6
-rwxr-xr-xtools/testing/selftests/bpf/test_xdp_meta.sh58
-rw-r--r--tools/testing/selftests/bpf/trace_helpers.c4
-rw-r--r--tools/testing/selftests/bpf/xdp_hw_metadata.c3
-rwxr-xr-xtools/testing/selftests/cgroup/test_cpuset_prs.sh33
-rw-r--r--tools/testing/selftests/coredump/Makefile7
-rw-r--r--tools/testing/selftests/coredump/README.rst50
-rwxr-xr-xtools/testing/selftests/coredump/stackdump14
-rw-r--r--tools/testing/selftests/coredump/stackdump_test.c151
-rw-r--r--tools/testing/selftests/cpufreq/.gitignore2
-rw-r--r--tools/testing/selftests/cpufreq/Makefile1
-rw-r--r--tools/testing/selftests/damon/Makefile2
-rw-r--r--tools/testing/selftests/drivers/net/Makefile3
-rw-r--r--tools/testing/selftests/drivers/net/bonding/Makefile2
-rwxr-xr-xtools/testing/selftests/drivers/net/bonding/bond_macvlan.sh99
-rwxr-xr-xtools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh96
-rw-r--r--tools/testing/selftests/drivers/net/bonding/config1
-rwxr-xr-xtools/testing/selftests/drivers/net/hds.py120
-rw-r--r--tools/testing/selftests/drivers/net/hw/ncdevmem.c3
-rwxr-xr-xtools/testing/selftests/drivers/net/hw/pp_alloc_fail.py6
-rwxr-xr-xtools/testing/selftests/drivers/net/hw/rss_ctx.py12
-rw-r--r--tools/testing/selftests/drivers/net/lib/py/env.py10
-rw-r--r--tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh225
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_lag.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh1
-rwxr-xr-xtools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh55
-rwxr-xr-xtools/testing/selftests/drivers/net/netcons_basic.sh218
-rwxr-xr-xtools/testing/selftests/drivers/net/netcons_overflow.sh67
-rwxr-xr-xtools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh9
-rwxr-xr-xtools/testing/selftests/drivers/net/queues.py51
-rwxr-xr-xtools/testing/selftests/drivers/net/stats.py113
-rw-r--r--tools/testing/selftests/exec/.gitignore4
-rw-r--r--tools/testing/selftests/exec/Makefile19
-rwxr-xr-xtools/testing/selftests/exec/check-exec-tests.sh205
-rw-r--r--tools/testing/selftests/exec/check-exec.c456
-rw-r--r--tools/testing/selftests/exec/config2
-rw-r--r--tools/testing/selftests/exec/execveat.c75
-rw-r--r--tools/testing/selftests/exec/false.c5
-rw-r--r--tools/testing/selftests/filesystems/nsfs/.gitignore (renamed from tools/testing/selftests/nsfs/.gitignore)1
-rw-r--r--tools/testing/selftests/filesystems/nsfs/Makefile (renamed from tools/testing/selftests/nsfs/Makefile)4
-rw-r--r--tools/testing/selftests/filesystems/nsfs/config (renamed from tools/testing/selftests/nsfs/config)0
-rw-r--r--tools/testing/selftests/filesystems/nsfs/iterate_mntns.c149
-rw-r--r--tools/testing/selftests/filesystems/nsfs/owner.c (renamed from tools/testing/selftests/nsfs/owner.c)0
-rw-r--r--tools/testing/selftests/filesystems/nsfs/pidns.c (renamed from tools/testing/selftests/nsfs/pidns.c)0
-rw-r--r--tools/testing/selftests/filesystems/statmount/.gitignore1
-rw-r--r--tools/testing/selftests/filesystems/statmount/Makefile2
-rw-r--r--tools/testing/selftests/filesystems/statmount/listmount_test.c66
-rw-r--r--tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc8
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc19
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc4
-rw-r--r--tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc4
-rw-r--r--tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc2
-rw-r--r--tools/testing/selftests/hid/.gitignore1
-rw-r--r--tools/testing/selftests/hid/progs/hid_bpf_helpers.h19
-rwxr-xr-xtools/testing/selftests/hid/run-hid-tools-tests.sh16
-rw-r--r--tools/testing/selftests/iommu/iommufd_fail_nth.c14
-rw-r--r--tools/testing/selftests/ipc/msgque.c2
-rw-r--r--tools/testing/selftests/kselftest.h28
-rw-r--r--tools/testing/selftests/kselftest/ksft.py3
-rw-r--r--tools/testing/selftests/kselftest/ktap_helpers.sh21
-rw-r--r--tools/testing/selftests/kselftest_harness.h24
-rw-r--r--tools/testing/selftests/kvm/aarch64/set_id_regs.c1
-rw-r--r--tools/testing/selftests/kvm/s390x/ucontrol_test.c172
-rw-r--r--tools/testing/selftests/landlock/Makefile6
-rw-r--r--tools/testing/selftests/landlock/common.h38
-rw-r--r--tools/testing/selftests/landlock/fs_test.c178
-rw-r--r--tools/testing/selftests/landlock/ptrace_test.c2
-rw-r--r--tools/testing/selftests/landlock/sandbox-and-launch.c82
-rw-r--r--tools/testing/selftests/landlock/wait-pipe.c42
-rw-r--r--tools/testing/selftests/landlock/wrappers.h47
-rwxr-xr-xtools/testing/selftests/livepatch/test-callbacks.sh2
-rwxr-xr-xtools/testing/selftests/livepatch/test-sysfs.sh71
-rw-r--r--tools/testing/selftests/lsm/lsm_set_self_attr_test.c7
-rw-r--r--tools/testing/selftests/media_tests/regression_test.txt8
-rw-r--r--tools/testing/selftests/memfd/memfd_test.c57
-rw-r--r--tools/testing/selftests/mm/cow.c8
-rw-r--r--tools/testing/selftests/mm/hugetlb_dio.c14
-rw-r--r--tools/testing/selftests/net/Makefile2
-rw-r--r--tools/testing/selftests/net/busy_poller.c88
-rw-r--r--tools/testing/selftests/net/cmsg_sender.c11
-rwxr-xr-xtools/testing/selftests/net/cmsg_so_priority.sh151
-rwxr-xr-xtools/testing/selftests/net/cmsg_time.sh35
-rwxr-xr-xtools/testing/selftests/net/fdb_notify.sh6
-rwxr-xr-xtools/testing/selftests/net/fib_rule_tests.sh31
-rw-r--r--tools/testing/selftests/net/forwarding/Makefile1
-rwxr-xr-xtools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh25
-rw-r--r--tools/testing/selftests/net/forwarding/lib.sh11
-rwxr-xr-xtools/testing/selftests/net/forwarding/local_termination.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/router_bridge_lag.sh1
-rwxr-xr-xtools/testing/selftests/net/forwarding/vxlan_reserved.sh352
-rw-r--r--tools/testing/selftests/net/ipsec.c3
-rw-r--r--tools/testing/selftests/net/lib.sh68
-rw-r--r--tools/testing/selftests/net/lib/py/ksft.py5
-rw-r--r--tools/testing/selftests/net/lib/py/utils.py6
-rw-r--r--tools/testing/selftests/net/lib/py/ynl.py20
-rw-r--r--tools/testing/selftests/net/mptcp/mptcp_connect.c43
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_connect.sh13
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_join.sh9
-rw-r--r--tools/testing/selftests/net/mptcp/mptcp_lib.sh21
-rwxr-xr-xtools/testing/selftests/net/mptcp/mptcp_sockopt.sh17
-rwxr-xr-xtools/testing/selftests/net/mptcp/simult_flows.sh21
-rwxr-xr-xtools/testing/selftests/net/netfilter/rpath.sh18
-rwxr-xr-xtools/testing/selftests/net/nl_netdev.py19
-rwxr-xr-xtools/testing/selftests/net/openvswitch/openvswitch.sh6
-rwxr-xr-xtools/testing/selftests/net/packetdrill/ksft_runner.sh24
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt18
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt13
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt29
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt35
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt23
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt21
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt36
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt21
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt38
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt72
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt36
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt72
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt50
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt43
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt41
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt53
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt50
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt40
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt43
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt37
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt64
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt66
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt62
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt26
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt20
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt42
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt30
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt20
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt54
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt38
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt92
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt91
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt145
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt23
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt25
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt37
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt32
-rw-r--r--tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt24
-rw-r--r--tools/testing/selftests/net/tls.c478
-rwxr-xr-xtools/testing/selftests/net/udpgso_bench.sh3
-rwxr-xr-xtools/testing/selftests/net/vlan_bridge_binding.sh256
-rw-r--r--tools/testing/selftests/net/ynl.mk3
-rw-r--r--tools/testing/selftests/nolibc/Makefile11
-rw-r--r--tools/testing/selftests/nolibc/nolibc-test.c44
-rwxr-xr-xtools/testing/selftests/nolibc/run-tests.sh9
-rw-r--r--tools/testing/selftests/pid_namespace/.gitignore1
-rw-r--r--tools/testing/selftests/pid_namespace/Makefile2
-rw-r--r--tools/testing/selftests/pid_namespace/pid_max.c358
-rw-r--r--tools/testing/selftests/pidfd/.gitignore2
-rw-r--r--tools/testing/selftests/pidfd/Makefile3
-rw-r--r--tools/testing/selftests/pidfd/pidfd.h40
-rw-r--r--tools/testing/selftests/pidfd/pidfd_bind_mount.c188
-rw-r--r--tools/testing/selftests/pidfd/pidfd_file_handle_test.c503
-rw-r--r--tools/testing/selftests/pidfd/pidfd_setns_test.c47
-rw-r--r--tools/testing/selftests/pidfd/pidfd_wait.c47
-rw-r--r--tools/testing/selftests/powerpc/benchmarks/gettimeofday.c2
-rw-r--r--tools/testing/selftests/powerpc/include/pkeys.h8
-rw-r--r--tools/testing/selftests/powerpc/ptrace/core-pkey.c31
-rw-r--r--tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c26
-rw-r--r--tools/testing/selftests/powerpc/vphn/test-vphn.c2
-rwxr-xr-xtools/testing/selftests/rcutorture/bin/kvm-remote.sh25
-rw-r--r--tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot1
-rw-r--r--tools/testing/selftests/resctrl/Makefile1
-rw-r--r--tools/testing/selftests/resctrl/cmt_test.c4
-rw-r--r--tools/testing/selftests/resctrl/mba_test.c2
-rw-r--r--tools/testing/selftests/resctrl/mbm_test.c4
-rw-r--r--tools/testing/selftests/resctrl/resctrl.h6
-rw-r--r--tools/testing/selftests/resctrl/resctrl_tests.c9
-rw-r--r--tools/testing/selftests/resctrl/resctrlfs.c137
-rw-r--r--tools/testing/selftests/ring-buffer/map_test.c8
-rw-r--r--tools/testing/selftests/riscv/abi/pointer_masking.c28
-rw-r--r--tools/testing/selftests/riscv/vector/v_initval_nolibc.c4
-rw-r--r--tools/testing/selftests/riscv/vector/vstate_prctl.c2
-rw-r--r--tools/testing/selftests/rseq/rseq.c32
-rw-r--r--tools/testing/selftests/rseq/rseq.h9
-rwxr-xr-xtools/testing/selftests/run_kselftest.sh2
-rw-r--r--tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/dsp_local_on.bpf.c7
-rw-r--r--tools/testing/selftests/sched_ext/dsp_local_on.c5
-rw-r--r--tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/exit.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/maximal.bpf.c8
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c2
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c4
-rw-r--r--tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c8
-rwxr-xr-xtools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py21
-rw-r--r--tools/testing/selftests/tc-testing/tc-tests/filters/flow.json4
-rw-r--r--tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json20
-rw-r--r--tools/testing/selftests/timers/clocksource-switch.c6
-rw-r--r--tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c41
-rw-r--r--tools/testing/selftests/vDSO/parse_vdso.c110
-rw-r--r--tools/testing/selftests/zram/.gitignore2
-rw-r--r--tools/testing/shared/linux/maple_tree.h2
-rw-r--r--tools/testing/vma/linux/atomic.h2
-rw-r--r--tools/testing/vma/vma.c4
-rw-r--r--tools/testing/vma/vma_internal.h4
-rw-r--r--tools/testing/vsock/README15
-rw-r--r--tools/testing/vsock/control.c9
-rw-r--r--tools/testing/vsock/msg_zerocopy_common.c10
-rw-r--r--tools/testing/vsock/msg_zerocopy_common.h1
-rw-r--r--tools/testing/vsock/util.c175
-rw-r--r--tools/testing/vsock/util.h9
-rw-r--r--tools/testing/vsock/vsock_perf.c20
-rw-r--r--tools/testing/vsock/vsock_test.c340
-rw-r--r--tools/testing/vsock/vsock_test_zerocopy.c2
-rw-r--r--tools/testing/vsock/vsock_uring_test.c2
-rw-r--r--tools/tracing/rtla/src/timerlat_hist.c177
354 files changed, 11360 insertions, 2145 deletions
diff --git a/tools/arch/arm64/include/uapi/asm/kvm.h b/tools/arch/arm64/include/uapi/asm/kvm.h
index 964df31da975..66736ff04011 100644
--- a/tools/arch/arm64/include/uapi/asm/kvm.h
+++ b/tools/arch/arm64/include/uapi/asm/kvm.h
@@ -484,6 +484,12 @@ enum {
*/
#define KVM_SYSTEM_EVENT_RESET_FLAG_PSCI_RESET2 (1ULL << 0)
+/*
+ * Shutdown caused by a PSCI v1.3 SYSTEM_OFF2 call.
+ * Valid only when the system event has a type of KVM_SYSTEM_EVENT_SHUTDOWN.
+ */
+#define KVM_SYSTEM_EVENT_SHUTDOWN_FLAG_PSCI_OFF2 (1ULL << 0)
+
/* run->fail_entry.hardware_entry_failure_reason codes. */
#define KVM_EXIT_FAIL_ENTRY_CPU_UNSUPPORTED (1ULL << 0)
diff --git a/tools/arch/x86/include/asm/cpufeatures.h b/tools/arch/x86/include/asm/cpufeatures.h
index 23698d0f4bb4..17b6590748c0 100644
--- a/tools/arch/x86/include/asm/cpufeatures.h
+++ b/tools/arch/x86/include/asm/cpufeatures.h
@@ -215,7 +215,7 @@
#define X86_FEATURE_SPEC_STORE_BYPASS_DISABLE ( 7*32+23) /* Disable Speculative Store Bypass. */
#define X86_FEATURE_LS_CFG_SSBD ( 7*32+24) /* AMD SSBD implementation via LS_CFG MSR */
#define X86_FEATURE_IBRS ( 7*32+25) /* "ibrs" Indirect Branch Restricted Speculation */
-#define X86_FEATURE_IBPB ( 7*32+26) /* "ibpb" Indirect Branch Prediction Barrier */
+#define X86_FEATURE_IBPB ( 7*32+26) /* "ibpb" Indirect Branch Prediction Barrier without a guaranteed RSB flush */
#define X86_FEATURE_STIBP ( 7*32+27) /* "stibp" Single Thread Indirect Branch Predictors */
#define X86_FEATURE_ZEN ( 7*32+28) /* Generic flag for all Zen and newer */
#define X86_FEATURE_L1TF_PTEINV ( 7*32+29) /* L1TF workaround PTE inversion */
@@ -317,6 +317,9 @@
#define X86_FEATURE_ZEN1 (11*32+31) /* CPU based on Zen1 microarchitecture */
/* Intel-defined CPU features, CPUID level 0x00000007:1 (EAX), word 12 */
+#define X86_FEATURE_SHA512 (12*32+ 0) /* SHA512 instructions */
+#define X86_FEATURE_SM3 (12*32+ 1) /* SM3 instructions */
+#define X86_FEATURE_SM4 (12*32+ 2) /* SM4 instructions */
#define X86_FEATURE_AVX_VNNI (12*32+ 4) /* "avx_vnni" AVX VNNI instructions */
#define X86_FEATURE_AVX512_BF16 (12*32+ 5) /* "avx512_bf16" AVX512 BFLOAT16 instructions */
#define X86_FEATURE_CMPCCXADD (12*32+ 7) /* CMPccXADD instructions */
@@ -348,6 +351,7 @@
#define X86_FEATURE_CPPC (13*32+27) /* "cppc" Collaborative Processor Performance Control */
#define X86_FEATURE_AMD_PSFD (13*32+28) /* Predictive Store Forwarding Disable */
#define X86_FEATURE_BTC_NO (13*32+29) /* Not vulnerable to Branch Type Confusion */
+#define X86_FEATURE_AMD_IBPB_RET (13*32+30) /* IBPB clears return address predictor */
#define X86_FEATURE_BRS (13*32+31) /* "brs" Branch Sampling available */
/* Thermal and Power Management Leaf, CPUID level 0x00000006 (EAX), word 14 */
@@ -472,7 +476,9 @@
#define X86_FEATURE_BHI_CTRL (21*32+ 2) /* BHI_DIS_S HW control available */
#define X86_FEATURE_CLEAR_BHB_HW (21*32+ 3) /* BHI_DIS_S HW control enabled */
#define X86_FEATURE_CLEAR_BHB_LOOP_ON_VMEXIT (21*32+ 4) /* Clear branch history at vmexit using SW loop */
-#define X86_FEATURE_AMD_FAST_CPPC (21*32 + 5) /* AMD Fast CPPC */
+#define X86_FEATURE_AMD_FAST_CPPC (21*32 + 5) /* Fast CPPC */
+#define X86_FEATURE_AMD_HETEROGENEOUS_CORES (21*32 + 6) /* Heterogeneous Core Topology */
+#define X86_FEATURE_AMD_WORKLOAD_CLASS (21*32 + 7) /* Workload Classification */
/*
* BUG word(s)
@@ -523,4 +529,5 @@
#define X86_BUG_DIV0 X86_BUG(1*32 + 1) /* "div0" AMD DIV0 speculation bug */
#define X86_BUG_RFDS X86_BUG(1*32 + 2) /* "rfds" CPU is vulnerable to Register File Data Sampling */
#define X86_BUG_BHI X86_BUG(1*32 + 3) /* "bhi" CPU is affected by Branch History Injection */
+#define X86_BUG_IBPB_NO_RET X86_BUG(1*32 + 4) /* "ibpb_no_ret" IBPB omits return target predictions */
#endif /* _ASM_X86_CPUFEATURES_H */
diff --git a/tools/arch/x86/include/uapi/asm/kvm.h b/tools/arch/x86/include/uapi/asm/kvm.h
index a8debbf2f702..88585c1de416 100644
--- a/tools/arch/x86/include/uapi/asm/kvm.h
+++ b/tools/arch/x86/include/uapi/asm/kvm.h
@@ -440,6 +440,7 @@ struct kvm_sync_regs {
#define KVM_X86_QUIRK_FIX_HYPERCALL_INSN (1 << 5)
#define KVM_X86_QUIRK_MWAIT_NEVER_UD_FAULTS (1 << 6)
#define KVM_X86_QUIRK_SLOT_ZAP_ALL (1 << 7)
+#define KVM_X86_QUIRK_STUFF_FEATURE_MSRS (1 << 8)
#define KVM_STATE_NESTED_FORMAT_VMX 0
#define KVM_STATE_NESTED_FORMAT_SVM 1
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 2ff949ea82fa..e71be67f1d86 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -822,11 +822,18 @@ prog_dump(struct bpf_prog_info *info, enum dump_mode mode,
printf("%s:\n", sym_name);
}
- if (disasm_print_insn(img, lens[i], opcodes,
- name, disasm_opt, btf,
- prog_linfo, ksyms[i], i,
- linum))
- goto exit_free;
+ if (ksyms) {
+ if (disasm_print_insn(img, lens[i], opcodes,
+ name, disasm_opt, btf,
+ prog_linfo, ksyms[i], i,
+ linum))
+ goto exit_free;
+ } else {
+ if (disasm_print_insn(img, lens[i], opcodes,
+ name, disasm_opt, btf,
+ NULL, 0, 0, false))
+ goto exit_free;
+ }
img += lens[i];
diff --git a/tools/hv/.gitignore b/tools/hv/.gitignore
new file mode 100644
index 000000000000..0c5bc15d602f
--- /dev/null
+++ b/tools/hv/.gitignore
@@ -0,0 +1,3 @@
+hv_fcopy_uio_daemon
+hv_kvp_daemon
+hv_vss_daemon
diff --git a/tools/hv/hv_fcopy_uio_daemon.c b/tools/hv/hv_fcopy_uio_daemon.c
index 7a00f3066a98..0198321d14a2 100644
--- a/tools/hv/hv_fcopy_uio_daemon.c
+++ b/tools/hv/hv_fcopy_uio_daemon.c
@@ -35,8 +35,6 @@
#define WIN8_SRV_MINOR 1
#define WIN8_SRV_VERSION (WIN8_SRV_MAJOR << 16 | WIN8_SRV_MINOR)
-#define MAX_FOLDER_NAME 15
-#define MAX_PATH_LEN 15
#define FCOPY_UIO "/sys/bus/vmbus/devices/eb765408-105f-49b6-b4aa-c123b64d17d4/uio"
#define FCOPY_VER_COUNT 1
@@ -51,7 +49,7 @@ static const int fw_versions[] = {
#define HV_RING_SIZE 0x4000 /* 16KB ring buffer size */
-unsigned char desc[HV_RING_SIZE];
+static unsigned char desc[HV_RING_SIZE];
static int target_fd;
static char target_fname[PATH_MAX];
@@ -409,8 +407,8 @@ int main(int argc, char *argv[])
struct vmbus_br txbr, rxbr;
void *ring;
uint32_t len = HV_RING_SIZE;
- char uio_name[MAX_FOLDER_NAME] = {0};
- char uio_dev_path[MAX_PATH_LEN] = {0};
+ char uio_name[NAME_MAX] = {0};
+ char uio_dev_path[PATH_MAX] = {0};
static struct option long_options[] = {
{"help", no_argument, 0, 'h' },
@@ -468,8 +466,10 @@ int main(int argc, char *argv[])
*/
ret = pread(fcopy_fd, &tmp, sizeof(int), 0);
if (ret < 0) {
+ if (errno == EINTR || errno == EAGAIN)
+ continue;
syslog(LOG_ERR, "pread failed: %s", strerror(errno));
- continue;
+ goto close;
}
len = HV_RING_SIZE;
diff --git a/tools/hv/hv_get_dns_info.sh b/tools/hv/hv_get_dns_info.sh
index 058c17b46ffc..268521234d4b 100755
--- a/tools/hv/hv_get_dns_info.sh
+++ b/tools/hv/hv_get_dns_info.sh
@@ -1,4 +1,4 @@
-#!/bin/bash
+#!/bin/sh
# This example script parses /etc/resolv.conf to retrive DNS information.
# In the interest of keeping the KVP daemon code free of distro specific
@@ -10,4 +10,4 @@
# this script can be based on the Network Manager APIs for retrieving DNS
# entries.
-cat /etc/resolv.conf 2>/dev/null | awk '/^nameserver/ { print $2 }'
+exec awk '/^nameserver/ { print $2 }' /etc/resolv.conf 2>/dev/null
diff --git a/tools/hv/hv_kvp_daemon.c b/tools/hv/hv_kvp_daemon.c
index ae57bf69ad4a..04ba035d67e9 100644
--- a/tools/hv/hv_kvp_daemon.c
+++ b/tools/hv/hv_kvp_daemon.c
@@ -725,7 +725,7 @@ static void kvp_get_ipconfig_info(char *if_name,
* .
*/
- sprintf(cmd, KVP_SCRIPTS_PATH "%s", "hv_get_dns_info");
+ sprintf(cmd, "exec %s %s", KVP_SCRIPTS_PATH "hv_get_dns_info", if_name);
/*
* Execute the command to gather DNS info.
@@ -742,7 +742,7 @@ static void kvp_get_ipconfig_info(char *if_name,
* Enabled: DHCP enabled.
*/
- sprintf(cmd, KVP_SCRIPTS_PATH "%s %s", "hv_get_dhcp_info", if_name);
+ sprintf(cmd, "exec %s %s", KVP_SCRIPTS_PATH "hv_get_dhcp_info", if_name);
file = popen(cmd, "r");
if (file == NULL)
@@ -1606,8 +1606,9 @@ static int kvp_set_ip_info(char *if_name, struct hv_kvp_ipaddr_value *new_val)
* invoke the external script to do its magic.
*/
- str_len = snprintf(cmd, sizeof(cmd), KVP_SCRIPTS_PATH "%s %s %s",
- "hv_set_ifconfig", if_filename, nm_filename);
+ str_len = snprintf(cmd, sizeof(cmd), "exec %s %s %s",
+ KVP_SCRIPTS_PATH "hv_set_ifconfig",
+ if_filename, nm_filename);
/*
* This is a little overcautious, but it's necessary to suppress some
* false warnings from gcc 8.0.1.
diff --git a/tools/hv/hv_set_ifconfig.sh b/tools/hv/hv_set_ifconfig.sh
index 440a91b35823..2f8baed2b8f7 100755
--- a/tools/hv/hv_set_ifconfig.sh
+++ b/tools/hv/hv_set_ifconfig.sh
@@ -81,7 +81,7 @@ echo "ONBOOT=yes" >> $1
cp $1 /etc/sysconfig/network-scripts/
-chmod 600 $2
+umask 0177
interface=$(echo $2 | awk -F - '{ print $2 }')
filename="${2##*/}"
diff --git a/tools/include/linux/objtool_types.h b/tools/include/linux/objtool_types.h
index 453a4f4ef39d..df5d9fa84dba 100644
--- a/tools/include/linux/objtool_types.h
+++ b/tools/include/linux/objtool_types.h
@@ -54,4 +54,16 @@ struct unwind_hint {
#define UNWIND_HINT_TYPE_SAVE 6
#define UNWIND_HINT_TYPE_RESTORE 7
+/*
+ * Annotate types
+ */
+#define ANNOTYPE_NOENDBR 1
+#define ANNOTYPE_RETPOLINE_SAFE 2
+#define ANNOTYPE_INSTR_BEGIN 3
+#define ANNOTYPE_INSTR_END 4
+#define ANNOTYPE_UNRET_BEGIN 5
+#define ANNOTYPE_IGNORE_ALTS 6
+#define ANNOTYPE_INTRA_FUNCTION_CALL 7
+#define ANNOTYPE_REACHABLE 8
+
#endif /* _LINUX_OBJTOOL_TYPES_H */
diff --git a/tools/include/nolibc/sys.h b/tools/include/nolibc/sys.h
index 7b82bc3cf107..d4a5c2399a66 100644
--- a/tools/include/nolibc/sys.h
+++ b/tools/include/nolibc/sys.h
@@ -23,6 +23,7 @@
#include <linux/prctl.h>
#include <linux/resource.h>
#include <linux/utsname.h>
+#include <linux/signal.h>
#include "arch.h"
#include "errno.h"
@@ -1226,6 +1227,23 @@ pid_t waitpid(pid_t pid, int *status, int options)
/*
+ * int waitid(idtype_t idtype, id_t id, siginfo_t *infop, int options);
+ */
+
+static __attribute__((unused))
+int sys_waitid(int which, pid_t pid, siginfo_t *infop, int options, struct rusage *rusage)
+{
+ return my_syscall5(__NR_waitid, which, pid, infop, options, rusage);
+}
+
+static __attribute__((unused))
+int waitid(int which, pid_t pid, siginfo_t *infop, int options)
+{
+ return __sysret(sys_waitid(which, pid, infop, options, NULL));
+}
+
+
+/*
* ssize_t write(int fd, const void *buf, size_t count);
*/
diff --git a/tools/include/uapi/asm-generic/mman.h b/tools/include/uapi/asm-generic/mman.h
index 406f7718f9ad..51d2556af54a 100644
--- a/tools/include/uapi/asm-generic/mman.h
+++ b/tools/include/uapi/asm-generic/mman.h
@@ -19,4 +19,8 @@
#define MCL_FUTURE 2 /* lock all future mappings */
#define MCL_ONFAULT 4 /* lock all pages that are faulted in */
+#define SHADOW_STACK_SET_TOKEN (1ULL << 0) /* Set up a restore token in the shadow stack */
+#define SHADOW_STACK_SET_MARKER (1ULL << 1) /* Set up a top of stack marker in the shadow stack */
+
+
#endif /* __ASM_GENERIC_MMAN_H */
diff --git a/tools/include/uapi/asm-generic/socket.h b/tools/include/uapi/asm-generic/socket.h
index 281df9139d2b..ffff554a5230 100644
--- a/tools/include/uapi/asm-generic/socket.h
+++ b/tools/include/uapi/asm-generic/socket.h
@@ -126,6 +126,8 @@
#define SCM_TS_OPT_ID 78
+#define SO_RCVPRIORITY 79
+
#if !defined(__KERNEL__)
#if __BITS_PER_LONG == 64 || (defined(__x86_64__) && defined(__ILP32__))
diff --git a/tools/include/uapi/asm-generic/unistd.h b/tools/include/uapi/asm-generic/unistd.h
index 5bf6148cac2b..88dc393c2bca 100644
--- a/tools/include/uapi/asm-generic/unistd.h
+++ b/tools/include/uapi/asm-generic/unistd.h
@@ -841,8 +841,17 @@ __SYSCALL(__NR_lsm_list_modules, sys_lsm_list_modules)
#define __NR_mseal 462
__SYSCALL(__NR_mseal, sys_mseal)
+#define __NR_setxattrat 463
+__SYSCALL(__NR_setxattrat, sys_setxattrat)
+#define __NR_getxattrat 464
+__SYSCALL(__NR_getxattrat, sys_getxattrat)
+#define __NR_listxattrat 465
+__SYSCALL(__NR_listxattrat, sys_listxattrat)
+#define __NR_removexattrat 466
+__SYSCALL(__NR_removexattrat, sys_removexattrat)
+
#undef __NR_syscalls
-#define __NR_syscalls 463
+#define __NR_syscalls 467
/*
* 32 bit systems traditionally used different
diff --git a/tools/include/uapi/drm/drm.h b/tools/include/uapi/drm/drm.h
index 16122819edfe..7fba37b94401 100644
--- a/tools/include/uapi/drm/drm.h
+++ b/tools/include/uapi/drm/drm.h
@@ -1024,6 +1024,13 @@ struct drm_crtc_queue_sequence {
__u64 user_data; /* user data passed to event */
};
+#define DRM_CLIENT_NAME_MAX_LEN 64
+struct drm_set_client_name {
+ __u64 name_len;
+ __u64 name;
+};
+
+
#if defined(__cplusplus)
}
#endif
@@ -1288,6 +1295,16 @@ extern "C" {
*/
#define DRM_IOCTL_MODE_CLOSEFB DRM_IOWR(0xD0, struct drm_mode_closefb)
+/**
+ * DRM_IOCTL_SET_CLIENT_NAME - Attach a name to a drm_file
+ *
+ * Having a name allows for easier tracking and debugging.
+ * The length of the name (without null ending char) must be
+ * <= DRM_CLIENT_NAME_MAX_LEN.
+ * The call will fail if the name contains whitespaces or non-printable chars.
+ */
+#define DRM_IOCTL_SET_CLIENT_NAME DRM_IOWR(0xD1, struct drm_set_client_name)
+
/*
* Device specific ioctls should only be in their respective headers
* The device specific ioctl range is from 0x40 to 0x9f.
diff --git a/tools/include/uapi/linux/if_link.h b/tools/include/uapi/linux/if_link.h
index 8516c1ccd57a..7e46ca4cd31b 100644
--- a/tools/include/uapi/linux/if_link.h
+++ b/tools/include/uapi/linux/if_link.h
@@ -1315,6 +1315,8 @@ enum {
IFLA_NETKIT_MODE,
IFLA_NETKIT_SCRUB,
IFLA_NETKIT_PEER_SCRUB,
+ IFLA_NETKIT_HEADROOM,
+ IFLA_NETKIT_TAILROOM,
__IFLA_NETKIT_MAX,
};
#define IFLA_NETKIT_MAX (__IFLA_NETKIT_MAX - 1)
diff --git a/tools/include/uapi/linux/kvm.h b/tools/include/uapi/linux/kvm.h
index 637efc055145..502ea63b5d2e 100644
--- a/tools/include/uapi/linux/kvm.h
+++ b/tools/include/uapi/linux/kvm.h
@@ -1158,7 +1158,15 @@ enum kvm_device_type {
#define KVM_DEV_TYPE_ARM_PV_TIME KVM_DEV_TYPE_ARM_PV_TIME
KVM_DEV_TYPE_RISCV_AIA,
#define KVM_DEV_TYPE_RISCV_AIA KVM_DEV_TYPE_RISCV_AIA
+ KVM_DEV_TYPE_LOONGARCH_IPI,
+#define KVM_DEV_TYPE_LOONGARCH_IPI KVM_DEV_TYPE_LOONGARCH_IPI
+ KVM_DEV_TYPE_LOONGARCH_EIOINTC,
+#define KVM_DEV_TYPE_LOONGARCH_EIOINTC KVM_DEV_TYPE_LOONGARCH_EIOINTC
+ KVM_DEV_TYPE_LOONGARCH_PCHPIC,
+#define KVM_DEV_TYPE_LOONGARCH_PCHPIC KVM_DEV_TYPE_LOONGARCH_PCHPIC
+
KVM_DEV_TYPE_MAX,
+
};
struct kvm_vfio_spapr_tce {
diff --git a/tools/include/uapi/linux/perf_event.h b/tools/include/uapi/linux/perf_event.h
index 4842c36fdf80..0524d541d4e3 100644
--- a/tools/include/uapi/linux/perf_event.h
+++ b/tools/include/uapi/linux/perf_event.h
@@ -511,7 +511,16 @@ struct perf_event_attr {
__u16 sample_max_stack;
__u16 __reserved_2;
__u32 aux_sample_size;
- __u32 __reserved_3;
+
+ union {
+ __u32 aux_action;
+ struct {
+ __u32 aux_start_paused : 1, /* start AUX area tracing paused */
+ aux_pause : 1, /* on overflow, pause AUX area tracing */
+ aux_resume : 1, /* on overflow, resume AUX area tracing */
+ __reserved_3 : 29;
+ };
+ };
/*
* User provided data if sigtrap=1, passed back to user via
diff --git a/tools/include/uapi/linux/stddef.h b/tools/include/uapi/linux/stddef.h
index bb6ea517efb5..c53cde425406 100644
--- a/tools/include/uapi/linux/stddef.h
+++ b/tools/include/uapi/linux/stddef.h
@@ -8,6 +8,13 @@
#define __always_inline __inline__
#endif
+/* Not all C++ standards support type declarations inside an anonymous union */
+#ifndef __cplusplus
+#define __struct_group_tag(TAG) TAG
+#else
+#define __struct_group_tag(TAG)
+#endif
+
/**
* __struct_group() - Create a mirrored named and anonyomous struct
*
@@ -20,14 +27,14 @@
* and size: one anonymous and one named. The former's members can be used
* normally without sub-struct naming, and the latter can be used to
* reason about the start, end, and size of the group of struct members.
- * The named struct can also be explicitly tagged for layer reuse, as well
- * as both having struct attributes appended.
+ * The named struct can also be explicitly tagged for layer reuse (C only),
+ * as well as both having struct attributes appended.
*/
#define __struct_group(TAG, NAME, ATTRS, MEMBERS...) \
union { \
struct { MEMBERS } ATTRS; \
- struct TAG { MEMBERS } ATTRS NAME; \
- }
+ struct __struct_group_tag(TAG) { MEMBERS } ATTRS NAME; \
+ } ATTRS
/**
* __DECLARE_FLEX_ARRAY() - Declare a flexible array usable in a union
diff --git a/tools/lib/perf/evlist.c b/tools/lib/perf/evlist.c
index c6d67fc9e57e..83c43dc13313 100644
--- a/tools/lib/perf/evlist.c
+++ b/tools/lib/perf/evlist.c
@@ -47,6 +47,20 @@ static void __perf_evlist__propagate_maps(struct perf_evlist *evlist,
*/
perf_cpu_map__put(evsel->cpus);
evsel->cpus = perf_cpu_map__intersect(evlist->user_requested_cpus, evsel->own_cpus);
+
+ /*
+ * Empty cpu lists would eventually get opened as "any" so remove
+ * genuinely empty ones before they're opened in the wrong place.
+ */
+ if (perf_cpu_map__is_empty(evsel->cpus)) {
+ struct perf_evsel *next = perf_evlist__next(evlist, evsel);
+
+ perf_evlist__remove(evlist, evsel);
+ /* Keep idx contiguous */
+ if (next)
+ list_for_each_entry_from(next, &evlist->entries, node)
+ next->idx--;
+ }
} else if (!evsel->own_cpus || evlist->has_user_cpus ||
(!evsel->requires_cpu && perf_cpu_map__has_any_cpu(evlist->user_requested_cpus))) {
/*
@@ -80,11 +94,11 @@ static void __perf_evlist__propagate_maps(struct perf_evlist *evlist,
static void perf_evlist__propagate_maps(struct perf_evlist *evlist)
{
- struct perf_evsel *evsel;
+ struct perf_evsel *evsel, *n;
evlist->needs_map_propagation = true;
- perf_evlist__for_each_evsel(evlist, evsel)
+ list_for_each_entry_safe(evsel, n, &evlist->entries, node)
__perf_evlist__propagate_maps(evlist, evsel);
}
diff --git a/tools/net/ynl/Makefile b/tools/net/ynl/Makefile
index d1cdf2a8f826..211df5a93ad9 100644
--- a/tools/net/ynl/Makefile
+++ b/tools/net/ynl/Makefile
@@ -1,5 +1,17 @@
# SPDX-License-Identifier: GPL-2.0
+include ../../scripts/Makefile.arch
+
+INSTALL ?= install
+prefix ?= /usr
+ifeq ($(LP64), 1)
+ libdir_relative = lib64
+else
+ libdir_relative = lib
+endif
+libdir ?= $(prefix)/$(libdir_relative)
+includedir ?= $(prefix)/include
+
SUBDIRS = lib generated samples
all: $(SUBDIRS) libynl.a
@@ -21,5 +33,20 @@ clean distclean:
fi \
done
rm -f libynl.a
+ rm -rf pyynl/__pycache__
+ rm -rf pyynl/lib/__pycache__
+ rm -rf pyynl.egg-info
+ rm -rf build
+
+install: libynl.a lib/*.h
+ @echo -e "\tINSTALL libynl.a"
+ @$(INSTALL) -d $(DESTDIR)$(libdir)
+ @$(INSTALL) -m 0644 libynl.a $(DESTDIR)$(libdir)/libynl.a
+ @echo -e "\tINSTALL libynl headers"
+ @$(INSTALL) -d $(DESTDIR)$(includedir)/ynl
+ @$(INSTALL) -m 0644 lib/*.h $(DESTDIR)$(includedir)/ynl/
+ @echo -e "\tINSTALL pyynl"
+ @pip install --prefix=$(DESTDIR)$(prefix) .
+ @make -C generated install
-.PHONY: all clean distclean $(SUBDIRS)
+.PHONY: all clean distclean install $(SUBDIRS)
diff --git a/tools/net/ynl/generated/.gitignore b/tools/net/ynl/generated/.gitignore
index ade488626d26..859a6fb446e1 100644
--- a/tools/net/ynl/generated/.gitignore
+++ b/tools/net/ynl/generated/.gitignore
@@ -1,2 +1,3 @@
*-user.c
*-user.h
+*.rst
diff --git a/tools/net/ynl/generated/Makefile b/tools/net/ynl/generated/Makefile
index 7db5240de58a..21f9e299dc75 100644
--- a/tools/net/ynl/generated/Makefile
+++ b/tools/net/ynl/generated/Makefile
@@ -7,32 +7,44 @@ ifeq ("$(DEBUG)","1")
CFLAGS += -g -fsanitize=address -fsanitize=leak -static-libasan
endif
+INSTALL ?= install
+prefix ?= /usr
+datarootdir ?= $(prefix)/share
+docdir ?= $(datarootdir)/doc
+includedir ?= $(prefix)/include
+
include ../Makefile.deps
YNL_GEN_ARG_ethtool:=--user-header linux/ethtool_netlink.h \
--exclude-op stats-get
-TOOL:=../ynl-gen-c.py
+TOOL:=../pyynl/ynl_gen_c.py
+TOOL_RST:=../pyynl/ynl_gen_rst.py
+SPECS_DIR:=../../../../Documentation/netlink/specs
GENS_PATHS=$(shell grep -nrI --files-without-match \
'protocol: netlink' \
- ../../../../Documentation/netlink/specs/)
-GENS=$(patsubst ../../../../Documentation/netlink/specs/%.yaml,%,${GENS_PATHS})
+ $(SPECS_DIR))
+GENS=$(patsubst $(SPECS_DIR)/%.yaml,%,${GENS_PATHS})
SRCS=$(patsubst %,%-user.c,${GENS})
HDRS=$(patsubst %,%-user.h,${GENS})
OBJS=$(patsubst %,%-user.o,${GENS})
-all: protos.a $(HDRS) $(SRCS) $(KHDRS) $(KSRCS) $(UAPI)
+SPECS_PATHS=$(wildcard $(SPECS_DIR)/*.yaml)
+SPECS=$(patsubst $(SPECS_DIR)/%.yaml,%,${SPECS_PATHS})
+RSTS=$(patsubst %,%.rst,${SPECS})
+
+all: protos.a $(HDRS) $(SRCS) $(KHDRS) $(KSRCS) $(UAPI) $(RSTS)
protos.a: $(OBJS)
@echo -e "\tAR $@"
@ar rcs $@ $(OBJS)
-%-user.h: ../../../../Documentation/netlink/specs/%.yaml $(TOOL)
+%-user.h: $(SPECS_DIR)/%.yaml $(TOOL)
@echo -e "\tGEN $@"
@$(TOOL) --mode user --header --spec $< -o $@ $(YNL_GEN_ARG_$*)
-%-user.c: ../../../../Documentation/netlink/specs/%.yaml $(TOOL)
+%-user.c: $(SPECS_DIR)/%.yaml $(TOOL)
@echo -e "\tGEN $@"
@$(TOOL) --mode user --source --spec $< -o $@ $(YNL_GEN_ARG_$*)
@@ -40,14 +52,37 @@ protos.a: $(OBJS)
@echo -e "\tCC $@"
@$(COMPILE.c) $(CFLAGS_$*) -o $@ $<
+%.rst: $(SPECS_DIR)/%.yaml $(TOOL_RST)
+ @echo -e "\tGEN_RST $@"
+ @$(TOOL_RST) -o $@ -i $<
+
clean:
rm -f *.o
distclean: clean
- rm -f *.c *.h *.a
+ rm -f *.c *.h *.a *.rst
regen:
@../ynl-regen.sh
-.PHONY: all clean distclean regen
+install-headers: $(HDRS)
+ @echo -e "\tINSTALL generated headers"
+ @$(INSTALL) -d $(DESTDIR)$(includedir)/ynl
+ @$(INSTALL) -m 0644 *.h $(DESTDIR)$(includedir)/ynl/
+
+install-rsts: $(RSTS)
+ @echo -e "\tINSTALL generated docs"
+ @$(INSTALL) -d $(DESTDIR)$(docdir)/ynl
+ @$(INSTALL) -m 0644 $(RSTS) $(DESTDIR)$(docdir)/ynl/
+
+install-specs:
+ @echo -e "\tINSTALL specs"
+ @$(INSTALL) -d $(DESTDIR)$(datarootdir)/ynl
+ @$(INSTALL) -m 0644 ../../../../Documentation/netlink/*.yaml $(DESTDIR)$(datarootdir)/ynl/
+ @$(INSTALL) -d $(DESTDIR)$(datarootdir)/ynl/specs
+ @$(INSTALL) -m 0644 $(SPECS_DIR)/*.yaml $(DESTDIR)$(datarootdir)/ynl/specs/
+
+install: install-headers install-rsts install-specs
+
+.PHONY: all clean distclean regen install install-headers install-rsts install-specs
.DEFAULT_GOAL: all
diff --git a/tools/net/ynl/lib/.gitignore b/tools/net/ynl/lib/.gitignore
index 296c4035dbf2..a4383358ec72 100644
--- a/tools/net/ynl/lib/.gitignore
+++ b/tools/net/ynl/lib/.gitignore
@@ -1,2 +1 @@
-__pycache__/
*.d
diff --git a/tools/net/ynl/lib/Makefile b/tools/net/ynl/lib/Makefile
index 94c49cca3dca..4b2b98704ff9 100644
--- a/tools/net/ynl/lib/Makefile
+++ b/tools/net/ynl/lib/Makefile
@@ -19,7 +19,6 @@ ynl.a: $(OBJS)
clean:
rm -f *.o *.d *~
- rm -rf __pycache__
distclean: clean
rm -f *.a
diff --git a/tools/net/ynl/pyproject.toml b/tools/net/ynl/pyproject.toml
new file mode 100644
index 000000000000..a81d8779b0e0
--- /dev/null
+++ b/tools/net/ynl/pyproject.toml
@@ -0,0 +1,24 @@
+[build-system]
+requires = ["setuptools>=61.0"]
+build-backend = "setuptools.build_meta"
+
+[project]
+name = "pyynl"
+authors = [
+ {name = "Donald Hunter", email = "donald.hunter@gmail.com"},
+ {name = "Jakub Kicinski", email = "kuba@kernel.org"},
+]
+description = "yaml netlink (ynl)"
+version = "0.0.1"
+requires-python = ">=3.9"
+dependencies = [
+ "pyyaml==6.*",
+ "jsonschema==4.*"
+]
+
+[tool.setuptools.packages.find]
+include = ["pyynl", "pyynl.lib"]
+
+[project.scripts]
+ynl = "pyynl.cli:main"
+ynl-ethtool = "pyynl.ethtool:main"
diff --git a/tools/net/ynl/pyynl/.gitignore b/tools/net/ynl/pyynl/.gitignore
new file mode 100644
index 000000000000..b801cd2d016e
--- /dev/null
+++ b/tools/net/ynl/pyynl/.gitignore
@@ -0,0 +1,2 @@
+__pycache__/
+lib/__pycache__/
diff --git a/tools/net/ynl/pyynl/__init__.py b/tools/net/ynl/pyynl/__init__.py
new file mode 100644
index 000000000000..e69de29bb2d1
--- /dev/null
+++ b/tools/net/ynl/pyynl/__init__.py
diff --git a/tools/net/ynl/cli.py b/tools/net/ynl/pyynl/cli.py
index 41d9fa5c818d..794e3c7dcc65 100755
--- a/tools/net/ynl/cli.py
+++ b/tools/net/ynl/pyynl/cli.py
@@ -3,6 +3,7 @@
import argparse
import json
+import os
import pathlib
import pprint
import sys
@@ -10,6 +11,24 @@ import sys
sys.path.append(pathlib.Path(__file__).resolve().parent.as_posix())
from lib import YnlFamily, Netlink, NlError
+sys_schema_dir='/usr/share/ynl'
+relative_schema_dir='../../../../Documentation/netlink'
+
+def schema_dir():
+ script_dir = os.path.dirname(os.path.abspath(__file__))
+ schema_dir = os.path.abspath(f"{script_dir}/{relative_schema_dir}")
+ if not os.path.isdir(schema_dir):
+ schema_dir = sys_schema_dir
+ if not os.path.isdir(schema_dir):
+ raise Exception(f"Schema directory {schema_dir} does not exist")
+ return schema_dir
+
+def spec_dir():
+ spec_dir = schema_dir() + '/specs'
+ if not os.path.isdir(spec_dir):
+ raise Exception(f"Spec directory {spec_dir} does not exist")
+ return spec_dir
+
class YnlEncoder(json.JSONEncoder):
def default(self, obj):
@@ -32,7 +51,14 @@ def main():
parser = argparse.ArgumentParser(description=description,
epilog=epilog)
- parser.add_argument('--spec', dest='spec', type=str, required=True)
+ spec_group = parser.add_mutually_exclusive_group(required=True)
+ spec_group.add_argument('--family', dest='family', type=str,
+ help='name of the netlink FAMILY')
+ spec_group.add_argument('--list-families', action='store_true',
+ help='list all netlink families supported by YNL (has spec)')
+ spec_group.add_argument('--spec', dest='spec', type=str,
+ help='choose the family by SPEC file path')
+
parser.add_argument('--schema', dest='schema', type=str)
parser.add_argument('--no-schema', action='store_true')
parser.add_argument('--json', dest='json_text', type=str)
@@ -70,6 +96,12 @@ def main():
else:
pprint.PrettyPrinter().pprint(msg)
+ if args.list_families:
+ for filename in sorted(os.listdir(spec_dir())):
+ if filename.endswith('.yaml'):
+ print(filename.removesuffix('.yaml'))
+ return
+
if args.no_schema:
args.schema = ''
@@ -77,7 +109,16 @@ def main():
if args.json_text:
attrs = json.loads(args.json_text)
- ynl = YnlFamily(args.spec, args.schema, args.process_unknown,
+ if args.family:
+ spec = f"{spec_dir()}/{args.family}.yaml"
+ if args.schema is None and spec.startswith(sys_schema_dir):
+ args.schema = '' # disable schema validation when installed
+ else:
+ spec = args.spec
+ if not os.path.isfile(spec):
+ raise Exception(f"Spec file {spec} does not exist")
+
+ ynl = YnlFamily(spec, args.schema, args.process_unknown,
recv_size=args.dbg_small_recv)
if args.dbg_small_recv:
ynl.set_recv_dbg(True)
diff --git a/tools/net/ynl/ethtool.py b/tools/net/ynl/pyynl/ethtool.py
index ebb0a11f67bf..af7fddd7b085 100755
--- a/tools/net/ynl/ethtool.py
+++ b/tools/net/ynl/pyynl/ethtool.py
@@ -11,6 +11,7 @@ import os
sys.path.append(pathlib.Path(__file__).resolve().parent.as_posix())
from lib import YnlFamily
+from cli import schema_dir, spec_dir
def args_to_req(ynl, op_name, args, req):
"""
@@ -156,10 +157,8 @@ def main():
args = parser.parse_args()
script_abs_dir = os.path.dirname(os.path.abspath(sys.argv[0]))
- spec = os.path.join(script_abs_dir,
- '../../../Documentation/netlink/specs/ethtool.yaml')
- schema = os.path.join(script_abs_dir,
- '../../../Documentation/netlink/genetlink-legacy.yaml')
+ spec = os.path.join(spec_dir(), 'ethtool.yaml')
+ schema = os.path.join(schema_dir(), 'genetlink-legacy.yaml')
ynl = YnlFamily(spec, schema)
diff --git a/tools/net/ynl/lib/__init__.py b/tools/net/ynl/pyynl/lib/__init__.py
index 9137b83e580a..9137b83e580a 100644
--- a/tools/net/ynl/lib/__init__.py
+++ b/tools/net/ynl/pyynl/lib/__init__.py
diff --git a/tools/net/ynl/lib/nlspec.py b/tools/net/ynl/pyynl/lib/nlspec.py
index a745739655ad..314ec8007496 100644
--- a/tools/net/ynl/lib/nlspec.py
+++ b/tools/net/ynl/pyynl/lib/nlspec.py
@@ -219,7 +219,10 @@ class SpecAttrSet(SpecElement):
else:
real_set = family.attr_sets[self.subset_of]
for elem in self.yaml['attributes']:
- attr = real_set[elem['name']]
+ real_attr = real_set[elem['name']]
+ combined_elem = real_attr.yaml | elem
+ attr = self.new_attr(combined_elem, real_attr.value)
+
self.attrs[attr.name] = attr
self.attrs_by_val[attr.value] = attr
diff --git a/tools/net/ynl/lib/ynl.py b/tools/net/ynl/pyynl/lib/ynl.py
index 01ec01a90e76..08f8bf89cfc2 100644
--- a/tools/net/ynl/lib/ynl.py
+++ b/tools/net/ynl/pyynl/lib/ynl.py
@@ -556,10 +556,10 @@ class YnlFamily(SpecFamily):
if attr["type"] == 'nest':
nl_type |= Netlink.NLA_F_NESTED
attr_payload = b''
- sub_attrs = SpaceAttrs(self.attr_sets[space], value, search_attrs)
+ sub_space = attr['nested-attributes']
+ sub_attrs = SpaceAttrs(self.attr_sets[sub_space], value, search_attrs)
for subname, subvalue in value.items():
- attr_payload += self._add_attr(attr['nested-attributes'],
- subname, subvalue, sub_attrs)
+ attr_payload += self._add_attr(sub_space, subname, subvalue, sub_attrs)
elif attr["type"] == 'flag':
if not value:
# If value is absent or false then skip attribute creation.
@@ -733,41 +733,45 @@ class YnlFamily(SpecFamily):
self._rsp_add(rsp, attr_name, None, self._decode_unknown(attr))
continue
- if attr_spec["type"] == 'nest':
- subdict = self._decode(NlAttrs(attr.raw), attr_spec['nested-attributes'], search_attrs)
- decoded = subdict
- elif attr_spec["type"] == 'string':
- decoded = attr.as_strz()
- elif attr_spec["type"] == 'binary':
- decoded = self._decode_binary(attr, attr_spec)
- elif attr_spec["type"] == 'flag':
- decoded = True
- elif attr_spec.is_auto_scalar:
- decoded = attr.as_auto_scalar(attr_spec['type'], attr_spec.byte_order)
- elif attr_spec["type"] in NlAttr.type_formats:
- decoded = attr.as_scalar(attr_spec['type'], attr_spec.byte_order)
- if 'enum' in attr_spec:
- decoded = self._decode_enum(decoded, attr_spec)
- elif attr_spec.display_hint:
- decoded = self._formatted_string(decoded, attr_spec.display_hint)
- elif attr_spec["type"] == 'indexed-array':
- decoded = self._decode_array_attr(attr, attr_spec)
- elif attr_spec["type"] == 'bitfield32':
- value, selector = struct.unpack("II", attr.raw)
- if 'enum' in attr_spec:
- value = self._decode_enum(value, attr_spec)
- selector = self._decode_enum(selector, attr_spec)
- decoded = {"value": value, "selector": selector}
- elif attr_spec["type"] == 'sub-message':
- decoded = self._decode_sub_msg(attr, attr_spec, search_attrs)
- elif attr_spec["type"] == 'nest-type-value':
- decoded = self._decode_nest_type_value(attr, attr_spec)
- else:
- if not self.process_unknown:
- raise Exception(f'Unknown {attr_spec["type"]} with name {attr_spec["name"]}')
- decoded = self._decode_unknown(attr)
-
- self._rsp_add(rsp, attr_spec["name"], attr_spec.is_multi, decoded)
+ try:
+ if attr_spec["type"] == 'nest':
+ subdict = self._decode(NlAttrs(attr.raw), attr_spec['nested-attributes'], search_attrs)
+ decoded = subdict
+ elif attr_spec["type"] == 'string':
+ decoded = attr.as_strz()
+ elif attr_spec["type"] == 'binary':
+ decoded = self._decode_binary(attr, attr_spec)
+ elif attr_spec["type"] == 'flag':
+ decoded = True
+ elif attr_spec.is_auto_scalar:
+ decoded = attr.as_auto_scalar(attr_spec['type'], attr_spec.byte_order)
+ elif attr_spec["type"] in NlAttr.type_formats:
+ decoded = attr.as_scalar(attr_spec['type'], attr_spec.byte_order)
+ if 'enum' in attr_spec:
+ decoded = self._decode_enum(decoded, attr_spec)
+ elif attr_spec.display_hint:
+ decoded = self._formatted_string(decoded, attr_spec.display_hint)
+ elif attr_spec["type"] == 'indexed-array':
+ decoded = self._decode_array_attr(attr, attr_spec)
+ elif attr_spec["type"] == 'bitfield32':
+ value, selector = struct.unpack("II", attr.raw)
+ if 'enum' in attr_spec:
+ value = self._decode_enum(value, attr_spec)
+ selector = self._decode_enum(selector, attr_spec)
+ decoded = {"value": value, "selector": selector}
+ elif attr_spec["type"] == 'sub-message':
+ decoded = self._decode_sub_msg(attr, attr_spec, search_attrs)
+ elif attr_spec["type"] == 'nest-type-value':
+ decoded = self._decode_nest_type_value(attr, attr_spec)
+ else:
+ if not self.process_unknown:
+ raise Exception(f'Unknown {attr_spec["type"]} with name {attr_spec["name"]}')
+ decoded = self._decode_unknown(attr)
+
+ self._rsp_add(rsp, attr_spec["name"], attr_spec.is_multi, decoded)
+ except:
+ print(f"Error decoding '{attr_spec.name}' from '{space}'")
+ raise
return rsp
diff --git a/tools/net/ynl/ynl-gen-c.py b/tools/net/ynl/pyynl/ynl_gen_c.py
index d8201c4b1520..c2eabc90dce8 100755
--- a/tools/net/ynl/ynl-gen-c.py
+++ b/tools/net/ynl/pyynl/ynl_gen_c.py
@@ -79,6 +79,20 @@ class Type(SpecAttr):
self.enum_name = None
delattr(self, "enum_name")
+ def _get_real_attr(self):
+ # if the attr is for a subset return the "real" attr (just one down, does not recurse)
+ return self.family.attr_sets[self.attr_set.subset_of][self.name]
+
+ def set_request(self):
+ self.request = True
+ if self.attr_set.subset_of:
+ self._get_real_attr().set_request()
+
+ def set_reply(self):
+ self.reply = True
+ if self.attr_set.subset_of:
+ self._get_real_attr().set_reply()
+
def get_limit(self, limit, default=None):
value = self.checks.get(limit, default)
if value is None:
@@ -106,6 +120,10 @@ class Type(SpecAttr):
enum_name = f"{self.attr_set.name_prefix}{self.name}"
self.enum_name = c_upper(enum_name)
+ if self.attr_set.subset_of:
+ if self.checks != self._get_real_attr().checks:
+ raise Exception("Overriding checks not supported by codegen, yet")
+
def is_multi_val(self):
return None
@@ -801,6 +819,8 @@ class EnumSet(SpecEnumSet):
self.user_type = 'int'
self.value_pfx = yaml.get('name-prefix', f"{family.ident_name}-{yaml['name']}-")
+ self.header = yaml.get('header', None)
+ self.enum_cnt_name = yaml.get('enum-cnt-name', None)
super().__init__(family, yaml)
@@ -1117,17 +1137,17 @@ class Family(SpecFamily):
for _, struct in self.pure_nested_structs.items():
if struct.request:
for _, arg in struct.member_list():
- arg.request = True
+ arg.set_request()
if struct.reply:
for _, arg in struct.member_list():
- arg.reply = True
+ arg.set_reply()
for root_set, rs_members in self.root_sets.items():
for attr, spec in self.attr_sets[root_set].items():
if attr in rs_members['request']:
- spec.request = True
+ spec.set_request()
if attr in rs_members['reply']:
- spec.reply = True
+ spec.set_reply()
def _load_global_policy(self):
global_set = set()
@@ -1763,7 +1783,14 @@ def parse_rsp_nested(ri, struct):
f'{struct.ptr_name}dst = yarg->data;']
init_lines = []
- _multi_parse(ri, struct, init_lines, local_vars)
+ if struct.member_list():
+ _multi_parse(ri, struct, init_lines, local_vars)
+ else:
+ # Empty nest
+ ri.cw.block_start()
+ ri.cw.p('return 0;')
+ ri.cw.block_end()
+ ri.cw.nl()
def parse_rsp_msg(ri, deref=False):
@@ -2384,6 +2411,17 @@ def print_kernel_family_struct_src(family, cw):
if not kernel_can_gen_family_struct(family):
return
+ if 'sock-priv' in family.kernel_family:
+ # Generate "trampolines" to make CFI happy
+ cw.write_func("static void", f"__{family.c_name}_nl_sock_priv_init",
+ [f"{family.c_name}_nl_sock_priv_init(priv);"],
+ ["void *priv"])
+ cw.nl()
+ cw.write_func("static void", f"__{family.c_name}_nl_sock_priv_destroy",
+ [f"{family.c_name}_nl_sock_priv_destroy(priv);"],
+ ["void *priv"])
+ cw.nl()
+
cw.block_start(f"struct genl_family {family.ident_name}_nl_family __ro_after_init =")
cw.p('.name\t\t= ' + family.fam_key + ',')
cw.p('.version\t= ' + family.ver_key + ',')
@@ -2401,9 +2439,8 @@ def print_kernel_family_struct_src(family, cw):
cw.p(f'.n_mcgrps\t= ARRAY_SIZE({family.c_name}_nl_mcgrps),')
if 'sock-priv' in family.kernel_family:
cw.p(f'.sock_priv_size\t= sizeof({family.kernel_family["sock-priv"]}),')
- # Force cast here, actual helpers take pointer to the real type.
- cw.p(f'.sock_priv_init\t= (void *){family.c_name}_nl_sock_priv_init,')
- cw.p(f'.sock_priv_destroy = (void *){family.c_name}_nl_sock_priv_destroy,')
+ cw.p(f'.sock_priv_init\t= __{family.c_name}_nl_sock_priv_init,')
+ cw.p(f'.sock_priv_destroy = __{family.c_name}_nl_sock_priv_destroy,')
cw.block_end(';')
@@ -2417,6 +2454,87 @@ def uapi_enum_start(family, cw, obj, ckey='', enum_name='enum-name'):
cw.block_start(line=start_line)
+def render_uapi_unified(family, cw, max_by_define, separate_ntf):
+ max_name = c_upper(family.get('cmd-max-name', f"{family.op_prefix}MAX"))
+ cnt_name = c_upper(family.get('cmd-cnt-name', f"__{family.op_prefix}MAX"))
+ max_value = f"({cnt_name} - 1)"
+
+ uapi_enum_start(family, cw, family['operations'], 'enum-name')
+ val = 0
+ for op in family.msgs.values():
+ if separate_ntf and ('notify' in op or 'event' in op):
+ continue
+
+ suffix = ','
+ if op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(op.enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+
+def render_uapi_directional(family, cw, max_by_define):
+ max_name = f"{family.op_prefix}USER_MAX"
+ cnt_name = f"__{family.op_prefix}USER_CNT"
+ max_value = f"({cnt_name} - 1)"
+
+ cw.block_start(line='enum')
+ cw.p(c_upper(f'{family.name}_MSG_USER_NONE = 0,'))
+ val = 0
+ for op in family.msgs.values():
+ if 'do' in op and 'event' not in op:
+ suffix = ','
+ if op.value and op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(op.enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+ max_name = f"{family.op_prefix}KERNEL_MAX"
+ cnt_name = f"__{family.op_prefix}KERNEL_CNT"
+ max_value = f"({cnt_name} - 1)"
+
+ cw.block_start(line='enum')
+ cw.p(c_upper(f'{family.name}_MSG_KERNEL_NONE = 0,'))
+ val = 0
+ for op in family.msgs.values():
+ if ('do' in op and 'reply' in op['do']) or 'notify' in op or 'event' in op:
+ enum_name = op.enum_name
+ if 'event' not in op and 'notify' not in op:
+ enum_name = f'{enum_name}_REPLY'
+
+ suffix = ','
+ if op.value and op.value != val:
+ suffix = f" = {op.value},"
+ val = op.value
+ cw.p(enum_name + suffix)
+ val += 1
+ cw.nl()
+ cw.p(cnt_name + ('' if max_by_define else ','))
+ if not max_by_define:
+ cw.p(f"{max_name} = {max_value}")
+ cw.block_end(line=';')
+ if max_by_define:
+ cw.p(f"#define {max_name} {max_value}")
+ cw.nl()
+
+
def render_uapi(family, cw):
hdr_prot = f"_UAPI_LINUX_{c_upper(family.uapi_header_name)}_H"
hdr_prot = hdr_prot.replace('/', '_')
@@ -2440,6 +2558,9 @@ def render_uapi(family, cw):
if const['type'] == 'enum' or const['type'] == 'flags':
enum = family.consts[const['name']]
+ if enum.header:
+ continue
+
if enum.has_doc():
if enum.has_entry_doc():
cw.p('/**')
@@ -2472,9 +2593,12 @@ def render_uapi(family, cw):
max_val = f' = {enum.get_mask()},'
cw.p(max_name + max_val)
else:
+ cnt_name = enum.enum_cnt_name
max_name = c_upper(name_pfx + 'max')
- cw.p('__' + max_name + ',')
- cw.p(max_name + ' = (__' + max_name + ' - 1)')
+ if not cnt_name:
+ cnt_name = '__' + name_pfx + 'max'
+ cw.p(c_upper(cnt_name) + ',')
+ cw.p(max_name + ' = (' + c_upper(cnt_name) + ' - 1)')
cw.block_end(line=';')
cw.nl()
elif const['type'] == 'const':
@@ -2503,7 +2627,8 @@ def render_uapi(family, cw):
val = attr.value
val += 1
cw.p(attr.enum_name + suffix)
- cw.nl()
+ if attr_set.items():
+ cw.nl()
cw.p(attr_set.cnt_name + ('' if max_by_define else ','))
if not max_by_define:
cw.p(f"{attr_set.max_name} = {max_value}")
@@ -2515,30 +2640,12 @@ def render_uapi(family, cw):
# Commands
separate_ntf = 'async-prefix' in family['operations']
- max_name = c_upper(family.get('cmd-max-name', f"{family.op_prefix}MAX"))
- cnt_name = c_upper(family.get('cmd-cnt-name', f"__{family.op_prefix}MAX"))
- max_value = f"({cnt_name} - 1)"
-
- uapi_enum_start(family, cw, family['operations'], 'enum-name')
- val = 0
- for op in family.msgs.values():
- if separate_ntf and ('notify' in op or 'event' in op):
- continue
-
- suffix = ','
- if op.value != val:
- suffix = f" = {op.value},"
- val = op.value
- cw.p(op.enum_name + suffix)
- val += 1
- cw.nl()
- cw.p(cnt_name + ('' if max_by_define else ','))
- if not max_by_define:
- cw.p(f"{max_name} = {max_value}")
- cw.block_end(line=';')
- if max_by_define:
- cw.p(f"#define {max_name} {max_value}")
- cw.nl()
+ if family.msg_id_model == 'unified':
+ render_uapi_unified(family, cw, max_by_define, separate_ntf)
+ elif family.msg_id_model == 'directional':
+ render_uapi_directional(family, cw, max_by_define)
+ else:
+ raise Exception(f'Unsupported message enum-model {family.msg_id_model}')
if separate_ntf:
uapi_enum_start(family, cw, family['operations'], enum_name='async-enum')
@@ -2635,7 +2742,8 @@ def find_kernel_root(full_path):
def main():
parser = argparse.ArgumentParser(description='Netlink simple parsing generator')
- parser.add_argument('--mode', dest='mode', type=str, required=True)
+ parser.add_argument('--mode', dest='mode', type=str, required=True,
+ choices=('user', 'kernel', 'uapi'))
parser.add_argument('--spec', dest='spec', type=str, required=True)
parser.add_argument('--header', dest='header', action='store_true', default=None)
parser.add_argument('--source', dest='header', action='store_false')
@@ -2662,13 +2770,6 @@ def main():
os.sys.exit(1)
return
- supported_models = ['unified']
- if args.mode in ['user', 'kernel']:
- supported_models += ['directional']
- if parsed.msg_id_model not in supported_models:
- print(f'Message enum-model {parsed.msg_id_model} not supported for {args.mode} generation')
- os.sys.exit(1)
-
cw = CodeWriter(BaseNlLib(), args.out_file, overwrite=(not args.cmp_out))
_, spec_kernel = find_kernel_root(args.spec)
@@ -2696,7 +2797,10 @@ def main():
cw.p('#define ' + hdr_prot)
cw.nl()
- hdr_file=os.path.basename(args.out_file[:-2]) + ".h"
+ if args.out_file:
+ hdr_file = os.path.basename(args.out_file[:-2]) + ".h"
+ else:
+ hdr_file = "generated_header_file.h"
if args.mode == 'kernel':
cw.p('#include <net/netlink.h>')
@@ -2718,12 +2822,17 @@ def main():
else:
cw.p(f'#include "{hdr_file}"')
cw.p('#include "ynl.h"')
- headers = [parsed.uapi_header]
+ headers = []
for definition in parsed['definitions']:
if 'header' in definition:
headers.append(definition['header'])
+ if args.mode == 'user':
+ headers.append(parsed.uapi_header)
+ seen_header = []
for one in headers:
- cw.p(f"#include <{one}>")
+ if one not in seen_header:
+ cw.p(f"#include <{one}>")
+ seen_header.append(one)
cw.nl()
if args.mode == "user":
diff --git a/tools/net/ynl/ynl-gen-rst.py b/tools/net/ynl/pyynl/ynl_gen_rst.py
index 6c56d0d726b4..6c56d0d726b4 100755
--- a/tools/net/ynl/ynl-gen-rst.py
+++ b/tools/net/ynl/pyynl/ynl_gen_rst.py
diff --git a/tools/net/ynl/ynl-regen.sh b/tools/net/ynl/ynl-regen.sh
index a37304dcc88e..81b4ecd89100 100755
--- a/tools/net/ynl/ynl-regen.sh
+++ b/tools/net/ynl/ynl-regen.sh
@@ -1,7 +1,7 @@
#!/bin/bash
# SPDX-License-Identifier: GPL-2.0 OR BSD-3-Clause
-TOOL=$(dirname $(realpath $0))/ynl-gen-c.py
+TOOL=$(dirname $(realpath $0))/pyynl/ynl_gen_c.py
force=
search=
diff --git a/tools/objtool/arch/loongarch/special.c b/tools/objtool/arch/loongarch/special.c
index 9bba1e9318e0..87230ed570fd 100644
--- a/tools/objtool/arch/loongarch/special.c
+++ b/tools/objtool/arch/loongarch/special.c
@@ -9,7 +9,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
}
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
return NULL;
}
diff --git a/tools/objtool/arch/powerpc/special.c b/tools/objtool/arch/powerpc/special.c
index d33868147196..51610689abf7 100644
--- a/tools/objtool/arch/powerpc/special.c
+++ b/tools/objtool/arch/powerpc/special.c
@@ -13,7 +13,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
}
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
exit(-1);
}
diff --git a/tools/objtool/arch/x86/special.c b/tools/objtool/arch/x86/special.c
index 4ea0f9815fda..9c1c9df09aaa 100644
--- a/tools/objtool/arch/x86/special.c
+++ b/tools/objtool/arch/x86/special.c
@@ -109,7 +109,8 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
* NOTE: MITIGATION_RETPOLINE made it harder still to decode dynamic jumps.
*/
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn)
+ struct instruction *insn,
+ unsigned long *table_size)
{
struct reloc *text_reloc, *rodata_reloc;
struct section *table_sec;
@@ -158,5 +159,6 @@ struct reloc *arch_find_switch_table(struct objtool_file *file,
if (reloc_type(text_reloc) == R_X86_64_PC32)
file->ignore_unreachables = true;
+ *table_size = 0;
return rodata_reloc;
}
diff --git a/tools/objtool/check.c b/tools/objtool/check.c
index 4ce176ad411f..753dbc4f8198 100644
--- a/tools/objtool/check.c
+++ b/tools/objtool/check.c
@@ -150,6 +150,15 @@ static inline struct reloc *insn_jump_table(struct instruction *insn)
return NULL;
}
+static inline unsigned long insn_jump_table_size(struct instruction *insn)
+{
+ if (insn->type == INSN_JUMP_DYNAMIC ||
+ insn->type == INSN_CALL_DYNAMIC)
+ return insn->_jump_table_size;
+
+ return 0;
+}
+
static bool is_jump_table_jump(struct instruction *insn)
{
struct alt_group *alt_group = insn->alt_group;
@@ -614,108 +623,6 @@ static int init_pv_ops(struct objtool_file *file)
return 0;
}
-static struct instruction *find_last_insn(struct objtool_file *file,
- struct section *sec)
-{
- struct instruction *insn = NULL;
- unsigned int offset;
- unsigned int end = (sec->sh.sh_size > 10) ? sec->sh.sh_size - 10 : 0;
-
- for (offset = sec->sh.sh_size - 1; offset >= end && !insn; offset--)
- insn = find_insn(file, sec, offset);
-
- return insn;
-}
-
-/*
- * Mark "ud2" instructions and manually annotated dead ends.
- */
-static int add_dead_ends(struct objtool_file *file)
-{
- struct section *rsec;
- struct reloc *reloc;
- struct instruction *insn;
- uint64_t offset;
-
- /*
- * Check for manually annotated dead ends.
- */
- rsec = find_section_by_name(file->elf, ".rela.discard.unreachable");
- if (!rsec)
- goto reachable;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type == STT_SECTION) {
- offset = reloc_addend(reloc);
- } else if (reloc->sym->local_label) {
- offset = reloc->sym->offset;
- } else {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, offset);
- if (insn)
- insn = prev_insn_same_sec(file, insn);
- else if (offset == reloc->sym->sec->sh.sh_size) {
- insn = find_last_insn(file, reloc->sym->sec);
- if (!insn) {
- WARN("can't find unreachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
- } else {
- WARN("can't find unreachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
-
- insn->dead_end = true;
- }
-
-reachable:
- /*
- * These manually annotated reachable checks are needed for GCC 4.4,
- * where the Linux unreachable() macro isn't supported. In that case
- * GCC doesn't know the "ud2" is fatal, so it generates code as if it's
- * not a dead end.
- */
- rsec = find_section_by_name(file->elf, ".rela.discard.reachable");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type == STT_SECTION) {
- offset = reloc_addend(reloc);
- } else if (reloc->sym->local_label) {
- offset = reloc->sym->offset;
- } else {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, offset);
- if (insn)
- insn = prev_insn_same_sec(file, insn);
- else if (offset == reloc->sym->sec->sh.sh_size) {
- insn = find_last_insn(file, reloc->sym->sec);
- if (!insn) {
- WARN("can't find reachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
- } else {
- WARN("can't find reachable insn at %s+0x%" PRIx64,
- reloc->sym->sec->name, offset);
- return -1;
- }
-
- insn->dead_end = false;
- }
-
- return 0;
-}
-
static int create_static_call_sections(struct objtool_file *file)
{
struct static_call_site *site;
@@ -1310,40 +1217,6 @@ static void add_uaccess_safe(struct objtool_file *file)
}
/*
- * FIXME: For now, just ignore any alternatives which add retpolines. This is
- * a temporary hack, as it doesn't allow ORC to unwind from inside a retpoline.
- * But it at least allows objtool to understand the control flow *around* the
- * retpoline.
- */
-static int add_ignore_alternatives(struct objtool_file *file)
-{
- struct section *rsec;
- struct reloc *reloc;
- struct instruction *insn;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.ignore_alts");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
-
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.ignore_alts entry");
- return -1;
- }
-
- insn->ignore_alts = true;
- }
-
- return 0;
-}
-
-/*
* Symbols that replace INSN_CALL_DYNAMIC, every (tail) call to such a symbol
* will be added to the .retpoline_sites section.
*/
@@ -2073,6 +1946,7 @@ out:
static int add_jump_table(struct objtool_file *file, struct instruction *insn,
struct reloc *next_table)
{
+ unsigned long table_size = insn_jump_table_size(insn);
struct symbol *pfunc = insn_func(insn)->pfunc;
struct reloc *table = insn_jump_table(insn);
struct instruction *dest_insn;
@@ -2087,6 +1961,8 @@ static int add_jump_table(struct objtool_file *file, struct instruction *insn,
for_each_reloc_from(table->sec, reloc) {
/* Check for the end of the table: */
+ if (table_size && reloc_offset(reloc) - reloc_offset(table) >= table_size)
+ break;
if (reloc != table && reloc == next_table)
break;
@@ -2131,12 +2007,12 @@ static int add_jump_table(struct objtool_file *file, struct instruction *insn,
* find_jump_table() - Given a dynamic jump, find the switch jump table
* associated with it.
*/
-static struct reloc *find_jump_table(struct objtool_file *file,
- struct symbol *func,
- struct instruction *insn)
+static void find_jump_table(struct objtool_file *file, struct symbol *func,
+ struct instruction *insn)
{
struct reloc *table_reloc;
struct instruction *dest_insn, *orig_insn = insn;
+ unsigned long table_size;
/*
* Backward search using the @first_jump_src links, these help avoid
@@ -2157,17 +2033,17 @@ static struct reloc *find_jump_table(struct objtool_file *file,
insn->jump_dest->offset > orig_insn->offset))
break;
- table_reloc = arch_find_switch_table(file, insn);
+ table_reloc = arch_find_switch_table(file, insn, &table_size);
if (!table_reloc)
continue;
dest_insn = find_insn(file, table_reloc->sym->sec, reloc_addend(table_reloc));
if (!dest_insn || !insn_func(dest_insn) || insn_func(dest_insn)->pfunc != func)
continue;
- return table_reloc;
+ orig_insn->_jump_table = table_reloc;
+ orig_insn->_jump_table_size = table_size;
+ break;
}
-
- return NULL;
}
/*
@@ -2178,7 +2054,6 @@ static void mark_func_jump_tables(struct objtool_file *file,
struct symbol *func)
{
struct instruction *insn, *last = NULL;
- struct reloc *reloc;
func_for_each_insn(file, func, insn) {
if (!last)
@@ -2201,9 +2076,7 @@ static void mark_func_jump_tables(struct objtool_file *file,
if (insn->type != INSN_JUMP_DYNAMIC)
continue;
- reloc = find_jump_table(file, func, insn);
- if (reloc)
- insn->_jump_table = reloc;
+ find_jump_table(file, func, insn);
}
}
@@ -2373,185 +2246,147 @@ static int read_unwind_hints(struct objtool_file *file)
return 0;
}
-static int read_noendbr_hints(struct objtool_file *file)
+static int read_annotate(struct objtool_file *file,
+ int (*func)(struct objtool_file *file, int type, struct instruction *insn))
{
+ struct section *sec;
struct instruction *insn;
- struct section *rsec;
struct reloc *reloc;
+ uint64_t offset;
+ int type, ret;
- rsec = find_section_by_name(file->elf, ".rela.discard.noendbr");
- if (!rsec)
+ sec = find_section_by_name(file->elf, ".discard.annotate_insn");
+ if (!sec)
return 0;
- for_each_reloc(rsec, reloc) {
- insn = find_insn(file, reloc->sym->sec,
- reloc->sym->offset + reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.noendbr entry");
- return -1;
- }
+ if (!sec->rsec)
+ return 0;
- insn->noendbr = 1;
+ if (sec->sh.sh_entsize != 8) {
+ static bool warned = false;
+ if (!warned) {
+ WARN("%s: dodgy linker, sh_entsize != 8", sec->name);
+ warned = true;
+ }
+ sec->sh.sh_entsize = 8;
}
- return 0;
-}
-
-static int read_retpoline_hints(struct objtool_file *file)
-{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.retpoline_safe");
- if (!rsec)
- return 0;
+ for_each_reloc(sec->rsec, reloc) {
+ type = *(u32 *)(sec->data->d_buf + (reloc_idx(reloc) * sec->sh.sh_entsize) + 4);
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ offset = reloc->sym->offset + reloc_addend(reloc);
+ insn = find_insn(file, reloc->sym->sec, offset);
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
if (!insn) {
- WARN("bad .discard.retpoline_safe entry");
+ WARN("bad .discard.annotate_insn entry: %d of type %d", reloc_idx(reloc), type);
return -1;
}
- if (insn->type != INSN_JUMP_DYNAMIC &&
- insn->type != INSN_CALL_DYNAMIC &&
- insn->type != INSN_RETURN &&
- insn->type != INSN_NOP) {
- WARN_INSN(insn, "retpoline_safe hint not an indirect jump/call/ret/nop");
- return -1;
- }
-
- insn->retpoline_safe = true;
+ ret = func(file, type, insn);
+ if (ret < 0)
+ return ret;
}
return 0;
}
-static int read_instr_hints(struct objtool_file *file)
+static int __annotate_early(struct objtool_file *file, int type, struct instruction *insn)
{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
+ switch (type) {
+ case ANNOTYPE_IGNORE_ALTS:
+ insn->ignore_alts = true;
+ break;
- rsec = find_section_by_name(file->elf, ".rela.discard.instr_end");
- if (!rsec)
- return 0;
+ /*
+ * Must be before read_unwind_hints() since that needs insn->noendbr.
+ */
+ case ANNOTYPE_NOENDBR:
+ insn->noendbr = 1;
+ break;
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ default:
+ break;
+ }
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_end entry");
- return -1;
- }
+ return 0;
+}
- insn->instr--;
- }
+static int __annotate_ifc(struct objtool_file *file, int type, struct instruction *insn)
+{
+ unsigned long dest_off;
- rsec = find_section_by_name(file->elf, ".rela.discard.instr_begin");
- if (!rsec)
+ if (type != ANNOTYPE_INTRA_FUNCTION_CALL)
return 0;
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ if (insn->type != INSN_CALL) {
+ WARN_INSN(insn, "intra_function_call not a direct call");
+ return -1;
+ }
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_begin entry");
- return -1;
- }
+ /*
+ * Treat intra-function CALLs as JMPs, but with a stack_op.
+ * See add_call_destinations(), which strips stack_ops from
+ * normal CALLs.
+ */
+ insn->type = INSN_JUMP_UNCONDITIONAL;
- insn->instr++;
+ dest_off = arch_jump_destination(insn);
+ insn->jump_dest = find_insn(file, insn->sec, dest_off);
+ if (!insn->jump_dest) {
+ WARN_INSN(insn, "can't find call dest at %s+0x%lx",
+ insn->sec->name, dest_off);
+ return -1;
}
return 0;
}
-static int read_validate_unret_hints(struct objtool_file *file)
+static int __annotate_late(struct objtool_file *file, int type, struct instruction *insn)
{
- struct section *rsec;
- struct instruction *insn;
- struct reloc *reloc;
-
- rsec = find_section_by_name(file->elf, ".rela.discard.validate_unret");
- if (!rsec)
- return 0;
-
- for_each_reloc(rsec, reloc) {
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s", rsec->name);
- return -1;
- }
+ switch (type) {
+ case ANNOTYPE_NOENDBR:
+ /* early */
+ break;
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.instr_end entry");
+ case ANNOTYPE_RETPOLINE_SAFE:
+ if (insn->type != INSN_JUMP_DYNAMIC &&
+ insn->type != INSN_CALL_DYNAMIC &&
+ insn->type != INSN_RETURN &&
+ insn->type != INSN_NOP) {
+ WARN_INSN(insn, "retpoline_safe hint not an indirect jump/call/ret/nop");
return -1;
}
- insn->unret = 1;
- }
-
- return 0;
-}
-
-static int read_intra_function_calls(struct objtool_file *file)
-{
- struct instruction *insn;
- struct section *rsec;
- struct reloc *reloc;
+ insn->retpoline_safe = true;
+ break;
- rsec = find_section_by_name(file->elf, ".rela.discard.intra_function_calls");
- if (!rsec)
- return 0;
+ case ANNOTYPE_INSTR_BEGIN:
+ insn->instr++;
+ break;
- for_each_reloc(rsec, reloc) {
- unsigned long dest_off;
+ case ANNOTYPE_INSTR_END:
+ insn->instr--;
+ break;
- if (reloc->sym->type != STT_SECTION) {
- WARN("unexpected relocation symbol type in %s",
- rsec->name);
- return -1;
- }
+ case ANNOTYPE_UNRET_BEGIN:
+ insn->unret = 1;
+ break;
- insn = find_insn(file, reloc->sym->sec, reloc_addend(reloc));
- if (!insn) {
- WARN("bad .discard.intra_function_call entry");
- return -1;
- }
+ case ANNOTYPE_IGNORE_ALTS:
+ /* early */
+ break;
- if (insn->type != INSN_CALL) {
- WARN_INSN(insn, "intra_function_call not a direct call");
- return -1;
- }
+ case ANNOTYPE_INTRA_FUNCTION_CALL:
+ /* ifc */
+ break;
- /*
- * Treat intra-function CALLs as JMPs, but with a stack_op.
- * See add_call_destinations(), which strips stack_ops from
- * normal CALLs.
- */
- insn->type = INSN_JUMP_UNCONDITIONAL;
+ case ANNOTYPE_REACHABLE:
+ insn->dead_end = false;
+ break;
- dest_off = arch_jump_destination(insn);
- insn->jump_dest = find_insn(file, insn->sec, dest_off);
- if (!insn->jump_dest) {
- WARN_INSN(insn, "can't find call dest at %s+0x%lx",
- insn->sec->name, dest_off);
- return -1;
- }
+ default:
+ WARN_INSN(insn, "Unknown annotation type: %d", type);
+ break;
}
return 0;
@@ -2666,14 +2501,7 @@ static int decode_sections(struct objtool_file *file)
add_ignores(file);
add_uaccess_safe(file);
- ret = add_ignore_alternatives(file);
- if (ret)
- return ret;
-
- /*
- * Must be before read_unwind_hints() since that needs insn->noendbr.
- */
- ret = read_noendbr_hints(file);
+ ret = read_annotate(file, __annotate_early);
if (ret)
return ret;
@@ -2695,7 +2523,7 @@ static int decode_sections(struct objtool_file *file)
* Must be before add_call_destination(); it changes INSN_CALL to
* INSN_JUMP.
*/
- ret = read_intra_function_calls(file);
+ ret = read_annotate(file, __annotate_ifc);
if (ret)
return ret;
@@ -2703,14 +2531,6 @@ static int decode_sections(struct objtool_file *file)
if (ret)
return ret;
- /*
- * Must be after add_call_destinations() such that it can override
- * dead_end_function() marks.
- */
- ret = add_dead_ends(file);
- if (ret)
- return ret;
-
ret = add_jump_table_alts(file);
if (ret)
return ret;
@@ -2719,15 +2539,11 @@ static int decode_sections(struct objtool_file *file)
if (ret)
return ret;
- ret = read_retpoline_hints(file);
- if (ret)
- return ret;
-
- ret = read_instr_hints(file);
- if (ret)
- return ret;
-
- ret = read_validate_unret_hints(file);
+ /*
+ * Must be after add_call_destinations() such that it can override
+ * dead_end_function() marks.
+ */
+ ret = read_annotate(file, __annotate_late);
if (ret)
return ret;
@@ -3820,9 +3636,12 @@ static int validate_branch(struct objtool_file *file, struct symbol *func,
break;
case INSN_CONTEXT_SWITCH:
- if (func && (!next_insn || !next_insn->hint)) {
- WARN_INSN(insn, "unsupported instruction in callable function");
- return 1;
+ if (func) {
+ if (!next_insn || !next_insn->hint) {
+ WARN_INSN(insn, "unsupported instruction in callable function");
+ return 1;
+ }
+ break;
}
return 0;
diff --git a/tools/objtool/include/objtool/check.h b/tools/objtool/include/objtool/check.h
index daa46f1f0965..e1cd13cd28a3 100644
--- a/tools/objtool/include/objtool/check.h
+++ b/tools/objtool/include/objtool/check.h
@@ -71,7 +71,10 @@ struct instruction {
struct instruction *first_jump_src;
union {
struct symbol *_call_dest;
- struct reloc *_jump_table;
+ struct {
+ struct reloc *_jump_table;
+ unsigned long _jump_table_size;
+ };
};
struct alternative *alts;
struct symbol *sym;
diff --git a/tools/objtool/include/objtool/special.h b/tools/objtool/include/objtool/special.h
index 86d4af9c5aa9..e7ee7ffccefd 100644
--- a/tools/objtool/include/objtool/special.h
+++ b/tools/objtool/include/objtool/special.h
@@ -38,5 +38,6 @@ bool arch_support_alt_relocation(struct special_alt *special_alt,
struct instruction *insn,
struct reloc *reloc);
struct reloc *arch_find_switch_table(struct objtool_file *file,
- struct instruction *insn);
+ struct instruction *insn,
+ unsigned long *table_size);
#endif /* _SPECIAL_H */
diff --git a/tools/objtool/noreturns.h b/tools/objtool/noreturns.h
index f37614cc2c1b..b2174894f9f7 100644
--- a/tools/objtool/noreturns.h
+++ b/tools/objtool/noreturns.h
@@ -19,6 +19,7 @@ NORETURN(__x64_sys_exit_group)
NORETURN(arch_cpu_idle_dead)
NORETURN(bch2_trans_in_restart_error)
NORETURN(bch2_trans_restart_error)
+NORETURN(bch2_trans_unlocked_error)
NORETURN(cpu_bringup_and_idle)
NORETURN(cpu_startup_entry)
NORETURN(do_exit)
diff --git a/tools/perf/Documentation/perf-arm-spe.txt b/tools/perf/Documentation/perf-arm-spe.txt
index de2b0b479249..37afade4f1b2 100644
--- a/tools/perf/Documentation/perf-arm-spe.txt
+++ b/tools/perf/Documentation/perf-arm-spe.txt
@@ -150,6 +150,7 @@ arm_spe/load_filter=1,min_latency=10/'
pct_enable=1 - collect physical timestamp instead of virtual timestamp (PMSCR.PCT) - requires privilege
store_filter=1 - collect stores only (PMSFCR.ST)
ts_enable=1 - enable timestamping with value of generic timer (PMSCR.TS)
+ discard=1 - enable SPE PMU events but don't collect sample data - see 'Discard mode' (PMBLIMITR.FM = DISCARD)
+++*+++ Latency is the total latency from the point at which sampling started on that instruction, rather
than only the execution latency.
@@ -220,6 +221,31 @@ Common errors
Increase sampling interval (see above)
+PMU events
+~~~~~~~~~~
+
+SPE has events that can be counted on core PMUs. These are prefixed with
+SAMPLE_, for example SAMPLE_POP, SAMPLE_FEED, SAMPLE_COLLISION and
+SAMPLE_FEED_BR.
+
+These events will only count when an SPE event is running on the same core that
+the PMU event is opened on, otherwise they read as 0. There are various ways to
+ensure that the PMU event and SPE event are scheduled together depending on the
+way the event is opened. For example opening both events as per-process events
+on the same process, although it's not guaranteed that the PMU event is enabled
+first when context switching. For that reason it may be better to open the PMU
+event as a systemwide event and then open SPE on the process of interest.
+
+Discard mode
+~~~~~~~~~~~~
+
+SPE related (SAMPLE_* etc) core PMU events can be used without the overhead of
+collecting sample data if discard mode is supported (optional from Armv8.6).
+First run a system wide SPE session (or on the core of interest) using options
+to minimize output. Then run perf stat:
+
+ perf record -e arm_spe/discard/ -a -N -B --no-bpf-event -o - > /dev/null &
+ perf stat -e SAMPLE_FEED_LD
SEE ALSO
--------
diff --git a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
index 1464c6be6eb3..c844cd5cda62 100644
--- a/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
+++ b/tools/perf/arch/mips/entry/syscalls/syscall_n64.tbl
@@ -377,3 +377,7 @@
460 n64 lsm_set_self_attr sys_lsm_set_self_attr
461 n64 lsm_list_modules sys_lsm_list_modules
462 n64 mseal sys_mseal
+463 n64 setxattrat sys_setxattrat
+464 n64 getxattrat sys_getxattrat
+465 n64 listxattrat sys_listxattrat
+466 n64 removexattrat sys_removexattrat
diff --git a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
index ebae8415dfbb..d8b4ab78bef0 100644
--- a/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/powerpc/entry/syscalls/syscall.tbl
@@ -553,3 +553,7 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
diff --git a/tools/perf/arch/s390/entry/syscalls/syscall.tbl b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
index 01071182763e..e9115b4d8b63 100644
--- a/tools/perf/arch/s390/entry/syscalls/syscall.tbl
+++ b/tools/perf/arch/s390/entry/syscalls/syscall.tbl
@@ -465,3 +465,7 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal sys_mseal
+463 common setxattrat sys_setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat sys_removexattrat
diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
index 534c74b14fab..4d0fb2fba7e2 100644
--- a/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
+++ b/tools/perf/arch/x86/entry/syscalls/syscall_32.tbl
@@ -468,3 +468,7 @@
460 i386 lsm_set_self_attr sys_lsm_set_self_attr
461 i386 lsm_list_modules sys_lsm_list_modules
462 i386 mseal sys_mseal
+463 i386 setxattrat sys_setxattrat
+464 i386 getxattrat sys_getxattrat
+465 i386 listxattrat sys_listxattrat
+466 i386 removexattrat sys_removexattrat
diff --git a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
index 7093ee21c0d1..5eb708bff1c7 100644
--- a/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
+++ b/tools/perf/arch/x86/entry/syscalls/syscall_64.tbl
@@ -386,6 +386,10 @@
460 common lsm_set_self_attr sys_lsm_set_self_attr
461 common lsm_list_modules sys_lsm_list_modules
462 common mseal sys_mseal
+463 common setxattrat sys_setxattrat
+464 common getxattrat sys_getxattrat
+465 common listxattrat sys_listxattrat
+466 common removexattrat sys_removexattrat
#
# Due to a historical design error, certain syscalls are numbered differently
diff --git a/tools/perf/builtin-ftrace.c b/tools/perf/builtin-ftrace.c
index 272d3c70810e..a56cf8b0a7d4 100644
--- a/tools/perf/builtin-ftrace.c
+++ b/tools/perf/builtin-ftrace.c
@@ -1151,8 +1151,9 @@ static int cmp_profile_data(const void *a, const void *b)
if (v1 > v2)
return -1;
- else
+ if (v1 < v2)
return 1;
+ return 0;
}
static void print_profile_result(struct perf_ftrace *ftrace)
diff --git a/tools/perf/tests/builtin-test.c b/tools/perf/tests/builtin-test.c
index 8dcf74d3c0a3..4751dd3c6f67 100644
--- a/tools/perf/tests/builtin-test.c
+++ b/tools/perf/tests/builtin-test.c
@@ -508,7 +508,7 @@ static int __cmd_test(struct test_suite **suites, int argc, const char *argv[],
for (size_t x = 0; x < num_tests; x++) {
struct child_test *child_test = child_tests[x];
- if (!child_test)
+ if (!child_test || child_test->process.pid <= 0)
continue;
pr_debug3("Killing %d pid %d\n",
diff --git a/tools/perf/tests/expr.c b/tools/perf/tests/expr.c
index 41ff1affdfcd..726cf8d4da28 100644
--- a/tools/perf/tests/expr.c
+++ b/tools/perf/tests/expr.c
@@ -75,14 +75,12 @@ static int test__expr(struct test_suite *t __maybe_unused, int subtest __maybe_u
double val, num_cpus_online, num_cpus, num_cores, num_dies, num_packages;
int ret;
struct expr_parse_ctx *ctx;
- bool is_intel = false;
char strcmp_cpuid_buf[256];
struct perf_cpu cpu = {-1};
char *cpuid = get_cpuid_allow_env_override(cpu);
char *escaped_cpuid1, *escaped_cpuid2;
TEST_ASSERT_VAL("get_cpuid", cpuid);
- is_intel = strstr(cpuid, "Intel") != NULL;
TEST_ASSERT_EQUAL("ids_union", test_ids_union(), 0);
@@ -245,12 +243,19 @@ static int test__expr(struct test_suite *t __maybe_unused, int subtest __maybe_u
if (num_dies) // Some platforms do not have CPU die support, for example s390
TEST_ASSERT_VAL("#num_dies >= #num_packages", num_dies >= num_packages);
- TEST_ASSERT_VAL("#system_tsc_freq", expr__parse(&val, ctx, "#system_tsc_freq") == 0);
- if (is_intel)
- TEST_ASSERT_VAL("#system_tsc_freq > 0", val > 0);
- else
- TEST_ASSERT_VAL("#system_tsc_freq == 0", fpclassify(val) == FP_ZERO);
+ if (expr__parse(&val, ctx, "#system_tsc_freq") == 0) {
+ bool is_intel = strstr(cpuid, "Intel") != NULL;
+
+ if (is_intel)
+ TEST_ASSERT_VAL("#system_tsc_freq > 0", val > 0);
+ else
+ TEST_ASSERT_VAL("#system_tsc_freq == 0", fpclassify(val) == FP_ZERO);
+ } else {
+#if defined(__i386__) || defined(__x86_64__)
+ TEST_ASSERT_VAL("#system_tsc_freq unsupported", 0);
+#endif
+ }
/*
* Source count returns the number of events aggregating in a leader
* event including the leader. Check parsing yields an id.
diff --git a/tools/perf/tests/hwmon_pmu.c b/tools/perf/tests/hwmon_pmu.c
index f8bcee9660d5..d2b066a2b557 100644
--- a/tools/perf/tests/hwmon_pmu.c
+++ b/tools/perf/tests/hwmon_pmu.c
@@ -65,7 +65,7 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
{ "temp2_label", "test hwmon event2\n", },
{ "temp2_input", "50000\n", },
};
- int dirfd, file;
+ int hwmon_dirfd = -1, test_dirfd = -1, file;
struct perf_pmu *hwm = NULL;
ssize_t len;
@@ -76,19 +76,24 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
dir[0] = '\0';
return NULL;
}
- dirfd = open(dir, O_DIRECTORY);
- if (dirfd < 0) {
+ test_dirfd = open(dir, O_PATH|O_DIRECTORY);
+ if (test_dirfd < 0) {
pr_err("Failed to open test directory \"%s\"\n", dir);
goto err_out;
}
/* Create the test hwmon directory and give it a name. */
- if (mkdirat(dirfd, "hwmon1234", 0755) < 0) {
+ if (mkdirat(test_dirfd, "hwmon1234", 0755) < 0) {
pr_err("Failed to mkdir hwmon directory\n");
goto err_out;
}
- file = openat(dirfd, "hwmon1234/name", O_WRONLY | O_CREAT, 0600);
- if (!file) {
+ hwmon_dirfd = openat(test_dirfd, "hwmon1234", O_DIRECTORY);
+ if (hwmon_dirfd < 0) {
+ pr_err("Failed to open test hwmon directory \"%s/hwmon1234\"\n", dir);
+ goto err_out;
+ }
+ file = openat(hwmon_dirfd, "name", O_WRONLY | O_CREAT, 0600);
+ if (file < 0) {
pr_err("Failed to open for writing file \"name\"\n");
goto err_out;
}
@@ -104,8 +109,8 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
for (size_t i = 0; i < ARRAY_SIZE(test_items); i++) {
const struct test_item *item = &test_items[i];
- file = openat(dirfd, item->name, O_WRONLY | O_CREAT, 0600);
- if (!file) {
+ file = openat(hwmon_dirfd, item->name, O_WRONLY | O_CREAT, 0600);
+ if (file < 0) {
pr_err("Failed to open for writing file \"%s\"\n", item->name);
goto err_out;
}
@@ -119,16 +124,18 @@ static struct perf_pmu *test_pmu_get(char *dir, size_t sz)
}
/* Make the PMU reading the files created above. */
- hwm = perf_pmus__add_test_hwmon_pmu(dirfd, "hwmon1234", test_hwmon_name);
+ hwm = perf_pmus__add_test_hwmon_pmu(hwmon_dirfd, "hwmon1234", test_hwmon_name);
if (!hwm)
pr_err("Test hwmon creation failed\n");
err_out:
if (!hwm) {
test_pmu_put(dir, hwm);
- if (dirfd >= 0)
- close(dirfd);
+ if (hwmon_dirfd >= 0)
+ close(hwmon_dirfd);
}
+ if (test_dirfd >= 0)
+ close(test_dirfd);
return hwm;
}
diff --git a/tools/perf/trace/beauty/fs_at_flags.sh b/tools/perf/trace/beauty/fs_at_flags.sh
index e3f13f96a27c..fac4d0c049fc 100755
--- a/tools/perf/trace/beauty/fs_at_flags.sh
+++ b/tools/perf/trace/beauty/fs_at_flags.sh
@@ -13,13 +13,14 @@ printf "static const char *fs_at_flags[] = {\n"
regex='^[[:space:]]*#[[:space:]]*define[[:space:]]+AT_([^_]+[[:alnum:]_]+)[[:space:]]+(0x[[:xdigit:]]+)[[:space:]]*.*'
# AT_EACCESS is only meaningful to faccessat, so we will special case it there...
# AT_STATX_SYNC_TYPE is not a bit, its a mask of AT_STATX_SYNC_AS_STAT, AT_STATX_FORCE_SYNC and AT_STATX_DONT_SYNC
-# AT_HANDLE_FID and AT_HANDLE_MNT_ID_UNIQUE are reusing values and are valid only for name_to_handle_at()
+# AT_HANDLE_FID, AT_HANDLE_MNT_ID_UNIQUE and AT_HANDLE_CONNECTABLE are reusing values and are valid only for name_to_handle_at()
# AT_RENAME_NOREPLACE reuses 0x1 and is valid only for renameat2()
grep -E $regex ${linux_fcntl} | \
grep -v AT_EACCESS | \
grep -v AT_STATX_SYNC_TYPE | \
grep -v AT_HANDLE_FID | \
grep -v AT_HANDLE_MNT_ID_UNIQUE | \
+ grep -v AT_HANDLE_CONNECTABLE | \
grep -v AT_RENAME_NOREPLACE | \
sed -r "s/$regex/\2 \1/g" | \
xargs printf "\t[ilog2(%s) + 1] = \"%s\",\n"
diff --git a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
index 87e2dec79fea..6e6907e63bfc 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/fcntl.h
@@ -153,9 +153,6 @@
object identity and may not be
usable with open_by_handle_at(2). */
#define AT_HANDLE_MNT_ID_UNIQUE 0x001 /* Return the u64 unique mount ID. */
-
-#if defined(__KERNEL__)
-#define AT_GETATTR_NOSEC 0x80000000
-#endif
+#define AT_HANDLE_CONNECTABLE 0x002 /* Request a connectable file handle */
#endif /* _UAPI_LINUX_FCNTL_H */
diff --git a/tools/perf/trace/beauty/include/uapi/linux/mount.h b/tools/perf/trace/beauty/include/uapi/linux/mount.h
index 225bc366ffcb..c07008816aca 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/mount.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/mount.h
@@ -154,7 +154,7 @@ struct mount_attr {
*/
struct statmount {
__u32 size; /* Total size, including strings */
- __u32 mnt_opts; /* [str] Mount options of the mount */
+ __u32 mnt_opts; /* [str] Options (comma separated, escaped) */
__u64 mask; /* What results were written */
__u32 sb_dev_major; /* Device ID */
__u32 sb_dev_minor;
@@ -173,7 +173,13 @@ struct statmount {
__u32 mnt_root; /* [str] Root of mount relative to root of fs */
__u32 mnt_point; /* [str] Mountpoint relative to current root */
__u64 mnt_ns_id; /* ID of the mount namespace */
- __u64 __spare2[49];
+ __u32 fs_subtype; /* [str] Subtype of fs_type (if any) */
+ __u32 sb_source; /* [str] Source string of the mount */
+ __u32 opt_num; /* Number of fs options */
+ __u32 opt_array; /* [str] Array of nul terminated fs options */
+ __u32 opt_sec_num; /* Number of security options */
+ __u32 opt_sec_array; /* [str] Array of nul terminated security options */
+ __u64 __spare2[46];
char str[]; /* Variable size part containing strings */
};
@@ -207,6 +213,10 @@ struct mnt_id_req {
#define STATMOUNT_FS_TYPE 0x00000020U /* Want/got fs_type */
#define STATMOUNT_MNT_NS_ID 0x00000040U /* Want/got mnt_ns_id */
#define STATMOUNT_MNT_OPTS 0x00000080U /* Want/got mnt_opts */
+#define STATMOUNT_FS_SUBTYPE 0x00000100U /* Want/got fs_subtype */
+#define STATMOUNT_SB_SOURCE 0x00000200U /* Want/got sb_source */
+#define STATMOUNT_OPT_ARRAY 0x00000400U /* Want/got opt_... */
+#define STATMOUNT_OPT_SEC_ARRAY 0x00000800U /* Want/got opt_sec... */
/*
* Special @mnt_id values that can be passed to listmount
diff --git a/tools/perf/trace/beauty/include/uapi/linux/prctl.h b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
index 35791791a879..5c6080680cb2 100644
--- a/tools/perf/trace/beauty/include/uapi/linux/prctl.h
+++ b/tools/perf/trace/beauty/include/uapi/linux/prctl.h
@@ -230,7 +230,7 @@ struct prctl_mm_map {
# define PR_PAC_APDBKEY (1UL << 3)
# define PR_PAC_APGAKEY (1UL << 4)
-/* Tagged user address controls for arm64 */
+/* Tagged user address controls for arm64 and RISC-V */
#define PR_SET_TAGGED_ADDR_CTRL 55
#define PR_GET_TAGGED_ADDR_CTRL 56
# define PR_TAGGED_ADDR_ENABLE (1UL << 0)
@@ -244,6 +244,9 @@ struct prctl_mm_map {
# define PR_MTE_TAG_MASK (0xffffUL << PR_MTE_TAG_SHIFT)
/* Unused; kept only for source compatibility */
# define PR_MTE_TCF_SHIFT 1
+/* RISC-V pointer masking tag length */
+# define PR_PMLEN_SHIFT 24
+# define PR_PMLEN_MASK (0x7fUL << PR_PMLEN_SHIFT)
/* Control reclaim behavior when allocating memory */
#define PR_SET_IO_FLUSHER 57
@@ -328,4 +331,26 @@ struct prctl_mm_map {
# define PR_PPC_DEXCR_CTRL_CLEAR_ONEXEC 0x10 /* Clear the aspect on exec */
# define PR_PPC_DEXCR_CTRL_MASK 0x1f
+/*
+ * Get the current shadow stack configuration for the current thread,
+ * this will be the value configured via PR_SET_SHADOW_STACK_STATUS.
+ */
+#define PR_GET_SHADOW_STACK_STATUS 74
+
+/*
+ * Set the current shadow stack configuration. Enabling the shadow
+ * stack will cause a shadow stack to be allocated for the thread.
+ */
+#define PR_SET_SHADOW_STACK_STATUS 75
+# define PR_SHADOW_STACK_ENABLE (1UL << 0)
+# define PR_SHADOW_STACK_WRITE (1UL << 1)
+# define PR_SHADOW_STACK_PUSH (1UL << 2)
+
+/*
+ * Prevent further changes to the specified shadow stack
+ * configuration. All bits may be locked via this call, including
+ * undefined bits.
+ */
+#define PR_LOCK_SHADOW_STACK_STATUS 76
+
#endif /* _LINUX_PRCTL_H */
diff --git a/tools/perf/util/build-id.c b/tools/perf/util/build-id.c
index 8982f68e7230..e763e8d99a43 100644
--- a/tools/perf/util/build-id.c
+++ b/tools/perf/util/build-id.c
@@ -277,7 +277,7 @@ static int write_buildid(const char *name, size_t name_len, struct build_id *bid
struct perf_record_header_build_id b;
size_t len;
- len = sizeof(b) + name_len + 1;
+ len = name_len + 1;
len = PERF_ALIGN(len, sizeof(u64));
memset(&b, 0, sizeof(b));
@@ -286,7 +286,7 @@ static int write_buildid(const char *name, size_t name_len, struct build_id *bid
misc |= PERF_RECORD_MISC_BUILD_ID_SIZE;
b.pid = pid;
b.header.misc = misc;
- b.header.size = len;
+ b.header.size = sizeof(b) + len;
err = do_write(fd, &b, sizeof(b));
if (err < 0)
diff --git a/tools/perf/util/evsel.c b/tools/perf/util/evsel.c
index f745723d486b..d22c5df1701e 100644
--- a/tools/perf/util/evsel.c
+++ b/tools/perf/util/evsel.c
@@ -2571,12 +2571,12 @@ try_fallback:
if (err == -EMFILE && rlimit__increase_nofile(&set_rlimit))
goto retry_open;
- if (err == -EOPNOTSUPP && evsel__precise_ip_fallback(evsel))
- goto retry_open;
-
if (err == -EINVAL && evsel__detect_missing_features(evsel))
goto fallback_missing_features;
+ if (evsel__precise_ip_fallback(evsel))
+ goto retry_open;
+
if (evsel__handle_error_quirks(evsel, err))
goto retry_open;
diff --git a/tools/perf/util/hwmon_pmu.c b/tools/perf/util/hwmon_pmu.c
index e61429b38ba7..4acb9bb19b84 100644
--- a/tools/perf/util/hwmon_pmu.c
+++ b/tools/perf/util/hwmon_pmu.c
@@ -258,8 +258,12 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
if (pmu->pmu.sysfs_aliases_loaded)
return 0;
- /* Use a dup-ed fd as closedir will close it. */
- dup_fd = dup(pmu->hwmon_dir_fd);
+ /*
+ * Use a dup-ed fd as closedir will close it. Use openat so that the
+ * directory contents are refreshed.
+ */
+ dup_fd = openat(pmu->hwmon_dir_fd, ".", O_DIRECTORY);
+
if (dup_fd == -1)
return -ENOMEM;
@@ -336,6 +340,9 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
close(fd);
}
}
+ if (hashmap__size(&pmu->events) == 0)
+ pr_debug2("hwmon_pmu: %s has no events\n", pmu->pmu.name);
+
hashmap__for_each_entry_safe((&pmu->events), cur, tmp, bkt) {
union hwmon_pmu_event_key key = {
.type_and_num = cur->key,
@@ -343,8 +350,8 @@ static int hwmon_pmu__read_events(struct hwmon_pmu *pmu)
struct hwmon_pmu_event_value *value = cur->pvalue;
if (!test_bit(HWMON_ITEM_INPUT, value->items)) {
- pr_debug("hwmon_pmu: removing event '%s%d' that has no input file\n",
- hwmon_type_strs[key.type], key.num);
+ pr_debug("hwmon_pmu: %s removing event '%s%d' that has no input file\n",
+ pmu->pmu.name, hwmon_type_strs[key.type], key.num);
hashmap__delete(&pmu->events, key.type_and_num, &key, &value);
zfree(&value->label);
zfree(&value->name);
diff --git a/tools/perf/util/machine.c b/tools/perf/util/machine.c
index 4f0ac998b0cc..27d5345d2b30 100644
--- a/tools/perf/util/machine.c
+++ b/tools/perf/util/machine.c
@@ -134,6 +134,8 @@ struct machine *machine__new_host(void)
if (machine__create_kernel_maps(machine) < 0)
goto out_delete;
+
+ machine->env = &perf_env;
}
return machine;
diff --git a/tools/perf/util/probe-event.c b/tools/perf/util/probe-event.c
index 6d51a4c98ad7..eaa0318e9b87 100644
--- a/tools/perf/util/probe-event.c
+++ b/tools/perf/util/probe-event.c
@@ -1370,7 +1370,7 @@ int parse_line_range_desc(const char *arg, struct line_range *lr)
{
char *buf = strdup(arg);
char *p;
- int err;
+ int err = 0;
if (!buf)
return -ENOMEM;
diff --git a/tools/power/cpupower/Makefile b/tools/power/cpupower/Makefile
index 175004ce44b2..51a95239fe06 100644
--- a/tools/power/cpupower/Makefile
+++ b/tools/power/cpupower/Makefile
@@ -87,11 +87,19 @@ INSTALL_SCRIPT = ${INSTALL} -m 644
# to something more interesting, like "arm-linux-". If you want
# to compile vs uClibc, that can be done here as well.
CROSS ?= #/usr/i386-linux-uclibc/usr/bin/i386-uclibc-
+ifneq ($(CROSS), )
+CC = $(CROSS)gcc
+LD = $(CROSS)gcc
+AR = $(CROSS)ar
+STRIP = $(CROSS)strip
+RANLIB = $(CROSS)ranlib
+else
CC ?= $(CROSS)gcc
LD ?= $(CROSS)gcc
AR ?= $(CROSS)ar
STRIP ?= $(CROSS)strip
RANLIB ?= $(CROSS)ranlib
+endif
HOSTCC = gcc
MKDIR = mkdir
diff --git a/tools/power/cpupower/bindings/python/Makefile b/tools/power/cpupower/bindings/python/Makefile
index e1ebb1d60cd4..741f21477432 100644
--- a/tools/power/cpupower/bindings/python/Makefile
+++ b/tools/power/cpupower/bindings/python/Makefile
@@ -11,6 +11,7 @@ HAVE_PYCONFIG := $(shell if which python-config >/dev/null 2>&1; then echo 1; el
LIB_DIR := ../../lib
PY_INCLUDE = $(firstword $(shell python-config --includes))
OBJECTS_LIB = $(wildcard $(LIB_DIR)/*.o)
+INSTALL_DIR = $(shell python3 -c "import site; print(site.getsitepackages()[0])")
all: _raw_pylibcpupower.so
@@ -28,6 +29,15 @@ else ifeq ($(HAVE_PYCONFIG),0)
endif
swig -python raw_pylibcpupower.swg
+# Only installs the Python bindings
+install: _raw_pylibcpupower.so
+ install -D _raw_pylibcpupower.so $(INSTALL_DIR)/_raw_pylibcpupower.so
+ install -D raw_pylibcpupower.py $(INSTALL_DIR)/raw_pylibcpupower.py
+
+uninstall:
+ rm -f $(INSTALL_DIR)/_raw_pylibcpupower.so
+ rm -f $(INSTALL_DIR)/raw_pylibcpupower.py
+
# Will only clean the bindings folder; will not clean the actual cpupower folder
clean:
rm -f raw_pylibcpupower.py raw_pylibcpupower_wrap.c raw_pylibcpupower_wrap.o _raw_pylibcpupower.so
diff --git a/tools/power/cpupower/bindings/python/README b/tools/power/cpupower/bindings/python/README
index 0a4bb2581e8a..952e2e02fd32 100644
--- a/tools/power/cpupower/bindings/python/README
+++ b/tools/power/cpupower/bindings/python/README
@@ -48,6 +48,31 @@ To run the test script:
$ python test_raw_pylibcpupower.py
+developing/using the bindings directly
+--------------------------------------
+
+You need to add the Python bindings directory to your $PYTHONPATH.
+
+You would set the path in the Bash terminal or in the Bash profile:
+
+PYTHONPATH=~/linux/tools/power/cpupower/bindings/python:$PYTHONPATH
+
+This allows you to set a specific repo of the bindings to use.
+
+
+installing/uninstalling
+-----------------------
+
+Python uses a system specific site-packages folder to look up modules to import
+by default. You do not need to install cpupower to use the SWIG bindings.
+
+You can install and uninstall the bindings to the site-packages with:
+
+sudo make install
+
+sudo make uninstall
+
+
credits
-------
diff --git a/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg b/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
index 96556d87a745..d82af6fa93c3 100644
--- a/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
+++ b/tools/power/cpupower/bindings/python/raw_pylibcpupower.swg
@@ -134,6 +134,9 @@ void cpufreq_put_stats(struct cpufreq_stats *stats);
unsigned long cpufreq_get_transitions(unsigned int cpu);
+char *cpufreq_get_energy_performance_preference(unsigned int cpu);
+void cpufreq_put_energy_performance_preference(char *ptr);
+
int cpufreq_set_policy(unsigned int cpu, struct cpufreq_policy *policy);
int cpufreq_modify_policy_min(unsigned int cpu, unsigned long min_freq);
@@ -160,6 +163,8 @@ int cpuidle_state_disable(unsigned int cpu, unsigned int idlestate,
unsigned int disable);
unsigned long cpuidle_state_latency(unsigned int cpu,
unsigned int idlestate);
+unsigned long cpuidle_state_residency(unsigned int cpu,
+ unsigned int idlestate);
unsigned long cpuidle_state_usage(unsigned int cpu,
unsigned int idlestate);
unsigned long long cpuidle_state_time(unsigned int cpu,
diff --git a/tools/power/cpupower/lib/cpufreq.c b/tools/power/cpupower/lib/cpufreq.c
index 1516d23c17c9..8dda3db2dff0 100644
--- a/tools/power/cpupower/lib/cpufreq.c
+++ b/tools/power/cpupower/lib/cpufreq.c
@@ -102,6 +102,10 @@ unsigned long cpufreq_get_sysfs_value_from_table(unsigned int cpu,
if (len == 0)
return 0;
+ if (!strcmp(linebuf, "enabled\n"))
+ return 1;
+ if (!strcmp(linebuf, "disabled\n"))
+ return 0;
value = strtoul(linebuf, &endp, 0);
if (endp == linebuf || errno == ERANGE)
@@ -123,12 +127,14 @@ static unsigned long sysfs_cpufreq_get_one_value(unsigned int cpu,
enum cpufreq_string {
SCALING_DRIVER,
SCALING_GOVERNOR,
+ ENERGY_PERFORMANCE_PREFERENCE,
MAX_CPUFREQ_STRING_FILES
};
static const char *cpufreq_string_files[MAX_CPUFREQ_STRING_FILES] = {
[SCALING_DRIVER] = "scaling_driver",
[SCALING_GOVERNOR] = "scaling_governor",
+ [ENERGY_PERFORMANCE_PREFERENCE] = "energy_performance_preference",
};
@@ -203,6 +209,18 @@ unsigned long cpufreq_get_transition_latency(unsigned int cpu)
return sysfs_cpufreq_get_one_value(cpu, CPUINFO_LATENCY);
}
+char *cpufreq_get_energy_performance_preference(unsigned int cpu)
+{
+ return sysfs_cpufreq_get_one_string(cpu, ENERGY_PERFORMANCE_PREFERENCE);
+}
+
+void cpufreq_put_energy_performance_preference(char *ptr)
+{
+ if (!ptr)
+ return;
+ free(ptr);
+}
+
int cpufreq_get_hardware_limits(unsigned int cpu,
unsigned long *min,
unsigned long *max)
diff --git a/tools/power/cpupower/lib/cpufreq.h b/tools/power/cpupower/lib/cpufreq.h
index 2f3c84035806..bfc617311ebd 100644
--- a/tools/power/cpupower/lib/cpufreq.h
+++ b/tools/power/cpupower/lib/cpufreq.h
@@ -68,6 +68,14 @@ unsigned long cpufreq_get_freq_hardware(unsigned int cpu);
unsigned long cpufreq_get_transition_latency(unsigned int cpu);
+/* determine energy performance preference
+ *
+ * returns NULL on failure, else the string that represents the energy performance
+ * preference requested.
+ */
+char *cpufreq_get_energy_performance_preference(unsigned int cpu);
+void cpufreq_put_energy_performance_preference(char *ptr);
+
/* determine hardware CPU frequency limits
*
* These may be limited further by thermal, energy or other
diff --git a/tools/power/cpupower/utils/cpufreq-info.c b/tools/power/cpupower/utils/cpufreq-info.c
index c96b77365c63..fc750e127404 100644
--- a/tools/power/cpupower/utils/cpufreq-info.c
+++ b/tools/power/cpupower/utils/cpufreq-info.c
@@ -120,7 +120,6 @@ static void print_duration(unsigned long duration)
} else
printf("%lu ns", duration);
}
- return;
}
static int get_boost_mode_x86(unsigned int cpu)
@@ -255,7 +254,12 @@ static int get_freq_kernel(unsigned int cpu, unsigned int human)
static int get_freq_hardware(unsigned int cpu, unsigned int human)
{
- unsigned long freq = cpufreq_get_freq_hardware(cpu);
+ unsigned long freq;
+
+ if (cpupower_cpu_info.caps & CPUPOWER_CAP_APERF)
+ return -EINVAL;
+
+ freq = cpufreq_get_freq_hardware(cpu);
printf(_(" current CPU frequency: "));
if (!freq) {
printf("Unable to call hardware\n");
@@ -418,12 +422,32 @@ static int get_freq_stats(unsigned int cpu, unsigned int human)
return 0;
}
+/* --epp / -z */
+
+static int get_epp(unsigned int cpu, bool interactive)
+{
+ char *epp;
+
+ epp = cpufreq_get_energy_performance_preference(cpu);
+ if (!epp)
+ return -EINVAL;
+ if (interactive)
+ printf(_(" energy performance preference: %s\n"), epp);
+
+ cpufreq_put_energy_performance_preference(epp);
+
+ return 0;
+}
+
/* --latency / -y */
static int get_latency(unsigned int cpu, unsigned int human)
{
unsigned long latency = cpufreq_get_transition_latency(cpu);
+ if (!get_epp(cpu, false))
+ return -EINVAL;
+
printf(_(" maximum transition latency: "));
if (!latency || latency == UINT_MAX) {
printf(_(" Cannot determine or is not supported.\n"));
@@ -457,6 +481,7 @@ static void debug_output_one(unsigned int cpu)
get_related_cpus(cpu);
get_affected_cpus(cpu);
get_latency(cpu, 1);
+ get_epp(cpu, true);
get_hardware_limits(cpu, 1);
freqs = cpufreq_get_available_frequencies(cpu);
@@ -497,6 +522,7 @@ static struct option info_opts[] = {
{"human", no_argument, NULL, 'm'},
{"no-rounding", no_argument, NULL, 'n'},
{"performance", no_argument, NULL, 'c'},
+ {"epp", no_argument, NULL, 'z'},
{ },
};
@@ -510,7 +536,7 @@ int cmd_freq_info(int argc, char **argv)
int output_param = 0;
do {
- ret = getopt_long(argc, argv, "oefwldpgrasmybnc", info_opts,
+ ret = getopt_long(argc, argv, "oefwldpgrasmybncz", info_opts,
NULL);
switch (ret) {
case '?':
@@ -534,6 +560,7 @@ int cmd_freq_info(int argc, char **argv)
case 's':
case 'y':
case 'c':
+ case 'z':
if (output_param) {
output_param = -1;
cont = 0;
@@ -643,6 +670,9 @@ int cmd_freq_info(int argc, char **argv)
case 'c':
ret = get_perf_cap(cpu);
break;
+ case 'z':
+ ret = get_epp(cpu, true);
+ break;
}
if (ret)
return ret;
diff --git a/tools/power/cpupower/utils/helpers/amd.c b/tools/power/cpupower/utils/helpers/amd.c
index 0a56e22240fc..795562e879de 100644
--- a/tools/power/cpupower/utils/helpers/amd.c
+++ b/tools/power/cpupower/utils/helpers/amd.c
@@ -177,6 +177,8 @@ enum amd_pstate_value {
AMD_PSTATE_HIGHEST_PERF,
AMD_PSTATE_MAX_FREQ,
AMD_PSTATE_LOWEST_NONLINEAR_FREQ,
+ AMD_PSTATE_HW_PREFCORE,
+ AMD_PSTATE_PREFCORE_RANKING,
MAX_AMD_PSTATE_VALUE_READ_FILES,
};
@@ -184,6 +186,8 @@ static const char *amd_pstate_value_files[MAX_AMD_PSTATE_VALUE_READ_FILES] = {
[AMD_PSTATE_HIGHEST_PERF] = "amd_pstate_highest_perf",
[AMD_PSTATE_MAX_FREQ] = "amd_pstate_max_freq",
[AMD_PSTATE_LOWEST_NONLINEAR_FREQ] = "amd_pstate_lowest_nonlinear_freq",
+ [AMD_PSTATE_HW_PREFCORE] = "amd_pstate_hw_prefcore",
+ [AMD_PSTATE_PREFCORE_RANKING] = "amd_pstate_prefcore_ranking",
};
static unsigned long amd_pstate_get_data(unsigned int cpu,
@@ -215,7 +219,9 @@ void amd_pstate_boost_init(unsigned int cpu, int *support, int *active)
void amd_pstate_show_perf_and_freq(unsigned int cpu, int no_rounding)
{
- printf(_(" AMD PSTATE Highest Performance: %lu. Maximum Frequency: "),
+
+ printf(_(" amd-pstate limits:\n"));
+ printf(_(" Highest Performance: %lu. Maximum Frequency: "),
amd_pstate_get_data(cpu, AMD_PSTATE_HIGHEST_PERF));
/*
* If boost isn't active, the cpuinfo_max doesn't indicate real max
@@ -224,22 +230,26 @@ void amd_pstate_show_perf_and_freq(unsigned int cpu, int no_rounding)
print_speed(amd_pstate_get_data(cpu, AMD_PSTATE_MAX_FREQ), no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Nominal Performance: %lu. Nominal Frequency: "),
+ printf(_(" Nominal Performance: %lu. Nominal Frequency: "),
acpi_cppc_get_data(cpu, NOMINAL_PERF));
print_speed(acpi_cppc_get_data(cpu, NOMINAL_FREQ) * 1000,
no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Lowest Non-linear Performance: %lu. Lowest Non-linear Frequency: "),
+ printf(_(" Lowest Non-linear Performance: %lu. Lowest Non-linear Frequency: "),
acpi_cppc_get_data(cpu, LOWEST_NONLINEAR_PERF));
print_speed(amd_pstate_get_data(cpu, AMD_PSTATE_LOWEST_NONLINEAR_FREQ),
no_rounding);
printf(".\n");
- printf(_(" AMD PSTATE Lowest Performance: %lu. Lowest Frequency: "),
+ printf(_(" Lowest Performance: %lu. Lowest Frequency: "),
acpi_cppc_get_data(cpu, LOWEST_PERF));
print_speed(acpi_cppc_get_data(cpu, LOWEST_FREQ) * 1000, no_rounding);
printf(".\n");
+
+ printf(_(" Preferred Core Support: %lu. Preferred Core Ranking: %lu.\n"),
+ amd_pstate_get_data(cpu, AMD_PSTATE_HW_PREFCORE),
+ amd_pstate_get_data(cpu, AMD_PSTATE_PREFCORE_RANKING));
}
/* AMD P-State Helper Functions ************************************/
diff --git a/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c b/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
index 55e55b6b42f9..f5a2a326b1b7 100644
--- a/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/hsw_ext_idle.c
@@ -117,7 +117,7 @@ static int hsw_ext_start(void)
for (num = 0; num < HSW_EXT_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- hsw_ext_get_count(num, &val, cpu);
+ is_valid[cpu] = !hsw_ext_get_count(num, &val, cpu);
previous_count[num][cpu] = val;
}
}
@@ -134,7 +134,7 @@ static int hsw_ext_stop(void)
for (num = 0; num < HSW_EXT_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !hsw_ext_get_count(num, &val, cpu);
+ is_valid[cpu] |= !hsw_ext_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c b/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
index ae6af354a81d..73b6b10cbdd2 100644
--- a/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
+++ b/tools/power/cpupower/utils/idle_monitor/mperf_monitor.c
@@ -33,7 +33,7 @@ static int mperf_get_count_percent(unsigned int self_id, double *percent,
unsigned int cpu);
static int mperf_get_count_freq(unsigned int id, unsigned long long *count,
unsigned int cpu);
-static struct timespec time_start, time_end;
+static struct timespec *time_start, *time_end;
static cstate_t mperf_cstates[MPERF_CSTATE_COUNT] = {
{
@@ -148,7 +148,7 @@ static int mperf_measure_stats(unsigned int cpu)
ret = get_aperf_mperf(cpu, &aval, &mval);
aperf_current_count[cpu] = aval;
mperf_current_count[cpu] = mval;
- is_valid[cpu] = !ret;
+ is_valid[cpu] |= !ret;
return 0;
}
@@ -174,7 +174,7 @@ static int mperf_get_count_percent(unsigned int id, double *percent,
dprint("%s: TSC Ref - mperf_diff: %llu, tsc_diff: %llu\n",
mperf_cstates[id].name, mperf_diff, tsc_diff);
} else if (max_freq_mode == MAX_FREQ_SYSFS) {
- timediff = max_frequency * timespec_diff_us(time_start, time_end);
+ timediff = max_frequency * timespec_diff_us(time_start[cpu], time_end[cpu]);
*percent = 100.0 * mperf_diff / timediff;
dprint("%s: MAXFREQ - mperf_diff: %llu, time_diff: %llu\n",
mperf_cstates[id].name, mperf_diff, timediff);
@@ -207,7 +207,7 @@ static int mperf_get_count_freq(unsigned int id, unsigned long long *count,
if (max_freq_mode == MAX_FREQ_TSC_REF) {
/* Calculate max_freq from TSC count */
tsc_diff = tsc_at_measure_end[cpu] - tsc_at_measure_start[cpu];
- time_diff = timespec_diff_us(time_start, time_end);
+ time_diff = timespec_diff_us(time_start[cpu], time_end[cpu]);
max_frequency = tsc_diff / time_diff;
}
@@ -226,9 +226,8 @@ static int mperf_start(void)
{
int cpu;
- clock_gettime(CLOCK_REALTIME, &time_start);
-
for (cpu = 0; cpu < cpu_count; cpu++) {
+ clock_gettime(CLOCK_REALTIME, &time_start[cpu]);
mperf_get_tsc(&tsc_at_measure_start[cpu]);
mperf_init_stats(cpu);
}
@@ -243,9 +242,9 @@ static int mperf_stop(void)
for (cpu = 0; cpu < cpu_count; cpu++) {
mperf_measure_stats(cpu);
mperf_get_tsc(&tsc_at_measure_end[cpu]);
+ clock_gettime(CLOCK_REALTIME, &time_end[cpu]);
}
- clock_gettime(CLOCK_REALTIME, &time_end);
return 0;
}
@@ -349,6 +348,8 @@ struct cpuidle_monitor *mperf_register(void)
aperf_current_count = calloc(cpu_count, sizeof(unsigned long long));
tsc_at_measure_start = calloc(cpu_count, sizeof(unsigned long long));
tsc_at_measure_end = calloc(cpu_count, sizeof(unsigned long long));
+ time_start = calloc(cpu_count, sizeof(struct timespec));
+ time_end = calloc(cpu_count, sizeof(struct timespec));
mperf_monitor.name_len = strlen(mperf_monitor.name);
return &mperf_monitor;
}
@@ -361,6 +362,8 @@ void mperf_unregister(void)
free(aperf_current_count);
free(tsc_at_measure_start);
free(tsc_at_measure_end);
+ free(time_start);
+ free(time_end);
free(is_valid);
}
diff --git a/tools/power/cpupower/utils/idle_monitor/nhm_idle.c b/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
index 16eaf006f61f..6b1733782ffa 100644
--- a/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/nhm_idle.c
@@ -151,7 +151,7 @@ static int nhm_stop(void)
for (num = 0; num < NHM_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !nhm_get_count(num, &val, cpu);
+ is_valid[cpu] |= !nhm_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/power/cpupower/utils/idle_monitor/snb_idle.c b/tools/power/cpupower/utils/idle_monitor/snb_idle.c
index 811d63ab17a7..5969b88a85b4 100644
--- a/tools/power/cpupower/utils/idle_monitor/snb_idle.c
+++ b/tools/power/cpupower/utils/idle_monitor/snb_idle.c
@@ -115,7 +115,7 @@ static int snb_start(void)
for (num = 0; num < SNB_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- snb_get_count(num, &val, cpu);
+ is_valid[cpu] = !snb_get_count(num, &val, cpu);
previous_count[num][cpu] = val;
}
}
@@ -132,7 +132,7 @@ static int snb_stop(void)
for (num = 0; num < SNB_CSTATE_COUNT; num++) {
for (cpu = 0; cpu < cpu_count; cpu++) {
- is_valid[cpu] = !snb_get_count(num, &val, cpu);
+ is_valid[cpu] |= !snb_get_count(num, &val, cpu);
current_count[num][cpu] = val;
}
}
diff --git a/tools/sched_ext/include/scx/common.bpf.h b/tools/sched_ext/include/scx/common.bpf.h
index 2f36b7b6418d..625f5b046776 100644
--- a/tools/sched_ext/include/scx/common.bpf.h
+++ b/tools/sched_ext/include/scx/common.bpf.h
@@ -40,9 +40,9 @@ void scx_bpf_dsq_insert(struct task_struct *p, u64 dsq_id, u64 slice, u64 enq_fl
void scx_bpf_dsq_insert_vtime(struct task_struct *p, u64 dsq_id, u64 slice, u64 vtime, u64 enq_flags) __ksym __weak;
u32 scx_bpf_dispatch_nr_slots(void) __ksym;
void scx_bpf_dispatch_cancel(void) __ksym;
-bool scx_bpf_dsq_move_to_local(u64 dsq_id) __ksym;
-void scx_bpf_dsq_move_set_slice(struct bpf_iter_scx_dsq *it__iter, u64 slice) __ksym;
-void scx_bpf_dsq_move_set_vtime(struct bpf_iter_scx_dsq *it__iter, u64 vtime) __ksym;
+bool scx_bpf_dsq_move_to_local(u64 dsq_id) __ksym __weak;
+void scx_bpf_dsq_move_set_slice(struct bpf_iter_scx_dsq *it__iter, u64 slice) __ksym __weak;
+void scx_bpf_dsq_move_set_vtime(struct bpf_iter_scx_dsq *it__iter, u64 vtime) __ksym __weak;
bool scx_bpf_dsq_move(struct bpf_iter_scx_dsq *it__iter, struct task_struct *p, u64 dsq_id, u64 enq_flags) __ksym __weak;
bool scx_bpf_dsq_move_vtime(struct bpf_iter_scx_dsq *it__iter, struct task_struct *p, u64 dsq_id, u64 enq_flags) __ksym __weak;
u32 scx_bpf_reenqueue_local(void) __ksym;
diff --git a/tools/sched_ext/scx_central.c b/tools/sched_ext/scx_central.c
index 21deea320bd7..e938156ed0a0 100644
--- a/tools/sched_ext/scx_central.c
+++ b/tools/sched_ext/scx_central.c
@@ -97,7 +97,7 @@ restart:
SCX_BUG_ON(!cpuset, "Failed to allocate cpuset");
CPU_ZERO(cpuset);
CPU_SET(skel->rodata->central_cpu, cpuset);
- SCX_BUG_ON(sched_setaffinity(0, sizeof(cpuset), cpuset),
+ SCX_BUG_ON(sched_setaffinity(0, sizeof(*cpuset), cpuset),
"Failed to affinitize to central CPU %d (max %d)",
skel->rodata->central_cpu, skel->rodata->nr_cpu_ids - 1);
CPU_FREE(cpuset);
diff --git a/tools/scripts/Makefile.arch b/tools/scripts/Makefile.arch
index f6a50f06dfc4..eabfe9f411d9 100644
--- a/tools/scripts/Makefile.arch
+++ b/tools/scripts/Makefile.arch
@@ -7,8 +7,8 @@ HOSTARCH := $(shell uname -m | sed -e s/i.86/x86/ -e s/x86_64/x86/ \
-e s/sh[234].*/sh/ -e s/aarch64.*/arm64/ \
-e s/riscv.*/riscv/ -e s/loongarch.*/loongarch/)
-ifndef ARCH
-ARCH := $(HOSTARCH)
+ifeq ($(strip $(ARCH)),)
+override ARCH := $(HOSTARCH)
endif
SRCARCH := $(ARCH)
diff --git a/tools/testing/cxl/cxl_core_exports.c b/tools/testing/cxl/cxl_core_exports.c
index 077e6883921d..f088792a8925 100644
--- a/tools/testing/cxl/cxl_core_exports.c
+++ b/tools/testing/cxl/cxl_core_exports.c
@@ -4,4 +4,4 @@
#include "cxl.h"
/* Exporting of cxl_core symbols that are only used by cxl_test */
-EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, CXL);
+EXPORT_SYMBOL_NS_GPL(cxl_num_decoders_committed, "CXL");
diff --git a/tools/testing/cxl/test/cxl.c b/tools/testing/cxl/test/cxl.c
index 050725afa45d..d0337c11f9ee 100644
--- a/tools/testing/cxl/test/cxl.c
+++ b/tools/testing/cxl/test/cxl.c
@@ -1531,5 +1531,5 @@ MODULE_PARM_DESC(interleave_arithmetic, "Modulo:0, XOR:1");
module_init(cxl_test_init);
module_exit(cxl_test_exit);
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(ACPI);
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("ACPI");
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/cxl/test/mem.c b/tools/testing/cxl/test/mem.c
index 71916e0e1546..347c1e7b37bd 100644
--- a/tools/testing/cxl/test/mem.c
+++ b/tools/testing/cxl/test/mem.c
@@ -1679,4 +1679,4 @@ static struct platform_driver cxl_mock_mem_driver = {
module_platform_driver(cxl_mock_mem_driver);
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/cxl/test/mock.c b/tools/testing/cxl/test/mock.c
index f4ce96cc11d4..450c7566c33f 100644
--- a/tools/testing/cxl/test/mock.c
+++ b/tools/testing/cxl/test/mock.c
@@ -76,7 +76,7 @@ int __wrap_acpi_table_parse_cedt(enum acpi_cedt_type id,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, ACPI);
+EXPORT_SYMBOL_NS_GPL(__wrap_acpi_table_parse_cedt, "ACPI");
acpi_status __wrap_acpi_evaluate_integer(acpi_handle handle,
acpi_string pathname,
@@ -147,7 +147,7 @@ struct cxl_hdm *__wrap_devm_cxl_setup_hdm(struct cxl_port *port,
return cxlhdm;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_setup_hdm, "CXL");
int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port)
{
@@ -162,7 +162,7 @@ int __wrap_devm_cxl_add_passthrough_decoder(struct cxl_port *port)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_passthrough_decoder, "CXL");
int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm,
struct cxl_endpoint_dvsec_info *info)
@@ -179,7 +179,7 @@ int __wrap_devm_cxl_enumerate_decoders(struct cxl_hdm *cxlhdm,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_enumerate_decoders, "CXL");
int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port)
{
@@ -194,7 +194,7 @@ int __wrap_devm_cxl_port_enumerate_dports(struct cxl_port *port)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_port_enumerate_dports, "CXL");
int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds)
{
@@ -209,7 +209,7 @@ int __wrap_cxl_await_media_ready(struct cxl_dev_state *cxlds)
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_await_media_ready, "CXL");
int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds,
struct cxl_hdm *cxlhdm,
@@ -226,7 +226,7 @@ int __wrap_cxl_hdm_decode_init(struct cxl_dev_state *cxlds,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_hdm_decode_init, "CXL");
int __wrap_cxl_dvsec_rr_decode(struct device *dev, struct cxl_port *port,
struct cxl_endpoint_dvsec_info *info)
@@ -242,7 +242,7 @@ int __wrap_cxl_dvsec_rr_decode(struct device *dev, struct cxl_port *port,
return rc;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dvsec_rr_decode, "CXL");
struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port,
struct device *dport_dev,
@@ -266,7 +266,7 @@ struct cxl_dport *__wrap_devm_cxl_add_rch_dport(struct cxl_port *port,
return dport;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_devm_cxl_add_rch_dport, "CXL");
resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev,
struct cxl_dport *dport)
@@ -283,7 +283,7 @@ resource_size_t __wrap_cxl_rcd_component_reg_phys(struct device *dev,
return component_reg_phys;
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_rcd_component_reg_phys, "CXL");
void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port)
{
@@ -297,7 +297,7 @@ void __wrap_cxl_endpoint_parse_cdat(struct cxl_port *port)
cxl_endpoint_parse_cdat(port);
put_cxl_mock_ops(index);
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_endpoint_parse_cdat, "CXL");
void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device *host)
{
@@ -309,8 +309,8 @@ void __wrap_cxl_dport_init_ras_reporting(struct cxl_dport *dport, struct device
put_cxl_mock_ops(index);
}
-EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, CXL);
+EXPORT_SYMBOL_NS_GPL(__wrap_cxl_dport_init_ras_reporting, "CXL");
MODULE_LICENSE("GPL v2");
-MODULE_IMPORT_NS(ACPI);
-MODULE_IMPORT_NS(CXL);
+MODULE_IMPORT_NS("ACPI");
+MODULE_IMPORT_NS("CXL");
diff --git a/tools/testing/kunit/kunit.py b/tools/testing/kunit/kunit.py
index 676fa99a8b19..7f9ae55fd6d5 100755
--- a/tools/testing/kunit/kunit.py
+++ b/tools/testing/kunit/kunit.py
@@ -312,7 +312,16 @@ def massage_argv(argv: Sequence[str]) -> Sequence[str]:
return list(map(massage_arg, argv))
def get_default_jobs() -> int:
- return len(os.sched_getaffinity(0))
+ if sys.version_info >= (3, 13):
+ if (ncpu := os.process_cpu_count()) is not None:
+ return ncpu
+ raise RuntimeError("os.process_cpu_count() returned None")
+ # See https://github.com/python/cpython/blob/b61fece/Lib/os.py#L1175-L1186.
+ if sys.platform != "darwin":
+ return len(os.sched_getaffinity(0))
+ if (ncpu := os.cpu_count()) is not None:
+ return ncpu
+ raise RuntimeError("os.cpu_count() returned None")
def add_common_opts(parser: argparse.ArgumentParser) -> None:
parser.add_argument('--build_dir',
diff --git a/tools/testing/kunit/kunit_kernel.py b/tools/testing/kunit/kunit_kernel.py
index e76d7894b6c5..d30f90eae9a4 100644
--- a/tools/testing/kunit/kunit_kernel.py
+++ b/tools/testing/kunit/kunit_kernel.py
@@ -125,6 +125,9 @@ class LinuxSourceTreeOperationsQemu(LinuxSourceTreeOperations):
'-append', ' '.join(params + [self._kernel_command_line]),
'-no-reboot',
'-nographic',
+ '-accel', 'kvm',
+ '-accel', 'hvf',
+ '-accel', 'tcg',
'-serial', self._serial] + self._extra_qemu_params
# Note: shlex.join() does what we want, but requires python 3.8+.
print('Running tests with:\n$', ' '.join(shlex.quote(arg) for arg in qemu_command))
diff --git a/tools/testing/kunit/qemu_configs/arm64.py b/tools/testing/kunit/qemu_configs/arm64.py
index d3ff27024755..5c44d3a87e6d 100644
--- a/tools/testing/kunit/qemu_configs/arm64.py
+++ b/tools/testing/kunit/qemu_configs/arm64.py
@@ -9,4 +9,4 @@ CONFIG_SERIAL_AMBA_PL011_CONSOLE=y''',
qemu_arch='aarch64',
kernel_path='arch/arm64/boot/Image.gz',
kernel_command_line='console=ttyAMA0',
- extra_qemu_params=['-machine', 'virt', '-cpu', 'max,pauth-impdef=on'])
+ extra_qemu_params=['-machine', 'virt', '-cpu', 'max'])
diff --git a/tools/testing/nvdimm/test/ndtest.c b/tools/testing/nvdimm/test/ndtest.c
index 892e990c034a..68a064ce598c 100644
--- a/tools/testing/nvdimm/test/ndtest.c
+++ b/tools/testing/nvdimm/test/ndtest.c
@@ -883,7 +883,7 @@ static const struct platform_device_id ndtest_id[] = {
static struct platform_driver ndtest_driver = {
.probe = ndtest_probe,
- .remove_new = ndtest_remove,
+ .remove = ndtest_remove,
.driver = {
.name = KBUILD_MODNAME,
},
diff --git a/tools/testing/selftests/acct/acct_syscall.c b/tools/testing/selftests/acct/acct_syscall.c
index e44e8fe1f4a3..87c044fb9293 100644
--- a/tools/testing/selftests/acct/acct_syscall.c
+++ b/tools/testing/selftests/acct/acct_syscall.c
@@ -24,7 +24,7 @@ int main(void)
// Check if test is run a root
if (geteuid()) {
- ksft_test_result_skip("This test needs root to run!\n");
+ ksft_exit_skip("This test needs root to run!\n");
return 1;
}
diff --git a/tools/testing/selftests/alsa/Makefile b/tools/testing/selftests/alsa/Makefile
index 944279160fed..8dab90ad22bb 100644
--- a/tools/testing/selftests/alsa/Makefile
+++ b/tools/testing/selftests/alsa/Makefile
@@ -27,5 +27,5 @@ include ../lib.mk
$(OUTPUT)/libatest.so: conf.c alsa-local.h
$(CC) $(CFLAGS) -shared -fPIC $< $(LDLIBS) -o $@
-$(OUTPUT)/%: %.c $(TEST_GEN_PROGS_EXTENDED) alsa-local.h
+$(OUTPUT)/%: %.c $(OUTPUT)/libatest.so alsa-local.h
$(CC) $(CFLAGS) $< $(LDLIBS) -latest -o $@
diff --git a/tools/testing/selftests/arm64/abi/hwcap.c b/tools/testing/selftests/arm64/abi/hwcap.c
index 0029ed9c5c9a..35f521e5f41c 100644
--- a/tools/testing/selftests/arm64/abi/hwcap.c
+++ b/tools/testing/selftests/arm64/abi/hwcap.c
@@ -46,6 +46,12 @@ static void atomics_sigill(void)
asm volatile(".inst 0xb82003ff" : : : );
}
+static void cmpbr_sigill(void)
+{
+ /* Not implemented, too complicated and unreliable anyway */
+}
+
+
static void crc32_sigill(void)
{
/* CRC32W W0, W0, W1 */
@@ -82,6 +88,18 @@ static void f8fma_sigill(void)
asm volatile(".inst 0xec0fc00");
}
+static void f8mm4_sigill(void)
+{
+ /* FMMLA V0.4SH, V0.16B, V0.16B */
+ asm volatile(".inst 0x6e00ec00");
+}
+
+static void f8mm8_sigill(void)
+{
+ /* FMMLA V0.4S, V0.16B, V0.16B */
+ asm volatile(".inst 0x6e80ec00");
+}
+
static void faminmax_sigill(void)
{
/* FAMIN V0.4H, V0.4H, V0.4H */
@@ -98,6 +116,12 @@ static void fpmr_sigill(void)
asm volatile("mrs x0, S3_3_C4_C4_2" : : : "x0");
}
+static void fprcvt_sigill(void)
+{
+ /* FCVTAS S0, H0 */
+ asm volatile(".inst 0x1efa0000");
+}
+
static void gcs_sigill(void)
{
unsigned long *gcspr;
@@ -226,6 +250,42 @@ static void sme2p1_sigill(void)
asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
}
+static void sme2p2_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* UXTB Z0.D, P0/Z, Z0.D */
+ asm volatile(".inst 0x4c1a000" : : : );
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void sme_aes_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* AESD z0.b, z0.b, z0.b */
+ asm volatile(".inst 0x4522e400" : : : "z0");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void sme_sbitperm_sigill(void)
+{
+ /* SMSTART SM */
+ asm volatile("msr S0_3_C4_C3_3, xzr" : : : );
+
+ /* BDEP Z0.B, Z0.B, Z0.B */
+ asm volatile(".inst 0x4500b400" : : : "z0");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
static void smei16i32_sigill(void)
{
/* SMSTART */
@@ -339,8 +399,44 @@ static void smesf8fma_sigill(void)
/* SMSTART */
asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
- /* FMLALB V0.8H, V0.16B, V0.16B */
- asm volatile(".inst 0xec0fc00");
+ /* FMLALB Z0.8H, Z0.B, Z0.B */
+ asm volatile(".inst 0x64205000");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smesfexpa_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* FEXPA Z0.D, Z0.D */
+ asm volatile(".inst 0x04e0b800");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smesmop4_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* SMOP4A ZA0.S, Z0.B, { Z0.B - Z1.B } */
+ asm volatile(".inst 0x80108000");
+
+ /* SMSTOP */
+ asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
+}
+
+static void smestmop_sigill(void)
+{
+ /* SMSTART */
+ asm volatile("msr S0_3_C4_C7_3, xzr" : : : );
+
+ /* STMOPA ZA0.S, { Z0.H - Z1.H }, Z0.H, Z20[0] */
+ asm volatile(".inst 0x80408008");
/* SMSTOP */
asm volatile("msr S0_3_C4_C6_3, xzr" : : : );
@@ -364,18 +460,42 @@ static void sve2p1_sigill(void)
asm volatile(".inst 0x65000000" : : : "z0");
}
+static void sve2p2_sigill(void)
+{
+ /* NOT Z0.D, P0/Z, Z0.D */
+ asm volatile(".inst 0x4cea000" : : : "z0");
+}
+
static void sveaes_sigill(void)
{
/* AESD z0.b, z0.b, z0.b */
asm volatile(".inst 0x4522e400" : : : "z0");
}
+static void sveaes2_sigill(void)
+{
+ /* AESD {Z0.B - Z1.B }, { Z0.B - Z1.B }, Z0.Q */
+ asm volatile(".inst 0x4522ec00" : : : "z0");
+}
+
static void sveb16b16_sigill(void)
{
/* BFADD Z0.H, Z0.H, Z0.H */
asm volatile(".inst 0x65000000" : : : );
}
+static void svebfscale_sigill(void)
+{
+ /* BFSCALE Z0.H, P0/M, Z0.H, Z0.H */
+ asm volatile(".inst 0x65098000" : : : "z0");
+}
+
+static void svef16mm_sigill(void)
+{
+ /* FMMLA Z0.S, Z0.H, Z0.H */
+ asm volatile(".inst 0x6420e400");
+}
+
static void svepmull_sigill(void)
{
/* PMULLB Z0.Q, Z0.D, Z0.D */
@@ -394,6 +514,12 @@ static void svesha3_sigill(void)
asm volatile(".inst 0x4203800" : : : "z0");
}
+static void sveeltperm_sigill(void)
+{
+ /* COMPACT Z0.B, P0, Z0.B */
+ asm volatile(".inst 0x5218000" : : : "x0");
+}
+
static void svesm4_sigill(void)
{
/* SM4E Z0.S, Z0.S, Z0.S */
@@ -470,6 +596,13 @@ static const struct hwcap_data {
.sigill_fn = aes_sigill,
},
{
+ .name = "CMPBR",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_CMPBR,
+ .cpuinfo = "cmpbr",
+ .sigill_fn = cmpbr_sigill,
+ },
+ {
.name = "CRC32",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_CRC32,
@@ -524,6 +657,20 @@ static const struct hwcap_data {
.sigill_fn = f8fma_sigill,
},
{
+ .name = "F8MM8",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_F8MM8,
+ .cpuinfo = "f8mm8",
+ .sigill_fn = f8mm8_sigill,
+ },
+ {
+ .name = "F8MM4",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_F8MM4,
+ .cpuinfo = "f8mm4",
+ .sigill_fn = f8mm4_sigill,
+ },
+ {
.name = "FAMINMAX",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_FAMINMAX,
@@ -546,6 +693,13 @@ static const struct hwcap_data {
.sigill_reliable = true,
},
{
+ .name = "FPRCVT",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_FPRCVT,
+ .cpuinfo = "fprcvt",
+ .sigill_fn = fprcvt_sigill,
+ },
+ {
.name = "GCS",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_GCS,
@@ -692,6 +846,20 @@ static const struct hwcap_data {
.sigill_fn = sme2p1_sigill,
},
{
+ .name = "SME 2.2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME2P2,
+ .cpuinfo = "sme2p2",
+ .sigill_fn = sme2p2_sigill,
+ },
+ {
+ .name = "SME AES",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_AES,
+ .cpuinfo = "smeaes",
+ .sigill_fn = sme_aes_sigill,
+ },
+ {
.name = "SME I16I32",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SME_I16I32,
@@ -741,6 +909,13 @@ static const struct hwcap_data {
.sigill_fn = smelutv2_sigill,
},
{
+ .name = "SME SBITPERM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SBITPERM,
+ .cpuinfo = "smesbitperm",
+ .sigill_fn = sme_sbitperm_sigill,
+ },
+ {
.name = "SME SF8FMA",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SME_SF8FMA,
@@ -762,6 +937,27 @@ static const struct hwcap_data {
.sigill_fn = smesf8dp4_sigill,
},
{
+ .name = "SME SFEXPA",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SFEXPA,
+ .cpuinfo = "smesfexpa",
+ .sigill_fn = smesfexpa_sigill,
+ },
+ {
+ .name = "SME SMOP4",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_SMOP4,
+ .cpuinfo = "smesmop4",
+ .sigill_fn = smesmop4_sigill,
+ },
+ {
+ .name = "SME STMOP",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SME_STMOP,
+ .cpuinfo = "smestmop",
+ .sigill_fn = smestmop_sigill,
+ },
+ {
.name = "SVE",
.at_hwcap = AT_HWCAP,
.hwcap_bit = HWCAP_SVE,
@@ -784,6 +980,13 @@ static const struct hwcap_data {
.sigill_fn = sve2p1_sigill,
},
{
+ .name = "SVE 2.2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE2P2,
+ .cpuinfo = "sve2p2",
+ .sigill_fn = sve2p2_sigill,
+ },
+ {
.name = "SVE AES",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SVEAES,
@@ -791,6 +994,34 @@ static const struct hwcap_data {
.sigill_fn = sveaes_sigill,
},
{
+ .name = "SVE AES2",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_AES2,
+ .cpuinfo = "sveaes2",
+ .sigill_fn = sveaes2_sigill,
+ },
+ {
+ .name = "SVE BFSCALE",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_BFSCALE,
+ .cpuinfo = "svebfscale",
+ .sigill_fn = svebfscale_sigill,
+ },
+ {
+ .name = "SVE ELTPERM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_ELTPERM,
+ .cpuinfo = "sveeltperm",
+ .sigill_fn = sveeltperm_sigill,
+ },
+ {
+ .name = "SVE F16MM",
+ .at_hwcap = AT_HWCAP,
+ .hwcap_bit = HWCAP_SVE_F16MM,
+ .cpuinfo = "svef16mm",
+ .sigill_fn = svef16mm_sigill,
+ },
+ {
.name = "SVE2 B16B16",
.at_hwcap = AT_HWCAP2,
.hwcap_bit = HWCAP2_SVE_B16B16,
diff --git a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
index df3230fdac39..66ab2e0bae5f 100644
--- a/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
+++ b/tools/testing/selftests/arm64/abi/syscall-abi-asm.S
@@ -81,32 +81,31 @@ do_syscall:
stp x27, x28, [sp, #96]
// Set SVCR if we're doing SME
- cbz x1, 1f
+ cbz x1, load_gpr
adrp x2, svcr_in
ldr x2, [x2, :lo12:svcr_in]
msr S3_3_C4_C2_2, x2
-1:
// Load ZA and ZT0 if enabled - uses x12 as scratch due to SME LDR
- tbz x2, #SVCR_ZA_SHIFT, 1f
+ tbz x2, #SVCR_ZA_SHIFT, load_gpr
mov w12, #0
ldr x2, =za_in
-2: _ldr_za 12, 2
+1: _ldr_za 12, 2
add x2, x2, x1
add x12, x12, #1
cmp x1, x12
- bne 2b
+ bne 1b
// ZT0
mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1
ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \
#ID_AA64SMFR0_EL1_SMEver_WIDTH
- cbz x2, 1f
+ cbz x2, load_gpr
adrp x2, zt_in
add x2, x2, :lo12:zt_in
_ldr_zt 2
-1:
+load_gpr:
// Load GPRs x8-x28, and save our SP/FP for later comparison
ldr x2, =gpr_in
add x2, x2, #64
@@ -125,9 +124,9 @@ do_syscall:
str x30, [x2], #8 // LR
// Load FPRs if we're not doing neither SVE nor streaming SVE
- cbnz x0, 1f
+ cbnz x0, check_sve_in
ldr x2, =svcr_in
- tbnz x2, #SVCR_SM_SHIFT, 1f
+ tbnz x2, #SVCR_SM_SHIFT, check_sve_in
ldr x2, =fpr_in
ldp q0, q1, [x2]
@@ -148,8 +147,8 @@ do_syscall:
ldp q30, q31, [x2, #16 * 30]
b 2f
-1:
+check_sve_in:
// Load the SVE registers if we're doing SVE/SME
ldr x2, =z_in
@@ -256,32 +255,31 @@ do_syscall:
stp q30, q31, [x2, #16 * 30]
// Save SVCR if we're doing SME
- cbz x1, 1f
+ cbz x1, check_sve_out
mrs x2, S3_3_C4_C2_2
adrp x3, svcr_out
str x2, [x3, :lo12:svcr_out]
-1:
// Save ZA if it's enabled - uses x12 as scratch due to SME STR
- tbz x2, #SVCR_ZA_SHIFT, 1f
+ tbz x2, #SVCR_ZA_SHIFT, check_sve_out
mov w12, #0
ldr x2, =za_out
-2: _str_za 12, 2
+1: _str_za 12, 2
add x2, x2, x1
add x12, x12, #1
cmp x1, x12
- bne 2b
+ bne 1b
// ZT0
mrs x2, S3_0_C0_C4_5 // ID_AA64SMFR0_EL1
ubfx x2, x2, #ID_AA64SMFR0_EL1_SMEver_SHIFT, \
#ID_AA64SMFR0_EL1_SMEver_WIDTH
- cbz x2, 1f
+ cbz x2, check_sve_out
adrp x2, zt_out
add x2, x2, :lo12:zt_out
_str_zt 2
-1:
+check_sve_out:
// Save the SVE state if we have some
cbz x0, 1f
diff --git a/tools/testing/selftests/arm64/fp/kernel-test.c b/tools/testing/selftests/arm64/fp/kernel-test.c
index 859345379044..348e8bef62c7 100644
--- a/tools/testing/selftests/arm64/fp/kernel-test.c
+++ b/tools/testing/selftests/arm64/fp/kernel-test.c
@@ -46,8 +46,7 @@ static void handle_kick_signal(int sig, siginfo_t *info, void *context)
}
static char *drivers[] = {
- "crct10dif-arm64-ce",
- /* "crct10dif-arm64-neon", - Same priority as generic */
+ "crct10dif-arm64",
"sha1-ce",
"sha224-arm64",
"sha224-arm64-neon",
diff --git a/tools/testing/selftests/bpf/.gitignore b/tools/testing/selftests/bpf/.gitignore
index c2a1842c3d8b..e9c377001f93 100644
--- a/tools/testing/selftests/bpf/.gitignore
+++ b/tools/testing/selftests/bpf/.gitignore
@@ -5,7 +5,6 @@ bpf-syscall*
test_verifier
test_maps
test_lru_map
-test_lpm_map
test_tag
FEATURE-DUMP.libbpf
FEATURE-DUMP.selftests
diff --git a/tools/testing/selftests/bpf/Makefile b/tools/testing/selftests/bpf/Makefile
index 6ad3b1ba1920..0a016cd71cba 100644
--- a/tools/testing/selftests/bpf/Makefile
+++ b/tools/testing/selftests/bpf/Makefile
@@ -83,7 +83,7 @@ CLANG_CPUV4 := 1
endif
# Order correspond to 'make run_tests' order
-TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_lpm_map test_progs \
+TEST_GEN_PROGS = test_verifier test_tag test_maps test_lru_map test_progs \
test_sockmap \
test_tcpnotify_user test_sysctl \
test_progs-no_alu32
@@ -129,7 +129,6 @@ TEST_FILES = xsk_prereqs.sh $(wildcard progs/btf_dump_test_case_*.c)
TEST_PROGS := test_kmod.sh \
test_xdp_redirect.sh \
test_xdp_redirect_multi.sh \
- test_xdp_meta.sh \
test_tunnel.sh \
test_lwt_seg6local.sh \
test_lirc_mode2.sh \
diff --git a/tools/testing/selftests/bpf/test_lpm_map.c b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c
index d98c72dc563e..d32e4edac930 100644
--- a/tools/testing/selftests/bpf/test_lpm_map.c
+++ b/tools/testing/selftests/bpf/map_tests/lpm_trie_map_basic_ops.c
@@ -20,10 +20,12 @@
#include <string.h>
#include <time.h>
#include <unistd.h>
+#include <endian.h>
#include <arpa/inet.h>
#include <sys/time.h>
#include <bpf/bpf.h>
+#include <test_maps.h>
#include "bpf_util.h"
@@ -33,6 +35,22 @@ struct tlpm_node {
uint8_t key[];
};
+struct lpm_trie_bytes_key {
+ union {
+ struct bpf_lpm_trie_key_hdr hdr;
+ __u32 prefixlen;
+ };
+ unsigned char data[8];
+};
+
+struct lpm_trie_int_key {
+ union {
+ struct bpf_lpm_trie_key_hdr hdr;
+ __u32 prefixlen;
+ };
+ unsigned int data;
+};
+
static struct tlpm_node *tlpm_match(struct tlpm_node *list,
const uint8_t *key,
size_t n_bits);
@@ -223,7 +241,7 @@ static void test_lpm_map(int keysize)
n_matches = 0;
n_matches_after_delete = 0;
n_nodes = 1 << 8;
- n_lookups = 1 << 16;
+ n_lookups = 1 << 9;
data = alloca(keysize);
memset(data, 0, keysize);
@@ -770,16 +788,385 @@ static void test_lpm_multi_thread(void)
close(map_fd);
}
-int main(void)
+static int lpm_trie_create(unsigned int key_size, unsigned int value_size, unsigned int max_entries)
+{
+ LIBBPF_OPTS(bpf_map_create_opts, opts);
+ int fd;
+
+ opts.map_flags = BPF_F_NO_PREALLOC;
+ fd = bpf_map_create(BPF_MAP_TYPE_LPM_TRIE, "lpm_trie", key_size, value_size, max_entries,
+ &opts);
+ CHECK(fd < 0, "bpf_map_create", "error %d\n", errno);
+
+ return fd;
+}
+
+static void test_lpm_trie_update_flags(void)
+{
+ struct lpm_trie_int_key key;
+ unsigned int value, got;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), 3);
+
+ /* invalid flags (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_F_LOCK);
+ CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err);
+
+ /* invalid flags (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST | BPF_EXIST);
+ CHECK(err != -EINVAL, "invalid update flag", "error %d\n", err);
+
+ /* overwrite an empty qp-trie (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite empty qp-trie", "error %d\n", err);
+
+ /* add a new node */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add the same node as new node (Error) */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err != -EEXIST, "add new elem again", "error %d\n", err);
+
+ /* overwrite the existed node */
+ value = 4;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite the node */
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "update elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite a non-existent node which is the prefix of the first
+ * node (Error).
+ */
+ key.prefixlen = 8;
+ key.data = 0;
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err);
+
+ /* add a new node which is the prefix of the first node */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add another new node which will be the sibling of the first node */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 5;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* overwrite the third node */
+ value = 3;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup key", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* delete the second node to make it an intermediate node */
+ key.prefixlen = 8;
+ key.data = 0;
+ err = bpf_map_delete_elem(fd, &key);
+ CHECK(err, "del elem", "error %d\n", err);
+
+ /* overwrite the intermediate node (Error) */
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err != -ENOENT, "overwrite nonexistent elem", "error %d\n", err);
+
+ close(fd);
+}
+
+static void test_lpm_trie_update_full_map(void)
+{
+ struct lpm_trie_int_key key;
+ int value, got;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), 3);
+
+ /* add a new node */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add new node */
+ key.prefixlen = 8;
+ key.data = 0;
+ value = 1;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* add new node */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 2;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add new elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* try to add more node (Error) */
+ key.prefixlen = 32;
+ key.data = 0;
+ value = 3;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err != -ENOSPC, "add to full trie", "error %d\n", err);
+
+ /* update the value of an existed node with BPF_EXIST */
+ key.prefixlen = 16;
+ key.data = 0;
+ value = 4;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_EXIST);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ /* update the value of an existed node with BPF_ANY */
+ key.prefixlen = 9;
+ key.data = htobe32(1 << 23);
+ value = 5;
+ err = bpf_map_update_elem(fd, &key, &value, BPF_ANY);
+ CHECK(err, "overwrite elem", "error %d\n", err);
+ got = 0;
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "error %d\n", err);
+ CHECK(got != value, "check value", "got %d exp %d\n", got, value);
+
+ close(fd);
+}
+
+static int cmp_str(const void *a, const void *b)
+{
+ const char *str_a = *(const char **)a, *str_b = *(const char **)b;
+
+ return strcmp(str_a, str_b);
+}
+
+/* Save strings in LPM trie. The trailing '\0' for each string will be
+ * accounted in the prefixlen. The strings returned during the iteration
+ * should be sorted as expected.
+ */
+static void test_lpm_trie_iterate_strs(void)
+{
+ static const char * const keys[] = {
+ "ab", "abO", "abc", "abo", "abS", "abcd",
+ };
+ const char *sorted_keys[ARRAY_SIZE(keys)];
+ struct lpm_trie_bytes_key key, next_key;
+ unsigned int value, got, i, j, len;
+ struct lpm_trie_bytes_key *cur;
+ int fd, err;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), ARRAY_SIZE(keys));
+
+ for (i = 0; i < ARRAY_SIZE(keys); i++) {
+ unsigned int flags;
+
+ /* add i-th element */
+ flags = i % 2 ? BPF_NOEXIST : 0;
+ len = strlen(keys[i]);
+ /* include the trailing '\0' */
+ key.prefixlen = (len + 1) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ memcpy(key.data, keys[i], len);
+ value = i + 100;
+ err = bpf_map_update_elem(fd, &key, &value, flags);
+ CHECK(err, "add elem", "#%u error %d\n", i, err);
+
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "#%u error %d\n", i, err);
+ CHECK(got != value, "lookup elem", "#%u expect %u got %u\n", i, value, got);
+
+ /* re-add i-th element (Error) */
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err != -EEXIST, "re-add elem", "#%u error %d\n", i, err);
+
+ /* Overwrite i-th element */
+ flags = i % 2 ? 0 : BPF_EXIST;
+ value = i;
+ err = bpf_map_update_elem(fd, &key, &value, flags);
+ CHECK(err, "update elem", "error %d\n", err);
+
+ /* Lookup #[0~i] elements */
+ for (j = 0; j <= i; j++) {
+ len = strlen(keys[j]);
+ key.prefixlen = (len + 1) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ memcpy(key.data, keys[j], len);
+ err = bpf_map_lookup_elem(fd, &key, &got);
+ CHECK(err, "lookup elem", "#%u/%u error %d\n", i, j, err);
+ CHECK(got != j, "lookup elem", "#%u/%u expect %u got %u\n",
+ i, j, value, got);
+ }
+ }
+
+ /* Add element to a full qp-trie (Error) */
+ key.prefixlen = sizeof(key.data) * 8;
+ memset(key.data, 0, sizeof(key.data));
+ value = 0;
+ err = bpf_map_update_elem(fd, &key, &value, 0);
+ CHECK(err != -ENOSPC, "add to full qp-trie", "error %d\n", err);
+
+ /* Iterate sorted elements: no deletion */
+ memcpy(sorted_keys, keys, sizeof(keys));
+ qsort(sorted_keys, ARRAY_SIZE(sorted_keys), sizeof(sorted_keys[0]), cmp_str);
+ cur = NULL;
+ for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) {
+ len = strlen(sorted_keys[i]);
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != (len + 1) * 8, "iterate",
+ "#%u invalid len %u expect %u\n",
+ i, next_key.prefixlen, (len + 1) * 8);
+ CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate",
+ "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]);
+
+ cur = &next_key;
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "more element", "error %d\n", err);
+
+ /* Iterate sorted elements: delete the found key after each iteration */
+ cur = NULL;
+ for (i = 0; i < ARRAY_SIZE(sorted_keys); i++) {
+ len = strlen(sorted_keys[i]);
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != (len + 1) * 8, "iterate",
+ "#%u invalid len %u expect %u\n",
+ i, next_key.prefixlen, (len + 1) * 8);
+ CHECK(memcmp(sorted_keys[i], next_key.data, len + 1), "iterate",
+ "#%u got %.*s exp %.*s\n", i, len, next_key.data, len, sorted_keys[i]);
+
+ cur = &next_key;
+
+ err = bpf_map_delete_elem(fd, cur);
+ CHECK(err, "delete", "#%u error %d\n", i, err);
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "non-empty qp-trie", "error %d\n", err);
+
+ close(fd);
+}
+
+/* Use the fixed prefixlen (32) and save integers in LPM trie. The iteration of
+ * LPM trie will return these integers in big-endian order, therefore, convert
+ * these integers to big-endian before update. After each iteration, delete the
+ * found key (the smallest integer) and expect the next iteration will return
+ * the second smallest number.
+ */
+static void test_lpm_trie_iterate_ints(void)
+{
+ struct lpm_trie_int_key key, next_key;
+ unsigned int i, max_entries;
+ struct lpm_trie_int_key *cur;
+ unsigned int *data_set;
+ int fd, err;
+ bool value;
+
+ max_entries = 4096;
+ data_set = calloc(max_entries, sizeof(*data_set));
+ CHECK(!data_set, "malloc", "no mem\n");
+ for (i = 0; i < max_entries; i++)
+ data_set[i] = i;
+
+ fd = lpm_trie_create(sizeof(key), sizeof(value), max_entries);
+ value = true;
+ for (i = 0; i < max_entries; i++) {
+ key.prefixlen = 32;
+ key.data = htobe32(data_set[i]);
+
+ err = bpf_map_update_elem(fd, &key, &value, BPF_NOEXIST);
+ CHECK(err, "add elem", "#%u error %d\n", i, err);
+ }
+
+ cur = NULL;
+ for (i = 0; i < max_entries; i++) {
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err, "iterate", "#%u error %d\n", i, err);
+ CHECK(next_key.prefixlen != 32, "iterate", "#%u invalid len %u\n",
+ i, next_key.prefixlen);
+ CHECK(be32toh(next_key.data) != data_set[i], "iterate", "#%u got 0x%x exp 0x%x\n",
+ i, be32toh(next_key.data), data_set[i]);
+ cur = &next_key;
+
+ /*
+ * Delete the minimal key, the next call of bpf_get_next_key()
+ * will return the second minimal key.
+ */
+ err = bpf_map_delete_elem(fd, &next_key);
+ CHECK(err, "del elem", "#%u elem error %d\n", i, err);
+ }
+ err = bpf_map_get_next_key(fd, cur, &next_key);
+ CHECK(err != -ENOENT, "more element", "error %d\n", err);
+
+ err = bpf_map_get_next_key(fd, NULL, &next_key);
+ CHECK(err != -ENOENT, "no-empty qp-trie", "error %d\n", err);
+
+ free(data_set);
+
+ close(fd);
+}
+
+void test_lpm_trie_map_basic_ops(void)
{
int i;
/* we want predictable, pseudo random tests */
srand(0xf00ba1);
- /* Use libbpf 1.0 API mode */
- libbpf_set_strict_mode(LIBBPF_STRICT_ALL);
-
test_lpm_basic();
test_lpm_order();
@@ -792,6 +1179,10 @@ int main(void)
test_lpm_get_next_key();
test_lpm_multi_thread();
- printf("test_lpm: OK\n");
- return 0;
+ test_lpm_trie_update_flags();
+ test_lpm_trie_update_full_map();
+ test_lpm_trie_iterate_strs();
+ test_lpm_trie_iterate_ints();
+
+ printf("%s: PASS\n", __func__);
}
diff --git a/tools/testing/selftests/bpf/map_tests/task_storage_map.c b/tools/testing/selftests/bpf/map_tests/task_storage_map.c
index 62971dbf2996..a4121d2248ac 100644
--- a/tools/testing/selftests/bpf/map_tests/task_storage_map.c
+++ b/tools/testing/selftests/bpf/map_tests/task_storage_map.c
@@ -78,8 +78,8 @@ void test_task_storage_map_stress_lookup(void)
CHECK(err, "open_and_load", "error %d\n", err);
/* Only for a fully preemptible kernel */
- if (!skel->kconfig->CONFIG_PREEMPT) {
- printf("%s SKIP (no CONFIG_PREEMPT)\n", __func__);
+ if (!skel->kconfig->CONFIG_PREEMPTION) {
+ printf("%s SKIP (no CONFIG_PREEMPTION)\n", __func__);
read_bpf_task_storage_busy__destroy(skel);
skips++;
return;
diff --git a/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c
new file mode 100644
index 000000000000..7526de379081
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/changes_pkt_data.c
@@ -0,0 +1,107 @@
+// SPDX-License-Identifier: GPL-2.0
+#include "bpf/libbpf.h"
+#include "changes_pkt_data_freplace.skel.h"
+#include "changes_pkt_data.skel.h"
+#include <test_progs.h>
+
+static void print_verifier_log(const char *log)
+{
+ if (env.verbosity >= VERBOSE_VERY)
+ fprintf(stdout, "VERIFIER LOG:\n=============\n%s=============\n", log);
+}
+
+static void test_aux(const char *main_prog_name,
+ const char *to_be_replaced,
+ const char *replacement,
+ bool expect_load)
+{
+ struct changes_pkt_data_freplace *freplace = NULL;
+ struct bpf_program *freplace_prog = NULL;
+ struct bpf_program *main_prog = NULL;
+ LIBBPF_OPTS(bpf_object_open_opts, opts);
+ struct changes_pkt_data *main = NULL;
+ char log[16*1024];
+ int err;
+
+ opts.kernel_log_buf = log;
+ opts.kernel_log_size = sizeof(log);
+ if (env.verbosity >= VERBOSE_SUPER)
+ opts.kernel_log_level = 1 | 2 | 4;
+ main = changes_pkt_data__open_opts(&opts);
+ if (!ASSERT_OK_PTR(main, "changes_pkt_data__open"))
+ goto out;
+ main_prog = bpf_object__find_program_by_name(main->obj, main_prog_name);
+ if (!ASSERT_OK_PTR(main_prog, "main_prog"))
+ goto out;
+ bpf_program__set_autoload(main_prog, true);
+ err = changes_pkt_data__load(main);
+ print_verifier_log(log);
+ if (!ASSERT_OK(err, "changes_pkt_data__load"))
+ goto out;
+ freplace = changes_pkt_data_freplace__open_opts(&opts);
+ if (!ASSERT_OK_PTR(freplace, "changes_pkt_data_freplace__open"))
+ goto out;
+ freplace_prog = bpf_object__find_program_by_name(freplace->obj, replacement);
+ if (!ASSERT_OK_PTR(freplace_prog, "freplace_prog"))
+ goto out;
+ bpf_program__set_autoload(freplace_prog, true);
+ bpf_program__set_autoattach(freplace_prog, true);
+ bpf_program__set_attach_target(freplace_prog,
+ bpf_program__fd(main_prog),
+ to_be_replaced);
+ err = changes_pkt_data_freplace__load(freplace);
+ print_verifier_log(log);
+ if (expect_load) {
+ ASSERT_OK(err, "changes_pkt_data_freplace__load");
+ } else {
+ ASSERT_ERR(err, "changes_pkt_data_freplace__load");
+ ASSERT_HAS_SUBSTR(log, "Extension program changes packet data", "error log");
+ }
+
+out:
+ changes_pkt_data_freplace__destroy(freplace);
+ changes_pkt_data__destroy(main);
+}
+
+/* There are two global subprograms in both changes_pkt_data.skel.h:
+ * - one changes packet data;
+ * - another does not.
+ * It is ok to freplace subprograms that change packet data with those
+ * that either do or do not. It is only ok to freplace subprograms
+ * that do not change packet data with those that do not as well.
+ * The below tests check outcomes for each combination of such freplace.
+ * Also test a case when main subprogram itself is replaced and is a single
+ * subprogram in a program.
+ */
+void test_changes_pkt_data_freplace(void)
+{
+ struct {
+ const char *main;
+ const char *to_be_replaced;
+ bool changes;
+ } mains[] = {
+ { "main_with_subprogs", "changes_pkt_data", true },
+ { "main_with_subprogs", "does_not_change_pkt_data", false },
+ { "main_changes", "main_changes", true },
+ { "main_does_not_change", "main_does_not_change", false },
+ };
+ struct {
+ const char *func;
+ bool changes;
+ } replacements[] = {
+ { "changes_pkt_data", true },
+ { "does_not_change_pkt_data", false }
+ };
+ char buf[64];
+
+ for (int i = 0; i < ARRAY_SIZE(mains); ++i) {
+ for (int j = 0; j < ARRAY_SIZE(replacements); ++j) {
+ snprintf(buf, sizeof(buf), "%s_with_%s",
+ mains[i].to_be_replaced, replacements[j].func);
+ if (!test__start_subtest(buf))
+ continue;
+ test_aux(mains[i].main, mains[i].to_be_replaced, replacements[j].func,
+ mains[i].changes || !replacements[j].changes);
+ }
+ }
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
index 6fa19449297e..43676a9922dc 100644
--- a/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
+++ b/tools/testing/selftests/bpf/prog_tests/raw_tp_null.c
@@ -3,11 +3,14 @@
#include <test_progs.h>
#include "raw_tp_null.skel.h"
+#include "raw_tp_null_fail.skel.h"
void test_raw_tp_null(void)
{
struct raw_tp_null *skel;
+ RUN_TESTS(raw_tp_null_fail);
+
skel = raw_tp_null__open_and_load();
if (!ASSERT_OK_PTR(skel, "raw_tp_null__open_and_load"))
return;
diff --git a/tools/testing/selftests/bpf/prog_tests/socket_helpers.h b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h
new file mode 100644
index 000000000000..1bdfb79ef009
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/socket_helpers.h
@@ -0,0 +1,394 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+
+#ifndef __SOCKET_HELPERS__
+#define __SOCKET_HELPERS__
+
+#include <linux/vm_sockets.h>
+
+/* include/linux/net.h */
+#define SOCK_TYPE_MASK 0xf
+
+#define IO_TIMEOUT_SEC 30
+#define MAX_STRERR_LEN 256
+
+/* workaround for older vm_sockets.h */
+#ifndef VMADDR_CID_LOCAL
+#define VMADDR_CID_LOCAL 1
+#endif
+
+/* include/linux/cleanup.h */
+#define __get_and_null(p, nullvalue) \
+ ({ \
+ __auto_type __ptr = &(p); \
+ __auto_type __val = *__ptr; \
+ *__ptr = nullvalue; \
+ __val; \
+ })
+
+#define take_fd(fd) __get_and_null(fd, -EBADF)
+
+/* Wrappers that fail the test on error and report it. */
+
+#define _FAIL(errnum, fmt...) \
+ ({ \
+ error_at_line(0, (errnum), __func__, __LINE__, fmt); \
+ CHECK_FAIL(true); \
+ })
+#define FAIL(fmt...) _FAIL(0, fmt)
+#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt)
+#define FAIL_LIBBPF(err, msg) \
+ ({ \
+ char __buf[MAX_STRERR_LEN]; \
+ libbpf_strerror((err), __buf, sizeof(__buf)); \
+ FAIL("%s: %s", (msg), __buf); \
+ })
+
+
+#define xaccept_nonblock(fd, addr, len) \
+ ({ \
+ int __ret = \
+ accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \
+ if (__ret == -1) \
+ FAIL_ERRNO("accept"); \
+ __ret; \
+ })
+
+#define xbind(fd, addr, len) \
+ ({ \
+ int __ret = bind((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("bind"); \
+ __ret; \
+ })
+
+#define xclose(fd) \
+ ({ \
+ int __ret = close((fd)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("close"); \
+ __ret; \
+ })
+
+#define xconnect(fd, addr, len) \
+ ({ \
+ int __ret = connect((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("connect"); \
+ __ret; \
+ })
+
+#define xgetsockname(fd, addr, len) \
+ ({ \
+ int __ret = getsockname((fd), (addr), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("getsockname"); \
+ __ret; \
+ })
+
+#define xgetsockopt(fd, level, name, val, len) \
+ ({ \
+ int __ret = getsockopt((fd), (level), (name), (val), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("getsockopt(" #name ")"); \
+ __ret; \
+ })
+
+#define xlisten(fd, backlog) \
+ ({ \
+ int __ret = listen((fd), (backlog)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("listen"); \
+ __ret; \
+ })
+
+#define xsetsockopt(fd, level, name, val, len) \
+ ({ \
+ int __ret = setsockopt((fd), (level), (name), (val), (len)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("setsockopt(" #name ")"); \
+ __ret; \
+ })
+
+#define xsend(fd, buf, len, flags) \
+ ({ \
+ ssize_t __ret = send((fd), (buf), (len), (flags)); \
+ if (__ret == -1) \
+ FAIL_ERRNO("send"); \
+ __ret; \
+ })
+
+#define xrecv_nonblock(fd, buf, len, flags) \
+ ({ \
+ ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \
+ IO_TIMEOUT_SEC); \
+ if (__ret == -1) \
+ FAIL_ERRNO("recv"); \
+ __ret; \
+ })
+
+#define xsocket(family, sotype, flags) \
+ ({ \
+ int __ret = socket(family, sotype, flags); \
+ if (__ret == -1) \
+ FAIL_ERRNO("socket"); \
+ __ret; \
+ })
+
+static inline void close_fd(int *fd)
+{
+ if (*fd >= 0)
+ xclose(*fd);
+}
+
+#define __close_fd __attribute__((cleanup(close_fd)))
+
+static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss)
+{
+ return (struct sockaddr *)ss;
+}
+
+static inline void init_addr_loopback4(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss));
+
+ addr4->sin_family = AF_INET;
+ addr4->sin_port = 0;
+ addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK);
+ *len = sizeof(*addr4);
+}
+
+static inline void init_addr_loopback6(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss));
+
+ addr6->sin6_family = AF_INET6;
+ addr6->sin6_port = 0;
+ addr6->sin6_addr = in6addr_loopback;
+ *len = sizeof(*addr6);
+}
+
+static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss));
+
+ addr->svm_family = AF_VSOCK;
+ addr->svm_port = VMADDR_PORT_ANY;
+ addr->svm_cid = VMADDR_CID_LOCAL;
+ *len = sizeof(*addr);
+}
+
+static inline void init_addr_loopback(int family, struct sockaddr_storage *ss,
+ socklen_t *len)
+{
+ switch (family) {
+ case AF_INET:
+ init_addr_loopback4(ss, len);
+ return;
+ case AF_INET6:
+ init_addr_loopback6(ss, len);
+ return;
+ case AF_VSOCK:
+ init_addr_loopback_vsock(ss, len);
+ return;
+ default:
+ FAIL("unsupported address family %d", family);
+ }
+}
+
+static inline int enable_reuseport(int s, int progfd)
+{
+ int err, one = 1;
+
+ err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one));
+ if (err)
+ return -1;
+ err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd,
+ sizeof(progfd));
+ if (err)
+ return -1;
+
+ return 0;
+}
+
+static inline int socket_loopback_reuseport(int family, int sotype, int progfd)
+{
+ struct sockaddr_storage addr;
+ socklen_t len = 0;
+ int err, s;
+
+ init_addr_loopback(family, &addr, &len);
+
+ s = xsocket(family, sotype, 0);
+ if (s == -1)
+ return -1;
+
+ if (progfd >= 0)
+ enable_reuseport(s, progfd);
+
+ err = xbind(s, sockaddr(&addr), len);
+ if (err)
+ goto close;
+
+ if (sotype & SOCK_DGRAM)
+ return s;
+
+ err = xlisten(s, SOMAXCONN);
+ if (err)
+ goto close;
+
+ return s;
+close:
+ xclose(s);
+ return -1;
+}
+
+static inline int socket_loopback(int family, int sotype)
+{
+ return socket_loopback_reuseport(family, sotype, -1);
+}
+
+static inline int poll_connect(int fd, unsigned int timeout_sec)
+{
+ struct timeval timeout = { .tv_sec = timeout_sec };
+ fd_set wfds;
+ int r, eval;
+ socklen_t esize = sizeof(eval);
+
+ FD_ZERO(&wfds);
+ FD_SET(fd, &wfds);
+
+ r = select(fd + 1, NULL, &wfds, NULL, &timeout);
+ if (r == 0)
+ errno = ETIME;
+ if (r != 1)
+ return -1;
+
+ if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0)
+ return -1;
+ if (eval != 0) {
+ errno = eval;
+ return -1;
+ }
+
+ return 0;
+}
+
+static inline int poll_read(int fd, unsigned int timeout_sec)
+{
+ struct timeval timeout = { .tv_sec = timeout_sec };
+ fd_set rfds;
+ int r;
+
+ FD_ZERO(&rfds);
+ FD_SET(fd, &rfds);
+
+ r = select(fd + 1, &rfds, NULL, NULL, &timeout);
+ if (r == 0)
+ errno = ETIME;
+
+ return r == 1 ? 0 : -1;
+}
+
+static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len,
+ unsigned int timeout_sec)
+{
+ if (poll_read(fd, timeout_sec))
+ return -1;
+
+ return accept(fd, addr, len);
+}
+
+static inline int recv_timeout(int fd, void *buf, size_t len, int flags,
+ unsigned int timeout_sec)
+{
+ if (poll_read(fd, timeout_sec))
+ return -1;
+
+ return recv(fd, buf, len, flags);
+}
+
+
+static inline int create_pair(int family, int sotype, int *p0, int *p1)
+{
+ __close_fd int s, c = -1, p = -1;
+ struct sockaddr_storage addr;
+ socklen_t len = sizeof(addr);
+ int err;
+
+ s = socket_loopback(family, sotype);
+ if (s < 0)
+ return s;
+
+ err = xgetsockname(s, sockaddr(&addr), &len);
+ if (err)
+ return err;
+
+ c = xsocket(family, sotype, 0);
+ if (c < 0)
+ return c;
+
+ err = connect(c, sockaddr(&addr), len);
+ if (err) {
+ if (errno != EINPROGRESS) {
+ FAIL_ERRNO("connect");
+ return err;
+ }
+
+ err = poll_connect(c, IO_TIMEOUT_SEC);
+ if (err) {
+ FAIL_ERRNO("poll_connect");
+ return err;
+ }
+ }
+
+ switch (sotype & SOCK_TYPE_MASK) {
+ case SOCK_DGRAM:
+ err = xgetsockname(c, sockaddr(&addr), &len);
+ if (err)
+ return err;
+
+ err = xconnect(s, sockaddr(&addr), len);
+ if (err)
+ return err;
+
+ *p0 = take_fd(s);
+ break;
+ case SOCK_STREAM:
+ case SOCK_SEQPACKET:
+ p = xaccept_nonblock(s, NULL, NULL);
+ if (p < 0)
+ return p;
+
+ *p0 = take_fd(p);
+ break;
+ default:
+ FAIL("Unsupported socket type %#x", sotype);
+ return -EOPNOTSUPP;
+ }
+
+ *p1 = take_fd(c);
+ return 0;
+}
+
+static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1,
+ int *p0, int *p1)
+{
+ int err;
+
+ err = create_pair(family, sotype, c0, p0);
+ if (err)
+ return err;
+
+ err = create_pair(family, sotype, c1, p1);
+ if (err) {
+ close(*c0);
+ close(*p0);
+ }
+
+ return err;
+}
+
+#endif // __SOCKET_HELPERS__
diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
index a2041f8e32eb..884ad87783d5 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
+++ b/tools/testing/selftests/bpf/prog_tests/sockmap_basic.c
@@ -12,6 +12,7 @@
#include "test_sockmap_progs_query.skel.h"
#include "test_sockmap_pass_prog.skel.h"
#include "test_sockmap_drop_prog.skel.h"
+#include "test_sockmap_change_tail.skel.h"
#include "bpf_iter_sockmap.skel.h"
#include "sockmap_helpers.h"
@@ -108,6 +109,35 @@ out:
close(s);
}
+static void test_sockmap_vsock_delete_on_close(void)
+{
+ int err, c, p, map;
+ const int zero = 0;
+
+ err = create_pair(AF_VSOCK, SOCK_STREAM, &c, &p);
+ if (!ASSERT_OK(err, "create_pair(AF_VSOCK)"))
+ return;
+
+ map = bpf_map_create(BPF_MAP_TYPE_SOCKMAP, NULL, sizeof(int),
+ sizeof(int), 1, NULL);
+ if (!ASSERT_GE(map, 0, "bpf_map_create")) {
+ close(c);
+ goto out;
+ }
+
+ err = bpf_map_update_elem(map, &zero, &c, BPF_NOEXIST);
+ close(c);
+ if (!ASSERT_OK(err, "bpf_map_update"))
+ goto out;
+
+ err = bpf_map_update_elem(map, &zero, &p, BPF_NOEXIST);
+ ASSERT_OK(err, "after close(), bpf_map_update");
+
+out:
+ close(p);
+ close(map);
+}
+
static void test_skmsg_helpers(enum bpf_map_type map_type)
{
struct test_skmsg_load_helpers *skel;
@@ -614,6 +644,54 @@ out:
test_sockmap_drop_prog__destroy(drop);
}
+static void test_sockmap_skb_verdict_change_tail(void)
+{
+ struct test_sockmap_change_tail *skel;
+ int err, map, verdict;
+ int c1, p1, sent, recvd;
+ int zero = 0;
+ char buf[2];
+
+ skel = test_sockmap_change_tail__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open_and_load"))
+ return;
+ verdict = bpf_program__fd(skel->progs.prog_skb_verdict);
+ map = bpf_map__fd(skel->maps.sock_map_rx);
+
+ err = bpf_prog_attach(verdict, map, BPF_SK_SKB_STREAM_VERDICT, 0);
+ if (!ASSERT_OK(err, "bpf_prog_attach"))
+ goto out;
+ err = create_pair(AF_INET, SOCK_STREAM, &c1, &p1);
+ if (!ASSERT_OK(err, "create_pair()"))
+ goto out;
+ err = bpf_map_update_elem(map, &zero, &c1, BPF_NOEXIST);
+ if (!ASSERT_OK(err, "bpf_map_update_elem(c1)"))
+ goto out_close;
+ sent = xsend(p1, "Tr", 2, 0);
+ ASSERT_EQ(sent, 2, "xsend(p1)");
+ recvd = recv(c1, buf, 2, 0);
+ ASSERT_EQ(recvd, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ sent = xsend(p1, "G", 1, 0);
+ ASSERT_EQ(sent, 1, "xsend(p1)");
+ recvd = recv(c1, buf, 2, 0);
+ ASSERT_EQ(recvd, 2, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ sent = xsend(p1, "E", 1, 0);
+ ASSERT_EQ(sent, 1, "xsend(p1)");
+ recvd = recv(c1, buf, 1, 0);
+ ASSERT_EQ(recvd, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+out_close:
+ close(c1);
+ close(p1);
+out:
+ test_sockmap_change_tail__destroy(skel);
+}
+
static void test_sockmap_skb_verdict_peek_helper(int map)
{
int err, c1, p1, zero = 0, sent, recvd, avail;
@@ -905,8 +983,10 @@ static void test_sockmap_same_sock(void)
err = socketpair(AF_UNIX, SOCK_STREAM, 0, stream);
ASSERT_OK(err, "socketpair(af_unix, sock_stream)");
- if (err)
+ if (err) {
+ close(tcp);
goto out;
+ }
for (i = 0; i < 2; i++) {
err = bpf_map_update_elem(map, &zero, &stream[0], BPF_ANY);
@@ -925,24 +1005,70 @@ static void test_sockmap_same_sock(void)
ASSERT_OK(err, "bpf_map_update_elem(tcp)");
}
+ close(tcp);
err = bpf_map_delete_elem(map, &zero);
- ASSERT_OK(err, "bpf_map_delete_elem(entry)");
+ ASSERT_ERR(err, "bpf_map_delete_elem(entry)");
close(stream[0]);
close(stream[1]);
out:
close(dgram);
- close(tcp);
close(udp);
test_sockmap_pass_prog__destroy(skel);
}
+static void test_sockmap_skb_verdict_vsock_poll(void)
+{
+ struct test_sockmap_pass_prog *skel;
+ int err, map, conn, peer;
+ struct bpf_program *prog;
+ struct bpf_link *link;
+ char buf = 'x';
+ int zero = 0;
+
+ skel = test_sockmap_pass_prog__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open_and_load"))
+ return;
+
+ if (create_pair(AF_VSOCK, SOCK_STREAM, &conn, &peer))
+ goto destroy;
+
+ prog = skel->progs.prog_skb_verdict;
+ map = bpf_map__fd(skel->maps.sock_map_rx);
+ link = bpf_program__attach_sockmap(prog, map);
+ if (!ASSERT_OK_PTR(link, "bpf_program__attach_sockmap"))
+ goto close;
+
+ err = bpf_map_update_elem(map, &zero, &conn, BPF_ANY);
+ if (!ASSERT_OK(err, "bpf_map_update_elem"))
+ goto detach;
+
+ if (xsend(peer, &buf, 1, 0) != 1)
+ goto detach;
+
+ err = poll_read(conn, IO_TIMEOUT_SEC);
+ if (!ASSERT_OK(err, "poll"))
+ goto detach;
+
+ if (xrecv_nonblock(conn, &buf, 1, 0) != 1)
+ FAIL("xrecv_nonblock");
+detach:
+ bpf_link__detach(link);
+close:
+ xclose(conn);
+ xclose(peer);
+destroy:
+ test_sockmap_pass_prog__destroy(skel);
+}
+
void test_sockmap_basic(void)
{
if (test__start_subtest("sockmap create_update_free"))
test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash create_update_free"))
test_sockmap_create_update_free(BPF_MAP_TYPE_SOCKHASH);
+ if (test__start_subtest("sockmap vsock delete on close"))
+ test_sockmap_vsock_delete_on_close();
if (test__start_subtest("sockmap sk_msg load helpers"))
test_skmsg_helpers(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash sk_msg load helpers"))
@@ -981,6 +1107,8 @@ void test_sockmap_basic(void)
test_sockmap_skb_verdict_fionread(true);
if (test__start_subtest("sockmap skb_verdict fionread on drop"))
test_sockmap_skb_verdict_fionread(false);
+ if (test__start_subtest("sockmap skb_verdict change tail"))
+ test_sockmap_skb_verdict_change_tail();
if (test__start_subtest("sockmap skb_verdict msg_f_peek"))
test_sockmap_skb_verdict_peek();
if (test__start_subtest("sockmap skb_verdict msg_f_peek with link"))
@@ -997,4 +1125,6 @@ void test_sockmap_basic(void)
test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKMAP);
if (test__start_subtest("sockhash sk_msg attach sockhash helpers with link"))
test_skmsg_helpers_with_link(BPF_MAP_TYPE_SOCKHASH);
+ if (test__start_subtest("sockmap skb_verdict vsock poll"))
+ test_sockmap_skb_verdict_vsock_poll();
}
diff --git a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
index 38e35c72bdaa..3e5571dd578d 100644
--- a/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
+++ b/tools/testing/selftests/bpf/prog_tests/sockmap_helpers.h
@@ -1,139 +1,12 @@
#ifndef __SOCKMAP_HELPERS__
#define __SOCKMAP_HELPERS__
-#include <linux/vm_sockets.h>
+#include "socket_helpers.h"
-/* include/linux/net.h */
-#define SOCK_TYPE_MASK 0xf
-
-#define IO_TIMEOUT_SEC 30
-#define MAX_STRERR_LEN 256
#define MAX_TEST_NAME 80
-/* workaround for older vm_sockets.h */
-#ifndef VMADDR_CID_LOCAL
-#define VMADDR_CID_LOCAL 1
-#endif
-
#define __always_unused __attribute__((__unused__))
-/* include/linux/cleanup.h */
-#define __get_and_null(p, nullvalue) \
- ({ \
- __auto_type __ptr = &(p); \
- __auto_type __val = *__ptr; \
- *__ptr = nullvalue; \
- __val; \
- })
-
-#define take_fd(fd) __get_and_null(fd, -EBADF)
-
-#define _FAIL(errnum, fmt...) \
- ({ \
- error_at_line(0, (errnum), __func__, __LINE__, fmt); \
- CHECK_FAIL(true); \
- })
-#define FAIL(fmt...) _FAIL(0, fmt)
-#define FAIL_ERRNO(fmt...) _FAIL(errno, fmt)
-#define FAIL_LIBBPF(err, msg) \
- ({ \
- char __buf[MAX_STRERR_LEN]; \
- libbpf_strerror((err), __buf, sizeof(__buf)); \
- FAIL("%s: %s", (msg), __buf); \
- })
-
-/* Wrappers that fail the test on error and report it. */
-
-#define xaccept_nonblock(fd, addr, len) \
- ({ \
- int __ret = \
- accept_timeout((fd), (addr), (len), IO_TIMEOUT_SEC); \
- if (__ret == -1) \
- FAIL_ERRNO("accept"); \
- __ret; \
- })
-
-#define xbind(fd, addr, len) \
- ({ \
- int __ret = bind((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("bind"); \
- __ret; \
- })
-
-#define xclose(fd) \
- ({ \
- int __ret = close((fd)); \
- if (__ret == -1) \
- FAIL_ERRNO("close"); \
- __ret; \
- })
-
-#define xconnect(fd, addr, len) \
- ({ \
- int __ret = connect((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("connect"); \
- __ret; \
- })
-
-#define xgetsockname(fd, addr, len) \
- ({ \
- int __ret = getsockname((fd), (addr), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("getsockname"); \
- __ret; \
- })
-
-#define xgetsockopt(fd, level, name, val, len) \
- ({ \
- int __ret = getsockopt((fd), (level), (name), (val), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("getsockopt(" #name ")"); \
- __ret; \
- })
-
-#define xlisten(fd, backlog) \
- ({ \
- int __ret = listen((fd), (backlog)); \
- if (__ret == -1) \
- FAIL_ERRNO("listen"); \
- __ret; \
- })
-
-#define xsetsockopt(fd, level, name, val, len) \
- ({ \
- int __ret = setsockopt((fd), (level), (name), (val), (len)); \
- if (__ret == -1) \
- FAIL_ERRNO("setsockopt(" #name ")"); \
- __ret; \
- })
-
-#define xsend(fd, buf, len, flags) \
- ({ \
- ssize_t __ret = send((fd), (buf), (len), (flags)); \
- if (__ret == -1) \
- FAIL_ERRNO("send"); \
- __ret; \
- })
-
-#define xrecv_nonblock(fd, buf, len, flags) \
- ({ \
- ssize_t __ret = recv_timeout((fd), (buf), (len), (flags), \
- IO_TIMEOUT_SEC); \
- if (__ret == -1) \
- FAIL_ERRNO("recv"); \
- __ret; \
- })
-
-#define xsocket(family, sotype, flags) \
- ({ \
- int __ret = socket(family, sotype, flags); \
- if (__ret == -1) \
- FAIL_ERRNO("socket"); \
- __ret; \
- })
-
#define xbpf_map_delete_elem(fd, key) \
({ \
int __ret = bpf_map_delete_elem((fd), (key)); \
@@ -193,130 +66,6 @@
__ret; \
})
-static inline void close_fd(int *fd)
-{
- if (*fd >= 0)
- xclose(*fd);
-}
-
-#define __close_fd __attribute__((cleanup(close_fd)))
-
-static inline int poll_connect(int fd, unsigned int timeout_sec)
-{
- struct timeval timeout = { .tv_sec = timeout_sec };
- fd_set wfds;
- int r, eval;
- socklen_t esize = sizeof(eval);
-
- FD_ZERO(&wfds);
- FD_SET(fd, &wfds);
-
- r = select(fd + 1, NULL, &wfds, NULL, &timeout);
- if (r == 0)
- errno = ETIME;
- if (r != 1)
- return -1;
-
- if (getsockopt(fd, SOL_SOCKET, SO_ERROR, &eval, &esize) < 0)
- return -1;
- if (eval != 0) {
- errno = eval;
- return -1;
- }
-
- return 0;
-}
-
-static inline int poll_read(int fd, unsigned int timeout_sec)
-{
- struct timeval timeout = { .tv_sec = timeout_sec };
- fd_set rfds;
- int r;
-
- FD_ZERO(&rfds);
- FD_SET(fd, &rfds);
-
- r = select(fd + 1, &rfds, NULL, NULL, &timeout);
- if (r == 0)
- errno = ETIME;
-
- return r == 1 ? 0 : -1;
-}
-
-static inline int accept_timeout(int fd, struct sockaddr *addr, socklen_t *len,
- unsigned int timeout_sec)
-{
- if (poll_read(fd, timeout_sec))
- return -1;
-
- return accept(fd, addr, len);
-}
-
-static inline int recv_timeout(int fd, void *buf, size_t len, int flags,
- unsigned int timeout_sec)
-{
- if (poll_read(fd, timeout_sec))
- return -1;
-
- return recv(fd, buf, len, flags);
-}
-
-static inline void init_addr_loopback4(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_in *addr4 = memset(ss, 0, sizeof(*ss));
-
- addr4->sin_family = AF_INET;
- addr4->sin_port = 0;
- addr4->sin_addr.s_addr = htonl(INADDR_LOOPBACK);
- *len = sizeof(*addr4);
-}
-
-static inline void init_addr_loopback6(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_in6 *addr6 = memset(ss, 0, sizeof(*ss));
-
- addr6->sin6_family = AF_INET6;
- addr6->sin6_port = 0;
- addr6->sin6_addr = in6addr_loopback;
- *len = sizeof(*addr6);
-}
-
-static inline void init_addr_loopback_vsock(struct sockaddr_storage *ss,
- socklen_t *len)
-{
- struct sockaddr_vm *addr = memset(ss, 0, sizeof(*ss));
-
- addr->svm_family = AF_VSOCK;
- addr->svm_port = VMADDR_PORT_ANY;
- addr->svm_cid = VMADDR_CID_LOCAL;
- *len = sizeof(*addr);
-}
-
-static inline void init_addr_loopback(int family, struct sockaddr_storage *ss,
- socklen_t *len)
-{
- switch (family) {
- case AF_INET:
- init_addr_loopback4(ss, len);
- return;
- case AF_INET6:
- init_addr_loopback6(ss, len);
- return;
- case AF_VSOCK:
- init_addr_loopback_vsock(ss, len);
- return;
- default:
- FAIL("unsupported address family %d", family);
- }
-}
-
-static inline struct sockaddr *sockaddr(struct sockaddr_storage *ss)
-{
- return (struct sockaddr *)ss;
-}
-
static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2)
{
u64 value;
@@ -334,136 +83,4 @@ static inline int add_to_sockmap(int sock_mapfd, int fd1, int fd2)
return xbpf_map_update_elem(sock_mapfd, &key, &value, BPF_NOEXIST);
}
-static inline int enable_reuseport(int s, int progfd)
-{
- int err, one = 1;
-
- err = xsetsockopt(s, SOL_SOCKET, SO_REUSEPORT, &one, sizeof(one));
- if (err)
- return -1;
- err = xsetsockopt(s, SOL_SOCKET, SO_ATTACH_REUSEPORT_EBPF, &progfd,
- sizeof(progfd));
- if (err)
- return -1;
-
- return 0;
-}
-
-static inline int socket_loopback_reuseport(int family, int sotype, int progfd)
-{
- struct sockaddr_storage addr;
- socklen_t len = 0;
- int err, s;
-
- init_addr_loopback(family, &addr, &len);
-
- s = xsocket(family, sotype, 0);
- if (s == -1)
- return -1;
-
- if (progfd >= 0)
- enable_reuseport(s, progfd);
-
- err = xbind(s, sockaddr(&addr), len);
- if (err)
- goto close;
-
- if (sotype & SOCK_DGRAM)
- return s;
-
- err = xlisten(s, SOMAXCONN);
- if (err)
- goto close;
-
- return s;
-close:
- xclose(s);
- return -1;
-}
-
-static inline int socket_loopback(int family, int sotype)
-{
- return socket_loopback_reuseport(family, sotype, -1);
-}
-
-static inline int create_pair(int family, int sotype, int *p0, int *p1)
-{
- __close_fd int s, c = -1, p = -1;
- struct sockaddr_storage addr;
- socklen_t len = sizeof(addr);
- int err;
-
- s = socket_loopback(family, sotype);
- if (s < 0)
- return s;
-
- err = xgetsockname(s, sockaddr(&addr), &len);
- if (err)
- return err;
-
- c = xsocket(family, sotype, 0);
- if (c < 0)
- return c;
-
- err = connect(c, sockaddr(&addr), len);
- if (err) {
- if (errno != EINPROGRESS) {
- FAIL_ERRNO("connect");
- return err;
- }
-
- err = poll_connect(c, IO_TIMEOUT_SEC);
- if (err) {
- FAIL_ERRNO("poll_connect");
- return err;
- }
- }
-
- switch (sotype & SOCK_TYPE_MASK) {
- case SOCK_DGRAM:
- err = xgetsockname(c, sockaddr(&addr), &len);
- if (err)
- return err;
-
- err = xconnect(s, sockaddr(&addr), len);
- if (err)
- return err;
-
- *p0 = take_fd(s);
- break;
- case SOCK_STREAM:
- case SOCK_SEQPACKET:
- p = xaccept_nonblock(s, NULL, NULL);
- if (p < 0)
- return p;
-
- *p0 = take_fd(p);
- break;
- default:
- FAIL("Unsupported socket type %#x", sotype);
- return -EOPNOTSUPP;
- }
-
- *p1 = take_fd(c);
- return 0;
-}
-
-static inline int create_socket_pairs(int family, int sotype, int *c0, int *c1,
- int *p0, int *p1)
-{
- int err;
-
- err = create_pair(family, sotype, c0, p0);
- if (err)
- return err;
-
- err = create_pair(family, sotype, c1, p1);
- if (err) {
- close(*c0);
- close(*p0);
- }
-
- return err;
-}
-
#endif // __SOCKMAP_HELPERS__
diff --git a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
index 60f474d965a9..42e822ea352f 100644
--- a/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
+++ b/tools/testing/selftests/bpf/prog_tests/task_local_storage.c
@@ -197,7 +197,7 @@ static void test_nodeadlock(void)
/* Unnecessary recursion and deadlock detection are reproducible
* in the preemptible kernel.
*/
- if (!skel->kconfig->CONFIG_PREEMPT) {
+ if (!skel->kconfig->CONFIG_PREEMPTION) {
test__skip();
goto done;
}
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c
new file mode 100644
index 000000000000..74752233e779
--- /dev/null
+++ b/tools/testing/selftests/bpf/prog_tests/tc_change_tail.c
@@ -0,0 +1,62 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <error.h>
+#include <test_progs.h>
+#include <linux/pkt_cls.h>
+
+#include "test_tc_change_tail.skel.h"
+#include "socket_helpers.h"
+
+#define LO_IFINDEX 1
+
+void test_tc_change_tail(void)
+{
+ LIBBPF_OPTS(bpf_tcx_opts, tcx_opts);
+ struct test_tc_change_tail *skel = NULL;
+ struct bpf_link *link;
+ int c1, p1;
+ char buf[2];
+ int ret;
+
+ skel = test_tc_change_tail__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "test_tc_change_tail__open_and_load"))
+ return;
+
+ link = bpf_program__attach_tcx(skel->progs.change_tail, LO_IFINDEX,
+ &tcx_opts);
+ if (!ASSERT_OK_PTR(link, "bpf_program__attach_tcx"))
+ goto destroy;
+
+ skel->links.change_tail = link;
+ ret = create_pair(AF_INET, SOCK_DGRAM, &c1, &p1);
+ if (!ASSERT_OK(ret, "create_pair"))
+ goto destroy;
+
+ ret = xsend(p1, "Tr", 2, 0);
+ ASSERT_EQ(ret, 2, "xsend(p1)");
+ ret = recv(c1, buf, 2, 0);
+ ASSERT_EQ(ret, 2, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ ret = xsend(p1, "G", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 2, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, 0, "change_tail_ret");
+
+ ret = xsend(p1, "E", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 1, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+ ret = xsend(p1, "Z", 1, 0);
+ ASSERT_EQ(ret, 1, "xsend(p1)");
+ ret = recv(c1, buf, 1, 0);
+ ASSERT_EQ(ret, 1, "recv(c1)");
+ ASSERT_EQ(skel->data->change_tail_ret, -EINVAL, "change_tail_ret");
+
+ close(c1);
+ close(p1);
+destroy:
+ test_tc_change_tail__destroy(skel);
+}
diff --git a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
index 151a4210028f..2461d183dee5 100644
--- a/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
+++ b/tools/testing/selftests/bpf/prog_tests/tc_netkit.c
@@ -14,10 +14,16 @@
#include "netlink_helpers.h"
#include "tc_helpers.h"
+#define NETKIT_HEADROOM 32
+#define NETKIT_TAILROOM 8
+
#define MARK 42
#define PRIO 0xeb9f
#define ICMP_ECHO 8
+#define FLAG_ADJUST_ROOM (1 << 0)
+#define FLAG_SAME_NETNS (1 << 1)
+
struct icmphdr {
__u8 type;
__u8 code;
@@ -35,7 +41,7 @@ struct iplink_req {
};
static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
- bool same_netns, int scrub, int peer_scrub)
+ int scrub, int peer_scrub, __u32 flags)
{
struct rtnl_handle rth = { .fd = -1 };
struct iplink_req req = {};
@@ -63,6 +69,10 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
addattr32(&req.n, sizeof(req), IFLA_NETKIT_SCRUB, scrub);
addattr32(&req.n, sizeof(req), IFLA_NETKIT_PEER_SCRUB, peer_scrub);
addattr32(&req.n, sizeof(req), IFLA_NETKIT_MODE, mode);
+ if (flags & FLAG_ADJUST_ROOM) {
+ addattr16(&req.n, sizeof(req), IFLA_NETKIT_HEADROOM, NETKIT_HEADROOM);
+ addattr16(&req.n, sizeof(req), IFLA_NETKIT_TAILROOM, NETKIT_TAILROOM);
+ }
addattr_nest_end(&req.n, data);
addattr_nest_end(&req.n, linkinfo);
@@ -87,7 +97,7 @@ static int create_netkit(int mode, int policy, int peer_policy, int *ifindex,
" addr ee:ff:bb:cc:aa:dd"),
"set hwaddress");
}
- if (same_netns) {
+ if (flags & FLAG_SAME_NETNS) {
ASSERT_OK(system("ip link set dev " netkit_peer " up"),
"up peer");
ASSERT_OK(system("ip addr add dev " netkit_peer " 10.0.0.2/24"),
@@ -184,8 +194,8 @@ void serial_test_tc_netkit_basic(void)
int err, ifindex;
err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -299,8 +309,8 @@ static void serial_test_tc_netkit_multi_links_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -428,8 +438,8 @@ static void serial_test_tc_netkit_multi_opts_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -543,8 +553,8 @@ void serial_test_tc_netkit_device(void)
int err, ifindex, ifindex2;
err = create_netkit(NETKIT_L3, NETKIT_PASS, NETKIT_PASS,
- &ifindex, true, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS);
if (err)
return;
@@ -655,8 +665,8 @@ static void serial_test_tc_netkit_neigh_links_target(int mode, int target)
int err, ifindex;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, 0);
if (err)
return;
@@ -733,8 +743,8 @@ static void serial_test_tc_netkit_pkt_type_mode(int mode)
struct bpf_link *link;
err = create_netkit(mode, NETKIT_PASS, NETKIT_PASS,
- &ifindex, true, NETKIT_SCRUB_DEFAULT,
- NETKIT_SCRUB_DEFAULT);
+ &ifindex, NETKIT_SCRUB_DEFAULT,
+ NETKIT_SCRUB_DEFAULT, FLAG_SAME_NETNS);
if (err)
return;
@@ -799,7 +809,7 @@ void serial_test_tc_netkit_pkt_type(void)
serial_test_tc_netkit_pkt_type_mode(NETKIT_L3);
}
-static void serial_test_tc_netkit_scrub_type(int scrub)
+static void serial_test_tc_netkit_scrub_type(int scrub, bool room)
{
LIBBPF_OPTS(bpf_netkit_opts, optl);
struct test_tc_link *skel;
@@ -807,7 +817,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub)
int err, ifindex;
err = create_netkit(NETKIT_L2, NETKIT_PASS, NETKIT_PASS,
- &ifindex, false, scrub, scrub);
+ &ifindex, scrub, scrub,
+ room ? FLAG_ADJUST_ROOM : 0);
if (err)
return;
@@ -842,6 +853,8 @@ static void serial_test_tc_netkit_scrub_type(int scrub)
ASSERT_EQ(skel->bss->seen_tc8, true, "seen_tc8");
ASSERT_EQ(skel->bss->mark, scrub == NETKIT_SCRUB_NONE ? MARK : 0, "mark");
ASSERT_EQ(skel->bss->prio, scrub == NETKIT_SCRUB_NONE ? PRIO : 0, "prio");
+ ASSERT_EQ(skel->bss->headroom, room ? NETKIT_HEADROOM : 0, "headroom");
+ ASSERT_EQ(skel->bss->tailroom, room ? NETKIT_TAILROOM : 0, "tailroom");
cleanup:
test_tc_link__destroy(skel);
@@ -852,6 +865,6 @@ cleanup:
void serial_test_tc_netkit_scrub(void)
{
- serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT);
- serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE);
+ serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_DEFAULT, false);
+ serial_test_tc_netkit_scrub_type(NETKIT_SCRUB_NONE, true);
}
diff --git a/tools/testing/selftests/bpf/prog_tests/verifier.c b/tools/testing/selftests/bpf/prog_tests/verifier.c
index d9f65adb456b..3ee40ee9413a 100644
--- a/tools/testing/selftests/bpf/prog_tests/verifier.c
+++ b/tools/testing/selftests/bpf/prog_tests/verifier.c
@@ -225,24 +225,7 @@ void test_verifier_xdp(void) { RUN(verifier_xdp); }
void test_verifier_xdp_direct_packet_access(void) { RUN(verifier_xdp_direct_packet_access); }
void test_verifier_bits_iter(void) { RUN(verifier_bits_iter); }
void test_verifier_lsm(void) { RUN(verifier_lsm); }
-
-void test_verifier_mtu(void)
-{
- __u64 caps = 0;
- int ret;
-
- /* In case CAP_BPF and CAP_PERFMON is not set */
- ret = cap_enable_effective(1ULL << CAP_BPF | 1ULL << CAP_NET_ADMIN, &caps);
- if (!ASSERT_OK(ret, "set_cap_bpf_cap_net_admin"))
- return;
- ret = cap_disable_effective(1ULL << CAP_SYS_ADMIN | 1ULL << CAP_PERFMON, NULL);
- if (!ASSERT_OK(ret, "disable_cap_sys_admin"))
- goto restore_cap;
- RUN(verifier_mtu);
-restore_cap:
- if (caps)
- cap_enable_effective(caps, NULL);
-}
+void test_verifier_mtu(void) { RUN(verifier_mtu); }
static int init_test_val_map(struct bpf_object *obj, char *map_name)
{
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
index e6a783c7f5db..937da9b7532a 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_context_test_run.c
@@ -2,6 +2,14 @@
#include <test_progs.h>
#include <network_helpers.h>
#include "test_xdp_context_test_run.skel.h"
+#include "test_xdp_meta.skel.h"
+
+#define TX_ADDR "10.0.0.1"
+#define RX_ADDR "10.0.0.2"
+#define RX_NAME "veth0"
+#define TX_NAME "veth1"
+#define TX_NETNS "xdp_context_tx"
+#define RX_NETNS "xdp_context_rx"
void test_xdp_context_error(int prog_fd, struct bpf_test_run_opts opts,
__u32 data_meta, __u32 data, __u32 data_end,
@@ -103,3 +111,82 @@ void test_xdp_context_test_run(void)
test_xdp_context_test_run__destroy(skel);
}
+
+void test_xdp_context_functional(void)
+{
+ LIBBPF_OPTS(bpf_tc_hook, tc_hook, .attach_point = BPF_TC_INGRESS);
+ LIBBPF_OPTS(bpf_tc_opts, tc_opts, .handle = 1, .priority = 1);
+ struct netns_obj *rx_ns = NULL, *tx_ns = NULL;
+ struct bpf_program *tc_prog, *xdp_prog;
+ struct test_xdp_meta *skel = NULL;
+ struct nstoken *nstoken = NULL;
+ int rx_ifindex;
+ int ret;
+
+ tx_ns = netns_new(TX_NETNS, false);
+ if (!ASSERT_OK_PTR(tx_ns, "create tx_ns"))
+ return;
+
+ rx_ns = netns_new(RX_NETNS, false);
+ if (!ASSERT_OK_PTR(rx_ns, "create rx_ns"))
+ goto close;
+
+ SYS(close, "ip link add " RX_NAME " netns " RX_NETNS
+ " type veth peer name " TX_NAME " netns " TX_NETNS);
+
+ nstoken = open_netns(RX_NETNS);
+ if (!ASSERT_OK_PTR(nstoken, "setns rx_ns"))
+ goto close;
+
+ SYS(close, "ip addr add " RX_ADDR "/24 dev " RX_NAME);
+ SYS(close, "ip link set dev " RX_NAME " up");
+
+ skel = test_xdp_meta__open_and_load();
+ if (!ASSERT_OK_PTR(skel, "open and load skeleton"))
+ goto close;
+
+ rx_ifindex = if_nametoindex(RX_NAME);
+ if (!ASSERT_GE(rx_ifindex, 0, "if_nametoindex rx"))
+ goto close;
+
+ tc_hook.ifindex = rx_ifindex;
+ ret = bpf_tc_hook_create(&tc_hook);
+ if (!ASSERT_OK(ret, "bpf_tc_hook_create"))
+ goto close;
+
+ tc_prog = bpf_object__find_program_by_name(skel->obj, "ing_cls");
+ if (!ASSERT_OK_PTR(tc_prog, "open ing_cls prog"))
+ goto close;
+
+ tc_opts.prog_fd = bpf_program__fd(tc_prog);
+ ret = bpf_tc_attach(&tc_hook, &tc_opts);
+ if (!ASSERT_OK(ret, "bpf_tc_attach"))
+ goto close;
+
+ xdp_prog = bpf_object__find_program_by_name(skel->obj, "ing_xdp");
+ if (!ASSERT_OK_PTR(xdp_prog, "open ing_xdp prog"))
+ goto close;
+
+ ret = bpf_xdp_attach(rx_ifindex,
+ bpf_program__fd(xdp_prog),
+ 0, NULL);
+ if (!ASSERT_GE(ret, 0, "bpf_xdp_attach"))
+ goto close;
+
+ close_netns(nstoken);
+
+ nstoken = open_netns(TX_NETNS);
+ if (!ASSERT_OK_PTR(nstoken, "setns tx_ns"))
+ goto close;
+
+ SYS(close, "ip addr add " TX_ADDR "/24 dev " TX_NAME);
+ SYS(close, "ip link set dev " TX_NAME " up");
+ ASSERT_OK(SYS_NOFAIL("ping -c 1 " RX_ADDR), "ping");
+
+close:
+ close_netns(nstoken);
+ test_xdp_meta__destroy(skel);
+ netns_free(rx_ns);
+ netns_free(tx_ns);
+}
+
diff --git a/tools/testing/selftests/bpf/progs/bpf_misc.h b/tools/testing/selftests/bpf/progs/bpf_misc.h
index eccaf955e394..f45f4352feeb 100644
--- a/tools/testing/selftests/bpf/progs/bpf_misc.h
+++ b/tools/testing/selftests/bpf/progs/bpf_misc.h
@@ -5,6 +5,10 @@
#define XSTR(s) STR(s)
#define STR(s) #s
+/* Expand a macro and then stringize the expansion */
+#define QUOTE(str) #str
+#define EXPAND_QUOTE(str) QUOTE(str)
+
/* This set of attributes controls behavior of the
* test_loader.c:test_loader__run_subtests().
*
@@ -106,6 +110,7 @@
* __arch_* Specify on which architecture the test case should be tested.
* Several __arch_* annotations could be specified at once.
* When test case is not run on current arch it is marked as skipped.
+ * __caps_unpriv Specify the capabilities that should be set when running the test.
*/
#define __msg(msg) __attribute__((btf_decl_tag("comment:test_expect_msg=" XSTR(__COUNTER__) "=" msg)))
#define __xlated(msg) __attribute__((btf_decl_tag("comment:test_expect_xlated=" XSTR(__COUNTER__) "=" msg)))
@@ -129,6 +134,13 @@
#define __arch_x86_64 __arch("X86_64")
#define __arch_arm64 __arch("ARM64")
#define __arch_riscv64 __arch("RISCV64")
+#define __caps_unpriv(caps) __attribute__((btf_decl_tag("comment:test_caps_unpriv=" EXPAND_QUOTE(caps))))
+
+/* Define common capabilities tested using __caps_unpriv */
+#define CAP_NET_ADMIN 12
+#define CAP_SYS_ADMIN 21
+#define CAP_PERFMON 38
+#define CAP_BPF 39
/* Convenience macro for use with 'asm volatile' blocks */
#define __naked __attribute__((naked))
diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data.c b/tools/testing/selftests/bpf/progs/changes_pkt_data.c
new file mode 100644
index 000000000000..43cada48b28a
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/changes_pkt_data.c
@@ -0,0 +1,39 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+__noinline
+long changes_pkt_data(struct __sk_buff *sk)
+{
+ return bpf_skb_pull_data(sk, 0);
+}
+
+__noinline __weak
+long does_not_change_pkt_data(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+SEC("?tc")
+int main_with_subprogs(struct __sk_buff *sk)
+{
+ changes_pkt_data(sk);
+ does_not_change_pkt_data(sk);
+ return 0;
+}
+
+SEC("?tc")
+int main_changes(struct __sk_buff *sk)
+{
+ bpf_skb_pull_data(sk, 0);
+ return 0;
+}
+
+SEC("?tc")
+int main_does_not_change(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c
new file mode 100644
index 000000000000..f9a622705f1b
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/changes_pkt_data_freplace.c
@@ -0,0 +1,18 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+SEC("?freplace")
+long changes_pkt_data(struct __sk_buff *sk)
+{
+ return bpf_skb_pull_data(sk, 0);
+}
+
+SEC("?freplace")
+long does_not_change_pkt_data(struct __sk_buff *sk)
+{
+ return 0;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/dynptr_fail.c b/tools/testing/selftests/bpf/progs/dynptr_fail.c
index 8f36c9de7591..dfd817d0348c 100644
--- a/tools/testing/selftests/bpf/progs/dynptr_fail.c
+++ b/tools/testing/selftests/bpf/progs/dynptr_fail.c
@@ -149,7 +149,7 @@ int ringbuf_release_uninit_dynptr(void *ctx)
/* A dynptr can't be used after it has been invalidated */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int use_after_invalid(void *ctx)
{
struct bpf_dynptr ptr;
@@ -428,7 +428,7 @@ int invalid_helper2(void *ctx)
/* A bpf_dynptr is invalidated if it's been written into */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int invalid_write1(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1407,7 +1407,7 @@ int invalid_slice_rdwr_rdonly(struct __sk_buff *skb)
/* bpf_dynptr_adjust can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_adjust_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1420,7 +1420,7 @@ int dynptr_adjust_invalid(void *ctx)
/* bpf_dynptr_is_null can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_is_null_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1433,7 +1433,7 @@ int dynptr_is_null_invalid(void *ctx)
/* bpf_dynptr_is_rdonly can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_is_rdonly_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1446,7 +1446,7 @@ int dynptr_is_rdonly_invalid(void *ctx)
/* bpf_dynptr_size can only be called on initialized dynptrs */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int dynptr_size_invalid(void *ctx)
{
struct bpf_dynptr ptr = {};
@@ -1459,7 +1459,7 @@ int dynptr_size_invalid(void *ctx)
/* Only initialized dynptrs can be cloned */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #1")
+__failure __msg("Expected an initialized dynptr as arg #0")
int clone_invalid1(void *ctx)
{
struct bpf_dynptr ptr1 = {};
@@ -1493,7 +1493,7 @@ int clone_invalid2(struct xdp_md *xdp)
/* Invalidating a dynptr should invalidate its clones */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate1(void *ctx)
{
struct bpf_dynptr clone;
@@ -1514,7 +1514,7 @@ int clone_invalidate1(void *ctx)
/* Invalidating a dynptr should invalidate its parent */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate2(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1535,7 +1535,7 @@ int clone_invalidate2(void *ctx)
/* Invalidating a dynptr should invalidate its siblings */
SEC("?raw_tp")
-__failure __msg("Expected an initialized dynptr as arg #3")
+__failure __msg("Expected an initialized dynptr as arg #2")
int clone_invalidate3(void *ctx)
{
struct bpf_dynptr ptr;
@@ -1723,7 +1723,7 @@ __noinline long global_call_bpf_dynptr(const struct bpf_dynptr *dynptr)
}
SEC("?raw_tp")
-__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
+__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr")
int test_dynptr_reg_type(void *ctx)
{
struct task_struct *current = NULL;
diff --git a/tools/testing/selftests/bpf/progs/iters.c b/tools/testing/selftests/bpf/progs/iters.c
index ef70b88bccb2..7c969c127573 100644
--- a/tools/testing/selftests/bpf/progs/iters.c
+++ b/tools/testing/selftests/bpf/progs/iters.c
@@ -1486,4 +1486,30 @@ int iter_subprog_check_stacksafe(const void *ctx)
return 0;
}
+struct bpf_iter_num global_it;
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_new_bad_arg(const void *ctx)
+{
+ bpf_iter_num_new(&global_it, 0, 1);
+ return 0;
+}
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_next_bad_arg(const void *ctx)
+{
+ bpf_iter_num_next(&global_it);
+ return 0;
+}
+
+SEC("raw_tp")
+__failure __msg("arg#0 expected pointer to an iterator on stack")
+int iter_destroy_bad_arg(const void *ctx)
+{
+ bpf_iter_num_destroy(&global_it);
+ return 0;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/iters_state_safety.c b/tools/testing/selftests/bpf/progs/iters_state_safety.c
index d47e59aba6de..f41257eadbb2 100644
--- a/tools/testing/selftests/bpf/progs/iters_state_safety.c
+++ b/tools/testing/selftests/bpf/progs/iters_state_safety.c
@@ -73,7 +73,7 @@ int create_and_forget_to_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int destroy_without_creating_fail(void *ctx)
{
/* init with zeros to stop verifier complaining about uninit stack */
@@ -91,7 +91,7 @@ int destroy_without_creating_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int compromise_iter_w_direct_write_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -143,7 +143,7 @@ int compromise_iter_w_direct_write_and_skip_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int compromise_iter_w_helper_write_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -230,7 +230,7 @@ int valid_stack_reuse(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected uninitialized iter_num as arg #1")
+__failure __msg("expected uninitialized iter_num as arg #0")
int double_create_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -258,7 +258,7 @@ int double_create_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int double_destroy_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -284,7 +284,7 @@ int double_destroy_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int next_without_new_fail(void *ctx)
{
struct bpf_iter_num iter;
@@ -305,7 +305,7 @@ int next_without_new_fail(void *ctx)
}
SEC("?raw_tp")
-__failure __msg("expected an initialized iter_num as arg #1")
+__failure __msg("expected an initialized iter_num as arg #0")
int next_after_destroy_fail(void *ctx)
{
struct bpf_iter_num iter;
diff --git a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
index 4a176e6aede8..6543d5b6e0a9 100644
--- a/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
+++ b/tools/testing/selftests/bpf/progs/iters_testmod_seq.c
@@ -79,7 +79,7 @@ int testmod_seq_truncated(const void *ctx)
SEC("?raw_tp")
__failure
-__msg("expected an initialized iter_testmod_seq as arg #2")
+__msg("expected an initialized iter_testmod_seq as arg #1")
int testmod_seq_getter_before_bad(const void *ctx)
{
struct bpf_iter_testmod_seq it;
@@ -89,7 +89,7 @@ int testmod_seq_getter_before_bad(const void *ctx)
SEC("?raw_tp")
__failure
-__msg("expected an initialized iter_testmod_seq as arg #2")
+__msg("expected an initialized iter_testmod_seq as arg #1")
int testmod_seq_getter_after_bad(const void *ctx)
{
struct bpf_iter_testmod_seq it;
diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null.c b/tools/testing/selftests/bpf/progs/raw_tp_null.c
index 457f34c151e3..5927054b6dd9 100644
--- a/tools/testing/selftests/bpf/progs/raw_tp_null.c
+++ b/tools/testing/selftests/bpf/progs/raw_tp_null.c
@@ -3,6 +3,7 @@
#include <vmlinux.h>
#include <bpf/bpf_tracing.h>
+#include "bpf_misc.h"
char _license[] SEC("license") = "GPL";
@@ -17,16 +18,14 @@ int BPF_PROG(test_raw_tp_null, struct sk_buff *skb)
if (task->pid != tid)
return 0;
- i = i + skb->mark + 1;
- /* The compiler may move the NULL check before this deref, which causes
- * the load to fail as deref of scalar. Prevent that by using a barrier.
+ /* If dead code elimination kicks in, the increment +=2 will be
+ * removed. For raw_tp programs attaching to tracepoints in kernel
+ * modules, we mark input arguments as PTR_MAYBE_NULL, so branch
+ * prediction should never kick in.
*/
- barrier();
- /* If dead code elimination kicks in, the increment below will
- * be removed. For raw_tp programs, we mark input arguments as
- * PTR_MAYBE_NULL, so branch prediction should never kick in.
- */
- if (!skb)
- i += 2;
+ asm volatile ("%[i] += 1; if %[ctx] != 0 goto +1; %[i] += 2;"
+ : [i]"+r"(i)
+ : [ctx]"r"(skb)
+ : "memory");
return 0;
}
diff --git a/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c
new file mode 100644
index 000000000000..38d669957bf1
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/raw_tp_null_fail.c
@@ -0,0 +1,24 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 Meta Platforms, Inc. and affiliates. */
+
+#include <vmlinux.h>
+#include <bpf/bpf_tracing.h>
+#include "bpf_misc.h"
+
+char _license[] SEC("license") = "GPL";
+
+/* Ensure module parameter has PTR_MAYBE_NULL */
+SEC("tp_btf/bpf_testmod_test_raw_tp_null")
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
+int test_raw_tp_null_bpf_testmod_test_raw_tp_null_arg_1(void *ctx) {
+ asm volatile("r1 = *(u64 *)(r1 +0); r1 = *(u64 *)(r1 +0);" ::: __clobber_all);
+ return 0;
+}
+
+/* Check NULL marking */
+SEC("tp_btf/sched_pi_setprio")
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
+int test_raw_tp_null_sched_pi_setprio_arg_2(void *ctx) {
+ asm volatile("r1 = *(u64 *)(r1 +8); r1 = *(u64 *)(r1 +0);" ::: __clobber_all);
+ return 0;
+}
diff --git a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
index 76556e0b42b2..69da05bb6c63 100644
--- a/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
+++ b/tools/testing/selftests/bpf/progs/read_bpf_task_storage_busy.c
@@ -4,7 +4,7 @@
#include <bpf/bpf_helpers.h>
#include <bpf/bpf_tracing.h>
-extern bool CONFIG_PREEMPT __kconfig __weak;
+extern bool CONFIG_PREEMPTION __kconfig __weak;
extern const int bpf_task_storage_busy __ksym;
char _license[] SEC("license") = "GPL";
@@ -24,7 +24,7 @@ int BPF_PROG(read_bpf_task_storage_busy)
{
int *value;
- if (!CONFIG_PREEMPT)
+ if (!CONFIG_PREEMPTION)
return 0;
if (bpf_get_current_pid_tgid() >> 32 != pid)
diff --git a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
index ea2dbb80f7b3..986829aaf73a 100644
--- a/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
+++ b/tools/testing/selftests/bpf/progs/task_storage_nodeadlock.c
@@ -10,7 +10,7 @@ char _license[] SEC("license") = "GPL";
#define EBUSY 16
#endif
-extern bool CONFIG_PREEMPT __kconfig __weak;
+extern bool CONFIG_PREEMPTION __kconfig __weak;
int nr_get_errs = 0;
int nr_del_errs = 0;
@@ -29,7 +29,7 @@ int BPF_PROG(socket_post_create, struct socket *sock, int family, int type,
int ret, zero = 0;
int *value;
- if (!CONFIG_PREEMPT)
+ if (!CONFIG_PREEMPTION)
return 0;
task = bpf_get_current_task_btf();
diff --git a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
index d1a57f7d09bd..fe6249d99b31 100644
--- a/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
+++ b/tools/testing/selftests/bpf/progs/tc_bpf2bpf.c
@@ -11,6 +11,8 @@ int subprog_tc(struct __sk_buff *skb)
__sink(skb);
__sink(ret);
+ /* let verifier know that 'subprog_tc' can change pointers to skb->data */
+ bpf_skb_change_proto(skb, 0, 0);
return ret;
}
diff --git a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
index e68667aec6a6..cd4d752bd089 100644
--- a/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
+++ b/tools/testing/selftests/bpf/progs/test_kfunc_dynptr_param.c
@@ -45,7 +45,7 @@ int BPF_PROG(not_valid_dynptr, int cmd, union bpf_attr *attr, unsigned int size)
}
SEC("?lsm.s/bpf")
-__failure __msg("arg#1 expected pointer to stack or const struct bpf_dynptr")
+__failure __msg("arg#0 expected pointer to stack or const struct bpf_dynptr")
int BPF_PROG(not_ptr_to_stack, int cmd, union bpf_attr *attr, unsigned int size)
{
unsigned long val = 0;
diff --git a/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c
new file mode 100644
index 000000000000..2796dd8545eb
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_sockmap_change_tail.c
@@ -0,0 +1,40 @@
+// SPDX-License-Identifier: GPL-2.0
+/* Copyright (c) 2024 ByteDance */
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+
+struct {
+ __uint(type, BPF_MAP_TYPE_SOCKMAP);
+ __uint(max_entries, 1);
+ __type(key, int);
+ __type(value, int);
+} sock_map_rx SEC(".maps");
+
+long change_tail_ret = 1;
+
+SEC("sk_skb")
+int prog_skb_verdict(struct __sk_buff *skb)
+{
+ char *data, *data_end;
+
+ bpf_skb_pull_data(skb, 1);
+ data = (char *)(unsigned long)skb->data;
+ data_end = (char *)(unsigned long)skb->data_end;
+
+ if (data + 1 > data_end)
+ return SK_PASS;
+
+ if (data[0] == 'T') { /* Trim the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, skb->len - 1, 0);
+ return SK_PASS;
+ } else if (data[0] == 'G') { /* Grow the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, skb->len + 1, 0);
+ return SK_PASS;
+ } else if (data[0] == 'E') { /* Error */
+ change_tail_ret = bpf_skb_change_tail(skb, 65535, 0);
+ return SK_PASS;
+ }
+ return SK_PASS;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/test_tc_change_tail.c b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c
new file mode 100644
index 000000000000..28edafe803f0
--- /dev/null
+++ b/tools/testing/selftests/bpf/progs/test_tc_change_tail.c
@@ -0,0 +1,106 @@
+// SPDX-License-Identifier: GPL-2.0
+#include <linux/bpf.h>
+#include <bpf/bpf_helpers.h>
+#include <linux/if_ether.h>
+#include <linux/in.h>
+#include <linux/ip.h>
+#include <linux/udp.h>
+#include <linux/pkt_cls.h>
+
+long change_tail_ret = 1;
+
+static __always_inline struct iphdr *parse_ip_header(struct __sk_buff *skb, int *ip_proto)
+{
+ void *data_end = (void *)(long)skb->data_end;
+ void *data = (void *)(long)skb->data;
+ struct ethhdr *eth = data;
+ struct iphdr *iph;
+
+ /* Verify Ethernet header */
+ if ((void *)(data + sizeof(*eth)) > data_end)
+ return NULL;
+
+ /* Skip Ethernet header to get to IP header */
+ iph = (void *)(data + sizeof(struct ethhdr));
+
+ /* Verify IP header */
+ if ((void *)(data + sizeof(struct ethhdr) + sizeof(*iph)) > data_end)
+ return NULL;
+
+ /* Basic IP header validation */
+ if (iph->version != 4) /* Only support IPv4 */
+ return NULL;
+
+ if (iph->ihl < 5) /* Minimum IP header length */
+ return NULL;
+
+ *ip_proto = iph->protocol;
+ return iph;
+}
+
+static __always_inline struct udphdr *parse_udp_header(struct __sk_buff *skb, struct iphdr *iph)
+{
+ void *data_end = (void *)(long)skb->data_end;
+ void *hdr = (void *)iph;
+ struct udphdr *udp;
+
+ /* Calculate UDP header position */
+ udp = hdr + (iph->ihl * 4);
+ hdr = (void *)udp;
+
+ /* Verify UDP header bounds */
+ if ((void *)(hdr + sizeof(*udp)) > data_end)
+ return NULL;
+
+ return udp;
+}
+
+SEC("tc/ingress")
+int change_tail(struct __sk_buff *skb)
+{
+ int len = skb->len;
+ struct udphdr *udp;
+ struct iphdr *iph;
+ void *data_end;
+ char *payload;
+ int ip_proto;
+
+ bpf_skb_pull_data(skb, len);
+
+ data_end = (void *)(long)skb->data_end;
+ iph = parse_ip_header(skb, &ip_proto);
+ if (!iph)
+ return TCX_PASS;
+
+ if (ip_proto != IPPROTO_UDP)
+ return TCX_PASS;
+
+ udp = parse_udp_header(skb, iph);
+ if (!udp)
+ return TCX_PASS;
+
+ payload = (char *)udp + (sizeof(struct udphdr));
+ if (payload + 1 > (char *)data_end)
+ return TCX_PASS;
+
+ if (payload[0] == 'T') { /* Trim the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, len - 1, 0);
+ if (!change_tail_ret)
+ bpf_skb_change_tail(skb, len, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'G') { /* Grow the packet */
+ change_tail_ret = bpf_skb_change_tail(skb, len + 1, 0);
+ if (!change_tail_ret)
+ bpf_skb_change_tail(skb, len, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'E') { /* Error */
+ change_tail_ret = bpf_skb_change_tail(skb, 65535, 0);
+ return TCX_PASS;
+ } else if (payload[0] == 'Z') { /* Zero */
+ change_tail_ret = bpf_skb_change_tail(skb, 0, 0);
+ return TCX_PASS;
+ }
+ return TCX_DROP;
+}
+
+char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/test_tc_link.c b/tools/testing/selftests/bpf/progs/test_tc_link.c
index 10d825928499..630f12e51b07 100644
--- a/tools/testing/selftests/bpf/progs/test_tc_link.c
+++ b/tools/testing/selftests/bpf/progs/test_tc_link.c
@@ -8,6 +8,7 @@
#include <linux/if_packet.h>
#include <bpf/bpf_endian.h>
#include <bpf/bpf_helpers.h>
+#include <bpf/bpf_core_read.h>
char LICENSE[] SEC("license") = "GPL";
@@ -27,6 +28,7 @@ bool seen_host;
bool seen_mcast;
int mark, prio;
+unsigned short headroom, tailroom;
SEC("tc/ingress")
int tc1(struct __sk_buff *skb)
@@ -104,11 +106,24 @@ out:
return TCX_PASS;
}
+struct sk_buff {
+ struct net_device *dev;
+};
+
+struct net_device {
+ unsigned short needed_headroom;
+ unsigned short needed_tailroom;
+};
+
SEC("tc/egress")
int tc8(struct __sk_buff *skb)
{
+ struct net_device *dev = BPF_CORE_READ((struct sk_buff *)skb, dev);
+
seen_tc8 = true;
mark = skb->mark;
prio = skb->priority;
+ headroom = BPF_CORE_READ(dev, needed_headroom);
+ tailroom = BPF_CORE_READ(dev, needed_tailroom);
return TCX_PASS;
}
diff --git a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
index 5aaf2b065f86..bba3e37f749b 100644
--- a/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
+++ b/tools/testing/selftests/bpf/progs/test_tp_btf_nullable.c
@@ -7,11 +7,7 @@
#include "bpf_misc.h"
SEC("tp_btf/bpf_testmod_test_nullable_bare")
-/* This used to be a failure test, but raw_tp nullable arguments can now
- * directly be dereferenced, whether they have nullable annotation or not,
- * and don't need to be explicitly checked.
- */
-__success
+__failure __msg("R1 invalid mem access 'trusted_ptr_or_null_'")
int BPF_PROG(handle_tp_btf_nullable_bare1, struct bpf_testmod_test_read_ctx *nullable_ctx)
{
return nullable_ctx->len;
diff --git a/tools/testing/selftests/bpf/progs/test_xdp_meta.c b/tools/testing/selftests/bpf/progs/test_xdp_meta.c
index a7c4a7d49fe6..fe2d71ae0e71 100644
--- a/tools/testing/selftests/bpf/progs/test_xdp_meta.c
+++ b/tools/testing/selftests/bpf/progs/test_xdp_meta.c
@@ -8,7 +8,7 @@
#define round_up(x, y) ((((x) - 1) | __round_mask(x, y)) + 1)
#define ctx_ptr(ctx, mem) (void *)(unsigned long)ctx->mem
-SEC("t")
+SEC("tc")
int ing_cls(struct __sk_buff *ctx)
{
__u8 *data, *data_meta, *data_end;
@@ -28,7 +28,7 @@ int ing_cls(struct __sk_buff *ctx)
return diff ? TC_ACT_SHOT : TC_ACT_OK;
}
-SEC("x")
+SEC("xdp")
int ing_xdp(struct xdp_md *ctx)
{
__u8 *data, *data_meta, *data_end;
diff --git a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
index 7c881bca9af5..8bcddadfc4da 100644
--- a/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
+++ b/tools/testing/selftests/bpf/progs/verifier_bits_iter.c
@@ -32,18 +32,18 @@ int BPF_PROG(no_destroy, struct bpf_iter_meta *meta, struct cgroup *cgrp)
SEC("iter/cgroup")
__description("uninitialized iter in ->next()")
-__failure __msg("expected an initialized iter_bits as arg #1")
+__failure __msg("expected an initialized iter_bits as arg #0")
int BPF_PROG(next_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
{
- struct bpf_iter_bits *it = NULL;
+ struct bpf_iter_bits it = {};
- bpf_iter_bits_next(it);
+ bpf_iter_bits_next(&it);
return 0;
}
SEC("iter/cgroup")
__description("uninitialized iter in ->destroy()")
-__failure __msg("expected an initialized iter_bits as arg #1")
+__failure __msg("expected an initialized iter_bits as arg #0")
int BPF_PROG(destroy_uninit, struct bpf_iter_meta *meta, struct cgroup *cgrp)
{
struct bpf_iter_bits it = {};
diff --git a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
index a570e48b917a..28b939572cda 100644
--- a/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
+++ b/tools/testing/selftests/bpf/progs/verifier_btf_ctx_access.c
@@ -11,7 +11,7 @@ __success __retval(0)
__naked void btf_ctx_access_accept(void)
{
asm volatile (" \
- r2 = *(u32*)(r1 + 8); /* load 2nd argument value (int pointer) */\
+ r2 = *(u64 *)(r1 + 8); /* load 2nd argument value (int pointer) */\
r0 = 0; \
exit; \
" ::: __clobber_all);
@@ -23,7 +23,43 @@ __success __retval(0)
__naked void ctx_access_u32_pointer_accept(void)
{
asm volatile (" \
- r2 = *(u32*)(r1 + 0); /* load 1nd argument value (u32 pointer) */\
+ r2 = *(u64 *)(r1 + 0); /* load 1nd argument value (u32 pointer) */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u32")
+__failure __msg("size 4 must be 8")
+__naked void ctx_access_u32_pointer_reject_32(void)
+{
+ asm volatile (" \
+ r2 = *(u32 *)(r1 + 0); /* load 1st argument with narrow load */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u16")
+__failure __msg("size 2 must be 8")
+__naked void ctx_access_u32_pointer_reject_16(void)
+{
+ asm volatile (" \
+ r2 = *(u16 *)(r1 + 0); /* load 1st argument with narrow load */\
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("fentry/bpf_fentry_test9")
+__description("btf_ctx_access u32 pointer reject u8")
+__failure __msg("size 1 must be 8")
+__naked void ctx_access_u32_pointer_reject_8(void)
+{
+ asm volatile (" \
+ r2 = *(u8 *)(r1 + 0); /* load 1st argument with narrow load */\
r0 = 0; \
exit; \
" ::: __clobber_all);
diff --git a/tools/testing/selftests/bpf/progs/verifier_d_path.c b/tools/testing/selftests/bpf/progs/verifier_d_path.c
index ec79cbcfde91..87e51a215558 100644
--- a/tools/testing/selftests/bpf/progs/verifier_d_path.c
+++ b/tools/testing/selftests/bpf/progs/verifier_d_path.c
@@ -11,7 +11,7 @@ __success __retval(0)
__naked void d_path_accept(void)
{
asm volatile (" \
- r1 = *(u32*)(r1 + 0); \
+ r1 = *(u64 *)(r1 + 0); \
r2 = r10; \
r2 += -8; \
r6 = 0; \
@@ -31,7 +31,7 @@ __failure __msg("helper call is not allowed in probe")
__naked void d_path_reject(void)
{
asm volatile (" \
- r1 = *(u32*)(r1 + 0); \
+ r1 = *(u64 *)(r1 + 0); \
r2 = r10; \
r2 += -8; \
r6 = 0; \
diff --git a/tools/testing/selftests/bpf/progs/verifier_mtu.c b/tools/testing/selftests/bpf/progs/verifier_mtu.c
index 70c7600a26a0..4ccf1ebc42d1 100644
--- a/tools/testing/selftests/bpf/progs/verifier_mtu.c
+++ b/tools/testing/selftests/bpf/progs/verifier_mtu.c
@@ -6,7 +6,9 @@
SEC("tc/ingress")
__description("uninit/mtu: write rejected")
-__failure __msg("invalid indirect read from stack")
+__success
+__caps_unpriv(CAP_BPF|CAP_NET_ADMIN)
+__failure_unpriv __msg_unpriv("invalid indirect read from stack")
int tc_uninit_mtu(struct __sk_buff *ctx)
{
__u32 mtu;
diff --git a/tools/testing/selftests/bpf/progs/verifier_sock.c b/tools/testing/selftests/bpf/progs/verifier_sock.c
index d3e70e38e442..0d5e56dffabb 100644
--- a/tools/testing/selftests/bpf/progs/verifier_sock.c
+++ b/tools/testing/selftests/bpf/progs/verifier_sock.c
@@ -50,6 +50,13 @@ struct {
__uint(map_flags, BPF_F_NO_PREALLOC);
} sk_storage_map SEC(".maps");
+struct {
+ __uint(type, BPF_MAP_TYPE_PROG_ARRAY);
+ __uint(max_entries, 1);
+ __uint(key_size, sizeof(__u32));
+ __uint(value_size, sizeof(__u32));
+} jmp_table SEC(".maps");
+
SEC("cgroup/skb")
__description("skb->sk: no NULL check")
__failure __msg("invalid mem access 'sock_common_or_null'")
@@ -1037,4 +1044,53 @@ __naked void sock_create_read_src_port(void)
: __clobber_all);
}
+__noinline
+long skb_pull_data2(struct __sk_buff *sk, __u32 len)
+{
+ return bpf_skb_pull_data(sk, len);
+}
+
+__noinline
+long skb_pull_data1(struct __sk_buff *sk, __u32 len)
+{
+ return skb_pull_data2(sk, len);
+}
+
+/* global function calls bpf_skb_pull_data(), which invalidates packet
+ * pointers established before global function call.
+ */
+SEC("tc")
+__failure __msg("invalid mem access")
+int invalidate_pkt_pointers_from_global_func(struct __sk_buff *sk)
+{
+ int *p = (void *)(long)sk->data;
+
+ if ((void *)(p + 1) > (void *)(long)sk->data_end)
+ return TCX_DROP;
+ skb_pull_data1(sk, 0);
+ *p = 42; /* this is unsafe */
+ return TCX_PASS;
+}
+
+__noinline
+int tail_call(struct __sk_buff *sk)
+{
+ bpf_tail_call_static(sk, &jmp_table, 0);
+ return 0;
+}
+
+/* Tail calls invalidate packet pointers. */
+SEC("tc")
+__failure __msg("invalid mem access")
+int invalidate_pkt_pointers_by_tail_call(struct __sk_buff *sk)
+{
+ int *p = (void *)(long)sk->data;
+
+ if ((void *)(p + 1) > (void *)(long)sk->data_end)
+ return TCX_DROP;
+ tail_call(sk);
+ *p = 42; /* this is unsafe */
+ return TCX_PASS;
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
index 671d9f415dbf..1e5a511e8494 100644
--- a/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
+++ b/tools/testing/selftests/bpf/progs/verifier_spill_fill.c
@@ -1244,4 +1244,39 @@ __naked void old_stack_misc_vs_cur_ctx_ptr(void)
: __clobber_all);
}
+SEC("socket")
+__description("stack_noperfmon: reject read of invalid slots")
+__success
+__caps_unpriv(CAP_BPF)
+__failure_unpriv __msg_unpriv("invalid read from stack off -8+1 size 8")
+__naked void stack_noperfmon_reject_invalid_read(void)
+{
+ asm volatile (" \
+ r2 = 1; \
+ r6 = r10; \
+ r6 += -8; \
+ *(u8 *)(r6 + 0) = r2; \
+ r2 = *(u64 *)(r6 + 0); \
+ r0 = 0; \
+ exit; \
+" ::: __clobber_all);
+}
+
+SEC("socket")
+__description("stack_noperfmon: narrow spill onto 64-bit scalar spilled slots")
+__success
+__caps_unpriv(CAP_BPF)
+__success_unpriv
+__naked void stack_noperfmon_spill_32bit_onto_64bit_slot(void)
+{
+ asm volatile(" \
+ r0 = 0; \
+ *(u64 *)(r10 - 8) = r0; \
+ *(u32 *)(r10 - 8) = r0; \
+ exit; \
+" :
+ :
+ : __clobber_all);
+}
+
char _license[] SEC("license") = "GPL";
diff --git a/tools/testing/selftests/bpf/sdt.h b/tools/testing/selftests/bpf/sdt.h
index ca0162b4dc57..1fcfa5160231 100644
--- a/tools/testing/selftests/bpf/sdt.h
+++ b/tools/testing/selftests/bpf/sdt.h
@@ -102,6 +102,8 @@
# define STAP_SDT_ARG_CONSTRAINT nZr
# elif defined __arm__
# define STAP_SDT_ARG_CONSTRAINT g
+# elif defined __loongarch__
+# define STAP_SDT_ARG_CONSTRAINT nmr
# else
# define STAP_SDT_ARG_CONSTRAINT nor
# endif
diff --git a/tools/testing/selftests/bpf/test_loader.c b/tools/testing/selftests/bpf/test_loader.c
index 3e9b009580d4..53b06647cf57 100644
--- a/tools/testing/selftests/bpf/test_loader.c
+++ b/tools/testing/selftests/bpf/test_loader.c
@@ -36,6 +36,7 @@
#define TEST_TAG_ARCH "comment:test_arch="
#define TEST_TAG_JITED_PFX "comment:test_jited="
#define TEST_TAG_JITED_PFX_UNPRIV "comment:test_jited_unpriv="
+#define TEST_TAG_CAPS_UNPRIV "comment:test_caps_unpriv="
/* Warning: duplicated in bpf_misc.h */
#define POINTER_VALUE 0xcafe4all
@@ -74,6 +75,7 @@ struct test_subspec {
struct expected_msgs jited;
int retval;
bool execute;
+ __u64 caps;
};
struct test_spec {
@@ -276,6 +278,37 @@ static int parse_int(const char *str, int *val, const char *name)
return 0;
}
+static int parse_caps(const char *str, __u64 *val, const char *name)
+{
+ int cap_flag = 0;
+ char *token = NULL, *saveptr = NULL;
+
+ char *str_cpy = strdup(str);
+ if (str_cpy == NULL) {
+ PRINT_FAIL("Memory allocation failed\n");
+ return -EINVAL;
+ }
+
+ token = strtok_r(str_cpy, "|", &saveptr);
+ while (token != NULL) {
+ errno = 0;
+ if (!strncmp("CAP_", token, sizeof("CAP_") - 1)) {
+ PRINT_FAIL("define %s constant in bpf_misc.h, failed to parse caps\n", token);
+ return -EINVAL;
+ }
+ cap_flag = strtol(token, NULL, 10);
+ if (!cap_flag || errno) {
+ PRINT_FAIL("failed to parse caps %s\n", name);
+ return -EINVAL;
+ }
+ *val |= (1ULL << cap_flag);
+ token = strtok_r(NULL, "|", &saveptr);
+ }
+
+ free(str_cpy);
+ return 0;
+}
+
static int parse_retval(const char *str, int *val, const char *name)
{
struct {
@@ -541,6 +574,12 @@ static int parse_test_spec(struct test_loader *tester,
jit_on_next_line = true;
} else if (str_has_pfx(s, TEST_BTF_PATH)) {
spec->btf_custom_path = s + sizeof(TEST_BTF_PATH) - 1;
+ } else if (str_has_pfx(s, TEST_TAG_CAPS_UNPRIV)) {
+ val = s + sizeof(TEST_TAG_CAPS_UNPRIV) - 1;
+ err = parse_caps(val, &spec->unpriv.caps, "test caps");
+ if (err)
+ goto cleanup;
+ spec->mode_mask |= UNPRIV;
}
}
@@ -917,6 +956,13 @@ void run_subtest(struct test_loader *tester,
test__end_subtest();
return;
}
+ if (subspec->caps) {
+ err = cap_enable_effective(subspec->caps, NULL);
+ if (err) {
+ PRINT_FAIL("failed to set capabilities: %i, %s\n", err, strerror(err));
+ goto subtest_cleanup;
+ }
+ }
}
/* Implicitly reset to NULL if next test case doesn't specify */
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index e5c7ecbe57e3..fd2da2234cc9 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -1579,8 +1579,12 @@ static void test_txmsg_redir(int cgrp, struct sockmap_options *opt)
static void test_txmsg_redir_wait_sndmem(int cgrp, struct sockmap_options *opt)
{
- txmsg_redir = 1;
opt->tx_wait_mem = true;
+ txmsg_redir = 1;
+ test_send_large(opt, cgrp);
+
+ txmsg_redir = 1;
+ txmsg_apply = 4097;
test_send_large(opt, cgrp);
opt->tx_wait_mem = false;
}
diff --git a/tools/testing/selftests/bpf/test_xdp_meta.sh b/tools/testing/selftests/bpf/test_xdp_meta.sh
deleted file mode 100755
index 2740322c1878..000000000000
--- a/tools/testing/selftests/bpf/test_xdp_meta.sh
+++ /dev/null
@@ -1,58 +0,0 @@
-#!/bin/sh
-
-BPF_FILE="test_xdp_meta.bpf.o"
-# Kselftest framework requirement - SKIP code is 4.
-readonly KSFT_SKIP=4
-readonly NS1="ns1-$(mktemp -u XXXXXX)"
-readonly NS2="ns2-$(mktemp -u XXXXXX)"
-
-cleanup()
-{
- if [ "$?" = "0" ]; then
- echo "selftests: test_xdp_meta [PASS]";
- else
- echo "selftests: test_xdp_meta [FAILED]";
- fi
-
- set +e
- ip link del veth1 2> /dev/null
- ip netns del ${NS1} 2> /dev/null
- ip netns del ${NS2} 2> /dev/null
-}
-
-ip link set dev lo xdp off 2>/dev/null > /dev/null
-if [ $? -ne 0 ];then
- echo "selftests: [SKIP] Could not run test without the ip xdp support"
- exit $KSFT_SKIP
-fi
-set -e
-
-ip netns add ${NS1}
-ip netns add ${NS2}
-
-trap cleanup 0 2 3 6 9
-
-ip link add veth1 type veth peer name veth2
-
-ip link set veth1 netns ${NS1}
-ip link set veth2 netns ${NS2}
-
-ip netns exec ${NS1} ip addr add 10.1.1.11/24 dev veth1
-ip netns exec ${NS2} ip addr add 10.1.1.22/24 dev veth2
-
-ip netns exec ${NS1} tc qdisc add dev veth1 clsact
-ip netns exec ${NS2} tc qdisc add dev veth2 clsact
-
-ip netns exec ${NS1} tc filter add dev veth1 ingress bpf da obj ${BPF_FILE} sec t
-ip netns exec ${NS2} tc filter add dev veth2 ingress bpf da obj ${BPF_FILE} sec t
-
-ip netns exec ${NS1} ip link set dev veth1 xdp obj ${BPF_FILE} sec x
-ip netns exec ${NS2} ip link set dev veth2 xdp obj ${BPF_FILE} sec x
-
-ip netns exec ${NS1} ip link set dev veth1 up
-ip netns exec ${NS2} ip link set dev veth2 up
-
-ip netns exec ${NS1} ping -c 1 10.1.1.22
-ip netns exec ${NS2} ping -c 1 10.1.1.11
-
-exit 0
diff --git a/tools/testing/selftests/bpf/trace_helpers.c b/tools/testing/selftests/bpf/trace_helpers.c
index 2d742fdac6b9..81943c6254e6 100644
--- a/tools/testing/selftests/bpf/trace_helpers.c
+++ b/tools/testing/selftests/bpf/trace_helpers.c
@@ -293,6 +293,10 @@ static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *st
return 0;
}
#else
+# ifndef PROCMAP_QUERY_VMA_EXECUTABLE
+# define PROCMAP_QUERY_VMA_EXECUTABLE 0x04
+# endif
+
static int procmap_query(int fd, const void *addr, __u32 query_flags, size_t *start, size_t *offset, int *flags)
{
return -EOPNOTSUPP;
diff --git a/tools/testing/selftests/bpf/xdp_hw_metadata.c b/tools/testing/selftests/bpf/xdp_hw_metadata.c
index 6f9956eed797..e38675d9b118 100644
--- a/tools/testing/selftests/bpf/xdp_hw_metadata.c
+++ b/tools/testing/selftests/bpf/xdp_hw_metadata.c
@@ -79,7 +79,7 @@ static int open_xsk(int ifindex, struct xsk *xsk, __u32 queue_id)
.fill_size = XSK_RING_PROD__DEFAULT_NUM_DESCS,
.comp_size = XSK_RING_CONS__DEFAULT_NUM_DESCS,
.frame_size = XSK_UMEM__DEFAULT_FRAME_SIZE,
- .flags = XSK_UMEM__DEFAULT_FLAGS,
+ .flags = XDP_UMEM_TX_METADATA_LEN,
.tx_metadata_len = sizeof(struct xsk_tx_metadata),
};
__u32 idx = 0;
@@ -551,6 +551,7 @@ static void hwtstamp_enable(const char *ifname)
{
struct hwtstamp_config cfg = {
.rx_filter = HWTSTAMP_FILTER_ALL,
+ .tx_type = HWTSTAMP_TX_ON,
};
hwtstamp_ioctl(SIOCGHWTSTAMP, ifname, &saved_hwtstamp_cfg);
diff --git a/tools/testing/selftests/cgroup/test_cpuset_prs.sh b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
index 03c1bdaed2c3..400a696a0d21 100755
--- a/tools/testing/selftests/cgroup/test_cpuset_prs.sh
+++ b/tools/testing/selftests/cgroup/test_cpuset_prs.sh
@@ -86,15 +86,15 @@ echo "" > test/cpuset.cpus
#
# If isolated CPUs have been reserved at boot time (as shown in
-# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-7
+# cpuset.cpus.isolated), these isolated CPUs should be outside of CPUs 0-8
# that will be used by this script for testing purpose. If not, some of
-# the tests may fail incorrectly. These isolated CPUs will also be removed
-# before being compared with the expected results.
+# the tests may fail incorrectly. These pre-isolated CPUs should stay in
+# an isolated state throughout the testing process for now.
#
BOOT_ISOLCPUS=$(cat $CGROUP2/cpuset.cpus.isolated)
if [[ -n "$BOOT_ISOLCPUS" ]]
then
- [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 7 ]] &&
+ [[ $(echo $BOOT_ISOLCPUS | sed -e "s/[,-].*//") -le 8 ]] &&
skip_test "Pre-isolated CPUs ($BOOT_ISOLCPUS) overlap CPUs to be tested"
echo "Pre-isolated CPUs: $BOOT_ISOLCPUS"
fi
@@ -684,14 +684,18 @@ check_isolcpus()
fi
#
+ # Appending pre-isolated CPUs
+ # Even though CPU #8 isn't used for testing, it can't be pre-isolated
+ # to make appending those CPUs easier.
+ #
+ [[ -n "$BOOT_ISOLCPUS" ]] && {
+ EXPECT_VAL=${EXPECT_VAL:+${EXPECT_VAL},}${BOOT_ISOLCPUS}
+ EXPECT_VAL2=${EXPECT_VAL2:+${EXPECT_VAL2},}${BOOT_ISOLCPUS}
+ }
+
+ #
# Check cpuset.cpus.isolated cpumask
#
- if [[ -z "$BOOT_ISOLCPUS" ]]
- then
- ISOLCPUS=$(cat $ISCPUS)
- else
- ISOLCPUS=$(cat $ISCPUS | sed -e "s/,*$BOOT_ISOLCPUS//")
- fi
[[ "$EXPECT_VAL2" != "$ISOLCPUS" ]] && {
# Take a 50ms pause and try again
pause 0.05
@@ -731,8 +735,6 @@ check_isolcpus()
fi
done
[[ "$ISOLCPUS" = *- ]] && ISOLCPUS=${ISOLCPUS}$LASTISOLCPU
- [[ -n "BOOT_ISOLCPUS" ]] &&
- ISOLCPUS=$(echo $ISOLCPUS | sed -e "s/,*$BOOT_ISOLCPUS//")
[[ "$EXPECT_VAL" = "$ISOLCPUS" ]]
}
@@ -836,8 +838,11 @@ run_state_test()
# if available
[[ -n "$ICPUS" ]] && {
check_isolcpus $ICPUS
- [[ $? -ne 0 ]] && test_fail $I "isolated CPU" \
- "Expect $ICPUS, get $ISOLCPUS instead"
+ [[ $? -ne 0 ]] && {
+ [[ -n "$BOOT_ISOLCPUS" ]] && ICPUS=${ICPUS},${BOOT_ISOLCPUS}
+ test_fail $I "isolated CPU" \
+ "Expect $ICPUS, get $ISOLCPUS instead"
+ }
}
reset_cgroup_states
#
diff --git a/tools/testing/selftests/coredump/Makefile b/tools/testing/selftests/coredump/Makefile
new file mode 100644
index 000000000000..ed210037b29d
--- /dev/null
+++ b/tools/testing/selftests/coredump/Makefile
@@ -0,0 +1,7 @@
+# SPDX-License-Identifier: GPL-2.0-only
+CFLAGS = $(KHDR_INCLUDES)
+
+TEST_GEN_PROGS := stackdump_test
+TEST_FILES := stackdump
+
+include ../lib.mk
diff --git a/tools/testing/selftests/coredump/README.rst b/tools/testing/selftests/coredump/README.rst
new file mode 100644
index 000000000000..164a7aa181c8
--- /dev/null
+++ b/tools/testing/selftests/coredump/README.rst
@@ -0,0 +1,50 @@
+coredump selftest
+=================
+
+Background context
+------------------
+
+`coredump` is a feature which dumps a process's memory space when the process terminates
+unexpectedly (e.g. due to segmentation fault), which can be useful for debugging. By default,
+`coredump` dumps the memory to the file named `core`, but this behavior can be changed by writing a
+different file name to `/proc/sys/kernel/core_pattern`. Furthermore, `coredump` can be piped to a
+user-space program by writing the pipe symbol (`|`) followed by the command to be executed to
+`/proc/sys/kernel/core_pattern`. For the full description, see `man 5 core`.
+
+The piped user program may be interested in reading the stack pointers of the crashed process. The
+crashed process's stack pointers can be read from `procfs`: it is the `kstkesp` field in
+`/proc/$PID/stat`. See `man 5 proc` for all the details.
+
+The problem
+-----------
+While a thread is active, the stack pointer is unsafe to read and therefore the `kstkesp` field
+reads zero. But when the thread is dead (e.g. during a coredump), this field should have valid
+value.
+
+However, this was broken in the past and `kstkesp` was zero even during coredump:
+
+* commit 0a1eb2d474ed ("fs/proc: Stop reporting eip and esp in /proc/PID/stat") changed kstkesp to
+ always be zero
+
+* commit fd7d56270b52 ("fs/proc: Report eip/esp in /prod/PID/stat for coredumping") fixed it for the
+ coredumping thread. However, other threads in a coredumping process still had the problem.
+
+* commit cb8f381f1613 ("fs/proc/array.c: allow reporting eip/esp for all coredumping threads") fixed
+ for all threads in a coredumping process.
+
+* commit 92307383082d ("coredump: Don't perform any cleanups before dumping core") broke it again
+ for the other threads in a coredumping process.
+
+The problem has been fixed now, but considering the history, it may appear again in the future.
+
+The goal of this test
+---------------------
+This test detects problem with reading `kstkesp` during coredump by doing the following:
+
+#. Tell the kernel to execute the "stackdump" script when a coredump happens. This script
+ reads the stack pointers of all threads of crashed processes.
+
+#. Spawn a child process who creates some threads and then crashes.
+
+#. Read the output from the "stackdump" script, and make sure all stack pointer values are
+ non-zero.
diff --git a/tools/testing/selftests/coredump/stackdump b/tools/testing/selftests/coredump/stackdump
new file mode 100755
index 000000000000..96714ce42d12
--- /dev/null
+++ b/tools/testing/selftests/coredump/stackdump
@@ -0,0 +1,14 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+
+CRASH_PROGRAM_ID=$1
+STACKDUMP_FILE=$2
+
+TMP=$(mktemp)
+
+for t in /proc/$CRASH_PROGRAM_ID/task/*; do
+ tid=$(basename $t)
+ cat /proc/$tid/stat | awk '{print $29}' >> $TMP
+done
+
+mv $TMP $STACKDUMP_FILE
diff --git a/tools/testing/selftests/coredump/stackdump_test.c b/tools/testing/selftests/coredump/stackdump_test.c
new file mode 100644
index 000000000000..137b2364a082
--- /dev/null
+++ b/tools/testing/selftests/coredump/stackdump_test.c
@@ -0,0 +1,151 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#include <fcntl.h>
+#include <libgen.h>
+#include <linux/limits.h>
+#include <pthread.h>
+#include <string.h>
+#include <sys/resource.h>
+#include <unistd.h>
+
+#include "../kselftest_harness.h"
+
+#define STACKDUMP_FILE "stack_values"
+#define STACKDUMP_SCRIPT "stackdump"
+#define NUM_THREAD_SPAWN 128
+
+static void *do_nothing(void *)
+{
+ while (1)
+ pause();
+}
+
+static void crashing_child(void)
+{
+ pthread_t thread;
+ int i;
+
+ for (i = 0; i < NUM_THREAD_SPAWN; ++i)
+ pthread_create(&thread, NULL, do_nothing, NULL);
+
+ /* crash on purpose */
+ i = *(int *)NULL;
+}
+
+FIXTURE(coredump)
+{
+ char original_core_pattern[256];
+};
+
+FIXTURE_SETUP(coredump)
+{
+ char buf[PATH_MAX];
+ FILE *file;
+ char *dir;
+ int ret;
+
+ file = fopen("/proc/sys/kernel/core_pattern", "r");
+ ASSERT_NE(NULL, file);
+
+ ret = fread(self->original_core_pattern, 1, sizeof(self->original_core_pattern), file);
+ ASSERT_TRUE(ret || feof(file));
+ ASSERT_LT(ret, sizeof(self->original_core_pattern));
+
+ self->original_core_pattern[ret] = '\0';
+
+ ret = fclose(file);
+ ASSERT_EQ(0, ret);
+}
+
+FIXTURE_TEARDOWN(coredump)
+{
+ const char *reason;
+ FILE *file;
+ int ret;
+
+ unlink(STACKDUMP_FILE);
+
+ file = fopen("/proc/sys/kernel/core_pattern", "w");
+ if (!file) {
+ reason = "Unable to open core_pattern";
+ goto fail;
+ }
+
+ ret = fprintf(file, "%s", self->original_core_pattern);
+ if (ret < 0) {
+ reason = "Unable to write to core_pattern";
+ goto fail;
+ }
+
+ ret = fclose(file);
+ if (ret) {
+ reason = "Unable to close core_pattern";
+ goto fail;
+ }
+
+ return;
+fail:
+ /* This should never happen */
+ fprintf(stderr, "Failed to cleanup stackdump test: %s\n", reason);
+}
+
+TEST_F(coredump, stackdump)
+{
+ struct sigaction action = {};
+ unsigned long long stack;
+ char *test_dir, *line;
+ size_t line_length;
+ char buf[PATH_MAX];
+ int ret, i;
+ FILE *file;
+ pid_t pid;
+
+ /*
+ * Step 1: Setup core_pattern so that the stackdump script is executed when the child
+ * process crashes
+ */
+ ret = readlink("/proc/self/exe", buf, sizeof(buf));
+ ASSERT_NE(-1, ret);
+ ASSERT_LT(ret, sizeof(buf));
+ buf[ret] = '\0';
+
+ test_dir = dirname(buf);
+
+ file = fopen("/proc/sys/kernel/core_pattern", "w");
+ ASSERT_NE(NULL, file);
+
+ ret = fprintf(file, "|%1$s/%2$s %%P %1$s/%3$s", test_dir, STACKDUMP_SCRIPT, STACKDUMP_FILE);
+ ASSERT_LT(0, ret);
+
+ ret = fclose(file);
+ ASSERT_EQ(0, ret);
+
+ /* Step 2: Create a process who spawns some threads then crashes */
+ pid = fork();
+ ASSERT_TRUE(pid >= 0);
+ if (pid == 0)
+ crashing_child();
+
+ /*
+ * Step 3: Wait for the stackdump script to write the stack pointers to the stackdump file
+ */
+ for (i = 0; i < 10; ++i) {
+ file = fopen(STACKDUMP_FILE, "r");
+ if (file)
+ break;
+ sleep(1);
+ }
+ ASSERT_NE(file, NULL);
+
+ /* Step 4: Make sure all stack pointer values are non-zero */
+ for (i = 0; -1 != getline(&line, &line_length, file); ++i) {
+ stack = strtoull(line, NULL, 10);
+ ASSERT_NE(stack, 0);
+ }
+
+ ASSERT_EQ(i, 1 + NUM_THREAD_SPAWN);
+
+ fclose(file);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/cpufreq/.gitignore b/tools/testing/selftests/cpufreq/.gitignore
new file mode 100644
index 000000000000..67604e91e068
--- /dev/null
+++ b/tools/testing/selftests/cpufreq/.gitignore
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0-only
+cpufreq_selftest.*
diff --git a/tools/testing/selftests/cpufreq/Makefile b/tools/testing/selftests/cpufreq/Makefile
index c86ca8342222..9b2ccb10b0cf 100644
--- a/tools/testing/selftests/cpufreq/Makefile
+++ b/tools/testing/selftests/cpufreq/Makefile
@@ -3,6 +3,7 @@ all:
TEST_PROGS := main.sh
TEST_FILES := cpu.sh cpufreq.sh governor.sh module.sh special-tests.sh
+EXTRA_CLEAN := cpufreq_selftest.dmesg_cpufreq.txt cpufreq_selftest.dmesg_full.txt cpufreq_selftest.txt
include ../lib.mk
diff --git a/tools/testing/selftests/damon/Makefile b/tools/testing/selftests/damon/Makefile
index 5b2a6a5dd1af..812f656260fb 100644
--- a/tools/testing/selftests/damon/Makefile
+++ b/tools/testing/selftests/damon/Makefile
@@ -6,7 +6,7 @@ TEST_GEN_FILES += debugfs_target_ids_read_before_terminate_race
TEST_GEN_FILES += debugfs_target_ids_pid_leak
TEST_GEN_FILES += access_memory access_memory_even
-TEST_FILES = _chk_dependency.sh _debugfs_common.sh
+TEST_FILES = _chk_dependency.sh _debugfs_common.sh _damon_sysfs.py
# functionality tests
TEST_PROGS = debugfs_attrs.sh debugfs_schemes.sh debugfs_target_ids.sh
diff --git a/tools/testing/selftests/drivers/net/Makefile b/tools/testing/selftests/drivers/net/Makefile
index 0fec8f9801ad..137470bdee0c 100644
--- a/tools/testing/selftests/drivers/net/Makefile
+++ b/tools/testing/selftests/drivers/net/Makefile
@@ -1,15 +1,18 @@
# SPDX-License-Identifier: GPL-2.0
TEST_INCLUDES := $(wildcard lib/py/*.py) \
+ $(wildcard lib/sh/*.sh) \
../../net/net_helper.sh \
../../net/lib.sh \
TEST_PROGS := \
netcons_basic.sh \
+ netcons_overflow.sh \
ping.py \
queues.py \
stats.py \
shaper.py \
+ hds.py \
# end of TEST_PROGS
include ../../lib.mk
diff --git a/tools/testing/selftests/drivers/net/bonding/Makefile b/tools/testing/selftests/drivers/net/bonding/Makefile
index 03a089165d3f..2b10854e4b1e 100644
--- a/tools/testing/selftests/drivers/net/bonding/Makefile
+++ b/tools/testing/selftests/drivers/net/bonding/Makefile
@@ -10,7 +10,7 @@ TEST_PROGS := \
mode-2-recovery-updelay.sh \
bond_options.sh \
bond-eth-type-change.sh \
- bond_macvlan.sh
+ bond_macvlan_ipvlan.sh
TEST_FILES := \
lag_lib.sh \
diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh
deleted file mode 100755
index b609fb6231f4..000000000000
--- a/tools/testing/selftests/drivers/net/bonding/bond_macvlan.sh
+++ /dev/null
@@ -1,99 +0,0 @@
-#!/bin/bash
-# SPDX-License-Identifier: GPL-2.0
-#
-# Test macvlan over balance-alb
-
-lib_dir=$(dirname "$0")
-source ${lib_dir}/bond_topo_2d1c.sh
-
-m1_ns="m1-$(mktemp -u XXXXXX)"
-m2_ns="m1-$(mktemp -u XXXXXX)"
-m1_ip4="192.0.2.11"
-m1_ip6="2001:db8::11"
-m2_ip4="192.0.2.12"
-m2_ip6="2001:db8::12"
-
-cleanup()
-{
- ip -n ${m1_ns} link del macv0
- ip netns del ${m1_ns}
- ip -n ${m2_ns} link del macv0
- ip netns del ${m2_ns}
-
- client_destroy
- server_destroy
- gateway_destroy
-}
-
-check_connection()
-{
- local ns=${1}
- local target=${2}
- local message=${3:-"macvlan_over_bond"}
- RET=0
-
-
- ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null
- check_err $? "ping failed"
- log_test "$mode: $message"
-}
-
-macvlan_over_bond()
-{
- local param="$1"
- RET=0
-
- # setup new bond mode
- bond_reset "${param}"
-
- ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge
- ip -n ${s_ns} link set macv0 netns ${m1_ns}
- ip -n ${m1_ns} link set dev macv0 up
- ip -n ${m1_ns} addr add ${m1_ip4}/24 dev macv0
- ip -n ${m1_ns} addr add ${m1_ip6}/24 dev macv0
-
- ip -n ${s_ns} link add link bond0 name macv0 type macvlan mode bridge
- ip -n ${s_ns} link set macv0 netns ${m2_ns}
- ip -n ${m2_ns} link set dev macv0 up
- ip -n ${m2_ns} addr add ${m2_ip4}/24 dev macv0
- ip -n ${m2_ns} addr add ${m2_ip6}/24 dev macv0
-
- sleep 2
-
- check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server"
- check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server"
- check_connection "${c_ns}" "${m1_ip4}" "IPv4: client->macvlan_1"
- check_connection "${c_ns}" "${m1_ip6}" "IPv6: client->macvlan_1"
- check_connection "${c_ns}" "${m2_ip4}" "IPv4: client->macvlan_2"
- check_connection "${c_ns}" "${m2_ip6}" "IPv6: client->macvlan_2"
- check_connection "${m1_ns}" "${m2_ip4}" "IPv4: macvlan_1->macvlan_2"
- check_connection "${m1_ns}" "${m2_ip6}" "IPv6: macvlan_1->macvlan_2"
-
-
- sleep 5
-
- check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client"
- check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client"
- check_connection "${m1_ns}" "${c_ip4}" "IPv4: macvlan_1->client"
- check_connection "${m1_ns}" "${c_ip6}" "IPv6: macvlan_1->client"
- check_connection "${m2_ns}" "${c_ip4}" "IPv4: macvlan_2->client"
- check_connection "${m2_ns}" "${c_ip6}" "IPv6: macvlan_2->client"
- check_connection "${m2_ns}" "${m1_ip4}" "IPv4: macvlan_2->macvlan_2"
- check_connection "${m2_ns}" "${m1_ip6}" "IPv6: macvlan_2->macvlan_2"
-
- ip -n ${c_ns} neigh flush dev eth0
-}
-
-trap cleanup EXIT
-
-setup_prepare
-ip netns add ${m1_ns}
-ip netns add ${m2_ns}
-
-modes="active-backup balance-tlb balance-alb"
-
-for mode in $modes; do
- macvlan_over_bond "mode $mode"
-done
-
-exit $EXIT_STATUS
diff --git a/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh
new file mode 100755
index 000000000000..c4711272fe45
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/bonding/bond_macvlan_ipvlan.sh
@@ -0,0 +1,96 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# Test macvlan/ipvlan over bond
+
+lib_dir=$(dirname "$0")
+source ${lib_dir}/bond_topo_2d1c.sh
+
+xvlan1_ns="xvlan1-$(mktemp -u XXXXXX)"
+xvlan2_ns="xvlan2-$(mktemp -u XXXXXX)"
+xvlan1_ip4="192.0.2.11"
+xvlan1_ip6="2001:db8::11"
+xvlan2_ip4="192.0.2.12"
+xvlan2_ip6="2001:db8::12"
+
+cleanup()
+{
+ client_destroy
+ server_destroy
+ gateway_destroy
+
+ ip netns del ${xvlan1_ns}
+ ip netns del ${xvlan2_ns}
+}
+
+check_connection()
+{
+ local ns=${1}
+ local target=${2}
+ local message=${3}
+ RET=0
+
+ ip netns exec ${ns} ping ${target} -c 4 -i 0.1 &>/dev/null
+ check_err $? "ping failed"
+ log_test "${bond_mode}/${xvlan_type}_${xvlan_mode}: ${message}"
+}
+
+xvlan_over_bond()
+{
+ local param="$1"
+ local xvlan_type="$2"
+ local xvlan_mode="$3"
+ RET=0
+
+ # setup new bond mode
+ bond_reset "${param}"
+
+ ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode}
+ ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan1_ns}
+ ip -n ${xvlan1_ns} link set dev ${xvlan_type}0 up
+ ip -n ${xvlan1_ns} addr add ${xvlan1_ip4}/24 dev ${xvlan_type}0
+ ip -n ${xvlan1_ns} addr add ${xvlan1_ip6}/24 dev ${xvlan_type}0
+
+ ip -n ${s_ns} link add link bond0 name ${xvlan_type}0 type ${xvlan_type} mode ${xvlan_mode}
+ ip -n ${s_ns} link set ${xvlan_type}0 netns ${xvlan2_ns}
+ ip -n ${xvlan2_ns} link set dev ${xvlan_type}0 up
+ ip -n ${xvlan2_ns} addr add ${xvlan2_ip4}/24 dev ${xvlan_type}0
+ ip -n ${xvlan2_ns} addr add ${xvlan2_ip6}/24 dev ${xvlan_type}0
+
+ sleep 2
+
+ check_connection "${c_ns}" "${s_ip4}" "IPv4: client->server"
+ check_connection "${c_ns}" "${s_ip6}" "IPv6: client->server"
+ check_connection "${c_ns}" "${xvlan1_ip4}" "IPv4: client->${xvlan_type}_1"
+ check_connection "${c_ns}" "${xvlan1_ip6}" "IPv6: client->${xvlan_type}_1"
+ check_connection "${c_ns}" "${xvlan2_ip4}" "IPv4: client->${xvlan_type}_2"
+ check_connection "${c_ns}" "${xvlan2_ip6}" "IPv6: client->${xvlan_type}_2"
+ check_connection "${xvlan1_ns}" "${xvlan2_ip4}" "IPv4: ${xvlan_type}_1->${xvlan_type}_2"
+ check_connection "${xvlan1_ns}" "${xvlan2_ip6}" "IPv6: ${xvlan_type}_1->${xvlan_type}_2"
+
+ check_connection "${s_ns}" "${c_ip4}" "IPv4: server->client"
+ check_connection "${s_ns}" "${c_ip6}" "IPv6: server->client"
+ check_connection "${xvlan1_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_1->client"
+ check_connection "${xvlan1_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_1->client"
+ check_connection "${xvlan2_ns}" "${c_ip4}" "IPv4: ${xvlan_type}_2->client"
+ check_connection "${xvlan2_ns}" "${c_ip6}" "IPv6: ${xvlan_type}_2->client"
+ check_connection "${xvlan2_ns}" "${xvlan1_ip4}" "IPv4: ${xvlan_type}_2->${xvlan_type}_1"
+ check_connection "${xvlan2_ns}" "${xvlan1_ip6}" "IPv6: ${xvlan_type}_2->${xvlan_type}_1"
+
+ ip -n ${c_ns} neigh flush dev eth0
+}
+
+trap cleanup EXIT
+
+setup_prepare
+ip netns add ${xvlan1_ns}
+ip netns add ${xvlan2_ns}
+
+bond_modes="active-backup balance-tlb balance-alb"
+
+for bond_mode in ${bond_modes}; do
+ xvlan_over_bond "mode ${bond_mode}" macvlan bridge
+ xvlan_over_bond "mode ${bond_mode}" ipvlan l2
+done
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/drivers/net/bonding/config b/tools/testing/selftests/drivers/net/bonding/config
index 899d7fb6ea8e..dad4e5fda4db 100644
--- a/tools/testing/selftests/drivers/net/bonding/config
+++ b/tools/testing/selftests/drivers/net/bonding/config
@@ -3,6 +3,7 @@ CONFIG_BRIDGE=y
CONFIG_DUMMY=y
CONFIG_IPV6=y
CONFIG_MACVLAN=y
+CONFIG_IPVLAN=y
CONFIG_NET_ACT_GACT=y
CONFIG_NET_CLS_FLOWER=y
CONFIG_NET_SCH_INGRESS=y
diff --git a/tools/testing/selftests/drivers/net/hds.py b/tools/testing/selftests/drivers/net/hds.py
new file mode 100755
index 000000000000..394971b25c0b
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/hds.py
@@ -0,0 +1,120 @@
+#!/usr/bin/env python3
+# SPDX-License-Identifier: GPL-2.0
+
+import errno
+from lib.py import ksft_run, ksft_exit, ksft_eq, ksft_raises, KsftSkipEx
+from lib.py import EthtoolFamily, NlError
+from lib.py import NetDrvEnv
+
+def get_hds(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+def get_hds_thresh(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+
+def set_hds_enable(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'enabled'})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("disabling of HDS not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+ ksft_eq('enabled', rings['tcp-data-split'])
+
+def set_hds_disable(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'tcp-data-split': 'disabled'})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("disabling of HDS not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'tcp-data-split' not in rings:
+ raise KsftSkipEx('tcp-data-split not supported by device')
+
+ ksft_eq('disabled', rings['tcp-data-split'])
+
+def set_hds_thresh_zero(cfg, netnl) -> None:
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': 0})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("hds-thresh-set not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+
+ ksft_eq(0, rings['hds-thresh'])
+
+def set_hds_thresh_max(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+ try:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': rings['hds-thresh-max']})
+ except NlError as e:
+ if e.error == errno.EINVAL:
+ raise KsftSkipEx("hds-thresh-set not supported by the device")
+ elif e.error == errno.EOPNOTSUPP:
+ raise KsftSkipEx("ring-set not supported by the device")
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ ksft_eq(rings['hds-thresh'], rings['hds-thresh-max'])
+
+def set_hds_thresh_gt(cfg, netnl) -> None:
+ try:
+ rings = netnl.rings_get({'header': {'dev-index': cfg.ifindex}})
+ except NlError as e:
+ raise KsftSkipEx('ring-get not supported by device')
+ if 'hds-thresh' not in rings:
+ raise KsftSkipEx('hds-thresh not supported by device')
+ if 'hds-thresh-max' not in rings:
+ raise KsftSkipEx('hds-thresh-max not defined by device')
+ hds_gt = rings['hds-thresh-max'] + 1
+ with ksft_raises(NlError) as e:
+ netnl.rings_set({'header': {'dev-index': cfg.ifindex}, 'hds-thresh': hds_gt})
+ ksft_eq(e.exception.nl_msg.error, -errno.EINVAL)
+
+def main() -> None:
+ with NetDrvEnv(__file__, queue_count=3) as cfg:
+ ksft_run([get_hds,
+ get_hds_thresh,
+ set_hds_disable,
+ set_hds_enable,
+ set_hds_thresh_zero,
+ set_hds_thresh_max,
+ set_hds_thresh_gt],
+ args=(cfg, EthtoolFamily()))
+ ksft_exit()
+
+if __name__ == "__main__":
+ main()
diff --git a/tools/testing/selftests/drivers/net/hw/ncdevmem.c b/tools/testing/selftests/drivers/net/hw/ncdevmem.c
index 8e502a1f8f9b..19a6969643f4 100644
--- a/tools/testing/selftests/drivers/net/hw/ncdevmem.c
+++ b/tools/testing/selftests/drivers/net/hw/ncdevmem.c
@@ -619,9 +619,6 @@ int do_server(struct memory_buffer *mem)
fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n",
page_aligned_frags, non_page_aligned_frags);
- fprintf(stderr, "page_aligned_frags=%lu, non_page_aligned_frags=%lu\n",
- page_aligned_frags, non_page_aligned_frags);
-
cleanup:
free(tmp_mem);
diff --git a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
index 05b6fbb3fcdd..ad192fef3117 100755
--- a/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
+++ b/tools/testing/selftests/drivers/net/hw/pp_alloc_fail.py
@@ -21,9 +21,9 @@ def _enable_pp_allocation_fail():
if not os.path.exists("/sys/kernel/debug/fail_function"):
raise KsftSkipEx("Kernel built without function error injection (or DebugFS)")
- if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"):
+ if not os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"):
with open("/sys/kernel/debug/fail_function/inject", "w") as fp:
- fp.write("page_pool_alloc_pages\n")
+ fp.write("page_pool_alloc_netmems\n")
_write_fail_config({
"verbose": 0,
@@ -37,7 +37,7 @@ def _disable_pp_allocation_fail():
if not os.path.exists("/sys/kernel/debug/fail_function"):
return
- if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_pages"):
+ if os.path.exists("/sys/kernel/debug/fail_function/page_pool_alloc_netmems"):
with open("/sys/kernel/debug/fail_function/inject", "w") as fp:
fp.write("\n")
diff --git a/tools/testing/selftests/drivers/net/hw/rss_ctx.py b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
index 0b49ce7ae678..ca8a7edff3dd 100755
--- a/tools/testing/selftests/drivers/net/hw/rss_ctx.py
+++ b/tools/testing/selftests/drivers/net/hw/rss_ctx.py
@@ -3,7 +3,8 @@
import datetime
import random
-from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt
+import re
+from lib.py import ksft_run, ksft_pr, ksft_exit, ksft_eq, ksft_ne, ksft_ge, ksft_lt, ksft_true
from lib.py import NetDrvEpEnv
from lib.py import EthtoolFamily, NetdevFamily
from lib.py import KsftSkipEx, KsftFailEx
@@ -96,6 +97,13 @@ def _send_traffic_check(cfg, port, name, params):
f"traffic on inactive queues ({name}): " + str(cnts))
+def _ntuple_rule_check(cfg, rule_id, ctx_id):
+ """Check that ntuple rule references RSS context ID"""
+ text = ethtool(f"-n {cfg.ifname} rule {rule_id}").stdout
+ pattern = f"RSS Context (ID: )?{ctx_id}"
+ ksft_true(re.search(pattern, text), "RSS context not referenced in ntuple rule")
+
+
def test_rss_key_indir(cfg):
"""Test basics like updating the main RSS key and indirection table."""
@@ -459,6 +467,8 @@ def test_rss_context(cfg, ctx_cnt=1, create_with_cfg=None):
ntuple = ethtool_create(cfg, "-N", flow)
defer(ethtool, f"-N {cfg.ifname} delete {ntuple}")
+ _ntuple_rule_check(cfg, ntuple, ctx_id)
+
for i in range(ctx_cnt):
_send_traffic_check(cfg, ports[i], f"context {i}",
{ 'target': (2+i*2, 3+i*2),
diff --git a/tools/testing/selftests/drivers/net/lib/py/env.py b/tools/testing/selftests/drivers/net/lib/py/env.py
index 1ea9bb695e94..987e452d3a45 100644
--- a/tools/testing/selftests/drivers/net/lib/py/env.py
+++ b/tools/testing/selftests/drivers/net/lib/py/env.py
@@ -5,7 +5,7 @@ import time
from pathlib import Path
from lib.py import KsftSkipEx, KsftXfailEx
from lib.py import ksft_setup
-from lib.py import cmd, ethtool, ip
+from lib.py import cmd, ethtool, ip, CmdExitFailure
from lib.py import NetNS, NetdevSimDev
from .remote import Remote
@@ -48,6 +48,7 @@ class NetDrvEnv:
else:
self._ns = NetdevSimDev(**kwargs)
self.dev = self._ns.nsims[0].dev
+ self.ifname = self.dev['ifname']
self.ifindex = self.dev['ifindex']
def __enter__(self):
@@ -234,7 +235,12 @@ class NetDrvEpEnv:
Good drivers will tell us via ethtool what their sync period is.
"""
if self._stats_settle_time is None:
- data = ethtool("-c " + self.ifname, json=True)[0]
+ data = {}
+ try:
+ data = ethtool("-c " + self.ifname, json=True)[0]
+ except CmdExitFailure as e:
+ if "Operation not supported" not in e.cmd.stderr:
+ raise
self._stats_settle_time = 0.025 + \
data.get('stats-block-usecs', 0) / 1000 / 1000
diff --git a/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh
new file mode 100644
index 000000000000..3acaba41ac7b
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/lib/sh/lib_netcons.sh
@@ -0,0 +1,225 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+
+# This file contains functions and helpers to support the netconsole
+# selftests
+#
+# Author: Breno Leitao <leitao@debian.org>
+
+set -euo pipefail
+
+LIBDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
+
+SRCIF="" # to be populated later
+SRCIP=192.0.2.1
+DSTIF="" # to be populated later
+DSTIP=192.0.2.2
+
+PORT="6666"
+MSG="netconsole selftest"
+USERDATA_KEY="key"
+USERDATA_VALUE="value"
+TARGET=$(mktemp -u netcons_XXXXX)
+DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk)
+NETCONS_CONFIGFS="/sys/kernel/config/netconsole"
+NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}"
+# NAMESPACE will be populated by setup_ns with a random value
+NAMESPACE=""
+
+# IDs for netdevsim
+NSIM_DEV_1_ID=$((256 + RANDOM % 256))
+NSIM_DEV_2_ID=$((512 + RANDOM % 256))
+NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device"
+
+# Used to create and delete namespaces
+source "${LIBDIR}"/../../../../net/lib.sh
+source "${LIBDIR}"/../../../../net/net_helper.sh
+
+# Create netdevsim interfaces
+create_ifaces() {
+
+ echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW"
+ echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW"
+ udevadm settle 2> /dev/null || true
+
+ local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID"
+ local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID"
+
+ # These are global variables
+ SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \
+ -path "$NSIM1"/net -exec basename {} \;)
+ DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \
+ -path "$NSIM2"/net -exec basename {} \;)
+}
+
+link_ifaces() {
+ local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device"
+ local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex)
+ local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex)
+
+ exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}"
+ exec {INITNS_FD}</proc/self/ns/net
+
+ # Bind the dst interface to namespace
+ ip link set "${DSTIF}" netns "${NAMESPACE}"
+
+ # Linking one device to the other one (on the other namespace}
+ if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK
+ then
+ echo "linking netdevsim1 with netdevsim2 should succeed"
+ cleanup
+ exit "${ksft_skip}"
+ fi
+}
+
+function configure_ip() {
+ # Configure the IPs for both interfaces
+ ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}"
+ ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up
+
+ ip addr add "${SRCIP}"/24 dev "${SRCIF}"
+ ip link set "${SRCIF}" up
+}
+
+function set_network() {
+ # setup_ns function is coming from lib.sh
+ setup_ns NAMESPACE
+
+ # Create both interfaces, and assign the destination to a different
+ # namespace
+ create_ifaces
+
+ # Link both interfaces back to back
+ link_ifaces
+
+ configure_ip
+}
+
+function create_dynamic_target() {
+ DSTMAC=$(ip netns exec "${NAMESPACE}" \
+ ip link show "${DSTIF}" | awk '/ether/ {print $2}')
+
+ # Create a dynamic target
+ mkdir "${NETCONS_PATH}"
+
+ echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip
+ echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip
+ echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac
+ echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name
+
+ echo 1 > "${NETCONS_PATH}"/enabled
+}
+
+function cleanup() {
+ local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device"
+
+ # delete netconsole dynamic reconfiguration
+ echo 0 > "${NETCONS_PATH}"/enabled
+ # Remove all the keys that got created during the selftest
+ find "${NETCONS_PATH}/userdata/" -mindepth 1 -type d -delete
+ # Remove the configfs entry
+ rmdir "${NETCONS_PATH}"
+
+ # Delete netdevsim devices
+ echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL"
+ echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL"
+
+ # this is coming from lib.sh
+ cleanup_all_ns
+
+ # Restoring printk configurations
+ echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk
+}
+
+function set_user_data() {
+ if [[ ! -d "${NETCONS_PATH}""/userdata" ]]
+ then
+ echo "Userdata path not available in ${NETCONS_PATH}/userdata"
+ exit "${ksft_skip}"
+ fi
+
+ KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}"
+ mkdir -p "${KEY_PATH}"
+ VALUE_PATH="${KEY_PATH}""/value"
+ echo "${USERDATA_VALUE}" > "${VALUE_PATH}"
+}
+
+function listen_port_and_save_to() {
+ local OUTPUT=${1}
+ # Just wait for 2 seconds
+ timeout 2 ip netns exec "${NAMESPACE}" \
+ socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}"
+}
+
+function validate_result() {
+ local TMPFILENAME="$1"
+
+ # TMPFILENAME will contain something like:
+ # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM
+ # key=value
+
+ # Check if the file exists
+ if [ ! -f "$TMPFILENAME" ]; then
+ echo "FAIL: File was not generated." >&2
+ exit "${ksft_fail}"
+ fi
+
+ if ! grep -q "${MSG}" "${TMPFILENAME}"; then
+ echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2
+ cat "${TMPFILENAME}" >&2
+ exit "${ksft_fail}"
+ fi
+
+ if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then
+ echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2
+ cat "${TMPFILENAME}" >&2
+ exit "${ksft_fail}"
+ fi
+
+ # Delete the file once it is validated, otherwise keep it
+ # for debugging purposes
+ rm "${TMPFILENAME}"
+ exit "${ksft_pass}"
+}
+
+function check_for_dependencies() {
+ if [ "$(id -u)" -ne 0 ]; then
+ echo "This test must be run as root" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which socat > /dev/null ; then
+ echo "SKIP: socat(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which ip > /dev/null ; then
+ echo "SKIP: ip(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ! which udevadm > /dev/null ; then
+ echo "SKIP: udevadm(1) is not available" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then
+ echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if [ ! -d "${NETCONS_CONFIGFS}" ]; then
+ echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ip link show "${DSTIF}" 2> /dev/null; then
+ echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2
+ exit "${ksft_skip}"
+ fi
+
+ if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then
+ echo "SKIP: IPs already in use. Skipping it" >&2
+ exit "${ksft_skip}"
+ fi
+}
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
index b79542a4dcc7..4a11bf1d514a 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_bridge.sh
@@ -12,6 +12,7 @@ ALL_TESTS="
bridge_rif_remaster_port
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
index e28f978104f3..b8bbe94f4736 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag.sh
@@ -10,6 +10,7 @@ ALL_TESTS="
lag_rif_nomaster_addr
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
index 6318cfa6434c..d1a9d379eaf3 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/rif_lag_vlan.sh
@@ -10,6 +10,7 @@ ALL_TESTS="
lag_rif_nomaster_addr
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/devlink_lib.sh
diff --git a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
index 0c47faff9274..c068e6c2a580 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/sharedbuffer.sh
@@ -22,20 +22,34 @@ SB_ITC=0
h1_create()
{
simple_if_init $h1 192.0.1.1/24
+ tc qdisc add dev $h1 clsact
+
+ # Add egress filter on $h1 that will guarantee that the packet sent,
+ # will be the only packet being passed to the device.
+ tc filter add dev $h1 egress pref 2 handle 102 matchall action drop
}
h1_destroy()
{
+ tc filter del dev $h1 egress pref 2 handle 102 matchall action drop
+ tc qdisc del dev $h1 clsact
simple_if_fini $h1 192.0.1.1/24
}
h2_create()
{
simple_if_init $h2 192.0.1.2/24
+ tc qdisc add dev $h2 clsact
+
+ # Add egress filter on $h2 that will guarantee that the packet sent,
+ # will be the only packet being passed to the device.
+ tc filter add dev $h2 egress pref 1 handle 101 matchall action drop
}
h2_destroy()
{
+ tc filter del dev $h2 egress pref 1 handle 101 matchall action drop
+ tc qdisc del dev $h2 clsact
simple_if_fini $h2 192.0.1.2/24
}
@@ -101,6 +115,11 @@ port_pool_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \
@@ -109,11 +128,6 @@ port_pool_test()
devlink sb occupancy snapshot $DEVLINK_DEV
RET=0
- max_occ=$(sb_occ_pool_check $dl_port1 $SB_POOL_ING $exp_max_occ)
- check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress pool"
-
- RET=0
max_occ=$(sb_occ_pool_check $dl_port2 $SB_POOL_ING $exp_max_occ)
check_err $? "Expected iPool($SB_POOL_ING) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress pool"
@@ -122,6 +136,11 @@ port_pool_test()
max_occ=$(sb_occ_pool_check $cpu_dl_port $SB_POOL_EGR_CPU $exp_max_occ)
check_err $? "Expected ePool($SB_POOL_EGR_CPU) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress pool"
+
+ tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
}
port_tc_ip_test()
@@ -129,6 +148,11 @@ port_tc_ip_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -b $h2mac -A 192.0.1.1 -B 192.0.1.2 \
@@ -139,17 +163,17 @@ port_tc_ip_test()
RET=0
max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress TC - IP packet"
-
- RET=0
- max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
- check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress TC - IP packet"
RET=0
max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_IP $exp_max_occ)
check_err $? "Expected egress TC($SB_ITC_CPU_IP) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress TC - IP packet"
+
+ tc filter del dev $h1 egress protocol ip pref 1 handle 101 flower \
+ src_mac $h1mac dst_mac $h2mac \
+ src_ip 192.0.1.1 dst_ip 192.0.1.2 \
+ action pass
}
port_tc_arp_test()
@@ -157,6 +181,9 @@ port_tc_arp_test()
local exp_max_occ=$(devlink_cell_size_get)
local max_occ
+ tc filter add dev $h1 egress protocol arp pref 1 handle 101 flower \
+ src_mac $h1mac action pass
+
devlink sb occupancy clearmax $DEVLINK_DEV
$MZ $h1 -c 1 -p 10 -a $h1mac -A 192.0.1.1 -t arp -q
@@ -166,17 +193,15 @@ port_tc_arp_test()
RET=0
max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
- log_test "physical port's($h1) ingress TC - ARP packet"
-
- RET=0
- max_occ=$(sb_occ_itc_check $dl_port2 $SB_ITC $exp_max_occ)
- check_err $? "Expected ingress TC($SB_ITC) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "physical port's($h2) ingress TC - ARP packet"
RET=0
max_occ=$(sb_occ_etc_check $cpu_dl_port $SB_ITC_CPU_ARP $exp_max_occ)
check_err $? "Expected egress TC($SB_ITC_IP2ME) max occupancy to be $exp_max_occ, but got $max_occ"
log_test "CPU port's egress TC - ARP packet"
+
+ tc filter del dev $h1 egress protocol arp pref 1 handle 101 flower \
+ src_mac $h1mac action pass
}
setup_prepare()
diff --git a/tools/testing/selftests/drivers/net/netcons_basic.sh b/tools/testing/selftests/drivers/net/netcons_basic.sh
index b175f4d966e5..fe765da498e8 100755
--- a/tools/testing/selftests/drivers/net/netcons_basic.sh
+++ b/tools/testing/selftests/drivers/net/netcons_basic.sh
@@ -18,224 +18,8 @@ set -euo pipefail
SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
-# Simple script to test dynamic targets in netconsole
-SRCIF="" # to be populated later
-SRCIP=192.0.2.1
-DSTIF="" # to be populated later
-DSTIP=192.0.2.2
+source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh
-PORT="6666"
-MSG="netconsole selftest"
-USERDATA_KEY="key"
-USERDATA_VALUE="value"
-TARGET=$(mktemp -u netcons_XXXXX)
-DEFAULT_PRINTK_VALUES=$(cat /proc/sys/kernel/printk)
-NETCONS_CONFIGFS="/sys/kernel/config/netconsole"
-NETCONS_PATH="${NETCONS_CONFIGFS}"/"${TARGET}"
-KEY_PATH="${NETCONS_PATH}/userdata/${USERDATA_KEY}"
-# NAMESPACE will be populated by setup_ns with a random value
-NAMESPACE=""
-
-# IDs for netdevsim
-NSIM_DEV_1_ID=$((256 + RANDOM % 256))
-NSIM_DEV_2_ID=$((512 + RANDOM % 256))
-NSIM_DEV_SYS_NEW="/sys/bus/netdevsim/new_device"
-
-# Used to create and delete namespaces
-source "${SCRIPTDIR}"/../../net/lib.sh
-source "${SCRIPTDIR}"/../../net/net_helper.sh
-
-# Create netdevsim interfaces
-create_ifaces() {
-
- echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_NEW"
- echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_NEW"
- udevadm settle 2> /dev/null || true
-
- local NSIM1=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_1_ID"
- local NSIM2=/sys/bus/netdevsim/devices/netdevsim"$NSIM_DEV_2_ID"
-
- # These are global variables
- SRCIF=$(find "$NSIM1"/net -maxdepth 1 -type d ! \
- -path "$NSIM1"/net -exec basename {} \;)
- DSTIF=$(find "$NSIM2"/net -maxdepth 1 -type d ! \
- -path "$NSIM2"/net -exec basename {} \;)
-}
-
-link_ifaces() {
- local NSIM_DEV_SYS_LINK="/sys/bus/netdevsim/link_device"
- local SRCIF_IFIDX=$(cat /sys/class/net/"$SRCIF"/ifindex)
- local DSTIF_IFIDX=$(cat /sys/class/net/"$DSTIF"/ifindex)
-
- exec {NAMESPACE_FD}</var/run/netns/"${NAMESPACE}"
- exec {INITNS_FD}</proc/self/ns/net
-
- # Bind the dst interface to namespace
- ip link set "${DSTIF}" netns "${NAMESPACE}"
-
- # Linking one device to the other one (on the other namespace}
- if ! echo "${INITNS_FD}:$SRCIF_IFIDX $NAMESPACE_FD:$DSTIF_IFIDX" > $NSIM_DEV_SYS_LINK
- then
- echo "linking netdevsim1 with netdevsim2 should succeed"
- cleanup
- exit "${ksft_skip}"
- fi
-}
-
-function configure_ip() {
- # Configure the IPs for both interfaces
- ip netns exec "${NAMESPACE}" ip addr add "${DSTIP}"/24 dev "${DSTIF}"
- ip netns exec "${NAMESPACE}" ip link set "${DSTIF}" up
-
- ip addr add "${SRCIP}"/24 dev "${SRCIF}"
- ip link set "${SRCIF}" up
-}
-
-function set_network() {
- # setup_ns function is coming from lib.sh
- setup_ns NAMESPACE
-
- # Create both interfaces, and assign the destination to a different
- # namespace
- create_ifaces
-
- # Link both interfaces back to back
- link_ifaces
-
- configure_ip
-}
-
-function create_dynamic_target() {
- DSTMAC=$(ip netns exec "${NAMESPACE}" \
- ip link show "${DSTIF}" | awk '/ether/ {print $2}')
-
- # Create a dynamic target
- mkdir "${NETCONS_PATH}"
-
- echo "${DSTIP}" > "${NETCONS_PATH}"/remote_ip
- echo "${SRCIP}" > "${NETCONS_PATH}"/local_ip
- echo "${DSTMAC}" > "${NETCONS_PATH}"/remote_mac
- echo "${SRCIF}" > "${NETCONS_PATH}"/dev_name
-
- echo 1 > "${NETCONS_PATH}"/enabled
-}
-
-function cleanup() {
- local NSIM_DEV_SYS_DEL="/sys/bus/netdevsim/del_device"
-
- # delete netconsole dynamic reconfiguration
- echo 0 > "${NETCONS_PATH}"/enabled
- # Remove key
- rmdir "${KEY_PATH}"
- # Remove the configfs entry
- rmdir "${NETCONS_PATH}"
-
- # Delete netdevsim devices
- echo "$NSIM_DEV_2_ID" > "$NSIM_DEV_SYS_DEL"
- echo "$NSIM_DEV_1_ID" > "$NSIM_DEV_SYS_DEL"
-
- # this is coming from lib.sh
- cleanup_all_ns
-
- # Restoring printk configurations
- echo "${DEFAULT_PRINTK_VALUES}" > /proc/sys/kernel/printk
-}
-
-function set_user_data() {
- if [[ ! -d "${NETCONS_PATH}""/userdata" ]]
- then
- echo "Userdata path not available in ${NETCONS_PATH}/userdata"
- exit "${ksft_skip}"
- fi
-
- mkdir -p "${KEY_PATH}"
- VALUE_PATH="${KEY_PATH}""/value"
- echo "${USERDATA_VALUE}" > "${VALUE_PATH}"
-}
-
-function listen_port_and_save_to() {
- local OUTPUT=${1}
- # Just wait for 2 seconds
- timeout 2 ip netns exec "${NAMESPACE}" \
- socat UDP-LISTEN:"${PORT}",fork "${OUTPUT}"
-}
-
-function validate_result() {
- local TMPFILENAME="$1"
-
- # TMPFILENAME will contain something like:
- # 6.11.1-0_fbk0_rc13_509_g30d75cea12f7,13,1822,115075213798,-;netconsole selftest: netcons_gtJHM
- # key=value
-
- # Check if the file exists
- if [ ! -f "$TMPFILENAME" ]; then
- echo "FAIL: File was not generated." >&2
- exit "${ksft_fail}"
- fi
-
- if ! grep -q "${MSG}" "${TMPFILENAME}"; then
- echo "FAIL: ${MSG} not found in ${TMPFILENAME}" >&2
- cat "${TMPFILENAME}" >&2
- exit "${ksft_fail}"
- fi
-
- if ! grep -q "${USERDATA_KEY}=${USERDATA_VALUE}" "${TMPFILENAME}"; then
- echo "FAIL: ${USERDATA_KEY}=${USERDATA_VALUE} not found in ${TMPFILENAME}" >&2
- cat "${TMPFILENAME}" >&2
- exit "${ksft_fail}"
- fi
-
- # Delete the file once it is validated, otherwise keep it
- # for debugging purposes
- rm "${TMPFILENAME}"
- exit "${ksft_pass}"
-}
-
-function check_for_dependencies() {
- if [ "$(id -u)" -ne 0 ]; then
- echo "This test must be run as root" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which socat > /dev/null ; then
- echo "SKIP: socat(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which ip > /dev/null ; then
- echo "SKIP: ip(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if ! which udevadm > /dev/null ; then
- echo "SKIP: udevadm(1) is not available" >&2
- exit "${ksft_skip}"
- fi
-
- if [ ! -f "${NSIM_DEV_SYS_NEW}" ]; then
- echo "SKIP: file ${NSIM_DEV_SYS_NEW} does not exist. Check if CONFIG_NETDEVSIM is enabled" >&2
- exit "${ksft_skip}"
- fi
-
- if [ ! -d "${NETCONS_CONFIGFS}" ]; then
- echo "SKIP: directory ${NETCONS_CONFIGFS} does not exist. Check if NETCONSOLE_DYNAMIC is enabled" >&2
- exit "${ksft_skip}"
- fi
-
- if ip link show "${DSTIF}" 2> /dev/null; then
- echo "SKIP: interface ${DSTIF} exists in the system. Not overwriting it." >&2
- exit "${ksft_skip}"
- fi
-
- if ip addr list | grep -E "inet.*(${SRCIP}|${DSTIP})" 2> /dev/null; then
- echo "SKIP: IPs already in use. Skipping it" >&2
- exit "${ksft_skip}"
- fi
-}
-
-# ========== #
-# Start here #
-# ========== #
modprobe netdevsim 2> /dev/null || true
modprobe netconsole 2> /dev/null || true
diff --git a/tools/testing/selftests/drivers/net/netcons_overflow.sh b/tools/testing/selftests/drivers/net/netcons_overflow.sh
new file mode 100755
index 000000000000..29bad56448a2
--- /dev/null
+++ b/tools/testing/selftests/drivers/net/netcons_overflow.sh
@@ -0,0 +1,67 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+
+# This test verifies that users can successfully create up to
+# MAX_USERDATA_ITEMS userdata entries without encountering any failures.
+#
+# Additionally, it tests for expected failure when attempting to exceed this
+# maximum limit.
+#
+# Author: Breno Leitao <leitao@debian.org>
+
+set -euo pipefail
+
+SCRIPTDIR=$(dirname "$(readlink -e "${BASH_SOURCE[0]}")")
+
+source "${SCRIPTDIR}"/lib/sh/lib_netcons.sh
+# This is coming from netconsole code. Check for it in drivers/net/netconsole.c
+MAX_USERDATA_ITEMS=16
+
+# Function to create userdata entries
+function create_userdata_max_entries() {
+ # All these keys should be created without any error
+ for i in $(seq $MAX_USERDATA_ITEMS)
+ do
+ # USERDATA_KEY is used by set_user_data
+ USERDATA_KEY="key"${i}
+ set_user_data
+ done
+}
+
+# Function to verify the entry limit
+function verify_entry_limit() {
+ # Allowing the test to fail without exiting, since the next command
+ # will fail
+ set +e
+ mkdir "${NETCONS_PATH}/userdata/key_that_will_fail" 2> /dev/null
+ ret="$?"
+ set -e
+ if [ "$ret" -eq 0 ];
+ then
+ echo "Adding more than ${MAX_USERDATA_ITEMS} entries in userdata should fail, but it didn't" >&2
+ ls "${NETCONS_PATH}/userdata/" >&2
+ exit "${ksft_fail}"
+ fi
+}
+
+# ========== #
+# Start here #
+# ========== #
+
+modprobe netdevsim 2> /dev/null || true
+modprobe netconsole 2> /dev/null || true
+
+# Check for basic system dependency and exit if not found
+check_for_dependencies
+
+# Remove the namespace, interfaces and netconsole target on exit
+trap cleanup EXIT
+# Create one namespace and two interfaces
+set_network
+# Create a dynamic target for netconsole
+create_dynamic_target
+# populate the maximum number of supported keys in userdata
+create_userdata_max_entries
+# Verify an additional entry is not allowed
+verify_entry_limit
+exit "${ksft_pass}"
diff --git a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
index fd13c8cfb7a8..b411fe66510f 100755
--- a/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
+++ b/tools/testing/selftests/drivers/net/netdevsim/tc-mq-visibility.sh
@@ -58,9 +58,12 @@ for root in mq mqprio; do
ethtool -L $NDEV combined 4
n_child_assert 4 "One real queue, rest default"
- # Graft some
- tcq replace parent 100:1 handle 204:
- n_child_assert 3 "Grafted"
+ # Remove real one
+ tcq del parent 100:4 handle 204:
+
+ # Replace default with pfifo
+ tcq replace parent 100:1 handle 205: pfifo limit 1000
+ n_child_assert 3 "Deleting real one, replacing default one with pfifo"
ethtool -L $NDEV combined 1
n_child_assert 1 "Grafted, one"
diff --git a/tools/testing/selftests/drivers/net/queues.py b/tools/testing/selftests/drivers/net/queues.py
index 30f29096e27c..38303da957ee 100755
--- a/tools/testing/selftests/drivers/net/queues.py
+++ b/tools/testing/selftests/drivers/net/queues.py
@@ -1,32 +1,37 @@
#!/usr/bin/env python3
# SPDX-License-Identifier: GPL-2.0
-from lib.py import ksft_run, ksft_exit, ksft_eq, KsftSkipEx
-from lib.py import EthtoolFamily, NetdevFamily
+from lib.py import ksft_disruptive, ksft_exit, ksft_run
+from lib.py import ksft_eq, ksft_raises, KsftSkipEx
+from lib.py import EthtoolFamily, NetdevFamily, NlError
from lib.py import NetDrvEnv
-from lib.py import cmd
+from lib.py import cmd, defer, ip
+import errno
import glob
-def sys_get_queues(ifname) -> int:
- folders = glob.glob(f'/sys/class/net/{ifname}/queues/rx-*')
+def sys_get_queues(ifname, qtype='rx') -> int:
+ folders = glob.glob(f'/sys/class/net/{ifname}/queues/{qtype}-*')
return len(folders)
-def nl_get_queues(cfg, nl):
+def nl_get_queues(cfg, nl, qtype='rx'):
queues = nl.queue_get({'ifindex': cfg.ifindex}, dump=True)
if queues:
- return len([q for q in queues if q['type'] == 'rx'])
+ return len([q for q in queues if q['type'] == qtype])
return None
def get_queues(cfg, nl) -> None:
- queues = nl_get_queues(cfg, nl)
- if not queues:
- raise KsftSkipEx('queue-get not supported by device')
+ snl = NetdevFamily(recv_size=4096)
- expected = sys_get_queues(cfg.dev['ifname'])
- ksft_eq(queues, expected)
+ for qtype in ['rx', 'tx']:
+ queues = nl_get_queues(cfg, snl, qtype)
+ if not queues:
+ raise KsftSkipEx('queue-get not supported by device')
+
+ expected = sys_get_queues(cfg.dev['ifname'], qtype)
+ ksft_eq(queues, expected)
def addremove_queues(cfg, nl) -> None:
@@ -56,9 +61,27 @@ def addremove_queues(cfg, nl) -> None:
ksft_eq(queues, expected)
+@ksft_disruptive
+def check_down(cfg, nl) -> None:
+ # Check the NAPI IDs before interface goes down and hides them
+ napis = nl.napi_get({'ifindex': cfg.ifindex}, dump=True)
+
+ ip(f"link set dev {cfg.dev['ifname']} down")
+ defer(ip, f"link set dev {cfg.dev['ifname']} up")
+
+ with ksft_raises(NlError) as cm:
+ nl.queue_get({'ifindex': cfg.ifindex, 'id': 0, 'type': 'rx'})
+ ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT)
+
+ if napis:
+ with ksft_raises(NlError) as cm:
+ nl.napi_get({'id': napis[0]['id']})
+ ksft_eq(cm.exception.nl_msg.error, -errno.ENOENT)
+
+
def main() -> None:
- with NetDrvEnv(__file__, queue_count=3) as cfg:
- ksft_run([get_queues, addremove_queues], args=(cfg, NetdevFamily()))
+ with NetDrvEnv(__file__, queue_count=100) as cfg:
+ ksft_run([get_queues, addremove_queues, check_down], args=(cfg, NetdevFamily()))
ksft_exit()
diff --git a/tools/testing/selftests/drivers/net/stats.py b/tools/testing/selftests/drivers/net/stats.py
index 63e3c045a3b2..efcc1e10575b 100755
--- a/tools/testing/selftests/drivers/net/stats.py
+++ b/tools/testing/selftests/drivers/net/stats.py
@@ -2,12 +2,15 @@
# SPDX-License-Identifier: GPL-2.0
import errno
+import subprocess
+import time
from lib.py import ksft_run, ksft_exit, ksft_pr
-from lib.py import ksft_ge, ksft_eq, ksft_in, ksft_true, ksft_raises, KsftSkipEx, KsftXfailEx
+from lib.py import ksft_ge, ksft_eq, ksft_is, ksft_in, ksft_lt, ksft_true, ksft_raises
+from lib.py import KsftSkipEx, KsftXfailEx
from lib.py import ksft_disruptive
from lib.py import EthtoolFamily, NetdevFamily, RtnlFamily, NlError
from lib.py import NetDrvEnv
-from lib.py import ip, defer
+from lib.py import cmd, ip, defer
ethnl = EthtoolFamily()
netfam = NetdevFamily()
@@ -110,6 +113,23 @@ def qstat_by_ifindex(cfg) -> None:
ksft_ge(triple[1][key], triple[0][key], comment="bad key: " + key)
ksft_ge(triple[2][key], triple[1][key], comment="bad key: " + key)
+ # Sanity check the dumps
+ queues = NetdevFamily(recv_size=4096).qstats_get({"scope": "queue"}, dump=True)
+ # Reformat the output into {ifindex: {rx: [id, id, ...], tx: [id, id, ...]}}
+ parsed = {}
+ for entry in queues:
+ ifindex = entry["ifindex"]
+ if ifindex not in parsed:
+ parsed[ifindex] = {"rx":[], "tx": []}
+ parsed[ifindex][entry["queue-type"]].append(entry['queue-id'])
+ # Now, validate
+ for ifindex, queues in parsed.items():
+ for qtype in ['rx', 'tx']:
+ ksft_eq(len(queues[qtype]), len(set(queues[qtype])),
+ comment="repeated queue keys")
+ ksft_eq(len(queues[qtype]), max(queues[qtype]) + 1,
+ comment="missing queue keys")
+
# Test invalid dumps
# 0 is invalid
with ksft_raises(NlError) as cm:
@@ -157,10 +177,95 @@ def check_down(cfg) -> None:
netfam.qstats_get({"ifindex": cfg.ifindex, "scope": "queue"}, dump=True)
+def __run_inf_loop(body):
+ body = body.strip()
+ if body[-1] != ';':
+ body += ';'
+
+ return subprocess.Popen(f"while true; do {body} done", shell=True,
+ stdout=subprocess.PIPE, stderr=subprocess.PIPE)
+
+
+def __stats_increase_sanely(old, new) -> None:
+ for k in old.keys():
+ ksft_ge(new[k], old[k])
+ ksft_lt(new[k] - old[k], 1 << 31, comment="likely wrapping error")
+
+
+def procfs_hammer(cfg) -> None:
+ """
+ Reading stats via procfs only holds the RCU lock, which is not an exclusive
+ lock, make sure drivers can handle parallel reads of stats.
+ """
+ one = __run_inf_loop("cat /proc/net/dev")
+ defer(one.kill)
+ two = __run_inf_loop("cat /proc/net/dev")
+ defer(two.kill)
+
+ time.sleep(1)
+ # Make sure the processes are running
+ ksft_is(one.poll(), None)
+ ksft_is(two.poll(), None)
+
+ rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ time.sleep(2)
+ rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ __stats_increase_sanely(rtstat1, rtstat2)
+ # defers will kill the loops
+
+
+@ksft_disruptive
+def procfs_downup_hammer(cfg) -> None:
+ """
+ Reading stats via procfs only holds the RCU lock, drivers often try
+ to sleep when reading the stats, or don't protect against races.
+ """
+ # Max out the queues, we'll flip between max and 1
+ channels = ethnl.channels_get({'header': {'dev-index': cfg.ifindex}})
+ if channels['combined-count'] == 0:
+ rx_type = 'rx'
+ else:
+ rx_type = 'combined'
+ cur_queue_cnt = channels[f'{rx_type}-count']
+ max_queue_cnt = channels[f'{rx_type}-max']
+
+ cmd(f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}")
+ defer(cmd, f"ethtool -L {cfg.ifname} {rx_type} {cur_queue_cnt}")
+
+ # Real test stats
+ stats = __run_inf_loop("cat /proc/net/dev")
+ defer(stats.kill)
+
+ ipset = f"ip link set dev {cfg.ifname}"
+ defer(ip, f"link set dev {cfg.ifname} up")
+ # The "echo -n 1" lets us count iterations below
+ updown = f"{ipset} down; sleep 0.05; {ipset} up; sleep 0.05; " + \
+ f"ethtool -L {cfg.ifname} {rx_type} 1; " + \
+ f"ethtool -L {cfg.ifname} {rx_type} {max_queue_cnt}; " + \
+ "echo -n 1"
+ updown = __run_inf_loop(updown)
+ kill_updown = defer(updown.kill)
+
+ time.sleep(1)
+ # Make sure the processes are running
+ ksft_is(stats.poll(), None)
+ ksft_is(updown.poll(), None)
+
+ rtstat1 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ # We're looking for crashes, give it extra time
+ time.sleep(9)
+ rtstat2 = rtnl.getlink({"ifi-index": cfg.ifindex})['stats64']
+ __stats_increase_sanely(rtstat1, rtstat2)
+
+ kill_updown.exec()
+ stdout, _ = updown.communicate(timeout=5)
+ ksft_pr("completed up/down cycles:", len(stdout.decode('utf-8')))
+
+
def main() -> None:
- with NetDrvEnv(__file__) as cfg:
+ with NetDrvEnv(__file__, queue_count=100) as cfg:
ksft_run([check_pause, check_fec, pkt_byte_sum, qstat_by_ifindex,
- check_down],
+ check_down, procfs_hammer, procfs_downup_hammer],
args=(cfg, ))
ksft_exit()
diff --git a/tools/testing/selftests/exec/.gitignore b/tools/testing/selftests/exec/.gitignore
index a0dc5d4bf733..7f3d1ae762ec 100644
--- a/tools/testing/selftests/exec/.gitignore
+++ b/tools/testing/selftests/exec/.gitignore
@@ -9,9 +9,13 @@ execveat.ephemeral
execveat.denatured
non-regular
null-argv
+/check-exec
+/false
+/inc
/load_address.*
!load_address.c
/recursion-depth
+/set-exec
xxxxxxxx*
pipe
S_I*.test
diff --git a/tools/testing/selftests/exec/Makefile b/tools/testing/selftests/exec/Makefile
index ba012bc5aab9..45a3cfc435cf 100644
--- a/tools/testing/selftests/exec/Makefile
+++ b/tools/testing/selftests/exec/Makefile
@@ -1,26 +1,33 @@
# SPDX-License-Identifier: GPL-2.0
CFLAGS = -Wall
CFLAGS += -Wno-nonnull
+CFLAGS += $(KHDR_INCLUDES)
+
+LDLIBS += -lcap
ALIGNS := 0x1000 0x200000 0x1000000
ALIGN_PIES := $(patsubst %,load_address.%,$(ALIGNS))
ALIGN_STATIC_PIES := $(patsubst %,load_address.static.%,$(ALIGNS))
ALIGNMENT_TESTS := $(ALIGN_PIES) $(ALIGN_STATIC_PIES)
-TEST_PROGS := binfmt_script.py
+TEST_PROGS := binfmt_script.py check-exec-tests.sh
TEST_GEN_PROGS := execveat non-regular $(ALIGNMENT_TESTS)
+TEST_GEN_PROGS_EXTENDED := false inc set-exec script-exec.inc script-noexec.inc
TEST_GEN_FILES := execveat.symlink execveat.denatured script subdir
# Makefile is a run-time dependency, since it's accessed by the execveat test
TEST_FILES := Makefile
TEST_GEN_PROGS += recursion-depth
TEST_GEN_PROGS += null-argv
+TEST_GEN_PROGS += check-exec
EXTRA_CLEAN := $(OUTPUT)/subdir.moved $(OUTPUT)/execveat.moved $(OUTPUT)/xxxxx* \
$(OUTPUT)/S_I*.test
include ../lib.mk
+CHECK_EXEC_SAMPLES := $(top_srcdir)/samples/check-exec
+
$(OUTPUT)/subdir:
mkdir -p $@
$(OUTPUT)/script: Makefile
@@ -38,3 +45,13 @@ $(OUTPUT)/load_address.0x%: load_address.c
$(OUTPUT)/load_address.static.0x%: load_address.c
$(CC) $(CFLAGS) $(LDFLAGS) -Wl,-z,max-page-size=$(lastword $(subst ., ,$@)) \
-fPIE -static-pie $< -o $@
+$(OUTPUT)/false: false.c
+ $(CC) $(CFLAGS) $(LDFLAGS) -static $< -o $@
+$(OUTPUT)/inc: $(CHECK_EXEC_SAMPLES)/inc.c
+ $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@
+$(OUTPUT)/set-exec: $(CHECK_EXEC_SAMPLES)/set-exec.c
+ $(CC) $(CFLAGS) $(LDFLAGS) $< -o $@
+$(OUTPUT)/script-exec.inc: $(CHECK_EXEC_SAMPLES)/script-exec.inc
+ cp $< $@
+$(OUTPUT)/script-noexec.inc: $(CHECK_EXEC_SAMPLES)/script-noexec.inc
+ cp $< $@
diff --git a/tools/testing/selftests/exec/check-exec-tests.sh b/tools/testing/selftests/exec/check-exec-tests.sh
new file mode 100755
index 000000000000..87102906ae3c
--- /dev/null
+++ b/tools/testing/selftests/exec/check-exec-tests.sh
@@ -0,0 +1,205 @@
+#!/usr/bin/env bash
+# SPDX-License-Identifier: GPL-2.0
+#
+# Test the "inc" interpreter.
+#
+# See include/uapi/linux/securebits.h, include/uapi/linux/fcntl.h and
+# samples/check-exec/inc.c
+#
+# Copyright © 2024 Microsoft Corporation
+
+set -u -e -o pipefail
+
+EXPECTED_OUTPUT="1"
+exec 2>/dev/null
+
+DIR="$(dirname $(readlink -f "$0"))"
+source "${DIR}"/../kselftest/ktap_helpers.sh
+
+exec_direct() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Updates PATH for `env` to execute the `inc` interpreter.
+ out="$(PATH="." "$@" "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for direct file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for direct file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_indirect() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Script passed as argument.
+ out="$("$@" ./inc "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for indirect file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for indirect file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_stdin_reg() {
+ local expect="$1"
+ local script="$2"
+ shift 2
+ local ret=0
+ local out
+
+ # Executing stdin must be allowed if the related file is executable.
+ out="$("$@" ./inc -i < "${script}")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for stdin regular file execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for stdin regular file execution: ${out}"
+ return 1
+ fi
+}
+
+exec_stdin_pipe() {
+ local expect="$1"
+ shift
+ local ret=0
+ local out
+
+ # A pipe is not executable.
+ out="$(cat script-exec.inc | "$@" ./inc -i)" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for stdin pipe execution: ${ret}"
+ return 1
+ fi
+}
+
+exec_argument() {
+ local expect="$1"
+ local ret=0
+ shift
+ local out
+
+ # Script not coming from a file must not be executed.
+ out="$("$@" ./inc -c "$(< script-exec.inc)")" || ret=$?
+
+ if [[ ${ret} -ne ${expect} ]]; then
+ echo "ERROR: Wrong expectation for arbitrary argument execution: ${ret}"
+ return 1
+ fi
+ if [[ ${ret} -eq 0 && "${out}" != "${EXPECTED_OUTPUT}" ]]; then
+ echo "ERROR: Wrong output for arbitrary argument execution: ${out}"
+ return 1
+ fi
+}
+
+exec_interactive() {
+ exec_stdin_pipe "$@"
+ exec_argument "$@"
+}
+
+ktap_test() {
+ ktap_test_result "$*" "$@"
+}
+
+ktap_print_header
+ktap_set_plan 28
+
+# Without secbit configuration, nothing is changed.
+
+ktap_print_msg "By default, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc
+ktap_test exec_indirect 0 script-exec.inc
+
+ktap_print_msg "By default, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc
+
+ktap_print_msg "By default, non-executable scripts are allowed to be interpreted, but not directly executed."
+# We get 126 because of direct execution by Bash.
+ktap_test exec_direct 126 script-noexec.inc
+ktap_test exec_indirect 0 script-noexec.inc
+
+ktap_print_msg "By default, non-executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-noexec.inc
+
+ktap_print_msg "By default, interactive commands are allowed to be interpreted."
+ktap_test exec_interactive 0
+
+# With only file restriction: protect non-malicious users from inadvertent errors (e.g. python ~/Downloads/*.py).
+
+ktap_print_msg "With -f, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -f --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, non-executable scripts are not allowed to be executed nor interpreted."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -f --
+ktap_test exec_indirect 1 script-noexec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, non-executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-noexec.inc ./set-exec -f --
+
+ktap_print_msg "With -f, interactive commands are allowed to be interpreted."
+ktap_test exec_interactive 0 ./set-exec -f --
+
+# With only denied interactive commands: check or monitor script content (e.g. with LSM).
+
+ktap_print_msg "With -i, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -i --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, non-executable scripts are allowed to be interpreted, but not directly executed."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -i --
+ktap_test exec_indirect 0 script-noexec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, non-executable stdin is not allowed to be interpreted."
+ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -i --
+
+ktap_print_msg "With -i, interactive commands are not allowed to be interpreted."
+ktap_test exec_interactive 1 ./set-exec -i --
+
+# With both file restriction and denied interactive commands: only allow executable scripts.
+
+ktap_print_msg "With -fi, executable scripts are allowed to be interpreted and executed."
+ktap_test exec_direct 0 script-exec.inc ./set-exec -fi --
+ktap_test exec_indirect 0 script-exec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, executable stdin is allowed to be interpreted."
+ktap_test exec_stdin_reg 0 script-exec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, non-executable scripts are not allowed to be interpreted nor executed."
+# Direct execution of non-executable script is alwayse denied by the kernel.
+ktap_test exec_direct 1 script-noexec.inc ./set-exec -fi --
+ktap_test exec_indirect 1 script-noexec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, non-executable stdin is not allowed to be interpreted."
+ktap_test exec_stdin_reg 1 script-noexec.inc ./set-exec -fi --
+
+ktap_print_msg "With -fi, interactive commands are not allowed to be interpreted."
+ktap_test exec_interactive 1 ./set-exec -fi --
+
+ktap_finished
diff --git a/tools/testing/selftests/exec/check-exec.c b/tools/testing/selftests/exec/check-exec.c
new file mode 100644
index 000000000000..4d3f4525e1e1
--- /dev/null
+++ b/tools/testing/selftests/exec/check-exec.c
@@ -0,0 +1,456 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Test execveat(2) with AT_EXECVE_CHECK, and prctl(2) with
+ * SECBIT_EXEC_RESTRICT_FILE, SECBIT_EXEC_DENY_INTERACTIVE, and their locked
+ * counterparts.
+ *
+ * Copyright © 2018-2020 ANSSI
+ * Copyright © 2024 Microsoft Corporation
+ *
+ * Author: Mickaël Salaün <mic@digikod.net>
+ */
+
+#include <asm-generic/unistd.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <linux/prctl.h>
+#include <linux/securebits.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <sys/capability.h>
+#include <sys/mount.h>
+#include <sys/prctl.h>
+#include <sys/socket.h>
+#include <sys/stat.h>
+#include <sys/sysmacros.h>
+#include <unistd.h>
+
+/* Defines AT_EXECVE_CHECK without type conflicts. */
+#define _ASM_GENERIC_FCNTL_H
+#include <linux/fcntl.h>
+
+#include "../kselftest_harness.h"
+
+static void drop_privileges(struct __test_metadata *const _metadata)
+{
+ const unsigned int noroot = SECBIT_NOROOT | SECBIT_NOROOT_LOCKED;
+ cap_t cap_p;
+
+ if ((cap_get_secbits() & noroot) != noroot)
+ EXPECT_EQ(0, cap_set_secbits(noroot));
+
+ cap_p = cap_get_proc();
+ EXPECT_NE(NULL, cap_p);
+ EXPECT_NE(-1, cap_clear(cap_p));
+
+ /*
+ * Drops everything, especially CAP_SETPCAP, CAP_DAC_OVERRIDE, and
+ * CAP_DAC_READ_SEARCH.
+ */
+ EXPECT_NE(-1, cap_set_proc(cap_p));
+ EXPECT_NE(-1, cap_free(cap_p));
+}
+
+static int test_secbits_set(const unsigned int secbits)
+{
+ int err;
+
+ err = prctl(PR_SET_SECUREBITS, secbits);
+ if (err)
+ return errno;
+ return 0;
+}
+
+FIXTURE(access)
+{
+ int memfd, pipefd;
+ int pipe_fds[2], socket_fds[2];
+};
+
+FIXTURE_VARIANT(access)
+{
+ const bool mount_exec;
+ const bool file_exec;
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_exec_file_exec) {
+ /* clang-format on */
+ .mount_exec = true,
+ .file_exec = true,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_exec_file_noexec) {
+ /* clang-format on */
+ .mount_exec = true,
+ .file_exec = false,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_noexec_file_exec) {
+ /* clang-format on */
+ .mount_exec = false,
+ .file_exec = true,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(access, mount_noexec_file_noexec) {
+ /* clang-format on */
+ .mount_exec = false,
+ .file_exec = false,
+};
+
+static const char binary_path[] = "./false";
+static const char workdir_path[] = "./test-mount";
+static const char reg_file_path[] = "./test-mount/regular_file";
+static const char dir_path[] = "./test-mount/directory";
+static const char block_dev_path[] = "./test-mount/block_device";
+static const char char_dev_path[] = "./test-mount/character_device";
+static const char fifo_path[] = "./test-mount/fifo";
+
+FIXTURE_SETUP(access)
+{
+ int procfd_path_size;
+ static const char path_template[] = "/proc/self/fd/%d";
+ char procfd_path[sizeof(path_template) + 10];
+
+ /* Makes sure we are not already restricted nor locked. */
+ EXPECT_EQ(0, test_secbits_set(0));
+
+ /*
+ * Cleans previous workspace if any error previously happened (don't
+ * check errors).
+ */
+ umount(workdir_path);
+ rmdir(workdir_path);
+
+ /* Creates a clean mount point. */
+ ASSERT_EQ(0, mkdir(workdir_path, 00700));
+ ASSERT_EQ(0, mount("test", workdir_path, "tmpfs",
+ MS_MGC_VAL | (variant->mount_exec ? 0 : MS_NOEXEC),
+ "mode=0700,size=9m"));
+
+ /* Creates a regular file. */
+ ASSERT_EQ(0, mknod(reg_file_path,
+ S_IFREG | (variant->file_exec ? 0700 : 0600), 0));
+ /* Creates a directory. */
+ ASSERT_EQ(0, mkdir(dir_path, variant->file_exec ? 0700 : 0600));
+ /* Creates a character device: /dev/null. */
+ ASSERT_EQ(0, mknod(char_dev_path, S_IFCHR | 0400, makedev(1, 3)));
+ /* Creates a block device: /dev/loop0 */
+ ASSERT_EQ(0, mknod(block_dev_path, S_IFBLK | 0400, makedev(7, 0)));
+ /* Creates a fifo. */
+ ASSERT_EQ(0, mknod(fifo_path, S_IFIFO | 0600, 0));
+
+ /* Creates a regular file without user mount point. */
+ self->memfd = memfd_create("test-exec-probe", MFD_CLOEXEC);
+ ASSERT_LE(0, self->memfd);
+ /* Sets mode, which must be ignored by the exec check. */
+ ASSERT_EQ(0, fchmod(self->memfd, variant->file_exec ? 0700 : 0600));
+
+ /* Creates a pipefs file descriptor. */
+ ASSERT_EQ(0, pipe(self->pipe_fds));
+ procfd_path_size = snprintf(procfd_path, sizeof(procfd_path),
+ path_template, self->pipe_fds[0]);
+ ASSERT_LT(procfd_path_size, sizeof(procfd_path));
+ self->pipefd = open(procfd_path, O_RDWR | O_CLOEXEC);
+ ASSERT_LE(0, self->pipefd);
+ ASSERT_EQ(0, fchmod(self->pipefd, variant->file_exec ? 0700 : 0600));
+
+ /* Creates a socket file descriptor. */
+ ASSERT_EQ(0, socketpair(AF_UNIX, SOCK_DGRAM | SOCK_CLOEXEC, 0,
+ self->socket_fds));
+}
+
+FIXTURE_TEARDOWN_PARENT(access)
+{
+ /* There is no need to unlink the test files. */
+ EXPECT_EQ(0, umount(workdir_path));
+ EXPECT_EQ(0, rmdir(workdir_path));
+}
+
+static void fill_exec_fd(struct __test_metadata *_metadata, const int fd_out)
+{
+ char buf[1024];
+ size_t len;
+ int fd_in;
+
+ fd_in = open(binary_path, O_CLOEXEC | O_RDONLY);
+ ASSERT_LE(0, fd_in);
+ /* Cannot use copy_file_range(2) because of EXDEV. */
+ len = read(fd_in, buf, sizeof(buf));
+ EXPECT_LE(0, len);
+ while (len > 0) {
+ EXPECT_EQ(len, write(fd_out, buf, len))
+ {
+ TH_LOG("Failed to write: %s (%d)", strerror(errno),
+ errno);
+ }
+ len = read(fd_in, buf, sizeof(buf));
+ EXPECT_LE(0, len);
+ }
+ EXPECT_EQ(0, close(fd_in));
+}
+
+static void fill_exec_path(struct __test_metadata *_metadata,
+ const char *const path)
+{
+ int fd_out;
+
+ fd_out = open(path, O_CLOEXEC | O_WRONLY);
+ ASSERT_LE(0, fd_out)
+ {
+ TH_LOG("Failed to open %s: %s", path, strerror(errno));
+ }
+ fill_exec_fd(_metadata, fd_out);
+ EXPECT_EQ(0, close(fd_out));
+}
+
+static void test_exec_fd(struct __test_metadata *_metadata, const int fd,
+ const int err_code)
+{
+ char *const argv[] = { "", NULL };
+ int access_ret, access_errno;
+
+ /*
+ * If we really execute fd, filled with the "false" binary, the current
+ * thread will exits with an error, which will be interpreted by the
+ * test framework as an error. With AT_EXECVE_CHECK, we only check a
+ * potential successful execution.
+ */
+ access_ret =
+ execveat(fd, "", argv, NULL, AT_EMPTY_PATH | AT_EXECVE_CHECK);
+ access_errno = errno;
+ if (err_code) {
+ EXPECT_EQ(-1, access_ret);
+ EXPECT_EQ(err_code, access_errno)
+ {
+ TH_LOG("Wrong error for execveat(2): %s (%d)",
+ strerror(access_errno), errno);
+ }
+ } else {
+ EXPECT_EQ(0, access_ret)
+ {
+ TH_LOG("Access denied: %s", strerror(access_errno));
+ }
+ }
+}
+
+static void test_exec_path(struct __test_metadata *_metadata,
+ const char *const path, const int err_code)
+{
+ int flags = O_CLOEXEC;
+ int fd;
+
+ /* Do not block on pipes. */
+ if (path == fifo_path)
+ flags |= O_NONBLOCK;
+
+ fd = open(path, flags | O_RDONLY);
+ ASSERT_LE(0, fd)
+ {
+ TH_LOG("Failed to open %s: %s", path, strerror(errno));
+ }
+ test_exec_fd(_metadata, fd, err_code);
+ EXPECT_EQ(0, close(fd));
+}
+
+/* Tests that we don't get ENOEXEC. */
+TEST_F(access, regular_file_empty)
+{
+ const int exec = variant->mount_exec && variant->file_exec;
+
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+}
+
+TEST_F(access, regular_file_elf)
+{
+ const int exec = variant->mount_exec && variant->file_exec;
+
+ fill_exec_path(_metadata, reg_file_path);
+
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_path(_metadata, reg_file_path, exec ? 0 : EACCES);
+}
+
+/* Tests that we don't get ENOEXEC. */
+TEST_F(access, memfd_empty)
+{
+ const int exec = variant->file_exec;
+
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+}
+
+TEST_F(access, memfd_elf)
+{
+ const int exec = variant->file_exec;
+
+ fill_exec_fd(_metadata, self->memfd);
+
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+
+ drop_privileges(_metadata);
+ test_exec_fd(_metadata, self->memfd, exec ? 0 : EACCES);
+}
+
+TEST_F(access, non_regular_files)
+{
+ test_exec_path(_metadata, dir_path, EACCES);
+ test_exec_path(_metadata, block_dev_path, EACCES);
+ test_exec_path(_metadata, char_dev_path, EACCES);
+ test_exec_path(_metadata, fifo_path, EACCES);
+ test_exec_fd(_metadata, self->socket_fds[0], EACCES);
+ test_exec_fd(_metadata, self->pipefd, EACCES);
+}
+
+/* clang-format off */
+FIXTURE(secbits) {};
+/* clang-format on */
+
+FIXTURE_VARIANT(secbits)
+{
+ const bool is_privileged;
+ const int error;
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(secbits, priv) {
+ /* clang-format on */
+ .is_privileged = true,
+ .error = 0,
+};
+
+/* clang-format off */
+FIXTURE_VARIANT_ADD(secbits, unpriv) {
+ /* clang-format on */
+ .is_privileged = false,
+ .error = EPERM,
+};
+
+FIXTURE_SETUP(secbits)
+{
+ /* Makes sure no exec bits are set. */
+ EXPECT_EQ(0, test_secbits_set(0));
+ EXPECT_EQ(0, prctl(PR_GET_SECUREBITS));
+
+ if (!variant->is_privileged)
+ drop_privileges(_metadata);
+}
+
+FIXTURE_TEARDOWN(secbits)
+{
+}
+
+TEST_F(secbits, legacy)
+{
+ EXPECT_EQ(variant->error, test_secbits_set(0));
+}
+
+#define CHILD(...) \
+ do { \
+ pid_t child = vfork(); \
+ EXPECT_LE(0, child); \
+ if (child == 0) { \
+ __VA_ARGS__; \
+ _exit(0); \
+ } \
+ } while (0)
+
+TEST_F(secbits, exec)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+
+ secbits &= ~(SECBIT_EXEC_RESTRICT_FILE | SECBIT_EXEC_DENY_INTERACTIVE);
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS));
+ CHILD(EXPECT_EQ(secbits, prctl(PR_GET_SECUREBITS)));
+}
+
+TEST_F(secbits, check_locked_set)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock set but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, check_locked_unset)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_RESTRICT_FILE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock unset but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_RESTRICT_FILE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, restrict_locked_set)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock set but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_F(secbits, restrict_locked_unset)
+{
+ unsigned int secbits = prctl(PR_GET_SECUREBITS);
+
+ secbits |= SECBIT_EXEC_DENY_INTERACTIVE_LOCKED;
+ EXPECT_EQ(0, test_secbits_set(secbits));
+
+ /* Checks lock unset but unchanged. */
+ EXPECT_EQ(variant->error, test_secbits_set(secbits));
+ CHILD(EXPECT_EQ(variant->error, test_secbits_set(secbits)));
+
+ secbits &= ~SECBIT_EXEC_DENY_INTERACTIVE;
+ EXPECT_EQ(EPERM, test_secbits_set(0));
+ CHILD(EXPECT_EQ(EPERM, test_secbits_set(0)));
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/exec/config b/tools/testing/selftests/exec/config
new file mode 100644
index 000000000000..c308079867b3
--- /dev/null
+++ b/tools/testing/selftests/exec/config
@@ -0,0 +1,2 @@
+CONFIG_BLK_DEV=y
+CONFIG_BLK_DEV_LOOP=y
diff --git a/tools/testing/selftests/exec/execveat.c b/tools/testing/selftests/exec/execveat.c
index 071e03532cba..8fb7395fd35b 100644
--- a/tools/testing/selftests/exec/execveat.c
+++ b/tools/testing/selftests/exec/execveat.c
@@ -23,9 +23,11 @@
#include "../kselftest.h"
-#define TESTS_EXPECTED 51
+#define TESTS_EXPECTED 54
#define TEST_NAME_LEN (PATH_MAX * 4)
+#define CHECK_COMM "CHECK_COMM"
+
static char longpath[2 * PATH_MAX] = "";
static char *envp[] = { "IN_TEST=yes", NULL, NULL };
static char *argv[] = { "execveat", "99", NULL };
@@ -237,6 +239,29 @@ static int check_execveat_pathmax(int root_dfd, const char *src, int is_script)
return fail;
}
+static int check_execveat_comm(int fd, char *argv0, char *expected)
+{
+ char buf[128], *old_env, *old_argv0;
+ int ret;
+
+ snprintf(buf, sizeof(buf), CHECK_COMM "=%s", expected);
+
+ old_env = envp[1];
+ envp[1] = buf;
+
+ old_argv0 = argv[0];
+ argv[0] = argv0;
+
+ ksft_print_msg("Check execveat(AT_EMPTY_PATH)'s comm is %s\n",
+ expected);
+ ret = check_execveat_invoked_rc(fd, "", AT_EMPTY_PATH, 0, 0);
+
+ envp[1] = old_env;
+ argv[0] = old_argv0;
+
+ return ret;
+}
+
static int run_tests(void)
{
int fail = 0;
@@ -389,6 +414,14 @@ static int run_tests(void)
fail += check_execveat_pathmax(root_dfd, "execveat", 0);
fail += check_execveat_pathmax(root_dfd, "script", 1);
+
+ /* /proc/pid/comm gives filename by default */
+ fail += check_execveat_comm(fd, "sentinel", "execveat");
+ /* /proc/pid/comm gives argv[0] when invoked via link */
+ fail += check_execveat_comm(fd_symlink, "sentinel", "execveat");
+ /* /proc/pid/comm gives filename if NULL is passed */
+ fail += check_execveat_comm(fd, NULL, "execveat");
+
return fail;
}
@@ -415,9 +448,13 @@ int main(int argc, char **argv)
int ii;
int rc;
const char *verbose = getenv("VERBOSE");
+ const char *check_comm = getenv(CHECK_COMM);
- if (argc >= 2) {
- /* If we are invoked with an argument, don't run tests. */
+ if (argc >= 2 || check_comm) {
+ /*
+ * If we are invoked with an argument, or no arguments but a
+ * command to check, don't run tests.
+ */
const char *in_test = getenv("IN_TEST");
if (verbose) {
@@ -426,6 +463,38 @@ int main(int argc, char **argv)
ksft_print_msg("\t[%d]='%s\n'", ii, argv[ii]);
}
+ /* If the tests wanted us to check the command, do so. */
+ if (check_comm) {
+ /* TASK_COMM_LEN == 16 */
+ char buf[32];
+ int fd, ret;
+
+ fd = open("/proc/self/comm", O_RDONLY);
+ if (fd < 0) {
+ ksft_perror("open() comm failed");
+ exit(1);
+ }
+
+ ret = read(fd, buf, sizeof(buf));
+ if (ret < 0) {
+ ksft_perror("read() comm failed");
+ close(fd);
+ exit(1);
+ }
+ close(fd);
+
+ // trim off the \n
+ buf[ret-1] = 0;
+
+ if (strcmp(buf, check_comm)) {
+ ksft_print_msg("bad comm, got: %s expected: %s\n",
+ buf, check_comm);
+ exit(1);
+ }
+
+ exit(0);
+ }
+
/* Check expected environment transferred. */
if (!in_test || strcmp(in_test, "yes") != 0) {
ksft_print_msg("no IN_TEST=yes in env\n");
diff --git a/tools/testing/selftests/exec/false.c b/tools/testing/selftests/exec/false.c
new file mode 100644
index 000000000000..104383ec3a79
--- /dev/null
+++ b/tools/testing/selftests/exec/false.c
@@ -0,0 +1,5 @@
+// SPDX-License-Identifier: GPL-2.0
+int main(void)
+{
+ return 1;
+}
diff --git a/tools/testing/selftests/nsfs/.gitignore b/tools/testing/selftests/filesystems/nsfs/.gitignore
index ed79ebdf286e..92a8249006d1 100644
--- a/tools/testing/selftests/nsfs/.gitignore
+++ b/tools/testing/selftests/filesystems/nsfs/.gitignore
@@ -1,3 +1,4 @@
# SPDX-License-Identifier: GPL-2.0-only
owner
pidns
+iterate_mntns
diff --git a/tools/testing/selftests/nsfs/Makefile b/tools/testing/selftests/filesystems/nsfs/Makefile
index dd9bd50b7b93..231aaa7dfd95 100644
--- a/tools/testing/selftests/nsfs/Makefile
+++ b/tools/testing/selftests/filesystems/nsfs/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0-only
-TEST_GEN_PROGS := owner pidns
+TEST_GEN_PROGS := owner pidns iterate_mntns
CFLAGS := -Wall -Werror
-include ../lib.mk
+include ../../lib.mk
diff --git a/tools/testing/selftests/nsfs/config b/tools/testing/selftests/filesystems/nsfs/config
index 598d0a225fc9..598d0a225fc9 100644
--- a/tools/testing/selftests/nsfs/config
+++ b/tools/testing/selftests/filesystems/nsfs/config
diff --git a/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c
new file mode 100644
index 000000000000..457cf76f3c5f
--- /dev/null
+++ b/tools/testing/selftests/filesystems/nsfs/iterate_mntns.c
@@ -0,0 +1,149 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "../../kselftest_harness.h"
+
+#define MNT_NS_COUNT 11
+#define MNT_NS_LAST_INDEX 10
+
+struct mnt_ns_info {
+ __u32 size;
+ __u32 nr_mounts;
+ __u64 mnt_ns_id;
+};
+
+#define MNT_NS_INFO_SIZE_VER0 16 /* size of first published struct */
+
+/* Get information about namespace. */
+#define NS_MNT_GET_INFO _IOR(0xb7, 10, struct mnt_ns_info)
+/* Get next namespace. */
+#define NS_MNT_GET_NEXT _IOR(0xb7, 11, struct mnt_ns_info)
+/* Get previous namespace. */
+#define NS_MNT_GET_PREV _IOR(0xb7, 12, struct mnt_ns_info)
+
+FIXTURE(iterate_mount_namespaces) {
+ int fd_mnt_ns[MNT_NS_COUNT];
+ __u64 mnt_ns_id[MNT_NS_COUNT];
+};
+
+FIXTURE_SETUP(iterate_mount_namespaces)
+{
+ for (int i = 0; i < MNT_NS_COUNT; i++)
+ self->fd_mnt_ns[i] = -EBADF;
+
+ /*
+ * Creating a new user namespace let's us guarantee that we only see
+ * mount namespaces that we did actually create.
+ */
+ ASSERT_EQ(unshare(CLONE_NEWUSER), 0);
+
+ for (int i = 0; i < MNT_NS_COUNT; i++) {
+ struct mnt_ns_info info = {};
+
+ ASSERT_EQ(unshare(CLONE_NEWNS), 0);
+ self->fd_mnt_ns[i] = open("/proc/self/ns/mnt", O_RDONLY | O_CLOEXEC);
+ ASSERT_GE(self->fd_mnt_ns[i], 0);
+ ASSERT_EQ(ioctl(self->fd_mnt_ns[i], NS_MNT_GET_INFO, &info), 0);
+ self->mnt_ns_id[i] = info.mnt_ns_id;
+ }
+}
+
+FIXTURE_TEARDOWN(iterate_mount_namespaces)
+{
+ for (int i = 0; i < MNT_NS_COUNT; i++) {
+ if (self->fd_mnt_ns[i] < 0)
+ continue;
+ ASSERT_EQ(close(self->fd_mnt_ns[i]), 0);
+ }
+}
+
+TEST_F(iterate_mount_namespaces, iterate_all_forward)
+{
+ int fd_mnt_ns_cur, count = 0;
+
+ fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[0], F_DUPFD_CLOEXEC);
+ ASSERT_GE(fd_mnt_ns_cur, 0);
+
+ for (;; count++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_next;
+
+ fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info);
+ if (fd_mnt_ns_next < 0 && errno == ENOENT)
+ break;
+ ASSERT_GE(fd_mnt_ns_next, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_next;
+ }
+ ASSERT_EQ(count, MNT_NS_LAST_INDEX);
+}
+
+TEST_F(iterate_mount_namespaces, iterate_all_backwards)
+{
+ int fd_mnt_ns_cur, count = 0;
+
+ fd_mnt_ns_cur = fcntl(self->fd_mnt_ns[MNT_NS_LAST_INDEX], F_DUPFD_CLOEXEC);
+ ASSERT_GE(fd_mnt_ns_cur, 0);
+
+ for (;; count++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_prev;
+
+ fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info);
+ if (fd_mnt_ns_prev < 0 && errno == ENOENT)
+ break;
+ ASSERT_GE(fd_mnt_ns_prev, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_prev;
+ }
+ ASSERT_EQ(count, MNT_NS_LAST_INDEX);
+}
+
+TEST_F(iterate_mount_namespaces, iterate_forward)
+{
+ int fd_mnt_ns_cur;
+
+ ASSERT_EQ(setns(self->fd_mnt_ns[0], CLONE_NEWNS), 0);
+
+ fd_mnt_ns_cur = self->fd_mnt_ns[0];
+ for (int i = 1; i < MNT_NS_COUNT; i++) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_next;
+
+ fd_mnt_ns_next = ioctl(fd_mnt_ns_cur, NS_MNT_GET_NEXT, &info);
+ ASSERT_GE(fd_mnt_ns_next, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_next;
+ ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]);
+ }
+}
+
+TEST_F(iterate_mount_namespaces, iterate_backward)
+{
+ int fd_mnt_ns_cur;
+
+ ASSERT_EQ(setns(self->fd_mnt_ns[MNT_NS_LAST_INDEX], CLONE_NEWNS), 0);
+
+ fd_mnt_ns_cur = self->fd_mnt_ns[MNT_NS_LAST_INDEX];
+ for (int i = MNT_NS_LAST_INDEX - 1; i >= 0; i--) {
+ struct mnt_ns_info info = {};
+ int fd_mnt_ns_prev;
+
+ fd_mnt_ns_prev = ioctl(fd_mnt_ns_cur, NS_MNT_GET_PREV, &info);
+ ASSERT_GE(fd_mnt_ns_prev, 0);
+ ASSERT_EQ(close(fd_mnt_ns_cur), 0);
+ fd_mnt_ns_cur = fd_mnt_ns_prev;
+ ASSERT_EQ(info.mnt_ns_id, self->mnt_ns_id[i]);
+ }
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/nsfs/owner.c b/tools/testing/selftests/filesystems/nsfs/owner.c
index 96a976c74550..96a976c74550 100644
--- a/tools/testing/selftests/nsfs/owner.c
+++ b/tools/testing/selftests/filesystems/nsfs/owner.c
diff --git a/tools/testing/selftests/nsfs/pidns.c b/tools/testing/selftests/filesystems/nsfs/pidns.c
index e3c772c6a7c7..e3c772c6a7c7 100644
--- a/tools/testing/selftests/nsfs/pidns.c
+++ b/tools/testing/selftests/filesystems/nsfs/pidns.c
diff --git a/tools/testing/selftests/filesystems/statmount/.gitignore b/tools/testing/selftests/filesystems/statmount/.gitignore
index 82a4846cbc4b..973363ad66a2 100644
--- a/tools/testing/selftests/filesystems/statmount/.gitignore
+++ b/tools/testing/selftests/filesystems/statmount/.gitignore
@@ -1,2 +1,3 @@
# SPDX-License-Identifier: GPL-2.0-only
+statmount_test_ns
/*_test
diff --git a/tools/testing/selftests/filesystems/statmount/Makefile b/tools/testing/selftests/filesystems/statmount/Makefile
index 3af3136e35a4..14ee91a41650 100644
--- a/tools/testing/selftests/filesystems/statmount/Makefile
+++ b/tools/testing/selftests/filesystems/statmount/Makefile
@@ -1,6 +1,6 @@
# SPDX-License-Identifier: GPL-2.0-or-later
CFLAGS += -Wall -O2 -g $(KHDR_INCLUDES)
-TEST_GEN_PROGS := statmount_test statmount_test_ns
+TEST_GEN_PROGS := statmount_test statmount_test_ns listmount_test
include ../../lib.mk
diff --git a/tools/testing/selftests/filesystems/statmount/listmount_test.c b/tools/testing/selftests/filesystems/statmount/listmount_test.c
new file mode 100644
index 000000000000..15f0834f7557
--- /dev/null
+++ b/tools/testing/selftests/filesystems/statmount/listmount_test.c
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "statmount.h"
+#include "../../kselftest_harness.h"
+
+#ifndef LISTMOUNT_REVERSE
+#define LISTMOUNT_REVERSE (1 << 0) /* List later mounts first */
+#endif
+
+#define LISTMNT_BUFFER 10
+
+/* Check that all mount ids are in increasing order. */
+TEST(listmount_forward)
+{
+ uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0;
+
+ for (;;) {
+ ssize_t nr_mounts;
+
+ nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id,
+ list, LISTMNT_BUFFER, 0);
+ ASSERT_GE(nr_mounts, 0);
+ if (nr_mounts == 0)
+ break;
+
+ for (size_t cur = 0; cur < nr_mounts; cur++) {
+ if (cur < nr_mounts - 1)
+ ASSERT_LT(list[cur], list[cur + 1]);
+ last_mnt_id = list[cur];
+ }
+ }
+}
+
+/* Check that all mount ids are in decreasing order. */
+TEST(listmount_backward)
+{
+ uint64_t list[LISTMNT_BUFFER], last_mnt_id = 0;
+
+ for (;;) {
+ ssize_t nr_mounts;
+
+ nr_mounts = listmount(LSMT_ROOT, 0, last_mnt_id,
+ list, LISTMNT_BUFFER, LISTMOUNT_REVERSE);
+ ASSERT_GE(nr_mounts, 0);
+ if (nr_mounts == 0)
+ break;
+
+ for (size_t cur = 0; cur < nr_mounts; cur++) {
+ if (cur < nr_mounts - 1)
+ ASSERT_GT(list[cur], list[cur + 1]);
+ last_mnt_id = list[cur];
+ }
+ }
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
index 35e8d47d6072..8a7ce647a60d 100644
--- a/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
+++ b/tools/testing/selftests/ftrace/test.d/00basic/mount_options.tc
@@ -15,11 +15,11 @@ find_alternate_gid() {
tac /etc/group | grep -v ":$original_gid:" | head -1 | cut -d: -f3
}
-mount_tracefs_with_options() {
+remount_tracefs_with_options() {
local mount_point="$1"
local options="$2"
- mount -t tracefs -o "$options" nodev "$mount_point"
+ mount -t tracefs -o "remount,$options" nodev "$mount_point"
setup
}
@@ -81,7 +81,7 @@ test_gid_mount_option() {
# Unmount existing tracefs instance and mount with new GID
unmount_tracefs "$mount_point"
- mount_tracefs_with_options "$mount_point" "$new_options"
+ remount_tracefs_with_options "$mount_point" "$new_options"
check_gid "$mount_point" "$other_group"
@@ -92,7 +92,7 @@ test_gid_mount_option() {
# Unmount and remount with the original GID
unmount_tracefs "$mount_point"
- mount_tracefs_with_options "$mount_point" "$mount_options"
+ remount_tracefs_with_options "$mount_point" "$mount_options"
check_gid "$mount_point" "$original_group"
}
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc
new file mode 100644
index 000000000000..b4ad09237e2a
--- /dev/null
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_fprobe_repeat.tc
@@ -0,0 +1,19 @@
+#!/bin/sh
+# SPDX-License-Identifier: GPL-2.0
+# description: Generic dynamic event - Repeating add/remove fprobe events
+# requires: dynamic_events "f[:[<group>/][<event>]] <func-name>[%return] [<args>]":README
+
+echo 0 > events/enable
+echo > dynamic_events
+
+PLACE=$FUNCTION_FORK
+REPEAT_TIMES=64
+
+for i in `seq 1 $REPEAT_TIMES`; do
+ echo "f:myevent $PLACE" >> dynamic_events
+ grep -q myevent dynamic_events
+ test -d events/fprobes/myevent
+ echo > dynamic_events
+done
+
+clear_trace
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
index a275decdc880..86c76679c56e 100644
--- a/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/add_remove_uprobe.tc
@@ -6,8 +6,10 @@
echo 0 > events/enable
echo > dynamic_events
+REALBIN=`readlink -f /bin/sh`
+
echo 'cat /proc/$$/maps' | /bin/sh | \
- grep "r-xp .*/bin/.*sh$" | \
+ grep "r-xp .*${REALBIN}$" | \
awk '{printf "p:myevent %s:0x%s\n", $6,$3 }' >> uprobe_events
grep -q myevent uprobe_events
diff --git a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
index 61877d166451..c9425a34fae3 100644
--- a/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
+++ b/tools/testing/selftests/ftrace/test.d/dynevent/fprobe_syntax_errors.tc
@@ -16,9 +16,7 @@ aarch64)
REG=%r0 ;;
esac
-check_error 'f^100 vfs_read' # MAXACT_NO_KPROBE
-check_error 'f^1a111 vfs_read' # BAD_MAXACT
-check_error 'f^100000 vfs_read' # MAXACT_TOO_BIG
+check_error 'f^100 vfs_read' # BAD_MAXACT
check_error 'f ^non_exist_func' # BAD_PROBE_ADDR (enoent)
check_error 'f ^vfs_read+10' # BAD_PROBE_ADDR
diff --git a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
index a16c6a6f6055..8f1c58f0c239 100644
--- a/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
+++ b/tools/testing/selftests/ftrace/test.d/kprobe/kprobe_syntax_errors.tc
@@ -111,7 +111,7 @@ check_error 'p vfs_read $arg* ^$arg*' # DOUBLE_ARGS
if !grep -q 'kernel return probes support:' README; then
check_error 'r vfs_read ^$arg*' # NOFENTRY_ARGS
fi
-check_error 'p vfs_read+8 ^$arg*' # NOFENTRY_ARGS
+check_error 'p vfs_read+20 ^$arg*' # NOFENTRY_ARGS
check_error 'p vfs_read ^hoge' # NO_BTFARG
check_error 'p kfree ^$arg10' # NO_BTFARG (exceed the number of parameters)
check_error 'r kfree ^$retval' # NO_RETVAL
diff --git a/tools/testing/selftests/hid/.gitignore b/tools/testing/selftests/hid/.gitignore
index 746c62361f77..933f483815b2 100644
--- a/tools/testing/selftests/hid/.gitignore
+++ b/tools/testing/selftests/hid/.gitignore
@@ -1,5 +1,6 @@
bpftool
*.skel.h
+/host-tools
/tools
hid_bpf
hidraw
diff --git a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
index e5db897586bb..531228b849da 100644
--- a/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
+++ b/tools/testing/selftests/hid/progs/hid_bpf_helpers.h
@@ -22,6 +22,9 @@
#define HID_REQ_SET_IDLE HID_REQ_SET_IDLE___not_used
#define HID_REQ_SET_PROTOCOL HID_REQ_SET_PROTOCOL___not_used
+/* do not define kfunc through vmlinux.h as this messes up our custom hack */
+#define BPF_NO_KFUNC_PROTOTYPES
+
#include "vmlinux.h"
#undef hid_bpf_ctx
@@ -91,31 +94,31 @@ struct hid_bpf_ops {
/* following are kfuncs exported by HID for HID-BPF */
extern __u8 *hid_bpf_get_data(struct hid_bpf_ctx *ctx,
unsigned int offset,
- const size_t __sz) __ksym;
-extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __ksym;
-extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __ksym;
+ const size_t __sz) __weak __ksym;
+extern struct hid_bpf_ctx *hid_bpf_allocate_context(unsigned int hid_id) __weak __ksym;
+extern void hid_bpf_release_context(struct hid_bpf_ctx *ctx) __weak __ksym;
extern int hid_bpf_hw_request(struct hid_bpf_ctx *ctx,
__u8 *data,
size_t buf__sz,
enum hid_report_type type,
- enum hid_class_request reqtype) __ksym;
+ enum hid_class_request reqtype) __weak __ksym;
extern int hid_bpf_hw_output_report(struct hid_bpf_ctx *ctx,
- __u8 *buf, size_t buf__sz) __ksym;
+ __u8 *buf, size_t buf__sz) __weak __ksym;
extern int hid_bpf_input_report(struct hid_bpf_ctx *ctx,
enum hid_report_type type,
__u8 *data,
- size_t buf__sz) __ksym;
+ size_t buf__sz) __weak __ksym;
extern int hid_bpf_try_input_report(struct hid_bpf_ctx *ctx,
enum hid_report_type type,
__u8 *data,
- size_t buf__sz) __ksym;
+ size_t buf__sz) __weak __ksym;
/* bpf_wq implementation */
extern int bpf_wq_init(struct bpf_wq *wq, void *p__map, unsigned int flags) __weak __ksym;
extern int bpf_wq_start(struct bpf_wq *wq, unsigned int flags) __weak __ksym;
extern int bpf_wq_set_callback_impl(struct bpf_wq *wq,
int (callback_fn)(void *map, int *key, void *wq),
- unsigned int flags__k, void *aux__ign) __ksym;
+ unsigned int flags__k, void *aux__ign) __weak __ksym;
#define bpf_wq_set_callback(timer, cb, flags) \
bpf_wq_set_callback_impl(timer, cb, flags, NULL)
diff --git a/tools/testing/selftests/hid/run-hid-tools-tests.sh b/tools/testing/selftests/hid/run-hid-tools-tests.sh
index bdae8464da86..af1682a53c27 100755
--- a/tools/testing/selftests/hid/run-hid-tools-tests.sh
+++ b/tools/testing/selftests/hid/run-hid-tools-tests.sh
@@ -2,24 +2,26 @@
# SPDX-License-Identifier: GPL-2.0
# Runs tests for the HID subsystem
+KSELFTEST_SKIP_TEST=4
+
if ! command -v python3 > /dev/null 2>&1; then
echo "hid-tools: [SKIP] python3 not installed"
- exit 77
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import pytest" > /dev/null 2>&1; then
- echo "hid: [SKIP/ pytest module not installed"
- exit 77
+ echo "hid: [SKIP] pytest module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import pytest_tap" > /dev/null 2>&1; then
- echo "hid: [SKIP/ pytest_tap module not installed"
- exit 77
+ echo "hid: [SKIP] pytest_tap module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
if ! python3 -c "import hidtools" > /dev/null 2>&1; then
- echo "hid: [SKIP/ hid-tools module not installed"
- exit 77
+ echo "hid: [SKIP] hid-tools module not installed"
+ exit $KSELFTEST_SKIP_TEST
fi
TARGET=${TARGET:=.}
diff --git a/tools/testing/selftests/iommu/iommufd_fail_nth.c b/tools/testing/selftests/iommu/iommufd_fail_nth.c
index 22f6fd5f0f74..64b1f8e1b0cf 100644
--- a/tools/testing/selftests/iommu/iommufd_fail_nth.c
+++ b/tools/testing/selftests/iommu/iommufd_fail_nth.c
@@ -615,7 +615,12 @@ TEST_FAIL_NTH(basic_fail_nth, access_pin_domain)
/* device.c */
TEST_FAIL_NTH(basic_fail_nth, device)
{
+ struct iommu_hwpt_selftest data = {
+ .iotlb = IOMMU_TEST_IOTLB_DEFAULT,
+ };
struct iommu_test_hw_info info;
+ uint32_t fault_id, fault_fd;
+ uint32_t fault_hwpt_id;
uint32_t ioas_id;
uint32_t ioas_id2;
uint32_t stdev_id;
@@ -678,6 +683,15 @@ TEST_FAIL_NTH(basic_fail_nth, device)
if (_test_cmd_vdevice_alloc(self->fd, viommu_id, idev_id, 0, &vdev_id))
return -1;
+ if (_test_ioctl_fault_alloc(self->fd, &fault_id, &fault_fd))
+ return -1;
+ close(fault_fd);
+
+ if (_test_cmd_hwpt_alloc(self->fd, idev_id, hwpt_id, fault_id,
+ IOMMU_HWPT_FAULT_ID_VALID, &fault_hwpt_id,
+ IOMMU_HWPT_DATA_SELFTEST, &data, sizeof(data)))
+ return -1;
+
return 0;
}
diff --git a/tools/testing/selftests/ipc/msgque.c b/tools/testing/selftests/ipc/msgque.c
index c75ea4094870..e9dbb84c100a 100644
--- a/tools/testing/selftests/ipc/msgque.c
+++ b/tools/testing/selftests/ipc/msgque.c
@@ -194,7 +194,7 @@ int fill_msgque(struct msgque_data *msgque)
int main(int argc, char **argv)
{
- int msg, pid, err;
+ int err;
struct msgque_data msgque;
if (getuid() != 0)
diff --git a/tools/testing/selftests/kselftest.h b/tools/testing/selftests/kselftest.h
index 29fedf609611..cdf91b0ca40f 100644
--- a/tools/testing/selftests/kselftest.h
+++ b/tools/testing/selftests/kselftest.h
@@ -18,7 +18,8 @@
* ksft_print_msg(fmt, ...);
* ksft_perror(msg);
*
- * and finally report the pass/fail/skip/xfail state of the test with one of:
+ * and finally report the pass/fail/skip/xfail/xpass state of the test
+ * with one of:
*
* ksft_test_result(condition, fmt, ...);
* ksft_test_result_report(result, fmt, ...);
@@ -26,6 +27,7 @@
* ksft_test_result_fail(fmt, ...);
* ksft_test_result_skip(fmt, ...);
* ksft_test_result_xfail(fmt, ...);
+ * ksft_test_result_xpass(fmt, ...);
* ksft_test_result_error(fmt, ...);
* ksft_test_result_code(exit_code, test_name, fmt, ...);
*
@@ -147,6 +149,11 @@ static inline void ksft_set_plan(unsigned int plan)
static inline void ksft_print_cnts(void)
{
+ if (ksft_cnt.ksft_xskip > 0)
+ printf(
+ "# %u skipped test(s) detected. Consider enabling relevant config options to improve coverage.\n",
+ ksft_cnt.ksft_xskip
+ );
if (ksft_plan != ksft_test_num())
printf("# Planned tests != run tests (%u != %u)\n",
ksft_plan, ksft_test_num());
@@ -227,6 +234,20 @@ static inline __printf(1, 2) void ksft_test_result_xfail(const char *msg, ...)
va_end(args);
}
+static inline __printf(1, 2) void ksft_test_result_xpass(const char *msg, ...)
+{
+ int saved_errno = errno;
+ va_list args;
+
+ ksft_cnt.ksft_xpass++;
+
+ va_start(args, msg);
+ printf("ok %u # XPASS ", ksft_test_num());
+ errno = saved_errno;
+ vprintf(msg, args);
+ va_end(args);
+}
+
static inline __printf(1, 2) void ksft_test_result_skip(const char *msg, ...)
{
int saved_errno = errno;
@@ -318,6 +339,9 @@ void ksft_test_result_code(int exit_code, const char *test_name,
case KSFT_XFAIL: \
ksft_test_result_xfail(fmt, ##__VA_ARGS__); \
break; \
+ case KSFT_XPASS: \
+ ksft_test_result_xpass(fmt, ##__VA_ARGS__); \
+ break; \
case KSFT_SKIP: \
ksft_test_result_skip(fmt, ##__VA_ARGS__); \
break; \
@@ -403,7 +427,7 @@ static inline __noreturn __printf(1, 2) void ksft_exit_skip(const char *msg, ...
*/
if (ksft_plan || ksft_test_num()) {
ksft_cnt.ksft_xskip++;
- printf("ok %d # SKIP ", 1 + ksft_test_num());
+ printf("ok %u # SKIP ", 1 + ksft_test_num());
} else {
printf("1..0 # SKIP ");
}
diff --git a/tools/testing/selftests/kselftest/ksft.py b/tools/testing/selftests/kselftest/ksft.py
index bf215790a89d..0e030837fc17 100644
--- a/tools/testing/selftests/kselftest/ksft.py
+++ b/tools/testing/selftests/kselftest/ksft.py
@@ -27,6 +27,9 @@ def set_plan(num_tests):
def print_cnts():
+ if ksft_cnt['skip'] > 0:
+ print(f"# {ksft_cnt['skip']} skipped test(s) detected. Consider enabling relevant config options to improve coverage.")
+
print(
f"# Totals: pass:{ksft_cnt['pass']} fail:{ksft_cnt['fail']} xfail:0 xpass:0 skip:{ksft_cnt['skip']} error:0"
)
diff --git a/tools/testing/selftests/kselftest/ktap_helpers.sh b/tools/testing/selftests/kselftest/ktap_helpers.sh
index 79a125eb24c2..32dbfe9da2c4 100644
--- a/tools/testing/selftests/kselftest/ktap_helpers.sh
+++ b/tools/testing/selftests/kselftest/ktap_helpers.sh
@@ -7,6 +7,7 @@
KTAP_TESTNO=1
KTAP_CNT_PASS=0
KTAP_CNT_FAIL=0
+KTAP_CNT_XFAIL=0
KTAP_CNT_SKIP=0
KSFT_PASS=0
@@ -40,7 +41,7 @@ ktap_skip_all() {
__ktap_test() {
result="$1"
description="$2"
- directive="$3" # optional
+ directive="${3:-}" # optional
local directive_str=
[ ! -z "$directive" ] && directive_str="# $directive"
@@ -69,6 +70,16 @@ ktap_test_skip() {
KTAP_CNT_SKIP=$((KTAP_CNT_SKIP+1))
}
+ktap_test_xfail() {
+ description="$1"
+
+ result="ok"
+ directive="XFAIL"
+ __ktap_test "$result" "$description" "$directive"
+
+ KTAP_CNT_XFAIL=$((KTAP_CNT_XFAIL+1))
+}
+
ktap_test_fail() {
description="$1"
@@ -99,7 +110,7 @@ ktap_exit_fail_msg() {
ktap_finished() {
ktap_print_totals
- if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP)) -eq "$KSFT_NUM_TESTS" ]; then
+ if [ $((KTAP_CNT_PASS + KTAP_CNT_SKIP + KTAP_CNT_XFAIL)) -eq "$KSFT_NUM_TESTS" ]; then
exit "$KSFT_PASS"
else
exit "$KSFT_FAIL"
@@ -107,5 +118,9 @@ ktap_finished() {
}
ktap_print_totals() {
- echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:0 xpass:0 skip:$KTAP_CNT_SKIP error:0"
+ if [ "$KTAP_CNT_SKIP" -gt 0 ]; then
+ echo "# $KTAP_CNT_SKIP skipped test(s) detected. " \
+ "Consider enabling relevant config options to improve coverage."
+ fi
+ echo "# Totals: pass:$KTAP_CNT_PASS fail:$KTAP_CNT_FAIL xfail:$KTAP_CNT_XFAIL xpass:0 skip:$KTAP_CNT_SKIP error:0"
}
diff --git a/tools/testing/selftests/kselftest_harness.h b/tools/testing/selftests/kselftest_harness.h
index a5a72415e37b..666c9fde76da 100644
--- a/tools/testing/selftests/kselftest_harness.h
+++ b/tools/testing/selftests/kselftest_harness.h
@@ -760,33 +760,33 @@
/* Report with actual signedness to avoid weird output. */ \
switch (is_signed_type(__exp) * 2 + is_signed_type(__seen)) { \
case 0: { \
- unsigned long long __exp_print = (uintptr_t)__exp; \
- unsigned long long __seen_print = (uintptr_t)__seen; \
- __TH_LOG("Expected %s (%llu) %s %s (%llu)", \
+ uintmax_t __exp_print = (uintmax_t)__exp; \
+ uintmax_t __seen_print = (uintmax_t)__seen; \
+ __TH_LOG("Expected %s (%ju) %s %s (%ju)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 1: { \
- unsigned long long __exp_print = (uintptr_t)__exp; \
- long long __seen_print = (intptr_t)__seen; \
- __TH_LOG("Expected %s (%llu) %s %s (%lld)", \
+ uintmax_t __exp_print = (uintmax_t)__exp; \
+ intmax_t __seen_print = (intmax_t)__seen; \
+ __TH_LOG("Expected %s (%ju) %s %s (%jd)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 2: { \
- long long __exp_print = (intptr_t)__exp; \
- unsigned long long __seen_print = (uintptr_t)__seen; \
- __TH_LOG("Expected %s (%lld) %s %s (%llu)", \
+ intmax_t __exp_print = (intmax_t)__exp; \
+ uintmax_t __seen_print = (uintmax_t)__seen; \
+ __TH_LOG("Expected %s (%jd) %s %s (%ju)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
} \
case 3: { \
- long long __exp_print = (intptr_t)__exp; \
- long long __seen_print = (intptr_t)__seen; \
- __TH_LOG("Expected %s (%lld) %s %s (%lld)", \
+ intmax_t __exp_print = (intmax_t)__exp; \
+ intmax_t __seen_print = (intmax_t)__seen; \
+ __TH_LOG("Expected %s (%jd) %s %s (%jd)", \
_expected_str, __exp_print, #_t, \
_seen_str, __seen_print); \
break; \
diff --git a/tools/testing/selftests/kvm/aarch64/set_id_regs.c b/tools/testing/selftests/kvm/aarch64/set_id_regs.c
index a79b7f18452d..3a97c160b5fe 100644
--- a/tools/testing/selftests/kvm/aarch64/set_id_regs.c
+++ b/tools/testing/selftests/kvm/aarch64/set_id_regs.c
@@ -152,7 +152,6 @@ static const struct reg_ftr_bits ftr_id_aa64mmfr0_el1[] = {
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGENDEL0, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, SNSMEM, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, BIGEND, 0),
- REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, ASIDBITS, 0),
REG_FTR_BITS(FTR_LOWER_SAFE, ID_AA64MMFR0_EL1, PARANGE, 0),
REG_FTR_END,
};
diff --git a/tools/testing/selftests/kvm/s390x/ucontrol_test.c b/tools/testing/selftests/kvm/s390x/ucontrol_test.c
index 0c112319dab1..135ee22856cf 100644
--- a/tools/testing/selftests/kvm/s390x/ucontrol_test.c
+++ b/tools/testing/selftests/kvm/s390x/ucontrol_test.c
@@ -210,10 +210,13 @@ TEST_F(uc_kvm, uc_attr_mem_limit)
struct kvm_device_attr attr = {
.group = KVM_S390_VM_MEM_CTRL,
.attr = KVM_S390_VM_MEM_LIMIT_SIZE,
- .addr = (unsigned long)&limit,
+ .addr = (u64)&limit,
};
int rc;
+ rc = ioctl(self->vm_fd, KVM_HAS_DEVICE_ATTR, &attr);
+ EXPECT_EQ(0, rc);
+
rc = ioctl(self->vm_fd, KVM_GET_DEVICE_ATTR, &attr);
EXPECT_EQ(0, rc);
EXPECT_EQ(~0UL, limit);
@@ -635,4 +638,171 @@ TEST_F(uc_kvm, uc_skey)
uc_assert_diag44(self);
}
+static char uc_flic_b[PAGE_SIZE];
+static struct kvm_s390_io_adapter uc_flic_ioa = { .id = 0 };
+static struct kvm_s390_io_adapter_req uc_flic_ioam = { .id = 0 };
+static struct kvm_s390_ais_req uc_flic_asim = { .isc = 0 };
+static struct kvm_s390_ais_all uc_flic_asima = { .simm = 0 };
+static struct uc_flic_attr_test {
+ char *name;
+ struct kvm_device_attr a;
+ int hasrc;
+ int geterrno;
+ int seterrno;
+} uc_flic_attr_tests[] = {
+ {
+ .name = "KVM_DEV_FLIC_GET_ALL_IRQS",
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_GET_ALL_IRQS,
+ .addr = (u64)&uc_flic_b,
+ .attr = PAGE_SIZE,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ENQUEUE",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_ENQUEUE, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_CLEAR_IRQS",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_CLEAR_IRQS, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ADAPTER_REGISTER",
+ .geterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_ADAPTER_REGISTER,
+ .addr = (u64)&uc_flic_ioa,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_ADAPTER_MODIFY",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_ADAPTER_MODIFY,
+ .addr = (u64)&uc_flic_ioam,
+ .attr = sizeof(uc_flic_ioam),
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_CLEAR_IO_IRQ",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = {
+ .group = KVM_DEV_FLIC_CLEAR_IO_IRQ,
+ .attr = 32,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AISM",
+ .geterrno = EINVAL,
+ .seterrno = ENOTSUP,
+ .a = {
+ .group = KVM_DEV_FLIC_AISM,
+ .addr = (u64)&uc_flic_asim,
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AIRQ_INJECT",
+ .geterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_AIRQ_INJECT, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_AISM_ALL",
+ .geterrno = ENOTSUP,
+ .seterrno = ENOTSUP,
+ .a = {
+ .group = KVM_DEV_FLIC_AISM_ALL,
+ .addr = (u64)&uc_flic_asima,
+ .attr = sizeof(uc_flic_asima),
+ },
+ },
+ {
+ .name = "KVM_DEV_FLIC_APF_ENABLE",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_APF_ENABLE, },
+ },
+ {
+ .name = "KVM_DEV_FLIC_APF_DISABLE_WAIT",
+ .geterrno = EINVAL,
+ .seterrno = EINVAL,
+ .a = { .group = KVM_DEV_FLIC_APF_DISABLE_WAIT, },
+ },
+};
+
+TEST_F(uc_kvm, uc_flic_attrs)
+{
+ struct kvm_create_device cd = { .type = KVM_DEV_TYPE_FLIC };
+ struct kvm_device_attr attr;
+ u64 value;
+ int rc, i;
+
+ rc = ioctl(self->vm_fd, KVM_CREATE_DEVICE, &cd);
+ ASSERT_EQ(0, rc) TH_LOG("create device failed with err %s (%i)",
+ strerror(errno), errno);
+
+ for (i = 0; i < ARRAY_SIZE(uc_flic_attr_tests); i++) {
+ TH_LOG("test %s", uc_flic_attr_tests[i].name);
+ attr = (struct kvm_device_attr) {
+ .group = uc_flic_attr_tests[i].a.group,
+ .attr = uc_flic_attr_tests[i].a.attr,
+ .addr = uc_flic_attr_tests[i].a.addr,
+ };
+ if (attr.addr == 0)
+ attr.addr = (u64)&value;
+
+ rc = ioctl(cd.fd, KVM_HAS_DEVICE_ATTR, &attr);
+ EXPECT_EQ(uc_flic_attr_tests[i].hasrc, !!rc)
+ TH_LOG("expected dev attr missing %s",
+ uc_flic_attr_tests[i].name);
+
+ rc = ioctl(cd.fd, KVM_GET_DEVICE_ATTR, &attr);
+ EXPECT_EQ(!!uc_flic_attr_tests[i].geterrno, !!rc)
+ TH_LOG("get dev attr rc not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ if (uc_flic_attr_tests[i].geterrno)
+ EXPECT_EQ(uc_flic_attr_tests[i].geterrno, errno)
+ TH_LOG("get dev attr errno not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+
+ rc = ioctl(cd.fd, KVM_SET_DEVICE_ATTR, &attr);
+ EXPECT_EQ(!!uc_flic_attr_tests[i].seterrno, !!rc)
+ TH_LOG("set sev attr rc not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ if (uc_flic_attr_tests[i].seterrno)
+ EXPECT_EQ(uc_flic_attr_tests[i].seterrno, errno)
+ TH_LOG("set dev attr errno not expected on %s %s (%i)",
+ uc_flic_attr_tests[i].name,
+ strerror(errno), errno);
+ }
+
+ close(cd.fd);
+}
+
+TEST_F(uc_kvm, uc_set_gsi_routing)
+{
+ struct kvm_irq_routing *routing = kvm_gsi_routing_create();
+ struct kvm_irq_routing_entry ue = {
+ .type = KVM_IRQ_ROUTING_S390_ADAPTER,
+ .gsi = 1,
+ .u.adapter = (struct kvm_irq_routing_s390_adapter) {
+ .ind_addr = 0,
+ },
+ };
+ int rc;
+
+ routing->entries[0] = ue;
+ routing->nr = 1;
+ rc = ioctl(self->vm_fd, KVM_SET_GSI_ROUTING, routing);
+ ASSERT_EQ(-1, rc) TH_LOG("err %s (%i)", strerror(errno), errno);
+ ASSERT_EQ(EINVAL, errno) TH_LOG("err %s (%i)", strerror(errno), errno);
+}
+
TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/Makefile b/tools/testing/selftests/landlock/Makefile
index 348e2dbdb4e0..5cb0828f0514 100644
--- a/tools/testing/selftests/landlock/Makefile
+++ b/tools/testing/selftests/landlock/Makefile
@@ -10,14 +10,14 @@ src_test := $(wildcard *_test.c)
TEST_GEN_PROGS := $(src_test:.c=)
-TEST_GEN_PROGS_EXTENDED := true
+TEST_GEN_PROGS_EXTENDED := true sandbox-and-launch wait-pipe
# Short targets:
-$(TEST_GEN_PROGS): LDLIBS += -lcap
+$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread
$(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static
include ../lib.mk
# Targets with $(OUTPUT)/ prefix:
-$(TEST_GEN_PROGS): LDLIBS += -lcap
+$(TEST_GEN_PROGS): LDLIBS += -lcap -lpthread
$(TEST_GEN_PROGS_EXTENDED): LDFLAGS += -static
diff --git a/tools/testing/selftests/landlock/common.h b/tools/testing/selftests/landlock/common.h
index 61056fa074bb..a604ea5d8297 100644
--- a/tools/testing/selftests/landlock/common.h
+++ b/tools/testing/selftests/landlock/common.h
@@ -9,17 +9,15 @@
#include <arpa/inet.h>
#include <errno.h>
-#include <linux/landlock.h>
#include <linux/securebits.h>
#include <sys/capability.h>
#include <sys/socket.h>
-#include <sys/syscall.h>
-#include <sys/types.h>
#include <sys/un.h>
#include <sys/wait.h>
#include <unistd.h>
#include "../kselftest_harness.h"
+#include "wrappers.h"
#define TMP_DIR "tmp"
@@ -30,33 +28,8 @@
/* TEST_F_FORK() should not be used for new tests. */
#define TEST_F_FORK(fixture_name, test_name) TEST_F(fixture_name, test_name)
-#ifndef landlock_create_ruleset
-static inline int
-landlock_create_ruleset(const struct landlock_ruleset_attr *const attr,
- const size_t size, const __u32 flags)
-{
- return syscall(__NR_landlock_create_ruleset, attr, size, flags);
-}
-#endif
-
-#ifndef landlock_add_rule
-static inline int landlock_add_rule(const int ruleset_fd,
- const enum landlock_rule_type rule_type,
- const void *const rule_attr,
- const __u32 flags)
-{
- return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr,
- flags);
-}
-#endif
-
-#ifndef landlock_restrict_self
-static inline int landlock_restrict_self(const int ruleset_fd,
- const __u32 flags)
-{
- return syscall(__NR_landlock_restrict_self, ruleset_fd, flags);
-}
-#endif
+static const char bin_sandbox_and_launch[] = "./sandbox-and-launch";
+static const char bin_wait_pipe[] = "./wait-pipe";
static void _init_caps(struct __test_metadata *const _metadata, bool drop_all)
{
@@ -250,11 +223,6 @@ struct service_fixture {
};
};
-static pid_t __maybe_unused sys_gettid(void)
-{
- return syscall(__NR_gettid);
-}
-
static void __maybe_unused set_unix_address(struct service_fixture *const srv,
const unsigned short index)
{
diff --git a/tools/testing/selftests/landlock/fs_test.c b/tools/testing/selftests/landlock/fs_test.c
index 6788762188fe..2af86bd796ba 100644
--- a/tools/testing/selftests/landlock/fs_test.c
+++ b/tools/testing/selftests/landlock/fs_test.c
@@ -37,6 +37,10 @@
#include <linux/fs.h>
#include <linux/mount.h>
+/* Defines AT_EXECVE_CHECK without type conflicts. */
+#define _ASM_GENERIC_FCNTL_H
+#include <linux/fcntl.h>
+
#include "common.h"
#ifndef renameat2
@@ -59,7 +63,7 @@ int open_tree(int dfd, const char *filename, unsigned int flags)
#define RENAME_EXCHANGE (1 << 1)
#endif
-#define BINARY_PATH "./true"
+static const char bin_true[] = "./true";
/* Paths (sibling number and depth) */
static const char dir_s1d1[] = TMP_DIR "/s1d1";
@@ -85,6 +89,9 @@ static const char file1_s3d1[] = TMP_DIR "/s3d1/f1";
/* dir_s3d2 is a mount point. */
static const char dir_s3d2[] = TMP_DIR "/s3d1/s3d2";
static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3";
+static const char file1_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3/f1";
+static const char dir_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4";
+static const char file1_s3d4[] = TMP_DIR "/s3d1/s3d2/s3d4/f1";
/*
* layout1 hierarchy:
@@ -108,8 +115,11 @@ static const char dir_s3d3[] = TMP_DIR "/s3d1/s3d2/s3d3";
* │   └── f2
* └── s3d1
*    ├── f1
- * └── s3d2
- * └── s3d3
+ * └── s3d2 [mount point]
+ *    ├── s3d3
+ *    │ └── f1
+ *    └── s3d4
+ *    └── f1
*/
static bool fgrep(FILE *const inf, const char *const str)
@@ -358,7 +368,8 @@ static void create_layout1(struct __test_metadata *const _metadata)
ASSERT_EQ(0, mount_opt(&mnt_tmp, dir_s3d2));
clear_cap(_metadata, CAP_SYS_ADMIN);
- ASSERT_EQ(0, mkdir(dir_s3d3, 0700));
+ create_file(_metadata, file1_s3d3);
+ create_file(_metadata, file1_s3d4);
}
static void remove_layout1(struct __test_metadata *const _metadata)
@@ -378,7 +389,8 @@ static void remove_layout1(struct __test_metadata *const _metadata)
EXPECT_EQ(0, remove_path(dir_s2d2));
EXPECT_EQ(0, remove_path(file1_s3d1));
- EXPECT_EQ(0, remove_path(dir_s3d3));
+ EXPECT_EQ(0, remove_path(file1_s3d3));
+ EXPECT_EQ(0, remove_path(file1_s3d4));
set_cap(_metadata, CAP_SYS_ADMIN);
umount(dir_s3d2);
clear_cap(_metadata, CAP_SYS_ADMIN);
@@ -1957,8 +1969,8 @@ TEST_F_FORK(layout1, relative_chroot_chdir)
test_relative_path(_metadata, REL_CHROOT_CHDIR);
}
-static void copy_binary(struct __test_metadata *const _metadata,
- const char *const dst_path)
+static void copy_file(struct __test_metadata *const _metadata,
+ const char *const src_path, const char *const dst_path)
{
int dst_fd, src_fd;
struct stat statbuf;
@@ -1968,11 +1980,10 @@ static void copy_binary(struct __test_metadata *const _metadata,
{
TH_LOG("Failed to open \"%s\": %s", dst_path, strerror(errno));
}
- src_fd = open(BINARY_PATH, O_RDONLY | O_CLOEXEC);
+ src_fd = open(src_path, O_RDONLY | O_CLOEXEC);
ASSERT_LE(0, src_fd)
{
- TH_LOG("Failed to open \"" BINARY_PATH "\": %s",
- strerror(errno));
+ TH_LOG("Failed to open \"%s\": %s", src_path, strerror(errno));
}
ASSERT_EQ(0, fstat(src_fd, &statbuf));
ASSERT_EQ(statbuf.st_size,
@@ -2003,11 +2014,26 @@ static void test_execute(struct __test_metadata *const _metadata, const int err,
ASSERT_EQ(1, WIFEXITED(status));
ASSERT_EQ(err ? 2 : 0, WEXITSTATUS(status))
{
- TH_LOG("Unexpected return code for \"%s\": %s", path,
- strerror(errno));
+ TH_LOG("Unexpected return code for \"%s\"", path);
};
}
+static void test_check_exec(struct __test_metadata *const _metadata,
+ const int err, const char *const path)
+{
+ int ret;
+ char *const argv[] = { (char *)path, NULL };
+
+ ret = execveat(AT_FDCWD, path, argv, NULL,
+ AT_EMPTY_PATH | AT_EXECVE_CHECK);
+ if (err) {
+ EXPECT_EQ(-1, ret);
+ EXPECT_EQ(errno, err);
+ } else {
+ EXPECT_EQ(0, ret);
+ }
+}
+
TEST_F_FORK(layout1, execute)
{
const struct rule rules[] = {
@@ -2021,9 +2047,13 @@ TEST_F_FORK(layout1, execute)
create_ruleset(_metadata, rules[0].access, rules);
ASSERT_LE(0, ruleset_fd);
- copy_binary(_metadata, file1_s1d1);
- copy_binary(_metadata, file1_s1d2);
- copy_binary(_metadata, file1_s1d3);
+ copy_file(_metadata, bin_true, file1_s1d1);
+ copy_file(_metadata, bin_true, file1_s1d2);
+ copy_file(_metadata, bin_true, file1_s1d3);
+
+ /* Checks before file1_s1d1 being denied. */
+ test_execute(_metadata, 0, file1_s1d1);
+ test_check_exec(_metadata, 0, file1_s1d1);
enforce_ruleset(_metadata, ruleset_fd);
ASSERT_EQ(0, close(ruleset_fd));
@@ -2031,14 +2061,94 @@ TEST_F_FORK(layout1, execute)
ASSERT_EQ(0, test_open(dir_s1d1, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d1, O_RDONLY));
test_execute(_metadata, EACCES, file1_s1d1);
+ test_check_exec(_metadata, EACCES, file1_s1d1);
ASSERT_EQ(0, test_open(dir_s1d2, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d2, O_RDONLY));
test_execute(_metadata, 0, file1_s1d2);
+ test_check_exec(_metadata, 0, file1_s1d2);
ASSERT_EQ(0, test_open(dir_s1d3, O_RDONLY));
ASSERT_EQ(0, test_open(file1_s1d3, O_RDONLY));
test_execute(_metadata, 0, file1_s1d3);
+ test_check_exec(_metadata, 0, file1_s1d3);
+}
+
+TEST_F_FORK(layout1, umount_sandboxer)
+{
+ int pipe_child[2], pipe_parent[2];
+ char buf_parent;
+ pid_t child;
+ int status;
+
+ copy_file(_metadata, bin_sandbox_and_launch, file1_s3d3);
+ ASSERT_EQ(0, pipe2(pipe_child, 0));
+ ASSERT_EQ(0, pipe2(pipe_parent, 0));
+
+ child = fork();
+ ASSERT_LE(0, child);
+ if (child == 0) {
+ char pipe_child_str[12], pipe_parent_str[12];
+ char *const argv[] = { (char *)file1_s3d3,
+ (char *)bin_wait_pipe, pipe_child_str,
+ pipe_parent_str, NULL };
+
+ /* Passes the pipe FDs to the executed binary and its child. */
+ EXPECT_EQ(0, close(pipe_child[0]));
+ EXPECT_EQ(0, close(pipe_parent[1]));
+ snprintf(pipe_child_str, sizeof(pipe_child_str), "%d",
+ pipe_child[1]);
+ snprintf(pipe_parent_str, sizeof(pipe_parent_str), "%d",
+ pipe_parent[0]);
+
+ /*
+ * We need bin_sandbox_and_launch (copied inside the mount as
+ * file1_s3d3) to execute bin_wait_pipe (outside the mount) to
+ * make sure the mount point will not be EBUSY because of
+ * file1_s3d3 being in use. This avoids a potential race
+ * condition between the following read() and umount() calls.
+ */
+ ASSERT_EQ(0, execve(argv[0], argv, NULL))
+ {
+ TH_LOG("Failed to execute \"%s\": %s", argv[0],
+ strerror(errno));
+ };
+ _exit(1);
+ return;
+ }
+
+ EXPECT_EQ(0, close(pipe_child[1]));
+ EXPECT_EQ(0, close(pipe_parent[0]));
+
+ /* Waits for the child to sandbox itself. */
+ EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1));
+
+ /* Tests that the sandboxer is tied to its mount point. */
+ set_cap(_metadata, CAP_SYS_ADMIN);
+ EXPECT_EQ(-1, umount(dir_s3d2));
+ EXPECT_EQ(EBUSY, errno);
+ clear_cap(_metadata, CAP_SYS_ADMIN);
+
+ /* Signals the child to launch a grandchild. */
+ EXPECT_EQ(1, write(pipe_parent[1], ".", 1));
+
+ /* Waits for the grandchild. */
+ EXPECT_EQ(1, read(pipe_child[0], &buf_parent, 1));
+
+ /* Tests that the domain's sandboxer is not tied to its mount point. */
+ set_cap(_metadata, CAP_SYS_ADMIN);
+ EXPECT_EQ(0, umount(dir_s3d2))
+ {
+ TH_LOG("Failed to umount \"%s\": %s", dir_s3d2,
+ strerror(errno));
+ };
+ clear_cap(_metadata, CAP_SYS_ADMIN);
+
+ /* Signals the grandchild to terminate. */
+ EXPECT_EQ(1, write(pipe_parent[1], ".", 1));
+ ASSERT_EQ(child, waitpid(child, &status, 0));
+ ASSERT_EQ(1, WIFEXITED(status));
+ ASSERT_EQ(0, WEXITSTATUS(status));
}
TEST_F_FORK(layout1, link)
@@ -2444,6 +2554,44 @@ TEST_F_FORK(layout1, refer_mount_root_deny)
EXPECT_EQ(0, close(root_fd));
}
+TEST_F_FORK(layout1, refer_part_mount_tree_is_allowed)
+{
+ const struct rule layer1[] = {
+ {
+ /* Parent mount point. */
+ .path = dir_s3d1,
+ .access = LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG,
+ },
+ {
+ /*
+ * Removing the source file is allowed because its
+ * access rights are already a superset of the
+ * destination.
+ */
+ .path = dir_s3d4,
+ .access = LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG |
+ LANDLOCK_ACCESS_FS_REMOVE_FILE,
+ },
+ {},
+ };
+ int ruleset_fd;
+
+ ASSERT_EQ(0, unlink(file1_s3d3));
+ ruleset_fd = create_ruleset(_metadata,
+ LANDLOCK_ACCESS_FS_REFER |
+ LANDLOCK_ACCESS_FS_MAKE_REG |
+ LANDLOCK_ACCESS_FS_REMOVE_FILE,
+ layer1);
+
+ ASSERT_LE(0, ruleset_fd);
+ enforce_ruleset(_metadata, ruleset_fd);
+ ASSERT_EQ(0, close(ruleset_fd));
+
+ ASSERT_EQ(0, rename(file1_s3d4, file1_s3d3));
+}
+
TEST_F_FORK(layout1, reparent_link)
{
const struct rule layer1[] = {
diff --git a/tools/testing/selftests/landlock/ptrace_test.c b/tools/testing/selftests/landlock/ptrace_test.c
index a19db4d0b3bd..8f31b673ff2d 100644
--- a/tools/testing/selftests/landlock/ptrace_test.c
+++ b/tools/testing/selftests/landlock/ptrace_test.c
@@ -22,8 +22,6 @@
/* Copied from security/yama/yama_lsm.c */
#define YAMA_SCOPE_DISABLED 0
#define YAMA_SCOPE_RELATIONAL 1
-#define YAMA_SCOPE_CAPABILITY 2
-#define YAMA_SCOPE_NO_ATTACH 3
static void create_domain(struct __test_metadata *const _metadata)
{
diff --git a/tools/testing/selftests/landlock/sandbox-and-launch.c b/tools/testing/selftests/landlock/sandbox-and-launch.c
new file mode 100644
index 000000000000..3e32e1a51ac5
--- /dev/null
+++ b/tools/testing/selftests/landlock/sandbox-and-launch.c
@@ -0,0 +1,82 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Sandbox itself and execute another program (in a different mount point).
+ *
+ * Used by layout1.umount_sandboxer from fs_test.c
+ *
+ * Copyright © 2024-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <errno.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <sys/prctl.h>
+#include <unistd.h>
+
+#include "wrappers.h"
+
+int main(int argc, char *argv[])
+{
+ struct landlock_ruleset_attr ruleset_attr = {
+ .scoped = LANDLOCK_SCOPE_SIGNAL,
+ };
+ int pipe_child, pipe_parent, ruleset_fd;
+ char buf;
+
+ /*
+ * The first argument must be the file descriptor number of a pipe.
+ * The second argument must be the program to execute.
+ */
+ if (argc != 4) {
+ fprintf(stderr, "Wrong number of arguments (not three)\n");
+ return 1;
+ }
+
+ pipe_child = atoi(argv[2]);
+ pipe_parent = atoi(argv[3]);
+
+ ruleset_fd =
+ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+ if (ruleset_fd < 0) {
+ perror("Failed to create ruleset");
+ return 1;
+ }
+
+ if (prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0)) {
+ perror("Failed to call prctl()");
+ return 1;
+ }
+
+ if (landlock_restrict_self(ruleset_fd, 0)) {
+ perror("Failed to restrict self");
+ return 1;
+ }
+
+ if (close(ruleset_fd)) {
+ perror("Failed to close ruleset");
+ return 1;
+ }
+
+ /* Signals that we are sandboxed. */
+ errno = 0;
+ if (write(pipe_child, ".", 1) != 1) {
+ perror("Failed to write to the second argument");
+ return 1;
+ }
+
+ /* Waits for the parent to try to umount. */
+ if (read(pipe_parent, &buf, 1) != 1) {
+ perror("Failed to write to the third argument");
+ return 1;
+ }
+
+ /* Shifts arguments. */
+ argv[0] = argv[1];
+ argv[1] = argv[2];
+ argv[2] = argv[3];
+ argv[3] = NULL;
+ execve(argv[0], argv, NULL);
+ perror("Failed to execute the provided binary");
+ return 1;
+}
diff --git a/tools/testing/selftests/landlock/wait-pipe.c b/tools/testing/selftests/landlock/wait-pipe.c
new file mode 100644
index 000000000000..0dbcd260a0fa
--- /dev/null
+++ b/tools/testing/selftests/landlock/wait-pipe.c
@@ -0,0 +1,42 @@
+// SPDX-License-Identifier: GPL-2.0
+/*
+ * Write in a pipe and wait.
+ *
+ * Used by layout1.umount_sandboxer from fs_test.c
+ *
+ * Copyright © 2024-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <stdio.h>
+#include <stdlib.h>
+#include <unistd.h>
+
+int main(int argc, char *argv[])
+{
+ int pipe_child, pipe_parent;
+ char buf;
+
+ /* The first argument must be the file descriptor number of a pipe. */
+ if (argc != 3) {
+ fprintf(stderr, "Wrong number of arguments (not two)\n");
+ return 1;
+ }
+
+ pipe_child = atoi(argv[1]);
+ pipe_parent = atoi(argv[2]);
+
+ /* Signals that we are waiting. */
+ if (write(pipe_child, ".", 1) != 1) {
+ perror("Failed to write to first argument");
+ return 1;
+ }
+
+ /* Waits for the parent do its test. */
+ if (read(pipe_parent, &buf, 1) != 1) {
+ perror("Failed to write to the second argument");
+ return 1;
+ }
+
+ return 0;
+}
diff --git a/tools/testing/selftests/landlock/wrappers.h b/tools/testing/selftests/landlock/wrappers.h
new file mode 100644
index 000000000000..65548323e45d
--- /dev/null
+++ b/tools/testing/selftests/landlock/wrappers.h
@@ -0,0 +1,47 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Syscall wrappers
+ *
+ * Copyright © 2017-2020 Mickaël Salaün <mic@digikod.net>
+ * Copyright © 2019-2020 ANSSI
+ * Copyright © 2021-2025 Microsoft Corporation
+ */
+
+#define _GNU_SOURCE
+#include <linux/landlock.h>
+#include <sys/syscall.h>
+#include <sys/types.h>
+#include <unistd.h>
+
+#ifndef landlock_create_ruleset
+static inline int
+landlock_create_ruleset(const struct landlock_ruleset_attr *const attr,
+ const size_t size, const __u32 flags)
+{
+ return syscall(__NR_landlock_create_ruleset, attr, size, flags);
+}
+#endif
+
+#ifndef landlock_add_rule
+static inline int landlock_add_rule(const int ruleset_fd,
+ const enum landlock_rule_type rule_type,
+ const void *const rule_attr,
+ const __u32 flags)
+{
+ return syscall(__NR_landlock_add_rule, ruleset_fd, rule_type, rule_attr,
+ flags);
+}
+#endif
+
+#ifndef landlock_restrict_self
+static inline int landlock_restrict_self(const int ruleset_fd,
+ const __u32 flags)
+{
+ return syscall(__NR_landlock_restrict_self, ruleset_fd, flags);
+}
+#endif
+
+static inline pid_t sys_gettid(void)
+{
+ return syscall(__NR_gettid);
+}
diff --git a/tools/testing/selftests/livepatch/test-callbacks.sh b/tools/testing/selftests/livepatch/test-callbacks.sh
index 37bbc3fb2780..2a03deb26a12 100755
--- a/tools/testing/selftests/livepatch/test-callbacks.sh
+++ b/tools/testing/selftests/livepatch/test-callbacks.sh
@@ -259,7 +259,7 @@ $MOD_TARGET: ${MOD_TARGET}_init
% insmod test_modules/$MOD_LIVEPATCH.ko pre_patch_ret=-19
livepatch: enabling patch '$MOD_LIVEPATCH'
livepatch: '$MOD_LIVEPATCH': initializing patching transition
-test_klp_callbacks_demo: pre_patch_callback: vmlinux
+$MOD_LIVEPATCH: pre_patch_callback: vmlinux
livepatch: pre-patch callback failed for object 'vmlinux'
livepatch: failed to enable patch '$MOD_LIVEPATCH'
livepatch: '$MOD_LIVEPATCH': canceling patching transition, going to unpatch
diff --git a/tools/testing/selftests/livepatch/test-sysfs.sh b/tools/testing/selftests/livepatch/test-sysfs.sh
index 2c91428d2997..58fe1d96997c 100755
--- a/tools/testing/selftests/livepatch/test-sysfs.sh
+++ b/tools/testing/selftests/livepatch/test-sysfs.sh
@@ -5,6 +5,8 @@
. $(dirname $0)/functions.sh
MOD_LIVEPATCH=test_klp_livepatch
+MOD_LIVEPATCH2=test_klp_callbacks_demo
+MOD_LIVEPATCH3=test_klp_syscall
setup_config
@@ -19,6 +21,8 @@ check_sysfs_rights "$MOD_LIVEPATCH" "enabled" "-rw-r--r--"
check_sysfs_value "$MOD_LIVEPATCH" "enabled" "1"
check_sysfs_rights "$MOD_LIVEPATCH" "force" "--w-------"
check_sysfs_rights "$MOD_LIVEPATCH" "replace" "-r--r--r--"
+check_sysfs_rights "$MOD_LIVEPATCH" "stack_order" "-r--r--r--"
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
check_sysfs_rights "$MOD_LIVEPATCH" "transition" "-r--r--r--"
check_sysfs_value "$MOD_LIVEPATCH" "transition" "0"
check_sysfs_rights "$MOD_LIVEPATCH" "vmlinux/patched" "-r--r--r--"
@@ -131,4 +135,71 @@ livepatch: '$MOD_LIVEPATCH': completing unpatching transition
livepatch: '$MOD_LIVEPATCH': unpatching complete
% rmmod $MOD_LIVEPATCH"
+start_test "sysfs test stack_order value"
+
+load_lp $MOD_LIVEPATCH
+
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
+
+load_lp $MOD_LIVEPATCH2
+
+check_sysfs_value "$MOD_LIVEPATCH2" "stack_order" "2"
+
+load_lp $MOD_LIVEPATCH3
+
+check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "3"
+
+disable_lp $MOD_LIVEPATCH2
+unload_lp $MOD_LIVEPATCH2
+
+check_sysfs_value "$MOD_LIVEPATCH" "stack_order" "1"
+check_sysfs_value "$MOD_LIVEPATCH3" "stack_order" "2"
+
+disable_lp $MOD_LIVEPATCH3
+unload_lp $MOD_LIVEPATCH3
+
+disable_lp $MOD_LIVEPATCH
+unload_lp $MOD_LIVEPATCH
+
+check_result "% insmod test_modules/$MOD_LIVEPATCH.ko
+livepatch: enabling patch '$MOD_LIVEPATCH'
+livepatch: '$MOD_LIVEPATCH': initializing patching transition
+livepatch: '$MOD_LIVEPATCH': starting patching transition
+livepatch: '$MOD_LIVEPATCH': completing patching transition
+livepatch: '$MOD_LIVEPATCH': patching complete
+% insmod test_modules/$MOD_LIVEPATCH2.ko
+livepatch: enabling patch '$MOD_LIVEPATCH2'
+livepatch: '$MOD_LIVEPATCH2': initializing patching transition
+$MOD_LIVEPATCH2: pre_patch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': starting patching transition
+livepatch: '$MOD_LIVEPATCH2': completing patching transition
+$MOD_LIVEPATCH2: post_patch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': patching complete
+% insmod test_modules/$MOD_LIVEPATCH3.ko
+livepatch: enabling patch '$MOD_LIVEPATCH3'
+livepatch: '$MOD_LIVEPATCH3': initializing patching transition
+livepatch: '$MOD_LIVEPATCH3': starting patching transition
+livepatch: '$MOD_LIVEPATCH3': completing patching transition
+livepatch: '$MOD_LIVEPATCH3': patching complete
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH2/enabled
+livepatch: '$MOD_LIVEPATCH2': initializing unpatching transition
+$MOD_LIVEPATCH2: pre_unpatch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH2': completing unpatching transition
+$MOD_LIVEPATCH2: post_unpatch_callback: vmlinux
+livepatch: '$MOD_LIVEPATCH2': unpatching complete
+% rmmod $MOD_LIVEPATCH2
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH3/enabled
+livepatch: '$MOD_LIVEPATCH3': initializing unpatching transition
+livepatch: '$MOD_LIVEPATCH3': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH3': completing unpatching transition
+livepatch: '$MOD_LIVEPATCH3': unpatching complete
+% rmmod $MOD_LIVEPATCH3
+% echo 0 > $SYSFS_KLP_DIR/$MOD_LIVEPATCH/enabled
+livepatch: '$MOD_LIVEPATCH': initializing unpatching transition
+livepatch: '$MOD_LIVEPATCH': starting unpatching transition
+livepatch: '$MOD_LIVEPATCH': completing unpatching transition
+livepatch: '$MOD_LIVEPATCH': unpatching complete
+% rmmod $MOD_LIVEPATCH"
+
exit 0
diff --git a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
index 66dec47e3ca3..732e89fe99c0 100644
--- a/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
+++ b/tools/testing/selftests/lsm/lsm_set_self_attr_test.c
@@ -56,16 +56,15 @@ TEST(flags_zero_lsm_set_self_attr)
TEST(flags_overset_lsm_set_self_attr)
{
const long page_size = sysconf(_SC_PAGESIZE);
- char *ctx = calloc(page_size, 1);
+ struct lsm_ctx *ctx = calloc(page_size, 1);
__u32 size = page_size;
- struct lsm_ctx *tctx = (struct lsm_ctx *)ctx;
ASSERT_NE(NULL, ctx);
if (attr_lsm_count()) {
- ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, tctx, &size,
+ ASSERT_LE(1, lsm_get_self_attr(LSM_ATTR_CURRENT, ctx, &size,
0));
}
- ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, tctx,
+ ASSERT_EQ(-1, lsm_set_self_attr(LSM_ATTR_CURRENT | LSM_ATTR_PREV, ctx,
size, 0));
free(ctx);
diff --git a/tools/testing/selftests/media_tests/regression_test.txt b/tools/testing/selftests/media_tests/regression_test.txt
index 2627367681f7..9d0fcd98c085 100644
--- a/tools/testing/selftests/media_tests/regression_test.txt
+++ b/tools/testing/selftests/media_tests/regression_test.txt
@@ -1,5 +1,5 @@
Testing for regressions in Media Controller API register, ioctl, syscall,
-and unregister paths. There have a few problems that result in user-after
+and unregister paths. There have a few problems that result in use-after
free on media_device, media_devnode, and cdev pointers when the driver is
unbound while ioctl is in progress.
@@ -15,11 +15,11 @@ Build media_device_test
cd tools/testing/selftests/media_tests
make
-Regressions test for cdev user-after free error on /dev/mediaX when driver
+Regressions test for cdev use-after-free error on /dev/mediaX when driver
is unbound:
Start media_device_test to regression test media devnode dynamic alloc
-and cdev user-after-free fixes. This opens media dev files and sits in
+and cdev use-after-free fixes. This opens media dev files and sits in
a loop running media ioctl MEDIA_IOC_DEVICE_INFO command once every 10
seconds. The idea is when device file goes away, media devnode and cdev
should stick around until this test exits.
@@ -40,4 +40,4 @@ keep ioctls going while bind/unbind runs.
Copy bind_unbind_sample.txt and make changes to specify the driver name
and number to run bind and unbind. Start the bind_unbind.sh
-Run dmesg looking for any user-after free errors or mutex lock errors.
+Run dmesg looking for any use-after-free errors or mutex lock errors.
diff --git a/tools/testing/selftests/memfd/memfd_test.c b/tools/testing/selftests/memfd/memfd_test.c
index 95af2d78fd31..c0c53451a16d 100644
--- a/tools/testing/selftests/memfd/memfd_test.c
+++ b/tools/testing/selftests/memfd/memfd_test.c
@@ -9,6 +9,7 @@
#include <fcntl.h>
#include <linux/memfd.h>
#include <sched.h>
+#include <stdbool.h>
#include <stdio.h>
#include <stdlib.h>
#include <signal.h>
@@ -281,6 +282,24 @@ static void *mfd_assert_mmap_shared(int fd)
return p;
}
+static void *mfd_assert_mmap_read_shared(int fd)
+{
+ void *p;
+
+ p = mmap(NULL,
+ mfd_def_size,
+ PROT_READ,
+ MAP_SHARED,
+ fd,
+ 0);
+ if (p == MAP_FAILED) {
+ printf("mmap() failed: %m\n");
+ abort();
+ }
+
+ return p;
+}
+
static void *mfd_assert_mmap_private(int fd)
{
void *p;
@@ -979,6 +998,30 @@ static void test_seal_future_write(void)
close(fd);
}
+static void test_seal_write_map_read_shared(void)
+{
+ int fd;
+ void *p;
+
+ printf("%s SEAL-WRITE-MAP-READ\n", memfd_str);
+
+ fd = mfd_assert_new("kern_memfd_seal_write_map_read",
+ mfd_def_size,
+ MFD_CLOEXEC | MFD_ALLOW_SEALING);
+
+ mfd_assert_add_seals(fd, F_SEAL_WRITE);
+ mfd_assert_has_seals(fd, F_SEAL_WRITE);
+
+ p = mfd_assert_mmap_read_shared(fd);
+
+ mfd_assert_read(fd);
+ mfd_assert_read_shared(fd);
+ mfd_fail_write(fd);
+
+ munmap(p, mfd_def_size);
+ close(fd);
+}
+
/*
* Test SEAL_SHRINK
* Test whether SEAL_SHRINK actually prevents shrinking
@@ -1557,6 +1600,11 @@ static void test_share_fork(char *banner, char *b_suffix)
close(fd);
}
+static bool pid_ns_supported(void)
+{
+ return access("/proc/self/ns/pid", F_OK) == 0;
+}
+
int main(int argc, char **argv)
{
pid_t pid;
@@ -1587,12 +1635,17 @@ int main(int argc, char **argv)
test_seal_write();
test_seal_future_write();
+ test_seal_write_map_read_shared();
test_seal_shrink();
test_seal_grow();
test_seal_resize();
- test_sysctl_simple();
- test_sysctl_nested();
+ if (pid_ns_supported()) {
+ test_sysctl_simple();
+ test_sysctl_nested();
+ } else {
+ printf("PID namespaces are not supported; skipping sysctl tests\n");
+ }
test_share_dup("SHARE-DUP", "");
test_share_mmap("SHARE-MMAP", "");
diff --git a/tools/testing/selftests/mm/cow.c b/tools/testing/selftests/mm/cow.c
index 32c6ccc2a6be..1238e1c5aae1 100644
--- a/tools/testing/selftests/mm/cow.c
+++ b/tools/testing/selftests/mm/cow.c
@@ -758,7 +758,7 @@ static void do_run_with_base_page(test_fn fn, bool swapout)
}
/* Populate a base page. */
- memset(mem, 0, pagesize);
+ memset(mem, 1, pagesize);
if (swapout) {
madvise(mem, pagesize, MADV_PAGEOUT);
@@ -824,12 +824,12 @@ static void do_run_with_thp(test_fn fn, enum thp_run thp_run, size_t thpsize)
* Try to populate a THP. Touch the first sub-page and test if
* we get the last sub-page populated automatically.
*/
- mem[0] = 0;
+ mem[0] = 1;
if (!pagemap_is_populated(pagemap_fd, mem + thpsize - pagesize)) {
ksft_test_result_skip("Did not get a THP populated\n");
goto munmap;
}
- memset(mem, 0, thpsize);
+ memset(mem, 1, thpsize);
size = thpsize;
switch (thp_run) {
@@ -1012,7 +1012,7 @@ static void run_with_hugetlb(test_fn fn, const char *desc, size_t hugetlbsize)
}
/* Populate an huge page. */
- memset(mem, 0, hugetlbsize);
+ memset(mem, 1, hugetlbsize);
/*
* We need a total of two hugetlb pages to handle COW/unsharing
diff --git a/tools/testing/selftests/mm/hugetlb_dio.c b/tools/testing/selftests/mm/hugetlb_dio.c
index 432d5af15e66..db63abe5ee5e 100644
--- a/tools/testing/selftests/mm/hugetlb_dio.c
+++ b/tools/testing/selftests/mm/hugetlb_dio.c
@@ -76,19 +76,15 @@ void run_dio_using_hugetlb(unsigned int start_off, unsigned int end_off)
/* Get the free huge pages after unmap*/
free_hpage_a = get_free_hugepages();
+ ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
+ ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
+
/*
* If the no. of free hugepages before allocation and after unmap does
* not match - that means there could still be a page which is pinned.
*/
- if (free_hpage_a != free_hpage_b) {
- ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
- ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
- ksft_test_result_fail(": Huge pages not freed!\n");
- } else {
- ksft_print_msg("No. Free pages before allocation : %d\n", free_hpage_b);
- ksft_print_msg("No. Free pages after munmap : %d\n", free_hpage_a);
- ksft_test_result_pass(": Huge pages freed successfully !\n");
- }
+ ksft_test_result(free_hpage_a == free_hpage_b,
+ "free huge pages from %u-%u\n", start_off, end_off);
}
int main(void)
diff --git a/tools/testing/selftests/net/Makefile b/tools/testing/selftests/net/Makefile
index cb2fc601de66..73ee88d6b043 100644
--- a/tools/testing/selftests/net/Makefile
+++ b/tools/testing/selftests/net/Makefile
@@ -32,6 +32,7 @@ TEST_PROGS += ioam6.sh
TEST_PROGS += gro.sh
TEST_PROGS += gre_gso.sh
TEST_PROGS += cmsg_so_mark.sh
+TEST_PROGS += cmsg_so_priority.sh
TEST_PROGS += cmsg_time.sh cmsg_ipv6.sh
TEST_PROGS += netns-name.sh
TEST_PROGS += nl_netdev.py
@@ -95,6 +96,7 @@ TEST_PROGS += test_bridge_backup_port.sh
TEST_PROGS += fdb_flush.sh fdb_notify.sh
TEST_PROGS += fq_band_pktlimit.sh
TEST_PROGS += vlan_hw_filter.sh
+TEST_PROGS += vlan_bridge_binding.sh
TEST_PROGS += bpf_offload.py
TEST_PROGS += ipv6_route_update_soft_lockup.sh
TEST_PROGS += busy_poll_test.sh
diff --git a/tools/testing/selftests/net/busy_poller.c b/tools/testing/selftests/net/busy_poller.c
index 99b0e8c17fca..04c7ff577bb8 100644
--- a/tools/testing/selftests/net/busy_poller.c
+++ b/tools/testing/selftests/net/busy_poller.c
@@ -54,16 +54,16 @@ struct epoll_params {
#define EPIOCGPARAMS _IOR(EPOLL_IOC_TYPE, 0x02, struct epoll_params)
#endif
-static uint32_t cfg_port = 8000;
+static uint16_t cfg_port = 8000;
static struct in_addr cfg_bind_addr = { .s_addr = INADDR_ANY };
static char *cfg_outfile;
static int cfg_max_events = 8;
-static int cfg_ifindex;
+static uint32_t cfg_ifindex;
/* busy poll params */
static uint32_t cfg_busy_poll_usecs;
-static uint32_t cfg_busy_poll_budget;
-static uint32_t cfg_prefer_busy_poll;
+static uint16_t cfg_busy_poll_budget;
+static uint8_t cfg_prefer_busy_poll;
/* IRQ params */
static uint32_t cfg_defer_hard_irqs;
@@ -79,6 +79,7 @@ static void usage(const char *filepath)
static void parse_opts(int argc, char **argv)
{
+ unsigned long long tmp;
int ret;
int c;
@@ -86,31 +87,40 @@ static void parse_opts(int argc, char **argv)
usage(argv[0]);
while ((c = getopt(argc, argv, "p:m:b:u:P:g:o:d:r:s:i:")) != -1) {
+ /* most options take integer values, except o and b, so reduce
+ * code duplication a bit for the common case by calling
+ * strtoull here and leave bounds checking and casting per
+ * option below.
+ */
+ if (c != 'o' && c != 'b')
+ tmp = strtoull(optarg, NULL, 0);
+
switch (c) {
case 'u':
- cfg_busy_poll_usecs = strtoul(optarg, NULL, 0);
- if (cfg_busy_poll_usecs == ULONG_MAX ||
- cfg_busy_poll_usecs > UINT32_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT32_MAX)
error(1, ERANGE, "busy_poll_usecs too large");
+
+ cfg_busy_poll_usecs = (uint32_t)tmp;
break;
case 'P':
- cfg_prefer_busy_poll = strtoul(optarg, NULL, 0);
- if (cfg_prefer_busy_poll == ULONG_MAX ||
- cfg_prefer_busy_poll > 1)
+ if (tmp == ULLONG_MAX || tmp > 1)
error(1, ERANGE,
"prefer busy poll should be 0 or 1");
+
+ cfg_prefer_busy_poll = (uint8_t)tmp;
break;
case 'g':
- cfg_busy_poll_budget = strtoul(optarg, NULL, 0);
- if (cfg_busy_poll_budget == ULONG_MAX ||
- cfg_busy_poll_budget > UINT16_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT16_MAX)
error(1, ERANGE,
"busy poll budget must be [0, UINT16_MAX]");
+
+ cfg_busy_poll_budget = (uint16_t)tmp;
break;
case 'p':
- cfg_port = strtoul(optarg, NULL, 0);
- if (cfg_port > UINT16_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT16_MAX)
error(1, ERANGE, "port must be <= 65535");
+
+ cfg_port = (uint16_t)tmp;
break;
case 'b':
ret = inet_aton(optarg, &cfg_bind_addr);
@@ -124,41 +134,39 @@ static void parse_opts(int argc, char **argv)
error(1, 0, "outfile invalid");
break;
case 'm':
- cfg_max_events = strtol(optarg, NULL, 0);
-
- if (cfg_max_events == LONG_MIN ||
- cfg_max_events == LONG_MAX ||
- cfg_max_events <= 0)
+ if (tmp == ULLONG_MAX || tmp > INT_MAX)
error(1, ERANGE,
- "max events must be > 0 and < LONG_MAX");
+ "max events must be > 0 and <= INT_MAX");
+
+ cfg_max_events = (int)tmp;
break;
case 'd':
- cfg_defer_hard_irqs = strtoul(optarg, NULL, 0);
-
- if (cfg_defer_hard_irqs == ULONG_MAX ||
- cfg_defer_hard_irqs > INT32_MAX)
+ if (tmp == ULLONG_MAX || tmp > INT32_MAX)
error(1, ERANGE,
"defer_hard_irqs must be <= INT32_MAX");
+
+ cfg_defer_hard_irqs = (uint32_t)tmp;
break;
case 'r':
- cfg_gro_flush_timeout = strtoull(optarg, NULL, 0);
-
- if (cfg_gro_flush_timeout == ULLONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT64_MAX)
error(1, ERANGE,
- "gro_flush_timeout must be < ULLONG_MAX");
+ "gro_flush_timeout must be < UINT64_MAX");
+
+ cfg_gro_flush_timeout = (uint64_t)tmp;
break;
case 's':
- cfg_irq_suspend_timeout = strtoull(optarg, NULL, 0);
-
- if (cfg_irq_suspend_timeout == ULLONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > UINT64_MAX)
error(1, ERANGE,
"irq_suspend_timeout must be < ULLONG_MAX");
+
+ cfg_irq_suspend_timeout = (uint64_t)tmp;
break;
case 'i':
- cfg_ifindex = strtoul(optarg, NULL, 0);
- if (cfg_ifindex == ULONG_MAX)
+ if (tmp == ULLONG_MAX || tmp > INT_MAX)
error(1, ERANGE,
- "ifindex must be < ULONG_MAX");
+ "ifindex must be <= INT_MAX");
+
+ cfg_ifindex = (int)tmp;
break;
}
}
@@ -215,7 +223,7 @@ static void setup_queue(void)
struct netdev_napi_set_req *set_req = NULL;
struct ynl_sock *ys;
struct ynl_error yerr;
- uint32_t napi_id;
+ uint32_t napi_id = 0;
ys = ynl_sock_create(&ynl_netdev_family, &yerr);
if (!ys)
@@ -277,8 +285,8 @@ static void run_poller(void)
* here
*/
epoll_params.busy_poll_usecs = cfg_busy_poll_usecs;
- epoll_params.busy_poll_budget = (uint16_t)cfg_busy_poll_budget;
- epoll_params.prefer_busy_poll = (uint8_t)cfg_prefer_busy_poll;
+ epoll_params.busy_poll_budget = cfg_busy_poll_budget;
+ epoll_params.prefer_busy_poll = cfg_prefer_busy_poll;
epoll_params.__pad = 0;
val = 1;
@@ -342,5 +350,9 @@ int main(int argc, char *argv[])
parse_opts(argc, argv);
setup_queue();
run_poller();
+
+ if (cfg_outfile)
+ free(cfg_outfile);
+
return 0;
}
diff --git a/tools/testing/selftests/net/cmsg_sender.c b/tools/testing/selftests/net/cmsg_sender.c
index 876c2db02a63..bc314382e4e1 100644
--- a/tools/testing/selftests/net/cmsg_sender.c
+++ b/tools/testing/selftests/net/cmsg_sender.c
@@ -59,6 +59,7 @@ struct options {
unsigned int proto;
} sock;
struct option_cmsg_u32 mark;
+ struct option_cmsg_u32 priority;
struct {
bool ena;
unsigned int delay;
@@ -97,6 +98,8 @@ static void __attribute__((noreturn)) cs_usage(const char *bin)
"\n"
"\t\t-m val Set SO_MARK with given value\n"
"\t\t-M val Set SO_MARK via setsockopt\n"
+ "\t\t-P val Set SO_PRIORITY via setsockopt\n"
+ "\t\t-Q val Set SO_PRIORITY via cmsg\n"
"\t\t-d val Set SO_TXTIME with given delay (usec)\n"
"\t\t-t Enable time stamp reporting\n"
"\t\t-f val Set don't fragment via cmsg\n"
@@ -115,7 +118,7 @@ static void cs_parse_args(int argc, char *argv[])
{
int o;
- while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:")) != -1) {
+ while ((o = getopt(argc, argv, "46sS:p:P:m:M:n:d:tf:F:c:C:l:L:H:Q:")) != -1) {
switch (o) {
case 's':
opt.silent_send = true;
@@ -148,6 +151,10 @@ static void cs_parse_args(int argc, char *argv[])
opt.mark.ena = true;
opt.mark.val = atoi(optarg);
break;
+ case 'Q':
+ opt.priority.ena = true;
+ opt.priority.val = atoi(optarg);
+ break;
case 'M':
opt.sockopt.mark = atoi(optarg);
break;
@@ -253,6 +260,8 @@ cs_write_cmsg(int fd, struct msghdr *msg, char *cbuf, size_t cbuf_sz)
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_SOCKET, SO_MARK, &opt.mark);
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
+ SOL_SOCKET, SO_PRIORITY, &opt.priority);
+ ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_IPV6, IPV6_DONTFRAG, &opt.v6.dontfrag);
ca_write_cmsg_u32(cbuf, cbuf_sz, &cmsg_len,
SOL_IPV6, IPV6_TCLASS, &opt.v6.tclass);
diff --git a/tools/testing/selftests/net/cmsg_so_priority.sh b/tools/testing/selftests/net/cmsg_so_priority.sh
new file mode 100755
index 000000000000..ee07d8653262
--- /dev/null
+++ b/tools/testing/selftests/net/cmsg_so_priority.sh
@@ -0,0 +1,151 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+source lib.sh
+
+readonly KSFT_SKIP=4
+
+IP4=192.0.2.1/24
+TGT4=192.0.2.2
+TGT4_RAW=192.0.2.3
+IP6=2001:db8::1/64
+TGT6=2001:db8::2
+TGT6_RAW=2001:db8::3
+PORT=1234
+TOTAL_TESTS=0
+FAILED_TESTS=0
+
+if ! command -v jq &> /dev/null; then
+ echo "SKIP cmsg_so_priroity.sh test: jq is not installed." >&2
+ exit "$KSFT_SKIP"
+fi
+
+check_result() {
+ ((TOTAL_TESTS++))
+ if [ "$1" -ne 0 ]; then
+ ((FAILED_TESTS++))
+ fi
+}
+
+cleanup()
+{
+ cleanup_ns $NS
+}
+
+trap cleanup EXIT
+
+setup_ns NS
+
+create_filter() {
+ local handle=$1
+ local vlan_prio=$2
+ local ip_type=$3
+ local proto=$4
+ local dst_ip=$5
+ local ip_proto
+
+ if [[ "$proto" == "u" ]]; then
+ ip_proto="udp"
+ elif [[ "$ip_type" == "ipv4" && "$proto" == "i" ]]; then
+ ip_proto="icmp"
+ elif [[ "$ip_type" == "ipv6" && "$proto" == "i" ]]; then
+ ip_proto="icmpv6"
+ fi
+
+ tc -n $NS filter add dev dummy1 \
+ egress pref 1 handle "$handle" proto 802.1q \
+ flower vlan_prio "$vlan_prio" vlan_ethtype "$ip_type" \
+ dst_ip "$dst_ip" ${ip_proto:+ip_proto $ip_proto} \
+ action pass
+}
+
+ip -n $NS link set dev lo up
+ip -n $NS link add name dummy1 up type dummy
+
+ip -n $NS link add link dummy1 name dummy1.10 up type vlan id 10 \
+ egress-qos-map 0:0 1:1 2:2 3:3 4:4 5:5 6:6 7:7
+
+ip -n $NS address add $IP4 dev dummy1.10
+ip -n $NS address add $IP6 dev dummy1.10 nodad
+
+ip netns exec $NS sysctl -wq net.ipv4.ping_group_range='0 2147483647'
+
+ip -n $NS neigh add $TGT4 lladdr 00:11:22:33:44:55 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT6 lladdr 00:11:22:33:44:55 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT4_RAW lladdr 00:11:22:33:44:66 nud permanent \
+ dev dummy1.10
+ip -n $NS neigh add $TGT6_RAW lladdr 00:11:22:33:44:66 nud permanent \
+ dev dummy1.10
+
+tc -n $NS qdisc add dev dummy1 clsact
+
+FILTER_COUNTER=10
+
+for i in 4 6; do
+ for proto in u i r; do
+ echo "Test IPV$i, prot: $proto"
+ for priority in {0..7}; do
+ if [[ $i == 4 && $proto == "r" ]]; then
+ TGT=$TGT4_RAW
+ elif [[ $i == 6 && $proto == "r" ]]; then
+ TGT=$TGT6_RAW
+ elif [ $i == 4 ]; then
+ TGT=$TGT4
+ else
+ TGT=$TGT6
+ fi
+
+ handle="${FILTER_COUNTER}${priority}"
+
+ create_filter $handle $priority ipv$i $proto $TGT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+
+ if [[ $pkts == 0 ]]; then
+ check_result 0
+ else
+ echo "prio $priority: expected 0, got $pkts"
+ check_result 1
+ fi
+
+ ip netns exec $NS ./cmsg_sender -$i -Q $priority \
+ -p $proto $TGT $PORT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+ if [[ $pkts == 1 ]]; then
+ check_result 0
+ else
+ echo "prio $priority -Q: expected 1, got $pkts"
+ check_result 1
+ fi
+
+ ip netns exec $NS ./cmsg_sender -$i -P $priority \
+ -p $proto $TGT $PORT
+
+ pkts=$(tc -n $NS -j -s filter show dev dummy1 egress \
+ | jq ".[] | select(.options.handle == ${handle}) | \
+ .options.actions[0].stats.packets")
+ if [[ $pkts == 2 ]]; then
+ check_result 0
+ else
+ echo "prio $priority -P: expected 2, got $pkts"
+ check_result 1
+ fi
+ done
+ FILTER_COUNTER=$((FILTER_COUNTER + 10))
+ done
+done
+
+if [ $FAILED_TESTS -ne 0 ]; then
+ echo "FAIL - $FAILED_TESTS/$TOTAL_TESTS tests failed"
+ exit 1
+else
+ echo "OK - All $TOTAL_TESTS tests passed"
+ exit 0
+fi
diff --git a/tools/testing/selftests/net/cmsg_time.sh b/tools/testing/selftests/net/cmsg_time.sh
index 1d7e756644bc..478af0aefa97 100755
--- a/tools/testing/selftests/net/cmsg_time.sh
+++ b/tools/testing/selftests/net/cmsg_time.sh
@@ -34,13 +34,28 @@ BAD=0
TOTAL=0
check_result() {
+ local ret=$1
+ local got=$2
+ local exp=$3
+ local case=$4
+ local xfail=$5
+ local xf=
+ local inc=
+
+ if [ "$xfail" == "xfail" ]; then
+ xf="(XFAIL)"
+ inc=0
+ else
+ inc=1
+ fi
+
((TOTAL++))
- if [ $1 -ne 0 ]; then
- echo " Case $4 returned $1, expected 0"
- ((BAD++))
+ if [ $ret -ne 0 ]; then
+ echo " Case $case returned $ret, expected 0 $xf"
+ ((BAD+=inc))
elif [ "$2" != "$3" ]; then
- echo " Case $4 returned '$2', expected '$3'"
- ((BAD++))
+ echo " Case $case returned '$got', expected '$exp' $xf"
+ ((BAD+=inc))
fi
}
@@ -66,14 +81,14 @@ for i in "-4 $TGT4" "-6 $TGT6"; do
awk '/SND/ { if ($3 > 1000) print "OK"; }')
check_result $? "$ts" "OK" "$prot - TXTIME abs"
- [ "$KSFT_MACHINE_SLOW" = yes ] && delay=8000 || delay=1000
+ [ "$KSFT_MACHINE_SLOW" = yes ] && xfail=xfail
- ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d $delay |
+ ts=$(ip netns exec $NS ./cmsg_sender -p $p $i 1234 -t -d 1000 |
awk '/SND/ {snd=$3}
/SCHED/ {sch=$3}
- END { if (snd - sch > '$((delay/2))') print "OK";
- else print snd, "-", sch, "<", '$((delay/2))'; }')
- check_result $? "$ts" "OK" "$prot - TXTIME rel"
+ END { if (snd - sch > 500) print "OK";
+ else print snd, "-", sch, "<", 500; }')
+ check_result $? "$ts" "OK" "$prot - TXTIME rel" $xfail
done
done
diff --git a/tools/testing/selftests/net/fdb_notify.sh b/tools/testing/selftests/net/fdb_notify.sh
index c03151e7791c..c159230c9b62 100755
--- a/tools/testing/selftests/net/fdb_notify.sh
+++ b/tools/testing/selftests/net/fdb_notify.sh
@@ -49,7 +49,7 @@ test_dup_vxlan_self()
{
ip_link_add br up type bridge vlan_filtering 1
ip_link_add vx up type vxlan id 2000 dstport 4789
- ip_link_master vx br
+ ip_link_set_master vx br
do_test_dup add "vxlan" dev vx self dst 192.0.2.1
do_test_dup del "vxlan" dev vx self dst 192.0.2.1
@@ -59,7 +59,7 @@ test_dup_vxlan_master()
{
ip_link_add br up type bridge vlan_filtering 1
ip_link_add vx up type vxlan id 2000 dstport 4789
- ip_link_master vx br
+ ip_link_set_master vx br
do_test_dup add "vxlan master" dev vx master
do_test_dup del "vxlan master" dev vx master
@@ -79,7 +79,7 @@ test_dup_macvlan_master()
ip_link_add br up type bridge vlan_filtering 1
ip_link_add dd up type dummy
ip_link_add mv up link dd type macvlan mode passthru
- ip_link_master mv br
+ ip_link_set_master mv br
do_test_dup add "macvlan master" dev mv self
do_test_dup del "macvlan master" dev mv self
diff --git a/tools/testing/selftests/net/fib_rule_tests.sh b/tools/testing/selftests/net/fib_rule_tests.sh
index 1d58b3b87465..847936363a12 100755
--- a/tools/testing/selftests/net/fib_rule_tests.sh
+++ b/tools/testing/selftests/net/fib_rule_tests.sh
@@ -291,6 +291,37 @@ fib_rule6_test()
"$getnomatch" "iif dscp redirect to table" \
"iif dscp no redirect to table"
fi
+
+ fib_check_iproute_support "flowlabel" "flowlabel"
+ if [ $? -eq 0 ]; then
+ match="flowlabel 0xfffff"
+ getmatch="flowlabel 0xfffff"
+ getnomatch="flowlabel 0xf"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "flowlabel redirect to table" \
+ "flowlabel no redirect to table"
+
+ match="flowlabel 0xfffff"
+ getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff"
+ getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "iif flowlabel redirect to table" \
+ "iif flowlabel no redirect to table"
+
+ match="flowlabel 0x08000/0x08000"
+ getmatch="flowlabel 0xfffff"
+ getnomatch="flowlabel 0xf7fff"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "flowlabel masked redirect to table" \
+ "flowlabel masked no redirect to table"
+
+ match="flowlabel 0x08000/0x08000"
+ getmatch="from $SRC_IP6 iif $DEV flowlabel 0xfffff"
+ getnomatch="from $SRC_IP6 iif $DEV flowlabel 0xf7fff"
+ fib_rule6_test_match_n_redirect "$match" "$getmatch" \
+ "$getnomatch" "iif flowlabel masked redirect to table" \
+ "iif flowlabel masked no redirect to table"
+ fi
}
fib_rule6_vrf_test()
diff --git a/tools/testing/selftests/net/forwarding/Makefile b/tools/testing/selftests/net/forwarding/Makefile
index 7d885cff8d79..00bde7b6f39e 100644
--- a/tools/testing/selftests/net/forwarding/Makefile
+++ b/tools/testing/selftests/net/forwarding/Makefile
@@ -105,6 +105,7 @@ TEST_PROGS = bridge_fdb_learning_limit.sh \
vxlan_bridge_1q_port_8472_ipv6.sh \
vxlan_bridge_1q_port_8472.sh \
vxlan_bridge_1q.sh \
+ vxlan_reserved.sh \
vxlan_symmetric_ipv6.sh \
vxlan_symmetric.sh
diff --git a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
index 1c8a26046589..2b5700b61ffa 100755
--- a/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
+++ b/tools/testing/selftests/net/forwarding/bridge_vlan_unaware.sh
@@ -1,7 +1,7 @@
#!/bin/bash
# SPDX-License-Identifier: GPL-2.0
-ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding"
+ALL_TESTS="ping_ipv4 ping_ipv6 learning flooding pvid_change"
NUM_NETIFS=4
source lib.sh
@@ -77,12 +77,16 @@ cleanup()
ping_ipv4()
{
- ping_test $h1 192.0.2.2
+ local msg=$1
+
+ ping_test $h1 192.0.2.2 "$msg"
}
ping_ipv6()
{
- ping6_test $h1 2001:db8:1::2
+ local msg=$1
+
+ ping6_test $h1 2001:db8:1::2 "$msg"
}
learning()
@@ -95,6 +99,21 @@ flooding()
flood_test $swp2 $h1 $h2
}
+pvid_change()
+{
+ # Test that the changing of the VLAN-aware PVID does not affect
+ # VLAN-unaware forwarding
+ bridge vlan add vid 3 dev $swp1 pvid untagged
+
+ ping_ipv4 " with bridge port $swp1 PVID changed"
+ ping_ipv6 " with bridge port $swp1 PVID changed"
+
+ bridge vlan del vid 3 dev $swp1
+
+ ping_ipv4 " with bridge port $swp1 PVID deleted"
+ ping_ipv6 " with bridge port $swp1 PVID deleted"
+}
+
trap cleanup EXIT
setup_prepare
diff --git a/tools/testing/selftests/net/forwarding/lib.sh b/tools/testing/selftests/net/forwarding/lib.sh
index 7337f398f9cc..8de80acf249e 100644
--- a/tools/testing/selftests/net/forwarding/lib.sh
+++ b/tools/testing/selftests/net/forwarding/lib.sh
@@ -68,6 +68,7 @@ declare -A NETIFS=(
: "${REQUIRE_JQ:=yes}"
: "${REQUIRE_MZ:=yes}"
: "${REQUIRE_MTOOLS:=no}"
+: "${REQUIRE_TEAMD:=no}"
# Whether to override MAC addresses on interfaces participating in the test.
: "${STABLE_MAC_ADDRS:=no}"
@@ -321,6 +322,9 @@ fi
if [[ "$REQUIRE_MZ" = "yes" ]]; then
require_command $MZ
fi
+if [[ "$REQUIRE_TEAMD" = "yes" ]]; then
+ require_command $TEAMD
+fi
if [[ "$REQUIRE_MTOOLS" = "yes" ]]; then
# https://github.com/troglobit/mtools
require_command msend
@@ -932,13 +936,6 @@ packets_rate()
echo $(((t1 - t0) / interval))
}
-mac_get()
-{
- local if_name=$1
-
- ip -j link show dev $if_name | jq -r '.[]["address"]'
-}
-
ether_addr_to_u64()
{
local addr="$1"
diff --git a/tools/testing/selftests/net/forwarding/local_termination.sh b/tools/testing/selftests/net/forwarding/local_termination.sh
index c35548767756..ecd34f364125 100755
--- a/tools/testing/selftests/net/forwarding/local_termination.sh
+++ b/tools/testing/selftests/net/forwarding/local_termination.sh
@@ -7,7 +7,6 @@ ALL_TESTS="standalone vlan_unaware_bridge vlan_aware_bridge test_vlan \
NUM_NETIFS=2
PING_COUNT=1
REQUIRE_MTOOLS=yes
-REQUIRE_MZ=no
source lib.sh
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
index fe4d7c906a70..a20d22d1df36 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_bridge_1q_lag.sh
@@ -49,6 +49,7 @@ ALL_TESTS="
test_mirror_gretap_second
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=6
source lib.sh
source mirror_lib.sh
diff --git a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
index 1261e6f46e34..ff7049582d35 100755
--- a/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
+++ b/tools/testing/selftests/net/forwarding/mirror_gre_lag_lacp.sh
@@ -53,6 +53,7 @@ ALL_TESTS="
test_mirror_gretap_second
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=6
source lib.sh
source mirror_lib.sh
diff --git a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
index e064b946e821..16583a470ec3 100755
--- a/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
+++ b/tools/testing/selftests/net/forwarding/router_bridge_1d_lag.sh
@@ -109,6 +109,7 @@ ALL_TESTS="
ping_ipv4
ping_ipv6
"
+REQUIRE_TEAMD="yes"
NUM_NETIFS=8
source lib.sh
diff --git a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
index f05ffe213c46..2a4cd1af1b85 100755
--- a/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
+++ b/tools/testing/selftests/net/forwarding/router_bridge_lag.sh
@@ -76,6 +76,7 @@
ping_ipv4
ping_ipv6
"}
+REQUIRE_TEAMD="yes"
NUM_NETIFS=8
: ${lib_dir:=.}
source $lib_dir/lib.sh
diff --git a/tools/testing/selftests/net/forwarding/vxlan_reserved.sh b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh
new file mode 100755
index 000000000000..46c31794b91b
--- /dev/null
+++ b/tools/testing/selftests/net/forwarding/vxlan_reserved.sh
@@ -0,0 +1,352 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+# +--------------------+
+# | H1 (vrf) |
+# | + $h1 |
+# | | 192.0.2.1/28 |
+# +----|---------------+
+# |
+# +----|--------------------------------+
+# | SW | |
+# | +--|------------------------------+ |
+# | | + $swp1 BR1 (802.1d) | |
+# | | | |
+# | | + vx1 (vxlan) | |
+# | | local 192.0.2.17 | |
+# | | id 1000 dstport $VXPORT | |
+# | +---------------------------------+ |
+# | |
+# | 192.0.2.32/28 via 192.0.2.18 |
+# | |
+# | + $rp1 |
+# | | 192.0.2.17/28 |
+# +--|----------------------------------+
+# |
+# +--|----------------------------------+
+# | | |
+# | + $rp2 |
+# | 192.0.2.18/28 |
+# | |
+# | VRP2 (vrf) |
+# +-------------------------------------+
+
+: ${VXPORT:=4789}
+: ${ALL_TESTS:="
+ default_test
+ plain_test
+ reserved_0_test
+ reserved_10_test
+ reserved_31_test
+ reserved_56_test
+ reserved_63_test
+ "}
+
+NUM_NETIFS=4
+source lib.sh
+
+h1_create()
+{
+ simple_if_init $h1 192.0.2.1/28
+ defer simple_if_fini $h1 192.0.2.1/28
+
+ tc qdisc add dev $h1 clsact
+ defer tc qdisc del dev $h1 clsact
+
+ tc filter add dev $h1 ingress pref 77 \
+ prot ip flower skip_hw ip_proto icmp action drop
+ defer tc filter del dev $h1 ingress pref 77
+}
+
+switch_create()
+{
+ ip_link_add br1 type bridge vlan_filtering 0 mcast_snooping 0
+ # Make sure the bridge uses the MAC address of the local port and not
+ # that of the VxLAN's device.
+ ip_link_set_addr br1 $(mac_get $swp1)
+ ip_link_set_up br1
+
+ ip_link_set_up $rp1
+ ip_addr_add $rp1 192.0.2.17/28
+ ip_route_add 192.0.2.32/28 nexthop via 192.0.2.18
+
+ ip_link_set_master $swp1 br1
+ ip_link_set_up $swp1
+}
+
+vrp2_create()
+{
+ simple_if_init $rp2 192.0.2.18/28
+ defer simple_if_fini $rp2 192.0.2.18/28
+}
+
+setup_prepare()
+{
+ h1=${NETIFS[p1]}
+ swp1=${NETIFS[p2]}
+
+ rp1=${NETIFS[p3]}
+ rp2=${NETIFS[p4]}
+
+ vrf_prepare
+ defer vrf_cleanup
+
+ forwarding_enable
+ defer forwarding_restore
+
+ h1_create
+ switch_create
+
+ vrp2_create
+}
+
+vxlan_header_bytes()
+{
+ local vni=$1; shift
+ local -a extra_bits=("$@")
+ local -a bits
+ local i
+
+ for ((i=0; i < 64; i++)); do
+ bits[i]=0
+ done
+
+ # Bit 4 is the I flag and is always on.
+ bits[4]=1
+
+ for i in ${extra_bits[@]}; do
+ bits[i]=1
+ done
+
+ # Bits 32..55 carry the VNI
+ local mask=0x800000
+ for ((i=0; i < 24; i++)); do
+ bits[$((i + 32))]=$(((vni & mask) != 0))
+ ((mask >>= 1))
+ done
+
+ local bytes
+ for ((i=0; i < 8; i++)); do
+ local byte=0
+ local j
+ for ((j=0; j < 8; j++)); do
+ local bit=${bits[8 * i + j]}
+ ((byte += bit << (7 - j)))
+ done
+ bytes+=$(printf %02x $byte):
+ done
+
+ echo ${bytes%:}
+}
+
+neg_bytes()
+{
+ local bytes=$1; shift
+
+ local -A neg=([0]=f [1]=e [2]=d [3]=c [4]=b [5]=a [6]=9 [7]=8
+ [8]=7 [9]=6 [a]=5 [b]=4 [c]=3 [d]=2 [e]=1 [f]=0 [:]=:)
+ local out
+ local i
+
+ for ((i=0; i < ${#bytes}; i++)); do
+ local c=${bytes:$i:1}
+ out+=${neg[$c]}
+ done
+ echo $out
+}
+
+vxlan_ping_do()
+{
+ local count=$1; shift
+ local dev=$1; shift
+ local next_hop_mac=$1; shift
+ local dest_ip=$1; shift
+ local dest_mac=$1; shift
+ local vni=$1; shift
+ local reserved_bits=$1; shift
+
+ local vxlan_header=$(vxlan_header_bytes $vni $reserved_bits)
+
+ $MZ $dev -c $count -d 100msec -q \
+ -b $next_hop_mac -B $dest_ip \
+ -t udp sp=23456,dp=$VXPORT,p=$(:
+ )"$vxlan_header:"$( : VXLAN
+ )"$dest_mac:"$( : ETH daddr
+ )"00:11:22:33:44:55:"$( : ETH saddr
+ )"08:00:"$( : ETH type
+ )"45:"$( : IP version + IHL
+ )"00:"$( : IP TOS
+ )"00:54:"$( : IP total length
+ )"99:83:"$( : IP identification
+ )"40:00:"$( : IP flags + frag off
+ )"40:"$( : IP TTL
+ )"01:"$( : IP proto
+ )"00:00:"$( : IP header csum
+ )"$(ipv4_to_bytes 192.0.2.3):"$( : IP saddr
+ )"$(ipv4_to_bytes 192.0.2.1):"$( : IP daddr
+ )"08:"$( : ICMP type
+ )"00:"$( : ICMP code
+ )"8b:f2:"$( : ICMP csum
+ )"1f:6a:"$( : ICMP request identifier
+ )"00:01:"$( : ICMP request seq. number
+ )"4f:ff:c5:5b:00:00:00:00:"$( : ICMP payload
+ )"6d:74:0b:00:00:00:00:00:"$( :
+ )"10:11:12:13:14:15:16:17:"$( :
+ )"18:19:1a:1b:1c:1d:1e:1f:"$( :
+ )"20:21:22:23:24:25:26:27:"$( :
+ )"28:29:2a:2b:2c:2d:2e:2f:"$( :
+ )"30:31:32:33:34:35:36:37"
+}
+
+vxlan_device_add()
+{
+ ip_link_add vx1 up type vxlan id 1000 \
+ local 192.0.2.17 dstport "$VXPORT" \
+ nolearning noudpcsum tos inherit ttl 100 "$@"
+ ip_link_set_master vx1 br1
+}
+
+vxlan_all_reserved_bits()
+{
+ local i
+
+ for ((i=0; i < 64; i++)); do
+ if ((i == 4 || i >= 32 && i < 56)); then
+ continue
+ fi
+ echo $i
+ done
+}
+
+vxlan_ping_vanilla()
+{
+ vxlan_ping_do 10 $rp2 $(mac_get $rp1) 192.0.2.17 $(mac_get $h1) 1000
+}
+
+vxlan_ping_reserved()
+{
+ for bit in $(vxlan_all_reserved_bits); do
+ vxlan_ping_do 1 $rp2 $(mac_get $rp1) \
+ 192.0.2.17 $(mac_get $h1) 1000 "$bit"
+ ((n++))
+ done
+}
+
+vxlan_ping_test()
+{
+ local what=$1; shift
+ local get_stat=$1; shift
+ local expect=$1; shift
+
+ RET=0
+
+ local t0=$($get_stat)
+
+ "$@"
+ check_err $? "Failure when running $@"
+
+ local t1=$($get_stat)
+ local delta=$((t1 - t0))
+
+ ((expect == delta))
+ check_err $? "Expected to capture $expect packets, got $delta."
+
+ log_test "$what"
+}
+
+__default_test_do()
+{
+ local n_allowed_bits=$1; shift
+ local what=$1; shift
+
+ vxlan_ping_test "$what: clean packets" \
+ "tc_rule_stats_get $h1 77 ingress" \
+ 10 vxlan_ping_vanilla
+
+ local t0=$(link_stats_get vx1 rx errors)
+ vxlan_ping_test "$what: mangled packets" \
+ "tc_rule_stats_get $h1 77 ingress" \
+ $n_allowed_bits vxlan_ping_reserved
+ local t1=$(link_stats_get vx1 rx errors)
+
+ RET=0
+ local expect=$((39 - n_allowed_bits))
+ local delta=$((t1 - t0))
+ ((expect == delta))
+ check_err $? "Expected $expect error packets, got $delta."
+ log_test "$what: drops reported"
+}
+
+default_test_do()
+{
+ vxlan_device_add
+ __default_test_do 0 "Default"
+}
+
+default_test()
+{
+ in_defer_scope \
+ default_test_do
+}
+
+plain_test_do()
+{
+ vxlan_device_add reserved_bits 0xf7ffffff000000ff
+ __default_test_do 0 "reserved_bits 0xf7ffffff000000ff"
+}
+
+plain_test()
+{
+ in_defer_scope \
+ plain_test_do
+}
+
+reserved_test()
+{
+ local bit=$1; shift
+
+ local allowed_bytes=$(vxlan_header_bytes 0xffffff $bit)
+ local reserved_bytes=$(neg_bytes $allowed_bytes)
+ local reserved_bits=${reserved_bytes//:/}
+
+ vxlan_device_add reserved_bits 0x$reserved_bits
+ __default_test_do 1 "reserved_bits 0x$reserved_bits"
+}
+
+reserved_0_test()
+{
+ in_defer_scope \
+ reserved_test 0
+}
+
+reserved_10_test()
+{
+ in_defer_scope \
+ reserved_test 10
+}
+
+reserved_31_test()
+{
+ in_defer_scope \
+ reserved_test 31
+}
+
+reserved_56_test()
+{
+ in_defer_scope \
+ reserved_test 56
+}
+
+reserved_63_test()
+{
+ in_defer_scope \
+ reserved_test 63
+}
+
+trap cleanup EXIT
+
+setup_prepare
+setup_wait
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/ipsec.c b/tools/testing/selftests/net/ipsec.c
index be4a30a0d02a..9b44a091802c 100644
--- a/tools/testing/selftests/net/ipsec.c
+++ b/tools/testing/selftests/net/ipsec.c
@@ -227,7 +227,8 @@ static int rtattr_pack(struct nlmsghdr *nh, size_t req_sz,
attr->rta_len = RTA_LENGTH(size);
attr->rta_type = rta_type;
- memcpy(RTA_DATA(attr), payload, size);
+ if (payload)
+ memcpy(RTA_DATA(attr), payload, size);
return 0;
}
diff --git a/tools/testing/selftests/net/lib.sh b/tools/testing/selftests/net/lib.sh
index 8994fec1c38f..0bd9a038a1f0 100644
--- a/tools/testing/selftests/net/lib.sh
+++ b/tools/testing/selftests/net/lib.sh
@@ -435,6 +435,13 @@ xfail_on_veth()
fi
}
+mac_get()
+{
+ local if_name=$1
+
+ ip -j link show dev $if_name | jq -r '.[]["address"]'
+}
+
kill_process()
{
local pid=$1; shift
@@ -451,7 +458,7 @@ ip_link_add()
defer ip link del dev "$name"
}
-ip_link_master()
+ip_link_set_master()
{
local member=$1; shift
local master=$1; shift
@@ -459,3 +466,62 @@ ip_link_master()
ip link set dev "$member" master "$master"
defer ip link set dev "$member" nomaster
}
+
+ip_link_set_addr()
+{
+ local name=$1; shift
+ local addr=$1; shift
+
+ local old_addr=$(mac_get "$name")
+ ip link set dev "$name" address "$addr"
+ defer ip link set dev "$name" address "$old_addr"
+}
+
+ip_link_is_up()
+{
+ local name=$1; shift
+
+ local state=$(ip -j link show "$name" |
+ jq -r '(.[].flags[] | select(. == "UP")) // "DOWN"')
+ [[ $state == "UP" ]]
+}
+
+ip_link_set_up()
+{
+ local name=$1; shift
+
+ if ! ip_link_is_up "$name"; then
+ ip link set dev "$name" up
+ defer ip link set dev "$name" down
+ fi
+}
+
+ip_link_set_down()
+{
+ local name=$1; shift
+
+ if ip_link_is_up "$name"; then
+ ip link set dev "$name" down
+ defer ip link set dev "$name" up
+ fi
+}
+
+ip_addr_add()
+{
+ local name=$1; shift
+
+ ip addr add dev "$name" "$@"
+ defer ip addr del dev "$name" "$@"
+}
+
+ip_route_add()
+{
+ ip route add "$@"
+ defer ip route del "$@"
+}
+
+bridge_vlan_add()
+{
+ bridge vlan add "$@"
+ defer bridge vlan del "$@"
+}
diff --git a/tools/testing/selftests/net/lib/py/ksft.py b/tools/testing/selftests/net/lib/py/ksft.py
index 477ae76de93d..3efe005436cd 100644
--- a/tools/testing/selftests/net/lib/py/ksft.py
+++ b/tools/testing/selftests/net/lib/py/ksft.py
@@ -71,6 +71,11 @@ def ksft_in(a, b, comment=""):
_fail("Check failed", a, "not in", b, comment)
+def ksft_is(a, b, comment=""):
+ if a is not b:
+ _fail("Check failed", a, "is not", b, comment)
+
+
def ksft_ge(a, b, comment=""):
if a < b:
_fail("Check failed", a, "<", b, comment)
diff --git a/tools/testing/selftests/net/lib/py/utils.py b/tools/testing/selftests/net/lib/py/utils.py
index 72590c3f90f1..9e3bcddcf3e8 100644
--- a/tools/testing/selftests/net/lib/py/utils.py
+++ b/tools/testing/selftests/net/lib/py/utils.py
@@ -10,7 +10,9 @@ import time
class CmdExitFailure(Exception):
- pass
+ def __init__(self, msg, cmd_obj):
+ super().__init__(msg)
+ self.cmd = cmd_obj
class cmd:
@@ -48,7 +50,7 @@ class cmd:
if len(stderr) > 0 and stderr[-1] == "\n":
stderr = stderr[:-1]
raise CmdExitFailure("Command failed: %s\nSTDOUT: %s\nSTDERR: %s" %
- (self.proc.args, stdout, stderr))
+ (self.proc.args, stdout, stderr), self)
class bkg(cmd):
diff --git a/tools/testing/selftests/net/lib/py/ynl.py b/tools/testing/selftests/net/lib/py/ynl.py
index a0d689d58c57..ad1e36baee2a 100644
--- a/tools/testing/selftests/net/lib/py/ynl.py
+++ b/tools/testing/selftests/net/lib/py/ynl.py
@@ -13,14 +13,14 @@ try:
SPEC_PATH = KSFT_DIR / "net/lib/specs"
sys.path.append(tools_full_path.as_posix())
- from net.lib.ynl.lib import YnlFamily, NlError
+ from net.lib.ynl.pyynl.lib import YnlFamily, NlError
else:
# Running in tree
tools_full_path = KSRC / "tools"
SPEC_PATH = KSRC / "Documentation/netlink/specs"
sys.path.append(tools_full_path.as_posix())
- from net.ynl.lib import YnlFamily, NlError
+ from net.ynl.pyynl.lib import YnlFamily, NlError
except ModuleNotFoundError as e:
ksft_pr("Failed importing `ynl` library from kernel sources")
ksft_pr(str(e))
@@ -32,23 +32,23 @@ except ModuleNotFoundError as e:
# Set schema='' to avoid jsonschema validation, it's slow
#
class EthtoolFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('ethtool.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class RtnlFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('rt_link.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class NetdevFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('netdev.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
class NetshaperFamily(YnlFamily):
- def __init__(self):
+ def __init__(self, recv_size=0):
super().__init__((SPEC_PATH / Path('net_shaper.yaml')).as_posix(),
- schema='')
+ schema='', recv_size=recv_size)
diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.c b/tools/testing/selftests/net/mptcp/mptcp_connect.c
index 4209b9569039..414addef9a45 100644
--- a/tools/testing/selftests/net/mptcp/mptcp_connect.c
+++ b/tools/testing/selftests/net/mptcp/mptcp_connect.c
@@ -25,6 +25,8 @@
#include <sys/types.h>
#include <sys/mman.h>
+#include <arpa/inet.h>
+
#include <netdb.h>
#include <netinet/in.h>
@@ -1211,23 +1213,42 @@ static void parse_setsock_options(const char *name)
exit(1);
}
-void xdisconnect(int fd, int addrlen)
+void xdisconnect(int fd)
{
- struct sockaddr_storage empty;
+ socklen_t addrlen = sizeof(struct sockaddr_storage);
+ struct sockaddr_storage addr, empty;
int msec_sleep = 10;
- int queued = 1;
- int i;
+ void *raw_addr;
+ int i, cmdlen;
+ char cmd[128];
+
+ /* get the local address and convert it to string */
+ if (getsockname(fd, (struct sockaddr *)&addr, &addrlen) < 0)
+ xerror("getsockname");
+
+ if (addr.ss_family == AF_INET)
+ raw_addr = &(((struct sockaddr_in *)&addr)->sin_addr);
+ else if (addr.ss_family == AF_INET6)
+ raw_addr = &(((struct sockaddr_in6 *)&addr)->sin6_addr);
+ else
+ xerror("bad family");
+
+ strcpy(cmd, "ss -M | grep -q ");
+ cmdlen = strlen(cmd);
+ if (!inet_ntop(addr.ss_family, raw_addr, &cmd[cmdlen],
+ sizeof(cmd) - cmdlen))
+ xerror("inet_ntop");
shutdown(fd, SHUT_WR);
- /* while until the pending data is completely flushed, the later
+ /*
+ * wait until the pending data is completely flushed and all
+ * the MPTCP sockets reached the closed status.
* disconnect will bypass/ignore/drop any pending data.
*/
for (i = 0; ; i += msec_sleep) {
- if (ioctl(fd, SIOCOUTQ, &queued) < 0)
- xerror("can't query out socket queue: %d", errno);
-
- if (!queued)
+ /* closed socket are not listed by 'ss' */
+ if (system(cmd) != 0)
break;
if (i > poll_timeout)
@@ -1281,9 +1302,9 @@ again:
return ret;
if (cfg_truncate > 0) {
- xdisconnect(fd, peer->ai_addrlen);
+ xdisconnect(fd);
} else if (--cfg_repeat > 0) {
- xdisconnect(fd, peer->ai_addrlen);
+ xdisconnect(fd);
/* the socket could be unblocking at this point, we need the
* connect to be blocking
diff --git a/tools/testing/selftests/net/mptcp/mptcp_connect.sh b/tools/testing/selftests/net/mptcp/mptcp_connect.sh
index b48b4e56826a..5e3c56253274 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_connect.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_connect.sh
@@ -137,7 +137,7 @@ TEST_GROUP=""
#shellcheck disable=SC2317
cleanup()
{
- rm -f "$cin_disconnect" "$cout_disconnect"
+ rm -f "$cin_disconnect"
rm -f "$cin" "$cout"
rm -f "$sin" "$sout"
rm -f "$capout"
@@ -155,7 +155,6 @@ cin=$(mktemp)
cout=$(mktemp)
capout=$(mktemp)
cin_disconnect="$cin".disconnect
-cout_disconnect="$cout".disconnect
trap cleanup EXIT
mptcp_lib_ns_init ns1 ns2 ns3 ns4
@@ -445,12 +444,8 @@ do_transfer()
printf "(duration %05sms) " "${duration}"
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
mptcp_lib_pr_fail "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
- cat /tmp/${listener_ns}.out
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
- [ ${listener_ns} != ${connector_ns} ] && cat /tmp/${connector_ns}.out
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
echo
cat "$capout"
@@ -587,7 +582,7 @@ make_file()
mptcp_lib_make_file $name 1024 $ksize
dd if=/dev/urandom conv=notrunc of="$name" oflag=append bs=1 count=$rem 2> /dev/null
- echo "Created $name (size $(du -b "$name")) containing data sent by $who"
+ echo "Created $name (size $(stat -c "%s" "$name") B) containing data sent by $who"
}
run_tests_lo()
diff --git a/tools/testing/selftests/net/mptcp/mptcp_join.sh b/tools/testing/selftests/net/mptcp/mptcp_join.sh
index c07e2bd3a315..13a3b68181ee 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_join.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_join.sh
@@ -1039,13 +1039,8 @@ do_transfer()
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
fail_test "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
- cat /tmp/${listener_ns}.out
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
- cat /tmp/${connector_ns}.out
-
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
return 1
fi
diff --git a/tools/testing/selftests/net/mptcp/mptcp_lib.sh b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
index 975d4d4c862a..051e289d7967 100644
--- a/tools/testing/selftests/net/mptcp/mptcp_lib.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_lib.sh
@@ -107,6 +107,27 @@ mptcp_lib_pr_info() {
mptcp_lib_print_info "INFO: ${*}"
}
+# $1-2: listener/connector ns ; $3 port ; $4-5 listener/connector stat file
+mptcp_lib_pr_err_stats() {
+ local lns="${1}"
+ local cns="${2}"
+ local port="${3}"
+ local lstat="${4}"
+ local cstat="${5}"
+
+ echo -en "${MPTCP_LIB_COLOR_RED}"
+ {
+ printf "\nnetns %s (listener) socket stat for %d:\n" "${lns}" "${port}"
+ ip netns exec "${lns}" ss -Menitam -o "sport = :${port}"
+ cat "${lstat}"
+
+ printf "\nnetns %s (connector) socket stat for %d:\n" "${cns}" "${port}"
+ ip netns exec "${cns}" ss -Menitam -o "dport = :${port}"
+ [ "${lstat}" != "${cstat}" ] && cat "${cstat}"
+ } 1>&2
+ echo -en "${MPTCP_LIB_COLOR_RESET}"
+}
+
# SELFTESTS_MPTCP_LIB_EXPECT_ALL_FEATURES env var can be set when validating all
# features using the last version of the kernel and the selftests to make sure
# a test is not being skipped by mistake.
diff --git a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
index 5e8d5b83e2d0..418a903c3a4d 100755
--- a/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
+++ b/tools/testing/selftests/net/mptcp/mptcp_sockopt.sh
@@ -169,6 +169,11 @@ do_transfer()
cmsg+=",TCPINQ"
fi
+ NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \
+ nstat -n
+ NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \
+ nstat -n
+
timeout ${timeout_test} \
ip netns exec ${listener_ns} \
$mptcp_connect -t ${timeout_poll} -l -M 1 -p $port -s ${srv_proto} -c "${cmsg}" \
@@ -189,14 +194,16 @@ do_transfer()
wait $spid
local rets=$?
+ NSTAT_HISTORY=/tmp/${listener_ns}.nstat ip netns exec ${listener_ns} \
+ nstat | grep Tcp > /tmp/${listener_ns}.out
+ NSTAT_HISTORY=/tmp/${connector_ns}.nstat ip netns exec ${connector_ns} \
+ nstat | grep Tcp > /tmp/${connector_ns}.out
+
print_title "Transfer ${ip:2}"
if [ ${rets} -ne 0 ] || [ ${retc} -ne 0 ]; then
mptcp_lib_pr_fail "client exit code $retc, server $rets"
- echo -e "\nnetns ${listener_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${listener_ns} ss -Menita 1>&2 -o "sport = :$port"
-
- echo -e "\nnetns ${connector_ns} socket stat for ${port}:" 1>&2
- ip netns exec ${connector_ns} ss -Menita 1>&2 -o "dport = :$port"
+ mptcp_lib_pr_err_stats "${listener_ns}" "${connector_ns}" "${port}" \
+ "/tmp/${listener_ns}.out" "/tmp/${connector_ns}.out"
mptcp_lib_result_fail "transfer ${ip}"
diff --git a/tools/testing/selftests/net/mptcp/simult_flows.sh b/tools/testing/selftests/net/mptcp/simult_flows.sh
index 8fa77c8e9b65..9c2a415976cb 100755
--- a/tools/testing/selftests/net/mptcp/simult_flows.sh
+++ b/tools/testing/selftests/net/mptcp/simult_flows.sh
@@ -155,6 +155,11 @@ do_transfer()
sleep 1
fi
+ NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \
+ nstat -n
+ NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \
+ nstat -n
+
timeout ${timeout_test} \
ip netns exec ${ns3} \
./mptcp_connect -jt ${timeout_poll} -l -p $port -T $max_time \
@@ -180,25 +185,27 @@ do_transfer()
kill ${cappid_connector}
fi
+ NSTAT_HISTORY=/tmp/${ns3}.nstat ip netns exec ${ns3} \
+ nstat | grep Tcp > /tmp/${ns3}.out
+ NSTAT_HISTORY=/tmp/${ns1}.nstat ip netns exec ${ns1} \
+ nstat | grep Tcp > /tmp/${ns1}.out
+
cmp $sin $cout > /dev/null 2>&1
local cmps=$?
cmp $cin $sout > /dev/null 2>&1
local cmpc=$?
- printf "%-16s" " max $max_time "
if [ $retc -eq 0 ] && [ $rets -eq 0 ] && \
[ $cmpc -eq 0 ] && [ $cmps -eq 0 ]; then
+ printf "%-16s" " max $max_time "
mptcp_lib_pr_ok
cat "$capout"
return 0
fi
- mptcp_lib_pr_fail
- echo "client exit code $retc, server $rets" 1>&2
- echo -e "\nnetns ${ns3} socket stat for $port:" 1>&2
- ip netns exec ${ns3} ss -nita 1>&2 -o "sport = :$port"
- echo -e "\nnetns ${ns1} socket stat for $port:" 1>&2
- ip netns exec ${ns1} ss -nita 1>&2 -o "dport = :$port"
+ mptcp_lib_pr_fail "client exit code $retc, server $rets"
+ mptcp_lib_pr_err_stats "${ns3}" "${ns1}" "${port}" \
+ "/tmp/${ns3}.out" "/tmp/${ns1}.out"
ls -l $sin $cout
ls -l $cin $sout
diff --git a/tools/testing/selftests/net/netfilter/rpath.sh b/tools/testing/selftests/net/netfilter/rpath.sh
index 4485fd7675ed..86ec4e68594d 100755
--- a/tools/testing/selftests/net/netfilter/rpath.sh
+++ b/tools/testing/selftests/net/netfilter/rpath.sh
@@ -61,9 +61,20 @@ ip -net "$ns2" a a 192.168.42.1/24 dev d0
ip -net "$ns1" a a fec0:42::2/64 dev v0 nodad
ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
+# avoid neighbor lookups and enable martian IPv6 pings
+ns2_hwaddr=$(ip -net "$ns2" link show dev v0 | \
+ sed -n 's, *link/ether \([^ ]*\) .*,\1,p')
+ns1_hwaddr=$(ip -net "$ns1" link show dev v0 | \
+ sed -n 's, *link/ether \([^ ]*\) .*,\1,p')
+ip -net "$ns1" neigh add fec0:42::1 lladdr "$ns2_hwaddr" nud permanent dev v0
+ip -net "$ns1" neigh add fec0:23::1 lladdr "$ns2_hwaddr" nud permanent dev v0
+ip -net "$ns2" neigh add fec0:42::2 lladdr "$ns1_hwaddr" nud permanent dev d0
+ip -net "$ns2" neigh add fec0:23::2 lladdr "$ns1_hwaddr" nud permanent dev v0
+
# firewall matches to test
[ -n "$iptables" ] && {
common='-t raw -A PREROUTING -s 192.168.0.0/16'
+ common+=' -p icmp --icmp-type echo-request'
if ! ip netns exec "$ns2" "$iptables" $common -m rpfilter;then
echo "Cannot add rpfilter rule"
exit $ksft_skip
@@ -72,6 +83,7 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
}
[ -n "$ip6tables" ] && {
common='-t raw -A PREROUTING -s fec0::/16'
+ common+=' -p icmpv6 --icmpv6-type echo-request'
if ! ip netns exec "$ns2" "$ip6tables" $common -m rpfilter;then
echo "Cannot add rpfilter rule"
exit $ksft_skip
@@ -82,8 +94,10 @@ ip -net "$ns2" a a fec0:42::1/64 dev d0 nodad
table inet t {
chain c {
type filter hook prerouting priority raw;
- ip saddr 192.168.0.0/16 fib saddr . iif oif exists counter
- ip6 saddr fec0::/16 fib saddr . iif oif exists counter
+ ip saddr 192.168.0.0/16 icmp type echo-request \
+ fib saddr . iif oif exists counter
+ ip6 saddr fec0::/16 icmpv6 type echo-request \
+ fib saddr . iif oif exists counter
}
}
EOF
diff --git a/tools/testing/selftests/net/nl_netdev.py b/tools/testing/selftests/net/nl_netdev.py
index 93d9d914529b..93e8cb671c3d 100755
--- a/tools/testing/selftests/net/nl_netdev.py
+++ b/tools/testing/selftests/net/nl_netdev.py
@@ -18,6 +18,23 @@ def lo_check(nf) -> None:
ksft_eq(len(lo_info['xdp-rx-metadata-features']), 0)
+def napi_list_check(nf) -> None:
+ with NetdevSimDev(queue_count=100) as nsimdev:
+ nsim = nsimdev.nsims[0]
+
+ ip(f"link set dev {nsim.ifname} up")
+
+ napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True)
+ ksft_eq(len(napis), 100)
+
+ for q in [50, 0, 99]:
+ for i in range(4):
+ nsim.dfs_write("queue_reset", f"{q} {i}")
+ napis = nf.napi_get({'ifindex': nsim.ifindex}, dump=True)
+ ksft_eq(len(napis), 100,
+ comment=f"queue count after reset queue {q} mode {i}")
+
+
def page_pool_check(nf) -> None:
with NetdevSimDev() as nsimdev:
nsim = nsimdev.nsims[0]
@@ -89,7 +106,7 @@ def page_pool_check(nf) -> None:
def main() -> None:
nf = NetdevFamily()
- ksft_run([empty_check, lo_check, page_pool_check],
+ ksft_run([empty_check, lo_check, page_pool_check, napi_list_check],
args=(nf, ))
ksft_exit()
diff --git a/tools/testing/selftests/net/openvswitch/openvswitch.sh b/tools/testing/selftests/net/openvswitch/openvswitch.sh
index cc0bfae2bafa..960e1ab4dd04 100755
--- a/tools/testing/selftests/net/openvswitch/openvswitch.sh
+++ b/tools/testing/selftests/net/openvswitch/openvswitch.sh
@@ -171,8 +171,10 @@ ovs_add_netns_and_veths () {
ovs_add_if "$1" "$2" "$4" -u || return 1
fi
- [ $TRACING -eq 1 ] && ovs_netns_spawn_daemon "$1" "$ns" \
- tcpdump -i any -s 65535
+ if [ $TRACING -eq 1 ]; then
+ ovs_netns_spawn_daemon "$1" "$3" tcpdump -l -i any -s 6553
+ ovs_wait grep -q "listening on any" ${ovs_dir}/stderr
+ fi
return 0
}
diff --git a/tools/testing/selftests/net/packetdrill/ksft_runner.sh b/tools/testing/selftests/net/packetdrill/ksft_runner.sh
index 4071c133f29e..e15c43b7359b 100755
--- a/tools/testing/selftests/net/packetdrill/ksft_runner.sh
+++ b/tools/testing/selftests/net/packetdrill/ksft_runner.sh
@@ -23,7 +23,7 @@ if [ $# -ne 1 ]; then
ktap_exit_fail_msg "usage: $0 <script>"
exit "$KSFT_FAIL"
fi
-script="$1"
+script="$(basename $1)"
if [ -z "$(which packetdrill)" ]; then
ktap_skip_all "packetdrill not found in PATH"
@@ -31,16 +31,30 @@ if [ -z "$(which packetdrill)" ]; then
fi
declare -a optargs
+failfunc=ktap_test_fail
+
if [[ -n "${KSFT_MACHINE_SLOW}" ]]; then
optargs+=('--tolerance_usecs=14000')
+
+ # xfail tests that are known flaky with dbg config, not fixable.
+ # still run them for coverage (and expect 100% pass without dbg).
+ declare -ar xfail_list=(
+ "tcp_fast_recovery_prr-ss.*.pkt"
+ "tcp_timestamping.*.pkt"
+ "tcp_user_timeout_user-timeout-probe.pkt"
+ "tcp_zerocopy_epoll_.*.pkt"
+ "tcp_tcp_info_tcp-info-*-limited.pkt"
+ )
+ readonly xfail_regex="^($(printf '%s|' "${xfail_list[@]}"))$"
+ [[ "$script" =~ ${xfail_regex} ]] && failfunc=ktap_test_xfail
fi
ktap_print_header
ktap_set_plan 2
-unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $(basename $script) > /dev/null \
- && ktap_test_pass "ipv4" || ktap_test_fail "ipv4"
-unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $(basename $script) > /dev/null \
- && ktap_test_pass "ipv6" || ktap_test_fail "ipv6"
+unshare -n packetdrill ${ipv4_args[@]} ${optargs[@]} $script > /dev/null \
+ && ktap_test_pass "ipv4" || $failfunc "ipv4"
+unshare -n packetdrill ${ipv6_args[@]} ${optargs[@]} $script > /dev/null \
+ && ktap_test_pass "ipv6" || $failfunc "ipv6"
ktap_finished
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt
new file mode 100644
index 000000000000..38535701656e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-accept.pkt
@@ -0,0 +1,18 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking accept.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+ +0...0.200 accept(3, ..., ...) = 4
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 257
+
+ +.1 write(4, ..., 2000) = 2000
+ +0 > P. 1:2001(2000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt
new file mode 100644
index 000000000000..3692ef102381
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-connect.pkt
@@ -0,0 +1,13 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking connect.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+
+ +.1...0.200 connect(3, ..., ...) = 0
+
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.1 < S. 0:0(0) ack 1 win 5792 <mss 1460,nop,wscale 2,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt
new file mode 100644
index 000000000000..914eabab367a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-read.pkt
@@ -0,0 +1,29 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking read.
+--tolerance_usecs=10000
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+
+ +0...0.100 read(4, ..., 2000) = 2000
+ +.1 < P. 1:2001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 2001
+
+ +.1...0.200 read(4, ..., 2000) = 2000
+ +.1 < P. 2001:4001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 4001
+
+ +.1 < P. 4001:6001(2000) ack 1 win 257
+ +0 > . 1:1(0) ack 6001
+ +0...0.000 read(4, ..., 1000) = 1000
+ +0...0.000 read(4, ..., 1000) = 1000
diff --git a/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt
new file mode 100644
index 000000000000..cec5a0725d95
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_blocking_blocking-write.pkt
@@ -0,0 +1,35 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test for blocking write.
+--tolerance_usecs=10000
+
+`./defaults.sh
+./set_sysctls.py /proc/sys/net/ipv4/tcp_min_tso_segs=10
+`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 50000 <mss 1000,nop,wscale 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 50000
+ +0 accept(3, ..., ...) = 4
+
+// Kernel doubles our value -> sk->sk_sndbuf is set to 42000
+ +0 setsockopt(4, SOL_SOCKET, SO_SNDBUF, [21000], 4) = 0
+ +0 getsockopt(4, SOL_SOCKET, SO_SNDBUF, [42000], [4]) = 0
+
+// A write of 60000 does not block.
+ +0...0.300 write(4, ..., 61000) = 61000 // this write() blocks
+
+ +.1 < . 1:1(0) ack 10001 win 50000
+
+ +.1 < . 1:1(0) ack 30001 win 50000
+
+// This ACK should wakeup the write(). An ACK of 35001 does not.
+ +.1 < . 1:1(0) ack 36001 win 50000
+
+// Reset to sysctls defaults.
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt
new file mode 100644
index 000000000000..8514d6bdbb6d
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-local-close-then-remote-fin.pkt
@@ -0,0 +1,23 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test basic connection teardown where local process closes first:
+// the local process calls close() first, so we send a FIN, and receive an ACK.
+// Then we receive a FIN and ACK it.
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +.01...0.011 connect(3, ..., ...) = 0
+ +0 > S 0:0(0) <...>
+ +0 < S. 0:0(0) ack 1 win 32768 <mss 1000,nop,wscale 6,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+ +0 write(3, ..., 1000) = 1000
+ +0 > P. 1:1001(1000) ack 1
+ +0 < . 1:1(0) ack 1001 win 257
+
+ +0 close(3) = 0
+ +0 > F. 1001:1001(0) ack 1
+ +0 < . 1:1(0) ack 1002 win 257
+
+ +0 < F. 1:1(0) ack 1002 win 257
+ +0 > . 1002:1002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt
new file mode 100644
index 000000000000..04103134bd99
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-on-syn-sent.pkt
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test to make sure no RST is being sent when close()
+// is called on a socket with SYN_SENT state.
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <...>
+
+// Application decideds to close the socket in SYN_SENT state
+// Make sure no RST is sent after close().
+ +0 close(3) = 0
+
+// Receive syn-ack to trigger the send side packet examination:
+// If a RESET were sent right after close(), it would have failed with
+// a mismatched timestamp.
+ +.1 < S. 0:0(0) ack 1 win 32000 <mss 1460,nop,wscale 7>
+ +0 > R 1:1(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt
new file mode 100644
index 000000000000..5f3a2914213a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_close_close-remote-fin-then-close.pkt
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify behavior for the sequence: remote side sends FIN, then we close().
+// Since the remote side (client) closes first, we test our LAST_ACK code path.
+
+`./defaults.sh`
+
+// Initialize a server socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +0 < . 1:1(0) ack 1 win 257
+
+ +0 accept(3, ..., ...) = 4
+
+// Client closes first.
+ +.01 < F. 1:1(0) ack 1 win 257
+ +0 > . 1:1(0) ack 2
+
+// App notices that client closed.
+ +0 read(4, ..., 1000) = 0
+
+// Then we close.
+ +.01 close(4) = 0
+ +0 > F. 1:1(0) ack 2
+
+// Client ACKs our FIN.
+ +.01 < . 2:2(0) ack 2 win 257
+
+// Verify that we send RST in response to any incoming segments
+// (because the kernel no longer has any record of this socket).
+ +.01 < . 2:2(0) ack 2 win 257
+ +0 > R 2:2(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt
new file mode 100644
index 000000000000..643baf3267cf
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ecn_ecn-uses-ect0.pkt
@@ -0,0 +1,21 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test ECN: verify that Linux TCP ECN sending code uses ECT0 (not ECT1).
+//
+`./defaults.sh
+sysctl -q net.ipv4.tcp_ecn=1 # fully enabled
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
+
+// ECN handshake: send EW flags in SYN packet, E flag in SYN-ACK response
++.002 ... 0.004 connect(4, ..., ...) = 0
+
+ +0 > SEW 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
++.002 < SE. 0:0(0) ack 1 win 32767 <mss 1000,nop,wscale 6,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+// Write 1 MSS.
++.002 write(4, ..., 1000) = 1000
+// Send 1 MSS with ect0.
+ +0 > [ect0] P. 1:1001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt
new file mode 100644
index 000000000000..f95b9b3c9fa1
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-large.pkt
@@ -0,0 +1,38 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk. The large chunk itself should be packetized as
+// usual.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write another 10040B chunk with no coalescing options.
+ +0 send(4, ..., 10400, MSG_EOR) = 10400
+
+// Write a 2KB chunk. This chunk should not be appended to the packets created
+// the previous chunk.
+ +0 write(4, ..., 2000) = 2000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:20801(10800) ack 1
++.001 < . 1:1(0) ack 20801 win 514
+// This 2KB packet should be sent alone.
+ +0 > P. 20801:22801(2000) ack 1
++.001 < . 1:1(0) ack 22801 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt
new file mode 100644
index 000000000000..2ff66075288e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-retrans.pkt
@@ -0,0 +1,72 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk. Also, when packets are retransmitted, they
+// will not be coalesce into the same skb.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write 10 400B chunks with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+// The 9 remaining 400B chunks should be sent as individual packets.
+ +0 > P. 10801:11201(400) ack 1
+ +0 > P. 11201:11601(400) ack 1
+ +0 > P. 11601:12001(400) ack 1
+ +0 > P. 12001:12401(400) ack 1
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
+ +0 > P. 13201:13601(400) ack 1
+ +0 > P. 13601:14001(400) ack 1
+ +0 > P. 14001:14401(400) ack 1
+// The last 10KB chunk should be sent separately.
+ +0 > P. 14401:24401(10000) ack 1
+
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 11201 win 514
++.001 < . 1:1(0) ack 11601 win 514
++.001 < . 1:1(0) ack 12001 win 514 <sack 13201:14401,nop,nop>
+// TCP should fill the hole but no coalescing should happen, and all
+// retransmissions should be sent out as individual packets.
+
+// Note : This is timeout based retransmit.
+// Do not put +0 here or flakes will come back.
++.004~+.008 > P. 12001:12401(400) ack 1
+
++.001 < . 1:1(0) ack 12401 win 514 <sack 13201:14401,nop,nop>
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
++.001 < . 1:1(0) ack 12801 win 514 <sack 13201:14401,nop,nop>
++.001 < . 1:1(0) ack 14401 win 514
++.001 < . 1:1(0) ack 24401 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt
new file mode 100644
index 000000000000..77039c5aac39
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-small.pkt
@@ -0,0 +1,36 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write a 400B chunk with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+ +0 > P. 10801:20801(10000) ack 1
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 20801 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt
new file mode 100644
index 000000000000..dd5a06250595
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_eor_no-coalesce-subsequent.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP does not append any data from consequent writes to the tail
+// skb created for the chunk even though we have 10 back-to-back small
+// writes.
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+// Write a 10400B chunk to fill the ICW, and have a 400 byte skb sitting on
+// the tail.
+ +0 write(4, ..., 10400) = 10400
+
+// Write 10 400B chunks with no coalescing options.
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+ +0 send(4, ..., 400, MSG_EOR) = 400
+// This chunk should not be appended to the skbs created for the previous chunk.
+ +0 write(4, ..., 10000) = 10000
+
+ +0 > P. 1:10001(10000) ack 1
++.001 < . 1:1(0) ack 10001 win 514
+// Now we have enough room to send out the 2 x 400B packets out.
+ +0 > P. 10001:10801(800) ack 1
+// The 9 remaining 400B chunks should be sent as individual packets.
+ +0 > P. 10801:11201(400) ack 1
+ +0 > P. 11201:11601(400) ack 1
+ +0 > P. 11601:12001(400) ack 1
+ +0 > P. 12001:12401(400) ack 1
+ +0 > P. 12401:12801(400) ack 1
+ +0 > P. 12801:13201(400) ack 1
+ +0 > P. 13201:13601(400) ack 1
+ +0 > P. 13601:14001(400) ack 1
+ +0 > P. 14001:14401(400) ack 1
+// The last 10KB chunk should be sent separately.
+ +0 > P. 14401:24401(10000) ack 1
+
++.001 < . 1:1(0) ack 10401 win 514
++.001 < . 1:1(0) ack 10801 win 514
++.001 < . 1:1(0) ack 11201 win 514
++.001 < . 1:1(0) ack 11601 win 514
++.001 < . 1:1(0) ack 12001 win 514
++.001 < . 1:1(0) ack 12401 win 514
++.001 < . 1:1(0) ack 12801 win 514
++.001 < . 1:1(0) ack 13201 win 514
++.001 < . 1:1(0) ack 13601 win 514
++.001 < . 1:1(0) ack 14001 win 514
++.001 < . 1:1(0) ack 14401 win 514
++.001 < . 1:1(0) ack 24401 win 514
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt
new file mode 100644
index 000000000000..0d3c8077e830
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-10pkt-lost-1.pkt
@@ -0,0 +1,72 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation.
+// In this variant we test a simple case where in-flight == ssthresh
+// all the way through recovery, so during fast recovery we send one segment
+// for each segment SACKed/ACKed.
+
+// Set up config.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+// RTT 100ms
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 10 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1:1001.
+ +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:4001,nop,nop>
+// Enter fast recovery.
+ +0 > . 1:1001(1000) ack 1
+ +.01 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd
+assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh
+}%
+
+// Write some more, which we will send 1 MSS at a time,
+// as in-flight segments are SACKed or ACKed.
+ +.01 write(4, ..., 7000) = 7000
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:5001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:6001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:7001,nop,nop>
+ +0 > . 12001:13001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:8001,nop,nop>
+ +0 > . 13001:14001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:9001,nop,nop>
+ +0 > . 14001:15001(1000) ack 1
+
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:10001,nop,nop>
+ +0 > . 15001:16001(1000) ack 1
+
+ +.02 < . 1:1(0) ack 10001 win 320
+ +0 > P. 16001:17001(1000) ack 1
+// Leave fast recovery.
+ +.01 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_snd_cwnd == 7, tcpi_snd_cwnd
+assert tcpi_snd_ssthresh == 7, tcpi_snd_ssthresh
+}%
+
+ +.03 < . 1:1(0) ack 12001 win 320
+ +.02 < . 1:1(0) ack 14001 win 320
+ +.02 < . 1:1(0) ack 16001 win 320
+ +.02 < . 1:1(0) ack 17001 win 320
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt
new file mode 100644
index 000000000000..7842a10b6967
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost-1_4-11_16.pkt
@@ -0,0 +1,50 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation. The sender sends 20 packets. Packet
+// 1 to 4, and 11 to 16 are dropped.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write 20 data segments.
+ +0 write(4, ..., 20000) = 20000
+ +0 > P. 1:10001(10000) ack 1
+
+// Receive first DUPACK, entering PRR part
+ +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+// Enter PRR CRB
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:11001,nop,nop>
+ +0 > . 12001:13001(1000) ack 1
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:12001,nop,nop>
+ +0 > . 13001:14001(1000) ack 1
+// Enter PRR slow start
+ +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:12001,nop,nop>
+ +0 > P. 14001:16001(2000) ack 1
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:12001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 > . 16001:17001(1000) ack 1
+// inflight reaches ssthresh, goes into packet conservation mode
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:13001,nop,nop>
+ +0 > . 17001:18001(1000) ack 1
++.002 < . 1:1(0) ack 1001 win 320 <sack 2001:14001,nop,nop>
+ +0 > . 18001:19001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt
new file mode 100644
index 000000000000..b66d7644c3b6
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-30pkt-lost1_4.pkt
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation. The sender sends 20 packets. Packet
+// 1 to 4 are lost. The sender writes another 10 packets.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 20 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1,2,3,4
+ +.01 < . 1:1(0) ack 1 win 320 <sack 4001:5001,nop,nop>
++.002 < . 1:1(0) ack 1 win 320 <sack 4001:6001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:7001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:9001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 < . 1:1(0) ack 1 win 320 <sack 4001:10001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+
+// Receiver ACKs all data.
+ +.01 < . 1:1(0) ack 1001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 2001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 3001 win 320 <sack 4001:10001,nop,nop>
+ +0 < . 1:1(0) ack 10001 win 320
+
+// Writes another 10 packets, which the ssthresh*mss amount
+// should be sent right away
+ +.01 write(4, ..., 10000) = 10000
+ +0 > . 10001:17001(7000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt
new file mode 100644
index 000000000000..8e87bfecabb5
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_fast_recovery_prr-ss-ack-below-snd_una-cubic.pkt
@@ -0,0 +1,41 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test PRR-slowstart implementation.
+// In this variant we verify that the sender uses SACK info on an ACK
+// below snd_una.
+
+// Set up config.
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 8>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+// RTT 10ms
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Send 10 data segments.
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// Lost packet 1:1001,4001:5001,7001:8001.
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +0 < . 1:1(0) ack 1 win 320 <sack 1001:3001 8001:9001,nop,nop>
+ +0 > . 1:1001(1000) ack 1
+
++.012 < . 1:1(0) ack 4001 win 320 <sack 8001:9001,nop,nop>
+ +0 > . 4001:7001(3000) ack 1
+
+ +0 write(4, ..., 10000) = 10000
+
+// The following ACK was reordered - delayed so that it arrives with
+// an ACK field below snd_una. Here we check that the newly-SACKed
+// 2MSS at 5001:7001 cause us to send out 2 more MSS.
++.002 < . 1:1(0) ack 3001 win 320 <sack 5001:7001,nop,nop>
+ +0 > . 7001:8001(1000) ack 1
+ +0 > . 10001:11001(1000) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt
new file mode 100644
index 000000000000..96b01eb5b7a4
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-no-sack.pkt
@@ -0,0 +1,53 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test RFC 3042 "Limited Transmit": "sending a new data segment in
+// response to each of the first two duplicate acknowledgments that
+// arrive at the sender".
+// This variation tests a receiver that doesn't support SACK.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write some data, and send the initial congestion window.
+ +0 write(4, ..., 15000) = 15000
+ +0 > P. 1:10001(10000) ack 1
+
+// Limited transmit: on first dupack, send a new data segment.
+ +.11 < . 1:1(0) ack 1 win 320
+ +0 > . 10001:11001(1000) ack 1
+
+// Limited transmit: on second dupack, send a new data segment.
+ +.01 < . 1:1(0) ack 1 win 320
+ +0 > . 11001:12001(1000) ack 1
+
+// It turned out to be reordering, not loss.
+// We have one packet newly acked (1001:3001 were DUP-ACK'd)
+// So we revert state back to Open. Slow start cwnd from 10 to 11
+// and send 11 - 9 = 2 packets
+ +.01 < . 1:1(0) ack 3001 win 320
+ +0 > P. 12001:14001(2000) ack 1
+
+ +.02 < . 1:1(0) ack 5001 win 320
+ +0 > P. 14001:15001(1000) ack 1
+
+// Client gradually ACKs all data.
+ +.02 < . 1:1(0) ack 7001 win 320
+ +.02 < . 1:1(0) ack 9001 win 320
+ +.02 < . 1:1(0) ack 11001 win 320
+ +.02 < . 1:1(0) ack 13001 win 320
+ +.02 < . 1:1(0) ack 15001 win 320
+
+// Clean up.
+ +.17 close(4) = 0
+ +0 > F. 15001:15001(0) ack 1
+ +.1 < F. 1:1(0) ack 15002 win 257
+ +0 > . 15002:15002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt
new file mode 100644
index 000000000000..642da51ec3a4
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_limited_transmit_limited-transmit-sack.pkt
@@ -0,0 +1,50 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test RFC 3042 "Limited Transmit": "sending a new data segment in
+// response to each of the first two duplicate acknowledgments that
+// arrive at the sender".
+// This variation tests a receiver that supports SACK.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +.1 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 320
+ +0 accept(3, ..., ...) = 4
+
+// Write some data, and send the initial congestion window.
+ +0 write(4, ..., 15000) = 15000
+ +0 > P. 1:10001(10000) ack 1
+
+// Limited transmit: on first dupack, send a new data segment.
+ +.11 < . 1:1(0) ack 1 win 320 <sack 1001:2001,nop,nop>
+ +0 > . 10001:11001(1000) ack 1
+
+// Limited transmit: on second dupack, send a new data segment.
+ +.01 < . 1:1(0) ack 1 win 320 <sack 1001:3001,nop,nop>
+ +0 > . 11001:12001(1000) ack 1
+
+// It turned out to be reordering, not loss.
+ +.01 < . 1:1(0) ack 3001 win 320
+ +0 > P. 12001:14001(2000) ack 1
+
+ +.02 < . 1:1(0) ack 5001 win 320
+ +0 > P. 14001:15001(1000) ack 1
+
+// Client gradually ACKs all data.
+ +.02 < . 1:1(0) ack 7001 win 320
+ +.02 < . 1:1(0) ack 9001 win 320
+ +.02 < . 1:1(0) ack 11001 win 320
+ +.02 < . 1:1(0) ack 13001 win 320
+ +.02 < . 1:1(0) ack 15001 win 320
+
+// Clean up.
+ +.17 close(4) = 0
+ +0 > F. 15001:15001(0) ack 1
+ +.1 < F. 1:1(0) ack 15002 win 257
+ +0 > . 15002:15002(0) ack 2
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt
new file mode 100644
index 000000000000..7adae7a9ef4a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_https_client.pkt
@@ -0,0 +1,40 @@
+// SPDX-License-Identifier: GPL-2.0
+// This is a test inspired by an Android client app using SSL. This
+// test verifies using TCP_NODELAY would save application latency
+// (Perhaps even better with TCP_NAGLE).
+//
+`./defaults.sh
+ethtool -K tun0 tso off gso off
+./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
+ +0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+ +0 connect(4, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < S. 0:0(0) ack 1 win 5792 <mss 974,nop,nop,sackOK,nop,wscale 7>
+ +0 > . 1:1(0) ack 1
+
+// SSL handshake (resumed session)
+ +0 write(4, ..., 517) = 517
+ +0 > P. 1:518(517) ack 1
+ +.1 < . 1:1(0) ack 518 win 229
+
+ +0 < P. 1:144(143) ack 1 win 229
+ +0 > . 518:518(0) ack 144
+ +0 read(4, ..., 1000) = 143
+
+// Application POST header (51B) and body (2002B)
+ +0 write(4, ..., 51) = 51
+ +0 > P. 518:569(51) ack 144
+ +.03 write(4, ..., 2002) = 2002
+ +0 > . 569:1543(974) ack 144
+ +0 > P. 1543:2517(974) ack 144
+// Without disabling Nagle, this packet will not happen until the remote ACK.
+ +0 > P. 2517:2571(54) ack 144
+
+ +.1 < . 1:1(0) ack 2571 win 229
+
+// Reset sysctls
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt
new file mode 100644
index 000000000000..fa9c01813996
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sendmsg_msg_more.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test the MSG_MORE flag will correctly corks the tiny writes
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+// Disable Nagle by default on this socket.
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+// Test the basic case: MSG_MORE overwrites TCP_NODELAY and enables Nagle.
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 40}], msg_flags=0}, MSG_MORE) = 40
+ +.21~+.215 > P. 1:41(40) ack 1
+ +.01 < . 1:1(0) ack 41 win 257
+
+// Test unsetting MSG_MORE releases the packet
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 100}], msg_flags=0}, MSG_MORE) = 100
++.005 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 160}], msg_flags=0}, MSG_MORE) = 160
+ +.01 sendmsg(4, {msg_name(...)=...,
+ msg_iov(3)=[{..., 100}, {..., 200}, {..., 195}],
+ msg_flags=0}, MSG_MORE) = 495
++.008 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 5}], msg_flags=0}, 0) = 5
+ +0 > P. 41:801(760) ack 1
+ +.02 < . 1:1(0) ack 801 win 257
+
+
+// Test >MSS write will unleash MSS packets but hold on the remaining data.
+ +.1 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 3100}], msg_flags=0}, MSG_MORE) = 3100
+ +0 > . 801:3801(3000) ack 1
++.003 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 50}], msg_flags=0}, MSG_MORE) = 50
+
+ +.01 < . 1:1(0) ack 2801 win 257
+// Err... we relase the remaining right after the ACK? note that PUSH is reset
+ +0 > . 3801:3951(150) ack 1
+
+// Test we'll hold on the subsequent writes when inflight (3801:3951) > 0
++.001 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 1}], msg_flags=0}, MSG_MORE) = 1
++.002 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 2}], msg_flags=0}, MSG_MORE) = 2
++.003 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 3}], msg_flags=0}, MSG_MORE) = 3
++.004 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 4}], msg_flags=0}, MSG_MORE) = 4
+ +.02 < . 1:1(0) ack 3951 win 257
+ +0 > . 3951:3961(10) ack 1
+ +.02 < . 1:1(0) ack 3961 win 257
+
+
+// Test the case a MSG_MORE send followed by a write flushes the data
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{..., 20}], msg_flags=0}, MSG_MORE) = 20
+ +.05 write(4, ..., 20) = 20
+ +0 > P. 3961:4001(40) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt
new file mode 100644
index 000000000000..0ddec5f7dc1a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_nagle_sockopt_cork_nodelay.pkt
@@ -0,0 +1,43 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP_CORK and TCP_NODELAY sockopt behavior
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+// Set TCP_CORK sockopt to hold small packets
+ +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0
+
+ +0 write(4, ..., 40) = 40
+ +.05 write(4, ..., 40) = 40
+
+// Unset TCP_CORK should push pending bytes out
+ +.01 setsockopt(4, SOL_TCP, TCP_CORK, [0], 4) = 0
+ +0 > P. 1:81(80) ack 1
+ +.01 < . 1:1(0) ack 81 win 257
+
+// Set TCP_CORK sockopt to hold small packets
+ +0 setsockopt(4, SOL_TCP, TCP_CORK, [1], 4) = 0
+
+ +0 write(4, ..., 40) = 40
+ +.05 write(4, ..., 40) = 40
+
+// Set TCP_NODELAY sockopt should push pending bytes out
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+ +0 > P. 81:161(80) ack 1
+ +.01 < . 1:1(0) ack 161 win 257
+
+// Set MSG_MORE to hold small packets
+ +0 send(4, ..., 40, MSG_MORE) = 40
+ +.05 send(4, ..., 40, MSG_MORE) = 40
+
+// Set TCP_NODELAY sockopt should push pending bytes out
+ +.01 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+ +0 > . 161:241(80) ack 1
+ +.01 < . 1:1(0) ack 241 win 257
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt
new file mode 100644
index 000000000000..310ef31518da
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-route-refresh-ip-tos.pkt
@@ -0,0 +1,37 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify that setsockopt calls that force a route refresh do not
+// cause problems matching SACKs with packets in the write queue.
+// This variant tests IP_TOS.
+
+`./defaults.sh`
+
+// Establish a connection.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_IP, IP_MTU_DISCOVER, [IP_PMTUDISC_DONT], 1) = 0
+ +0...0.010 connect(3, ..., ...) = 0
+
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 65535 <mss 1460,nop,wscale 2,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+
+ +.01 write(3, ..., 5840) = 5840
+ +0 > P. 1:5841(5840) ack 1
+ +.01 < . 1:1(0) ack 5841 win 65535
+
+ +.01 write(3, ..., 5840) = 5840
+ +0 > P. 5841:11681(5840) ack 1
+ +.01 < . 1:1(0) ack 11681 win 65535
+
+ +.01 write(3, ..., 14600) = 14600
+ +0 > P. 11681:26281(14600) ack 1
+
+// Try the socket option that we know can force a route refresh.
+ +0 setsockopt(3, SOL_IP, IP_TOS, [4], 1) = 0
+// Then revert to avoid routing/mangling/etc implications of that setting.
+ +0 setsockopt(3, SOL_IP, IP_TOS, [0], 1) = 0
+
+// Verify that we do not retransmit the SACKed segments.
+ +.01 < . 1:1(0) ack 13141 win 65535 <sack 16061:17521 20441:26281,nop,nop>
+ +0 > . 13141:16061(2920) ack 1
+ +0 > P. 17521:20441(2920) ack 1
+ +.01 < . 1:1(0) ack 26281 win 65535
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt
new file mode 100644
index 000000000000..f185e1ac57ea
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-2-6-8-3-9-nofack.pkt
@@ -0,0 +1,64 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests non-FACK SACK with SACKs coming in the order
+// 2 6 8 3 9, to test what happens when we get a new SACKed range
+// (for packet 3) that is on the right of an existing SACKed range
+// (for packet 2).
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+ +.1 < . 1:1(0) ack 1 win 257 <sack 2001:3001,nop,nop>
++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001,nop,nop>
++.001 < . 1:1(0) ack 1 win 257 <sack 2001:3001 6001:7001 8001:9001,nop,nop>
+
+// 3 SACKed packets, so we enter Fast Recovery.
+ +0 > . 1:1001(1000) ack 1
+ +0 %{ assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state }%
+ +0 %{ assert tcpi_lost == 6, tcpi_lost }%
+
+// SACK for 3001:4001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
++.007 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:9001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+ +0 %{ assert tcpi_reordering == 6, tcpi_reordering }% // 8001:9001 -> 3001:4001 is 6
+
+// SACK for 9001:10001.
+ +.01 < . 1:1(0) ack 1 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+
+// ACK for 1:1001 as packets from t=0.303 arrive.
++.083 < . 1:1(0) ack 1001 win 257 <sack 2001:4001 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 4,tcpi_lost }%
+
+// ACK for 1:4001 as packets from t=0.310 arrive.
++.017 < . 1:1(0) ack 4001 win 257 <sack 6001:7001 8001:10001,nop,nop>
+ +0 %{ assert tcpi_lost == 3,tcpi_lost }%
+
+// ACK for 1:7001 as packets from t=0.320 arrive.
+ +.01 < . 1:1(0) ack 7001 win 257 <sack 8001:10001,nop,nop>
+
+// ACK for all data as packets from t=0.403 arrive.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt
new file mode 100644
index 000000000000..0093b4973934
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-3-4-8-9-fack.pkt
@@ -0,0 +1,66 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests the case where we mark packets 0-4 lost, then
+// get a SACK for 3, and then a SACK for 4.
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// SACK for 7001:8001. Using RACK we delay the fast retransmit.
+ +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop>
+// RACK reordering timer
++.027 > . 1:1001(1000) ack 1
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_lost == 7, tcpi_lost # RACK thinks 1:7001 are lost
+assert tcpi_reordering == 3, tcpi_reordering
+}%
+
+// SACK for 3001:4001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:4001 7001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 6, tcpi_lost # since 3001:4001 is no longer lost
+assert tcpi_reordering == 5, tcpi_reordering # 7001:8001 -> 3001:4001
+}%
+
+// SACK for 4001:5001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
+// It uses the RFC3517 algorithm to mark 1:3001 lost
+// because >=3 higher-sequence packets are SACKed.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:8001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 5,tcpi_lost # SACK/RFC3517 thinks 1:3001 are lost
+}%
+
+// SACK for 8001:9001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:9001,nop,nop>
+
+// SACK for 9001:10001.
++.002 < . 1:1(0) ack 1 win 257 <sack 3001:5001 7001:10001,nop,nop>
+ +0 > . 5001:6001(1000) ack 1
+
+// To simplify clean-up, say we get an ACK for all data.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt
new file mode 100644
index 000000000000..980a832dc81c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sack_sack-shift-sacked-7-5-6-8-9-fack.pkt
@@ -0,0 +1,62 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test shifting of newly-SACKed ranges onto the previous already-SACKed skb.
+// This variant tests the case where we mark packets 0-4 lost, then
+// get a SACK for 5, and then a SACK for 6.
+
+`./defaults.sh`
+
+// Establish a connection and send 10 MSS.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.1 < . 1:1(0) ack 1 win 1024
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, ..., 10000) = 10000
+ +0 > P. 1:10001(10000) ack 1
+
+// SACK for 7001:8001. Using RACK we delay a fast retransmit.
+ +.1 < . 1:1(0) ack 1 win 257 <sack 7001:8001,nop,nop>
++.027 > . 1:1001(1000) ack 1
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Recovery, tcpi_ca_state
+assert tcpi_lost == 7,tcpi_lost # RACK thinks 1:7001 are lost
+assert tcpi_reordering == 3, tcpi_reordering
+}%
+
+// SACK for 5001:6001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:6001 7001:8001,nop,nop>
+ +0 > . 1001:2001(1000) ack 1
+ +0 %{
+assert tcpi_lost == 6, tcpi_lost
+assert tcpi_reordering == 3, tcpi_reordering # 7001:8001 -> 5001:6001 is 3
+}%
+
+// SACK for 6001:7001.
+// This SACK for an adjacent range causes the sender to
+// shift the newly-SACKed range onto the previous skb.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:8001,nop,nop>
+ +0 > . 2001:3001(1000) ack 1
+ +0 %{ assert tcpi_lost == 5, tcpi_lost }%
+
+// SACK for 8001:9001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:9001,nop,nop>
+ +0 > . 3001:4001(1000) ack 1
+
+// SACK for 9001:10001.
+ +0 < . 1:1(0) ack 1 win 257 <sack 5001:10001,nop,nop>
+ +0 > . 4001:5001(1000) ack 1
+
+// To simplify clean-up, say we get an ACK for all data.
+ +.1 < . 1:1(0) ack 10001 win 257
+ +0 %{
+assert tcpi_ca_state == TCP_CA_Open, tcpi_ca_state
+assert tcpi_unacked == 0, tcpi_unacked
+assert tcpi_sacked == 0, tcpi_sacked
+assert tcpi_lost == 0, tcpi_lost
+assert tcpi_retrans == 0, tcpi_retrans
+}%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt
new file mode 100644
index 000000000000..6740859a1360
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_sendfile_sendfile-simple.pkt
@@ -0,0 +1,26 @@
+// SPDX-License-Identifier: GPL-2.0
+// Simplest possible test of open() and then sendfile().
+// We write some zeroes into a file (since packetdrill expects payloads
+// to be all zeroes) and then open() the file, then use sendfile()
+// and verify that the correct number of zeroes goes out.
+
+`./defaults.sh
+/bin/rm -f /tmp/testfile
+/bin/dd bs=1 count=5 if=/dev/zero of=/tmp/testfile status=none
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +0 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+ +0 open("/tmp/testfile", O_RDONLY) = 5
+ +0 sendfile(4, 5, [0], 5) = 5
+ +0 > P. 1:6(5) ack 1
diff --git a/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt
new file mode 100644
index 000000000000..0cbd43253236
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_splice_tcp_splice_loop_test.pkt
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0
+`./defaults.sh`
+
+// Initialize a server socket
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 setsockopt(3, SOL_IP, IP_FREEBIND, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Connection should get accepted
+ +0 < S 0:0(0) win 32972 <mss 1460,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <...>
+ +0 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+
+ +0 pipe([5, 6]) = 0
+ +0 < U. 1:101(100) ack 1 win 257 urg 100
+ +0 splice(4, NULL, 6, NULL, 99, 0) = 99
+ +0 splice(4, NULL, 6, NULL, 1, 0) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt
new file mode 100644
index 000000000000..8940726a3ec2
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_fastopen-invalid-buf-ptr.pkt
@@ -0,0 +1,42 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test TCP fastopen behavior with NULL as buffer pointer, but a non-zero
+// buffer length.
+`./defaults.sh
+./set_sysctls.py /proc/sys/net/ipv4/tcp_timestamps=0`
+
+// Cache warmup: send a Fast Open cookie request
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(3, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation is now in progress)
++0 > S 0:0(0) <mss 1460,nop,nop,sackOK,nop,wscale 8,FO,nop,nop>
++0 < S. 123:123(0) ack 1 win 14600 <mss 1460,nop,nop,sackOK,nop,wscale 6,FO abcd1234,nop,nop>
++0 > . 1:1(0) ack 1
++0 close(3) = 0
++0 > F. 1:1(0) ack 1
++0 < F. 1:1(0) ack 2 win 92
++0 > . 2:2(0) ack 2
+
+// Test with MSG_FASTOPEN without TCP_FASTOPEN_CONNECT.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 4
++0 fcntl(4, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 sendto(4, NULL, 1, MSG_FASTOPEN, ..., ...) = -1
++0 close(4) = 0
+
+// Test with TCP_FASTOPEN_CONNECT without MSG_FASTOPEN.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 5
++0 fcntl(5, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(5, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(5, ..., ...) = 0
++0 sendto(5, NULL, 1, 0, ..., ...) = -1
++0 close(5) = 0
+
+// Test with both TCP_FASTOPEN_CONNECT and MSG_FASTOPEN.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 6
++0 fcntl(6, F_SETFL, O_RDWR|O_NONBLOCK) = 0
++0 setsockopt(6, SOL_TCP, TCP_FASTOPEN_CONNECT, [1], 4) = 0
++0 connect(6, ..., ...) = 0
++0 sendto(6, NULL, 1, MSG_FASTOPEN, ..., ...) = -1
++0 close(6) = 0
+
+`/tmp/sysctl_restore_${PPID}.sh`
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt
new file mode 100644
index 000000000000..b2b2cdf27e20
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_sendmsg-empty-iov.pkt
@@ -0,0 +1,30 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we correctly skip zero-length IOVs.
+`./defaults.sh`
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_ZEROCOPY, [1], 4) = 0
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,nop,wscale 7>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 257
+ +0 accept(3, ..., ...) = 4
+ +0 setsockopt(4, SOL_TCP, TCP_NODELAY, [1], 4) = 0
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 40}, {..., 0}, {..., 20}],
+ msg_flags=0}, 0) = 60
+ +0 > P. 1:61(60) ack 1
+ +.01 < . 1:1(0) ack 61 win 257
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 0}, {..., 0}, {..., 0}],
+ msg_flags=0}, MSG_ZEROCOPY) = 0
+
+ +0 sendmsg(4, {msg_name(...)=...,
+ msg_iov(4)=[{..., 0}, {..., 10}, {..., 0}, {..., 50}],
+ msg_flags=0}, MSG_ZEROCOPY) = 60
+ +0 > P. 61:121(60) ack 1
+ +.01 < . 1:1(0) ack 121 win 257
diff --git a/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt
new file mode 100644
index 000000000000..59f5903f285c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_syscall_bad_arg_syscall-invalid-buf-ptr.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test kernel behavior with NULL as buffer pointer
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.2 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+
+ +0 write(4, NULL, 1000) = -1 EFAULT (Bad address)
+ +0 send(4, NULL, 1000, 0) = -1 EFAULT (Bad address)
+ +0 sendto(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address)
+
+ +0 < . 1:1001(1000) ack 1 win 200
+ +0 read(4, NULL, 1000) = -1 EFAULT (Bad address)
+ +0 recv(4, NULL, 1000, 0) = -1 EFAULT (Bad address)
+ +0 recvfrom(4, NULL, 1000, 0, ..., ...) = -1 EFAULT (Bad address)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt
new file mode 100644
index 000000000000..d7fdb43a8e89
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-last_data_recv.pkt
@@ -0,0 +1,20 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tcpi_last_data_recv for active session
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
++0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
++0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
++0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
++0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
++0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
++.030 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8>
++0 > . 1:1(0) ack 1
+
++1 %{ assert 990 <= tcpi_last_data_recv <= 1010, tcpi_last_data_recv }%
+
++0 < . 1:1001(1000) ack 1 win 300
++0 > . 1:1(0) ack 1001
+
++0 %{ assert tcpi_last_data_recv <= 10, tcpi_last_data_recv }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt
new file mode 100644
index 000000000000..a9bcd46f6cb6
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-rwnd-limited.pkt
@@ -0,0 +1,54 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test rwnd limited time in tcp_info for client side.
+
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+
+// Server advertises 0 receive window.
+ +.01 < S. 0:0(0) ack 1 win 0 <mss 1000,nop,nop,sackOK>
+
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+
+// Make sure that initial rwnd limited time is 0.
+ +0 %{ assert tcpi_rwnd_limited == 0, tcpi_rwnd_limited }%
+
+// Receive window limited time starts here.
+ +0 write(3, ..., 1000) = 1000
+
+// Check that rwnd limited time in tcp_info is around 0.1s.
+ +.1 %{ assert 98000 <= tcpi_rwnd_limited <= 110000, tcpi_rwnd_limited }%
+
+// Server opens the receive window.
+ +.1 < . 1:1(0) ack 1 win 2000
+
+// Check that rwnd limited time in tcp_info is around 0.2s.
+ +0 %{ assert 198000 <= tcpi_rwnd_limited <= 210000, tcpi_rwnd_limited }%
+
+ +0 > P. 1:1001(1000) ack 1
+
+// Server advertises a very small receive window.
+ +.03 < . 1:1(0) ack 1001 win 10
+
+// Receive window limited time starts again.
+ +0 write(3, ..., 1000) = 1000
+
+// Server opens the receive window again.
+ +.1 < . 1:1(0) ack 1001 win 2000
+// Check that rwnd limited time in tcp_info is around 0.3s
+// and busy time is 0.3 + 0.03 (server opened small window temporarily).
+ +0 %{ assert 298000 <= tcpi_rwnd_limited <= 310000, tcpi_rwnd_limited;\
+ assert 328000 <= tcpi_busy_time <= 340000, tcpi_busy_time;\
+}%
+
+ +0 > P. 1001:2001(1000) ack 1
+ +.02 < . 1:1(0) ack 2001 win 2000
+ +0 %{ assert 348000 <= tcpi_busy_time <= 360000, tcpi_busy_time }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt
new file mode 100644
index 000000000000..f0de2acd0f8e
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_tcp_info_tcp-info-sndbuf-limited.pkt
@@ -0,0 +1,38 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test send-buffer-limited time in tcp_info for client side.
+`./defaults.sh`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 10000 <mss 1000,sackOK,nop,nop,nop,wscale 8>
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+ +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [10000], 4) = 0
+ +0 getsockopt(3, SOL_SOCKET, SO_SNDBUF, [20000], [4]) = 0
+
+ +.09...0.14 write(3, ..., 150000) = 150000
+
+ +.01 < . 1:1(0) ack 10001 win 10000
+
+ +.01 < . 1:1(0) ack 30001 win 10000
+
+// cwnd goes from 40(60KB) to 80(120KB), and that we hit the tiny sndbuf limit 10KB
+ +.01 < . 1:1(0) ack 70001 win 10000
+
+ +.02 < . 1:1(0) ack 95001 win 10000
+ +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited; \
+ assert 49000 <= tcpi_busy_time <= 52000, tcpi_busy_time; \
+ assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }%
+
+// This ack frees up enough buffer so we are no longer
+// buffer limited (socket flag SOCK_NOSPACE is cleared)
+ +.02 < . 1:1(0) ack 150001 win 10000
+ +0 %{ assert 19000 <= tcpi_sndbuf_limited <= 21000, tcpi_sndbuf_limited;\
+ assert 69000 <= tcpi_busy_time <= 73000, tcpi_busy_time;\
+ assert 0 == tcpi_rwnd_limited, tcpi_rwnd_limited }%
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt
new file mode 100644
index 000000000000..2087ec0c746a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_client-only-last-byte.pkt
@@ -0,0 +1,92 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that tx timestamping sends timestamps only for
+// the last byte of each sendmsg.
+`./defaults.sh
+`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+// Establish connection and verify that there was no error.
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 20000 <mss 1000,nop,nop,sackOK>
+ +0 > . 1:1(0) ack 1
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+ +0 fcntl(3, F_SETFL, O_RDWR) = 0 // set back to blocking
+
+ +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+ +0 write(3, ..., 11000) = 11000
+ +0 > P. 1:10001(10000) ack 1
+ +.01 < . 1:1(0) ack 10001 win 4000
+ +0 > P. 10001:11001(1000) ack 1
+ +.01 < . 1:1(0) ack 11001 win 4000
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the last byte should be received almost immediately
+// once 10001 is acked at t=20ms.
+// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...)
+// is called after when SYN is acked. So, we expect the last byte of the first
+// chunk to have a timestamp key of 10999 (i.e., 11000 - 1).
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the last byte should be received almost immediately
+// once 10001 is acked at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the last byte should be received at t=30ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=10999}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt
new file mode 100644
index 000000000000..876024a31110
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_partial.pkt
@@ -0,0 +1,91 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tx timestamping for partial writes (IPv4).
+`./defaults.sh
+`
+
+// Create a socket and set it to non-blocking.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 fcntl(3, F_GETFL) = 0x2 (flags O_RDWR)
+ +0 fcntl(3, F_SETFL, O_RDWR|O_NONBLOCK) = 0
+
+// Establish connection and verify that there was no error.
+ +0 connect(3, ..., ...) = -1 EINPROGRESS (Operation now in progress)
+ +0 > S 0:0(0) <mss 1460,sackOK,TS val 100 ecr 0,nop,wscale 8>
+ +.01 < S. 0:0(0) ack 1 win 2000 <mss 1000,sackOK,TS val 700 ecr 100,nop,wscale 7>
+ +0 > . 1:1(0) ack 1 <nop,nop,TS val 200 ecr 700>
+ +0 getsockopt(3, SOL_SOCKET, SO_ERROR, [0], [4]) = 0
+
+ +0 setsockopt(3, SOL_SOCKET, SO_SNDBUF, [1000], 4) = 0
+ +0 setsockopt(3, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+// We have a partial write.
+ +0 write(3, ..., 10000) = 2964
+ +0 > . 1:989(988) ack 1 <nop,nop,TS val 110 ecr 700>
+ +0 > P. 989:1977(988) ack 1 <nop,nop,TS val 110 ecr 700>
+ +.01 < . 1:1(0) ack 1977 win 92 <nop,nop,TS val 800 ecr 200>
+ +0 > P. 1977:2965(988) ack 1 <nop,nop,TS val 114 ecr 800>
+ +.01 < . 1:1(0) ack 2965 win 92 <nop,nop,TS val 800 ecr 200>
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately
+// after the first ack at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the first chunk should be received almost immediately
+// after the first ack at t=20ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the first chunk should be received after the last ack at
+// t=30ms.
+ +0 recvmsg(3, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=2963}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt
new file mode 100644
index 000000000000..84d94780e6be
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_timestamping_server.pkt
@@ -0,0 +1,145 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test tx timestamping for server-side (IPv4).
+`./defaults.sh
+`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop,nop,wscale 10>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK,nop,wscale 8>
+ +.01 < . 1:1(0) ack 1 win 514
+
+ +0 accept(3, ..., ...) = 4
+ +0 setsockopt(4, SOL_SOCKET, SO_TIMESTAMPING,
+ [SOF_TIMESTAMPING_TX_SCHED | SOF_TIMESTAMPING_TX_SOFTWARE |
+ SOF_TIMESTAMPING_TX_ACK | SOF_TIMESTAMPING_SOFTWARE |
+ SOF_TIMESTAMPING_OPT_ID], 4) = 0
+
+// Write two 2KB chunks.
+// setsockopt(..., [SOF_TIMESTAMPING_SOFTWARE | SOF_TIMESTAMPING_OPT_ID], ...)
+// is called after when SYN is acked. So, we expect the last byte of the first
+// and the second chunks to have timestamp keys of 1999 (i.e., 2000 - 1) and
+// 3999 (i.e., 4000 - 1) respectively.
+ +0 write(4, ..., 2000) = 2000
+ +0 write(4, ..., 2000) = 2000
+ +0 > P. 1:2001(2000) ack 1
+ +0 > P. 2001:4001(2000) ack 1
+ +.01 < . 1:1(0) ack 2001 win 514
+ +.01 < . 1:1(0) ack 4001 win 514
+
+// Make sure that internal TCP timestamps are not overwritten and we have sane
+// RTT measurement.
+ +0 %{
+assert 5000 <= tcpi_rtt <= 20000, 'srtt=%d us' % tcpi_rtt
+}%
+
+// SCM_TSTAMP_SCHED for the first chunk should be received almost immediately
+// after write at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the first chunk should be received almost immediately
+// after write at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SCHED for the second chunk should be received almost immediately
+// after that at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SCHED,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_SND for the second chunk should be received almost immediately
+// after that at t=10ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=10000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_SND,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the first chunk should be received at t=20ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=20000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=1999}}
+ ]}, MSG_ERRQUEUE) = 0
+// SCM_TSTAMP_ACK for the second chunk should be received at t=30ms.
+ +0 recvmsg(4, {msg_name(...)=...,
+ msg_iov(1)=[{...,0}],
+ msg_flags=MSG_ERRQUEUE|MSG_TRUNC,
+ msg_control=[
+ {cmsg_level=SOL_SOCKET,
+ cmsg_type=SCM_TIMESTAMPING,
+ cmsg_data={scm_sec=0,scm_nsec=30000000}},
+ {cmsg_level=CMSG_LEVEL_IP,
+ cmsg_type=CMSG_TYPE_RECVERR,
+ cmsg_data={ee_errno=ENOMSG,
+ ee_origin=SO_EE_ORIGIN_TIMESTAMPING,
+ ee_type=0,
+ ee_code=0,
+ ee_info=SCM_TSTAMP_ACK,
+ ee_data=3999}}
+ ]}, MSG_ERRQUEUE) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt
new file mode 100644
index 000000000000..e61424a7bd0a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_fin_tsval.pkt
@@ -0,0 +1,23 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we send FIN packet with correct TSval
+--tcp_ts_tick_usecs=1000
+--tolerance_usecs=7000
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+ +1 close(4) = 0
+// Check that FIN TSval is updated properly, one second has passed since last sent packet.
+ +0 > F. 1:1(0) ack 1 <nop,nop,TS val 1200 ecr 200>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt
new file mode 100644
index 000000000000..174ce9a1bfc0
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_invalid_ack.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we reject TS val updates on a packet with invalid ACK sequence
+
+`./defaults.sh
+`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +.1 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+// bad packet with high tsval (its ACK sequence is above our sndnxt)
+ +0 < F. 1:1(0) ack 9999 win 20000 <nop,nop,TS val 200000 ecr 100>
+
+
+ +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100>
+ +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt
new file mode 100644
index 000000000000..2e3b3bb7493a
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_ts_recent_reset_tsval.pkt
@@ -0,0 +1,25 @@
+// SPDX-License-Identifier: GPL-2.0
+// Test that we send RST packet with correct TSval
+--tcp_ts_tick_usecs=1000
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,TS val 100 ecr 0>
+ +0 > S. 0:0(0) ack 1 <mss 1460,sackOK,TS val 100 ecr 100>
+ +.1 < . 1:1(0) ack 1 win 20000 <nop,nop,TS val 200 ecr 100>
+ +0 accept(3, ..., ...) = 4
+
+ +0 < . 1:1001(1000) ack 1 win 20000 <nop,nop,TS val 201 ecr 100>
+ +0 > . 1:1(0) ack 1001 <nop,nop,TS val 200 ecr 201>
+
+ +1 close(4) = 0
+// Check that RST TSval is updated properly, one second has passed since last sent packet.
+ +0 > R. 1:1(0) ack 1001 <nop,nop,TS val 1200 ecr 201>
diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt
new file mode 100644
index 000000000000..183051ba0cae
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user-timeout-probe.pkt
@@ -0,0 +1,37 @@
+// SPDX-License-Identifier: GPL-2.0
+
+`./defaults.sh`
+
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+
+ +0 < S 0:0(0) win 0 <mss 1460>
+ +0 > S. 0:0(0) ack 1 <mss 1460>
+
+ +.1 < . 1:1(0) ack 1 win 65530
+ +0 accept(3, ..., ...) = 4
+
+ +0 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0
+ +0 write(4, ..., 24) = 24
+ +0 > P. 1:25(24) ack 1
+ +.1 < . 1:1(0) ack 25 win 65530
+ +0 %{ assert tcpi_probes == 0, tcpi_probes; \
+ assert tcpi_backoff == 0, tcpi_backoff }%
+
+// install a qdisc dropping all packets
+ +0 `tc qdisc delete dev tun0 root 2>/dev/null ; tc qdisc add dev tun0 root pfifo limit 0`
+ +0 write(4, ..., 24) = 24
+ // When qdisc is congested we retry every 500ms
+ // (TCP_RESOURCE_PROBE_INTERVAL) and therefore
+ // we retry 6 times before hitting 3s timeout.
+ // First verify that the connection is alive:
++3.250 write(4, ..., 24) = 24
+ // Now verify that shortly after that the socket is dead:
+ +.100 write(4, ..., 24) = -1 ETIMEDOUT (Connection timed out)
+
+ +0 %{ assert tcpi_probes == 6, tcpi_probes; \
+ assert tcpi_backoff == 0, tcpi_backoff }%
+ +0 close(4) = 0
diff --git a/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt
new file mode 100644
index 000000000000..2efe02bfba9c
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_user_timeout_user_timeout.pkt
@@ -0,0 +1,32 @@
+// SPDX-License-Identifier: GPL-2.0
+`./defaults.sh`
+
+// Initialize connection
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+ +0 < S 0:0(0) win 32792 <mss 1000,sackOK,nop,nop>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK>
+ +.1 < . 1:1(0) ack 1 win 32792
+
+
+ +0 accept(3, ..., ...) = 4
+
+// Okay, we received nothing, and decide to close this idle socket.
+// We set TCP_USER_TIMEOUT to 3 seconds because really it is not worth
+// trying hard to cleanly close this flow, at the price of keeping
+// a TCP structure in kernel for about 1 minute !
+ +2 setsockopt(4, SOL_TCP, TCP_USER_TIMEOUT, [3000], 4) = 0
+ +0 close(4) = 0
+
+ +0 > F. 1:1(0) ack 1
+ +.3~+.400 > F. 1:1(0) ack 1
+ +.3~+.400 > F. 1:1(0) ack 1
+ +.6~+.800 > F. 1:1(0) ack 1
+
+// We finally receive something from the peer, but it is way too late
+// Our socket vanished because TCP_USER_TIMEOUT was really small
+ +0 < . 1:2(1) ack 1 win 32792
+ +0 > R 1:1(0)
diff --git a/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt
new file mode 100644
index 000000000000..8bd60226ccfc
--- /dev/null
+++ b/tools/testing/selftests/net/packetdrill/tcp_validate_validate-established-no-flags.pkt
@@ -0,0 +1,24 @@
+// SPDX-License-Identifier: GPL-2.0
+// Verify that established connections drop a segment without the ACK flag set.
+
+`./defaults.sh`
+
+// Create a socket.
+ 0 socket(..., SOCK_STREAM, IPPROTO_TCP) = 3
+ +0 setsockopt(3, SOL_SOCKET, SO_REUSEADDR, [1], 4) = 0
+ +0 bind(3, ..., ...) = 0
+ +0 listen(3, 1) = 0
+
+// Establish a connection.
+ +0 < S 0:0(0) win 20000 <mss 1000,sackOK,nop,nop>
+ +0 > S. 0:0(0) ack 1 <mss 1460,nop,nop,sackOK>
+ +.01 < . 1:1(0) ack 1 win 20000
+ +0 accept(3, ..., ...) = 4
+
+// Receive a segment with no flags set, verify that it's not enqueued.
+ +.01 < - 1:1001(1000) win 20000
+ +0 ioctl(4, SIOCINQ, [0]) = 0
+
+// Receive a segment with ACK flag set, verify that it is enqueued.
+ +.01 < . 1:1001(1000) ack 1 win 20000
+ +0 ioctl(4, SIOCINQ, [1000]) = 0
diff --git a/tools/testing/selftests/net/tls.c b/tools/testing/selftests/net/tls.c
index 1a706d03bb6b..9a85f93c33d8 100644
--- a/tools/testing/selftests/net/tls.c
+++ b/tools/testing/selftests/net/tls.c
@@ -44,9 +44,11 @@ struct tls_crypto_info_keys {
};
static void tls_crypto_info_init(uint16_t tls_version, uint16_t cipher_type,
- struct tls_crypto_info_keys *tls12)
+ struct tls_crypto_info_keys *tls12,
+ char key_generation)
{
- memset(tls12, 0, sizeof(*tls12));
+ memset(tls12, key_generation, sizeof(*tls12));
+ memset(tls12, 0, sizeof(struct tls_crypto_info));
switch (cipher_type) {
case TLS_CIPHER_CHACHA20_POLY1305:
@@ -275,7 +277,7 @@ TEST_F(tls_basic, recseq_wrap)
if (self->notls)
SKIP(return, "no TLS support");
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0);
memset(&tls12.aes128.rec_seq, 0xff, sizeof(tls12.aes128.rec_seq));
ASSERT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
@@ -391,7 +393,7 @@ FIXTURE_SETUP(tls)
SKIP(return, "Unsupported cipher in FIPS mode");
tls_crypto_info_init(variant->tls_version, variant->cipher_type,
- &tls12);
+ &tls12, 0);
ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls);
@@ -1175,7 +1177,7 @@ TEST_F(tls, bidir)
struct tls_crypto_info_keys tls12;
tls_crypto_info_init(variant->tls_version, variant->cipher_type,
- &tls12);
+ &tls12, 0);
ret = setsockopt(self->fd, SOL_TLS, TLS_RX, &tls12,
tls12.len);
@@ -1614,7 +1616,7 @@ TEST_F(tls, getsockopt)
EXPECT_EQ(get.crypto_info.cipher_type, variant->cipher_type);
/* get the full crypto_info */
- tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &expect, 0);
len = expect.len;
memrnd(&get, sizeof(get));
EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &get, &len), 0);
@@ -1668,6 +1670,464 @@ TEST_F(tls, recv_efault)
EXPECT_EQ(memcmp(rec2, recv_mem + 9, ret - 9), 0);
}
+#define TLS_RECORD_TYPE_HANDSHAKE 0x16
+/* key_update, length 1, update_not_requested */
+static const char key_update_msg[] = "\x18\x00\x00\x01\x00";
+static void tls_send_keyupdate(struct __test_metadata *_metadata, int fd)
+{
+ size_t len = sizeof(key_update_msg);
+
+ EXPECT_EQ(tls_send_cmsg(fd, TLS_RECORD_TYPE_HANDSHAKE,
+ (char *)key_update_msg, len, 0),
+ len);
+}
+
+static void tls_recv_keyupdate(struct __test_metadata *_metadata, int fd, int flags)
+{
+ char buf[100];
+
+ EXPECT_EQ(tls_recv_cmsg(_metadata, fd, TLS_RECORD_TYPE_HANDSHAKE, buf, sizeof(buf), flags),
+ sizeof(key_update_msg));
+ EXPECT_EQ(memcmp(buf, key_update_msg, sizeof(key_update_msg)), 0);
+}
+
+/* set the key to 0 then 1 for RX, immediately to 1 for TX */
+TEST_F(tls_basic, rekey_rx)
+{
+ struct tls_crypto_info_keys tls12_0, tls12_1;
+ char const *test_str = "test_message";
+ int send_len = strlen(test_str) + 1;
+ char buf[20];
+ int ret;
+
+ if (self->notls)
+ return;
+
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_0, 0);
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_1, 1);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_0, tls12_0.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len);
+ EXPECT_EQ(ret, 0);
+
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str, send_len), 0);
+}
+
+/* set the key to 0 then 1 for TX, immediately to 1 for RX */
+TEST_F(tls_basic, rekey_tx)
+{
+ struct tls_crypto_info_keys tls12_0, tls12_1;
+ char const *test_str = "test_message";
+ int send_len = strlen(test_str) + 1;
+ char buf[20];
+ int ret;
+
+ if (self->notls)
+ return;
+
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_0, 0);
+ tls_crypto_info_init(TLS_1_3_VERSION, TLS_CIPHER_AES_GCM_128,
+ &tls12_1, 1);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_0, tls12_0.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_1, tls12_1.len);
+ ASSERT_EQ(ret, 0);
+
+ ret = setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_1, tls12_1.len);
+ EXPECT_EQ(ret, 0);
+
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str, send_len), 0);
+}
+
+TEST_F(tls, rekey)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ char const *test_str_2 = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* initial send/recv */
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* send after rekey */
+ send_len = strlen(test_str_2) + 1;
+ EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* recv blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* recv non-blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ /* recv after rekey */
+ EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1);
+ EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0);
+}
+
+TEST_F(tls, rekey_fail)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ char const *test_str_2 = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ /* initial send/recv */
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+
+ if (variant->tls_version != TLS_1_3_VERSION) {
+ /* just check that rekey is not supported and return */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EBUSY);
+ return;
+ }
+
+ /* successful update */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* invalid update: change of version */
+ tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* invalid update (RX socket): change of version */
+ tls_crypto_info_init(TLS_1_2_VERSION, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* invalid update: change of cipher */
+ if (variant->cipher_type == TLS_CIPHER_AES_GCM_256)
+ tls_crypto_info_init(variant->tls_version, TLS_CIPHER_CHACHA20_POLY1305, &tls12, 1);
+ else
+ tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_256, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* send after rekey, the invalid updates shouldn't have an effect */
+ send_len = strlen(test_str_2) + 1;
+ EXPECT_EQ(send(self->fd, test_str_2, send_len, 0), send_len);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), -1);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* recv blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* recv non-blocking -> -EKEYEXPIRED */
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_DONTWAIT), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ /* recv after rekey */
+ EXPECT_NE(recv(self->cfd, buf, send_len, 0), -1);
+ EXPECT_EQ(memcmp(buf, test_str_2, send_len), 0);
+}
+
+TEST_F(tls, rekey_peek)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, send_len, 0), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ /* can't receive the KeyUpdate without a control message */
+ EXPECT_EQ(recv(self->cfd, buf, send_len, MSG_PEEK), -1);
+
+ /* peek KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+}
+
+TEST_F(tls, splice_rekey)
+{
+ int send_len = TLS_PAYLOAD_MAX_LEN / 2;
+ char mem_send[TLS_PAYLOAD_MAX_LEN];
+ char mem_recv[TLS_PAYLOAD_MAX_LEN];
+ struct tls_crypto_info_keys tls12;
+ int p[2];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ memrnd(mem_send, sizeof(mem_send));
+
+ ASSERT_GE(pipe(p), 0);
+ EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(send(self->fd, mem_send, send_len, 0), send_len);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0);
+
+ /* can't splice the KeyUpdate */
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1);
+ EXPECT_EQ(errno, EINVAL);
+
+ /* peek KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, MSG_PEEK);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* can't splice before updating the key */
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), -1);
+ EXPECT_EQ(errno, EKEYEXPIRED);
+
+ /* update RX key */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_send, mem_recv, send_len), 0);
+}
+
+TEST_F(tls, rekey_peek_splice)
+{
+ char const *test_str_1 = "test_message_before_rekey";
+ struct tls_crypto_info_keys tls12;
+ int send_len;
+ char buf[100];
+ char mem_recv[TLS_PAYLOAD_MAX_LEN];
+ int p[2];
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ ASSERT_GE(pipe(p), 0);
+
+ send_len = strlen(test_str_1) + 1;
+ EXPECT_EQ(send(self->fd, test_str_1, send_len, 0), send_len);
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ EXPECT_EQ(recv(self->cfd, buf, sizeof(buf), MSG_PEEK), send_len);
+ EXPECT_EQ(memcmp(buf, test_str_1, send_len), 0);
+
+ EXPECT_EQ(splice(self->cfd, NULL, p[1], NULL, TLS_PAYLOAD_MAX_LEN, 0), send_len);
+ EXPECT_EQ(read(p[0], mem_recv, send_len), send_len);
+ EXPECT_EQ(memcmp(mem_recv, test_str_1, send_len), 0);
+}
+
+TEST_F(tls, rekey_getsockopt)
+{
+ struct tls_crypto_info_keys tls12;
+ struct tls_crypto_info_keys tls12_get;
+ socklen_t len;
+
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->fd, SOL_TLS, TLS_TX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+
+ len = tls12.len;
+ EXPECT_EQ(getsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12_get, &len), 0);
+ EXPECT_EQ(len, tls12.len);
+ EXPECT_EQ(memcmp(&tls12_get, &tls12, tls12.len), 0);
+}
+
+TEST_F(tls, rekey_poll_pending)
+{
+ char const *test_str = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ struct pollfd pfd = { };
+ int send_len;
+ int ret;
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ /* send immediately after rekey */
+ send_len = strlen(test_str) + 1;
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+
+ /* key hasn't been updated, expect cfd to be non-readable */
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 0), 0);
+
+ ret = fork();
+ ASSERT_GE(ret, 0);
+
+ if (ret) {
+ int pid2, status;
+
+ /* wait before installing the new key */
+ sleep(1);
+
+ /* update RX key while poll() is sleeping */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ pid2 = wait(&status);
+ EXPECT_EQ(pid2, ret);
+ EXPECT_EQ(status, 0);
+ } else {
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 5000), 1);
+
+ exit(!__test_passed(_metadata));
+ }
+}
+
+TEST_F(tls, rekey_poll_delay)
+{
+ char const *test_str = "test_message_after_rekey";
+ struct tls_crypto_info_keys tls12;
+ struct pollfd pfd = { };
+ int send_len;
+ int ret;
+
+ if (variant->tls_version != TLS_1_3_VERSION)
+ return;
+
+ /* update TX key */
+ tls_send_keyupdate(_metadata, self->fd);
+ tls_crypto_info_init(variant->tls_version, variant->cipher_type, &tls12, 1);
+ EXPECT_EQ(setsockopt(self->fd, SOL_TLS, TLS_TX, &tls12, tls12.len), 0);
+
+ /* get KeyUpdate */
+ tls_recv_keyupdate(_metadata, self->cfd, 0);
+
+ ret = fork();
+ ASSERT_GE(ret, 0);
+
+ if (ret) {
+ int pid2, status;
+
+ /* wait before installing the new key */
+ sleep(1);
+
+ /* update RX key while poll() is sleeping */
+ EXPECT_EQ(setsockopt(self->cfd, SOL_TLS, TLS_RX, &tls12, tls12.len), 0);
+
+ sleep(1);
+ send_len = strlen(test_str) + 1;
+ EXPECT_EQ(send(self->fd, test_str, send_len, 0), send_len);
+
+ pid2 = wait(&status);
+ EXPECT_EQ(pid2, ret);
+ EXPECT_EQ(status, 0);
+ } else {
+ pfd.fd = self->cfd;
+ pfd.events = POLLIN;
+ EXPECT_EQ(poll(&pfd, 1, 5000), 1);
+ exit(!__test_passed(_metadata));
+ }
+}
+
FIXTURE(tls_err)
{
int fd, cfd;
@@ -1696,7 +2156,7 @@ FIXTURE_SETUP(tls_err)
int ret;
tls_crypto_info_init(variant->tls_version, TLS_CIPHER_AES_GCM_128,
- &tls12);
+ &tls12, 0);
ulp_sock_pair(_metadata, &self->fd, &self->cfd, &self->notls);
ulp_sock_pair(_metadata, &self->fd2, &self->cfd2, &self->notls);
@@ -2118,7 +2578,7 @@ TEST(tls_v6ops) {
int sfd, ret, fd;
socklen_t len, len2;
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_128, &tls12, 0);
addr.sin6_family = AF_INET6;
addr.sin6_addr = in6addr_any;
@@ -2177,7 +2637,7 @@ TEST(prequeue) {
len = sizeof(addr);
memrnd(buf, sizeof(buf));
- tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12);
+ tls_crypto_info_init(TLS_1_2_VERSION, TLS_CIPHER_AES_GCM_256, &tls12, 0);
addr.sin_family = AF_INET;
addr.sin_addr.s_addr = htonl(INADDR_ANY);
diff --git a/tools/testing/selftests/net/udpgso_bench.sh b/tools/testing/selftests/net/udpgso_bench.sh
index 640bc43452fa..88fa1d53ba2b 100755
--- a/tools/testing/selftests/net/udpgso_bench.sh
+++ b/tools/testing/selftests/net/udpgso_bench.sh
@@ -92,6 +92,9 @@ run_udp() {
echo "udp"
run_in_netns ${args}
+ echo "udp sendmmsg"
+ run_in_netns ${args} -m
+
echo "udp gso"
run_in_netns ${args} -S 0
diff --git a/tools/testing/selftests/net/vlan_bridge_binding.sh b/tools/testing/selftests/net/vlan_bridge_binding.sh
new file mode 100755
index 000000000000..e7cb8c678bde
--- /dev/null
+++ b/tools/testing/selftests/net/vlan_bridge_binding.sh
@@ -0,0 +1,256 @@
+#!/bin/bash
+# SPDX-License-Identifier: GPL-2.0
+
+source lib.sh
+
+ALL_TESTS="
+ test_binding_on
+ test_binding_off
+ test_binding_toggle_on
+ test_binding_toggle_off
+ test_binding_toggle_on_when_upper_down
+ test_binding_toggle_off_when_upper_down
+ test_binding_toggle_on_when_lower_down
+ test_binding_toggle_off_when_lower_down
+"
+
+setup_prepare()
+{
+ local port
+
+ ip_link_add br up type bridge vlan_filtering 1
+
+ for port in d1 d2 d3; do
+ ip_link_add $port type veth peer name r$port
+ ip_link_set_up $port
+ ip_link_set_up r$port
+ ip_link_set_master $port br
+ done
+
+ bridge_vlan_add vid 11 dev br self
+ bridge_vlan_add vid 11 dev d1 master
+
+ bridge_vlan_add vid 12 dev br self
+ bridge_vlan_add vid 12 dev d2 master
+
+ bridge_vlan_add vid 13 dev br self
+ bridge_vlan_add vid 13 dev d1 master
+ bridge_vlan_add vid 13 dev d2 master
+
+ bridge_vlan_add vid 14 dev br self
+ bridge_vlan_add vid 14 dev d1 master
+ bridge_vlan_add vid 14 dev d2 master
+ bridge_vlan_add vid 14 dev d3 master
+}
+
+operstate_is()
+{
+ local dev=$1; shift
+ local expect=$1; shift
+
+ local operstate=$(ip -j link show $dev | jq -r .[].operstate)
+ if [[ $operstate == UP ]]; then
+ operstate=1
+ elif [[ $operstate == DOWN || $operstate == LOWERLAYERDOWN ]]; then
+ operstate=0
+ fi
+ echo -n $operstate
+ [[ $operstate == $expect ]]
+}
+
+check_operstate()
+{
+ local dev=$1; shift
+ local expect=$1; shift
+ local operstate
+
+ operstate=$(busywait 1000 \
+ operstate_is "$dev" "$expect")
+ check_err $? "Got operstate of $operstate, expected $expect"
+}
+
+add_one_vlan()
+{
+ local link=$1; shift
+ local id=$1; shift
+
+ ip_link_add $link.$id link $link type vlan id $id "$@"
+}
+
+add_vlans()
+{
+ add_one_vlan br 11 "$@"
+ add_one_vlan br 12 "$@"
+ add_one_vlan br 13 "$@"
+ add_one_vlan br 14 "$@"
+}
+
+set_vlans()
+{
+ ip link set dev br.11 "$@"
+ ip link set dev br.12 "$@"
+ ip link set dev br.13 "$@"
+ ip link set dev br.14 "$@"
+}
+
+down_netdevs()
+{
+ local dev
+
+ for dev in "$@"; do
+ ip_link_set_down $dev
+ done
+}
+
+check_operstates()
+{
+ local opst_11=$1; shift
+ local opst_12=$1; shift
+ local opst_13=$1; shift
+ local opst_14=$1; shift
+
+ check_operstate br.11 $opst_11
+ check_operstate br.12 $opst_12
+ check_operstate br.13 $opst_13
+ check_operstate br.14 $opst_14
+}
+
+do_test_binding()
+{
+ local inject=$1; shift
+ local what=$1; shift
+ local opsts_d1=$1; shift
+ local opsts_d2=$1; shift
+ local opsts_d12=$1; shift
+ local opsts_d123=$1; shift
+
+ RET=0
+
+ defer_scope_push
+ down_netdevs d1
+ $inject
+ check_operstates $opsts_d1
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d2
+ $inject
+ check_operstates $opsts_d2
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d1 d2
+ $inject
+ check_operstates $opsts_d12
+ defer_scope_pop
+
+ defer_scope_push
+ down_netdevs d1 d2 d3
+ $inject
+ check_operstates $opsts_d123
+ defer_scope_pop
+
+ log_test "Test bridge_binding $what"
+}
+
+do_test_binding_on()
+{
+ local inject=$1; shift
+ local what=$1; shift
+
+ do_test_binding "$inject" "$what" \
+ "0 1 1 1" \
+ "1 0 1 1" \
+ "0 0 0 1" \
+ "0 0 0 0"
+}
+
+do_test_binding_off()
+{
+ local inject=$1; shift
+ local what=$1; shift
+
+ do_test_binding "$inject" "$what" \
+ "1 1 1 1" \
+ "1 1 1 1" \
+ "1 1 1 1" \
+ "0 0 0 0"
+}
+
+test_binding_on()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ do_test_binding_on : "on"
+}
+
+test_binding_off()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ do_test_binding_off : "off"
+}
+
+test_binding_toggle_on()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ set_vlans type vlan bridge_binding on
+ do_test_binding_on : "off->on"
+}
+
+test_binding_toggle_off()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ set_vlans type vlan bridge_binding off
+ do_test_binding_off : "on->off"
+}
+
+dfr_set_binding_on()
+{
+ set_vlans type vlan bridge_binding on
+ defer set_vlans type vlan bridge_binding off
+}
+
+dfr_set_binding_off()
+{
+ set_vlans type vlan bridge_binding off
+ defer set_vlans type vlan bridge_binding on
+}
+
+test_binding_toggle_on_when_lower_down()
+{
+ add_vlans bridge_binding off
+ set_vlans up
+ do_test_binding_on dfr_set_binding_on "off->on when lower down"
+}
+
+test_binding_toggle_off_when_lower_down()
+{
+ add_vlans bridge_binding on
+ set_vlans up
+ do_test_binding_off dfr_set_binding_off "on->off when lower down"
+}
+
+test_binding_toggle_on_when_upper_down()
+{
+ add_vlans bridge_binding off
+ set_vlans type vlan bridge_binding on
+ set_vlans up
+ do_test_binding_on : "off->on when upper down"
+}
+
+test_binding_toggle_off_when_upper_down()
+{
+ add_vlans bridge_binding on
+ set_vlans type vlan bridge_binding off
+ set_vlans up
+ do_test_binding_off : "on->off when upper down"
+}
+
+trap defer_scopes_cleanup EXIT
+setup_prepare
+tests_run
+
+exit $EXIT_STATUS
diff --git a/tools/testing/selftests/net/ynl.mk b/tools/testing/selftests/net/ynl.mk
index d43afe243779..12e7cae251be 100644
--- a/tools/testing/selftests/net/ynl.mk
+++ b/tools/testing/selftests/net/ynl.mk
@@ -31,7 +31,8 @@ $(OUTPUT)/libynl.a: $(YNL_SPECS) $(OUTPUT)/.libynl-$(YNL_GENS_HASH).sig
$(Q)cp $(top_srcdir)/tools/net/ynl/libynl.a $(OUTPUT)/libynl.a
EXTRA_CLEAN += \
- $(top_srcdir)/tools/net/ynl/lib/__pycache__ \
+ $(top_srcdir)/tools/net/ynl/pyynl/__pycache__ \
+ $(top_srcdir)/tools/net/ynl/pyynl/lib/__pycache__ \
$(top_srcdir)/tools/net/ynl/lib/*.[ado] \
$(OUTPUT)/.libynl-*.sig \
$(OUTPUT)/libynl.a
diff --git a/tools/testing/selftests/nolibc/Makefile b/tools/testing/selftests/nolibc/Makefile
index e92e0b885861..7d14a7c0cb62 100644
--- a/tools/testing/selftests/nolibc/Makefile
+++ b/tools/testing/selftests/nolibc/Makefile
@@ -43,6 +43,7 @@ cc-option = $(call __cc-option, $(CC),$(CLANG_CROSS_FLAGS),$(1),$(2))
# configure default variants for target kernel supported architectures
XARCH_powerpc = ppc
XARCH_mips = mips32le
+XARCH_riscv = riscv64
XARCH = $(or $(XARCH_$(ARCH)),$(ARCH))
# map from user input variants to their kernel supported architectures
@@ -51,6 +52,8 @@ ARCH_ppc64 = powerpc
ARCH_ppc64le = powerpc
ARCH_mips32le = mips
ARCH_mips32be = mips
+ARCH_riscv32 = riscv
+ARCH_riscv64 = riscv
ARCH := $(or $(ARCH_$(XARCH)),$(XARCH))
# kernel image names by architecture
@@ -65,6 +68,8 @@ IMAGE_ppc = vmlinux
IMAGE_ppc64 = vmlinux
IMAGE_ppc64le = arch/powerpc/boot/zImage
IMAGE_riscv = arch/riscv/boot/Image
+IMAGE_riscv32 = arch/riscv/boot/Image
+IMAGE_riscv64 = arch/riscv/boot/Image
IMAGE_s390 = arch/s390/boot/bzImage
IMAGE_loongarch = arch/loongarch/boot/vmlinuz.efi
IMAGE = $(objtree)/$(IMAGE_$(XARCH))
@@ -82,6 +87,8 @@ DEFCONFIG_ppc = pmac32_defconfig
DEFCONFIG_ppc64 = powernv_be_defconfig
DEFCONFIG_ppc64le = powernv_defconfig
DEFCONFIG_riscv = defconfig
+DEFCONFIG_riscv32 = rv32_defconfig
+DEFCONFIG_riscv64 = defconfig
DEFCONFIG_s390 = defconfig
DEFCONFIG_loongarch = defconfig
DEFCONFIG = $(DEFCONFIG_$(XARCH))
@@ -104,6 +111,8 @@ QEMU_ARCH_ppc = ppc
QEMU_ARCH_ppc64 = ppc64
QEMU_ARCH_ppc64le = ppc64
QEMU_ARCH_riscv = riscv64
+QEMU_ARCH_riscv32 = riscv32
+QEMU_ARCH_riscv64 = riscv64
QEMU_ARCH_s390 = s390x
QEMU_ARCH_loongarch = loongarch64
QEMU_ARCH = $(QEMU_ARCH_$(XARCH))
@@ -130,6 +139,8 @@ QEMU_ARGS_ppc = -M g3beige -append "console=ttyS0 panic=-1 $(TEST:%=NOLIB
QEMU_ARGS_ppc64 = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_ppc64le = -M powernv -append "console=hvc0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_riscv = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
+QEMU_ARGS_riscv32 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
+QEMU_ARGS_riscv64 = -M virt -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_s390 = -M s390-ccw-virtio -append "console=ttyS0 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS_loongarch = -M virt -append "console=ttyS0,115200 panic=-1 $(TEST:%=NOLIBC_TEST=%)"
QEMU_ARGS = -m 1G $(QEMU_ARGS_$(XARCH)) $(QEMU_ARGS_BIOS) $(QEMU_ARGS_EXTRA)
diff --git a/tools/testing/selftests/nolibc/nolibc-test.c b/tools/testing/selftests/nolibc/nolibc-test.c
index 6fba7025c5e3..0e0e3b48a8c3 100644
--- a/tools/testing/selftests/nolibc/nolibc-test.c
+++ b/tools/testing/selftests/nolibc/nolibc-test.c
@@ -302,7 +302,10 @@ int expect_syszr(int expr, int llen)
{
int ret = 0;
- if (expr) {
+ if (errno == ENOSYS) {
+ llen += printf(" = ENOSYS");
+ result(llen, SKIPPED);
+ } else if (expr) {
ret = 1;
llen += printf(" = %d %s ", expr, errorname(errno));
result(llen, FAIL);
@@ -342,7 +345,10 @@ int expect_sysne(int expr, int llen, int val)
{
int ret = 0;
- if (expr == val) {
+ if (errno == ENOSYS) {
+ llen += printf(" = ENOSYS");
+ result(llen, SKIPPED);
+ } else if (expr == val) {
ret = 1;
llen += printf(" = %d %s ", expr, errorname(errno));
result(llen, FAIL);
@@ -367,7 +373,9 @@ int expect_syserr2(int expr, int expret, int experr1, int experr2, int llen)
int _errno = errno;
llen += printf(" = %d %s ", expr, errorname(_errno));
- if (expr != expret || (_errno != experr1 && _errno != experr2)) {
+ if (errno == ENOSYS) {
+ result(llen, SKIPPED);
+ } else if (expr != expret || (_errno != experr1 && _errno != experr2)) {
ret = 1;
if (experr2 == 0)
llen += printf(" != (%d %s) ", expret, errorname(experr1));
@@ -1229,19 +1237,20 @@ int run_stdlib(int min, int max)
static int expect_vfprintf(int llen, int c, const char *expected, const char *fmt, ...)
{
- int ret, fd;
+ int ret, pipefd[2];
ssize_t w, r;
char buf[100];
FILE *memfile;
va_list args;
- fd = open("/tmp", O_TMPFILE | O_EXCL | O_RDWR, 0600);
- if (fd == -1) {
- result(llen, SKIPPED);
- return 0;
+ ret = pipe(pipefd);
+ if (ret == -1) {
+ llen += printf(" pipe() != %s", strerror(errno));
+ result(llen, FAIL);
+ return 1;
}
- memfile = fdopen(fd, "w+");
+ memfile = fdopen(pipefd[1], "w");
if (!memfile) {
result(llen, FAIL);
return 1;
@@ -1257,13 +1266,10 @@ static int expect_vfprintf(int llen, int c, const char *expected, const char *fm
return 1;
}
- fflush(memfile);
- lseek(fd, 0, SEEK_SET);
-
- r = read(fd, buf, sizeof(buf) - 1);
-
fclose(memfile);
+ r = read(pipefd[0], buf, sizeof(buf) - 1);
+
if (r != w) {
llen += printf(" written(%d) != read(%d)", (int)w, (int)r);
result(llen, FAIL);
@@ -1323,7 +1329,8 @@ static int run_protection(int min __attribute__((unused)),
int max __attribute__((unused)))
{
pid_t pid;
- int llen = 0, status;
+ int llen = 0, ret;
+ siginfo_t siginfo = {};
struct rlimit rlimit = { 0, 0 };
llen += printf("0 -fstackprotector ");
@@ -1361,10 +1368,11 @@ static int run_protection(int min __attribute__((unused)),
return 1;
default:
- pid = waitpid(pid, &status, 0);
+ ret = waitid(P_PID, pid, &siginfo, WEXITED);
- if (pid == -1 || !WIFSIGNALED(status) || WTERMSIG(status) != SIGABRT) {
- llen += printf("waitpid()");
+ if (ret != 0 || siginfo.si_signo != SIGCHLD ||
+ siginfo.si_code != CLD_KILLED || siginfo.si_status != SIGABRT) {
+ llen += printf("waitid()");
result(llen, FAIL);
return 1;
}
diff --git a/tools/testing/selftests/nolibc/run-tests.sh b/tools/testing/selftests/nolibc/run-tests.sh
index e7ecda4ae796..9c5160c53881 100755
--- a/tools/testing/selftests/nolibc/run-tests.sh
+++ b/tools/testing/selftests/nolibc/run-tests.sh
@@ -17,7 +17,7 @@ perform_download=0
test_mode=system
werror=1
llvm=
-archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv s390 loongarch"
+archs="i386 x86_64 arm64 arm mips32le mips32be ppc ppc64 ppc64le riscv32 riscv64 s390 loongarch"
TEMP=$(getopt -o 'j:d:c:b:a:m:pelh' -n "$0" -- "$@")
@@ -143,6 +143,13 @@ test_arch() {
arch=$1
ct_arch=$(crosstool_arch "$arch")
ct_abi=$(crosstool_abi "$1")
+
+ if [ ! -d "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/." ]; then
+ echo "No toolchain found in ${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}."
+ echo "Did you install the toolchains or set the correct arch ? Rerun with -h for help."
+ return 1
+ fi
+
cross_compile=$(realpath "${download_location}gcc-${crosstool_version}-nolibc/${ct_arch}-${ct_abi}/bin/${ct_arch}-${ct_abi}-")
build_dir="${build_location}/${arch}"
if [ "$werror" -ne 0 ]; then
diff --git a/tools/testing/selftests/pid_namespace/.gitignore b/tools/testing/selftests/pid_namespace/.gitignore
index 93ab9d7e5b7e..5118f0f3edf4 100644
--- a/tools/testing/selftests/pid_namespace/.gitignore
+++ b/tools/testing/selftests/pid_namespace/.gitignore
@@ -1 +1,2 @@
+pid_max
regression_enomem
diff --git a/tools/testing/selftests/pid_namespace/Makefile b/tools/testing/selftests/pid_namespace/Makefile
index 9286a1d22cd3..b972f55d07ae 100644
--- a/tools/testing/selftests/pid_namespace/Makefile
+++ b/tools/testing/selftests/pid_namespace/Makefile
@@ -1,7 +1,7 @@
# SPDX-License-Identifier: GPL-2.0
CFLAGS += -g $(KHDR_INCLUDES)
-TEST_GEN_PROGS = regression_enomem
+TEST_GEN_PROGS = regression_enomem pid_max
LOCAL_HDRS += $(selfdir)/pidfd/pidfd.h
diff --git a/tools/testing/selftests/pid_namespace/pid_max.c b/tools/testing/selftests/pid_namespace/pid_max.c
new file mode 100644
index 000000000000..51c414faabb0
--- /dev/null
+++ b/tools/testing/selftests/pid_namespace/pid_max.c
@@ -0,0 +1,358 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+#define _GNU_SOURCE
+#include <assert.h>
+#include <errno.h>
+#include <fcntl.h>
+#include <linux/types.h>
+#include <sched.h>
+#include <signal.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <syscall.h>
+#include <sys/wait.h>
+
+#include "../kselftest_harness.h"
+#include "../pidfd/pidfd.h"
+
+#define __STACK_SIZE (8 * 1024 * 1024)
+static pid_t do_clone(int (*fn)(void *), void *arg, int flags)
+{
+ char *stack;
+ pid_t ret;
+
+ stack = malloc(__STACK_SIZE);
+ if (!stack)
+ return -ENOMEM;
+
+#ifdef __ia64__
+ ret = __clone2(fn, stack, __STACK_SIZE, flags | SIGCHLD, arg);
+#else
+ ret = clone(fn, stack + __STACK_SIZE, flags | SIGCHLD, arg);
+#endif
+ free(stack);
+ return ret;
+}
+
+static int pid_max_cb(void *data)
+{
+ int fd, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return -1;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return -1;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return -1;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return -1;
+ }
+
+ for (int i = 0; i < 501; i++) {
+ pid = fork();
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+ wait_for_pid(pid);
+ if (pid > 500) {
+ fprintf(stderr, "Managed to create pid number beyond limit\n");
+ return -1;
+ }
+ }
+
+ return 0;
+}
+
+static int pid_max_nested_inner(void *data)
+{
+ int fret = -1;
+ pid_t pids[2];
+ int fd, i, ret;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ pids[0] = fork();
+ if (pids[0] < 0) {
+ fprintf(stderr, "Failed to create first new process\n");
+ return fret;
+ }
+
+ if (pids[0] == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[1] = fork();
+ wait_for_pid(pids[0]);
+ if (pids[1] >= 0) {
+ if (pids[1] == 0)
+ exit(EXIT_SUCCESS);
+ wait_for_pid(pids[1]);
+
+ fprintf(stderr, "Managed to create process even though ancestor pid namespace had a limit\n");
+ return fret;
+ }
+
+ /* Now make sure that we wrap pids at 400. */
+ for (i = 0; i < 510; i++) {
+ pid_t pid;
+
+ pid = fork();
+ if (pid < 0)
+ return fret;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ wait_for_pid(pid);
+ if (pid >= 500) {
+ fprintf(stderr, "Managed to create process with pid %d beyond configured limit\n", pid);
+ return fret;
+ }
+ }
+
+ return 0;
+}
+
+static int pid_max_nested_outer(void *data)
+{
+ int fret = -1, nr_procs = 400;
+ pid_t pids[1000];
+ int fd, i, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "400", sizeof("400") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ /*
+ * Create 397 processes. This leaves room for do_clone() (398) and
+ * one more 399. So creating another process needs to fail.
+ */
+ for (nr_procs = 0; nr_procs < 396; nr_procs++) {
+ pid = fork();
+ if (pid < 0)
+ goto reap;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[nr_procs] = pid;
+ }
+
+ pid = do_clone(pid_max_nested_inner, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ if (pid < 0) {
+ fprintf(stderr, "%m - Failed to clone nested pidns\n");
+ goto reap;
+ }
+
+ if (wait_for_pid(pid)) {
+ fprintf(stderr, "%m - Nested pid_max failed\n");
+ goto reap;
+ }
+
+ fret = 0;
+
+reap:
+ for (int i = 0; i < nr_procs; i++)
+ wait_for_pid(pids[i]);
+
+ return fret;
+}
+
+static int pid_max_nested_limit_inner(void *data)
+{
+ int fret = -1, nr_procs = 400;
+ int fd, ret;
+ pid_t pid;
+ pid_t pids[1000];
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return fret;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return fret;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return fret;
+ }
+
+ ret = write(fd, "500", sizeof("500") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return fret;
+ }
+
+ for (nr_procs = 0; nr_procs < 500; nr_procs++) {
+ pid = fork();
+ if (pid < 0)
+ break;
+
+ if (pid == 0)
+ exit(EXIT_SUCCESS);
+
+ pids[nr_procs] = pid;
+ }
+
+ if (nr_procs >= 400) {
+ fprintf(stderr, "Managed to create processes beyond the configured outer limit\n");
+ goto reap;
+ }
+
+ fret = 0;
+
+reap:
+ for (int i = 0; i < nr_procs; i++)
+ wait_for_pid(pids[i]);
+
+ return fret;
+}
+
+static int pid_max_nested_limit_outer(void *data)
+{
+ int fd, ret;
+ pid_t pid;
+
+ ret = mount("", "/", NULL, MS_PRIVATE | MS_REC, 0);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to make rootfs private mount\n");
+ return -1;
+ }
+
+ umount2("/proc", MNT_DETACH);
+
+ ret = mount("proc", "/proc", "proc", 0, NULL);
+ if (ret) {
+ fprintf(stderr, "%m - Failed to mount proc\n");
+ return -1;
+ }
+
+ fd = open("/proc/sys/kernel/pid_max", O_RDWR | O_CLOEXEC | O_NOCTTY);
+ if (fd < 0) {
+ fprintf(stderr, "%m - Failed to open pid_max\n");
+ return -1;
+ }
+
+ ret = write(fd, "400", sizeof("400") - 1);
+ close(fd);
+ if (ret < 0) {
+ fprintf(stderr, "%m - Failed to write pid_max\n");
+ return -1;
+ }
+
+ pid = do_clone(pid_max_nested_limit_inner, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ if (pid < 0) {
+ fprintf(stderr, "%m - Failed to clone nested pidns\n");
+ return -1;
+ }
+
+ if (wait_for_pid(pid)) {
+ fprintf(stderr, "%m - Nested pid_max failed\n");
+ return -1;
+ }
+
+ return 0;
+}
+
+TEST(pid_max_simple)
+{
+ pid_t pid;
+
+
+ pid = do_clone(pid_max_cb, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST(pid_max_nested_limit)
+{
+ pid_t pid;
+
+ pid = do_clone(pid_max_nested_limit_outer, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST(pid_max_nested)
+{
+ pid_t pid;
+
+ pid = do_clone(pid_max_nested_outer, NULL, CLONE_NEWPID | CLONE_NEWNS);
+ ASSERT_GT(pid, 0);
+ ASSERT_EQ(0, wait_for_pid(pid));
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/.gitignore b/tools/testing/selftests/pidfd/.gitignore
index 973198a3ec3d..bf92481f925c 100644
--- a/tools/testing/selftests/pidfd/.gitignore
+++ b/tools/testing/selftests/pidfd/.gitignore
@@ -6,3 +6,5 @@ pidfd_wait
pidfd_fdinfo_test
pidfd_getfd_test
pidfd_setns_test
+pidfd_file_handle_test
+pidfd_bind_mount
diff --git a/tools/testing/selftests/pidfd/Makefile b/tools/testing/selftests/pidfd/Makefile
index d731e3e76d5b..301343a11b62 100644
--- a/tools/testing/selftests/pidfd/Makefile
+++ b/tools/testing/selftests/pidfd/Makefile
@@ -2,7 +2,8 @@
CFLAGS += -g $(KHDR_INCLUDES) -pthread -Wall
TEST_GEN_PROGS := pidfd_test pidfd_fdinfo_test pidfd_open_test \
- pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test
+ pidfd_poll_test pidfd_wait pidfd_getfd_test pidfd_setns_test \
+ pidfd_file_handle_test pidfd_bind_mount
include ../lib.mk
diff --git a/tools/testing/selftests/pidfd/pidfd.h b/tools/testing/selftests/pidfd/pidfd.h
index 88d6830ee004..0b96ac4b8ce5 100644
--- a/tools/testing/selftests/pidfd/pidfd.h
+++ b/tools/testing/selftests/pidfd/pidfd.h
@@ -12,11 +12,11 @@
#include <stdlib.h>
#include <string.h>
#include <syscall.h>
-#include <sys/mount.h>
#include <sys/types.h>
#include <sys/wait.h>
#include "../kselftest.h"
+#include "../clone3/clone3_selftests.h"
#ifndef P_PIDFD
#define P_PIDFD 3
@@ -68,6 +68,11 @@
#define PIDFD_SKIP 3
#define PIDFD_XFAIL 4
+static inline int sys_waitid(int which, pid_t pid, siginfo_t *info, int options)
+{
+ return syscall(__NR_waitid, which, pid, info, options, NULL);
+}
+
static inline int wait_for_pid(pid_t pid)
{
int status, ret;
@@ -114,4 +119,37 @@ static inline int sys_memfd_create(const char *name, unsigned int flags)
return syscall(__NR_memfd_create, name, flags);
}
+static inline pid_t create_child(int *pidfd, unsigned flags)
+{
+ struct __clone_args args = {
+ .flags = CLONE_PIDFD | flags,
+ .exit_signal = SIGCHLD,
+ .pidfd = ptr_to_u64(pidfd),
+ };
+
+ return sys_clone3(&args, sizeof(struct __clone_args));
+}
+
+static inline ssize_t read_nointr(int fd, void *buf, size_t count)
+{
+ ssize_t ret;
+
+ do {
+ ret = read(fd, buf, count);
+ } while (ret < 0 && errno == EINTR);
+
+ return ret;
+}
+
+static inline ssize_t write_nointr(int fd, const void *buf, size_t count)
+{
+ ssize_t ret;
+
+ do {
+ ret = write(fd, buf, count);
+ } while (ret < 0 && errno == EINTR);
+
+ return ret;
+}
+
#endif /* __PIDFD_H */
diff --git a/tools/testing/selftests/pidfd/pidfd_bind_mount.c b/tools/testing/selftests/pidfd/pidfd_bind_mount.c
new file mode 100644
index 000000000000..7822dd080258
--- /dev/null
+++ b/tools/testing/selftests/pidfd/pidfd_bind_mount.c
@@ -0,0 +1,188 @@
+// SPDX-License-Identifier: GPL-2.0-or-later
+// Copyright (c) 2024 Christian Brauner <brauner@kernel.org>
+
+#define _GNU_SOURCE
+#include <fcntl.h>
+#include <limits.h>
+#include <sched.h>
+#include <stdio.h>
+#include <string.h>
+#include <linux/fs.h>
+#include <sys/ioctl.h>
+#include <sys/stat.h>
+#include <sys/mount.h>
+#include <unistd.h>
+
+#include "pidfd.h"
+#include "../kselftest_harness.h"
+
+#ifndef __NR_open_tree
+ #if defined __alpha__
+ #define __NR_open_tree 538
+ #elif defined _MIPS_SIM
+ #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */
+ #define __NR_open_tree 4428
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */
+ #define __NR_open_tree 6428
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */
+ #define __NR_open_tree 5428
+ #endif
+ #elif defined __ia64__
+ #define __NR_open_tree (428 + 1024)
+ #else
+ #define __NR_open_tree 428
+ #endif
+#endif
+
+#ifndef __NR_move_mount
+ #if defined __alpha__
+ #define __NR_move_mount 539
+ #elif defined _MIPS_SIM
+ #if _MIPS_SIM == _MIPS_SIM_ABI32 /* o32 */
+ #define __NR_move_mount 4429
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_NABI32 /* n32 */
+ #define __NR_move_mount 6429
+ #endif
+ #if _MIPS_SIM == _MIPS_SIM_ABI64 /* n64 */
+ #define __NR_move_mount 5429
+ #endif
+ #elif defined __ia64__
+ #define __NR_move_mount (428 + 1024)
+ #else
+ #define __NR_move_mount 429
+ #endif
+#endif
+
+#ifndef MOVE_MOUNT_F_EMPTY_PATH
+#define MOVE_MOUNT_F_EMPTY_PATH 0x00000004 /* Empty from path permitted */
+#endif
+
+#ifndef MOVE_MOUNT_F_EMPTY_PATH
+#define MOVE_MOUNT_T_EMPTY_PATH 0x00000040 /* Empty to path permitted */
+#endif
+
+static inline int sys_move_mount(int from_dfd, const char *from_pathname,
+ int to_dfd, const char *to_pathname,
+ unsigned int flags)
+{
+ return syscall(__NR_move_mount, from_dfd, from_pathname, to_dfd,
+ to_pathname, flags);
+}
+
+#ifndef OPEN_TREE_CLONE
+#define OPEN_TREE_CLONE 1
+#endif
+
+#ifndef OPEN_TREE_CLOEXEC
+#define OPEN_TREE_CLOEXEC O_CLOEXEC
+#endif
+
+#ifndef AT_RECURSIVE
+#define AT_RECURSIVE 0x8000 /* Apply to the entire subtree */
+#endif
+
+static inline int sys_open_tree(int dfd, const char *filename, unsigned int flags)
+{
+ return syscall(__NR_open_tree, dfd, filename, flags);
+}
+
+FIXTURE(pidfd_bind_mount) {
+ char template[PATH_MAX];
+ int fd_tmp;
+ int pidfd;
+ struct stat st1;
+ struct stat st2;
+ __u32 gen1;
+ __u32 gen2;
+ bool must_unmount;
+};
+
+FIXTURE_SETUP(pidfd_bind_mount)
+{
+ self->fd_tmp = -EBADF;
+ self->must_unmount = false;
+ ASSERT_EQ(unshare(CLONE_NEWNS), 0);
+ ASSERT_LE(snprintf(self->template, PATH_MAX, "%s", P_tmpdir "/pidfd_bind_mount_XXXXXX"), PATH_MAX);
+ self->fd_tmp = mkstemp(self->template);
+ ASSERT_GE(self->fd_tmp, 0);
+ self->pidfd = sys_pidfd_open(getpid(), 0);
+ ASSERT_GE(self->pidfd, 0);
+ ASSERT_GE(fstat(self->pidfd, &self->st1), 0);
+ ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen1), 0);
+}
+
+FIXTURE_TEARDOWN(pidfd_bind_mount)
+{
+ ASSERT_EQ(close(self->fd_tmp), 0);
+ if (self->must_unmount)
+ ASSERT_EQ(umount2(self->template, 0), 0);
+ ASSERT_EQ(unlink(self->template), 0);
+}
+
+/*
+ * Test that a detached mount can be created for a pidfd and then
+ * attached to the filesystem hierarchy.
+ */
+TEST_F(pidfd_bind_mount, bind_mount)
+{
+ int fd_tree;
+
+ fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH);
+ ASSERT_GE(fd_tree, 0);
+
+ ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0);
+ self->must_unmount = true;
+
+ ASSERT_EQ(close(fd_tree), 0);
+}
+
+/* Test that a pidfd can be reopened through procfs. */
+TEST_F(pidfd_bind_mount, reopen)
+{
+ int pidfd;
+ char proc_path[PATH_MAX];
+
+ sprintf(proc_path, "/proc/self/fd/%d", self->pidfd);
+ pidfd = open(proc_path, O_RDONLY | O_NOCTTY | O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_GE(fstat(self->pidfd, &self->st2), 0);
+ ASSERT_EQ(ioctl(self->pidfd, FS_IOC_GETVERSION, &self->gen2), 0);
+
+ ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino);
+ ASSERT_TRUE(self->gen1 == self->gen2);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+/*
+ * Test that a detached mount can be created for a pidfd and then
+ * attached to the filesystem hierarchy and reopened.
+ */
+TEST_F(pidfd_bind_mount, bind_mount_reopen)
+{
+ int fd_tree, fd_pidfd_mnt;
+
+ fd_tree = sys_open_tree(self->pidfd, "", OPEN_TREE_CLONE | OPEN_TREE_CLOEXEC | AT_EMPTY_PATH);
+ ASSERT_GE(fd_tree, 0);
+
+ ASSERT_EQ(move_mount(fd_tree, "", self->fd_tmp, "", MOVE_MOUNT_F_EMPTY_PATH | MOVE_MOUNT_T_EMPTY_PATH), 0);
+ self->must_unmount = true;
+
+ fd_pidfd_mnt = openat(-EBADF, self->template, O_RDONLY | O_NOCTTY | O_CLOEXEC);
+ ASSERT_GE(fd_pidfd_mnt, 0);
+
+ ASSERT_GE(fstat(fd_tree, &self->st2), 0);
+ ASSERT_EQ(ioctl(fd_pidfd_mnt, FS_IOC_GETVERSION, &self->gen2), 0);
+
+ ASSERT_TRUE(self->st1.st_dev == self->st2.st_dev && self->st1.st_ino == self->st2.st_ino);
+ ASSERT_TRUE(self->gen1 == self->gen2);
+
+ ASSERT_EQ(close(fd_tree), 0);
+ ASSERT_EQ(close(fd_pidfd_mnt), 0);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/pidfd_file_handle_test.c b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c
new file mode 100644
index 000000000000..439b9c6c0457
--- /dev/null
+++ b/tools/testing/selftests/pidfd/pidfd_file_handle_test.c
@@ -0,0 +1,503 @@
+// SPDX-License-Identifier: GPL-2.0
+
+#define _GNU_SOURCE
+#include <errno.h>
+#include <fcntl.h>
+#include <limits.h>
+#include <linux/types.h>
+#include <poll.h>
+#include <sched.h>
+#include <signal.h>
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#include <syscall.h>
+#include <sys/prctl.h>
+#include <sys/wait.h>
+#include <unistd.h>
+#include <sys/socket.h>
+#include <linux/kcmp.h>
+#include <sys/stat.h>
+
+#include "pidfd.h"
+#include "../kselftest_harness.h"
+
+FIXTURE(file_handle)
+{
+ pid_t pid;
+ int pidfd;
+
+ pid_t child_pid1;
+ int child_pidfd1;
+
+ pid_t child_pid2;
+ int child_pidfd2;
+
+ pid_t child_pid3;
+ int child_pidfd3;
+};
+
+FIXTURE_SETUP(file_handle)
+{
+ int ret;
+ int ipc_sockets[2];
+ char c;
+
+ self->pid = getpid();
+ self->pidfd = sys_pidfd_open(self->pid, 0);
+ ASSERT_GE(self->pidfd, 0);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid1 = create_child(&self->child_pidfd1, CLONE_NEWUSER);
+ EXPECT_GE(self->child_pid1, 0);
+
+ if (self->child_pid1 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid2 = create_child(&self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID);
+ EXPECT_GE(self->child_pid2, 0);
+
+ if (self->child_pid2 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+
+ ret = socketpair(AF_LOCAL, SOCK_STREAM | SOCK_CLOEXEC, 0, ipc_sockets);
+ EXPECT_EQ(ret, 0);
+
+ self->child_pid3 = create_child(&self->child_pidfd3, CLONE_NEWUSER | CLONE_NEWPID);
+ EXPECT_GE(self->child_pid3, 0);
+
+ if (self->child_pid3 == 0) {
+ close(ipc_sockets[0]);
+
+ if (write_nointr(ipc_sockets[1], "1", 1) < 0)
+ _exit(EXIT_FAILURE);
+
+ close(ipc_sockets[1]);
+
+ pause();
+ _exit(EXIT_SUCCESS);
+ }
+
+ close(ipc_sockets[1]);
+ ASSERT_EQ(read_nointr(ipc_sockets[0], &c, 1), 1);
+ close(ipc_sockets[0]);
+}
+
+FIXTURE_TEARDOWN(file_handle)
+{
+ EXPECT_EQ(close(self->pidfd), 0);
+
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd1, SIGKILL, NULL, 0), 0);
+ if (self->child_pidfd1 >= 0)
+ EXPECT_EQ(0, close(self->child_pidfd1));
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0);
+
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd2, SIGKILL, NULL, 0), 0);
+ if (self->child_pidfd2 >= 0)
+ EXPECT_EQ(0, close(self->child_pidfd2));
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0);
+
+ if (self->child_pidfd3 >= 0) {
+ EXPECT_EQ(sys_pidfd_send_signal(self->child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(0, close(self->child_pidfd3));
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+ }
+}
+
+/*
+ * Test that we can decode a pidfs file handle in the same pid
+ * namespace.
+ */
+TEST_F(file_handle, file_handle_same_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd1, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd1, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we can decode a pidfs file handle from a child pid
+ * namespace.
+ */
+TEST_F(file_handle, file_handle_child_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_CLOEXEC);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, O_NONBLOCK);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we fail to decode a pidfs file handle from an ancestor
+ * child pid namespace.
+ */
+TEST_F(file_handle, file_handle_foreign_pidns)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ pid_t pid;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->pidfd, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(setns(self->child_pidfd2, CLONE_NEWUSER | CLONE_NEWPID), 0);
+
+ pid = fork();
+ ASSERT_GE(pid, 0);
+
+ if (pid == 0) {
+ int pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ if (pidfd >= 0) {
+ TH_LOG("Managed to open pidfd outside of the caller's pid namespace hierarchy");
+ _exit(1);
+ }
+ _exit(0);
+ }
+
+ ASSERT_EQ(wait_for_pid(pid), 0);
+
+ free(fh);
+}
+
+/*
+ * Test that we can decode a pidfs file handle of a process that has
+ * exited but not been reaped.
+ */
+TEST_F(file_handle, pid_has_exited)
+{
+ int mnt_id, pidfd, child_pidfd3;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ child_pidfd3 = self->child_pidfd3;
+ self->child_pidfd3 = -EBADF;
+ EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(close(child_pidfd3), 0);
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED | WNOWAIT), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+}
+
+/*
+ * Test that we fail to decode a pidfs file handle of a process that has
+ * already been reaped.
+ */
+TEST_F(file_handle, pid_has_been_reaped)
+{
+ int mnt_id, pidfd, child_pidfd3;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd3, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd3, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+
+ child_pidfd3 = self->child_pidfd3;
+ self->child_pidfd3 = -EBADF;
+ EXPECT_EQ(sys_pidfd_send_signal(child_pidfd3, SIGKILL, NULL, 0), 0);
+ EXPECT_EQ(close(child_pidfd3), 0);
+ EXPECT_EQ(sys_waitid(P_PID, self->child_pid3, NULL, WEXITED), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_LT(pidfd, 0);
+}
+
+/*
+ * Test valid flags to open a pidfd file handle. Note, that
+ * PIDFD_NONBLOCK is defined as O_NONBLOCK and O_NONBLOCK is an alias to
+ * O_NDELAY. Also note that PIDFD_THREAD is an alias for O_EXCL.
+ */
+TEST_F(file_handle, open_by_handle_at_valid_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh,
+ O_RDONLY |
+ O_WRONLY |
+ O_RDWR |
+ O_NONBLOCK |
+ O_NDELAY |
+ O_CLOEXEC |
+ O_EXCL);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+/*
+ * Test that invalid flags passed to open a pidfd file handle are
+ * rejected.
+ */
+TEST_F(file_handle, open_by_handle_at_invalid_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+ int pidfd = -EBADF;
+ static const struct invalid_pidfs_file_handle_flags {
+ int oflag;
+ const char *oflag_name;
+ } invalid_pidfs_file_handle_flags[] = {
+ { FASYNC, "FASYNC" },
+ { O_CREAT, "O_CREAT" },
+ { O_NOCTTY, "O_NOCTTY" },
+ { O_CREAT, "O_CREAT" },
+ { O_TRUNC, "O_TRUNC" },
+ { O_APPEND, "O_APPEND" },
+ { O_SYNC, "O_SYNC" },
+ { O_DSYNC, "O_DSYNC" },
+ { O_DIRECT, "O_DIRECT" },
+ { O_DIRECTORY, "O_DIRECTORY" },
+ { O_NOFOLLOW, "O_NOFOLLOW" },
+ { O_NOATIME, "O_NOATIME" },
+ { O_PATH, "O_PATH" },
+ { O_TMPFILE, "O_TMPFILE" },
+ /*
+ * O_LARGEFILE is added implicitly by
+ * open_by_handle_at() so pidfs simply masks it off.
+ */
+ };
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH), 0);
+
+ for (int i = 0; i < ARRAY_SIZE(invalid_pidfs_file_handle_flags); i++) {
+ pidfd = open_by_handle_at(self->pidfd, fh, invalid_pidfs_file_handle_flags[i].oflag);
+ ASSERT_LT(pidfd, 0) {
+ TH_LOG("open_by_handle_at() succeeded with invalid flags: %s", invalid_pidfs_file_handle_flags[i].oflag_name);
+ }
+ }
+}
+
+/* Test that lookup fails. */
+TEST_F(file_handle, lookup_must_fail)
+{
+ int mnt_id;
+ struct file_handle *fh;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, AT_EMPTY_PATH), 0);
+ ASSERT_EQ(errno, ENOTDIR);
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "lookup-is-not-possible-with-pidfs", fh, &mnt_id, 0), 0);
+ ASSERT_EQ(errno, ENOTDIR);
+}
+
+#ifndef AT_HANDLE_CONNECTABLE
+#define AT_HANDLE_CONNECTABLE 0x002
+#endif
+
+/*
+ * Test that AT_HANDLE_CONNECTABLE is rejected. Connectable file handles
+ * don't make sense for pidfs. Note that currently AT_HANDLE_CONNECTABLE
+ * is rejected because it is incompatible with AT_EMPTY_PATH which is
+ * required with pidfds as we don't support lookup.
+ */
+TEST_F(file_handle, invalid_name_to_handle_at_flags)
+{
+ int mnt_id;
+ struct file_handle *fh;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_NE(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_CONNECTABLE), 0);
+}
+
+#ifndef AT_HANDLE_FID
+#define AT_HANDLE_FID 0x200
+#endif
+
+/*
+ * Test that a request with AT_HANDLE_FID always leads to decodable file
+ * handle as pidfs always provides export operations.
+ */
+TEST_F(file_handle, valid_name_to_handle_at_flags)
+{
+ int mnt_id, pidfd;
+ struct file_handle *fh;
+ struct stat st1, st2;
+
+ fh = malloc(sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ ASSERT_NE(fh, NULL);
+ memset(fh, 0, sizeof(struct file_handle) + MAX_HANDLE_SZ);
+ fh->handle_bytes = MAX_HANDLE_SZ;
+
+ ASSERT_EQ(name_to_handle_at(self->child_pidfd2, "", fh, &mnt_id, AT_EMPTY_PATH | AT_HANDLE_FID), 0);
+
+ ASSERT_EQ(fstat(self->child_pidfd2, &st1), 0);
+
+ pidfd = open_by_handle_at(self->pidfd, fh, 0);
+ ASSERT_GE(pidfd, 0);
+
+ ASSERT_EQ(fstat(pidfd, &st2), 0);
+ ASSERT_TRUE(st1.st_dev == st2.st_dev && st1.st_ino == st2.st_ino);
+
+ ASSERT_EQ(close(pidfd), 0);
+}
+
+TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/pidfd/pidfd_setns_test.c b/tools/testing/selftests/pidfd/pidfd_setns_test.c
index 7c2a4349170a..222f8131283b 100644
--- a/tools/testing/selftests/pidfd/pidfd_setns_test.c
+++ b/tools/testing/selftests/pidfd/pidfd_setns_test.c
@@ -19,7 +19,6 @@
#include <linux/ioctl.h>
#include "pidfd.h"
-#include "../clone3/clone3_selftests.h"
#include "../kselftest_harness.h"
#ifndef PIDFS_IOCTL_MAGIC
@@ -118,22 +117,6 @@ FIXTURE(current_nsset)
int child_pidfd_derived_nsfds2[PIDFD_NS_MAX];
};
-static int sys_waitid(int which, pid_t pid, int options)
-{
- return syscall(__NR_waitid, which, pid, NULL, options, NULL);
-}
-
-pid_t create_child(int *pidfd, unsigned flags)
-{
- struct __clone_args args = {
- .flags = CLONE_PIDFD | flags,
- .exit_signal = SIGCHLD,
- .pidfd = ptr_to_u64(pidfd),
- };
-
- return sys_clone3(&args, sizeof(struct clone_args));
-}
-
static bool switch_timens(void)
{
int fd, ret;
@@ -150,28 +133,6 @@ static bool switch_timens(void)
return ret == 0;
}
-static ssize_t read_nointr(int fd, void *buf, size_t count)
-{
- ssize_t ret;
-
- do {
- ret = read(fd, buf, count);
- } while (ret < 0 && errno == EINTR);
-
- return ret;
-}
-
-static ssize_t write_nointr(int fd, const void *buf, size_t count)
-{
- ssize_t ret;
-
- do {
- ret = write(fd, buf, count);
- } while (ret < 0 && errno == EINTR);
-
- return ret;
-}
-
FIXTURE_SETUP(current_nsset)
{
int i, proc_fd, ret;
@@ -229,7 +190,7 @@ FIXTURE_SETUP(current_nsset)
_exit(EXIT_SUCCESS);
}
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED | WNOWAIT), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED | WNOWAIT), 0);
self->pidfd = sys_pidfd_open(self->pid, 0);
EXPECT_GE(self->pidfd, 0) {
@@ -432,9 +393,9 @@ FIXTURE_TEARDOWN(current_nsset)
EXPECT_EQ(0, close(self->child_pidfd1));
if (self->child_pidfd2 >= 0)
EXPECT_EQ(0, close(self->child_pidfd2));
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, WEXITED), 0);
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, WEXITED), 0);
- ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid_exited, NULL, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid1, NULL, WEXITED), 0);
+ ASSERT_EQ(sys_waitid(P_PID, self->child_pid2, NULL, WEXITED), 0);
}
static int preserve_ns(const int pid, const char *ns)
diff --git a/tools/testing/selftests/pidfd/pidfd_wait.c b/tools/testing/selftests/pidfd/pidfd_wait.c
index 0dcb8365ddc3..1e2d49751cde 100644
--- a/tools/testing/selftests/pidfd/pidfd_wait.c
+++ b/tools/testing/selftests/pidfd/pidfd_wait.c
@@ -26,22 +26,11 @@
#define SKIP(s, ...) XFAIL(s, ##__VA_ARGS__)
#endif
-static pid_t sys_clone3(struct clone_args *args)
-{
- return syscall(__NR_clone3, args, sizeof(struct clone_args));
-}
-
-static int sys_waitid(int which, pid_t pid, siginfo_t *info, int options,
- struct rusage *ru)
-{
- return syscall(__NR_waitid, which, pid, info, options, ru);
-}
-
TEST(wait_simple)
{
int pidfd = -1;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.pidfd = ptr_to_u64(&pidfd),
.flags = CLONE_PIDFD | CLONE_PARENT_SETTID,
@@ -55,7 +44,7 @@ TEST(wait_simple)
pidfd = open("/proc/self", O_DIRECTORY | O_RDONLY | O_CLOEXEC);
ASSERT_GE(pidfd, 0);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_NE(pid, 0);
EXPECT_EQ(close(pidfd), 0);
pidfd = -1;
@@ -63,18 +52,18 @@ TEST(wait_simple)
pidfd = open("/dev/null", O_RDONLY | O_CLOEXEC);
ASSERT_GE(pidfd, 0);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_NE(pid, 0);
EXPECT_EQ(close(pidfd), 0);
pidfd = -1;
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0)
exit(EXIT_SUCCESS);
- pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ pid = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_GE(pid, 0);
ASSERT_EQ(WIFEXITED(info.si_status), true);
ASSERT_EQ(WEXITSTATUS(info.si_status), 0);
@@ -89,7 +78,7 @@ TEST(wait_states)
{
int pidfd = -1;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.pidfd = ptr_to_u64(&pidfd),
.flags = CLONE_PIDFD | CLONE_PARENT_SETTID,
@@ -102,7 +91,7 @@ TEST(wait_states)
};
ASSERT_EQ(pipe(pfd), 0);
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0) {
@@ -117,28 +106,28 @@ TEST(wait_states)
}
close(pfd[0]);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WCONTINUED), 0);
ASSERT_EQ(write(pfd[1], "C", 1), 1);
close(pfd[1]);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_CONTINUED);
ASSERT_EQ(info.si_pid, parent_tid);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WUNTRACED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGKILL, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_KILLED);
ASSERT_EQ(info.si_pid, parent_tid);
@@ -151,7 +140,7 @@ TEST(wait_nonblock)
int pidfd;
unsigned int flags = 0;
pid_t parent_tid = -1;
- struct clone_args args = {
+ struct __clone_args args = {
.parent_tid = ptr_to_u64(&parent_tid),
.flags = CLONE_PARENT_SETTID,
.exit_signal = SIGCHLD,
@@ -173,12 +162,12 @@ TEST(wait_nonblock)
SKIP(return, "Skipping PIDFD_NONBLOCK test");
}
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_LT(ret, 0);
ASSERT_EQ(errno, ECHILD);
EXPECT_EQ(close(pidfd), 0);
- pid = sys_clone3(&args);
+ pid = sys_clone3(&args, sizeof(args));
ASSERT_GE(pid, 0);
if (pid == 0) {
@@ -201,7 +190,7 @@ TEST(wait_nonblock)
* Callers need to see EAGAIN/EWOULDBLOCK with non-blocking pidfd when
* child processes exist but none have exited.
*/
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED);
ASSERT_LT(ret, 0);
ASSERT_EQ(errno, EAGAIN);
@@ -210,19 +199,19 @@ TEST(wait_nonblock)
* WNOHANG raised explicitly when child processes exist but none have
* exited.
*/
- ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG, NULL);
+ ret = sys_waitid(P_PIDFD, pidfd, &info, WEXITED | WNOHANG);
ASSERT_EQ(ret, 0);
ASSERT_EQ(fcntl(pidfd, F_SETFL, (flags & ~O_NONBLOCK)), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WSTOPPED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_STOPPED);
ASSERT_EQ(info.si_pid, parent_tid);
ASSERT_EQ(sys_pidfd_send_signal(pidfd, SIGCONT, NULL, 0), 0);
- ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED, NULL), 0);
+ ASSERT_EQ(sys_waitid(P_PIDFD, pidfd, &info, WEXITED), 0);
ASSERT_EQ(info.si_signo, SIGCHLD);
ASSERT_EQ(info.si_code, CLD_EXITED);
ASSERT_EQ(info.si_pid, parent_tid);
diff --git a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
index 580fcac0a09f..b71ef8a493ed 100644
--- a/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
+++ b/tools/testing/selftests/powerpc/benchmarks/gettimeofday.c
@@ -20,7 +20,7 @@ static int test_gettimeofday(void)
gettimeofday(&tv_end, NULL);
}
- timersub(&tv_start, &tv_end, &tv_diff);
+ timersub(&tv_end, &tv_start, &tv_diff);
printf("time = %.6f\n", tv_diff.tv_sec + (tv_diff.tv_usec) * 1e-6);
diff --git a/tools/testing/selftests/powerpc/include/pkeys.h b/tools/testing/selftests/powerpc/include/pkeys.h
index 51729d9a7111..3a0129467de6 100644
--- a/tools/testing/selftests/powerpc/include/pkeys.h
+++ b/tools/testing/selftests/powerpc/include/pkeys.h
@@ -35,10 +35,18 @@
#define __NR_pkey_alloc 384
#define __NR_pkey_free 385
+#ifndef NT_PPC_PKEY
+#define NT_PPC_PKEY 0x110
+#endif
+
#define PKEY_BITS_PER_PKEY 2
#define NR_PKEYS 32
#define PKEY_BITS_MASK ((1UL << PKEY_BITS_PER_PKEY) - 1)
+#define AMR_BITS_PER_PKEY 2
+#define PKEY_REG_BITS (sizeof(u64) * 8)
+#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+
inline unsigned long pkeyreg_get(void)
{
return mfspr(SPRN_AMR);
diff --git a/tools/testing/selftests/powerpc/ptrace/core-pkey.c b/tools/testing/selftests/powerpc/ptrace/core-pkey.c
index f6da4cb30cd6..f061434af452 100644
--- a/tools/testing/selftests/powerpc/ptrace/core-pkey.c
+++ b/tools/testing/selftests/powerpc/ptrace/core-pkey.c
@@ -16,26 +16,7 @@
#include <unistd.h>
#include "ptrace.h"
#include "child.h"
-
-#ifndef __NR_pkey_alloc
-#define __NR_pkey_alloc 384
-#endif
-
-#ifndef __NR_pkey_free
-#define __NR_pkey_free 385
-#endif
-
-#ifndef NT_PPC_PKEY
-#define NT_PPC_PKEY 0x110
-#endif
-
-#ifndef PKEY_DISABLE_EXECUTE
-#define PKEY_DISABLE_EXECUTE 0x4
-#endif
-
-#define AMR_BITS_PER_PKEY 2
-#define PKEY_REG_BITS (sizeof(u64) * 8)
-#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+#include "pkeys.h"
#define CORE_FILE_LIMIT (5 * 1024 * 1024) /* 5 MB should be enough */
@@ -61,16 +42,6 @@ struct shared_info {
time_t core_time;
};
-static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights)
-{
- return syscall(__NR_pkey_alloc, flags, init_access_rights);
-}
-
-static int sys_pkey_free(int pkey)
-{
- return syscall(__NR_pkey_free, pkey);
-}
-
static int increase_core_file_limit(void)
{
struct rlimit rlim;
diff --git a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
index d89474377f11..fc633014424f 100644
--- a/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
+++ b/tools/testing/selftests/powerpc/ptrace/ptrace-pkey.c
@@ -7,26 +7,7 @@
*/
#include "ptrace.h"
#include "child.h"
-
-#ifndef __NR_pkey_alloc
-#define __NR_pkey_alloc 384
-#endif
-
-#ifndef __NR_pkey_free
-#define __NR_pkey_free 385
-#endif
-
-#ifndef NT_PPC_PKEY
-#define NT_PPC_PKEY 0x110
-#endif
-
-#ifndef PKEY_DISABLE_EXECUTE
-#define PKEY_DISABLE_EXECUTE 0x4
-#endif
-
-#define AMR_BITS_PER_PKEY 2
-#define PKEY_REG_BITS (sizeof(u64) * 8)
-#define pkeyshift(pkey) (PKEY_REG_BITS - ((pkey + 1) * AMR_BITS_PER_PKEY))
+#include "pkeys.h"
static const char user_read[] = "[User Read (Running)]";
static const char user_write[] = "[User Write (Running)]";
@@ -61,11 +42,6 @@ struct shared_info {
unsigned long invalid_uamor;
};
-static int sys_pkey_alloc(unsigned long flags, unsigned long init_access_rights)
-{
- return syscall(__NR_pkey_alloc, flags, init_access_rights);
-}
-
static int child(struct shared_info *info)
{
unsigned long reg;
diff --git a/tools/testing/selftests/powerpc/vphn/test-vphn.c b/tools/testing/selftests/powerpc/vphn/test-vphn.c
index 81d3069ffb84..f348f54914a9 100644
--- a/tools/testing/selftests/powerpc/vphn/test-vphn.c
+++ b/tools/testing/selftests/powerpc/vphn/test-vphn.c
@@ -275,7 +275,7 @@ static struct test {
}
},
{
- /* Parse a 32-bit value split accross two consecutives 64-bit
+ /* Parse a 32-bit value split across two consecutives 64-bit
* input values.
*/
"vphn: 16-bit value followed by 2 x 32-bit values",
diff --git a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
index 134cdef5a6e0..48a8052d5dae 100755
--- a/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
+++ b/tools/testing/selftests/rcutorture/bin/kvm-remote.sh
@@ -181,10 +181,11 @@ done
# Function to check for presence of a file on the specified system.
# Complain if the system cannot be reached, and retry after a wait.
-# Currently just waits forever if a machine disappears.
+# Currently just waits 15 minutes if a machine disappears.
#
# Usage: checkremotefile system pathname
checkremotefile () {
+ local nsshfails=0
local ret
local sleeptime=60
@@ -195,6 +196,11 @@ checkremotefile () {
if test "$ret" -eq 255
then
echo " ---" ssh failure to $1 checking for file $2, retry after $sleeptime seconds. `date` | tee -a "$oldrun/remote-log"
+ nsshfails=$((nsshfails+1))
+ if ((nsshfails > 15))
+ then
+ return 255
+ fi
elif test "$ret" -eq 0
then
return 0
@@ -268,12 +274,23 @@ echo All batches started. `date` | tee -a "$oldrun/remote-log"
for i in $systems
do
echo " ---" Waiting for $i `date` | tee -a "$oldrun/remote-log"
- while checkremotefile "$i" "$resdir/$ds/remote.run"
+ while :
do
+ checkremotefile "$i" "$resdir/$ds/remote.run"
+ ret=$?
+ if test "$ret" -eq 1
+ then
+ echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log"
+ ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - )
+ break;
+ fi
+ if test "$ret" -eq 255
+ then
+ echo System $i persistent ssh failure, lost results `date` | tee -a "$oldrun/remote-log"
+ break;
+ fi
sleep 30
done
- echo " ---" Collecting results from $i `date` | tee -a "$oldrun/remote-log"
- ( cd "$oldrun"; ssh -o BatchMode=yes $i "cd $rundir; tar -czf - kvm-remote-*.sh.out */console.log */kvm-test-1-run*.sh.out */qemu[_-]pid */qemu-retval */qemu-affinity; rm -rf $T > /dev/null 2>&1" | tar -xzf - )
done
( kvm-end-run-stats.sh "$oldrun" "$starttime"; echo $? > $T/exitcode ) | tee -a "$oldrun/remote-log"
diff --git a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
index 8e50bfd4b710..90318591dae2 100644
--- a/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
+++ b/tools/testing/selftests/rcutorture/configs/rcu/TREE03.boot
@@ -5,3 +5,4 @@ rcutree.gp_cleanup_delay=3
rcutree.kthread_prio=2
threadirqs
rcutree.use_softirq=0
+rcutorture.preempt_duration=10
diff --git a/tools/testing/selftests/resctrl/Makefile b/tools/testing/selftests/resctrl/Makefile
index f408bd6bfc3d..984534cfbf1b 100644
--- a/tools/testing/selftests/resctrl/Makefile
+++ b/tools/testing/selftests/resctrl/Makefile
@@ -8,5 +8,6 @@ TEST_GEN_PROGS := resctrl_tests
LOCAL_HDRS += $(wildcard *.h)
include ../lib.mk
+CFLAGS += -I$(top_srcdir)/tools/include
$(OUTPUT)/resctrl_tests: $(wildcard *.c)
diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c
index 3bbf3042fb06..d09e693dc739 100644
--- a/tools/testing/selftests/resctrl/cmt_test.c
+++ b/tools/testing/selftests/resctrl/cmt_test.c
@@ -169,8 +169,8 @@ static int cmt_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results(&param, span, n);
- if (ret && (get_vendor() == ARCH_INTEL))
- ksft_print_msg("Intel CMT may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n");
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c
index 536d9089d2f6..c7e9adc0368f 100644
--- a/tools/testing/selftests/resctrl/mba_test.c
+++ b/tools/testing/selftests/resctrl/mba_test.c
@@ -201,6 +201,8 @@ static int mba_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results();
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c
index 315b2ef3b3bc..84d8bc250539 100644
--- a/tools/testing/selftests/resctrl/mbm_test.c
+++ b/tools/testing/selftests/resctrl/mbm_test.c
@@ -160,8 +160,8 @@ static int mbm_run_test(const struct resctrl_test *test, const struct user_param
return ret;
ret = check_results(param.fill_buf ? param.fill_buf->buf_size : 0);
- if (ret && (get_vendor() == ARCH_INTEL))
- ksft_print_msg("Intel MBM may be inaccurate when Sub-NUMA Clustering is enabled. Check BIOS configuration.\n");
+ if (ret && (get_vendor() == ARCH_INTEL) && !snc_kernel_support())
+ ksft_print_msg("Kernel doesn't support Sub-NUMA Clustering but it is enabled on the system.\n");
return ret;
}
diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h
index dab1953fc7a0..cd3adfc14969 100644
--- a/tools/testing/selftests/resctrl/resctrl.h
+++ b/tools/testing/selftests/resctrl/resctrl.h
@@ -11,6 +11,7 @@
#include <signal.h>
#include <dirent.h>
#include <stdbool.h>
+#include <ctype.h>
#include <sys/stat.h>
#include <sys/ioctl.h>
#include <sys/mount.h>
@@ -21,6 +22,7 @@
#include <sys/eventfd.h>
#include <asm/unistd.h>
#include <linux/perf_event.h>
+#include <linux/compiler.h>
#include "../kselftest.h"
#define MB (1024 * 1024)
@@ -156,8 +158,11 @@ struct perf_event_read {
*/
extern volatile int *value_sink;
+extern int snc_unreliable;
+
extern char llc_occup_path[1024];
+int snc_nodes_per_l3_cache(void);
int get_vendor(void);
bool check_resctrlfs_support(void);
int filter_dmesg(void);
@@ -198,6 +203,7 @@ void ctrlc_handler(int signum, siginfo_t *info, void *ptr);
int signal_handler_register(const struct resctrl_test *test);
void signal_handler_unregister(void);
unsigned int count_bits(unsigned long n);
+int snc_kernel_support(void);
void perf_event_attr_initialize(struct perf_event_attr *pea, __u64 config);
void perf_event_initialize_read_format(struct perf_event_read *pe_read);
diff --git a/tools/testing/selftests/resctrl/resctrl_tests.c b/tools/testing/selftests/resctrl/resctrl_tests.c
index 3335af815b21..5154ffd821c4 100644
--- a/tools/testing/selftests/resctrl/resctrl_tests.c
+++ b/tools/testing/selftests/resctrl/resctrl_tests.c
@@ -118,7 +118,7 @@ static bool test_vendor_specific_check(const struct resctrl_test *test)
static void run_single_test(const struct resctrl_test *test, const struct user_params *uparams)
{
- int ret;
+ int ret, snc_mode;
if (test->disabled)
return;
@@ -128,8 +128,15 @@ static void run_single_test(const struct resctrl_test *test, const struct user_p
return;
}
+ snc_mode = snc_nodes_per_l3_cache();
+
ksft_print_msg("Starting %s test ...\n", test->name);
+ if (snc_mode == 1 && snc_unreliable && get_vendor() == ARCH_INTEL) {
+ ksft_test_result_skip("SNC detection unreliable due to offline CPUs. Test results may not be accurate if SNC enabled.\n");
+ return;
+ }
+
if (test_prepare(test)) {
ksft_exit_fail_msg("Abnormal failure when preparing for the test\n");
return;
diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c
index d38d6dd90be4..195f04c4d158 100644
--- a/tools/testing/selftests/resctrl/resctrlfs.c
+++ b/tools/testing/selftests/resctrl/resctrlfs.c
@@ -13,6 +13,8 @@
#include "resctrl.h"
+int snc_unreliable;
+
static int find_resctrl_mount(char *buffer)
{
FILE *mounts;
@@ -157,6 +159,98 @@ int get_domain_id(const char *resource, int cpu_no, int *domain_id)
}
/*
+ * Count number of CPUs in a /sys bitmap
+ */
+static unsigned int count_sys_bitmap_bits(char *name)
+{
+ FILE *fp = fopen(name, "r");
+ int count = 0, c;
+
+ if (!fp)
+ return 0;
+
+ while ((c = fgetc(fp)) != EOF) {
+ if (!isxdigit(c))
+ continue;
+ switch (c) {
+ case 'f':
+ count++;
+ fallthrough;
+ case '7': case 'b': case 'd': case 'e':
+ count++;
+ fallthrough;
+ case '3': case '5': case '6': case '9': case 'a': case 'c':
+ count++;
+ fallthrough;
+ case '1': case '2': case '4': case '8':
+ count++;
+ break;
+ }
+ }
+ fclose(fp);
+
+ return count;
+}
+
+static bool cpus_offline_empty(void)
+{
+ char offline_cpus_str[64];
+ FILE *fp;
+
+ fp = fopen("/sys/devices/system/cpu/offline", "r");
+ if (!fp) {
+ ksft_perror("Could not open /sys/devices/system/cpu/offline");
+ return 0;
+ }
+
+ if (fscanf(fp, "%63s", offline_cpus_str) < 0) {
+ if (!errno) {
+ fclose(fp);
+ return 1;
+ }
+ ksft_perror("Could not read /sys/devices/system/cpu/offline");
+ }
+
+ fclose(fp);
+
+ return 0;
+}
+
+/*
+ * Detect SNC by comparing #CPUs in node0 with #CPUs sharing LLC with CPU0.
+ * If any CPUs are offline declare the detection as unreliable.
+ */
+int snc_nodes_per_l3_cache(void)
+{
+ int node_cpus, cache_cpus;
+ static int snc_mode;
+
+ if (!snc_mode) {
+ snc_mode = 1;
+ if (!cpus_offline_empty()) {
+ ksft_print_msg("Runtime SNC detection unreliable due to offline CPUs.\n");
+ ksft_print_msg("Setting SNC mode to disabled.\n");
+ snc_unreliable = 1;
+ return snc_mode;
+ }
+ node_cpus = count_sys_bitmap_bits("/sys/devices/system/node/node0/cpumap");
+ cache_cpus = count_sys_bitmap_bits("/sys/devices/system/cpu/cpu0/cache/index3/shared_cpu_map");
+
+ if (!node_cpus || !cache_cpus) {
+ ksft_print_msg("Could not determine Sub-NUMA Cluster mode.\n");
+ snc_unreliable = 1;
+ return snc_mode;
+ }
+ snc_mode = cache_cpus / node_cpus;
+
+ if (snc_mode > 1)
+ ksft_print_msg("SNC-%d mode discovered.\n", snc_mode);
+ }
+
+ return snc_mode;
+}
+
+/*
* get_cache_size - Get cache size for a specified CPU
* @cpu_no: CPU number
* @cache_type: Cache level L2/L3
@@ -211,6 +305,17 @@ int get_cache_size(int cpu_no, const char *cache_type, unsigned long *cache_size
break;
}
+ /*
+ * The amount of cache represented by each bit in the masks
+ * in the schemata file is reduced by a factor equal to SNC
+ * nodes per L3 cache.
+ * E.g. on a SNC-2 system with a 100MB L3 cache a test that
+ * allocates memory from its local SNC node (default behavior
+ * without using libnuma) will only see 50 MB llc_occupancy
+ * with a fully populated L3 mask in the schemata file.
+ */
+ if (cache_num == 3)
+ *cache_size /= snc_nodes_per_l3_cache();
return 0;
}
@@ -852,3 +957,35 @@ unsigned int count_bits(unsigned long n)
return count;
}
+
+/**
+ * snc_kernel_support - Check for existence of mon_sub_L3_00 file that indicates
+ * SNC resctrl support on the kernel side.
+ *
+ * Return: 0 if not supported, 1 if SNC is disabled or SNC discovery is
+ * unreliable or SNC is both enabled and supported.
+ */
+int snc_kernel_support(void)
+{
+ char node_path[PATH_MAX];
+ struct stat statbuf;
+ int ret;
+
+ ret = snc_nodes_per_l3_cache();
+ /*
+ * If SNC is disabled then its kernel support isn't important. If SNC
+ * got disabled because the discovery process was unreliable the
+ * snc_unreliable variable was set. It can be used to verify the SNC
+ * discovery reliability elsewhere in the selftest.
+ */
+ if (ret == 1)
+ return ret;
+
+ snprintf(node_path, sizeof(node_path), "%s/%s", RESCTRL_PATH,
+ "mon_data/mon_L3_00/mon_sub_L3_00");
+
+ if (!stat(node_path, &statbuf))
+ return 1;
+
+ return 0;
+}
diff --git a/tools/testing/selftests/ring-buffer/map_test.c b/tools/testing/selftests/ring-buffer/map_test.c
index d10a847130fb..a58f520f2f41 100644
--- a/tools/testing/selftests/ring-buffer/map_test.c
+++ b/tools/testing/selftests/ring-buffer/map_test.c
@@ -233,12 +233,18 @@ TEST_F(map, data_mmap)
ASSERT_NE(data, MAP_FAILED);
munmap(data, data_len);
- /* Overflow the available subbufs by 1 */
+ /* Offset within ring-buffer bounds, mapping size overflow */
meta_len += desc->meta->subbuf_size * 2;
data = mmap(NULL, data_len, PROT_READ, MAP_SHARED,
desc->cpu_fd, meta_len);
ASSERT_EQ(data, MAP_FAILED);
+ /* Offset outside ring-buffer bounds */
+ data_len = desc->meta->subbuf_size * desc->meta->nr_subbufs;
+ data = mmap(NULL, data_len, PROT_READ, MAP_SHARED,
+ desc->cpu_fd, data_len + (desc->meta->subbuf_size * 2));
+ ASSERT_EQ(data, MAP_FAILED);
+
/* Verify meta-page padding */
if (desc->meta->meta_page_size > getpagesize()) {
data_len = desc->meta->meta_page_size;
diff --git a/tools/testing/selftests/riscv/abi/pointer_masking.c b/tools/testing/selftests/riscv/abi/pointer_masking.c
index dee41b7ee3e3..059d2e87eb1f 100644
--- a/tools/testing/selftests/riscv/abi/pointer_masking.c
+++ b/tools/testing/selftests/riscv/abi/pointer_masking.c
@@ -185,8 +185,20 @@ static void test_fork_exec(void)
}
}
+static bool pwrite_wrapper(int fd, void *buf, size_t count, const char *msg)
+{
+ int ret = pwrite(fd, buf, count, 0);
+
+ if (ret != count) {
+ ksft_perror(msg);
+ return false;
+ }
+ return true;
+}
+
static void test_tagged_addr_abi_sysctl(void)
{
+ char *err_pwrite_msg = "failed to write to /proc/sys/abi/tagged_addr_disabled\n";
char value;
int fd;
@@ -200,14 +212,18 @@ static void test_tagged_addr_abi_sysctl(void)
}
value = '1';
- pwrite(fd, &value, 1, 0);
- ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL,
- "sysctl disabled\n");
+ if (!pwrite_wrapper(fd, &value, 1, "write '1'"))
+ ksft_test_result_fail(err_pwrite_msg);
+ else
+ ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == -EINVAL,
+ "sysctl disabled\n");
value = '0';
- pwrite(fd, &value, 1, 0);
- ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0,
- "sysctl enabled\n");
+ if (!pwrite_wrapper(fd, &value, 1, "write '0'"))
+ ksft_test_result_fail(err_pwrite_msg);
+ else
+ ksft_test_result(set_tagged_addr_ctrl(min_pmlen, true) == 0,
+ "sysctl enabled\n");
set_tagged_addr_ctrl(0, false);
diff --git a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c b/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
index 1dd94197da30..6174ffe016dc 100644
--- a/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
+++ b/tools/testing/selftests/riscv/vector/v_initval_nolibc.c
@@ -25,6 +25,8 @@ int main(void)
unsigned long vl;
char *datap, *tmp;
+ ksft_set_plan(1);
+
datap = malloc(MAX_VSIZE);
if (!datap) {
ksft_test_result_fail("fail to allocate memory for size = %d\n", MAX_VSIZE);
@@ -63,6 +65,8 @@ int main(void)
}
free(datap);
+
+ ksft_test_result_pass("tests for v_initval_nolibc pass\n");
ksft_exit_pass();
return 0;
}
diff --git a/tools/testing/selftests/riscv/vector/vstate_prctl.c b/tools/testing/selftests/riscv/vector/vstate_prctl.c
index 895177f6bf4c..40b3bffcbb40 100644
--- a/tools/testing/selftests/riscv/vector/vstate_prctl.c
+++ b/tools/testing/selftests/riscv/vector/vstate_prctl.c
@@ -76,6 +76,8 @@ int main(void)
long flag, expected;
long rc;
+ ksft_set_plan(1);
+
pair.key = RISCV_HWPROBE_KEY_IMA_EXT_0;
rc = riscv_hwprobe(&pair, 1, 0, NULL, 0);
if (rc < 0) {
diff --git a/tools/testing/selftests/rseq/rseq.c b/tools/testing/selftests/rseq/rseq.c
index 5b9772cdf265..f6156790c3b4 100644
--- a/tools/testing/selftests/rseq/rseq.c
+++ b/tools/testing/selftests/rseq/rseq.c
@@ -61,7 +61,6 @@ unsigned int rseq_size = -1U;
unsigned int rseq_flags;
static int rseq_ownership;
-static int rseq_reg_success; /* At least one rseq registration has succeded. */
/* Allocate a large area for the TLS. */
#define RSEQ_THREAD_AREA_ALLOC_SIZE 1024
@@ -152,14 +151,27 @@ int rseq_register_current_thread(void)
}
rc = sys_rseq(&__rseq_abi, get_rseq_min_alloc_size(), 0, RSEQ_SIG);
if (rc) {
- if (RSEQ_READ_ONCE(rseq_reg_success)) {
+ /*
+ * After at least one thread has registered successfully
+ * (rseq_size > 0), the registration of other threads should
+ * never fail.
+ */
+ if (RSEQ_READ_ONCE(rseq_size) > 0) {
/* Incoherent success/failure within process. */
abort();
}
return -1;
}
assert(rseq_current_cpu_raw() >= 0);
- RSEQ_WRITE_ONCE(rseq_reg_success, 1);
+
+ /*
+ * The first thread to register sets the rseq_size to mimic the libc
+ * behavior.
+ */
+ if (RSEQ_READ_ONCE(rseq_size) == 0) {
+ RSEQ_WRITE_ONCE(rseq_size, get_rseq_kernel_feature_size());
+ }
+
return 0;
}
@@ -235,12 +247,18 @@ void rseq_init(void)
return;
}
rseq_ownership = 1;
- if (!rseq_available()) {
- rseq_size = 0;
- return;
- }
+
+ /* Calculate the offset of the rseq area from the thread pointer. */
rseq_offset = (void *)&__rseq_abi - rseq_thread_pointer();
+
+ /* rseq flags are deprecated, always set to 0. */
rseq_flags = 0;
+
+ /*
+ * Set the size to 0 until at least one thread registers to mimic the
+ * libc behavior.
+ */
+ rseq_size = 0;
}
static __attribute__((destructor))
diff --git a/tools/testing/selftests/rseq/rseq.h b/tools/testing/selftests/rseq/rseq.h
index 4e217b620e0c..062d10925a10 100644
--- a/tools/testing/selftests/rseq/rseq.h
+++ b/tools/testing/selftests/rseq/rseq.h
@@ -60,7 +60,14 @@
extern ptrdiff_t rseq_offset;
/*
- * Size of the registered rseq area. 0 if the registration was
+ * The rseq ABI is composed of extensible feature fields. The extensions
+ * are done by appending additional fields at the end of the structure.
+ * The rseq_size defines the size of the active feature set which can be
+ * used by the application for the current rseq registration. Features
+ * starting at offset >= rseq_size are inactive and should not be used.
+ *
+ * The rseq_size is the intersection between the available allocation
+ * size for the rseq area and the feature size supported by the kernel.
* unsuccessful.
*/
extern unsigned int rseq_size;
diff --git a/tools/testing/selftests/run_kselftest.sh b/tools/testing/selftests/run_kselftest.sh
index a28c1416cb89..50e03eefe7ac 100755
--- a/tools/testing/selftests/run_kselftest.sh
+++ b/tools/testing/selftests/run_kselftest.sh
@@ -21,7 +21,7 @@ usage()
cat <<EOF
Usage: $0 [OPTIONS]
-s | --summary Print summary with detailed log in output.log (conflict with -p)
- -p | --per_test_log Print test log in /tmp with each test name (conflict with -s)
+ -p | --per-test-log Print test log in /tmp with each test name (conflict with -s)
-t | --test COLLECTION:TEST Run TEST from COLLECTION
-c | --collection COLLECTION Run all tests from COLLECTION
-l | --list List the available collection:test entries
diff --git a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
index 37d9bf6fb745..6f4c3f5a1c5d 100644
--- a/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
+++ b/tools/testing/selftests/sched_ext/ddsp_bogus_dsq_fail.bpf.c
@@ -20,7 +20,7 @@ s32 BPF_STRUCT_OPS(ddsp_bogus_dsq_fail_select_cpu, struct task_struct *p,
* If we dispatch to a bogus DSQ that will fall back to the
* builtin global DSQ, we fail gracefully.
*/
- scx_bpf_dispatch_vtime(p, 0xcafef00d, SCX_SLICE_DFL,
+ scx_bpf_dsq_insert_vtime(p, 0xcafef00d, SCX_SLICE_DFL,
p->scx.dsq_vtime, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
index dffc97d9cdf1..e4a55027778f 100644
--- a/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
+++ b/tools/testing/selftests/sched_ext/ddsp_vtimelocal_fail.bpf.c
@@ -17,8 +17,8 @@ s32 BPF_STRUCT_OPS(ddsp_vtimelocal_fail_select_cpu, struct task_struct *p,
if (cpu >= 0) {
/* Shouldn't be allowed to vtime dispatch to a builtin DSQ. */
- scx_bpf_dispatch_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL,
- p->scx.dsq_vtime, 0);
+ scx_bpf_dsq_insert_vtime(p, SCX_DSQ_LOCAL, SCX_SLICE_DFL,
+ p->scx.dsq_vtime, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
index 6a7db1502c29..fbda6bf54671 100644
--- a/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
+++ b/tools/testing/selftests/sched_ext/dsp_local_on.bpf.c
@@ -43,9 +43,12 @@ void BPF_STRUCT_OPS(dsp_local_on_dispatch, s32 cpu, struct task_struct *prev)
if (!p)
return;
- target = bpf_get_prandom_u32() % nr_cpus;
+ if (p->nr_cpus_allowed == nr_cpus)
+ target = bpf_get_prandom_u32() % nr_cpus;
+ else
+ target = scx_bpf_task_cpu(p);
- scx_bpf_dispatch(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_LOCAL_ON | target, SCX_SLICE_DFL, 0);
bpf_task_release(p);
}
diff --git a/tools/testing/selftests/sched_ext/dsp_local_on.c b/tools/testing/selftests/sched_ext/dsp_local_on.c
index 472851b56854..0ff27e57fe43 100644
--- a/tools/testing/selftests/sched_ext/dsp_local_on.c
+++ b/tools/testing/selftests/sched_ext/dsp_local_on.c
@@ -34,9 +34,10 @@ static enum scx_test_status run(void *ctx)
/* Just sleeping is fine, plenty of scheduling events happening */
sleep(1);
- SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_ERROR));
bpf_link__destroy(link);
+ SCX_EQ(skel->data->uei.kind, EXIT_KIND(SCX_EXIT_UNREG));
+
return SCX_TEST_PASS;
}
@@ -50,7 +51,7 @@ static void cleanup(void *ctx)
struct scx_test dsp_local_on = {
.name = "dsp_local_on",
.description = "Verify we can directly dispatch tasks to a local DSQs "
- "from osp.dispatch()",
+ "from ops.dispatch()",
.setup = setup,
.run = run,
.cleanup = cleanup,
diff --git a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
index 1efb50d61040..a7cf868d5e31 100644
--- a/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
+++ b/tools/testing/selftests/sched_ext/enq_select_cpu_fails.bpf.c
@@ -31,7 +31,7 @@ void BPF_STRUCT_OPS(enq_select_cpu_fails_enqueue, struct task_struct *p,
/* Can only call from ops.select_cpu() */
scx_bpf_select_cpu_dfl(p, 0, 0, &found);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
}
SEC(".struct_ops.link")
diff --git a/tools/testing/selftests/sched_ext/exit.bpf.c b/tools/testing/selftests/sched_ext/exit.bpf.c
index d75d4faf07f6..4bc36182d3ff 100644
--- a/tools/testing/selftests/sched_ext/exit.bpf.c
+++ b/tools/testing/selftests/sched_ext/exit.bpf.c
@@ -33,7 +33,7 @@ void BPF_STRUCT_OPS(exit_enqueue, struct task_struct *p, u64 enq_flags)
if (exit_point == EXIT_ENQUEUE)
EXIT_CLEANLY();
- scx_bpf_dispatch(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
}
void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p)
@@ -41,7 +41,7 @@ void BPF_STRUCT_OPS(exit_dispatch, s32 cpu, struct task_struct *p)
if (exit_point == EXIT_DISPATCH)
EXIT_CLEANLY();
- scx_bpf_consume(DSQ_ID);
+ scx_bpf_dsq_move_to_local(DSQ_ID);
}
void BPF_STRUCT_OPS(exit_enable, struct task_struct *p)
diff --git a/tools/testing/selftests/sched_ext/maximal.bpf.c b/tools/testing/selftests/sched_ext/maximal.bpf.c
index 4d4cd8d966db..430f5e13bf55 100644
--- a/tools/testing/selftests/sched_ext/maximal.bpf.c
+++ b/tools/testing/selftests/sched_ext/maximal.bpf.c
@@ -12,6 +12,8 @@
char _license[] SEC("license") = "GPL";
+#define DSQ_ID 0
+
s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu,
u64 wake_flags)
{
@@ -20,7 +22,7 @@ s32 BPF_STRUCT_OPS(maximal_select_cpu, struct task_struct *p, s32 prev_cpu,
void BPF_STRUCT_OPS(maximal_enqueue, struct task_struct *p, u64 enq_flags)
{
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, DSQ_ID, SCX_SLICE_DFL, enq_flags);
}
void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags)
@@ -28,7 +30,7 @@ void BPF_STRUCT_OPS(maximal_dequeue, struct task_struct *p, u64 deq_flags)
void BPF_STRUCT_OPS(maximal_dispatch, s32 cpu, struct task_struct *prev)
{
- scx_bpf_consume(SCX_DSQ_GLOBAL);
+ scx_bpf_dsq_move_to_local(DSQ_ID);
}
void BPF_STRUCT_OPS(maximal_runnable, struct task_struct *p, u64 enq_flags)
@@ -123,7 +125,7 @@ void BPF_STRUCT_OPS(maximal_cgroup_set_weight, struct cgroup *cgrp, u32 weight)
s32 BPF_STRUCT_OPS_SLEEPABLE(maximal_init)
{
- return 0;
+ return scx_bpf_create_dsq(DSQ_ID, -1);
}
void BPF_STRUCT_OPS(maximal_exit, struct scx_exit_info *info)
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
index f171ac470970..13d0f5be788d 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dfl.bpf.c
@@ -30,7 +30,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_enqueue, struct task_struct *p,
}
scx_bpf_put_idle_cpumask(idle_mask);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, enq_flags);
}
SEC(".struct_ops.link")
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
index 9efdbb7da928..815f1d5d61ac 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dfl_nodispatch.bpf.c
@@ -67,7 +67,7 @@ void BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_enqueue, struct task_struct *p,
saw_local = true;
}
- scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, enq_flags);
+ scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, enq_flags);
}
s32 BPF_STRUCT_OPS(select_cpu_dfl_nodispatch_init_task,
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
index 59bfc4f36167..4bb99699e920 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch.bpf.c
@@ -29,7 +29,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_select_cpu, struct task_struct *p,
cpu = prev_cpu;
dispatch:
- scx_bpf_dispatch(p, dsq_id, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, dsq_id, SCX_SLICE_DFL, 0);
return cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
index 3bbd5fcdfb18..2a75de11b2cf 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_bad_dsq.bpf.c
@@ -18,7 +18,7 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_bad_dsq_select_cpu, struct task_struct *p
s32 prev_cpu, u64 wake_flags)
{
/* Dispatching to a random DSQ should fail. */
- scx_bpf_dispatch(p, 0xcafef00d, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, 0xcafef00d, SCX_SLICE_DFL, 0);
return prev_cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
index 0fda57fe0ecf..99d075695c97 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_dispatch_dbl_dsp.bpf.c
@@ -18,8 +18,8 @@ s32 BPF_STRUCT_OPS(select_cpu_dispatch_dbl_dsp_select_cpu, struct task_struct *p
s32 prev_cpu, u64 wake_flags)
{
/* Dispatching twice in a row is disallowed. */
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
- scx_bpf_dispatch(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
+ scx_bpf_dsq_insert(p, SCX_DSQ_GLOBAL, SCX_SLICE_DFL, 0);
return prev_cpu;
}
diff --git a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
index e6c67bcf5e6e..bfcb96cd4954 100644
--- a/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
+++ b/tools/testing/selftests/sched_ext/select_cpu_vtime.bpf.c
@@ -2,8 +2,8 @@
/*
* A scheduler that validates that enqueue flags are properly stored and
* applied at dispatch time when a task is directly dispatched from
- * ops.select_cpu(). We validate this by using scx_bpf_dispatch_vtime(), and
- * making the test a very basic vtime scheduler.
+ * ops.select_cpu(). We validate this by using scx_bpf_dsq_insert_vtime(),
+ * and making the test a very basic vtime scheduler.
*
* Copyright (c) 2024 Meta Platforms, Inc. and affiliates.
* Copyright (c) 2024 David Vernet <dvernet@meta.com>
@@ -47,13 +47,13 @@ s32 BPF_STRUCT_OPS(select_cpu_vtime_select_cpu, struct task_struct *p,
cpu = prev_cpu;
scx_bpf_test_and_clear_cpu_idle(cpu);
ddsp:
- scx_bpf_dispatch_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0);
+ scx_bpf_dsq_insert_vtime(p, VTIME_DSQ, SCX_SLICE_DFL, task_vtime(p), 0);
return cpu;
}
void BPF_STRUCT_OPS(select_cpu_vtime_dispatch, s32 cpu, struct task_struct *p)
{
- if (scx_bpf_consume(VTIME_DSQ))
+ if (scx_bpf_dsq_move_to_local(VTIME_DSQ))
consumed = true;
}
diff --git a/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py
new file mode 100755
index 000000000000..0f44a6199495
--- /dev/null
+++ b/tools/testing/selftests/tc-testing/scripts/sfq_rejects_limit_1.py
@@ -0,0 +1,21 @@
+#!/usr/bin/env python3
+# SPDX-License-Identifier: GPL-2.0
+#
+# Script that checks that SFQ rejects a limit of 1 at the kernel
+# level. We can't use iproute2's tc because it does not accept a limit
+# of 1.
+
+import sys
+import os
+
+from pyroute2 import IPRoute
+from pyroute2.netlink.exceptions import NetlinkError
+
+ip = IPRoute()
+ifidx = ip.link_lookup(ifname=sys.argv[1])
+
+try:
+ ip.tc('add', 'sfq', ifidx, limit=1)
+ sys.exit(1)
+except NetlinkError:
+ sys.exit(0)
diff --git a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
index 996448afe31b..91d120548bf5 100644
--- a/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
+++ b/tools/testing/selftests/tc-testing/tc-tests/filters/flow.json
@@ -78,10 +78,10 @@
"setup": [
"$TC qdisc add dev $DEV1 ingress"
],
- "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0xff",
+ "cmdUnderTest": "$TC filter add dev $DEV1 parent ffff: handle 1 prio 1 protocol ip flow map key dst rshift 0x1f",
"expExitCode": "0",
"verifyCmd": "$TC filter get dev $DEV1 parent ffff: handle 1 protocol ip prio 1 flow",
- "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 255 baseclass",
+ "matchPattern": "filter parent ffff: protocol ip pref 1 flow chain [0-9]+ handle 0x1 map keys dst rshift 31 baseclass",
"matchCount": "1",
"teardown": [
"$TC qdisc del dev $DEV1 ingress"
diff --git a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
index 16d51936b385..50e8d72781cb 100644
--- a/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
+++ b/tools/testing/selftests/tc-testing/tc-tests/qdiscs/sfq.json
@@ -208,5 +208,25 @@
"teardown": [
"$TC qdisc del dev $DUMMY handle 1: root"
]
+ },
+ {
+ "id": "4d6f",
+ "name": "Check that limit of 1 is rejected",
+ "category": [
+ "qdisc",
+ "sfq"
+ ],
+ "plugins": {
+ "requires": "nsPlugin"
+ },
+ "setup": [
+ ],
+ "cmdUnderTest": "./scripts/sfq_rejects_limit_1.py $DUMMY",
+ "expExitCode": "0",
+ "verifyCmd": "$TC qdisc show dev $DUMMY",
+ "matchPattern": "sfq",
+ "matchCount": "0",
+ "teardown": [
+ ]
}
]
diff --git a/tools/testing/selftests/timers/clocksource-switch.c b/tools/testing/selftests/timers/clocksource-switch.c
index c5264594064c..83faa4e354e3 100644
--- a/tools/testing/selftests/timers/clocksource-switch.c
+++ b/tools/testing/selftests/timers/clocksource-switch.c
@@ -156,8 +156,8 @@ int main(int argc, char **argv)
/* Check everything is sane before we start switching asynchronously */
if (do_sanity_check) {
for (i = 0; i < count; i++) {
- printf("Validating clocksource %s\n",
- clocksource_list[i]);
+ ksft_print_msg("Validating clocksource %s\n",
+ clocksource_list[i]);
if (change_clocksource(clocksource_list[i])) {
status = -1;
goto out;
@@ -169,7 +169,7 @@ int main(int argc, char **argv)
}
}
- printf("Running Asynchronous Switching Tests...\n");
+ ksft_print_msg("Running Asynchronous Switching Tests...\n");
pid = fork();
if (!pid)
return run_tests(runtime);
diff --git a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
index b5c3ddb90942..02ecfe687dc2 100644
--- a/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
+++ b/tools/testing/selftests/tmpfs/bug-link-o-tmpfile.c
@@ -23,45 +23,56 @@
#include <sys/mount.h>
#include <unistd.h>
+#include "../kselftest.h"
+
int main(void)
{
int fd;
+ // Setting up kselftest framework
+ ksft_print_header();
+ ksft_set_plan(1);
+
+ // Check if test is run as root
+ if (geteuid()) {
+ ksft_exit_skip("This test needs root to run!\n");
+ return 1;
+ }
+
if (unshare(CLONE_NEWNS) == -1) {
if (errno == ENOSYS || errno == EPERM) {
- fprintf(stderr, "error: unshare, errno %d\n", errno);
- return 4;
+ ksft_exit_skip("unshare() error: unshare, errno %d\n", errno);
+ } else {
+ ksft_exit_fail_msg("unshare() error: unshare, errno %d\n", errno);
}
- fprintf(stderr, "error: unshare, errno %d\n", errno);
- return 1;
}
+
if (mount(NULL, "/", NULL, MS_PRIVATE|MS_REC, NULL) == -1) {
- fprintf(stderr, "error: mount '/', errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("mount() error: Root filesystem private mount: Fail %d\n", errno);
}
/* Our heroes: 1 root inode, 1 O_TMPFILE inode, 1 permanent inode. */
if (mount(NULL, "/tmp", "tmpfs", 0, "nr_inodes=3") == -1) {
- fprintf(stderr, "error: mount tmpfs, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("mount() error: Mounting tmpfs on /tmp: Fail %d\n", errno);
}
fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600);
if (fd == -1) {
- fprintf(stderr, "error: open 1, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("openat() error: Open first temporary file: Fail %d\n", errno);
}
+
if (linkat(fd, "", AT_FDCWD, "/tmp/1", AT_EMPTY_PATH) == -1) {
- fprintf(stderr, "error: linkat, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("linkat() error: Linking the temporary file: Fail %d\n", errno);
+ /* Ensure fd is closed on failure */
+ close(fd);
}
close(fd);
fd = openat(AT_FDCWD, "/tmp", O_WRONLY|O_TMPFILE, 0600);
if (fd == -1) {
- fprintf(stderr, "error: open 2, errno %d\n", errno);
- return 1;
+ ksft_exit_fail_msg("openat() error: Opening the second temporary file: Fail %d\n", errno);
}
-
+ ksft_test_result_pass(" ");
+ ksft_exit_pass();
return 0;
}
diff --git a/tools/testing/selftests/vDSO/parse_vdso.c b/tools/testing/selftests/vDSO/parse_vdso.c
index 28f35620c499..2fe5e983cb22 100644
--- a/tools/testing/selftests/vDSO/parse_vdso.c
+++ b/tools/testing/selftests/vDSO/parse_vdso.c
@@ -53,6 +53,7 @@ static struct vdso_info
/* Symbol table */
ELF(Sym) *symtab;
const char *symstrings;
+ ELF(Word) *gnu_hash;
ELF_HASH_ENTRY *bucket, *chain;
ELF_HASH_ENTRY nbucket, nchain;
@@ -81,6 +82,16 @@ static unsigned long elf_hash(const char *name)
return h;
}
+static uint32_t gnu_hash(const char *name)
+{
+ const unsigned char *s = (void *)name;
+ uint32_t h = 5381;
+
+ for (; *s; s++)
+ h += h * 32 + *s;
+ return h;
+}
+
void vdso_init_from_sysinfo_ehdr(uintptr_t base)
{
size_t i;
@@ -123,6 +134,7 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
*/
ELF_HASH_ENTRY *hash = 0;
vdso_info.symstrings = 0;
+ vdso_info.gnu_hash = 0;
vdso_info.symtab = 0;
vdso_info.versym = 0;
vdso_info.verdef = 0;
@@ -143,6 +155,11 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
((uintptr_t)dyn[i].d_un.d_ptr
+ vdso_info.load_offset);
break;
+ case DT_GNU_HASH:
+ vdso_info.gnu_hash =
+ (ELF(Word) *)((uintptr_t)dyn[i].d_un.d_ptr +
+ vdso_info.load_offset);
+ break;
case DT_VERSYM:
vdso_info.versym = (ELF(Versym) *)
((uintptr_t)dyn[i].d_un.d_ptr
@@ -155,17 +172,27 @@ void vdso_init_from_sysinfo_ehdr(uintptr_t base)
break;
}
}
- if (!vdso_info.symstrings || !vdso_info.symtab || !hash)
+ if (!vdso_info.symstrings || !vdso_info.symtab ||
+ (!hash && !vdso_info.gnu_hash))
return; /* Failed */
if (!vdso_info.verdef)
vdso_info.versym = 0;
/* Parse the hash table header. */
- vdso_info.nbucket = hash[0];
- vdso_info.nchain = hash[1];
- vdso_info.bucket = &hash[2];
- vdso_info.chain = &hash[vdso_info.nbucket + 2];
+ if (vdso_info.gnu_hash) {
+ vdso_info.nbucket = vdso_info.gnu_hash[0];
+ /* The bucket array is located after the header (4 uint32) and the bloom
+ * filter (size_t array of gnu_hash[2] elements).
+ */
+ vdso_info.bucket = vdso_info.gnu_hash + 4 +
+ sizeof(size_t) / 4 * vdso_info.gnu_hash[2];
+ } else {
+ vdso_info.nbucket = hash[0];
+ vdso_info.nchain = hash[1];
+ vdso_info.bucket = &hash[2];
+ vdso_info.chain = &hash[vdso_info.nbucket + 2];
+ }
/* That's all we need. */
vdso_info.valid = true;
@@ -209,6 +236,26 @@ static bool vdso_match_version(ELF(Versym) ver,
&& !strcmp(name, vdso_info.symstrings + aux->vda_name);
}
+static bool check_sym(ELF(Sym) *sym, ELF(Word) i, const char *name,
+ const char *version, unsigned long ver_hash)
+{
+ /* Check for a defined global or weak function w/ right name. */
+ if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC)
+ return false;
+ if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL &&
+ ELF64_ST_BIND(sym->st_info) != STB_WEAK)
+ return false;
+ if (strcmp(name, vdso_info.symstrings + sym->st_name))
+ return false;
+
+ /* Check symbol version. */
+ if (vdso_info.versym &&
+ !vdso_match_version(vdso_info.versym[i], version, ver_hash))
+ return false;
+
+ return true;
+}
+
void *vdso_sym(const char *version, const char *name)
{
unsigned long ver_hash;
@@ -216,29 +263,36 @@ void *vdso_sym(const char *version, const char *name)
return 0;
ver_hash = elf_hash(version);
- ELF(Word) chain = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket];
-
- for (; chain != STN_UNDEF; chain = vdso_info.chain[chain]) {
- ELF(Sym) *sym = &vdso_info.symtab[chain];
-
- /* Check for a defined global or weak function w/ right name. */
- if (ELF64_ST_TYPE(sym->st_info) != STT_FUNC)
- continue;
- if (ELF64_ST_BIND(sym->st_info) != STB_GLOBAL &&
- ELF64_ST_BIND(sym->st_info) != STB_WEAK)
- continue;
- if (sym->st_shndx == SHN_UNDEF)
- continue;
- if (strcmp(name, vdso_info.symstrings + sym->st_name))
- continue;
-
- /* Check symbol version. */
- if (vdso_info.versym
- && !vdso_match_version(vdso_info.versym[chain],
- version, ver_hash))
- continue;
-
- return (void *)(vdso_info.load_offset + sym->st_value);
+ ELF(Word) i;
+
+ if (vdso_info.gnu_hash) {
+ uint32_t h1 = gnu_hash(name), h2, *hashval;
+
+ i = vdso_info.bucket[h1 % vdso_info.nbucket];
+ if (i == 0)
+ return 0;
+ h1 |= 1;
+ hashval = vdso_info.bucket + vdso_info.nbucket +
+ (i - vdso_info.gnu_hash[1]);
+ for (;; i++) {
+ ELF(Sym) *sym = &vdso_info.symtab[i];
+ h2 = *hashval++;
+ if (h1 == (h2 | 1) &&
+ check_sym(sym, i, name, version, ver_hash))
+ return (void *)(vdso_info.load_offset +
+ sym->st_value);
+ if (h2 & 1)
+ break;
+ }
+ } else {
+ i = vdso_info.bucket[elf_hash(name) % vdso_info.nbucket];
+ for (; i; i = vdso_info.chain[i]) {
+ ELF(Sym) *sym = &vdso_info.symtab[i];
+ if (sym->st_shndx != SHN_UNDEF &&
+ check_sym(sym, i, name, version, ver_hash))
+ return (void *)(vdso_info.load_offset +
+ sym->st_value);
+ }
}
return 0;
diff --git a/tools/testing/selftests/zram/.gitignore b/tools/testing/selftests/zram/.gitignore
new file mode 100644
index 000000000000..088cd9bad87a
--- /dev/null
+++ b/tools/testing/selftests/zram/.gitignore
@@ -0,0 +1,2 @@
+# SPDX-License-Identifier: GPL-2.0-only
+err.log
diff --git a/tools/testing/shared/linux/maple_tree.h b/tools/testing/shared/linux/maple_tree.h
index 06c89bdcc515..f67d47d32857 100644
--- a/tools/testing/shared/linux/maple_tree.h
+++ b/tools/testing/shared/linux/maple_tree.h
@@ -2,6 +2,6 @@
#define atomic_t int32_t
#define atomic_inc(x) uatomic_inc(x)
#define atomic_read(x) uatomic_read(x)
-#define atomic_set(x, y) do {} while (0)
+#define atomic_set(x, y) uatomic_set(x, y)
#define U8_MAX UCHAR_MAX
#include "../../../../include/linux/maple_tree.h"
diff --git a/tools/testing/vma/linux/atomic.h b/tools/testing/vma/linux/atomic.h
index e01f66f98982..3e1b6adc027b 100644
--- a/tools/testing/vma/linux/atomic.h
+++ b/tools/testing/vma/linux/atomic.h
@@ -6,7 +6,7 @@
#define atomic_t int32_t
#define atomic_inc(x) uatomic_inc(x)
#define atomic_read(x) uatomic_read(x)
-#define atomic_set(x, y) do {} while (0)
+#define atomic_set(x, y) uatomic_set(x, y)
#define U8_MAX UCHAR_MAX
#endif /* _LINUX_ATOMIC_H */
diff --git a/tools/testing/vma/vma.c b/tools/testing/vma/vma.c
index 8fab5e13c7c3..9bcf1736bf18 100644
--- a/tools/testing/vma/vma.c
+++ b/tools/testing/vma/vma.c
@@ -89,7 +89,7 @@ static struct vm_area_struct *alloc_and_link_vma(struct mm_struct *mm,
* begun. Linking to the tree will have caused this to be incremented,
* which means we will get a false positive otherwise.
*/
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
return vma;
}
@@ -214,7 +214,7 @@ static bool vma_write_started(struct vm_area_struct *vma)
int seq = vma->vm_lock_seq;
/* We reset after each check. */
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
/* The vma_start_write() stub simply increments this value. */
return seq > -1;
diff --git a/tools/testing/vma/vma_internal.h b/tools/testing/vma/vma_internal.h
index e76ff579e1fd..1d9fc97b8e80 100644
--- a/tools/testing/vma/vma_internal.h
+++ b/tools/testing/vma/vma_internal.h
@@ -241,7 +241,7 @@ struct vm_area_struct {
* counter reuse can only lead to occasional unnecessary use of the
* slowpath.
*/
- int vm_lock_seq;
+ unsigned int vm_lock_seq;
struct vma_lock *vm_lock;
#endif
@@ -416,7 +416,7 @@ static inline bool vma_lock_alloc(struct vm_area_struct *vma)
return false;
init_rwsem(&vma->vm_lock->lock);
- vma->vm_lock_seq = -1;
+ vma->vm_lock_seq = UINT_MAX;
return true;
}
diff --git a/tools/testing/vsock/README b/tools/testing/vsock/README
index 84ee217ba8ee..680ce666ceb5 100644
--- a/tools/testing/vsock/README
+++ b/tools/testing/vsock/README
@@ -36,6 +36,21 @@ Invoke test binaries in both directions as follows:
--control-port=1234 \
--peer-cid=3
+Some tests are designed to produce kernel memory leaks. Leaks detection,
+however, is deferred to Kernel Memory Leak Detector. It is recommended to enable
+kmemleak (CONFIG_DEBUG_KMEMLEAK=y) and explicitly trigger a scan after each test
+suite run, e.g.
+
+ # echo clear > /sys/kernel/debug/kmemleak
+ # $TEST_BINARY ...
+ # echo "wait for any grace periods" && sleep 2
+ # echo scan > /sys/kernel/debug/kmemleak
+ # echo "wait for kmemleak" && sleep 5
+ # echo scan > /sys/kernel/debug/kmemleak
+ # cat /sys/kernel/debug/kmemleak
+
+For more information see Documentation/dev-tools/kmemleak.rst.
+
vsock_perf utility
-------------------
'vsock_perf' is a simple tool to measure vsock performance. It works in
diff --git a/tools/testing/vsock/control.c b/tools/testing/vsock/control.c
index d2deb4b15b94..0066e0324d35 100644
--- a/tools/testing/vsock/control.c
+++ b/tools/testing/vsock/control.c
@@ -27,6 +27,7 @@
#include "timeout.h"
#include "control.h"
+#include "util.h"
static int control_fd = -1;
@@ -50,7 +51,6 @@ void control_init(const char *control_host,
for (ai = result; ai; ai = ai->ai_next) {
int fd;
- int val = 1;
fd = socket(ai->ai_family, ai->ai_socktype, ai->ai_protocol);
if (fd < 0)
@@ -65,11 +65,8 @@ void control_init(const char *control_host,
break;
}
- if (setsockopt(fd, SOL_SOCKET, SO_REUSEADDR,
- &val, sizeof(val)) < 0) {
- perror("setsockopt");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_REUSEADDR, 1,
+ "setsockopt SO_REUSEADDR");
if (bind(fd, ai->ai_addr, ai->ai_addrlen) < 0)
goto next;
diff --git a/tools/testing/vsock/msg_zerocopy_common.c b/tools/testing/vsock/msg_zerocopy_common.c
index 5a4bdf7b5132..8622e5a0f8b7 100644
--- a/tools/testing/vsock/msg_zerocopy_common.c
+++ b/tools/testing/vsock/msg_zerocopy_common.c
@@ -14,16 +14,6 @@
#include "msg_zerocopy_common.h"
-void enable_so_zerocopy(int fd)
-{
- int val = 1;
-
- if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) {
- perror("setsockopt");
- exit(EXIT_FAILURE);
- }
-}
-
void vsock_recv_completion(int fd, const bool *zerocopied)
{
struct sock_extended_err *serr;
diff --git a/tools/testing/vsock/msg_zerocopy_common.h b/tools/testing/vsock/msg_zerocopy_common.h
index 3763c5ccedb9..ad14139e93ca 100644
--- a/tools/testing/vsock/msg_zerocopy_common.h
+++ b/tools/testing/vsock/msg_zerocopy_common.h
@@ -12,7 +12,6 @@
#define VSOCK_RECVERR 1
#endif
-void enable_so_zerocopy(int fd);
void vsock_recv_completion(int fd, const bool *zerocopied);
#endif /* MSG_ZEROCOPY_COMMON_H */
diff --git a/tools/testing/vsock/util.c b/tools/testing/vsock/util.c
index a3d448a075e3..7058dc614c25 100644
--- a/tools/testing/vsock/util.c
+++ b/tools/testing/vsock/util.c
@@ -401,7 +401,7 @@ void recv_buf(int fd, void *buf, size_t len, int flags, ssize_t expected_ret)
*/
void send_byte(int fd, int expected_ret, int flags)
{
- const uint8_t byte = 'A';
+ static const uint8_t byte = 'A';
send_buf(fd, &byte, sizeof(byte), flags, expected_ret);
}
@@ -420,7 +420,7 @@ void recv_byte(int fd, int expected_ret, int flags)
recv_buf(fd, &byte, sizeof(byte), flags, expected_ret);
if (byte != 'A') {
- fprintf(stderr, "unexpected byte read %c\n", byte);
+ fprintf(stderr, "unexpected byte read 0x%02x\n", byte);
exit(EXIT_FAILURE);
}
}
@@ -486,8 +486,7 @@ void list_tests(const struct test_case *test_cases)
exit(EXIT_FAILURE);
}
-void skip_test(struct test_case *test_cases, size_t test_cases_len,
- const char *test_id_str)
+static unsigned long parse_test_id(const char *test_id_str, size_t test_cases_len)
{
unsigned long test_id;
char *endptr = NULL;
@@ -505,9 +504,35 @@ void skip_test(struct test_case *test_cases, size_t test_cases_len,
exit(EXIT_FAILURE);
}
+ return test_id;
+}
+
+void skip_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str)
+{
+ unsigned long test_id = parse_test_id(test_id_str, test_cases_len);
test_cases[test_id].skip = true;
}
+void pick_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str)
+{
+ static bool skip_all = true;
+ unsigned long test_id;
+
+ if (skip_all) {
+ unsigned long i;
+
+ for (i = 0; i < test_cases_len; ++i)
+ test_cases[i].skip = true;
+
+ skip_all = false;
+ }
+
+ test_id = parse_test_id(test_id_str, test_cases_len);
+ test_cases[test_id].skip = false;
+}
+
unsigned long hash_djb2(const void *data, size_t len)
{
unsigned long hash = 5381;
@@ -651,3 +676,145 @@ void free_test_iovec(const struct iovec *test_iovec,
free(iovec);
}
+
+/* Set "unsigned long long" socket option and check that it's indeed set */
+void setsockopt_ull_check(int fd, int level, int optname,
+ unsigned long long val, char const *errmsg)
+{
+ unsigned long long chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ chkval = ~val; /* just make storage != val */
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (chkval != val) {
+ fprintf(stderr, "value mismatch: set %llu got %llu\n", val,
+ chkval);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %llu\n", errmsg, val);
+ exit(EXIT_FAILURE);
+;
+}
+
+/* Set "int" socket option and check that it's indeed set */
+void setsockopt_int_check(int fd, int level, int optname, int val,
+ char const *errmsg)
+{
+ int chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ chkval = ~val; /* just make storage != val */
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (chkval != val) {
+ fprintf(stderr, "value mismatch: set %d got %d\n", val, chkval);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %d\n", errmsg, val);
+ exit(EXIT_FAILURE);
+}
+
+static void mem_invert(unsigned char *mem, size_t size)
+{
+ size_t i;
+
+ for (i = 0; i < size; i++)
+ mem[i] = ~mem[i];
+}
+
+/* Set "timeval" socket option and check that it's indeed set */
+void setsockopt_timeval_check(int fd, int level, int optname,
+ struct timeval val, char const *errmsg)
+{
+ struct timeval chkval;
+ socklen_t chklen;
+ int err;
+
+ err = setsockopt(fd, level, optname, &val, sizeof(val));
+ if (err) {
+ fprintf(stderr, "setsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ /* just make storage != val */
+ chkval = val;
+ mem_invert((unsigned char *)&chkval, sizeof(chkval));
+ chklen = sizeof(chkval);
+
+ err = getsockopt(fd, level, optname, &chkval, &chklen);
+ if (err) {
+ fprintf(stderr, "getsockopt err: %s (%d)\n",
+ strerror(errno), errno);
+ goto fail;
+ }
+
+ if (chklen != sizeof(chkval)) {
+ fprintf(stderr, "size mismatch: set %zu got %d\n", sizeof(val),
+ chklen);
+ goto fail;
+ }
+
+ if (memcmp(&chkval, &val, sizeof(val)) != 0) {
+ fprintf(stderr, "value mismatch: set %ld:%ld got %ld:%ld\n",
+ val.tv_sec, val.tv_usec, chkval.tv_sec, chkval.tv_usec);
+ goto fail;
+ }
+ return;
+fail:
+ fprintf(stderr, "%s val %ld:%ld\n", errmsg, val.tv_sec, val.tv_usec);
+ exit(EXIT_FAILURE);
+}
+
+void enable_so_zerocopy_check(int fd)
+{
+ setsockopt_int_check(fd, SOL_SOCKET, SO_ZEROCOPY, 1,
+ "setsockopt SO_ZEROCOPY");
+}
diff --git a/tools/testing/vsock/util.h b/tools/testing/vsock/util.h
index fff22d4a14c0..e62f46b2b92a 100644
--- a/tools/testing/vsock/util.h
+++ b/tools/testing/vsock/util.h
@@ -62,10 +62,19 @@ void run_tests(const struct test_case *test_cases,
void list_tests(const struct test_case *test_cases);
void skip_test(struct test_case *test_cases, size_t test_cases_len,
const char *test_id_str);
+void pick_test(struct test_case *test_cases, size_t test_cases_len,
+ const char *test_id_str);
unsigned long hash_djb2(const void *data, size_t len);
size_t iovec_bytes(const struct iovec *iov, size_t iovnum);
unsigned long iovec_hash_djb2(const struct iovec *iov, size_t iovnum);
struct iovec *alloc_test_iovec(const struct iovec *test_iovec, int iovnum);
void free_test_iovec(const struct iovec *test_iovec,
struct iovec *iovec, int iovnum);
+void setsockopt_ull_check(int fd, int level, int optname,
+ unsigned long long val, char const *errmsg);
+void setsockopt_int_check(int fd, int level, int optname, int val,
+ char const *errmsg);
+void setsockopt_timeval_check(int fd, int level, int optname,
+ struct timeval val, char const *errmsg);
+void enable_so_zerocopy_check(int fd);
#endif /* UTIL_H */
diff --git a/tools/testing/vsock/vsock_perf.c b/tools/testing/vsock/vsock_perf.c
index 4e8578f815e0..75971ac708c9 100644
--- a/tools/testing/vsock/vsock_perf.c
+++ b/tools/testing/vsock/vsock_perf.c
@@ -33,7 +33,7 @@
static unsigned int port = DEFAULT_PORT;
static unsigned long buf_size_bytes = DEFAULT_BUF_SIZE_BYTES;
-static unsigned long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES;
+static unsigned long long vsock_buf_bytes = DEFAULT_VSOCK_BUF_BYTES;
static bool zerocopy;
static void error(const char *s)
@@ -133,7 +133,7 @@ static float get_gbps(unsigned long bits, time_t ns_delta)
((float)ns_delta / NSEC_PER_SEC);
}
-static void run_receiver(unsigned long rcvlowat_bytes)
+static void run_receiver(int rcvlowat_bytes)
{
unsigned int read_cnt;
time_t rx_begin_ns;
@@ -162,8 +162,8 @@ static void run_receiver(unsigned long rcvlowat_bytes)
printf("Run as receiver\n");
printf("Listen port %u\n", port);
printf("RX buffer %lu bytes\n", buf_size_bytes);
- printf("vsock buffer %lu bytes\n", vsock_buf_bytes);
- printf("SO_RCVLOWAT %lu bytes\n", rcvlowat_bytes);
+ printf("vsock buffer %llu bytes\n", vsock_buf_bytes);
+ printf("SO_RCVLOWAT %d bytes\n", rcvlowat_bytes);
fd = socket(AF_VSOCK, SOCK_STREAM, 0);
@@ -251,6 +251,16 @@ static void run_receiver(unsigned long rcvlowat_bytes)
close(fd);
}
+static void enable_so_zerocopy(int fd)
+{
+ int val = 1;
+
+ if (setsockopt(fd, SOL_SOCKET, SO_ZEROCOPY, &val, sizeof(val))) {
+ perror("setsockopt");
+ exit(EXIT_FAILURE);
+ }
+}
+
static void run_sender(int peer_cid, unsigned long to_send_bytes)
{
time_t tx_begin_ns;
@@ -439,7 +449,7 @@ static long strtolx(const char *arg)
int main(int argc, char **argv)
{
unsigned long to_send_bytes = DEFAULT_TO_SEND_BYTES;
- unsigned long rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES;
+ int rcvlowat_bytes = DEFAULT_RCVLOWAT_BYTES;
int peer_cid = -1;
bool sender = false;
diff --git a/tools/testing/vsock/vsock_test.c b/tools/testing/vsock/vsock_test.c
index 8d38dbf8f41f..1eebbc0d5f61 100644
--- a/tools/testing/vsock/vsock_test.c
+++ b/tools/testing/vsock/vsock_test.c
@@ -22,12 +22,17 @@
#include <signal.h>
#include <sys/ioctl.h>
#include <linux/sockios.h>
+#include <linux/time64.h>
#include "vsock_test_zerocopy.h"
#include "timeout.h"
#include "control.h"
#include "util.h"
+/* Basic messages for control_writeulong(), control_readulong() */
+#define CONTROL_CONTINUE 1
+#define CONTROL_DONE 0
+
static void test_stream_connection_reset(const struct test_opts *opts)
{
union {
@@ -429,7 +434,7 @@ static void test_seqpacket_msg_bounds_client(const struct test_opts *opts)
static void test_seqpacket_msg_bounds_server(const struct test_opts *opts)
{
- unsigned long sock_buf_size;
+ unsigned long long sock_buf_size;
unsigned long remote_hash;
unsigned long curr_hash;
int fd;
@@ -444,17 +449,13 @@ static void test_seqpacket_msg_bounds_server(const struct test_opts *opts)
sock_buf_size = SOCK_BUF_SIZE;
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE,
- &sock_buf_size, sizeof(sock_buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_MAX_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_MAX_SIZE)");
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
- &sock_buf_size, sizeof(sock_buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
/* Ready to receive data. */
control_writeln("SRVREADY");
@@ -563,7 +564,7 @@ static time_t current_nsec(void)
exit(EXIT_FAILURE);
}
- return (ts.tv_sec * 1000000000ULL) + ts.tv_nsec;
+ return (ts.tv_sec * NSEC_PER_SEC) + ts.tv_nsec;
}
#define RCVTIMEO_TIMEOUT_SEC 1
@@ -586,10 +587,8 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts)
tv.tv_sec = RCVTIMEO_TIMEOUT_SEC;
tv.tv_usec = 0;
- if (setsockopt(fd, SOL_SOCKET, SO_RCVTIMEO, (void *)&tv, sizeof(tv)) == -1) {
- perror("setsockopt(SO_RCVTIMEO)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_timeval_check(fd, SOL_SOCKET, SO_RCVTIMEO, tv,
+ "setsockopt(SO_RCVTIMEO)");
read_enter_ns = current_nsec();
@@ -605,7 +604,7 @@ static void test_seqpacket_timeout_client(const struct test_opts *opts)
}
read_overhead_ns = current_nsec() - read_enter_ns -
- 1000000000ULL * RCVTIMEO_TIMEOUT_SEC;
+ NSEC_PER_SEC * RCVTIMEO_TIMEOUT_SEC;
if (read_overhead_ns > READ_OVERHEAD_NSEC) {
fprintf(stderr,
@@ -634,7 +633,8 @@ static void test_seqpacket_timeout_server(const struct test_opts *opts)
static void test_seqpacket_bigmsg_client(const struct test_opts *opts)
{
- unsigned long sock_buf_size;
+ unsigned long long sock_buf_size;
+ size_t buf_size;
socklen_t len;
void *data;
int fd;
@@ -655,13 +655,20 @@ static void test_seqpacket_bigmsg_client(const struct test_opts *opts)
sock_buf_size++;
- data = malloc(sock_buf_size);
+ /* size_t can be < unsigned long long */
+ buf_size = (size_t)sock_buf_size;
+ if (buf_size != sock_buf_size) {
+ fprintf(stderr, "Returned BUFFER_SIZE too large\n");
+ exit(EXIT_FAILURE);
+ }
+
+ data = malloc(buf_size);
if (!data) {
perror("malloc");
exit(EXIT_FAILURE);
}
- send_buf(fd, data, sock_buf_size, 0, -EMSGSIZE);
+ send_buf(fd, data, buf_size, 0, -EMSGSIZE);
control_writeln("CLISENT");
@@ -835,7 +842,7 @@ static void test_stream_poll_rcvlowat_server(const struct test_opts *opts)
static void test_stream_poll_rcvlowat_client(const struct test_opts *opts)
{
- unsigned long lowat_val = RCVLOWAT_BUF_SIZE;
+ int lowat_val = RCVLOWAT_BUF_SIZE;
char buf[RCVLOWAT_BUF_SIZE];
struct pollfd fds;
short poll_flags;
@@ -847,11 +854,8 @@ static void test_stream_poll_rcvlowat_client(const struct test_opts *opts)
exit(EXIT_FAILURE);
}
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &lowat_val, sizeof(lowat_val))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ lowat_val, "setsockopt(SO_RCVLOWAT)");
control_expectln("SRVSENT");
@@ -1357,9 +1361,10 @@ static void test_stream_rcvlowat_def_cred_upd_client(const struct test_opts *opt
static void test_stream_credit_update_test(const struct test_opts *opts,
bool low_rx_bytes_test)
{
- size_t recv_buf_size;
+ int recv_buf_size;
struct pollfd fds;
size_t buf_size;
+ unsigned long long sock_buf_size;
void *buf;
int fd;
@@ -1371,11 +1376,12 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
buf_size = RCVLOWAT_CREDIT_UPD_BUF_SIZE;
- if (setsockopt(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
- &buf_size, sizeof(buf_size))) {
- perror("setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
- exit(EXIT_FAILURE);
- }
+ /* size_t can be < unsigned long long */
+ sock_buf_size = buf_size;
+
+ setsockopt_ull_check(fd, AF_VSOCK, SO_VM_SOCKETS_BUFFER_SIZE,
+ sock_buf_size,
+ "setsockopt(SO_VM_SOCKETS_BUFFER_SIZE)");
if (low_rx_bytes_test) {
/* Set new SO_RCVLOWAT here. This enables sending credit
@@ -1384,11 +1390,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
*/
recv_buf_size = 1 + VIRTIO_VSOCK_MAX_PKT_BUF_SIZE;
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &recv_buf_size, sizeof(recv_buf_size))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ recv_buf_size, "setsockopt(SO_RCVLOWAT)");
}
/* Send one dummy byte here, because 'setsockopt()' above also
@@ -1430,11 +1433,8 @@ static void test_stream_credit_update_test(const struct test_opts *opts,
recv_buf_size++;
/* Updating SO_RCVLOWAT will send credit update. */
- if (setsockopt(fd, SOL_SOCKET, SO_RCVLOWAT,
- &recv_buf_size, sizeof(recv_buf_size))) {
- perror("setsockopt(SO_RCVLOWAT)");
- exit(EXIT_FAILURE);
- }
+ setsockopt_int_check(fd, SOL_SOCKET, SO_RCVLOWAT,
+ recv_buf_size, "setsockopt(SO_RCVLOWAT)");
}
fds.fd = fd;
@@ -1478,6 +1478,236 @@ static void test_stream_cred_upd_on_set_rcvlowat(const struct test_opts *opts)
test_stream_credit_update_test(opts, false);
}
+/* The goal of test leak_acceptq is to stress the race between connect() and
+ * close(listener). Implementation of client/server loops boils down to:
+ *
+ * client server
+ * ------ ------
+ * write(CONTINUE)
+ * expect(CONTINUE)
+ * listen()
+ * write(LISTENING)
+ * expect(LISTENING)
+ * connect() close()
+ */
+#define ACCEPTQ_LEAK_RACE_TIMEOUT 2 /* seconds */
+
+static void test_stream_leak_acceptq_client(const struct test_opts *opts)
+{
+ time_t tout;
+ int fd;
+
+ tout = current_nsec() + ACCEPTQ_LEAK_RACE_TIMEOUT * NSEC_PER_SEC;
+ do {
+ control_writeulong(CONTROL_CONTINUE);
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd >= 0)
+ close(fd);
+ } while (current_nsec() < tout);
+
+ control_writeulong(CONTROL_DONE);
+}
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_leak_acceptq_server(const struct test_opts *opts)
+{
+ int fd;
+
+ while (control_readulong() == CONTROL_CONTINUE) {
+ fd = vsock_stream_listen(VMADDR_CID_ANY, opts->peer_port);
+ control_writeln("LISTENING");
+ close(fd);
+ }
+}
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_msgzcopy_leak_errq_client(const struct test_opts *opts)
+{
+ struct pollfd fds = { 0 };
+ int fd;
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd < 0) {
+ perror("connect");
+ exit(EXIT_FAILURE);
+ }
+
+ enable_so_zerocopy_check(fd);
+ send_byte(fd, 1, MSG_ZEROCOPY);
+
+ fds.fd = fd;
+ fds.events = 0;
+ if (poll(&fds, 1, -1) < 0) {
+ perror("poll");
+ exit(EXIT_FAILURE);
+ }
+
+ close(fd);
+}
+
+static void test_stream_msgzcopy_leak_errq_server(const struct test_opts *opts)
+{
+ int fd;
+
+ fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ if (fd < 0) {
+ perror("accept");
+ exit(EXIT_FAILURE);
+ }
+
+ recv_byte(fd, 1, 0);
+ vsock_wait_remote_close(fd);
+ close(fd);
+}
+
+/* Test msgzcopy_leak_zcskb is meant to exercise sendmsg() error handling path,
+ * that might leak an skb. The idea is to fail virtio_transport_init_zcopy_skb()
+ * by hitting net.core.optmem_max limit in sock_omalloc(), specifically
+ *
+ * vsock_connectible_sendmsg
+ * virtio_transport_stream_enqueue
+ * virtio_transport_send_pkt_info
+ * virtio_transport_init_zcopy_skb
+ * . msg_zerocopy_realloc
+ * . msg_zerocopy_alloc
+ * . sock_omalloc
+ * . sk_omem_alloc + size > sysctl_optmem_max
+ * return -ENOMEM
+ *
+ * We abuse the implementation detail of net/socket.c:____sys_sendmsg().
+ * sk_omem_alloc can be precisely bumped by sock_kmalloc(), as it is used to
+ * fetch user-provided control data.
+ *
+ * While this approach works for now, it relies on assumptions regarding the
+ * implementation and configuration (for example, order of net.core.optmem_max
+ * can not exceed MAX_PAGE_ORDER), which may not hold in the future. A more
+ * resilient testing could be implemented by leveraging the Fault injection
+ * framework (CONFIG_FAULT_INJECTION), e.g.
+ *
+ * client# echo N > /sys/kernel/debug/failslab/ignore-gfp-wait
+ * client# echo 0 > /sys/kernel/debug/failslab/verbose
+ *
+ * void client(const struct test_opts *opts)
+ * {
+ * char buf[16];
+ * int f, s, i;
+ *
+ * f = open("/proc/self/fail-nth", O_WRONLY);
+ *
+ * for (i = 1; i < 32; i++) {
+ * control_writeulong(CONTROL_CONTINUE);
+ *
+ * s = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ * enable_so_zerocopy_check(s);
+ *
+ * sprintf(buf, "%d", i);
+ * write(f, buf, strlen(buf));
+ *
+ * send(s, &(char){ 0 }, 1, MSG_ZEROCOPY);
+ *
+ * write(f, "0", 1);
+ * close(s);
+ * }
+ *
+ * control_writeulong(CONTROL_DONE);
+ * close(f);
+ * }
+ *
+ * void server(const struct test_opts *opts)
+ * {
+ * int fd;
+ *
+ * while (control_readulong() == CONTROL_CONTINUE) {
+ * fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ * vsock_wait_remote_close(fd);
+ * close(fd);
+ * }
+ * }
+ *
+ * Refer to Documentation/fault-injection/fault-injection.rst.
+ */
+#define MAX_PAGE_ORDER 10 /* usually */
+#define PAGE_SIZE 4096
+
+/* Test for a memory leak. User is expected to run kmemleak scan, see README. */
+static void test_stream_msgzcopy_leak_zcskb_client(const struct test_opts *opts)
+{
+ size_t optmem_max, ctl_len, chunk_size;
+ struct msghdr msg = { 0 };
+ struct iovec iov;
+ char *chunk;
+ int fd, res;
+ FILE *f;
+
+ f = fopen("/proc/sys/net/core/optmem_max", "r");
+ if (!f) {
+ perror("fopen(optmem_max)");
+ exit(EXIT_FAILURE);
+ }
+
+ if (fscanf(f, "%zu", &optmem_max) != 1) {
+ fprintf(stderr, "fscanf(optmem_max) failed\n");
+ exit(EXIT_FAILURE);
+ }
+
+ fclose(f);
+
+ fd = vsock_stream_connect(opts->peer_cid, opts->peer_port);
+ if (fd < 0) {
+ perror("connect");
+ exit(EXIT_FAILURE);
+ }
+
+ enable_so_zerocopy_check(fd);
+
+ ctl_len = optmem_max - 1;
+ if (ctl_len > PAGE_SIZE << MAX_PAGE_ORDER) {
+ fprintf(stderr, "Try with net.core.optmem_max = 100000\n");
+ exit(EXIT_FAILURE);
+ }
+
+ chunk_size = CMSG_SPACE(ctl_len);
+ chunk = malloc(chunk_size);
+ if (!chunk) {
+ perror("malloc");
+ exit(EXIT_FAILURE);
+ }
+ memset(chunk, 0, chunk_size);
+
+ iov.iov_base = &(char){ 0 };
+ iov.iov_len = 1;
+
+ msg.msg_iov = &iov;
+ msg.msg_iovlen = 1;
+ msg.msg_control = chunk;
+ msg.msg_controllen = ctl_len;
+
+ errno = 0;
+ res = sendmsg(fd, &msg, MSG_ZEROCOPY);
+ if (res >= 0 || errno != ENOMEM) {
+ fprintf(stderr, "Expected ENOMEM, got errno=%d res=%d\n",
+ errno, res);
+ exit(EXIT_FAILURE);
+ }
+
+ close(fd);
+}
+
+static void test_stream_msgzcopy_leak_zcskb_server(const struct test_opts *opts)
+{
+ int fd;
+
+ fd = vsock_stream_accept(VMADDR_CID_ANY, opts->peer_port, NULL);
+ if (fd < 0) {
+ perror("accept");
+ exit(EXIT_FAILURE);
+ }
+
+ vsock_wait_remote_close(fd);
+ close(fd);
+}
+
static struct test_case test_cases[] = {
{
.name = "SOCK_STREAM connection reset",
@@ -1608,6 +1838,21 @@ static struct test_case test_cases[] = {
.run_client = test_seqpacket_unsent_bytes_client,
.run_server = test_seqpacket_unsent_bytes_server,
},
+ {
+ .name = "SOCK_STREAM leak accept queue",
+ .run_client = test_stream_leak_acceptq_client,
+ .run_server = test_stream_leak_acceptq_server,
+ },
+ {
+ .name = "SOCK_STREAM MSG_ZEROCOPY leak MSG_ERRQUEUE",
+ .run_client = test_stream_msgzcopy_leak_errq_client,
+ .run_server = test_stream_msgzcopy_leak_errq_server,
+ },
+ {
+ .name = "SOCK_STREAM MSG_ZEROCOPY leak completion skb",
+ .run_client = test_stream_msgzcopy_leak_zcskb_client,
+ .run_server = test_stream_msgzcopy_leak_zcskb_server,
+ },
{},
};
@@ -1649,6 +1894,11 @@ static const struct option longopts[] = {
.val = 's',
},
{
+ .name = "pick",
+ .has_arg = required_argument,
+ .val = 't',
+ },
+ {
.name = "help",
.has_arg = no_argument,
.val = '?',
@@ -1685,6 +1935,8 @@ static void usage(void)
" --peer-cid <cid> CID of the other side\n"
" --peer-port <port> AF_VSOCK port used for the test [default: %d]\n"
" --list List of tests that will be executed\n"
+ " --pick <test_id> Test ID to execute selectively;\n"
+ " use multiple --pick options to select more tests\n"
" --skip <test_id> Test ID to skip;\n"
" use multiple --skip options to skip more tests\n",
DEFAULT_PEER_PORT
@@ -1741,6 +1993,10 @@ int main(int argc, char **argv)
skip_test(test_cases, ARRAY_SIZE(test_cases) - 1,
optarg);
break;
+ case 't':
+ pick_test(test_cases, ARRAY_SIZE(test_cases) - 1,
+ optarg);
+ break;
case '?':
default:
usage();
diff --git a/tools/testing/vsock/vsock_test_zerocopy.c b/tools/testing/vsock/vsock_test_zerocopy.c
index 04c376b6937f..9d9a6cb9614a 100644
--- a/tools/testing/vsock/vsock_test_zerocopy.c
+++ b/tools/testing/vsock/vsock_test_zerocopy.c
@@ -162,7 +162,7 @@ static void test_client(const struct test_opts *opts,
}
if (test_data->so_zerocopy)
- enable_so_zerocopy(fd);
+ enable_so_zerocopy_check(fd);
iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt);
diff --git a/tools/testing/vsock/vsock_uring_test.c b/tools/testing/vsock/vsock_uring_test.c
index 6c3e6f70c457..5c3078969659 100644
--- a/tools/testing/vsock/vsock_uring_test.c
+++ b/tools/testing/vsock/vsock_uring_test.c
@@ -73,7 +73,7 @@ static void vsock_io_uring_client(const struct test_opts *opts,
}
if (msg_zerocopy)
- enable_so_zerocopy(fd);
+ enable_so_zerocopy_check(fd);
iovec = alloc_test_iovec(test_data->vecs, test_data->vecs_cnt);
diff --git a/tools/tracing/rtla/src/timerlat_hist.c b/tools/tracing/rtla/src/timerlat_hist.c
index 8b66387e5f35..4403cc4eba30 100644
--- a/tools/tracing/rtla/src/timerlat_hist.c
+++ b/tools/tracing/rtla/src/timerlat_hist.c
@@ -282,6 +282,21 @@ static void timerlat_hist_header(struct osnoise_tool *tool)
}
/*
+ * format_summary_value - format a line of summary value (min, max or avg)
+ * of hist data
+ */
+static void format_summary_value(struct trace_seq *seq,
+ int count,
+ unsigned long long val,
+ bool avg)
+{
+ if (count)
+ trace_seq_printf(seq, "%9llu ", avg ? val / count : val);
+ else
+ trace_seq_printf(seq, "%9c ", '-');
+}
+
+/*
* timerlat_print_summary - print the summary of the hist data to the output
*/
static void
@@ -328,29 +343,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_irq);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].min_irq,
+ false);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_thread);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].min_thread,
+ false);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].min_user);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].min_user,
+ false);
}
trace_seq_printf(trace->seq, "\n");
@@ -364,29 +373,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_irq / data->hist[cpu].irq_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].sum_irq,
+ true);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_thread / data->hist[cpu].thread_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].sum_thread,
+ true);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].sum_user / data->hist[cpu].user_count);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].sum_user,
+ true);
}
trace_seq_printf(trace->seq, "\n");
@@ -400,29 +403,23 @@ timerlat_print_summary(struct timerlat_hist_params *params,
if (!data->hist[cpu].irq_count && !data->hist[cpu].thread_count)
continue;
- if (!params->no_irq) {
- if (data->hist[cpu].irq_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_irq);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_irq)
+ format_summary_value(trace->seq,
+ data->hist[cpu].irq_count,
+ data->hist[cpu].max_irq,
+ false);
- if (!params->no_thread) {
- if (data->hist[cpu].thread_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_thread);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (!params->no_thread)
+ format_summary_value(trace->seq,
+ data->hist[cpu].thread_count,
+ data->hist[cpu].max_thread,
+ false);
- if (params->user_hist) {
- if (data->hist[cpu].user_count)
- trace_seq_printf(trace->seq, "%9llu ",
- data->hist[cpu].max_user);
- else
- trace_seq_printf(trace->seq, " - ");
- }
+ if (params->user_hist)
+ format_summary_value(trace->seq,
+ data->hist[cpu].user_count,
+ data->hist[cpu].max_user,
+ false);
}
trace_seq_printf(trace->seq, "\n");
trace_seq_do_printf(trace->seq);
@@ -506,16 +503,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "min: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_irq);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.min_irq,
+ false);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_thread);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.min_thread,
+ false);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.min_user);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.min_user,
+ false);
trace_seq_printf(trace->seq, "\n");
@@ -523,16 +526,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "avg: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_irq / sum.irq_count);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.sum_irq,
+ true);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_thread / sum.thread_count);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.sum_thread,
+ true);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.sum_user / sum.user_count);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.sum_user,
+ true);
trace_seq_printf(trace->seq, "\n");
@@ -540,16 +549,22 @@ timerlat_print_stats_all(struct timerlat_hist_params *params,
trace_seq_printf(trace->seq, "max: ");
if (!params->no_irq)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_irq);
+ format_summary_value(trace->seq,
+ sum.irq_count,
+ sum.max_irq,
+ false);
if (!params->no_thread)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_thread);
+ format_summary_value(trace->seq,
+ sum.thread_count,
+ sum.max_thread,
+ false);
if (params->user_hist)
- trace_seq_printf(trace->seq, "%9llu ",
- sum.max_user);
+ format_summary_value(trace->seq,
+ sum.user_count,
+ sum.max_user,
+ false);
trace_seq_printf(trace->seq, "\n");
trace_seq_do_printf(trace->seq);